All of lore.kernel.org
 help / color / mirror / Atom feed
From: Greg Kroah-Hartman <gregkh@linuxfoundation.org>
To: linux-kernel@vger.kernel.org, akpm@linux-foundation.org,
	torvalds@linux-foundation.org, stable@vger.kernel.org
Cc: lwn@lwn.net, jslaby@suse.cz,
	Greg Kroah-Hartman <gregkh@linuxfoundation.org>
Subject: Re: Linux 6.1.103
Date: Sat,  3 Aug 2024 09:05:52 +0200	[thread overview]
Message-ID: <2024080352-appliance-oppressor-ff53@gregkh> (raw)
In-Reply-To: <2024080351-earflap-punk-7a45@gregkh>

diff --git a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
index 8d2c6d74b605..bc9ccdfd3a27 100644
--- a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
+++ b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
@@ -49,7 +49,10 @@ properties:
       to take when the temperature crosses those thresholds.
 
 patternProperties:
-  "^[a-zA-Z][a-zA-Z0-9\\-]{1,12}-thermal$":
+  # Node name is limited in size due to Linux kernel requirements - 19
+  # characters in total (see THERMAL_NAME_LENGTH, including terminating NUL
+  # byte):
+  "^[a-zA-Z][a-zA-Z0-9\\-]{1,10}-thermal$":
     type: object
     description:
       Each thermal zone node contains information about how frequently it
diff --git a/Makefile b/Makefile
index 00ec5357bc78..97149e46565a 100644
--- a/Makefile
+++ b/Makefile
@@ -1,7 +1,7 @@
 # SPDX-License-Identifier: GPL-2.0
 VERSION = 6
 PATCHLEVEL = 1
-SUBLEVEL = 102
+SUBLEVEL = 103
 EXTRAVERSION =
 NAME = Curry Ramen
 
diff --git a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
index 4d6a0c3e8455..ff062f4fd726 100644
--- a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
@@ -5,31 +5,8 @@
 
 #include "imx6q.dtsi"
 #include "imx6qdl-kontron-samx6i.dtsi"
-#include <dt-bindings/gpio/gpio.h>
 
 / {
 	model = "Kontron SMARC sAMX6i Quad/Dual";
 	compatible = "kontron,imx6q-samx6i", "fsl,imx6q";
 };
-
-/* Quad/Dual SoMs have 3 chip-select signals */
-&ecspi4 {
-	cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
-		   <&gpio3 29 GPIO_ACTIVE_LOW>,
-		   <&gpio3 25 GPIO_ACTIVE_LOW>;
-};
-
-&pinctrl_ecspi4 {
-	fsl,pins = <
-		MX6QDL_PAD_EIM_D21__ECSPI4_SCLK 0x100b1
-		MX6QDL_PAD_EIM_D28__ECSPI4_MOSI 0x100b1
-		MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
-
-		/* SPI4_IMX_CS2# - connected to internal flash */
-		MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
-		/* SPI4_IMX_CS0# - connected to SMARC SPI0_CS0# */
-		MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
-		/* SPI4_CS3# - connected to  SMARC SPI0_CS1# */
-		MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
-	>;
-};
diff --git a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
index 85aeebc9485d..668d33d1ff0c 100644
--- a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
@@ -244,7 +244,8 @@ &ecspi4 {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_ecspi4>;
 	cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
-		   <&gpio3 29 GPIO_ACTIVE_LOW>;
+		   <&gpio3 29 GPIO_ACTIVE_LOW>,
+		   <&gpio3 25 GPIO_ACTIVE_LOW>;
 	status = "okay";
 
 	/* default boot source: workaround #1 for errata ERR006282 */
@@ -259,7 +260,7 @@ smarc_flash: flash@0 {
 &fec {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_enet>;
-	phy-mode = "rgmii";
+	phy-connection-type = "rgmii-id";
 	phy-handle = <&ethphy>;
 
 	mdio {
@@ -269,7 +270,7 @@ mdio {
 		ethphy: ethernet-phy@1 {
 			compatible = "ethernet-phy-ieee802.3-c22";
 			reg = <1>;
-			reset-gpios = <&gpio1 25 GPIO_ACTIVE_LOW>;
+			reset-gpios = <&gpio2 1 GPIO_ACTIVE_LOW>;
 			reset-assert-us = <1000>;
 		};
 	};
@@ -464,6 +465,8 @@ MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
 			MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
 			/* SPI_IMX_CS0# - connected to SMARC SPI0_CS0# */
 			MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
+			/* SPI4_CS3# - connected to SMARC SPI0_CS1# */
+			MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
 		>;
 	};
 
@@ -516,7 +519,7 @@ MX6QDL_PAD_RGMII_RX_CTL__RGMII_RX_CTL 0x1b0b0
 			MX6QDL_PAD_ENET_MDIO__ENET_MDIO       0x1b0b0
 			MX6QDL_PAD_ENET_MDC__ENET_MDC         0x1b0b0
 			MX6QDL_PAD_ENET_REF_CLK__ENET_TX_CLK  0x1b0b0
-			MX6QDL_PAD_ENET_CRS_DV__GPIO1_IO25    0x1b0b0 /* RST_GBE0_PHY# */
+			MX6QDL_PAD_NANDF_D1__GPIO2_IO01       0x1b0b0 /* RST_GBE0_PHY# */
 		>;
 	};
 
@@ -729,7 +732,7 @@ &pcie {
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_pcie>;
 	wake-up-gpio = <&gpio6 18 GPIO_ACTIVE_HIGH>;
-	reset-gpio = <&gpio3 13 GPIO_ACTIVE_HIGH>;
+	reset-gpio = <&gpio3 13 GPIO_ACTIVE_LOW>;
 };
 
 /* LCD_BKLT_PWM */
@@ -817,5 +820,6 @@ &wdog1 {
 	/* CPLD is feeded by watchdog (hardwired) */
 	pinctrl-names = "default";
 	pinctrl-0 = <&pinctrl_wdog1>;
+	fsl,ext-reset-output;
 	status = "okay";
 };
diff --git a/arch/arm/mach-pxa/spitz.c b/arch/arm/mach-pxa/spitz.c
index 937f56bbaf6c..effd28294da0 100644
--- a/arch/arm/mach-pxa/spitz.c
+++ b/arch/arm/mach-pxa/spitz.c
@@ -512,10 +512,8 @@ static struct ads7846_platform_data spitz_ads7846_info = {
 static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
 	.dev_id = "spi2.1",
 	.table = {
-		GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_CONT,
-			    "BL_CONT", GPIO_ACTIVE_LOW),
-		GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_ON,
-			    "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.1", 6, "BL_CONT", GPIO_ACTIVE_LOW),
+		GPIO_LOOKUP("sharp-scoop.1", 7, "BL_ON", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
@@ -523,10 +521,8 @@ static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
 static struct gpiod_lookup_table akita_lcdcon_gpio_table = {
 	.dev_id = "spi2.1",
 	.table = {
-		GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_CONT,
-			    "BL_CONT", GPIO_ACTIVE_LOW),
-		GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_ON,
-			    "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 3, "BL_ON", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 4, "BL_CONT", GPIO_ACTIVE_LOW),
 		{ },
 	},
 };
@@ -953,12 +949,9 @@ static inline void spitz_i2c_init(void) {}
 static struct gpiod_lookup_table spitz_audio_gpio_table = {
 	.dev_id = "spitz-audio",
 	.table = {
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
-			    "mute-l", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
-			    "mute-r", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.1", SPITZ_GPIO_MIC_BIAS - SPITZ_SCP2_GPIO_BASE,
-			    "mic", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.1", 8, "mic", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
@@ -966,12 +959,9 @@ static struct gpiod_lookup_table spitz_audio_gpio_table = {
 static struct gpiod_lookup_table akita_audio_gpio_table = {
 	.dev_id = "spitz-audio",
 	.table = {
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
-			    "mute-l", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
-			    "mute-r", GPIO_ACTIVE_HIGH),
-		GPIO_LOOKUP("i2c-max7310", AKITA_GPIO_MIC_BIAS - AKITA_IOEXP_GPIO_BASE,
-			    "mic", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+		GPIO_LOOKUP("i2c-max7310", 2, "mic", GPIO_ACTIVE_HIGH),
 		{ },
 	},
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
index 7c029f552a23..256c46771db7 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
@@ -311,8 +311,8 @@ &hdmi_tx {
 		 <&reset RESET_HDMI_SYSTEM_RESET>,
 		 <&reset RESET_HDMI_TX>;
 	reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
-	clocks = <&clkc CLKID_HDMI_PCLK>,
-		 <&clkc CLKID_CLK81>,
+	clocks = <&clkc CLKID_HDMI>,
+		 <&clkc CLKID_HDMI_PCLK>,
 		 <&clkc CLKID_GCLK_VENCI_INT0>;
 	clock-names = "isfr", "iahb", "venci";
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
index 350022935052..a689bd14ece9 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
@@ -323,8 +323,8 @@ &hdmi_tx {
 		 <&reset RESET_HDMI_SYSTEM_RESET>,
 		 <&reset RESET_HDMI_TX>;
 	reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
-	clocks = <&clkc CLKID_HDMI_PCLK>,
-		 <&clkc CLKID_CLK81>,
+	clocks = <&clkc CLKID_HDMI>,
+		 <&clkc CLKID_HDMI_PCLK>,
 		 <&clkc CLKID_GCLK_VENCI_INT0>;
 	clock-names = "isfr", "iahb", "venci";
 };
diff --git a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
index 80737731af3f..8bc4ef9d8a61 100644
--- a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
@@ -337,7 +337,7 @@ tdmin_lb: audio-controller@3c0 {
 		};
 
 		spdifin: audio-controller@400 {
-			compatible = "amlogic,g12a-spdifin",
+			compatible = "amlogic,sm1-spdifin",
 				     "amlogic,axg-spdifin";
 			reg = <0x0 0x400 0x0 0x30>;
 			#sound-dai-cells = <0>;
@@ -351,7 +351,7 @@ spdifin: audio-controller@400 {
 		};
 
 		spdifout_a: audio-controller@480 {
-			compatible = "amlogic,g12a-spdifout",
+			compatible = "amlogic,sm1-spdifout",
 				     "amlogic,axg-spdifout";
 			reg = <0x0 0x480 0x0 0x50>;
 			#sound-dai-cells = <0>;
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
index b1ddc491d293..9c9431455f85 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
@@ -286,8 +286,8 @@ asm_sel {
 	/* eMMC is shared pin with parallel NAND */
 	emmc_pins_default: emmc-pins-default {
 		mux {
-			function = "emmc", "emmc_rst";
-			groups = "emmc";
+			function = "emmc";
+			groups = "emmc", "emmc_rst";
 		};
 
 		/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
index 527dcb279ba5..f4bb9c6521c6 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
@@ -244,8 +244,8 @@ &pio {
 	/* eMMC is shared pin with parallel NAND */
 	emmc_pins_default: emmc-pins-default {
 		mux {
-			function = "emmc", "emmc_rst";
-			groups = "emmc";
+			function = "emmc";
+			groups = "emmc", "emmc_rst";
 		};
 
 		/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
index 3d95625f1b0b..d7fc924a9d0e 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
@@ -168,21 +168,24 @@ anx_bridge: anx7625@58 {
 		vdd18-supply = <&pp1800_mipibrdg>;
 		vdd33-supply = <&vddio_mipibrdg>;
 
-		#address-cells = <1>;
-		#size-cells = <0>;
-		port@0 {
-			reg = <0>;
+		ports {
+			#address-cells = <1>;
+			#size-cells = <0>;
 
-			anx7625_in: endpoint {
-				remote-endpoint = <&dsi_out>;
+			port@0 {
+				reg = <0>;
+
+				anx7625_in: endpoint {
+					remote-endpoint = <&dsi_out>;
+				};
 			};
-		};
 
-		port@1 {
-			reg = <1>;
+			port@1 {
+				reg = <1>;
 
-			anx7625_out: endpoint {
-				remote-endpoint = <&panel_in>;
+				anx7625_out: endpoint {
+					remote-endpoint = <&panel_in>;
+				};
 			};
 		};
 	};
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
index 1db97d94658b..03ccdbb1c5ed 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
@@ -767,7 +767,6 @@ pins-tx {
 		};
 		pins-rts {
 			pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
-			output-enable;
 		};
 		pins-cts {
 			pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
@@ -786,7 +785,6 @@ pins-tx {
 		};
 		pins-rts {
 			pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
-			output-enable;
 		};
 		pins-cts {
 			pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
index 77819186086a..de320bebe412 100644
--- a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
@@ -368,7 +368,6 @@ &usb3_dwc3 {
 
 &hsusb_phy1 {
 	status = "okay";
-	extcon = <&typec>;
 
 	vdda-pll-supply = <&vreg_l12a_1p8>;
 	vdda-phy-dpdm-supply = <&vreg_l24a_3p075>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi
index 986a5b5c05e4..3b9a4bf89701 100644
--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi
@@ -2016,7 +2016,7 @@ ufshc: ufshc@624000 {
 				<&gcc GCC_UFS_RX_SYMBOL_0_CLK>;
 			freq-table-hz =
 				<100000000 200000000>,
-				<0 0>,
+				<100000000 200000000>,
 				<0 0>,
 				<0 0>,
 				<0 0>,
diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi
index 7a41250539ff..3d4941dc31d7 100644
--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi
@@ -1457,7 +1457,6 @@ adreno_smmu: iommu@5040000 {
 			 * SoC VDDMX RPM Power Domain in the Adreno driver.
 			 */
 			power-domains = <&gpucc GPU_GX_GDSC>;
-			status = "disabled";
 		};
 
 		gpucc: clock-controller@5065000 {
diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi
index 95c515da9f2e..71644b9b8866 100644
--- a/arch/arm64/boot/dts/qcom/sdm845.dtsi
+++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi
@@ -2537,6 +2537,8 @@ ufs_mem_phy: phy@1d87000 {
 			clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sm6350.dtsi b/arch/arm64/boot/dts/qcom/sm6350.dtsi
index 9da373090593..ba078099b805 100644
--- a/arch/arm64/boot/dts/qcom/sm6350.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm6350.dtsi
@@ -830,6 +830,8 @@ ufs_mem_phy: phy@1d87000 {
 			clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 
@@ -893,6 +895,7 @@ fastrpc {
 					compatible = "qcom,fastrpc";
 					qcom,glink-channels = "fastrpcglink-apps-dsp";
 					label = "adsp";
+					qcom,non-secure-domain;
 					#address-cells = <1>;
 					#size-cells = <0>;
 
@@ -1000,6 +1003,7 @@ fastrpc {
 					compatible = "qcom,fastrpc";
 					qcom,glink-channels = "fastrpcglink-apps-dsp";
 					label = "cdsp";
+					qcom,non-secure-domain;
 					#address-cells = <1>;
 					#size-cells = <0>;
 
diff --git a/arch/arm64/boot/dts/qcom/sm8250.dtsi b/arch/arm64/boot/dts/qcom/sm8250.dtsi
index 3d02adbc0b62..6a2852584405 100644
--- a/arch/arm64/boot/dts/qcom/sm8250.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8250.dtsi
@@ -2125,7 +2125,7 @@ ufs_mem_hc: ufshc@1d84000 {
 				     "jedec,ufs-2.0";
 			reg = <0 0x01d84000 0 0x3000>;
 			interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>;
-			phys = <&ufs_mem_phy_lanes>;
+			phys = <&ufs_mem_phy>;
 			phy-names = "ufsphy";
 			lanes-per-direction = <2>;
 			#reset-cells = <1>;
@@ -2169,10 +2169,8 @@ ufs_mem_hc: ufshc@1d84000 {
 
 		ufs_mem_phy: phy@1d87000 {
 			compatible = "qcom,sm8250-qmp-ufs-phy";
-			reg = <0 0x01d87000 0 0x1c0>;
-			#address-cells = <2>;
-			#size-cells = <2>;
-			ranges;
+			reg = <0 0x01d87000 0 0x1000>;
+
 			clock-names = "ref",
 				      "ref_aux";
 			clocks = <&rpmhcc RPMH_CXO_CLK>,
@@ -2180,16 +2178,12 @@ ufs_mem_phy: phy@1d87000 {
 
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
-			status = "disabled";
 
-			ufs_mem_phy_lanes: phy@1d87400 {
-				reg = <0 0x01d87400 0 0x16c>,
-				      <0 0x01d87600 0 0x200>,
-				      <0 0x01d87c00 0 0x200>,
-				      <0 0x01d87800 0 0x16c>,
-				      <0 0x01d87a00 0 0x200>;
-				#phy-cells = <0>;
-			};
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
+			#phy-cells = <0>;
+
+			status = "disabled";
 		};
 
 		ipa_virt: interconnect@1e00000 {
diff --git a/arch/arm64/boot/dts/qcom/sm8450.dtsi b/arch/arm64/boot/dts/qcom/sm8450.dtsi
index 128542582b3d..aa0977af9411 100644
--- a/arch/arm64/boot/dts/qcom/sm8450.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8450.dtsi
@@ -3153,6 +3153,8 @@ ufs_mem_phy: phy@1d87000 {
 				 <&gcc GCC_UFS_PHY_PHY_AUX_CLK>,
 				 <&gcc GCC_UFS_0_CLKREF_EN>;
 
+			power-domains = <&gcc UFS_PHY_GDSC>;
+
 			resets = <&ufs_mem_hc 0>;
 			reset-names = "ufsphy";
 			status = "disabled";
diff --git a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
index b677ef6705d9..158c99b1a7b7 100644
--- a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
@@ -2209,8 +2209,7 @@ gic: interrupt-controller@f1000000 {
 			interrupt-controller;
 			reg = <0x0 0xf1000000 0 0x20000>,
 			      <0x0 0xf1060000 0 0x110000>;
-			interrupts = <GIC_PPI 9
-				      (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_HIGH)>;
+			interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
 		};
 
 		fcpvd0: fcp@fea10000 {
@@ -2857,9 +2856,12 @@ sensor5_crit: sensor5-crit {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
index 4092c0016035..140c4672ff5b 100644
--- a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
@@ -935,8 +935,7 @@ gic: interrupt-controller@f1000000 {
 			interrupt-controller;
 			reg = <0x0 0xf1000000 0 0x20000>,
 			      <0x0 0xf1060000 0 0x110000>;
-			interrupts = <GIC_PPI 9
-				      (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_HIGH)>;
+			interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
 		};
 
 		prr: chipid@fff00044 {
@@ -991,10 +990,13 @@ sensor3_crit: sensor3-crit {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 
 	ufs30_clk: ufs30-clk {
diff --git a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
index 868d1a3cbdf6..3de3ea0073c3 100644
--- a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
@@ -18,12 +18,80 @@ cpus {
 		#address-cells = <1>;
 		#size-cells = <0>;
 
+		cpu-map {
+			cluster0 {
+				core0 {
+					cpu = <&a76_0>;
+				};
+				core1 {
+					cpu = <&a76_1>;
+				};
+			};
+
+			cluster1 {
+				core0 {
+					cpu = <&a76_2>;
+				};
+				core1 {
+					cpu = <&a76_3>;
+				};
+			};
+		};
+
 		a76_0: cpu@0 {
 			compatible = "arm,cortex-a76";
 			reg = <0>;
 			device_type = "cpu";
 			power-domains = <&sysc R8A779G0_PD_A1E0D0C0>;
+			next-level-cache = <&L3_CA76_0>;
+			enable-method = "psci";
+		};
+
+		a76_1: cpu@100 {
+			compatible = "arm,cortex-a76";
+			reg = <0x100>;
+			device_type = "cpu";
+			power-domains = <&sysc R8A779G0_PD_A1E0D0C1>;
+			next-level-cache = <&L3_CA76_0>;
+			enable-method = "psci";
+		};
+
+		a76_2: cpu@10000 {
+			compatible = "arm,cortex-a76";
+			reg = <0x10000>;
+			device_type = "cpu";
+			power-domains = <&sysc R8A779G0_PD_A1E0D1C0>;
+			next-level-cache = <&L3_CA76_1>;
+			enable-method = "psci";
 		};
+
+		a76_3: cpu@10100 {
+			compatible = "arm,cortex-a76";
+			reg = <0x10100>;
+			device_type = "cpu";
+			power-domains = <&sysc R8A779G0_PD_A1E0D1C1>;
+			next-level-cache = <&L3_CA76_1>;
+			enable-method = "psci";
+		};
+
+		L3_CA76_0: cache-controller-0 {
+			compatible = "cache";
+			power-domains = <&sysc R8A779G0_PD_A2E0D0>;
+			cache-unified;
+			cache-level = <3>;
+		};
+
+		L3_CA76_1: cache-controller-1 {
+			compatible = "cache";
+			power-domains = <&sysc R8A779G0_PD_A2E0D1>;
+			cache-unified;
+			cache-level = <3>;
+		};
+	};
+
+	psci {
+		compatible = "arm,psci-1.0", "arm,psci-0.2";
+		method = "smc";
 	};
 
 	extal_clk: extal {
@@ -482,8 +550,7 @@ gic: interrupt-controller@f1000000 {
 			interrupt-controller;
 			reg = <0x0 0xf1000000 0 0x20000>,
 			      <0x0 0xf1060000 0 0x110000>;
-			interrupts = <GIC_PPI 9
-				      (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_HIGH)>;
+			interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
 		};
 
 		prr: chipid@fff00044 {
@@ -494,9 +561,12 @@ prr: chipid@fff00044 {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
index 011d4c88f4ed..2e7db48462e1 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
@@ -41,10 +41,13 @@ psci {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
 
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
index d26488b5a82d..4703fbc9a8e0 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
@@ -1091,9 +1091,12 @@ target: trip-point {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
index 1d57df706939..56a979e82c4f 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
@@ -15,13 +15,6 @@ cpus {
 		/delete-node/ cpu-map;
 		/delete-node/ cpu@100;
 	};
-
-	timer {
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
-	};
 };
 
 &soc {
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
index 9d89d4590358..9cf27ca9f1d2 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
@@ -15,11 +15,4 @@ cpus {
 		/delete-node/ cpu-map;
 		/delete-node/ cpu@100;
 	};
-
-	timer {
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
-	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
index b3d37ca942ee..60a20a3ca12e 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
@@ -1097,9 +1097,12 @@ target: trip-point {
 
 	timer {
 		compatible = "arm,armv8-timer";
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>;
+		interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+				      <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+		interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+				  "hyp-virt";
 	};
 };
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
index c448cc6634c1..d85a6ac0f024 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
@@ -15,11 +15,4 @@ cpus {
 		/delete-node/ cpu-map;
 		/delete-node/ cpu@100;
 	};
-
-	timer {
-		interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
-				      <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
-	};
 };
diff --git a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
index edc8d2e3980d..bc9e98fe0f01 100644
--- a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
@@ -17,6 +17,7 @@ aliases {
 		ethernet0 = &gmac;
 		mmc0 = &emmc;
 		mmc1 = &sdmmc;
+		mmc2 = &sdio;
 	};
 
 	chosen {
@@ -145,11 +146,25 @@ &emmc {
 
 &gmac {
 	clock_in_out = "output";
+	phy-handle = <&rtl8201f>;
 	phy-supply = <&vcc_io>;
-	snps,reset-gpio = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
-	snps,reset-active-low;
-	snps,reset-delays-us = <0 50000 50000>;
 	status = "okay";
+
+	mdio {
+		compatible = "snps,dwmac-mdio";
+		#address-cells = <1>;
+		#size-cells = <0>;
+
+		rtl8201f: ethernet-phy@1 {
+			compatible = "ethernet-phy-ieee802.3-c22";
+			reg = <1>;
+			pinctrl-names = "default";
+			pinctrl-0 = <&mac_rst>;
+			reset-assert-us = <20000>;
+			reset-deassert-us = <50000>;
+			reset-gpios = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
+		};
+	};
 };
 
 &i2c1 {
@@ -160,6 +175,26 @@ &pinctrl {
 	pinctrl-names = "default";
 	pinctrl-0 = <&rtc_32k>;
 
+	bluetooth {
+		bt_reg_on: bt-reg-on {
+			rockchip,pins = <4 RK_PB3 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+
+		bt_wake_host: bt-wake-host {
+			rockchip,pins = <4 RK_PB4 RK_FUNC_GPIO &pcfg_pull_down>;
+		};
+
+		host_wake_bt: host-wake-bt {
+			rockchip,pins = <4 RK_PB2 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+	};
+
+	gmac {
+		mac_rst: mac-rst {
+			rockchip,pins = <0 RK_PA7 RK_FUNC_GPIO &pcfg_pull_none>;
+		};
+	};
+
 	leds {
 		green_led: green-led {
 			rockchip,pins = <0 RK_PA6 RK_FUNC_GPIO &pcfg_pull_none>;
@@ -203,15 +238,31 @@ &sdio {
 	cap-sd-highspeed;
 	cap-sdio-irq;
 	keep-power-in-suspend;
-	max-frequency = <1000000>;
+	max-frequency = <100000000>;
 	mmc-pwrseq = <&sdio_pwrseq>;
+	no-mmc;
+	no-sd;
 	non-removable;
-	sd-uhs-sdr104;
+	sd-uhs-sdr50;
+	vmmc-supply = <&vcc_io>;
+	vqmmc-supply = <&vcc_1v8>;
 	status = "okay";
+
+	rtl8723ds: wifi@1 {
+		reg = <1>;
+		interrupt-parent = <&gpio0>;
+		interrupts = <RK_PA0 IRQ_TYPE_LEVEL_HIGH>;
+		interrupt-names = "host-wake";
+		pinctrl-names = "default";
+		pinctrl-0 = <&wifi_host_wake>;
+	};
 };
 
 &sdmmc {
+	cap-mmc-highspeed;
 	cap-sd-highspeed;
+	disable-wp;
+	vmmc-supply = <&vcc_io>;
 	status = "okay";
 };
 
@@ -230,16 +281,22 @@ u2phy_otg: otg-port {
 };
 
 &uart0 {
+	pinctrl-names = "default";
+	pinctrl-0 = <&uart0_xfer>;
 	status = "okay";
 };
 
 &uart4 {
+	uart-has-rtscts;
 	status = "okay";
 
 	bluetooth {
-		compatible = "realtek,rtl8723bs-bt";
-		device-wake-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
+		compatible = "realtek,rtl8723ds-bt";
+		device-wake-gpios = <&gpio4 RK_PB2 GPIO_ACTIVE_HIGH>;
+		enable-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
 		host-wake-gpios = <&gpio4 RK_PB4 GPIO_ACTIVE_HIGH>;
+		pinctrl-names = "default";
+		pinctrl-0 = <&bt_reg_on &bt_wake_host &host_wake_bt>;
 	};
 };
 
diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
index d42846efff2f..5adb2fbc2aaf 100644
--- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
@@ -820,8 +820,8 @@ cru: clock-controller@ff440000 {
 			<0>, <24000000>,
 			<24000000>, <24000000>,
 			<15000000>, <15000000>,
-			<100000000>, <100000000>,
-			<100000000>, <100000000>,
+			<300000000>, <100000000>,
+			<400000000>, <100000000>,
 			<50000000>, <100000000>,
 			<100000000>, <100000000>,
 			<50000000>, <50000000>,
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
index 674792567fa6..4fc8354e069a 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
@@ -478,7 +478,7 @@ regulator-state-mem {
 		};
 
 		codec {
-			mic-in-differential;
+			rockchip,mic-in-differential;
 		};
 	};
 };
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
index bab46db2b18c..478620c78259 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
@@ -481,10 +481,6 @@ regulator-state-mem {
 				};
 			};
 		};
-
-		codec {
-			mic-in-differential;
-		};
 	};
 };
 
diff --git a/arch/arm64/boot/dts/rockchip/rk356x.dtsi b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
index 99ad6fc51b58..e5c88f000725 100644
--- a/arch/arm64/boot/dts/rockchip/rk356x.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
@@ -737,6 +737,7 @@ vop_mmu: iommu@fe043e00 {
 		clocks = <&cru ACLK_VOP>, <&cru HCLK_VOP>;
 		clock-names = "aclk", "iface";
 		#iommu-cells = <0>;
+		power-domains = <&power RK3568_PD_VO>;
 		status = "disabled";
 	};
 
diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c
index 3137b45750df..b7cb28f5ee29 100644
--- a/arch/m68k/amiga/config.c
+++ b/arch/m68k/amiga/config.c
@@ -180,6 +180,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record)
 			dev->slotsize = be16_to_cpu(cd->cd_SlotSize);
 			dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr);
 			dev->boardsize = be32_to_cpu(cd->cd_BoardSize);
+
+			/* CS-LAB Warp 1260 workaround */
+			if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) &&
+			    dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) {
+
+				/* turn off all interrupts */
+				pr_info("Warp 1260 card detected: applying interrupt storm workaround\n");
+				*(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff;
+			}
 		} else
 			pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n");
 #endif /* CONFIG_ZORRO */
diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c
index 56f02ea2c248..715d1e0d973e 100644
--- a/arch/m68k/atari/ataints.c
+++ b/arch/m68k/atari/ataints.c
@@ -302,11 +302,7 @@ void __init atari_init_IRQ(void)
 
 	if (ATARIHW_PRESENT(SCU)) {
 		/* init the SCU if present */
-		tt_scu.sys_mask = 0x10;		/* enable VBL (for the cursor) and
-									 * disable HSYNC interrupts (who
-									 * needs them?)  MFP and SCC are
-									 * enabled in VME mask
-									 */
+		tt_scu.sys_mask = 0x0;		/* disable all interrupts */
 		tt_scu.vme_mask = 0x60;		/* enable MFP and SCC ints */
 	} else {
 		/* If no SCU and no Hades, the HSYNC interrupt needs to be
diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h
index 6cf464cdab06..694a44a5c3b0 100644
--- a/arch/m68k/include/asm/cmpxchg.h
+++ b/arch/m68k/include/asm/cmpxchg.h
@@ -32,7 +32,7 @@ static inline unsigned long __xchg(unsigned long x, volatile void * ptr, int siz
 		x = tmp;
 		break;
 	default:
-		tmp = __invalid_xchg_size(x, ptr, size);
+		x = __invalid_xchg_size(x, ptr, size);
 		break;
 	}
 
diff --git a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
index c16b521308cb..9089d1e4f3fe 100644
--- a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
+++ b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
@@ -23,14 +23,6 @@ cpu0: cpu@0 {
 		};
 	};
 
-	memory@200000 {
-		compatible = "memory";
-		device_type = "memory";
-		reg = <0x00000000 0x00200000 0x00000000 0x0ee00000>, /* 238 MB at 2 MB */
-			<0x00000000 0x20000000 0x00000000 0x1f000000>, /* 496 MB at 512 MB */
-			<0x00000001 0x10000000 0x00000001 0xb0000000>; /* 6912 MB at 4352MB */
-	};
-
 	cpu_clk: cpu_clk {
 		#clock-cells = <0>;
 		compatible = "fixed-clock";
@@ -52,6 +44,13 @@ package0: bus@10000000 {
 			0 0x40000000 0 0x40000000 0 0x40000000
 			0xfe 0x00000000 0xfe 0x00000000 0 0x40000000>;
 
+		isa@18000000 {
+			compatible = "isa";
+			#size-cells = <1>;
+			#address-cells = <2>;
+			ranges = <1 0x0 0x0 0x18000000 0x4000>;
+		};
+
 		pm: reset-controller@1fe07000 {
 			compatible = "loongson,ls2k-pm";
 			reg = <0 0x1fe07000 0 0x422>;
@@ -130,7 +129,8 @@ gmac@3,0 {
 					     <13 IRQ_TYPE_LEVEL_LOW>;
 				interrupt-names = "macirq", "eth_lpi";
 				interrupt-parent = <&liointc0>;
-				phy-mode = "rgmii";
+				phy-mode = "rgmii-id";
+				phy-handle = <&phy1>;
 				mdio {
 					#address-cells = <1>;
 					#size-cells = <0>;
@@ -153,7 +153,8 @@ gmac@3,1 {
 					     <15 IRQ_TYPE_LEVEL_LOW>;
 				interrupt-names = "macirq", "eth_lpi";
 				interrupt-parent = <&liointc0>;
-				phy-mode = "rgmii";
+				phy-mode = "rgmii-id";
+				phy-handle = <&phy1>;
 				mdio {
 					#address-cells = <1>;
 					#size-cells = <0>;
diff --git a/arch/mips/include/asm/mach-loongson64/boot_param.h b/arch/mips/include/asm/mach-loongson64/boot_param.h
index e007edd6b60a..9218b3ae3383 100644
--- a/arch/mips/include/asm/mach-loongson64/boot_param.h
+++ b/arch/mips/include/asm/mach-loongson64/boot_param.h
@@ -42,12 +42,14 @@ enum loongson_cpu_type {
 	Legacy_1B = 0x5,
 	Legacy_2G = 0x6,
 	Legacy_2H = 0x7,
+	Legacy_2K = 0x8,
 	Loongson_1A = 0x100,
 	Loongson_1B = 0x101,
 	Loongson_2E = 0x200,
 	Loongson_2F = 0x201,
 	Loongson_2G = 0x202,
 	Loongson_2H = 0x203,
+	Loongson_2K = 0x204,
 	Loongson_3A = 0x300,
 	Loongson_3B = 0x301
 };
diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h
index 23c67c0871b1..696b40beb774 100644
--- a/arch/mips/include/asm/mips-cm.h
+++ b/arch/mips/include/asm/mips-cm.h
@@ -228,6 +228,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status)
 GCR_ACCESSOR_RO(32, 0x0f0, cpc_status)
 #define CM_GCR_CPC_STATUS_EX			BIT(0)
 
+/* GCR_ACCESS - Controls core/IOCU access to GCRs */
+GCR_ACCESSOR_RW(32, 0x120, access_cm3)
+#define CM_GCR_ACCESS_ACCESSEN			GENMASK(7, 0)
+
 /* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */
 GCR_ACCESSOR_RW(32, 0x130, l2_config)
 #define CM_GCR_L2_CONFIG_BYPASS			BIT(20)
diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c
index bcd6a944b839..739997e6fd65 100644
--- a/arch/mips/kernel/smp-cps.c
+++ b/arch/mips/kernel/smp-cps.c
@@ -230,7 +230,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id)
 	write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB);
 
 	/* Ensure the core can access the GCRs */
-	set_gcr_access(1 << core);
+	if (mips_cm_revision() < CM_REV_CM3)
+		set_gcr_access(1 << core);
+	else
+		set_gcr_access_cm3(1 << core);
 
 	if (mips_cpc_present()) {
 		/* Reset the core */
diff --git a/arch/mips/loongson64/env.c b/arch/mips/loongson64/env.c
index ef3750a6ffac..09ff05269861 100644
--- a/arch/mips/loongson64/env.c
+++ b/arch/mips/loongson64/env.c
@@ -88,6 +88,12 @@ void __init prom_lefi_init_env(void)
 	cpu_clock_freq = ecpu->cpu_clock_freq;
 	loongson_sysconf.cputype = ecpu->cputype;
 	switch (ecpu->cputype) {
+	case Legacy_2K:
+	case Loongson_2K:
+		smp_group[0] = 0x900000001fe11000;
+		loongson_sysconf.cores_per_node = 2;
+		loongson_sysconf.cores_per_package = 2;
+		break;
 	case Legacy_3A:
 	case Loongson_3A:
 		loongson_sysconf.cores_per_node = 4;
@@ -221,6 +227,8 @@ void __init prom_lefi_init_env(void)
 		default:
 			break;
 		}
+	} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64R) {
+		loongson_fdt_blob = __dtb_loongson64_2core_2k1000_begin;
 	} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64G) {
 		if (loongson_sysconf.bridgetype == LS7A)
 			loongson_fdt_blob = __dtb_loongson64g_4core_ls7a_begin;
diff --git a/arch/mips/loongson64/reset.c b/arch/mips/loongson64/reset.c
index e420800043b0..2a8e4cd72605 100644
--- a/arch/mips/loongson64/reset.c
+++ b/arch/mips/loongson64/reset.c
@@ -11,6 +11,7 @@
 #include <linux/init.h>
 #include <linux/kexec.h>
 #include <linux/pm.h>
+#include <linux/reboot.h>
 #include <linux/slab.h>
 
 #include <asm/bootinfo.h>
@@ -21,36 +22,21 @@
 #include <loongson.h>
 #include <boot_param.h>
 
-static void loongson_restart(char *command)
+static int firmware_restart(struct sys_off_data *unusedd)
 {
 
 	void (*fw_restart)(void) = (void *)loongson_sysconf.restart_addr;
 
 	fw_restart();
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
+	return NOTIFY_DONE;
 }
 
-static void loongson_poweroff(void)
+static int firmware_poweroff(struct sys_off_data *unused)
 {
 	void (*fw_poweroff)(void) = (void *)loongson_sysconf.poweroff_addr;
 
 	fw_poweroff();
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
-}
-
-static void loongson_halt(void)
-{
-	pr_notice("\n\n** You can safely turn off the power now **\n\n");
-	while (1) {
-		if (cpu_wait)
-			cpu_wait();
-	}
+	return NOTIFY_DONE;
 }
 
 #ifdef CONFIG_KEXEC
@@ -154,9 +140,17 @@ static void loongson_crash_shutdown(struct pt_regs *regs)
 
 static int __init mips_reboot_setup(void)
 {
-	_machine_restart = loongson_restart;
-	_machine_halt = loongson_halt;
-	pm_power_off = loongson_poweroff;
+	if (loongson_sysconf.restart_addr) {
+		register_sys_off_handler(SYS_OFF_MODE_RESTART,
+				 SYS_OFF_PRIO_FIRMWARE,
+				 firmware_restart, NULL);
+	}
+
+	if (loongson_sysconf.poweroff_addr) {
+		register_sys_off_handler(SYS_OFF_MODE_POWER_OFF,
+				 SYS_OFF_PRIO_FIRMWARE,
+				 firmware_poweroff, NULL);
+	}
 
 #ifdef CONFIG_KEXEC
 	kexec_argv = kmalloc(KEXEC_ARGV_SIZE, GFP_KERNEL);
diff --git a/arch/mips/loongson64/smp.c b/arch/mips/loongson64/smp.c
index 660e1de4412a..52dc95995783 100644
--- a/arch/mips/loongson64/smp.c
+++ b/arch/mips/loongson64/smp.c
@@ -479,12 +479,25 @@ static void loongson3_smp_finish(void)
 static void __init loongson3_smp_setup(void)
 {
 	int i = 0, num = 0; /* i: physical id, num: logical id */
+	int max_cpus = 0;
 
 	init_cpu_possible(cpu_none_mask);
 
+	for (i = 0; i < ARRAY_SIZE(smp_group); i++) {
+		if (!smp_group[i])
+			break;
+		max_cpus += loongson_sysconf.cores_per_node;
+	}
+
+	if (max_cpus < loongson_sysconf.nr_cpus) {
+		pr_err("SMP Groups are less than the number of CPUs\n");
+		loongson_sysconf.nr_cpus = max_cpus ? max_cpus : 1;
+	}
+
 	/* For unified kernel, NR_CPUS is the maximum possible value,
 	 * loongson_sysconf.nr_cpus is the really present value
 	 */
+	i = 0;
 	while (i < loongson_sysconf.nr_cpus) {
 		if (loongson_sysconf.reserved_cpus_mask & (1<<i)) {
 			/* Reserved physical CPU cores */
@@ -505,14 +518,14 @@ static void __init loongson3_smp_setup(void)
 		__cpu_logical_map[num] = -1;
 		num++;
 	}
-
 	csr_ipi_probe();
 	ipi_set0_regs_init();
 	ipi_clear0_regs_init();
 	ipi_status0_regs_init();
 	ipi_en0_regs_init();
 	ipi_mailbox_buf_init();
-	ipi_write_enable(0);
+	if (smp_group[0])
+		ipi_write_enable(0);
 
 	cpu_set_core(&cpu_data[0],
 		     cpu_logical_map(0) % loongson_sysconf.cores_per_package);
@@ -829,6 +842,9 @@ static int loongson3_disable_clock(unsigned int cpu)
 	uint64_t core_id = cpu_core(&cpu_data[cpu]);
 	uint64_t package_id = cpu_data[cpu].package;
 
+	if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+		return 0;
+
 	if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
 		LOONGSON_CHIPCFG(package_id) &= ~(1 << (12 + core_id));
 	} else {
@@ -843,6 +859,9 @@ static int loongson3_enable_clock(unsigned int cpu)
 	uint64_t core_id = cpu_core(&cpu_data[cpu]);
 	uint64_t package_id = cpu_data[cpu].package;
 
+	if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+		return 0;
+
 	if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
 		LOONGSON_CHIPCFG(package_id) |= 1 << (12 + core_id);
 	} else {
diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c
old mode 100755
new mode 100644
diff --git a/arch/mips/sgi-ip30/ip30-console.c b/arch/mips/sgi-ip30/ip30-console.c
index b91f8c4fdc78..a087b7ebe129 100644
--- a/arch/mips/sgi-ip30/ip30-console.c
+++ b/arch/mips/sgi-ip30/ip30-console.c
@@ -1,6 +1,7 @@
 // SPDX-License-Identifier: GPL-2.0
 
 #include <linux/io.h>
+#include <linux/processor.h>
 
 #include <asm/sn/ioc3.h>
 
diff --git a/arch/parisc/Kconfig b/arch/parisc/Kconfig
index 5762633ea95e..3341d4a42199 100644
--- a/arch/parisc/Kconfig
+++ b/arch/parisc/Kconfig
@@ -75,6 +75,7 @@ config PARISC
 	select HAVE_SOFTIRQ_ON_OWN_STACK if IRQSTACKS
 	select TRACE_IRQFLAGS_SUPPORT
 	select HAVE_FUNCTION_DESCRIPTORS if 64BIT
+	select PCI_MSI_ARCH_FALLBACKS if PCI_MSI
 
 	help
 	  The PA-RISC microprocessor is designed by Hewlett-Packard and used
diff --git a/arch/powerpc/configs/85xx-hw.config b/arch/powerpc/configs/85xx-hw.config
index 524db76f47b7..8aff83217397 100644
--- a/arch/powerpc/configs/85xx-hw.config
+++ b/arch/powerpc/configs/85xx-hw.config
@@ -24,6 +24,7 @@ CONFIG_FS_ENET=y
 CONFIG_FSL_CORENET_CF=y
 CONFIG_FSL_DMA=y
 CONFIG_FSL_HV_MANAGER=y
+CONFIG_FSL_IFC=y
 CONFIG_FSL_PQ_MDIO=y
 CONFIG_FSL_RIO=y
 CONFIG_FSL_XGMAC_MDIO=y
@@ -58,6 +59,7 @@ CONFIG_INPUT_FF_MEMLESS=m
 CONFIG_MARVELL_PHY=y
 CONFIG_MDIO_BUS_MUX_GPIO=y
 CONFIG_MDIO_BUS_MUX_MMIOREG=y
+CONFIG_MEMORY=y
 CONFIG_MMC_SDHCI_OF_ESDHC=y
 CONFIG_MMC_SDHCI_PLTFM=y
 CONFIG_MMC_SDHCI=y
diff --git a/arch/powerpc/include/asm/kexec.h b/arch/powerpc/include/asm/kexec.h
index a1ddba01e7d1..f2db1b443920 100644
--- a/arch/powerpc/include/asm/kexec.h
+++ b/arch/powerpc/include/asm/kexec.h
@@ -181,6 +181,10 @@ static inline void crash_send_ipi(void (*crash_ipi_callback)(struct pt_regs *))
 
 #endif /* CONFIG_KEXEC_CORE */
 
+#if defined(CONFIG_KEXEC_FILE) || defined(CONFIG_CRASH_DUMP)
+int update_cpus_node(void *fdt);
+#endif
+
 #ifdef CONFIG_PPC_BOOK3S_64
 #include <asm/book3s/64/kexec.h>
 #endif
diff --git a/arch/powerpc/include/asm/plpks.h b/arch/powerpc/include/asm/plpks.h
new file mode 100644
index 000000000000..9e2219b0202d
--- /dev/null
+++ b/arch/powerpc/include/asm/plpks.h
@@ -0,0 +1,163 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+/*
+ * Copyright (C) 2022 IBM Corporation
+ * Author: Nayna Jain <nayna@linux.ibm.com>
+ *
+ * Platform keystore for pseries LPAR(PLPKS).
+ */
+
+#ifndef _ASM_POWERPC_PLPKS_H
+#define _ASM_POWERPC_PLPKS_H
+
+#ifdef CONFIG_PSERIES_PLPKS
+
+#include <linux/types.h>
+#include <linux/list.h>
+
+// Object policy flags from supported_policies
+#define PLPKS_OSSECBOOTAUDIT	PPC_BIT32(1) // OS secure boot must be audit/enforce
+#define PLPKS_OSSECBOOTENFORCE	PPC_BIT32(2) // OS secure boot must be enforce
+#define PLPKS_PWSET		PPC_BIT32(3) // No access without password set
+#define PLPKS_WORLDREADABLE	PPC_BIT32(4) // Readable without authentication
+#define PLPKS_IMMUTABLE		PPC_BIT32(5) // Once written, object cannot be removed
+#define PLPKS_TRANSIENT		PPC_BIT32(6) // Object does not persist through reboot
+#define PLPKS_SIGNEDUPDATE	PPC_BIT32(7) // Object can only be modified by signed updates
+#define PLPKS_HVPROVISIONED	PPC_BIT32(28) // Hypervisor has provisioned this object
+
+// Signature algorithm flags from signed_update_algorithms
+#define PLPKS_ALG_RSA2048	PPC_BIT(0)
+#define PLPKS_ALG_RSA4096	PPC_BIT(1)
+
+// Object label OS metadata flags
+#define PLPKS_VAR_LINUX		0x02
+#define PLPKS_VAR_COMMON	0x04
+
+// Flags for which consumer owns an object is owned by
+#define PLPKS_FW_OWNER			0x1
+#define PLPKS_BOOTLOADER_OWNER		0x2
+#define PLPKS_OS_OWNER			0x3
+
+// Flags for label metadata fields
+#define PLPKS_LABEL_VERSION		0
+#define PLPKS_MAX_LABEL_ATTR_SIZE	16
+#define PLPKS_MAX_NAME_SIZE		239
+#define PLPKS_MAX_DATA_SIZE		4000
+
+// Timeouts for PLPKS operations
+#define PLPKS_MAX_TIMEOUT		(5 * USEC_PER_SEC)
+#define PLPKS_FLUSH_SLEEP		10000 // usec
+
+struct plpks_var {
+	char *component;
+	u8 *name;
+	u8 *data;
+	u32 policy;
+	u16 namelen;
+	u16 datalen;
+	u8 os;
+};
+
+struct plpks_var_name {
+	u8  *name;
+	u16 namelen;
+};
+
+struct plpks_var_name_list {
+	u32 varcount;
+	struct plpks_var_name varlist[];
+};
+
+/**
+ * Writes the specified var and its data to PKS.
+ * Any caller of PKS driver should present a valid component type for
+ * their variable.
+ */
+int plpks_write_var(struct plpks_var var);
+
+/**
+ * Removes the specified var and its data from PKS.
+ */
+int plpks_remove_var(char *component, u8 varos,
+		     struct plpks_var_name vname);
+
+/**
+ * Returns the data for the specified os variable.
+ */
+int plpks_read_os_var(struct plpks_var *var);
+
+/**
+ * Returns the data for the specified firmware variable.
+ */
+int plpks_read_fw_var(struct plpks_var *var);
+
+/**
+ * Returns the data for the specified bootloader variable.
+ */
+int plpks_read_bootloader_var(struct plpks_var *var);
+
+/**
+ * Returns if PKS is available on this LPAR.
+ */
+bool plpks_is_available(void);
+
+/**
+ * Returns version of the Platform KeyStore.
+ */
+u8 plpks_get_version(void);
+
+/**
+ * Returns hypervisor storage overhead per object, not including the size of
+ * the object or label. Only valid for config version >= 2
+ */
+u16 plpks_get_objoverhead(void);
+
+/**
+ * Returns maximum password size. Must be >= 32 bytes
+ */
+u16 plpks_get_maxpwsize(void);
+
+/**
+ * Returns maximum object size supported by Platform KeyStore.
+ */
+u16 plpks_get_maxobjectsize(void);
+
+/**
+ * Returns maximum object label size supported by Platform KeyStore.
+ */
+u16 plpks_get_maxobjectlabelsize(void);
+
+/**
+ * Returns total size of the configured Platform KeyStore.
+ */
+u32 plpks_get_totalsize(void);
+
+/**
+ * Returns used space from the total size of the Platform KeyStore.
+ */
+u32 plpks_get_usedspace(void);
+
+/**
+ * Returns bitmask of policies supported by the hypervisor.
+ */
+u32 plpks_get_supportedpolicies(void);
+
+/**
+ * Returns maximum byte size of a single object supported by the hypervisor.
+ * Only valid for config version >= 3
+ */
+u32 plpks_get_maxlargeobjectsize(void);
+
+/**
+ * Returns bitmask of signature algorithms supported for signed updates.
+ * Only valid for config version >= 3
+ */
+u64 plpks_get_signedupdatealgorithms(void);
+
+/**
+ * Returns the length of the PLPKS password in bytes.
+ */
+u16 plpks_get_passwordlen(void);
+
+#endif // CONFIG_PSERIES_PLPKS
+
+#endif // _ASM_POWERPC_PLPKS_H
diff --git a/arch/powerpc/kernel/prom.c b/arch/powerpc/kernel/prom.c
index 9531ab90feb8..e5b90d67cd53 100644
--- a/arch/powerpc/kernel/prom.c
+++ b/arch/powerpc/kernel/prom.c
@@ -324,6 +324,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 					  void *data)
 {
 	const char *type = of_get_flat_dt_prop(node, "device_type", NULL);
+	const __be32 *cpu_version = NULL;
 	const __be32 *prop;
 	const __be32 *intserv;
 	int i, nthreads;
@@ -404,7 +405,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 		prop = of_get_flat_dt_prop(node, "cpu-version", NULL);
 		if (prop && (be32_to_cpup(prop) & 0xff000000) == 0x0f000000) {
 			identify_cpu(0, be32_to_cpup(prop));
-			seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(prop));
+			cpu_version = prop;
 		}
 
 		check_cpu_feature_properties(node);
@@ -415,6 +416,12 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
 	}
 
 	identical_pvr_fixup(node);
+
+	// We can now add the CPU name & PVR to the hardware description
+	seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
+	if (cpu_version)
+		seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(cpu_version));
+
 	init_mmu_slb_size(node);
 
 #ifdef CONFIG_PPC64
@@ -852,9 +859,6 @@ void __init early_init_devtree(void *params)
 
 	dt_cpu_ftrs_scan();
 
-	// We can now add the CPU name & PVR to the hardware description
-	seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
-
 	/* Retrieve CPU related informations from the flat tree
 	 * (altivec support, boot CPU ID, ...)
 	 */
diff --git a/arch/powerpc/kexec/core_64.c b/arch/powerpc/kexec/core_64.c
index e465e4487737..653b3c8c6a53 100644
--- a/arch/powerpc/kexec/core_64.c
+++ b/arch/powerpc/kexec/core_64.c
@@ -17,6 +17,7 @@
 #include <linux/cpu.h>
 #include <linux/hardirq.h>
 #include <linux/of.h>
+#include <linux/libfdt.h>
 
 #include <asm/page.h>
 #include <asm/current.h>
@@ -31,6 +32,7 @@
 #include <asm/hw_breakpoint.h>
 #include <asm/svm.h>
 #include <asm/ultravisor.h>
+#include <asm/crashdump-ppc64.h>
 
 int machine_kexec_prepare(struct kimage *image)
 {
@@ -431,3 +433,113 @@ static int __init export_htab_values(void)
 }
 late_initcall(export_htab_values);
 #endif /* CONFIG_PPC_64S_HASH_MMU */
+
+#if defined(CONFIG_KEXEC_FILE) || defined(CONFIG_CRASH_DUMP)
+/**
+ * add_node_props - Reads node properties from device node structure and add
+ *                  them to fdt.
+ * @fdt:            Flattened device tree of the kernel
+ * @node_offset:    offset of the node to add a property at
+ * @dn:             device node pointer
+ *
+ * Returns 0 on success, negative errno on error.
+ */
+static int add_node_props(void *fdt, int node_offset, const struct device_node *dn)
+{
+	int ret = 0;
+	struct property *pp;
+
+	if (!dn)
+		return -EINVAL;
+
+	for_each_property_of_node(dn, pp) {
+		ret = fdt_setprop(fdt, node_offset, pp->name, pp->value, pp->length);
+		if (ret < 0) {
+			pr_err("Unable to add %s property: %s\n", pp->name, fdt_strerror(ret));
+			return ret;
+		}
+	}
+	return ret;
+}
+
+/**
+ * update_cpus_node - Update cpus node of flattened device tree using of_root
+ *                    device node.
+ * @fdt:              Flattened device tree of the kernel.
+ *
+ * Returns 0 on success, negative errno on error.
+ *
+ * Note: expecting no subnodes under /cpus/<node> with device_type == "cpu".
+ * If this changes, update this function to include them.
+ */
+int update_cpus_node(void *fdt)
+{
+	int prev_node_offset;
+	const char *device_type;
+	const struct fdt_property *prop;
+	struct device_node *cpus_node, *dn;
+	int cpus_offset, cpus_subnode_offset, ret = 0;
+
+	cpus_offset = fdt_path_offset(fdt, "/cpus");
+	if (cpus_offset < 0 && cpus_offset != -FDT_ERR_NOTFOUND) {
+		pr_err("Malformed device tree: error reading /cpus node: %s\n",
+		       fdt_strerror(cpus_offset));
+		return cpus_offset;
+	}
+
+	prev_node_offset = cpus_offset;
+	/* Delete sub-nodes of /cpus node with device_type == "cpu" */
+	for (cpus_subnode_offset = fdt_first_subnode(fdt, cpus_offset); cpus_subnode_offset >= 0;) {
+		/* Ignore nodes that do not have a device_type property or device_type != "cpu" */
+		prop = fdt_get_property(fdt, cpus_subnode_offset, "device_type", NULL);
+		if (!prop || strcmp(prop->data, "cpu")) {
+			prev_node_offset = cpus_subnode_offset;
+			goto next_node;
+		}
+
+		ret = fdt_del_node(fdt, cpus_subnode_offset);
+		if (ret < 0) {
+			pr_err("Failed to delete a cpus sub-node: %s\n", fdt_strerror(ret));
+			return ret;
+		}
+next_node:
+		if (prev_node_offset == cpus_offset)
+			cpus_subnode_offset = fdt_first_subnode(fdt, cpus_offset);
+		else
+			cpus_subnode_offset = fdt_next_subnode(fdt, prev_node_offset);
+	}
+
+	cpus_node = of_find_node_by_path("/cpus");
+	/* Fail here to avoid kexec/kdump kernel boot hung */
+	if (!cpus_node) {
+		pr_err("No /cpus node found\n");
+		return -EINVAL;
+	}
+
+	/* Add all /cpus sub-nodes of device_type == "cpu" to FDT */
+	for_each_child_of_node(cpus_node, dn) {
+		/* Ignore device nodes that do not have a device_type property
+		 * or device_type != "cpu".
+		 */
+		device_type = of_get_property(dn, "device_type", NULL);
+		if (!device_type || strcmp(device_type, "cpu"))
+			continue;
+
+		cpus_subnode_offset = fdt_add_subnode(fdt, cpus_offset, dn->full_name);
+		if (cpus_subnode_offset < 0) {
+			pr_err("Unable to add %s subnode: %s\n", dn->full_name,
+			       fdt_strerror(cpus_subnode_offset));
+			ret = cpus_subnode_offset;
+			goto out;
+		}
+
+		ret = add_node_props(fdt, cpus_subnode_offset, dn);
+		if (ret < 0)
+			goto out;
+	}
+out:
+	of_node_put(cpus_node);
+	of_node_put(dn);
+	return ret;
+}
+#endif /* CONFIG_KEXEC_FILE || CONFIG_CRASH_DUMP */
diff --git a/arch/powerpc/kexec/file_load_64.c b/arch/powerpc/kexec/file_load_64.c
index 349a781cea0b..180c1dfe4aa7 100644
--- a/arch/powerpc/kexec/file_load_64.c
+++ b/arch/powerpc/kexec/file_load_64.c
@@ -952,93 +952,6 @@ unsigned int kexec_extra_fdt_size_ppc64(struct kimage *image)
 	return (unsigned int)(usm_entries * sizeof(u64));
 }
 
-/**
- * add_node_props - Reads node properties from device node structure and add
- *                  them to fdt.
- * @fdt:            Flattened device tree of the kernel
- * @node_offset:    offset of the node to add a property at
- * @dn:             device node pointer
- *
- * Returns 0 on success, negative errno on error.
- */
-static int add_node_props(void *fdt, int node_offset, const struct device_node *dn)
-{
-	int ret = 0;
-	struct property *pp;
-
-	if (!dn)
-		return -EINVAL;
-
-	for_each_property_of_node(dn, pp) {
-		ret = fdt_setprop(fdt, node_offset, pp->name, pp->value, pp->length);
-		if (ret < 0) {
-			pr_err("Unable to add %s property: %s\n", pp->name, fdt_strerror(ret));
-			return ret;
-		}
-	}
-	return ret;
-}
-
-/**
- * update_cpus_node - Update cpus node of flattened device tree using of_root
- *                    device node.
- * @fdt:              Flattened device tree of the kernel.
- *
- * Returns 0 on success, negative errno on error.
- */
-static int update_cpus_node(void *fdt)
-{
-	struct device_node *cpus_node, *dn;
-	int cpus_offset, cpus_subnode_offset, ret = 0;
-
-	cpus_offset = fdt_path_offset(fdt, "/cpus");
-	if (cpus_offset < 0 && cpus_offset != -FDT_ERR_NOTFOUND) {
-		pr_err("Malformed device tree: error reading /cpus node: %s\n",
-		       fdt_strerror(cpus_offset));
-		return cpus_offset;
-	}
-
-	if (cpus_offset > 0) {
-		ret = fdt_del_node(fdt, cpus_offset);
-		if (ret < 0) {
-			pr_err("Error deleting /cpus node: %s\n", fdt_strerror(ret));
-			return -EINVAL;
-		}
-	}
-
-	/* Add cpus node to fdt */
-	cpus_offset = fdt_add_subnode(fdt, fdt_path_offset(fdt, "/"), "cpus");
-	if (cpus_offset < 0) {
-		pr_err("Error creating /cpus node: %s\n", fdt_strerror(cpus_offset));
-		return -EINVAL;
-	}
-
-	/* Add cpus node properties */
-	cpus_node = of_find_node_by_path("/cpus");
-	ret = add_node_props(fdt, cpus_offset, cpus_node);
-	of_node_put(cpus_node);
-	if (ret < 0)
-		return ret;
-
-	/* Loop through all subnodes of cpus and add them to fdt */
-	for_each_node_by_type(dn, "cpu") {
-		cpus_subnode_offset = fdt_add_subnode(fdt, cpus_offset, dn->full_name);
-		if (cpus_subnode_offset < 0) {
-			pr_err("Unable to add %s subnode: %s\n", dn->full_name,
-			       fdt_strerror(cpus_subnode_offset));
-			ret = cpus_subnode_offset;
-			goto out;
-		}
-
-		ret = add_node_props(fdt, cpus_subnode_offset, dn);
-		if (ret < 0)
-			goto out;
-	}
-out:
-	of_node_put(dn);
-	return ret;
-}
-
 static int copy_property(void *fdt, int node_offset, const struct device_node *dn,
 			 const char *propname)
 {
diff --git a/arch/powerpc/kvm/powerpc.c b/arch/powerpc/kvm/powerpc.c
index b850b0efa201..98ac5d39ad9c 100644
--- a/arch/powerpc/kvm/powerpc.c
+++ b/arch/powerpc/kvm/powerpc.c
@@ -1998,8 +1998,10 @@ static int kvm_vcpu_ioctl_enable_cap(struct kvm_vcpu *vcpu,
 			break;
 
 		r = -ENXIO;
-		if (!xive_enabled())
+		if (!xive_enabled()) {
+			fdput(f);
 			break;
+		}
 
 		r = -EPERM;
 		dev = kvm_device_from_filp(f.file);
diff --git a/arch/powerpc/platforms/pseries/plpks.c b/arch/powerpc/platforms/pseries/plpks.c
index 25f95440a773..d1eb6f0433fe 100644
--- a/arch/powerpc/platforms/pseries/plpks.c
+++ b/arch/powerpc/platforms/pseries/plpks.c
@@ -18,15 +18,23 @@
 #include <linux/types.h>
 #include <asm/hvcall.h>
 #include <asm/machdep.h>
-
-#include "plpks.h"
+#include <asm/plpks.h>
+#include <asm/firmware.h>
 
 static u8 *ospassword;
 static u16 ospasswordlength;
 
 // Retrieved with H_PKS_GET_CONFIG
+static u8 version;
+static u16 objoverhead;
 static u16 maxpwsize;
 static u16 maxobjsize;
+static s16 maxobjlabelsize;
+static u32 totalsize;
+static u32 usedspace;
+static u32 supportedpolicies;
+static u32 maxlargeobjectsize;
+static u64 signedupdatealgorithms;
 
 struct plpks_auth {
 	u8 version;
@@ -113,7 +121,8 @@ static int plpks_gen_password(void)
 	u8 *password, consumer = PLPKS_OS_OWNER;
 	int rc;
 
-	password = kzalloc(maxpwsize, GFP_KERNEL);
+	// The password must not cross a page boundary, so we align to the next power of 2
+	password = kzalloc(roundup_pow_of_two(maxpwsize), GFP_KERNEL);
 	if (!password)
 		return -ENOMEM;
 
@@ -149,7 +158,9 @@ static struct plpks_auth *construct_auth(u8 consumer)
 	if (consumer > PLPKS_OS_OWNER)
 		return ERR_PTR(-EINVAL);
 
-	auth = kzalloc(struct_size(auth, password, maxpwsize), GFP_KERNEL);
+	// The auth structure must not cross a page boundary and must be
+	// 16 byte aligned. We align to the next largest power of 2
+	auth = kzalloc(roundup_pow_of_two(struct_size(auth, password, maxpwsize)), GFP_KERNEL);
 	if (!auth)
 		return ERR_PTR(-ENOMEM);
 
@@ -183,7 +194,8 @@ static struct label *construct_label(char *component, u8 varos, u8 *name,
 	if (component && slen > sizeof(label->attr.prefix))
 		return ERR_PTR(-EINVAL);
 
-	label = kzalloc(sizeof(*label), GFP_KERNEL);
+	// The label structure must not cross a page boundary, so we align to the next power of 2
+	label = kzalloc(roundup_pow_of_two(sizeof(*label)), GFP_KERNEL);
 	if (!label)
 		return ERR_PTR(-ENOMEM);
 
@@ -203,32 +215,157 @@ static struct label *construct_label(char *component, u8 varos, u8 *name,
 static int _plpks_get_config(void)
 {
 	unsigned long retbuf[PLPAR_HCALL_BUFSIZE] = { 0 };
-	struct {
+	struct config {
 		u8 version;
 		u8 flags;
-		__be32 rsvd0;
+		__be16 rsvd0;
+		__be16 objoverhead;
 		__be16 maxpwsize;
 		__be16 maxobjlabelsize;
 		__be16 maxobjsize;
 		__be32 totalsize;
 		__be32 usedspace;
 		__be32 supportedpolicies;
-		__be64 rsvd1;
-	} __packed config;
+		__be32 maxlargeobjectsize;
+		__be64 signedupdatealgorithms;
+		u8 rsvd1[476];
+	} __packed * config;
 	size_t size;
-	int rc;
+	int rc = 0;
+
+	size = sizeof(*config);
+
+	// Config struct must not cross a page boundary. So long as the struct
+	// size is a power of 2, this should be fine as alignment is guaranteed
+	config = kzalloc(size, GFP_KERNEL);
+	if (!config) {
+		rc = -ENOMEM;
+		goto err;
+	}
+
+	rc = plpar_hcall(H_PKS_GET_CONFIG, retbuf, virt_to_phys(config), size);
+
+	if (rc != H_SUCCESS) {
+		rc = pseries_status_to_err(rc);
+		goto err;
+	}
+
+	version = config->version;
+	objoverhead = be16_to_cpu(config->objoverhead);
+	maxpwsize = be16_to_cpu(config->maxpwsize);
+	maxobjsize = be16_to_cpu(config->maxobjsize);
+	maxobjlabelsize = be16_to_cpu(config->maxobjlabelsize);
+	totalsize = be32_to_cpu(config->totalsize);
+	usedspace = be32_to_cpu(config->usedspace);
+	supportedpolicies = be32_to_cpu(config->supportedpolicies);
+	maxlargeobjectsize = be32_to_cpu(config->maxlargeobjectsize);
+	signedupdatealgorithms = be64_to_cpu(config->signedupdatealgorithms);
+
+	// Validate that the numbers we get back match the requirements of the spec
+	if (maxpwsize < 32) {
+		pr_err("Invalid Max Password Size received from hypervisor (%d < 32)\n", maxpwsize);
+		rc = -EIO;
+		goto err;
+	}
+
+	if (maxobjlabelsize < 255) {
+		pr_err("Invalid Max Object Label Size received from hypervisor (%d < 255)\n",
+		       maxobjlabelsize);
+		rc = -EIO;
+		goto err;
+	}
+
+	if (totalsize < 4096) {
+		pr_err("Invalid Total Size received from hypervisor (%d < 4096)\n", totalsize);
+		rc = -EIO;
+		goto err;
+	}
+
+	if (version >= 3 && maxlargeobjectsize >= 65536 && maxobjsize != 0xFFFF) {
+		pr_err("Invalid Max Object Size (0x%x != 0xFFFF)\n", maxobjsize);
+		rc = -EIO;
+		goto err;
+	}
+
+err:
+	kfree(config);
+	return rc;
+}
+
+u8 plpks_get_version(void)
+{
+	return version;
+}
+
+u16 plpks_get_objoverhead(void)
+{
+	return objoverhead;
+}
+
+u16 plpks_get_maxpwsize(void)
+{
+	return maxpwsize;
+}
+
+u16 plpks_get_maxobjectsize(void)
+{
+	return maxobjsize;
+}
+
+u16 plpks_get_maxobjectlabelsize(void)
+{
+	return maxobjlabelsize;
+}
+
+u32 plpks_get_totalsize(void)
+{
+	return totalsize;
+}
+
+u32 plpks_get_usedspace(void)
+{
+	// Unlike other config values, usedspace regularly changes as objects
+	// are updated, so we need to refresh.
+	int rc = _plpks_get_config();
+	if (rc) {
+		pr_err("Couldn't get config, rc: %d\n", rc);
+		return 0;
+	}
+	return usedspace;
+}
 
-	size = sizeof(config);
+u32 plpks_get_supportedpolicies(void)
+{
+	return supportedpolicies;
+}
 
-	rc = plpar_hcall(H_PKS_GET_CONFIG, retbuf, virt_to_phys(&config), size);
+u32 plpks_get_maxlargeobjectsize(void)
+{
+	return maxlargeobjectsize;
+}
 
-	if (rc != H_SUCCESS)
-		return pseries_status_to_err(rc);
+u64 plpks_get_signedupdatealgorithms(void)
+{
+	return signedupdatealgorithms;
+}
 
-	maxpwsize = be16_to_cpu(config.maxpwsize);
-	maxobjsize = be16_to_cpu(config.maxobjsize);
+u16 plpks_get_passwordlen(void)
+{
+	return ospasswordlength;
+}
+
+bool plpks_is_available(void)
+{
+	int rc;
+
+	if (!firmware_has_feature(FW_FEATURE_LPAR))
+		return false;
+
+	rc = _plpks_get_config();
+	if (rc)
+		return false;
 
-	return 0;
+	return true;
 }
 
 static int plpks_confirm_object_flushed(struct label *label,
diff --git a/arch/powerpc/platforms/pseries/plpks.h b/arch/powerpc/platforms/pseries/plpks.h
deleted file mode 100644
index 07278a990c2d..000000000000
--- a/arch/powerpc/platforms/pseries/plpks.h
+++ /dev/null
@@ -1,96 +0,0 @@
-/* SPDX-License-Identifier: GPL-2.0 */
-/*
- * Copyright (C) 2022 IBM Corporation
- * Author: Nayna Jain <nayna@linux.ibm.com>
- *
- * Platform keystore for pseries LPAR(PLPKS).
- */
-
-#ifndef _PSERIES_PLPKS_H
-#define _PSERIES_PLPKS_H
-
-#include <linux/types.h>
-#include <linux/list.h>
-
-// Object policy flags from supported_policies
-#define PLPKS_OSSECBOOTAUDIT	PPC_BIT32(1) // OS secure boot must be audit/enforce
-#define PLPKS_OSSECBOOTENFORCE	PPC_BIT32(2) // OS secure boot must be enforce
-#define PLPKS_PWSET		PPC_BIT32(3) // No access without password set
-#define PLPKS_WORLDREADABLE	PPC_BIT32(4) // Readable without authentication
-#define PLPKS_IMMUTABLE		PPC_BIT32(5) // Once written, object cannot be removed
-#define PLPKS_TRANSIENT		PPC_BIT32(6) // Object does not persist through reboot
-#define PLPKS_SIGNEDUPDATE	PPC_BIT32(7) // Object can only be modified by signed updates
-#define PLPKS_HVPROVISIONED	PPC_BIT32(28) // Hypervisor has provisioned this object
-
-// Signature algorithm flags from signed_update_algorithms
-#define PLPKS_ALG_RSA2048	PPC_BIT(0)
-#define PLPKS_ALG_RSA4096	PPC_BIT(1)
-
-// Object label OS metadata flags
-#define PLPKS_VAR_LINUX		0x02
-#define PLPKS_VAR_COMMON	0x04
-
-// Flags for which consumer owns an object is owned by
-#define PLPKS_FW_OWNER			0x1
-#define PLPKS_BOOTLOADER_OWNER		0x2
-#define PLPKS_OS_OWNER			0x3
-
-// Flags for label metadata fields
-#define PLPKS_LABEL_VERSION		0
-#define PLPKS_MAX_LABEL_ATTR_SIZE	16
-#define PLPKS_MAX_NAME_SIZE		239
-#define PLPKS_MAX_DATA_SIZE		4000
-
-// Timeouts for PLPKS operations
-#define PLPKS_MAX_TIMEOUT		(5 * USEC_PER_SEC)
-#define PLPKS_FLUSH_SLEEP		10000 // usec
-
-struct plpks_var {
-	char *component;
-	u8 *name;
-	u8 *data;
-	u32 policy;
-	u16 namelen;
-	u16 datalen;
-	u8 os;
-};
-
-struct plpks_var_name {
-	u8  *name;
-	u16 namelen;
-};
-
-struct plpks_var_name_list {
-	u32 varcount;
-	struct plpks_var_name varlist[];
-};
-
-/**
- * Writes the specified var and its data to PKS.
- * Any caller of PKS driver should present a valid component type for
- * their variable.
- */
-int plpks_write_var(struct plpks_var var);
-
-/**
- * Removes the specified var and its data from PKS.
- */
-int plpks_remove_var(char *component, u8 varos,
-		     struct plpks_var_name vname);
-
-/**
- * Returns the data for the specified os variable.
- */
-int plpks_read_os_var(struct plpks_var *var);
-
-/**
- * Returns the data for the specified firmware variable.
- */
-int plpks_read_fw_var(struct plpks_var *var);
-
-/**
- * Returns the data for the specified bootloader variable.
- */
-int plpks_read_bootloader_var(struct plpks_var *var);
-
-#endif
diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c
index 75fa98221d48..af105e1bc3fc 100644
--- a/arch/powerpc/xmon/ppc-dis.c
+++ b/arch/powerpc/xmon/ppc-dis.c
@@ -122,32 +122,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr)
   bool insn_is_short;
   ppc_cpu_t dialect;
 
-  dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON
-            | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC;
+  dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON;
 
-  if (cpu_has_feature(CPU_FTRS_POWER5))
-    dialect |= PPC_OPCODE_POWER5;
+  if (IS_ENABLED(CONFIG_PPC64))
+    dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL |
+	PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 |
+	PPC_OPCODE_POWER9;
 
-  if (cpu_has_feature(CPU_FTRS_CELL))
-    dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC);
+  if (cpu_has_feature(CPU_FTR_TM))
+    dialect |= PPC_OPCODE_HTM;
 
-  if (cpu_has_feature(CPU_FTRS_POWER6))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC);
+  if (cpu_has_feature(CPU_FTR_ALTIVEC))
+    dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2;
 
-  if (cpu_has_feature(CPU_FTRS_POWER7))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-                | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX);
-
-  if (cpu_has_feature(CPU_FTRS_POWER8))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-		| PPC_OPCODE_POWER8 | PPC_OPCODE_HTM
-		| PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX);
-
-  if (cpu_has_feature(CPU_FTRS_POWER9))
-    dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
-		| PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM
-		| PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2
-		| PPC_OPCODE_VSX | PPC_OPCODE_VSX3);
+  if (cpu_has_feature(CPU_FTR_VSX))
+    dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3;
 
   /* Get the major opcode of the insn.  */
   opcode = NULL;
diff --git a/arch/s390/kernel/uv.c b/arch/s390/kernel/uv.c
index 5caa0ed2b594..1ae7a0403804 100644
--- a/arch/s390/kernel/uv.c
+++ b/arch/s390/kernel/uv.c
@@ -172,36 +172,36 @@ int uv_convert_owned_from_secure(unsigned long paddr)
 }
 
 /*
- * Calculate the expected ref_count for a page that would otherwise have no
+ * Calculate the expected ref_count for a folio that would otherwise have no
  * further pins. This was cribbed from similar functions in other places in
  * the kernel, but with some slight modifications. We know that a secure
- * page can not be a huge page for example.
+ * folio can not be a large folio, for example.
  */
-static int expected_page_refs(struct page *page)
+static int expected_folio_refs(struct folio *folio)
 {
 	int res;
 
-	res = page_mapcount(page);
-	if (PageSwapCache(page)) {
+	res = folio_mapcount(folio);
+	if (folio_test_swapcache(folio)) {
 		res++;
-	} else if (page_mapping(page)) {
+	} else if (folio_mapping(folio)) {
 		res++;
-		if (page_has_private(page))
+		if (folio->private)
 			res++;
 	}
 	return res;
 }
 
-static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
+static int make_folio_secure(struct folio *folio, struct uv_cb_header *uvcb)
 {
 	int expected, cc = 0;
 
-	if (PageWriteback(page))
+	if (folio_test_writeback(folio))
 		return -EAGAIN;
-	expected = expected_page_refs(page);
-	if (!page_ref_freeze(page, expected))
+	expected = expected_folio_refs(folio);
+	if (!folio_ref_freeze(folio, expected))
 		return -EBUSY;
-	set_bit(PG_arch_1, &page->flags);
+	set_bit(PG_arch_1, &folio->flags);
 	/*
 	 * If the UVC does not succeed or fail immediately, we don't want to
 	 * loop for long, or we might get stall notifications.
@@ -211,9 +211,9 @@ static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
 	 * -EAGAIN and we let the callers deal with it.
 	 */
 	cc = __uv_call(0, (u64)uvcb);
-	page_ref_unfreeze(page, expected);
+	folio_ref_unfreeze(folio, expected);
 	/*
-	 * Return -ENXIO if the page was not mapped, -EINVAL for other errors.
+	 * Return -ENXIO if the folio was not mapped, -EINVAL for other errors.
 	 * If busy or partially completed, return -EAGAIN.
 	 */
 	if (cc == UVC_CC_OK)
@@ -261,7 +261,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 	bool local_drain = false;
 	spinlock_t *ptelock;
 	unsigned long uaddr;
-	struct page *page;
+	struct folio *folio;
 	pte_t *ptep;
 	int rc;
 
@@ -288,15 +288,26 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 	rc = -ENXIO;
 	ptep = get_locked_pte(gmap->mm, uaddr, &ptelock);
 	if (pte_present(*ptep) && !(pte_val(*ptep) & _PAGE_INVALID) && pte_write(*ptep)) {
-		page = pte_page(*ptep);
+		folio = page_folio(pte_page(*ptep));
+		rc = -EINVAL;
+		if (folio_test_large(folio))
+			goto unlock;
 		rc = -EAGAIN;
-		if (trylock_page(page)) {
+		if (folio_trylock(folio)) {
 			if (should_export_before_import(uvcb, gmap->mm))
-				uv_convert_from_secure(page_to_phys(page));
-			rc = make_page_secure(page, uvcb);
-			unlock_page(page);
+				uv_convert_from_secure(PFN_PHYS(folio_pfn(folio)));
+			rc = make_folio_secure(folio, uvcb);
+			folio_unlock(folio);
 		}
+
+		/*
+		 * Once we drop the PTL, the folio may get unmapped and
+		 * freed immediately. We need a temporary reference.
+		 */
+		if (rc == -EAGAIN)
+			folio_get(folio);
 	}
+unlock:
 	pte_unmap_unlock(ptep, ptelock);
 out:
 	mmap_read_unlock(gmap->mm);
@@ -306,10 +317,11 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 		 * If we are here because the UVC returned busy or partial
 		 * completion, this is just a useless check, but it is safe.
 		 */
-		wait_on_page_writeback(page);
+		folio_wait_writeback(folio);
+		folio_put(folio);
 	} else if (rc == -EBUSY) {
 		/*
-		 * If we have tried a local drain and the page refcount
+		 * If we have tried a local drain and the folio refcount
 		 * still does not match our expected safe value, try with a
 		 * system wide drain. This is needed if the pagevecs holding
 		 * the page are on a different CPU.
@@ -320,7 +332,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
 			return -EAGAIN;
 		}
 		/*
-		 * We are here if the page refcount does not match the
+		 * We are here if the folio refcount does not match the
 		 * expected safe value. The main culprits are usually
 		 * pagevecs. With lru_add_drain() we drain the pagevecs
 		 * on the local CPU so that hopefully the refcount will
diff --git a/arch/s390/pci/pci_irq.c b/arch/s390/pci/pci_irq.c
index 04c19ab93a32..393bcc2c3dc2 100644
--- a/arch/s390/pci/pci_irq.c
+++ b/arch/s390/pci/pci_irq.c
@@ -268,33 +268,20 @@ static void zpci_floating_irq_handler(struct airq_struct *airq,
 	}
 }
 
-int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+static int __alloc_airq(struct zpci_dev *zdev, int msi_vecs,
+			unsigned long *bit)
 {
-	struct zpci_dev *zdev = to_zpci(pdev);
-	unsigned int hwirq, msi_vecs, cpu;
-	unsigned long bit;
-	struct msi_desc *msi;
-	struct msi_msg msg;
-	int cpu_addr;
-	int rc, irq;
-
-	zdev->aisb = -1UL;
-	zdev->msi_first_bit = -1U;
-	if (type == PCI_CAP_ID_MSI && nvec > 1)
-		return 1;
-	msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
-
 	if (irq_delivery == DIRECTED) {
 		/* Allocate cpu vector bits */
-		bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
-		if (bit == -1UL)
+		*bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
+		if (*bit == -1UL)
 			return -EIO;
 	} else {
 		/* Allocate adapter summary indicator bit */
-		bit = airq_iv_alloc_bit(zpci_sbv);
-		if (bit == -1UL)
+		*bit = airq_iv_alloc_bit(zpci_sbv);
+		if (*bit == -1UL)
 			return -EIO;
-		zdev->aisb = bit;
+		zdev->aisb = *bit;
 
 		/* Create adapter interrupt vector */
 		zdev->aibv = airq_iv_create(msi_vecs, AIRQ_IV_DATA | AIRQ_IV_BITLOCK, NULL);
@@ -302,27 +289,66 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
 			return -ENOMEM;
 
 		/* Wire up shortcut pointer */
-		zpci_ibv[bit] = zdev->aibv;
+		zpci_ibv[*bit] = zdev->aibv;
 		/* Each function has its own interrupt vector */
-		bit = 0;
+		*bit = 0;
 	}
+	return 0;
+}
 
-	/* Request MSI interrupts */
+int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+{
+	unsigned int hwirq, msi_vecs, irqs_per_msi, i, cpu;
+	struct zpci_dev *zdev = to_zpci(pdev);
+	struct msi_desc *msi;
+	struct msi_msg msg;
+	unsigned long bit;
+	int cpu_addr;
+	int rc, irq;
+
+	zdev->aisb = -1UL;
+	zdev->msi_first_bit = -1U;
+
+	msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
+	if (msi_vecs < nvec) {
+		pr_info("%s requested %d irqs, allocate system limit of %d",
+			pci_name(pdev), nvec, zdev->max_msi);
+	}
+
+	rc = __alloc_airq(zdev, msi_vecs, &bit);
+	if (rc < 0)
+		return rc;
+
+	/*
+	 * Request MSI interrupts:
+	 * When using MSI, nvec_used interrupt sources and their irq
+	 * descriptors are controlled through one msi descriptor.
+	 * Thus the outer loop over msi descriptors shall run only once,
+	 * while two inner loops iterate over the interrupt vectors.
+	 * When using MSI-X, each interrupt vector/irq descriptor
+	 * is bound to exactly one msi descriptor (nvec_used is one).
+	 * So the inner loops are executed once, while the outer iterates
+	 * over the MSI-X descriptors.
+	 */
 	hwirq = bit;
 	msi_for_each_desc(msi, &pdev->dev, MSI_DESC_NOTASSOCIATED) {
-		rc = -EIO;
 		if (hwirq - bit >= msi_vecs)
 			break;
-		irq = __irq_alloc_descs(-1, 0, 1, 0, THIS_MODULE,
-				(irq_delivery == DIRECTED) ?
-				msi->affinity : NULL);
+		irqs_per_msi = min_t(unsigned int, msi_vecs, msi->nvec_used);
+		irq = __irq_alloc_descs(-1, 0, irqs_per_msi, 0, THIS_MODULE,
+					(irq_delivery == DIRECTED) ?
+					msi->affinity : NULL);
 		if (irq < 0)
 			return -ENOMEM;
-		rc = irq_set_msi_desc(irq, msi);
-		if (rc)
-			return rc;
-		irq_set_chip_and_handler(irq, &zpci_irq_chip,
-					 handle_percpu_irq);
+
+		for (i = 0; i < irqs_per_msi; i++) {
+			rc = irq_set_msi_desc_off(irq, i, msi);
+			if (rc)
+				return rc;
+			irq_set_chip_and_handler(irq + i, &zpci_irq_chip,
+						 handle_percpu_irq);
+		}
+
 		msg.data = hwirq - bit;
 		if (irq_delivery == DIRECTED) {
 			if (msi->affinity)
@@ -335,31 +361,35 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
 			msg.address_lo |= (cpu_addr << 8);
 
 			for_each_possible_cpu(cpu) {
-				airq_iv_set_data(zpci_ibv[cpu], hwirq, irq);
+				for (i = 0; i < irqs_per_msi; i++)
+					airq_iv_set_data(zpci_ibv[cpu],
+							 hwirq + i, irq + i);
 			}
 		} else {
 			msg.address_lo = zdev->msi_addr & 0xffffffff;
-			airq_iv_set_data(zdev->aibv, hwirq, irq);
+			for (i = 0; i < irqs_per_msi; i++)
+				airq_iv_set_data(zdev->aibv, hwirq + i, irq + i);
 		}
 		msg.address_hi = zdev->msi_addr >> 32;
 		pci_write_msi_msg(irq, &msg);
-		hwirq++;
+		hwirq += irqs_per_msi;
 	}
 
 	zdev->msi_first_bit = bit;
-	zdev->msi_nr_irqs = msi_vecs;
+	zdev->msi_nr_irqs = hwirq - bit;
 
 	rc = zpci_set_irq(zdev);
 	if (rc)
 		return rc;
 
-	return (msi_vecs == nvec) ? 0 : msi_vecs;
+	return (zdev->msi_nr_irqs == nvec) ? 0 : zdev->msi_nr_irqs;
 }
 
 void arch_teardown_msi_irqs(struct pci_dev *pdev)
 {
 	struct zpci_dev *zdev = to_zpci(pdev);
 	struct msi_desc *msi;
+	unsigned int i;
 	int rc;
 
 	/* Disable interrupts */
@@ -369,8 +399,10 @@ void arch_teardown_msi_irqs(struct pci_dev *pdev)
 
 	/* Release MSI interrupts */
 	msi_for_each_desc(msi, &pdev->dev, MSI_DESC_ASSOCIATED) {
-		irq_set_msi_desc(msi->irq, NULL);
-		irq_free_desc(msi->irq);
+		for (i = 0; i < msi->nvec_used; i++) {
+			irq_set_msi_desc(msi->irq + i, NULL);
+			irq_free_desc(msi->irq + i);
+		}
 		msi->msg.address_lo = 0;
 		msi->msg.address_hi = 0;
 		msi->msg.data = 0;
diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h
index a67abebd4359..1b86d02a8455 100644
--- a/arch/sparc/include/asm/oplib_64.h
+++ b/arch/sparc/include/asm/oplib_64.h
@@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void);
 int prom_ihandle2path(int handle, char *buffer, int bufsize);
 
 /* Client interface level routines. */
+void prom_cif_init(void *cif_handler);
 void p1275_cmd_direct(unsigned long *);
 
 #endif /* !(__SPARC64_OPLIB_H) */
diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c
index 103aa9104318..f7b8a1a865b8 100644
--- a/arch/sparc/prom/init_64.c
+++ b/arch/sparc/prom/init_64.c
@@ -26,9 +26,6 @@ phandle prom_chosen_node;
  * routines in the prom library.
  * It gets passed the pointer to the PROM vector.
  */
-
-extern void prom_cif_init(void *);
-
 void __init prom_init(void *cif_handler)
 {
 	phandle node;
diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c
index 889aa602f8d8..51c3f984bbf7 100644
--- a/arch/sparc/prom/p1275.c
+++ b/arch/sparc/prom/p1275.c
@@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args)
 	local_irq_restore(flags);
 }
 
-void prom_cif_init(void *cif_handler, void *cif_stack)
+void prom_cif_init(void *cif_handler)
 {
 	p1275buf.prom_cif_handler = (void (*)(long *))cif_handler;
 }
diff --git a/arch/um/drivers/ubd_kern.c b/arch/um/drivers/ubd_kern.c
index 13a22a461305..1203f5078cb5 100644
--- a/arch/um/drivers/ubd_kern.c
+++ b/arch/um/drivers/ubd_kern.c
@@ -456,43 +456,31 @@ static int bulk_req_safe_read(
 	return n;
 }
 
-/* Called without dev->lock held, and only in interrupt context. */
-static void ubd_handler(void)
+static void ubd_end_request(struct io_thread_req *io_req)
 {
-	int n;
-	int count;
-
-	while(1){
-		n = bulk_req_safe_read(
-			thread_fd,
-			irq_req_buffer,
-			&irq_remainder,
-			&irq_remainder_size,
-			UBD_REQ_BUFFER_SIZE
-		);
-		if (n < 0) {
-			if(n == -EAGAIN)
-				break;
-			printk(KERN_ERR "spurious interrupt in ubd_handler, "
-			       "err = %d\n", -n);
-			return;
-		}
-		for (count = 0; count < n/sizeof(struct io_thread_req *); count++) {
-			struct io_thread_req *io_req = (*irq_req_buffer)[count];
-
-			if ((io_req->error == BLK_STS_NOTSUPP) && (req_op(io_req->req) == REQ_OP_DISCARD)) {
-				blk_queue_max_discard_sectors(io_req->req->q, 0);
-				blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
-			}
-			blk_mq_end_request(io_req->req, io_req->error);
-			kfree(io_req);
-		}
+	if (io_req->error == BLK_STS_NOTSUPP) {
+		if (req_op(io_req->req) == REQ_OP_DISCARD)
+			blk_queue_max_discard_sectors(io_req->req->q, 0);
+		else if (req_op(io_req->req) == REQ_OP_WRITE_ZEROES)
+			blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
 	}
+	blk_mq_end_request(io_req->req, io_req->error);
+	kfree(io_req);
 }
 
 static irqreturn_t ubd_intr(int irq, void *dev)
 {
-	ubd_handler();
+	int len, i;
+
+	while ((len = bulk_req_safe_read(thread_fd, irq_req_buffer,
+			&irq_remainder, &irq_remainder_size,
+			UBD_REQ_BUFFER_SIZE)) >= 0) {
+		for (i = 0; i < len / sizeof(struct io_thread_req *); i++)
+			ubd_end_request((*irq_req_buffer)[i]);
+	}
+
+	if (len < 0 && len != -EAGAIN)
+		pr_err("spurious interrupt in %s, err = %d\n", __func__, len);
 	return IRQ_HANDLED;
 }
 
diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c
index 3e270da6b6f6..c8c4ef94c753 100644
--- a/arch/um/kernel/time.c
+++ b/arch/um/kernel/time.c
@@ -874,9 +874,9 @@ int setup_time_travel_start(char *str)
 	return 1;
 }
 
-__setup("time-travel-start", setup_time_travel_start);
+__setup("time-travel-start=", setup_time_travel_start);
 __uml_help(setup_time_travel_start,
-"time-travel-start=<seconds>\n"
+"time-travel-start=<nanoseconds>\n"
 "Configure the UML instance's wall clock to start at this value rather than\n"
 "the host's wall clock at the time of UML boot.\n");
 #endif
diff --git a/arch/um/os-Linux/signal.c b/arch/um/os-Linux/signal.c
index 24a403a70a02..850d21e6473e 100644
--- a/arch/um/os-Linux/signal.c
+++ b/arch/um/os-Linux/signal.c
@@ -8,6 +8,7 @@
 
 #include <stdlib.h>
 #include <stdarg.h>
+#include <stdbool.h>
 #include <errno.h>
 #include <signal.h>
 #include <string.h>
@@ -65,9 +66,7 @@ static void sig_handler_common(int sig, struct siginfo *si, mcontext_t *mc)
 
 int signals_enabled;
 #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
-static int signals_blocked;
-#else
-#define signals_blocked 0
+static int signals_blocked, signals_blocked_pending;
 #endif
 static unsigned int signals_pending;
 static unsigned int signals_active = 0;
@@ -76,14 +75,27 @@ void sig_handler(int sig, struct siginfo *si, mcontext_t *mc)
 {
 	int enabled = signals_enabled;
 
-	if ((signals_blocked || !enabled) && (sig == SIGIO)) {
+#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
+	if ((signals_blocked ||
+	     __atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) &&
+	    (sig == SIGIO)) {
+		/* increment so unblock will do another round */
+		__atomic_add_fetch(&signals_blocked_pending, 1,
+				   __ATOMIC_SEQ_CST);
+		return;
+	}
+#endif
+
+	if (!enabled && (sig == SIGIO)) {
 		/*
 		 * In TT_MODE_EXTERNAL, need to still call time-travel
-		 * handlers unless signals are also blocked for the
-		 * external time message processing. This will mark
-		 * signals_pending by itself (only if necessary.)
+		 * handlers. This will mark signals_pending by itself
+		 * (only if necessary.)
+		 * Note we won't get here if signals are hard-blocked
+		 * (which is handled above), in that case the hard-
+		 * unblock will handle things.
 		 */
-		if (!signals_blocked && time_travel_mode == TT_MODE_EXTERNAL)
+		if (time_travel_mode == TT_MODE_EXTERNAL)
 			sigio_run_timetravel_handlers();
 		else
 			signals_pending |= SIGIO_MASK;
@@ -380,33 +392,99 @@ int um_set_signals_trace(int enable)
 #ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
 void mark_sigio_pending(void)
 {
+	/*
+	 * It would seem that this should be atomic so
+	 * it isn't a read-modify-write with a signal
+	 * that could happen in the middle, losing the
+	 * value set by the signal.
+	 *
+	 * However, this function is only called when in
+	 * time-travel=ext simulation mode, in which case
+	 * the only signal ever pending is SIGIO, which
+	 * is blocked while this can be called, and the
+	 * timer signal (SIGALRM) cannot happen.
+	 */
 	signals_pending |= SIGIO_MASK;
 }
 
 void block_signals_hard(void)
 {
-	if (signals_blocked)
-		return;
-	signals_blocked = 1;
+	signals_blocked++;
 	barrier();
 }
 
 void unblock_signals_hard(void)
 {
+	static bool unblocking;
+
 	if (!signals_blocked)
+		panic("unblocking signals while not blocked");
+
+	if (--signals_blocked)
 		return;
-	/* Must be set to 0 before we check the pending bits etc. */
-	signals_blocked = 0;
+	/*
+	 * Must be set to 0 before we check pending so the
+	 * SIGIO handler will run as normal unless we're still
+	 * going to process signals_blocked_pending.
+	 */
 	barrier();
 
-	if (signals_pending && signals_enabled) {
-		/* this is a bit inefficient, but that's not really important */
-		block_signals();
-		unblock_signals();
-	} else if (signals_pending & SIGIO_MASK) {
-		/* we need to run time-travel handlers even if not enabled */
-		sigio_run_timetravel_handlers();
+	/*
+	 * Note that block_signals_hard()/unblock_signals_hard() can be called
+	 * within the unblock_signals()/sigio_run_timetravel_handlers() below.
+	 * This would still be prone to race conditions since it's actually a
+	 * call _within_ e.g. vu_req_read_message(), where we observed this
+	 * issue, which loops. Thus, if the inner call handles the recorded
+	 * pending signals, we can get out of the inner call with the real
+	 * signal hander no longer blocked, and still have a race. Thus don't
+	 * handle unblocking in the inner call, if it happens, but only in
+	 * the outermost call - 'unblocking' serves as an ownership for the
+	 * signals_blocked_pending decrement.
+	 */
+	if (unblocking)
+		return;
+	unblocking = true;
+
+	while (__atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) {
+		if (signals_enabled) {
+			/* signals are enabled so we can touch this */
+			signals_pending |= SIGIO_MASK;
+			/*
+			 * this is a bit inefficient, but that's
+			 * not really important
+			 */
+			block_signals();
+			unblock_signals();
+		} else {
+			/*
+			 * we need to run time-travel handlers even
+			 * if not enabled
+			 */
+			sigio_run_timetravel_handlers();
+		}
+
+		/*
+		 * The decrement of signals_blocked_pending must be atomic so
+		 * that the signal handler will either happen before or after
+		 * the decrement, not during a read-modify-write:
+		 *  - If it happens before, it can increment it and we'll
+		 *    decrement it and do another round in the loop.
+		 *  - If it happens after it'll see 0 for both signals_blocked
+		 *    and signals_blocked_pending and thus run the handler as
+		 *    usual (subject to signals_enabled, but that's unrelated.)
+		 *
+		 * Note that a call to unblock_signals_hard() within the calls
+		 * to unblock_signals() or sigio_run_timetravel_handlers() above
+		 * will do nothing due to the 'unblocking' state, so this cannot
+		 * underflow as the only one decrementing will be the outermost
+		 * one.
+		 */
+		if (__atomic_sub_fetch(&signals_blocked_pending, 1,
+				       __ATOMIC_SEQ_CST) < 0)
+			panic("signals_blocked_pending underflow");
 	}
+
+	unblocking = false;
 }
 #endif
 
diff --git a/arch/x86/events/core.c b/arch/x86/events/core.c
index 1394312b732a..2b2c9fd74ef9 100644
--- a/arch/x86/events/core.c
+++ b/arch/x86/events/core.c
@@ -2573,6 +2573,7 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
 			      struct device_attribute *attr,
 			      const char *buf, size_t count)
 {
+	static DEFINE_MUTEX(rdpmc_mutex);
 	unsigned long val;
 	ssize_t ret;
 
@@ -2586,6 +2587,8 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
 	if (x86_pmu.attr_rdpmc_broken)
 		return -ENOTSUPP;
 
+	guard(mutex)(&rdpmc_mutex);
+
 	if (val != x86_pmu.attr_rdpmc) {
 		/*
 		 * Changing into or out of never available or always available,
diff --git a/arch/x86/events/intel/cstate.c b/arch/x86/events/intel/cstate.c
index 551741e79e03..8175bff77efa 100644
--- a/arch/x86/events/intel/cstate.c
+++ b/arch/x86/events/intel/cstate.c
@@ -80,7 +80,7 @@
  *	MSR_PKG_C7_RESIDENCY:  Package C7 Residency Counter.
  *			       perf code: 0x03
  *			       Available model: NHM,WSM,SNB,IVB,HSW,BDW,SKL,CNL,
- *						KBL,CML,ICL,TGL,RKL,ADL,RPL,MTL
+ *						KBL,CML,ICL,TGL,RKL
  *			       Scope: Package (physical package)
  *	MSR_PKG_C8_RESIDENCY:  Package C8 Residency Counter.
  *			       perf code: 0x04
@@ -89,8 +89,7 @@
  *			       Scope: Package (physical package)
  *	MSR_PKG_C9_RESIDENCY:  Package C9 Residency Counter.
  *			       perf code: 0x05
- *			       Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL,
- *						ADL,RPL,MTL
+ *			       Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL
  *			       Scope: Package (physical package)
  *	MSR_PKG_C10_RESIDENCY: Package C10 Residency Counter.
  *			       perf code: 0x06
@@ -584,9 +583,7 @@ static const struct cstate_model adl_cstates __initconst = {
 	.pkg_events		= BIT(PERF_CSTATE_PKG_C2_RES) |
 				  BIT(PERF_CSTATE_PKG_C3_RES) |
 				  BIT(PERF_CSTATE_PKG_C6_RES) |
-				  BIT(PERF_CSTATE_PKG_C7_RES) |
 				  BIT(PERF_CSTATE_PKG_C8_RES) |
-				  BIT(PERF_CSTATE_PKG_C9_RES) |
 				  BIT(PERF_CSTATE_PKG_C10_RES),
 };
 
diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c
index 42a55794004a..cc5c6a326496 100644
--- a/arch/x86/events/intel/pt.c
+++ b/arch/x86/events/intel/pt.c
@@ -877,7 +877,7 @@ static void pt_update_head(struct pt *pt)
  */
 static void *pt_buffer_region(struct pt_buffer *buf)
 {
-	return phys_to_virt(TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
+	return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
 }
 
 /**
@@ -989,7 +989,7 @@ pt_topa_entry_for_page(struct pt_buffer *buf, unsigned int pg)
 	 * order allocations, there shouldn't be many of these.
 	 */
 	list_for_each_entry(topa, &buf->tables, list) {
-		if (topa->offset + topa->size > pg << PAGE_SHIFT)
+		if (topa->offset + topa->size > (unsigned long)pg << PAGE_SHIFT)
 			goto found;
 	}
 
diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h
index 96906a62aacd..f5e46c04c145 100644
--- a/arch/x86/events/intel/pt.h
+++ b/arch/x86/events/intel/pt.h
@@ -33,8 +33,8 @@ struct topa_entry {
 	u64	rsvd2	: 1;
 	u64	size	: 4;
 	u64	rsvd3	: 2;
-	u64	base	: 36;
-	u64	rsvd4	: 16;
+	u64	base	: 40;
+	u64	rsvd4	: 12;
 };
 
 /* TSC to Core Crystal Clock Ratio */
diff --git a/arch/x86/events/intel/uncore_snbep.c b/arch/x86/events/intel/uncore_snbep.c
index 9b5859812f4f..d081eb89ba12 100644
--- a/arch/x86/events/intel/uncore_snbep.c
+++ b/arch/x86/events/intel/uncore_snbep.c
@@ -459,6 +459,7 @@
 #define SPR_RAW_EVENT_MASK_EXT			0xffffff
 
 /* SPR CHA */
+#define SPR_CHA_EVENT_MASK_EXT			0xffffffff
 #define SPR_CHA_PMON_CTL_TID_EN			(1 << 16)
 #define SPR_CHA_PMON_EVENT_MASK			(SNBEP_PMON_RAW_EVENT_MASK | \
 						 SPR_CHA_PMON_CTL_TID_EN)
@@ -475,6 +476,7 @@ DEFINE_UNCORE_FORMAT_ATTR(umask_ext, umask, "config:8-15,32-43,45-55");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext2, umask, "config:8-15,32-57");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext3, umask, "config:8-15,32-39");
 DEFINE_UNCORE_FORMAT_ATTR(umask_ext4, umask, "config:8-15,32-55");
+DEFINE_UNCORE_FORMAT_ATTR(umask_ext5, umask, "config:8-15,32-63");
 DEFINE_UNCORE_FORMAT_ATTR(qor, qor, "config:16");
 DEFINE_UNCORE_FORMAT_ATTR(edge, edge, "config:18");
 DEFINE_UNCORE_FORMAT_ATTR(tid_en, tid_en, "config:19");
@@ -5648,7 +5650,7 @@ static struct intel_uncore_ops spr_uncore_chabox_ops = {
 
 static struct attribute *spr_uncore_cha_formats_attr[] = {
 	&format_attr_event.attr,
-	&format_attr_umask_ext4.attr,
+	&format_attr_umask_ext5.attr,
 	&format_attr_tid_en2.attr,
 	&format_attr_edge.attr,
 	&format_attr_inv.attr,
@@ -5684,7 +5686,7 @@ ATTRIBUTE_GROUPS(uncore_alias);
 static struct intel_uncore_type spr_uncore_chabox = {
 	.name			= "cha",
 	.event_mask		= SPR_CHA_PMON_EVENT_MASK,
-	.event_mask_ext		= SPR_RAW_EVENT_MASK_EXT,
+	.event_mask_ext		= SPR_CHA_EVENT_MASK_EXT,
 	.num_shared_regs	= 1,
 	.constraints		= skx_uncore_chabox_constraints,
 	.ops			= &spr_uncore_chabox_ops,
diff --git a/arch/x86/include/asm/kvm_host.h b/arch/x86/include/asm/kvm_host.h
index 887a171488ea..9de3db4a32f8 100644
--- a/arch/x86/include/asm/kvm_host.h
+++ b/arch/x86/include/asm/kvm_host.h
@@ -1651,7 +1651,7 @@ struct kvm_x86_nested_ops {
 	bool (*is_exception_vmexit)(struct kvm_vcpu *vcpu, u8 vector,
 				    u32 error_code);
 	int (*check_events)(struct kvm_vcpu *vcpu);
-	bool (*has_events)(struct kvm_vcpu *vcpu);
+	bool (*has_events)(struct kvm_vcpu *vcpu, bool for_injection);
 	void (*triple_fault)(struct kvm_vcpu *vcpu);
 	int (*get_state)(struct kvm_vcpu *vcpu,
 			 struct kvm_nested_state __user *user_kvm_nested_state,
diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c
index 5cd51f25f446..c77297fa2dad 100644
--- a/arch/x86/kernel/devicetree.c
+++ b/arch/x86/kernel/devicetree.c
@@ -87,7 +87,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev)
 
 	ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin);
 	if (ret)
-		return ret;
+		return pcibios_err_to_errno(ret);
 	if (!pin)
 		return 0;
 
diff --git a/arch/x86/kvm/vmx/nested.c b/arch/x86/kvm/vmx/nested.c
index 9d683b6067c7..2283f485a81f 100644
--- a/arch/x86/kvm/vmx/nested.c
+++ b/arch/x86/kvm/vmx/nested.c
@@ -3934,7 +3934,7 @@ static bool nested_vmx_preemption_timer_pending(struct kvm_vcpu *vcpu)
 	       to_vmx(vcpu)->nested.preemption_timer_expired;
 }
 
-static bool vmx_has_nested_events(struct kvm_vcpu *vcpu)
+static bool vmx_has_nested_events(struct kvm_vcpu *vcpu, bool for_injection)
 {
 	return nested_vmx_preemption_timer_pending(vcpu) ||
 	       to_vmx(vcpu)->nested.mtf_pending;
diff --git a/arch/x86/kvm/vmx/vmx.c b/arch/x86/kvm/vmx/vmx.c
index 10aff2c9a4e4..87abf4eebf8a 100644
--- a/arch/x86/kvm/vmx/vmx.c
+++ b/arch/x86/kvm/vmx/vmx.c
@@ -4980,14 +4980,19 @@ static int vmx_nmi_allowed(struct kvm_vcpu *vcpu, bool for_injection)
 	return !vmx_nmi_blocked(vcpu);
 }
 
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
+{
+	return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
+	       (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
+		(GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+}
+
 bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
 {
 	if (is_guest_mode(vcpu) && nested_exit_on_intr(vcpu))
 		return false;
 
-	return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
-	       (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
-		(GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+	return __vmx_interrupt_blocked(vcpu);
 }
 
 static int vmx_interrupt_allowed(struct kvm_vcpu *vcpu, bool for_injection)
diff --git a/arch/x86/kvm/vmx/vmx.h b/arch/x86/kvm/vmx/vmx.h
index e2b04f4c0fef..9e0bb98b116d 100644
--- a/arch/x86/kvm/vmx/vmx.h
+++ b/arch/x86/kvm/vmx/vmx.h
@@ -413,6 +413,7 @@ u64 construct_eptp(struct kvm_vcpu *vcpu, hpa_t root_hpa, int root_level);
 bool vmx_guest_inject_ac(struct kvm_vcpu *vcpu);
 void vmx_update_exception_bitmap(struct kvm_vcpu *vcpu);
 bool vmx_nmi_blocked(struct kvm_vcpu *vcpu);
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
 bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
 bool vmx_get_nmi_mask(struct kvm_vcpu *vcpu);
 void vmx_set_nmi_mask(struct kvm_vcpu *vcpu, bool masked);
diff --git a/arch/x86/kvm/x86.c b/arch/x86/kvm/x86.c
index 53d83b37db8c..658a88483d8b 100644
--- a/arch/x86/kvm/x86.c
+++ b/arch/x86/kvm/x86.c
@@ -10131,7 +10131,7 @@ static int kvm_check_and_inject_events(struct kvm_vcpu *vcpu,
 
 	if (is_guest_mode(vcpu) &&
 	    kvm_x86_ops.nested_ops->has_events &&
-	    kvm_x86_ops.nested_ops->has_events(vcpu))
+	    kvm_x86_ops.nested_ops->has_events(vcpu, true))
 		*req_immediate_exit = true;
 
 	/*
@@ -13013,7 +13013,7 @@ static inline bool kvm_vcpu_has_events(struct kvm_vcpu *vcpu)
 
 	if (is_guest_mode(vcpu) &&
 	    kvm_x86_ops.nested_ops->has_events &&
-	    kvm_x86_ops.nested_ops->has_events(vcpu))
+	    kvm_x86_ops.nested_ops->has_events(vcpu, false))
 		return true;
 
 	if (kvm_xen_has_pending_events(vcpu))
diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c
index 8edd62206604..722a33be08a1 100644
--- a/arch/x86/pci/intel_mid_pci.c
+++ b/arch/x86/pci/intel_mid_pci.c
@@ -233,9 +233,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev)
 		return 0;
 
 	ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
-	if (ret < 0) {
+	if (ret) {
 		dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret);
-		return ret;
+		return pcibios_err_to_errno(ret);
 	}
 
 	id = x86_match_cpu(intel_mid_cpu_ids);
diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c
index 5a4ecf0c2ac4..b4621cc95e1f 100644
--- a/arch/x86/pci/xen.c
+++ b/arch/x86/pci/xen.c
@@ -38,10 +38,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev)
 	u8 gsi;
 
 	rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
-	if (rc < 0) {
+	if (rc) {
 		dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n",
 			 rc);
-		return rc;
+		return pcibios_err_to_errno(rc);
 	}
 	/* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/
 	pirq = gsi;
diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c
index fdd49d70b437..c81cea208c2c 100644
--- a/arch/x86/platform/intel/iosf_mbi.c
+++ b/arch/x86/platform/intel/iosf_mbi.c
@@ -62,7 +62,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr)
 
 fail_read:
 	dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
-	return result;
+	return pcibios_err_to_errno(result);
 }
 
 static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
@@ -91,7 +91,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
 
 fail_write:
 	dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
-	return result;
+	return pcibios_err_to_errno(result);
 }
 
 int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr)
diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c
index 58db86f7b384..a02cc5433889 100644
--- a/arch/x86/xen/p2m.c
+++ b/arch/x86/xen/p2m.c
@@ -736,7 +736,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
 		 * immediate unmapping.
 		 */
 		map_ops[i].status = GNTST_general_error;
-		unmap[0].host_addr = map_ops[i].host_addr,
+		unmap[0].host_addr = map_ops[i].host_addr;
 		unmap[0].handle = map_ops[i].handle;
 		map_ops[i].handle = INVALID_GRANT_HANDLE;
 		if (map_ops[i].flags & GNTMAP_device_map)
@@ -746,7 +746,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
 
 		if (kmap_ops) {
 			kmap_ops[i].status = GNTST_general_error;
-			unmap[1].host_addr = kmap_ops[i].host_addr,
+			unmap[1].host_addr = kmap_ops[i].host_addr;
 			unmap[1].handle = kmap_ops[i].handle;
 			kmap_ops[i].handle = INVALID_GRANT_HANDLE;
 			if (kmap_ops[i].flags & GNTMAP_device_map)
diff --git a/block/bio-integrity.c b/block/bio-integrity.c
index 4533eb491661..adbc00449a9c 100644
--- a/block/bio-integrity.c
+++ b/block/bio-integrity.c
@@ -199,8 +199,7 @@ bool bio_integrity_prep(struct bio *bio)
 	unsigned long start, end;
 	unsigned int len, nr_pages;
 	unsigned int bytes, offset, i;
-	unsigned int intervals;
-	blk_status_t status;
+	gfp_t gfp = GFP_NOIO;
 
 	if (!bi)
 		return true;
@@ -223,13 +222,19 @@ bool bio_integrity_prep(struct bio *bio)
 		if (!bi->profile->generate_fn ||
 		    !(bi->flags & BLK_INTEGRITY_GENERATE))
 			return true;
+
+		/*
+		 * Zero the memory allocated to not leak uninitialized kernel
+		 * memory to disk.  For PI this only affects the app tag, but
+		 * for non-integrity metadata it affects the entire metadata
+		 * buffer.
+		 */
+		gfp |= __GFP_ZERO;
 	}
-	intervals = bio_integrity_intervals(bi, bio_sectors(bio));
 
 	/* Allocate kernel buffer for protection data */
-	len = intervals * bi->tuple_size;
-	buf = kmalloc(len, GFP_NOIO);
-	status = BLK_STS_RESOURCE;
+	len = bio_integrity_bytes(bi, bio_sectors(bio));
+	buf = kmalloc(len, gfp);
 	if (unlikely(buf == NULL)) {
 		printk(KERN_ERR "could not allocate integrity buffer\n");
 		goto err_end_io;
@@ -244,7 +249,6 @@ bool bio_integrity_prep(struct bio *bio)
 	if (IS_ERR(bip)) {
 		printk(KERN_ERR "could not allocate data integrity bioset\n");
 		kfree(buf);
-		status = BLK_STS_RESOURCE;
 		goto err_end_io;
 	}
 
@@ -272,7 +276,6 @@ bool bio_integrity_prep(struct bio *bio)
 
 		if (ret == 0) {
 			printk(KERN_ERR "could not attach integrity payload\n");
-			status = BLK_STS_RESOURCE;
 			goto err_end_io;
 		}
 
@@ -294,7 +297,7 @@ bool bio_integrity_prep(struct bio *bio)
 	return true;
 
 err_end_io:
-	bio->bi_status = status;
+	bio->bi_status = BLK_STS_RESOURCE;
 	bio_endio(bio);
 	return false;
 
diff --git a/drivers/android/binder.c b/drivers/android/binder.c
index 46111f8c12e6..e0ef648df265 100644
--- a/drivers/android/binder.c
+++ b/drivers/android/binder.c
@@ -569,9 +569,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work)
 static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread)
 {
 	return !thread->transaction_stack &&
-		binder_worklist_empty_ilocked(&thread->todo) &&
-		(thread->looper & (BINDER_LOOPER_STATE_ENTERED |
-				   BINDER_LOOPER_STATE_REGISTERED));
+		binder_worklist_empty_ilocked(&thread->todo);
 }
 
 static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc,
diff --git a/drivers/ata/libata-scsi.c b/drivers/ata/libata-scsi.c
index 65fde5717928..c8970453b4d9 100644
--- a/drivers/ata/libata-scsi.c
+++ b/drivers/ata/libata-scsi.c
@@ -900,11 +900,8 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc)
 				   &sense_key, &asc, &ascq, verbose);
 		ata_scsi_set_sense(qc->dev, cmd, sense_key, asc, ascq);
 	} else {
-		/*
-		 * ATA PASS-THROUGH INFORMATION AVAILABLE
-		 * Always in descriptor format sense.
-		 */
-		scsi_build_sense(cmd, 1, RECOVERED_ERROR, 0, 0x1D);
+		/* ATA PASS-THROUGH INFORMATION AVAILABLE */
+		ata_scsi_set_sense(qc->dev, cmd, RECOVERED_ERROR, 0, 0x1D);
 	}
 
 	if ((cmd->sense_buffer[0] & 0x7f) >= 0x72) {
diff --git a/drivers/auxdisplay/ht16k33.c b/drivers/auxdisplay/ht16k33.c
index 02425991c159..57b4efff344e 100644
--- a/drivers/auxdisplay/ht16k33.c
+++ b/drivers/auxdisplay/ht16k33.c
@@ -507,6 +507,7 @@ static int ht16k33_led_probe(struct device *dev, struct led_classdev *led,
 	led->max_brightness = MAX_BRIGHTNESS;
 
 	err = devm_led_classdev_register_ext(dev, led, &init_data);
+	fwnode_handle_put(init_data.fwnode);
 	if (err)
 		dev_err(dev, "Failed to register LED\n");
 
diff --git a/drivers/base/devres.c b/drivers/base/devres.c
index 4ab2b50ee38f..f9add2ecdc55 100644
--- a/drivers/base/devres.c
+++ b/drivers/base/devres.c
@@ -892,9 +892,12 @@ void *devm_krealloc(struct device *dev, void *ptr, size_t new_size, gfp_t gfp)
 	/*
 	 * Otherwise: allocate new, larger chunk. We need to allocate before
 	 * taking the lock as most probably the caller uses GFP_KERNEL.
+	 * alloc_dr() will call check_dr_size() to reserve extra memory
+	 * for struct devres automatically, so size @new_size user request
+	 * is delivered to it directly as devm_kmalloc() does.
 	 */
 	new_dr = alloc_dr(devm_kmalloc_release,
-			  total_new_size, gfp, dev_to_node(dev));
+			  new_size, gfp, dev_to_node(dev));
 	if (!new_dr)
 		return NULL;
 
@@ -1218,7 +1221,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu);
  */
 void devm_free_percpu(struct device *dev, void __percpu *pdata)
 {
-	WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match,
+	/*
+	 * Use devres_release() to prevent memory leakage as
+	 * devm_free_pages() does.
+	 */
+	WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match,
 			       (__force void *)pdata));
 }
 EXPORT_SYMBOL_GPL(devm_free_percpu);
diff --git a/drivers/block/rbd.c b/drivers/block/rbd.c
index f58ca9ce3503..4f8efc829a59 100644
--- a/drivers/block/rbd.c
+++ b/drivers/block/rbd.c
@@ -362,7 +362,7 @@ enum rbd_watch_state {
 enum rbd_lock_state {
 	RBD_LOCK_STATE_UNLOCKED,
 	RBD_LOCK_STATE_LOCKED,
-	RBD_LOCK_STATE_RELEASING,
+	RBD_LOCK_STATE_QUIESCING,
 };
 
 /* WatchNotify::ClientId */
@@ -422,7 +422,7 @@ struct rbd_device {
 	struct list_head	running_list;
 	struct completion	acquire_wait;
 	int			acquire_err;
-	struct completion	releasing_wait;
+	struct completion	quiescing_wait;
 
 	spinlock_t		object_map_lock;
 	u8			*object_map;
@@ -525,7 +525,7 @@ static bool __rbd_is_lock_owner(struct rbd_device *rbd_dev)
 	lockdep_assert_held(&rbd_dev->lock_rwsem);
 
 	return rbd_dev->lock_state == RBD_LOCK_STATE_LOCKED ||
-	       rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING;
+	       rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING;
 }
 
 static bool rbd_is_lock_owner(struct rbd_device *rbd_dev)
@@ -3458,13 +3458,14 @@ static void rbd_lock_del_request(struct rbd_img_request *img_req)
 	lockdep_assert_held(&rbd_dev->lock_rwsem);
 	spin_lock(&rbd_dev->lock_lists_lock);
 	if (!list_empty(&img_req->lock_item)) {
+		rbd_assert(!list_empty(&rbd_dev->running_list));
 		list_del_init(&img_req->lock_item);
-		need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING &&
+		need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING &&
 			       list_empty(&rbd_dev->running_list));
 	}
 	spin_unlock(&rbd_dev->lock_lists_lock);
 	if (need_wakeup)
-		complete(&rbd_dev->releasing_wait);
+		complete(&rbd_dev->quiescing_wait);
 }
 
 static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
@@ -3477,11 +3478,6 @@ static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
 	if (rbd_lock_add_request(img_req))
 		return 1;
 
-	if (rbd_dev->opts->exclusive) {
-		WARN_ON(1); /* lock got released? */
-		return -EROFS;
-	}
-
 	/*
 	 * Note the use of mod_delayed_work() in rbd_acquire_lock()
 	 * and cancel_delayed_work() in wake_lock_waiters().
@@ -4182,16 +4178,16 @@ static bool rbd_quiesce_lock(struct rbd_device *rbd_dev)
 	/*
 	 * Ensure that all in-flight IO is flushed.
 	 */
-	rbd_dev->lock_state = RBD_LOCK_STATE_RELEASING;
-	rbd_assert(!completion_done(&rbd_dev->releasing_wait));
+	rbd_dev->lock_state = RBD_LOCK_STATE_QUIESCING;
+	rbd_assert(!completion_done(&rbd_dev->quiescing_wait));
 	if (list_empty(&rbd_dev->running_list))
 		return true;
 
 	up_write(&rbd_dev->lock_rwsem);
-	wait_for_completion(&rbd_dev->releasing_wait);
+	wait_for_completion(&rbd_dev->quiescing_wait);
 
 	down_write(&rbd_dev->lock_rwsem);
-	if (rbd_dev->lock_state != RBD_LOCK_STATE_RELEASING)
+	if (rbd_dev->lock_state != RBD_LOCK_STATE_QUIESCING)
 		return false;
 
 	rbd_assert(list_empty(&rbd_dev->running_list));
@@ -4602,6 +4598,10 @@ static void rbd_reacquire_lock(struct rbd_device *rbd_dev)
 			rbd_warn(rbd_dev, "failed to update lock cookie: %d",
 				 ret);
 
+		if (rbd_dev->opts->exclusive)
+			rbd_warn(rbd_dev,
+			     "temporarily releasing lock on exclusive mapping");
+
 		/*
 		 * Lock cookie cannot be updated on older OSDs, so do
 		 * a manual release and queue an acquire.
@@ -5383,7 +5383,7 @@ static struct rbd_device *__rbd_dev_create(struct rbd_spec *spec)
 	INIT_LIST_HEAD(&rbd_dev->acquiring_list);
 	INIT_LIST_HEAD(&rbd_dev->running_list);
 	init_completion(&rbd_dev->acquire_wait);
-	init_completion(&rbd_dev->releasing_wait);
+	init_completion(&rbd_dev->quiescing_wait);
 
 	spin_lock_init(&rbd_dev->object_map_lock);
 
@@ -6589,11 +6589,6 @@ static int rbd_add_acquire_lock(struct rbd_device *rbd_dev)
 	if (ret)
 		return ret;
 
-	/*
-	 * The lock may have been released by now, unless automatic lock
-	 * transitions are disabled.
-	 */
-	rbd_assert(!rbd_dev->opts->exclusive || rbd_is_lock_owner(rbd_dev));
 	return 0;
 }
 
diff --git a/drivers/bluetooth/btusb.c b/drivers/bluetooth/btusb.c
index 6a772b955d69..2d8c405a27a6 100644
--- a/drivers/bluetooth/btusb.c
+++ b/drivers/bluetooth/btusb.c
@@ -545,6 +545,10 @@ static const struct usb_device_id blacklist_table[] = {
 						     BTUSB_WIDEBAND_SPEECH },
 	{ USB_DEVICE(0x13d3, 0x3571), .driver_info = BTUSB_REALTEK |
 						     BTUSB_WIDEBAND_SPEECH },
+	{ USB_DEVICE(0x13d3, 0x3591), .driver_info = BTUSB_REALTEK |
+						     BTUSB_WIDEBAND_SPEECH },
+	{ USB_DEVICE(0x0489, 0xe125), .driver_info = BTUSB_REALTEK |
+						     BTUSB_WIDEBAND_SPEECH },
 
 	/* Realtek Bluetooth devices */
 	{ USB_VENDOR_AND_INTERFACE_INFO(0x0bda, 0xe0, 0x01, 0x01),
diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c
index 0555e3838bce..5229da114377 100644
--- a/drivers/char/hw_random/amd-rng.c
+++ b/drivers/char/hw_random/amd-rng.c
@@ -142,8 +142,10 @@ static int __init amd_rng_mod_init(void)
 
 found:
 	err = pci_read_config_dword(pdev, 0x58, &pmbase);
-	if (err)
+	if (err) {
+		err = pcibios_err_to_errno(err);
 		goto put_dev;
+	}
 
 	pmbase &= 0x0000FF00;
 	if (pmbase == 0) {
diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c
index 8512ec76d526..4a6186f9f889 100644
--- a/drivers/char/tpm/eventlog/common.c
+++ b/drivers/char/tpm/eventlog/common.c
@@ -47,6 +47,8 @@ static int tpm_bios_measurements_open(struct inode *inode,
 	if (!err) {
 		seq = file->private_data;
 		seq->private = chip;
+	} else {
+		put_device(&chip->dev);
 	}
 
 	return err;
diff --git a/drivers/clk/clk-en7523.c b/drivers/clk/clk-en7523.c
index 29f0126cbd05..d22fae24a3da 100644
--- a/drivers/clk/clk-en7523.c
+++ b/drivers/clk/clk-en7523.c
@@ -41,6 +41,7 @@ struct en_clk_desc {
 	u8 div_shift;
 	u16 div_val0;
 	u8 div_step;
+	u8 div_offset;
 };
 
 struct en_clk_gate {
@@ -68,6 +69,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_EMI,
 		.name = "emi",
@@ -81,6 +83,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_BUS,
 		.name = "bus",
@@ -94,6 +97,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_SLIC,
 		.name = "slic",
@@ -134,13 +138,14 @@ static const struct en_clk_desc en7523_base_clks[] = {
 		.div_bits = 3,
 		.div_shift = 0,
 		.div_step = 1,
+		.div_offset = 1,
 	}, {
 		.id = EN7523_CLK_CRYPTO,
 		.name = "crypto",
 
 		.base_reg = REG_CRYPTO_CLKSRC,
 		.base_bits = 1,
-		.base_shift = 8,
+		.base_shift = 0,
 		.base_values = emi_base,
 		.n_base_values = ARRAY_SIZE(emi_base),
 	}
@@ -185,7 +190,7 @@ static u32 en7523_get_div(void __iomem *base, int i)
 	if (!val && desc->div_val0)
 		return desc->div_val0;
 
-	return (val + 1) * desc->div_step;
+	return (val + desc->div_offset) * desc->div_step;
 }
 
 static int en7523_pci_is_enabled(struct clk_hw *hw)
diff --git a/drivers/clk/davinci/da8xx-cfgchip.c b/drivers/clk/davinci/da8xx-cfgchip.c
index 4103d605e804..6faa4372ed65 100644
--- a/drivers/clk/davinci/da8xx-cfgchip.c
+++ b/drivers/clk/davinci/da8xx-cfgchip.c
@@ -505,7 +505,7 @@ da8xx_cfgchip_register_usb0_clk48(struct device *dev,
 	const char * const parent_names[] = { "usb_refclkin", "pll0_auxclk" };
 	struct clk *fck_clk;
 	struct da8xx_usb0_clk48 *usb0;
-	struct clk_init_data init;
+	struct clk_init_data init = {};
 	int ret;
 
 	fck_clk = devm_clk_get(dev, "fck");
@@ -579,7 +579,7 @@ da8xx_cfgchip_register_usb1_clk48(struct device *dev,
 {
 	const char * const parent_names[] = { "usb0_clk48", "usb_refclkin" };
 	struct da8xx_usb1_clk48 *usb1;
-	struct clk_init_data init;
+	struct clk_init_data init = {};
 	int ret;
 
 	usb1 = devm_kzalloc(dev, sizeof(*usb1), GFP_KERNEL);
diff --git a/drivers/clk/qcom/camcc-sc7280.c b/drivers/clk/qcom/camcc-sc7280.c
index ec163ea769f5..932096a972bc 100644
--- a/drivers/clk/qcom/camcc-sc7280.c
+++ b/drivers/clk/qcom/camcc-sc7280.c
@@ -2260,6 +2260,7 @@ static struct gdsc cam_cc_bps_gdsc = {
 		.name = "cam_cc_bps_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = HW_CTRL | RETAIN_FF_ENABLE,
 };
 
@@ -2269,6 +2270,7 @@ static struct gdsc cam_cc_ife_0_gdsc = {
 		.name = "cam_cc_ife_0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2278,6 +2280,7 @@ static struct gdsc cam_cc_ife_1_gdsc = {
 		.name = "cam_cc_ife_1_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2287,6 +2290,7 @@ static struct gdsc cam_cc_ife_2_gdsc = {
 		.name = "cam_cc_ife_2_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = RETAIN_FF_ENABLE,
 };
 
@@ -2296,6 +2300,7 @@ static struct gdsc cam_cc_ipe_0_gdsc = {
 		.name = "cam_cc_ipe_0_gdsc",
 	},
 	.pwrsts = PWRSTS_OFF_ON,
+	.parent = &cam_cc_titan_top_gdsc.pd,
 	.flags = HW_CTRL | RETAIN_FF_ENABLE,
 };
 
diff --git a/drivers/clk/qcom/clk-branch.h b/drivers/clk/qcom/clk-branch.h
index 17a58119165e..55b3a2c3afed 100644
--- a/drivers/clk/qcom/clk-branch.h
+++ b/drivers/clk/qcom/clk-branch.h
@@ -37,6 +37,32 @@ struct clk_branch {
 	struct clk_regmap clkr;
 };
 
+/* Branch clock common bits for HLOS-owned clocks */
+#define CBCR_FORCE_MEM_CORE_ON		BIT(14)
+#define CBCR_FORCE_MEM_PERIPH_ON	BIT(13)
+#define CBCR_FORCE_MEM_PERIPH_OFF	BIT(12)
+
+static inline void qcom_branch_set_force_mem_core(struct regmap *regmap,
+						  struct clk_branch clk, bool on)
+{
+	regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_CORE_ON,
+			   on ? CBCR_FORCE_MEM_CORE_ON : 0);
+}
+
+static inline void qcom_branch_set_force_periph_on(struct regmap *regmap,
+						   struct clk_branch clk, bool on)
+{
+	regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_ON,
+			   on ? CBCR_FORCE_MEM_PERIPH_ON : 0);
+}
+
+static inline void qcom_branch_set_force_periph_off(struct regmap *regmap,
+						    struct clk_branch clk, bool on)
+{
+	regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_OFF,
+			   on ? CBCR_FORCE_MEM_PERIPH_OFF : 0);
+}
+
 extern const struct clk_ops clk_branch_ops;
 extern const struct clk_ops clk_branch2_ops;
 extern const struct clk_ops clk_branch_simple_ops;
diff --git a/drivers/clk/qcom/clk-rcg2.c b/drivers/clk/qcom/clk-rcg2.c
index dc797bd137ca..e46bb60dcda4 100644
--- a/drivers/clk/qcom/clk-rcg2.c
+++ b/drivers/clk/qcom/clk-rcg2.c
@@ -1136,7 +1136,39 @@ clk_rcg2_shared_recalc_rate(struct clk_hw *hw, unsigned long parent_rate)
 	return clk_rcg2_recalc_rate(hw, parent_rate);
 }
 
+static int clk_rcg2_shared_init(struct clk_hw *hw)
+{
+	/*
+	 * This does a few things:
+	 *
+	 *  1. Sets rcg->parked_cfg to reflect the value at probe so that the
+	 *     proper parent is reported from clk_rcg2_shared_get_parent().
+	 *
+	 *  2. Clears the force enable bit of the RCG because we rely on child
+	 *     clks (branches) to turn the RCG on/off with a hardware feedback
+	 *     mechanism and only set the force enable bit in the RCG when we
+	 *     want to make sure the clk stays on for parent switches or
+	 *     parking.
+	 *
+	 *  3. Parks shared RCGs on the safe source at registration because we
+	 *     can't be certain that the parent clk will stay on during boot,
+	 *     especially if the parent is shared. If this RCG is enabled at
+	 *     boot, and the parent is turned off, the RCG will get stuck on. A
+	 *     GDSC can wedge if is turned on and the RCG is stuck on because
+	 *     the GDSC's controller will hang waiting for the clk status to
+	 *     toggle on when it never does.
+	 *
+	 * The safest option here is to "park" the RCG at init so that the clk
+	 * can never get stuck on or off. This ensures the GDSC can't get
+	 * wedged.
+	 */
+	clk_rcg2_shared_disable(hw);
+
+	return 0;
+}
+
 const struct clk_ops clk_rcg2_shared_ops = {
+	.init = clk_rcg2_shared_init,
 	.enable = clk_rcg2_shared_enable,
 	.disable = clk_rcg2_shared_disable,
 	.get_parent = clk_rcg2_shared_get_parent,
diff --git a/drivers/clk/qcom/gcc-sc7280.c b/drivers/clk/qcom/gcc-sc7280.c
index 46d41ebce2b0..2067e39840cb 100644
--- a/drivers/clk/qcom/gcc-sc7280.c
+++ b/drivers/clk/qcom/gcc-sc7280.c
@@ -3469,6 +3469,9 @@ static int gcc_sc7280_probe(struct platform_device *pdev)
 	regmap_update_bits(regmap, 0x71004, BIT(0), BIT(0));
 	regmap_update_bits(regmap, 0x7100C, BIT(13), BIT(13));
 
+	/* FORCE_MEM_CORE_ON for ufs phy ice core clocks */
+	qcom_branch_set_force_mem_core(regmap, gcc_ufs_phy_ice_core_clk, true);
+
 	ret = qcom_cc_register_rcg_dfs(regmap, gcc_dfs_clocks,
 			ARRAY_SIZE(gcc_dfs_clocks));
 	if (ret)
diff --git a/drivers/clk/qcom/gpucc-sm8350.c b/drivers/clk/qcom/gpucc-sm8350.c
index 5367ce654ac9..cc9fcbc88465 100644
--- a/drivers/clk/qcom/gpucc-sm8350.c
+++ b/drivers/clk/qcom/gpucc-sm8350.c
@@ -2,6 +2,7 @@
 /*
  * Copyright (c) 2019-2020, The Linux Foundation. All rights reserved.
  * Copyright (c) 2022, Linaro Limited
+ * Copyright (c) 2024, Qualcomm Innovation Center, Inc. All rights reserved.
  */
 
 #include <linux/clk.h>
@@ -147,7 +148,7 @@ static struct clk_rcg2 gpu_cc_gmu_clk_src = {
 		.parent_data = gpu_cc_parent_data_0,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_0),
 		.flags = CLK_SET_RATE_PARENT,
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
@@ -169,7 +170,7 @@ static struct clk_rcg2 gpu_cc_hub_clk_src = {
 		.parent_data = gpu_cc_parent_data_1,
 		.num_parents = ARRAY_SIZE(gpu_cc_parent_data_1),
 		.flags = CLK_SET_RATE_PARENT,
-		.ops = &clk_rcg2_ops,
+		.ops = &clk_rcg2_shared_ops,
 	},
 };
 
diff --git a/drivers/cpufreq/ti-cpufreq.c b/drivers/cpufreq/ti-cpufreq.c
index 61ef653bcf56..15e2ef830350 100644
--- a/drivers/cpufreq/ti-cpufreq.c
+++ b/drivers/cpufreq/ti-cpufreq.c
@@ -381,7 +381,7 @@ static int ti_cpufreq_probe(struct platform_device *pdev)
 
 	ret = dev_pm_opp_set_config(opp_data->cpu_dev, &config);
 	if (ret < 0) {
-		dev_err(opp_data->cpu_dev, "Failed to set OPP config\n");
+		dev_err_probe(opp_data->cpu_dev, ret, "Failed to set OPP config\n");
 		goto fail_put_node;
 	}
 
diff --git a/drivers/crypto/qat/qat_common/adf_cfg.c b/drivers/crypto/qat/qat_common/adf_cfg.c
index 1931e5b37f2b..368d14d81503 100644
--- a/drivers/crypto/qat/qat_common/adf_cfg.c
+++ b/drivers/crypto/qat/qat_common/adf_cfg.c
@@ -276,17 +276,19 @@ int adf_cfg_add_key_value_param(struct adf_accel_dev *accel_dev,
 	 * 3. if the key exists with the same value, then return without doing
 	 *    anything (the newly created key_val is freed).
 	 */
+	down_write(&cfg->lock);
 	if (!adf_cfg_key_val_get(accel_dev, section_name, key, temp_val)) {
 		if (strncmp(temp_val, key_val->val, sizeof(temp_val))) {
 			adf_cfg_keyval_remove(key, section);
 		} else {
 			kfree(key_val);
-			return 0;
+			goto out;
 		}
 	}
 
-	down_write(&cfg->lock);
 	adf_cfg_keyval_add(key_val, section);
+
+out:
 	up_write(&cfg->lock);
 	return 0;
 }
diff --git a/drivers/dma/ti/k3-udma.c b/drivers/dma/ti/k3-udma.c
index 82e7acfda6ed..e323e1a5f20f 100644
--- a/drivers/dma/ti/k3-udma.c
+++ b/drivers/dma/ti/k3-udma.c
@@ -4423,7 +4423,9 @@ static int udma_get_mmrs(struct platform_device *pdev, struct udma_dev *ud)
 		ud->rchan_cnt = UDMA_CAP2_RCHAN_CNT(cap2);
 		break;
 	case DMA_TYPE_BCDMA:
-		ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2);
+		ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2) +
+				BCDMA_CAP3_HBCHAN_CNT(cap3) +
+				BCDMA_CAP3_UBCHAN_CNT(cap3);
 		ud->tchan_cnt = BCDMA_CAP2_TCHAN_CNT(cap2);
 		ud->rchan_cnt = BCDMA_CAP2_RCHAN_CNT(cap2);
 		ud->rflow_cnt = ud->rchan_cnt;
diff --git a/drivers/edac/Makefile b/drivers/edac/Makefile
index 2d1641a27a28..a98e1981df15 100644
--- a/drivers/edac/Makefile
+++ b/drivers/edac/Makefile
@@ -54,11 +54,13 @@ obj-$(CONFIG_EDAC_MPC85XX)		+= mpc85xx_edac_mod.o
 layerscape_edac_mod-y			:= fsl_ddr_edac.o layerscape_edac.o
 obj-$(CONFIG_EDAC_LAYERSCAPE)		+= layerscape_edac_mod.o
 
-skx_edac-y				:= skx_common.o skx_base.o
-obj-$(CONFIG_EDAC_SKX)			+= skx_edac.o
+skx_edac_common-y			:= skx_common.o
 
-i10nm_edac-y				:= skx_common.o i10nm_base.o
-obj-$(CONFIG_EDAC_I10NM)		+= i10nm_edac.o
+skx_edac-y				:= skx_base.o
+obj-$(CONFIG_EDAC_SKX)			+= skx_edac.o skx_edac_common.o
+
+i10nm_edac-y				:= i10nm_base.o
+obj-$(CONFIG_EDAC_I10NM)		+= i10nm_edac.o skx_edac_common.o
 
 obj-$(CONFIG_EDAC_CELL)			+= cell_edac.o
 obj-$(CONFIG_EDAC_PPC4XX)		+= ppc4xx_edac.o
diff --git a/drivers/edac/skx_common.c b/drivers/edac/skx_common.c
index f0f8e98f6efb..e218909f9f9e 100644
--- a/drivers/edac/skx_common.c
+++ b/drivers/edac/skx_common.c
@@ -48,7 +48,7 @@ static u64 skx_tolm, skx_tohm;
 static LIST_HEAD(dev_edac_list);
 static bool skx_mem_cfg_2lm;
 
-int __init skx_adxl_get(void)
+int skx_adxl_get(void)
 {
 	const char * const *names;
 	int i, j;
@@ -110,12 +110,14 @@ int __init skx_adxl_get(void)
 
 	return -ENODEV;
 }
+EXPORT_SYMBOL_GPL(skx_adxl_get);
 
-void __exit skx_adxl_put(void)
+void skx_adxl_put(void)
 {
 	kfree(adxl_values);
 	kfree(adxl_msg);
 }
+EXPORT_SYMBOL_GPL(skx_adxl_put);
 
 static bool skx_adxl_decode(struct decoded_addr *res, bool error_in_1st_level_mem)
 {
@@ -187,12 +189,14 @@ void skx_set_mem_cfg(bool mem_cfg_2lm)
 {
 	skx_mem_cfg_2lm = mem_cfg_2lm;
 }
+EXPORT_SYMBOL_GPL(skx_set_mem_cfg);
 
 void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log)
 {
 	driver_decode = decode;
 	skx_show_retry_rd_err_log = show_retry_log;
 }
+EXPORT_SYMBOL_GPL(skx_set_decode);
 
 int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
 {
@@ -206,6 +210,7 @@ int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
 	*id = GET_BITFIELD(reg, 12, 14);
 	return 0;
 }
+EXPORT_SYMBOL_GPL(skx_get_src_id);
 
 int skx_get_node_id(struct skx_dev *d, u8 *id)
 {
@@ -219,6 +224,7 @@ int skx_get_node_id(struct skx_dev *d, u8 *id)
 	*id = GET_BITFIELD(reg, 0, 2);
 	return 0;
 }
+EXPORT_SYMBOL_GPL(skx_get_node_id);
 
 static int get_width(u32 mtr)
 {
@@ -284,6 +290,7 @@ int skx_get_all_bus_mappings(struct res_config *cfg, struct list_head **list)
 		*list = &dev_edac_list;
 	return ndev;
 }
+EXPORT_SYMBOL_GPL(skx_get_all_bus_mappings);
 
 int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
 {
@@ -323,6 +330,7 @@ int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
 	pci_dev_put(pdev);
 	return -ENODEV;
 }
+EXPORT_SYMBOL_GPL(skx_get_hi_lo);
 
 static int skx_get_dimm_attr(u32 reg, int lobit, int hibit, int add,
 			     int minval, int maxval, const char *name)
@@ -394,6 +402,7 @@ int skx_get_dimm_info(u32 mtr, u32 mcmtr, u32 amap, struct dimm_info *dimm,
 
 	return 1;
 }
+EXPORT_SYMBOL_GPL(skx_get_dimm_info);
 
 int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
 			int chan, int dimmno, const char *mod_str)
@@ -442,6 +451,7 @@ int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
 
 	return (size == 0 || size == ~0ull) ? 0 : 1;
 }
+EXPORT_SYMBOL_GPL(skx_get_nvdimm_info);
 
 int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
 		     const char *ctl_name, const char *mod_str,
@@ -512,6 +522,7 @@ int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
 	imc->mci = NULL;
 	return rc;
 }
+EXPORT_SYMBOL_GPL(skx_register_mci);
 
 static void skx_unregister_mci(struct skx_imc *imc)
 {
@@ -694,6 +705,7 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val,
 	mce->kflags |= MCE_HANDLED_EDAC;
 	return NOTIFY_DONE;
 }
+EXPORT_SYMBOL_GPL(skx_mce_check_error);
 
 void skx_remove(void)
 {
@@ -731,3 +743,8 @@ void skx_remove(void)
 		kfree(d);
 	}
 }
+EXPORT_SYMBOL_GPL(skx_remove);
+
+MODULE_LICENSE("GPL v2");
+MODULE_AUTHOR("Tony Luck");
+MODULE_DESCRIPTION("MC Driver for Intel server processors");
diff --git a/drivers/edac/skx_common.h b/drivers/edac/skx_common.h
index 0cbadd3d2cd3..c0c174c101d2 100644
--- a/drivers/edac/skx_common.h
+++ b/drivers/edac/skx_common.h
@@ -178,8 +178,8 @@ typedef int (*get_dimm_config_f)(struct mem_ctl_info *mci,
 typedef bool (*skx_decode_f)(struct decoded_addr *res);
 typedef void (*skx_show_retry_log_f)(struct decoded_addr *res, char *msg, int len, bool scrub_err);
 
-int __init skx_adxl_get(void);
-void __exit skx_adxl_put(void);
+int skx_adxl_get(void);
+void skx_adxl_put(void);
 void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log);
 void skx_set_mem_cfg(bool mem_cfg_2lm);
 
diff --git a/drivers/firmware/efi/libstub/x86-stub.c b/drivers/firmware/efi/libstub/x86-stub.c
index f7eb389aeec0..b8246fc7f412 100644
--- a/drivers/firmware/efi/libstub/x86-stub.c
+++ b/drivers/firmware/efi/libstub/x86-stub.c
@@ -435,11 +435,12 @@ void __noreturn efi_stub_entry(efi_handle_t handle,
 efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 				   efi_system_table_t *sys_table_arg)
 {
-	static struct boot_params boot_params __page_aligned_bss;
-	struct setup_header *hdr = &boot_params.hdr;
 	efi_guid_t proto = LOADED_IMAGE_PROTOCOL_GUID;
+	struct boot_params *boot_params;
+	struct setup_header *hdr;
 	int options_size = 0;
 	efi_status_t status;
+	unsigned long alloc;
 	char *cmdline_ptr;
 
 	if (efi_is_native())
@@ -457,6 +458,13 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 		efi_exit(handle, status);
 	}
 
+	status = efi_allocate_pages(PARAM_SIZE, &alloc, ULONG_MAX);
+	if (status != EFI_SUCCESS)
+		efi_exit(handle, status);
+
+	boot_params = memset((void *)alloc, 0x0, PARAM_SIZE);
+	hdr	    = &boot_params->hdr;
+
 	/* Assign the setup_header fields that the kernel actually cares about */
 	hdr->root_flags	= 1;
 	hdr->vid_mode	= 0xffff;
@@ -466,17 +474,16 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
 
 	/* Convert unicode cmdline to ascii */
 	cmdline_ptr = efi_convert_cmdline(image, &options_size);
-	if (!cmdline_ptr)
-		goto fail;
+	if (!cmdline_ptr) {
+		efi_free(PARAM_SIZE, alloc);
+		efi_exit(handle, EFI_OUT_OF_RESOURCES);
+	}
 
 	efi_set_u64_split((unsigned long)cmdline_ptr, &hdr->cmd_line_ptr,
-			  &boot_params.ext_cmd_line_ptr);
+			  &boot_params->ext_cmd_line_ptr);
 
-	efi_stub_entry(handle, sys_table_arg, &boot_params);
+	efi_stub_entry(handle, sys_table_arg, boot_params);
 	/* not reached */
-
-fail:
-	efi_exit(handle, status);
 }
 
 static void add_e820ext(struct boot_params *params,
diff --git a/drivers/firmware/turris-mox-rwtm.c b/drivers/firmware/turris-mox-rwtm.c
index c2d34dc8ba46..c3d49fcc5330 100644
--- a/drivers/firmware/turris-mox-rwtm.c
+++ b/drivers/firmware/turris-mox-rwtm.c
@@ -2,7 +2,7 @@
 /*
  * Turris Mox rWTM firmware driver
  *
- * Copyright (C) 2019 Marek Behún <kabel@kernel.org>
+ * Copyright (C) 2019, 2024 Marek Behún <kabel@kernel.org>
  */
 
 #include <linux/armada-37xx-rwtm-mailbox.h>
@@ -174,6 +174,9 @@ static void mox_rwtm_rx_callback(struct mbox_client *cl, void *data)
 	struct mox_rwtm *rwtm = dev_get_drvdata(cl->dev);
 	struct armada_37xx_rwtm_rx_msg *msg = data;
 
+	if (completion_done(&rwtm->cmd_done))
+		return;
+
 	rwtm->reply = *msg;
 	complete(&rwtm->cmd_done);
 }
@@ -199,9 +202,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	ret = mox_get_status(MBOX_CMD_BOARD_INFO, reply->retval);
 	if (ret == -ENODATA) {
@@ -235,9 +237,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	ret = mox_get_status(MBOX_CMD_ECDSA_PUB_KEY, reply->retval);
 	if (ret == -ENODATA) {
@@ -274,9 +275,8 @@ static int check_get_random_support(struct mox_rwtm *rwtm)
 	if (ret < 0)
 		return ret;
 
-	ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
-	if (ret < 0)
-		return ret;
+	if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+		return -ETIMEDOUT;
 
 	return mox_get_status(MBOX_CMD_GET_RANDOM, rwtm->reply.retval);
 }
@@ -499,6 +499,7 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
 	platform_set_drvdata(pdev, rwtm);
 
 	mutex_init(&rwtm->busy);
+	init_completion(&rwtm->cmd_done);
 
 	rwtm->mbox_client.dev = dev;
 	rwtm->mbox_client.rx_callback = mox_rwtm_rx_callback;
@@ -512,8 +513,6 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
 		goto remove_files;
 	}
 
-	init_completion(&rwtm->cmd_done);
-
 	ret = mox_get_board_info(rwtm);
 	if (ret < 0)
 		dev_warn(dev, "Cannot read board information: %i\n", ret);
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
index 157441dd0704..d4faa489bd5f 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
@@ -5815,7 +5815,7 @@ int amdgpu_device_baco_exit(struct drm_device *dev)
 	    adev->nbio.funcs->enable_doorbell_interrupt)
 		adev->nbio.funcs->enable_doorbell_interrupt(adev, true);
 
-	if (amdgpu_passthrough(adev) &&
+	if (amdgpu_passthrough(adev) && adev->nbio.funcs &&
 	    adev->nbio.funcs->clear_doorbell_interrupt)
 		adev->nbio.funcs->clear_doorbell_interrupt(adev);
 
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
index ea0fb079f942..fd98d2508a22 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
@@ -583,7 +583,6 @@ void amdgpu_gmc_noretry_set(struct amdgpu_device *adev)
 	struct amdgpu_gmc *gmc = &adev->gmc;
 	uint32_t gc_ver = adev->ip_versions[GC_HWIP][0];
 	bool noretry_default = (gc_ver == IP_VERSION(9, 0, 1) ||
-				gc_ver == IP_VERSION(9, 3, 0) ||
 				gc_ver == IP_VERSION(9, 4, 0) ||
 				gc_ver == IP_VERSION(9, 4, 1) ||
 				gc_ver == IP_VERSION(9, 4, 2) ||
diff --git a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
index c7af36370b0d..38f57455bc74 100644
--- a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
+++ b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
@@ -241,6 +241,14 @@ static void sdma_v5_2_ring_set_wptr(struct amdgpu_ring *ring)
 		DRM_DEBUG("calling WDOORBELL64(0x%08x, 0x%016llx)\n",
 				ring->doorbell_index, ring->wptr << 2);
 		WDOORBELL64(ring->doorbell_index, ring->wptr << 2);
+		/* SDMA seems to miss doorbells sometimes when powergating kicks in.
+		 * Updating the wptr directly will wake it. This is only safe because
+		 * we disallow gfxoff in begin_use() and then allow it again in end_use().
+		 */
+		WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR),
+		       lower_32_bits(ring->wptr << 2));
+		WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR_HI),
+		       upper_32_bits(ring->wptr << 2));
 	} else {
 		DRM_DEBUG("Not using doorbell -- "
 				"mmSDMA%i_GFX_RB_WPTR == 0x%08x "
@@ -1705,6 +1713,10 @@ static void sdma_v5_2_ring_begin_use(struct amdgpu_ring *ring)
 	 * but it shouldn't hurt for other parts since
 	 * this GFXOFF will be disallowed anyway when SDMA is
 	 * active, this just makes it explicit.
+	 * sdma_v5_2_ring_set_wptr() takes advantage of this
+	 * to update the wptr because sometimes SDMA seems to miss
+	 * doorbells when entering PG.  If you remove this, update
+	 * sdma_v5_2_ring_set_wptr() as well!
 	 */
 	amdgpu_gfx_off_ctrl(adev, false);
 }
diff --git a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
index a80e45300783..f4f3ca7aad60 100644
--- a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
+++ b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
@@ -154,7 +154,8 @@ const struct dc_plane_status *dc_plane_get_status(
 		if (pipe_ctx->plane_state != plane_state)
 			continue;
 
-		pipe_ctx->plane_state->status.is_flip_pending = false;
+		if (pipe_ctx->plane_state)
+			pipe_ctx->plane_state->status.is_flip_pending = false;
 
 		break;
 	}
diff --git a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
index f3257cf4b06f..3aab1caed2ac 100644
--- a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
+++ b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
@@ -79,8 +79,8 @@ MODULE_FIRMWARE("amdgpu/smu_13_0_10.bin");
 #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD_MASK 0x00000070L
 #define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD__SHIFT 0x4
 #define smnPCIE_LC_SPEED_CNTL			0x11140290
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xC000
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0xE
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xE0
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0x5
 
 static const int link_width[] = {0, 1, 2, 4, 8, 12, 16};
 static const int link_speed[] = {25, 50, 80, 160};
diff --git a/drivers/gpu/drm/display/drm_dp_mst_topology.c b/drivers/gpu/drm/display/drm_dp_mst_topology.c
index 72b2b171e533..805f8455b8d6 100644
--- a/drivers/gpu/drm/display/drm_dp_mst_topology.c
+++ b/drivers/gpu/drm/display/drm_dp_mst_topology.c
@@ -2923,7 +2923,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
 
 	/* FIXME: Actually do some real error handling here */
 	ret = drm_dp_mst_wait_tx_reply(mstb, txmsg);
-	if (ret <= 0) {
+	if (ret < 0) {
 		drm_err(mgr->dev, "Sending link address failed with %d\n", ret);
 		goto out;
 	}
@@ -2975,7 +2975,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
 	mutex_unlock(&mgr->lock);
 
 out:
-	if (ret <= 0)
+	if (ret < 0)
 		mstb->link_address_sent = false;
 	kfree(txmsg);
 	return ret < 0 ? ret : changed;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
index 5cf13e52f7c9..23d5058eca8d 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
@@ -355,9 +355,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj)
 
 static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op)
 {
-	if (op & ETNA_PREP_READ)
+	op &= ETNA_PREP_READ | ETNA_PREP_WRITE;
+
+	if (op == ETNA_PREP_READ)
 		return DMA_FROM_DEVICE;
-	else if (op & ETNA_PREP_WRITE)
+	else if (op == ETNA_PREP_WRITE)
 		return DMA_TO_DEVICE;
 	else
 		return DMA_BIDIRECTIONAL;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_sched.c b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
index 72e2553fbc98..5d506767b8f2 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_sched.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
@@ -38,9 +38,6 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 	u32 dma_addr;
 	int change;
 
-	/* block scheduler */
-	drm_sched_stop(&gpu->sched, sched_job);
-
 	/*
 	 * If the GPU managed to complete this jobs fence, the timout is
 	 * spurious. Bail out.
@@ -62,6 +59,9 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 		goto out_no_timeout;
 	}
 
+	/* block scheduler */
+	drm_sched_stop(&gpu->sched, sched_job);
+
 	if(sched_job)
 		drm_sched_increase_karma(sched_job);
 
@@ -75,8 +75,7 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
 	return DRM_GPU_SCHED_STAT_NOMINAL;
 
 out_no_timeout:
-	/* restart scheduler after GPU is usable again */
-	drm_sched_start(&gpu->sched, true);
+	list_add(&sched_job->list, &sched_job->sched->pending_list);
 	return DRM_GPU_SCHED_STAT_NOMINAL;
 }
 
diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
index be6efcaaa3b3..c9ad16960e82 100644
--- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
@@ -309,6 +309,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector)
 	if (mode_dev->panel_fixed_mode != NULL) {
 		struct drm_display_mode *mode =
 		    drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+		if (!mode)
+			return 0;
+
 		drm_mode_probed_add(connector, mode);
 		return 1;
 	}
diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c
index 7ee6c8ce103b..9842de0dad3a 100644
--- a/drivers/gpu/drm/gma500/psb_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c
@@ -502,6 +502,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector)
 	if (mode_dev->panel_fixed_mode != NULL) {
 		struct drm_display_mode *mode =
 		    drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+		if (!mode)
+			return 0;
+
 		drm_mode_probed_add(connector, mode);
 		return 1;
 	}
diff --git a/drivers/gpu/drm/i915/display/intel_dp.c b/drivers/gpu/drm/i915/display/intel_dp.c
index a27563bfd909..3f65d890b8a9 100644
--- a/drivers/gpu/drm/i915/display/intel_dp.c
+++ b/drivers/gpu/drm/i915/display/intel_dp.c
@@ -4089,6 +4089,8 @@ int intel_dp_retrain_link(struct intel_encoder *encoder,
 		    !intel_dp_mst_is_master_trans(crtc_state))
 			continue;
 
+		intel_dp->link_trained = false;
+
 		intel_dp_check_frl_training(intel_dp);
 		intel_dp_pcon_dsc_configure(intel_dp, crtc_state);
 		intel_dp_start_link_train(intel_dp, crtc_state);
diff --git a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
index eae138b9f2df..321dbecba0f3 100644
--- a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
+++ b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
@@ -3313,11 +3313,7 @@ static void remove_from_engine(struct i915_request *rq)
 
 static bool can_preempt(struct intel_engine_cs *engine)
 {
-	if (GRAPHICS_VER(engine->i915) > 8)
-		return true;
-
-	/* GPGPU on bdw requires extra w/a; not implemented */
-	return engine->class != RENDER_CLASS;
+	return GRAPHICS_VER(engine->i915) > 8;
 }
 
 static void kick_execlists(const struct i915_request *rq, int prio)
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_drv.c b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
index 25639fbfd374..905275df0980 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_drv.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
@@ -598,6 +598,8 @@ static const struct of_device_id mtk_ddp_comp_dt_ids[] = {
 	  .data = (void *)MTK_DISP_OVL },
 	{ .compatible = "mediatek,mt8192-disp-ovl",
 	  .data = (void *)MTK_DISP_OVL },
+	{ .compatible = "mediatek,mt8195-disp-ovl",
+	  .data = (void *)MTK_DISP_OVL },
 	{ .compatible = "mediatek,mt8183-disp-ovl-2l",
 	  .data = (void *)MTK_DISP_OVL_2L },
 	{ .compatible = "mediatek,mt8192-disp-ovl-2l",
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_plane.c b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
index c4a0203d17e3..30d361671aa9 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_plane.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
@@ -157,6 +157,8 @@ static void mtk_plane_atomic_async_update(struct drm_plane *plane,
 	plane->state->src_y = new_state->src_y;
 	plane->state->src_h = new_state->src_h;
 	plane->state->src_w = new_state->src_w;
+	plane->state->dst.x1 = new_state->dst.x1;
+	plane->state->dst.y1 = new_state->dst.y1;
 
 	mtk_plane_update_new_state(new_state, new_plane_state);
 	swap(plane->state->fb, new_state->fb);
diff --git a/drivers/gpu/drm/meson/meson_drv.c b/drivers/gpu/drm/meson/meson_drv.c
index fbac39aa38cc..f0df41cf39a3 100644
--- a/drivers/gpu/drm/meson/meson_drv.c
+++ b/drivers/gpu/drm/meson/meson_drv.c
@@ -249,29 +249,20 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	if (ret)
 		goto free_drm;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_0);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_osd1;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_1);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_vd1_0;
 	ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_2);
-	if (ret) {
-		meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
-		meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
-		goto free_drm;
-	}
+	if (ret)
+		goto free_canvas_vd1_1;
 
 	priv->vsync_irq = platform_get_irq(pdev, 0);
 
 	ret = drm_vblank_init(drm, 1);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 
 	/* Assign limits per soc revision/package */
 	for (i = 0 ; i < ARRAY_SIZE(meson_drm_soc_attrs) ; ++i) {
@@ -287,11 +278,11 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	 */
 	ret = drm_aperture_remove_framebuffers(&meson_driver);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 
 	ret = drmm_mode_config_init(drm);
 	if (ret)
-		goto free_drm;
+		goto free_canvas_vd1_2;
 	drm->mode_config.max_width = 3840;
 	drm->mode_config.max_height = 2160;
 	drm->mode_config.funcs = &meson_mode_config_funcs;
@@ -306,7 +297,7 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 	if (priv->afbcd.ops) {
 		ret = priv->afbcd.ops->init(priv);
 		if (ret)
-			goto free_drm;
+			goto free_canvas_vd1_2;
 	}
 
 	/* Encoder Initialization */
@@ -364,6 +355,14 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
 exit_afbcd:
 	if (priv->afbcd.ops)
 		priv->afbcd.ops->exit(priv);
+free_canvas_vd1_2:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_2);
+free_canvas_vd1_1:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
+free_canvas_vd1_0:
+	meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
+free_canvas_osd1:
+	meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
 free_drm:
 	drm_dev_put(drm);
 
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
index 3632f0768aa9..1bf41a82cd0f 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
@@ -1653,8 +1653,7 @@ void dpu_encoder_trigger_kickoff_pending(struct drm_encoder *drm_enc)
 		phys = dpu_enc->phys_encs[i];
 
 		ctl = phys->hw_ctl;
-		if (ctl->ops.clear_pending_flush)
-			ctl->ops.clear_pending_flush(ctl);
+		ctl->ops.clear_pending_flush(ctl);
 
 		/* update only for command mode primary ctl */
 		if ((phys == dpu_enc->cur_master) &&
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
index 42c7e378d504..05a09d86e183 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
@@ -548,8 +548,7 @@ static void dpu_encoder_phys_wb_disable(struct dpu_encoder_phys *phys_enc)
 	}
 
 	/* reset h/w before final flush */
-	if (phys_enc->hw_ctl->ops.clear_pending_flush)
-		phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
+	phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
 
 	/*
 	 * New CTL reset sequence from 5.0 MDP onwards.
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
index 96c012ec8467..ec5265771cdf 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
@@ -81,7 +81,8 @@ struct dpu_hw_ctl_ops {
 
 	/**
 	 * Clear the value of the cached pending_flush_mask
-	 * No effect on hardware
+	 * No effect on hardware.
+	 * Required to be implemented.
 	 * @ctx       : ctl path ctx pointer
 	 */
 	void (*clear_pending_flush)(struct dpu_hw_ctl *ctx);
diff --git a/drivers/gpu/drm/msm/dsi/dsi_host.c b/drivers/gpu/drm/msm/dsi/dsi_host.c
index cd9ca3690161..034ad810fd65 100644
--- a/drivers/gpu/drm/msm/dsi/dsi_host.c
+++ b/drivers/gpu/drm/msm/dsi/dsi_host.c
@@ -848,6 +848,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 	u32 slice_per_intf, total_bytes_per_intf;
 	u32 pkt_per_line;
 	u32 eol_byte_num;
+	u32 bytes_per_pkt;
 
 	/* first calculate dsc parameters and then program
 	 * compress mode registers
@@ -855,6 +856,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 	slice_per_intf = DIV_ROUND_UP(hdisplay, dsc->slice_width);
 
 	total_bytes_per_intf = dsc->slice_chunk_size * slice_per_intf;
+	bytes_per_pkt = dsc->slice_chunk_size; /* * slice_per_pkt; */
 
 	eol_byte_num = total_bytes_per_intf % 3;
 
@@ -892,6 +894,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
 		dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL, reg_ctrl);
 		dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL2, reg_ctrl2);
 	} else {
+		reg |= DSI_VIDEO_COMPRESSION_MODE_CTRL_WC(bytes_per_pkt);
 		dsi_write(msm_host, REG_DSI_VIDEO_COMPRESSION_MODE_CTRL, reg);
 	}
 }
diff --git a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
index 1c008bd9102f..820d8d29b62b 100644
--- a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
+++ b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
@@ -1271,7 +1271,11 @@ static int boe_panel_prepare(struct drm_panel *panel)
 	usleep_range(10000, 11000);
 
 	if (boe->desc->lp11_before_reset) {
-		mipi_dsi_dcs_nop(boe->dsi);
+		ret = mipi_dsi_dcs_nop(boe->dsi);
+		if (ret < 0) {
+			dev_err(&boe->dsi->dev, "Failed to send NOP: %d\n", ret);
+			goto poweroff;
+		}
 		usleep_range(1000, 2000);
 	}
 	gpiod_set_value(boe->enable_gpio, 1);
@@ -1292,13 +1296,13 @@ static int boe_panel_prepare(struct drm_panel *panel)
 	return 0;
 
 poweroff:
+	gpiod_set_value(boe->enable_gpio, 0);
 	regulator_disable(boe->avee);
 poweroffavdd:
 	regulator_disable(boe->avdd);
 poweroff1v8:
 	usleep_range(5000, 7000);
 	regulator_disable(boe->pp1800);
-	gpiod_set_value(boe->enable_gpio, 0);
 
 	return ret;
 }
diff --git a/drivers/gpu/drm/panfrost/panfrost_drv.c b/drivers/gpu/drm/panfrost/panfrost_drv.c
index 919e6cc04982..3c0aa8b5e1ae 100644
--- a/drivers/gpu/drm/panfrost/panfrost_drv.c
+++ b/drivers/gpu/drm/panfrost/panfrost_drv.c
@@ -704,3 +704,4 @@ module_platform_driver(panfrost_driver);
 MODULE_AUTHOR("Panfrost Project Developers");
 MODULE_DESCRIPTION("Panfrost DRM Driver");
 MODULE_LICENSE("GPL v2");
+MODULE_SOFTDEP("pre: governor_simpleondemand");
diff --git a/drivers/gpu/drm/qxl/qxl_display.c b/drivers/gpu/drm/qxl/qxl_display.c
index f91a86225d5e..462a4d2ac0b9 100644
--- a/drivers/gpu/drm/qxl/qxl_display.c
+++ b/drivers/gpu/drm/qxl/qxl_display.c
@@ -236,6 +236,9 @@ static int qxl_add_mode(struct drm_connector *connector,
 		return 0;
 
 	mode = drm_cvt_mode(dev, width, height, 60, false, false, false);
+	if (!mode)
+		return 0;
+
 	if (preferred)
 		mode->type |= DRM_MODE_TYPE_PREFERRED;
 	mode->hdisplay = width;
diff --git a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
index a72642bb9cc6..80b8c8334284 100644
--- a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
+++ b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
@@ -1923,7 +1923,7 @@ static void vop2_setup_layer_mixer(struct vop2_video_port *vp)
 		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX,
 			(vp2->nlayers + vp1->nlayers + vp0->nlayers - 1));
 	else
-		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT1_MUX, 8);
+		port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX, 8);
 
 	layer_sel = vop2_readl(vop2, RK3568_OVL_LAYER_SEL);
 
diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c
index 6a6ebcc896b1..3ac674427675 100644
--- a/drivers/hwmon/adt7475.c
+++ b/drivers/hwmon/adt7475.c
@@ -1863,7 +1863,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index)
 		data->pwm[CONTROL][index] &= ~0xE0;
 		data->pwm[CONTROL][index] |= (7 << 5);
 
-		i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
+		i2c_smbus_write_byte_data(client, PWM_REG(index),
 					  data->pwm[INPUT][index]);
 
 		i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c
index 2895cea54193..266baae94e3e 100644
--- a/drivers/hwmon/max6697.c
+++ b/drivers/hwmon/max6697.c
@@ -312,6 +312,7 @@ static ssize_t temp_store(struct device *dev,
 		return ret;
 
 	mutex_lock(&data->update_lock);
+	temp = clamp_val(temp, -1000000, 1000000);	/* prevent underflow */
 	temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset;
 	temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127);
 	data->temp[nr][index] = temp;
@@ -429,14 +430,14 @@ static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20);
 static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21);
 static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23);
 
-static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 14);
+static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15);
 static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8);
 static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9);
 static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10);
 static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11);
 static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12);
 static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13);
-static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 15);
+static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14);
 
 static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1);
 static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2);
diff --git a/drivers/hwtracing/coresight/coresight-platform.c b/drivers/hwtracing/coresight/coresight-platform.c
index 475899714104..3f82ae07a18e 100644
--- a/drivers/hwtracing/coresight/coresight-platform.c
+++ b/drivers/hwtracing/coresight/coresight-platform.c
@@ -323,8 +323,10 @@ static int of_get_coresight_platform_data(struct device *dev,
 			continue;
 
 		ret = of_coresight_parse_endpoint(dev, ep, pdata);
-		if (ret)
+		if (ret) {
+			of_node_put(ep);
 			return ret;
+		}
 	}
 
 	return 0;
diff --git a/drivers/iio/frequency/adrf6780.c b/drivers/iio/frequency/adrf6780.c
index b4defb82f37e..3f46032c9275 100644
--- a/drivers/iio/frequency/adrf6780.c
+++ b/drivers/iio/frequency/adrf6780.c
@@ -9,7 +9,6 @@
 #include <linux/bits.h>
 #include <linux/clk.h>
 #include <linux/clkdev.h>
-#include <linux/clk-provider.h>
 #include <linux/delay.h>
 #include <linux/device.h>
 #include <linux/iio/iio.h>
diff --git a/drivers/infiniband/core/cache.c b/drivers/infiniband/core/cache.c
index 4084d05a4510..c319664ca74b 100644
--- a/drivers/infiniband/core/cache.c
+++ b/drivers/infiniband/core/cache.c
@@ -794,7 +794,6 @@ static struct ib_gid_table *alloc_gid_table(int sz)
 static void release_gid_table(struct ib_device *device,
 			      struct ib_gid_table *table)
 {
-	bool leak = false;
 	int i;
 
 	if (!table)
@@ -803,15 +802,12 @@ static void release_gid_table(struct ib_device *device,
 	for (i = 0; i < table->sz; i++) {
 		if (is_gid_entry_free(table->data_vec[i]))
 			continue;
-		if (kref_read(&table->data_vec[i]->kref) > 1) {
-			dev_err(&device->dev,
-				"GID entry ref leak for index %d ref=%u\n", i,
-				kref_read(&table->data_vec[i]->kref));
-			leak = true;
-		}
+
+		WARN_ONCE(true,
+			  "GID entry ref leak for dev %s index %d ref=%u\n",
+			  dev_name(&device->dev), i,
+			  kref_read(&table->data_vec[i]->kref));
 	}
-	if (leak)
-		return;
 
 	mutex_destroy(&table->lock);
 	kfree(table->data_vec);
diff --git a/drivers/infiniband/core/device.c b/drivers/infiniband/core/device.c
index 453188db39d8..291ded20934c 100644
--- a/drivers/infiniband/core/device.c
+++ b/drivers/infiniband/core/device.c
@@ -2146,6 +2146,9 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
 	unsigned long flags;
 	int ret;
 
+	if (!rdma_is_port_valid(ib_dev, port))
+		return -EINVAL;
+
 	/*
 	 * Drivers wish to call this before ib_register_driver, so we have to
 	 * setup the port data early.
@@ -2154,9 +2157,6 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
 	if (ret)
 		return ret;
 
-	if (!rdma_is_port_valid(ib_dev, port))
-		return -EINVAL;
-
 	pdata = &ib_dev->port_data[port];
 	spin_lock_irqsave(&pdata->netdev_lock, flags);
 	old_ndev = rcu_dereference_protected(
diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c
index 2b47073c61a6..2d09d1be38f1 100644
--- a/drivers/infiniband/core/iwcm.c
+++ b/drivers/infiniband/core/iwcm.c
@@ -369,8 +369,10 @@ EXPORT_SYMBOL(iw_cm_disconnect);
  *
  * Clean up all resources associated with the connection and release
  * the initial reference taken by iw_create_cm_id.
+ *
+ * Returns true if and only if the last cm_id_priv reference has been dropped.
  */
-static void destroy_cm_id(struct iw_cm_id *cm_id)
+static bool destroy_cm_id(struct iw_cm_id *cm_id)
 {
 	struct iwcm_id_private *cm_id_priv;
 	struct ib_qp *qp;
@@ -440,7 +442,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
 		iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM);
 	}
 
-	(void)iwcm_deref_id(cm_id_priv);
+	return iwcm_deref_id(cm_id_priv);
 }
 
 /*
@@ -451,7 +453,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
  */
 void iw_destroy_cm_id(struct iw_cm_id *cm_id)
 {
-	destroy_cm_id(cm_id);
+	if (!destroy_cm_id(cm_id))
+		flush_workqueue(iwcm_wq);
 }
 EXPORT_SYMBOL(iw_destroy_cm_id);
 
@@ -1035,7 +1038,7 @@ static void cm_work_handler(struct work_struct *_work)
 		if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) {
 			ret = process_event(cm_id_priv, &levent);
 			if (ret)
-				destroy_cm_id(&cm_id_priv->id);
+				WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id));
 		} else
 			pr_debug("dropping event %d\n", levent.event);
 		if (iwcm_deref_id(cm_id_priv))
diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
index 6ed0568747ea..4c34cb1cb786 100644
--- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c
+++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
@@ -2359,7 +2359,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp,
 		break;
 	case IB_WR_SEND_WITH_IMM:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM;
-		wqe->send.imm_data = wr->ex.imm_data;
+		wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data);
 		break;
 	case IB_WR_SEND_WITH_INV:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV;
@@ -2389,7 +2389,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr,
 		break;
 	case IB_WR_RDMA_WRITE_WITH_IMM:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM;
-		wqe->rdma.imm_data = wr->ex.imm_data;
+		wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data);
 		break;
 	case IB_WR_RDMA_READ:
 		wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ;
@@ -3340,7 +3340,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *gsi_sqp,
 	wc->byte_len = orig_cqe->length;
 	wc->qp = &gsi_qp->ib_qp;
 
-	wc->ex.imm_data = orig_cqe->immdata;
+	wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata));
 	wc->src_qp = orig_cqe->src_qp;
 	memcpy(wc->smac, orig_cqe->smac, ETH_ALEN);
 	if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) {
@@ -3476,7 +3476,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc)
 				 (unsigned long)(cqe->qp_handle),
 				 struct bnxt_re_qp, qplib_qp);
 			wc->qp = &qp->ib_qp;
-			wc->ex.imm_data = cqe->immdata;
+			wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata));
 			wc->src_qp = cqe->src_qp;
 			memcpy(wc->smac, cqe->smac, ETH_ALEN);
 			wc->port_num = 1;
diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
index 49d89c080827..4f1a845f9be6 100644
--- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h
+++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
@@ -164,7 +164,7 @@ struct bnxt_qplib_swqe {
 		/* Send, with imm, inval key */
 		struct {
 			union {
-				__be32	imm_data;
+				u32	imm_data;
 				u32	inv_key;
 			};
 			u32		q_key;
@@ -182,7 +182,7 @@ struct bnxt_qplib_swqe {
 		/* RDMA write, with imm, read */
 		struct {
 			union {
-				__be32	imm_data;
+				u32	imm_data;
 				u32	inv_key;
 			};
 			u64		remote_va;
@@ -374,7 +374,7 @@ struct bnxt_qplib_cqe {
 	u16				cfa_meta;
 	u64				wr_id;
 	union {
-		__be32			immdata;
+		__le32			immdata;
 		u32			invrkey;
 	};
 	u64				qp_handle;
diff --git a/drivers/infiniband/hw/hns/hns_roce_device.h b/drivers/infiniband/hw/hns/hns_roce_device.h
index 8748b65c87ea..a2bdfa026c56 100644
--- a/drivers/infiniband/hw/hns/hns_roce_device.h
+++ b/drivers/infiniband/hw/hns/hns_roce_device.h
@@ -82,6 +82,7 @@
 #define MR_TYPE_DMA				0x03
 
 #define HNS_ROCE_FRMR_MAX_PA			512
+#define HNS_ROCE_FRMR_ALIGN_SIZE		128
 
 #define PKEY_ID					0xffff
 #define NODE_DESC_SIZE				64
@@ -90,6 +91,8 @@
 /* Configure to HW for PAGE_SIZE larger than 4KB */
 #define PG_SHIFT_OFFSET				(PAGE_SHIFT - 12)
 
+#define ATOMIC_WR_LEN				8
+
 #define HNS_ROCE_IDX_QUE_ENTRY_SZ		4
 #define SRQ_DB_REG				0x230
 
@@ -180,6 +183,9 @@ enum {
 #define HNS_HW_PAGE_SHIFT			12
 #define HNS_HW_PAGE_SIZE			(1 << HNS_HW_PAGE_SHIFT)
 
+#define HNS_HW_MAX_PAGE_SHIFT			27
+#define HNS_HW_MAX_PAGE_SIZE			(1 << HNS_HW_MAX_PAGE_SHIFT)
+
 struct hns_roce_uar {
 	u64		pfn;
 	unsigned long	index;
diff --git a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
index c931cce50d50..c4521ab66ee4 100644
--- a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
+++ b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
@@ -602,11 +602,16 @@ static inline int set_rc_wqe(struct hns_roce_qp *qp,
 		     (wr->send_flags & IB_SEND_SIGNALED) ? 1 : 0);
 
 	if (wr->opcode == IB_WR_ATOMIC_CMP_AND_SWP ||
-	    wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD)
+	    wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD) {
+		if (msg_len != ATOMIC_WR_LEN)
+			return -EINVAL;
 		set_atomic_seg(wr, rc_sq_wqe, valid_num_sge);
-	else if (wr->opcode != IB_WR_REG_MR)
+	} else if (wr->opcode != IB_WR_REG_MR) {
 		ret = set_rwqe_data_seg(&qp->ibqp, wr, rc_sq_wqe,
 					&curr_idx, valid_num_sge);
+		if (ret)
+			return ret;
+	}
 
 	/*
 	 * The pipeline can sequentially post all valid WQEs into WQ buffer,
@@ -2569,14 +2574,16 @@ static int set_llm_cfg_to_hw(struct hns_roce_dev *hr_dev,
 static struct hns_roce_link_table *
 alloc_link_table_buf(struct hns_roce_dev *hr_dev)
 {
+	u16 total_sl = hr_dev->caps.sl_num * hr_dev->func_num;
 	struct hns_roce_v2_priv *priv = hr_dev->priv;
 	struct hns_roce_link_table *link_tbl;
 	u32 pg_shift, size, min_size;
 
 	link_tbl = &priv->ext_llm;
 	pg_shift = hr_dev->caps.llm_buf_pg_sz + PAGE_SHIFT;
-	size = hr_dev->caps.num_qps * HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
-	min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(hr_dev->caps.sl_num) << pg_shift;
+	size = hr_dev->caps.num_qps * hr_dev->func_num *
+	       HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
+	min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(total_sl) << pg_shift;
 
 	/* Alloc data table */
 	size = max(size, min_size);
@@ -6413,9 +6420,16 @@ static void hns_roce_v2_int_mask_enable(struct hns_roce_dev *hr_dev,
 	roce_write(hr_dev, ROCEE_VF_ABN_INT_CFG_REG, enable_flag);
 }
 
-static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
+static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
+{
+	hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+}
+
+static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev,
+				    struct hns_roce_eq *eq)
 {
 	struct device *dev = hr_dev->dev;
+	int eqn = eq->eqn;
 	int ret;
 	u8 cmd;
 
@@ -6426,12 +6440,9 @@ static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
 
 	ret = hns_roce_destroy_hw_ctx(hr_dev, cmd, eqn & HNS_ROCE_V2_EQN_M);
 	if (ret)
-		dev_err(dev, "[mailbox cmd] destroy eqc(%u) failed.\n", eqn);
-}
+		dev_err(dev, "[mailbox cmd] destroy eqc(%d) failed.\n", eqn);
 
-static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
-{
-	hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+	free_eq_buf(hr_dev, eq);
 }
 
 static void init_eq_config(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
@@ -6737,7 +6748,7 @@ static int hns_roce_v2_init_eq_table(struct hns_roce_dev *hr_dev)
 
 err_create_eq_fail:
 	for (i -= 1; i >= 0; i--)
-		free_eq_buf(hr_dev, &eq_table->eq[i]);
+		hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
 	kfree(eq_table->eq);
 
 	return ret;
@@ -6757,11 +6768,8 @@ static void hns_roce_v2_cleanup_eq_table(struct hns_roce_dev *hr_dev)
 	__hns_roce_free_irq(hr_dev);
 	destroy_workqueue(hr_dev->irq_workq);
 
-	for (i = 0; i < eq_num; i++) {
-		hns_roce_v2_destroy_eqc(hr_dev, i);
-
-		free_eq_buf(hr_dev, &eq_table->eq[i]);
-	}
+	for (i = 0; i < eq_num; i++)
+		hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
 
 	kfree(eq_table->eq);
 }
diff --git a/drivers/infiniband/hw/hns/hns_roce_mr.c b/drivers/infiniband/hw/hns/hns_roce_mr.c
index 190e62da98e4..980261969b0c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_mr.c
+++ b/drivers/infiniband/hw/hns/hns_roce_mr.c
@@ -423,6 +423,11 @@ int hns_roce_map_mr_sg(struct ib_mr *ibmr, struct scatterlist *sg, int sg_nents,
 	struct hns_roce_mtr *mtr = &mr->pbl_mtr;
 	int ret, sg_num = 0;
 
+	if (!IS_ALIGNED(*sg_offset, HNS_ROCE_FRMR_ALIGN_SIZE) ||
+	    ibmr->page_size < HNS_HW_PAGE_SIZE ||
+	    ibmr->page_size > HNS_HW_MAX_PAGE_SIZE)
+		return sg_num;
+
 	mr->npages = 0;
 	mr->page_list = kvcalloc(mr->pbl_mtr.hem_cfg.buf_pg_count,
 				 sizeof(dma_addr_t), GFP_KERNEL);
diff --git a/drivers/infiniband/hw/hns/hns_roce_qp.c b/drivers/infiniband/hw/hns/hns_roce_qp.c
index 7b79e6b3f3ba..c97b5dba1772 100644
--- a/drivers/infiniband/hw/hns/hns_roce_qp.c
+++ b/drivers/infiniband/hw/hns/hns_roce_qp.c
@@ -538,13 +538,15 @@ static unsigned int get_sge_num_from_max_inl_data(bool is_ud_or_gsi,
 {
 	unsigned int inline_sge;
 
-	inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
+	if (!max_inline_data)
+		return 0;
 
 	/*
 	 * if max_inline_data less than
 	 * HNS_ROCE_SGE_IN_WQE * HNS_ROCE_SGE_SIZE,
 	 * In addition to ud's mode, no need to extend sge.
 	 */
+	inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
 	if (!is_ud_or_gsi && inline_sge <= HNS_ROCE_SGE_IN_WQE)
 		inline_sge = 0;
 
diff --git a/drivers/infiniband/hw/hns/hns_roce_srq.c b/drivers/infiniband/hw/hns/hns_roce_srq.c
index 6a4923c21cbc..727f92650071 100644
--- a/drivers/infiniband/hw/hns/hns_roce_srq.c
+++ b/drivers/infiniband/hw/hns/hns_roce_srq.c
@@ -296,7 +296,7 @@ static int set_srq_basic_param(struct hns_roce_srq *srq,
 
 	max_sge = proc_srq_sge(hr_dev, srq, !!udata);
 	if (attr->max_wr > hr_dev->caps.max_srq_wrs ||
-	    attr->max_sge > max_sge) {
+	    attr->max_sge > max_sge || !attr->max_sge) {
 		ibdev_err(&hr_dev->ib_dev,
 			  "invalid SRQ attr, depth = %u, sge = %u.\n",
 			  attr->max_wr, attr->max_sge);
diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c
index 111fa88a3be4..9a439569ffcf 100644
--- a/drivers/infiniband/hw/mlx4/alias_GUID.c
+++ b/drivers/infiniband/hw/mlx4/alias_GUID.c
@@ -829,7 +829,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev)
 
 int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev)
 {
-	char alias_wq_name[15];
+	char alias_wq_name[22];
 	int ret = 0;
 	int i, j;
 	union ib_gid gid;
diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c
index a37cfac5e23f..dc9cf45d2d32 100644
--- a/drivers/infiniband/hw/mlx4/mad.c
+++ b/drivers/infiniband/hw/mlx4/mad.c
@@ -2158,7 +2158,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev,
 				       struct mlx4_ib_demux_ctx *ctx,
 				       int port)
 {
-	char name[12];
+	char name[21];
 	int ret = 0;
 	int i;
 
diff --git a/drivers/infiniband/hw/mlx5/mlx5_ib.h b/drivers/infiniband/hw/mlx5/mlx5_ib.h
index 8d94e6834e01..0ef347e91ffe 100644
--- a/drivers/infiniband/hw/mlx5/mlx5_ib.h
+++ b/drivers/infiniband/hw/mlx5/mlx5_ib.h
@@ -109,6 +109,19 @@ unsigned long __mlx5_umem_find_best_quantized_pgoff(
 		__mlx5_bit_sz(typ, page_offset_fld), 0, scale,                 \
 		page_offset_quantized)
 
+static inline unsigned long
+mlx5_umem_dmabuf_find_best_pgsz(struct ib_umem_dmabuf *umem_dmabuf)
+{
+	/*
+	 * mkeys used for dmabuf are fixed at PAGE_SIZE because we must be able
+	 * to hold any sgl after a move operation. Ideally the mkc page size
+	 * could be changed at runtime to be optimal, but right now the driver
+	 * cannot do that.
+	 */
+	return ib_umem_find_best_pgsz(&umem_dmabuf->umem, PAGE_SIZE,
+				      umem_dmabuf->umem.iova);
+}
+
 enum {
 	MLX5_IB_MMAP_OFFSET_START = 9,
 	MLX5_IB_MMAP_OFFSET_END = 255,
diff --git a/drivers/infiniband/hw/mlx5/odp.c b/drivers/infiniband/hw/mlx5/odp.c
index bc97958818bb..af73c5ebe6ac 100644
--- a/drivers/infiniband/hw/mlx5/odp.c
+++ b/drivers/infiniband/hw/mlx5/odp.c
@@ -706,10 +706,8 @@ static int pagefault_dmabuf_mr(struct mlx5_ib_mr *mr, size_t bcnt,
 		return err;
 	}
 
-	page_size = mlx5_umem_find_best_pgsz(&umem_dmabuf->umem, mkc,
-					     log_page_size, 0,
-					     umem_dmabuf->umem.iova);
-	if (unlikely(page_size < PAGE_SIZE)) {
+	page_size = mlx5_umem_dmabuf_find_best_pgsz(umem_dmabuf);
+	if (!page_size) {
 		ib_umem_dmabuf_unmap_pages(umem_dmabuf);
 		err = -EINVAL;
 	} else {
diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c
index 2ace1007a419..35768fdbd5b7 100644
--- a/drivers/infiniband/sw/rxe/rxe_req.c
+++ b/drivers/infiniband/sw/rxe/rxe_req.c
@@ -390,7 +390,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
 	int			paylen;
 	int			solicited;
 	u32			qp_num;
-	int			ack_req;
+	int			ack_req = 0;
 
 	/* length from start of bth to end of icrc */
 	paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE;
@@ -411,8 +411,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
 	qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn :
 					 qp->attr.dest_qp_num;
 
-	ack_req = ((pkt->mask & RXE_END_MASK) ||
-		(qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
+	if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC)
+		ack_req = ((pkt->mask & RXE_END_MASK) ||
+			   (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
 	if (ack_req)
 		qp->req.noack_pkts = 0;
 
diff --git a/drivers/input/keyboard/qt1050.c b/drivers/input/keyboard/qt1050.c
index 403060d05c3b..7193a4198e21 100644
--- a/drivers/input/keyboard/qt1050.c
+++ b/drivers/input/keyboard/qt1050.c
@@ -226,7 +226,12 @@ static bool qt1050_identify(struct qt1050_priv *ts)
 	int err;
 
 	/* Read Chip ID */
-	regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+	err = regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+	if (err) {
+		dev_err(&ts->client->dev, "Failed to read chip ID: %d\n", err);
+		return false;
+	}
+
 	if (val != QT1050_CHIP_ID_VER) {
 		dev_err(&ts->client->dev, "ID %d not supported\n", val);
 		return false;
diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c
index d4eb59b55bf1..5fa0d6ef627b 100644
--- a/drivers/input/mouse/elan_i2c_core.c
+++ b/drivers/input/mouse/elan_i2c_core.c
@@ -1372,6 +1372,8 @@ static int __maybe_unused elan_suspend(struct device *dev)
 	}
 
 err:
+	if (ret)
+		enable_irq(client->irq);
 	mutex_unlock(&data->sysfs_mutex);
 	return ret;
 }
diff --git a/drivers/interconnect/qcom/qcm2290.c b/drivers/interconnect/qcom/qcm2290.c
index ca7ad37ea677..d75bb918e1bb 100644
--- a/drivers/interconnect/qcom/qcm2290.c
+++ b/drivers/interconnect/qcom/qcm2290.c
@@ -166,7 +166,7 @@ static struct qcom_icc_node mas_snoc_bimc = {
 	.qos.ap_owned = true,
 	.qos.qos_port = 6,
 	.qos.qos_mode = NOC_QOS_MODE_BYPASS,
-	.mas_rpm_id = 164,
+	.mas_rpm_id = 3,
 	.slv_rpm_id = -1,
 	.num_links = ARRAY_SIZE(mas_snoc_bimc_links),
 	.links = mas_snoc_bimc_links,
diff --git a/drivers/iommu/intel/iommu.c b/drivers/iommu/intel/iommu.c
index e111b35a7aff..7b9502c30fe9 100644
--- a/drivers/iommu/intel/iommu.c
+++ b/drivers/iommu/intel/iommu.c
@@ -113,13 +113,17 @@ static inline unsigned long lvl_to_nr_pages(unsigned int lvl)
 
 /* VT-d pages must always be _smaller_ than MM pages. Otherwise things
    are never going to work. */
-static inline unsigned long mm_to_dma_pfn(unsigned long mm_pfn)
+static inline unsigned long mm_to_dma_pfn_start(unsigned long mm_pfn)
 {
 	return mm_pfn << (PAGE_SHIFT - VTD_PAGE_SHIFT);
 }
+static inline unsigned long mm_to_dma_pfn_end(unsigned long mm_pfn)
+{
+	return ((mm_pfn + 1) << (PAGE_SHIFT - VTD_PAGE_SHIFT)) - 1;
+}
 static inline unsigned long page_to_dma_pfn(struct page *pg)
 {
-	return mm_to_dma_pfn(page_to_pfn(pg));
+	return mm_to_dma_pfn_start(page_to_pfn(pg));
 }
 static inline unsigned long virt_to_dma_pfn(void *p)
 {
@@ -2439,8 +2443,8 @@ static int __init si_domain_init(int hw)
 
 		for_each_mem_pfn_range(i, nid, &start_pfn, &end_pfn, NULL) {
 			ret = iommu_domain_identity_map(si_domain,
-					mm_to_dma_pfn(start_pfn),
-					mm_to_dma_pfn(end_pfn));
+					mm_to_dma_pfn_start(start_pfn),
+					mm_to_dma_pfn_end(end_pfn-1));
 			if (ret)
 				return ret;
 		}
@@ -2461,8 +2465,8 @@ static int __init si_domain_init(int hw)
 				continue;
 
 			ret = iommu_domain_identity_map(si_domain,
-					mm_to_dma_pfn(start >> PAGE_SHIFT),
-					mm_to_dma_pfn(end >> PAGE_SHIFT));
+					mm_to_dma_pfn_start(start >> PAGE_SHIFT),
+					mm_to_dma_pfn_end(end >> PAGE_SHIFT));
 			if (ret)
 				return ret;
 		}
@@ -3698,8 +3702,8 @@ static int intel_iommu_memory_notifier(struct notifier_block *nb,
 				       unsigned long val, void *v)
 {
 	struct memory_notify *mhp = v;
-	unsigned long start_vpfn = mm_to_dma_pfn(mhp->start_pfn);
-	unsigned long last_vpfn = mm_to_dma_pfn(mhp->start_pfn +
+	unsigned long start_vpfn = mm_to_dma_pfn_start(mhp->start_pfn);
+	unsigned long last_vpfn = mm_to_dma_pfn_end(mhp->start_pfn +
 			mhp->nr_pages - 1);
 
 	switch (val) {
@@ -4401,7 +4405,7 @@ static void intel_iommu_tlb_sync(struct iommu_domain *domain,
 	unsigned long i;
 
 	nrpages = aligned_nrpages(gather->start, size);
-	start_pfn = mm_to_dma_pfn(iova_pfn);
+	start_pfn = mm_to_dma_pfn_start(iova_pfn);
 
 	xa_for_each(&dmar_domain->iommu_array, i, info)
 		iommu_flush_iotlb_psi(info->iommu, dmar_domain,
diff --git a/drivers/iommu/sprd-iommu.c b/drivers/iommu/sprd-iommu.c
index e4358393fe37..71d22daaec2e 100644
--- a/drivers/iommu/sprd-iommu.c
+++ b/drivers/iommu/sprd-iommu.c
@@ -234,8 +234,8 @@ static void sprd_iommu_cleanup(struct sprd_iommu_domain *dom)
 
 	pgt_size = sprd_iommu_pgt_size(&dom->domain);
 	dma_free_coherent(dom->sdev->dev, pgt_size, dom->pgt_va, dom->pgt_pa);
-	dom->sdev = NULL;
 	sprd_iommu_hw_en(dom->sdev, false);
+	dom->sdev = NULL;
 }
 
 static void sprd_iommu_domain_free(struct iommu_domain *domain)
diff --git a/drivers/irqchip/irq-imx-irqsteer.c b/drivers/irqchip/irq-imx-irqsteer.c
index 96230a04ec23..44ce85c27f57 100644
--- a/drivers/irqchip/irq-imx-irqsteer.c
+++ b/drivers/irqchip/irq-imx-irqsteer.c
@@ -35,6 +35,7 @@ struct irqsteer_data {
 	int			channel;
 	struct irq_domain	*domain;
 	u32			*saved_reg;
+	struct device		*dev;
 };
 
 static int imx_irqsteer_get_reg_index(struct irqsteer_data *data,
@@ -71,10 +72,26 @@ static void imx_irqsteer_irq_mask(struct irq_data *d)
 	raw_spin_unlock_irqrestore(&data->lock, flags);
 }
 
+static void imx_irqsteer_irq_bus_lock(struct irq_data *d)
+{
+	struct irqsteer_data *data = d->chip_data;
+
+	pm_runtime_get_sync(data->dev);
+}
+
+static void imx_irqsteer_irq_bus_sync_unlock(struct irq_data *d)
+{
+	struct irqsteer_data *data = d->chip_data;
+
+	pm_runtime_put_autosuspend(data->dev);
+}
+
 static const struct irq_chip imx_irqsteer_irq_chip = {
-	.name		= "irqsteer",
-	.irq_mask	= imx_irqsteer_irq_mask,
-	.irq_unmask	= imx_irqsteer_irq_unmask,
+	.name			= "irqsteer",
+	.irq_mask		= imx_irqsteer_irq_mask,
+	.irq_unmask		= imx_irqsteer_irq_unmask,
+	.irq_bus_lock		= imx_irqsteer_irq_bus_lock,
+	.irq_bus_sync_unlock	= imx_irqsteer_irq_bus_sync_unlock,
 };
 
 static int imx_irqsteer_irq_map(struct irq_domain *h, unsigned int irq,
@@ -149,6 +166,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev)
 	if (!data)
 		return -ENOMEM;
 
+	data->dev = &pdev->dev;
 	data->regs = devm_platform_ioremap_resource(pdev, 0);
 	if (IS_ERR(data->regs)) {
 		dev_err(&pdev->dev, "failed to initialize reg\n");
diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c
index e840609c50eb..2063afffd085 100644
--- a/drivers/isdn/hardware/mISDN/hfcmulti.c
+++ b/drivers/isdn/hardware/mISDN/hfcmulti.c
@@ -1931,7 +1931,7 @@ hfcmulti_dtmf(struct hfc_multi *hc)
 static void
 hfcmulti_tx(struct hfc_multi *hc, int ch)
 {
-	int i, ii, temp, len = 0;
+	int i, ii, temp, tmp_len, len = 0;
 	int Zspace, z1, z2; /* must be int for calculation */
 	int Fspace, f1, f2;
 	u_char *d;
@@ -2152,14 +2152,15 @@ hfcmulti_tx(struct hfc_multi *hc, int ch)
 		HFC_wait_nodebug(hc);
 	}
 
+	tmp_len = (*sp)->len;
 	dev_kfree_skb(*sp);
 	/* check for next frame */
 	if (bch && get_next_bframe(bch)) {
-		len = (*sp)->len;
+		len = tmp_len;
 		goto next_frame;
 	}
 	if (dch && get_next_dframe(dch)) {
-		len = (*sp)->len;
+		len = tmp_len;
 		goto next_frame;
 	}
 
diff --git a/drivers/leds/flash/leds-mt6360.c b/drivers/leds/flash/leds-mt6360.c
index e1066a52d2d2..2fab335a6425 100644
--- a/drivers/leds/flash/leds-mt6360.c
+++ b/drivers/leds/flash/leds-mt6360.c
@@ -637,14 +637,17 @@ static int mt6360_init_isnk_properties(struct mt6360_led *led,
 
 			ret = fwnode_property_read_u32(child, "reg", &reg);
 			if (ret || reg > MT6360_LED_ISNK3 ||
-			    priv->leds_active & BIT(reg))
+			    priv->leds_active & BIT(reg)) {
+				fwnode_handle_put(child);
 				return -EINVAL;
+			}
 
 			ret = fwnode_property_read_u32(child, "color", &color);
 			if (ret) {
 				dev_err(priv->dev,
 					"led %d, no color specified\n",
 					led->led_no);
+				fwnode_handle_put(child);
 				return ret;
 			}
 
diff --git a/drivers/leds/led-class.c b/drivers/leds/led-class.c
index aa39b2a48fdf..7391d2cf1370 100644
--- a/drivers/leds/led-class.c
+++ b/drivers/leds/led-class.c
@@ -235,7 +235,6 @@ struct led_classdev *of_led_get(struct device_node *np, int index)
 
 	led_dev = class_find_device_by_of_node(leds_class, led_node);
 	of_node_put(led_node);
-	put_device(led_dev);
 
 	if (!led_dev)
 		return ERR_PTR(-EPROBE_DEFER);
diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c
index 072491d3e17b..024b73f84ce0 100644
--- a/drivers/leds/led-triggers.c
+++ b/drivers/leds/led-triggers.c
@@ -179,9 +179,9 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig)
 
 		cancel_work_sync(&led_cdev->set_brightness_work);
 		led_stop_software_blink(led_cdev);
+		device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
 		if (led_cdev->trigger->deactivate)
 			led_cdev->trigger->deactivate(led_cdev);
-		device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
 		led_cdev->trigger = NULL;
 		led_cdev->trigger_data = NULL;
 		led_cdev->activated = false;
diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c
index fcaa34706b6c..2ef9fc7371bd 100644
--- a/drivers/leds/leds-ss4200.c
+++ b/drivers/leds/leds-ss4200.c
@@ -356,8 +356,10 @@ static int ich7_lpc_probe(struct pci_dev *dev,
 
 	nas_gpio_pci_dev = dev;
 	status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base);
-	if (status)
+	if (status) {
+		status = pcibios_err_to_errno(status);
 		goto out;
+	}
 	g_pm_io_base &= 0x00000ff80;
 
 	status = pci_read_config_dword(dev, GPIO_CTRL, &gc);
@@ -369,8 +371,9 @@ static int ich7_lpc_probe(struct pci_dev *dev,
 	}
 
 	status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base);
-	if (0 > status) {
+	if (status) {
 		dev_info(&dev->dev, "Unable to read GPIOBASE.\n");
+		status = pcibios_err_to_errno(status);
 		goto out;
 	}
 	dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base);
diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c
index b8228ca40454..ab9b381c8ff1 100644
--- a/drivers/macintosh/therm_windtunnel.c
+++ b/drivers/macintosh/therm_windtunnel.c
@@ -548,7 +548,7 @@ g4fan_exit( void )
 	platform_driver_unregister( &therm_of_driver );
 
 	if( x.of_dev )
-		of_device_unregister( x.of_dev );
+		of_platform_device_destroy(&x.of_dev->dev, NULL);
 }
 
 module_init(g4fan_init);
diff --git a/drivers/md/dm-verity-target.c b/drivers/md/dm-verity-target.c
index 6a707b41dc86..52585e2c61aa 100644
--- a/drivers/md/dm-verity-target.c
+++ b/drivers/md/dm-verity-target.c
@@ -1496,14 +1496,6 @@ static int verity_ctr(struct dm_target *ti, unsigned int argc, char **argv)
 	return r;
 }
 
-/*
- * Check whether a DM target is a verity target.
- */
-bool dm_is_verity_target(struct dm_target *ti)
-{
-	return ti->type->module == THIS_MODULE;
-}
-
 /*
  * Get the verity mode (error behavior) of a verity target.
  *
@@ -1575,6 +1567,14 @@ static void __exit dm_verity_exit(void)
 module_init(dm_verity_init);
 module_exit(dm_verity_exit);
 
+/*
+ * Check whether a DM target is a verity target.
+ */
+bool dm_is_verity_target(struct dm_target *ti)
+{
+	return ti->type == &verity_target;
+}
+
 MODULE_AUTHOR("Mikulas Patocka <mpatocka@redhat.com>");
 MODULE_AUTHOR("Mandeep Baines <msb@chromium.org>");
 MODULE_AUTHOR("Will Drewry <wad@chromium.org>");
diff --git a/drivers/md/md.c b/drivers/md/md.c
index 506c998c0ca5..7dc1c42acccc 100644
--- a/drivers/md/md.c
+++ b/drivers/md/md.c
@@ -527,13 +527,9 @@ static void md_end_flush(struct bio *bio)
 
 	rdev_dec_pending(rdev, mddev);
 
-	if (atomic_dec_and_test(&mddev->flush_pending)) {
-		/* The pair is percpu_ref_get() from md_flush_request() */
-		percpu_ref_put(&mddev->active_io);
-
+	if (atomic_dec_and_test(&mddev->flush_pending))
 		/* The pre-request flush has finished */
 		queue_work(md_wq, &mddev->flush_work);
-	}
 }
 
 static void md_submit_flush_data(struct work_struct *ws);
@@ -564,12 +560,8 @@ static void submit_flushes(struct work_struct *ws)
 			rcu_read_lock();
 		}
 	rcu_read_unlock();
-	if (atomic_dec_and_test(&mddev->flush_pending)) {
-		/* The pair is percpu_ref_get() from md_flush_request() */
-		percpu_ref_put(&mddev->active_io);
-
+	if (atomic_dec_and_test(&mddev->flush_pending))
 		queue_work(md_wq, &mddev->flush_work);
-	}
 }
 
 static void md_submit_flush_data(struct work_struct *ws)
@@ -594,8 +586,20 @@ static void md_submit_flush_data(struct work_struct *ws)
 		bio_endio(bio);
 	} else {
 		bio->bi_opf &= ~REQ_PREFLUSH;
-		md_handle_request(mddev, bio);
+
+		/*
+		 * make_requst() will never return error here, it only
+		 * returns error in raid5_make_request() by dm-raid.
+		 * Since dm always splits data and flush operation into
+		 * two separate io, io size of flush submitted by dm
+		 * always is 0, make_request() will not be called here.
+		 */
+		if (WARN_ON_ONCE(!mddev->pers->make_request(mddev, bio)))
+			bio_io_error(bio);;
 	}
+
+	/* The pair is percpu_ref_get() from md_flush_request() */
+	percpu_ref_put(&mddev->active_io);
 }
 
 /*
diff --git a/drivers/media/i2c/imx412.c b/drivers/media/i2c/imx412.c
index 7f6d29e0e7c4..77fa6253ba3e 100644
--- a/drivers/media/i2c/imx412.c
+++ b/drivers/media/i2c/imx412.c
@@ -544,14 +544,13 @@ static int imx412_update_controls(struct imx412 *imx412,
  */
 static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
 {
-	u32 lpfr, shutter;
+	u32 lpfr;
 	int ret;
 
 	lpfr = imx412->vblank + imx412->cur_mode->height;
-	shutter = lpfr - exposure;
 
-	dev_dbg(imx412->dev, "Set exp %u, analog gain %u, shutter %u, lpfr %u",
-		exposure, gain, shutter, lpfr);
+	dev_dbg(imx412->dev, "Set exp %u, analog gain %u, lpfr %u",
+		exposure, gain, lpfr);
 
 	ret = imx412_write_reg(imx412, IMX412_REG_HOLD, 1, 1);
 	if (ret)
@@ -561,7 +560,7 @@ static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
 	if (ret)
 		goto error_release_group_hold;
 
-	ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, shutter);
+	ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, exposure);
 	if (ret)
 		goto error_release_group_hold;
 
diff --git a/drivers/media/pci/ivtv/ivtv-udma.c b/drivers/media/pci/ivtv/ivtv-udma.c
index 210be8290f24..fd76f88975ae 100644
--- a/drivers/media/pci/ivtv/ivtv-udma.c
+++ b/drivers/media/pci/ivtv/ivtv-udma.c
@@ -131,6 +131,8 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
 
 	/* Fill SG List with new values */
 	if (ivtv_udma_fill_sg_list(dma, &user_dma, 0) < 0) {
+		IVTV_DEBUG_WARN("%s: could not allocate bounce buffers for highmem userspace buffers\n",
+				__func__);
 		unpin_user_pages(dma->map, dma->page_count);
 		dma->page_count = 0;
 		return -ENOMEM;
@@ -139,6 +141,12 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
 	/* Map SG List */
 	dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
 				    dma->page_count, DMA_TO_DEVICE);
+	if (!dma->SG_length) {
+		IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+		unpin_user_pages(dma->map, dma->page_count);
+		dma->page_count = 0;
+		return -EINVAL;
+	}
 
 	/* Fill SG Array with new values */
 	ivtv_udma_fill_sg_array (dma, ivtv_dest_addr, 0, -1);
diff --git a/drivers/media/pci/ivtv/ivtv-yuv.c b/drivers/media/pci/ivtv/ivtv-yuv.c
index 4ba10c34a16a..bd0b80331602 100644
--- a/drivers/media/pci/ivtv/ivtv-yuv.c
+++ b/drivers/media/pci/ivtv/ivtv-yuv.c
@@ -115,6 +115,12 @@ static int ivtv_yuv_prep_user_dma(struct ivtv *itv, struct ivtv_user_dma *dma,
 	}
 	dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
 				    dma->page_count, DMA_TO_DEVICE);
+	if (!dma->SG_length) {
+		IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+		unpin_user_pages(dma->map, dma->page_count);
+		dma->page_count = 0;
+		return -EINVAL;
+	}
 
 	/* Fill SG Array with new values */
 	ivtv_udma_fill_sg_array(dma, y_buffer_offset, uv_buffer_offset, y_size);
diff --git a/drivers/media/pci/ivtv/ivtvfb.c b/drivers/media/pci/ivtv/ivtvfb.c
index 00ac94d4ab19..a642becdc0d7 100644
--- a/drivers/media/pci/ivtv/ivtvfb.c
+++ b/drivers/media/pci/ivtv/ivtvfb.c
@@ -281,10 +281,10 @@ static int ivtvfb_prep_dec_dma_to_device(struct ivtv *itv,
 	/* Map User DMA */
 	if (ivtv_udma_setup(itv, ivtv_dest_addr, userbuf, size_in_bytes) <= 0) {
 		mutex_unlock(&itv->udma.lock);
-		IVTVFB_WARN("ivtvfb_prep_dec_dma_to_device, Error with pin_user_pages: %d bytes, %d pages returned\n",
-			       size_in_bytes, itv->udma.page_count);
+		IVTVFB_WARN("%s, Error in ivtv_udma_setup: %d bytes, %d pages returned\n",
+			       __func__, size_in_bytes, itv->udma.page_count);
 
-		/* pin_user_pages must have failed completely */
+		/* pin_user_pages or DMA must have failed completely */
 		return -EIO;
 	}
 
diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c
index 9c6cfef03331..a66df6adfaad 100644
--- a/drivers/media/pci/saa7134/saa7134-dvb.c
+++ b/drivers/media/pci/saa7134/saa7134-dvb.c
@@ -466,7 +466,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe)
 	/* switch the board to analog mode */
 	if (fe->ops.i2c_gate_ctrl)
 		fe->ops.i2c_gate_ctrl(fe, 1);
-	i2c_transfer(&dev->i2c_adap, &analog_msg, 1);
+	if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1)
+		return -EIO;
+
 	return 0;
 }
 
@@ -1018,7 +1020,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe,
 	else
 		wbuf[1] = rbuf & 0xef;
 	msg[0].len = 2;
-	i2c_transfer(&dev->i2c_adap, msg, 1);
+	if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1)
+		return -EIO;
+
 	return 0;
 }
 
diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c
index 1a52c2ea2da5..7ea976efc024 100644
--- a/drivers/media/platform/qcom/venus/vdec.c
+++ b/drivers/media/platform/qcom/venus/vdec.c
@@ -1221,7 +1221,7 @@ static int vdec_stop_output(struct venus_inst *inst)
 		break;
 	case VENUS_DEC_STATE_INIT:
 	case VENUS_DEC_STATE_CAPTURE_SETUP:
-		ret = hfi_session_flush(inst, HFI_FLUSH_INPUT, true);
+		ret = hfi_session_flush(inst, HFI_FLUSH_ALL, true);
 		break;
 	default:
 		break;
@@ -1705,6 +1705,7 @@ static int vdec_close(struct file *file)
 
 	vdec_pm_get(inst);
 
+	cancel_work_sync(&inst->delayed_process_work);
 	v4l2_m2m_ctx_release(inst->m2m_ctx);
 	v4l2_m2m_release(inst->m2m_dev);
 	vdec_ctrl_deinit(inst);
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
index 174aa6176f54..3b6657d4877a 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
@@ -1559,12 +1559,14 @@ static int rcsi2_probe(struct platform_device *pdev)
 
 	ret = v4l2_async_register_subdev(&priv->subdev);
 	if (ret < 0)
-		goto error_async;
+		goto error_pm_runtime;
 
 	dev_info(priv->dev, "%d lanes found\n", priv->lanes);
 
 	return 0;
 
+error_pm_runtime:
+	pm_runtime_disable(&pdev->dev);
 error_async:
 	v4l2_async_nf_unregister(&priv->notifier);
 	v4l2_async_nf_cleanup(&priv->notifier);
@@ -1581,6 +1583,7 @@ static int rcsi2_remove(struct platform_device *pdev)
 	v4l2_async_nf_unregister(&priv->notifier);
 	v4l2_async_nf_cleanup(&priv->notifier);
 	v4l2_async_unregister_subdev(&priv->subdev);
+	v4l2_subdev_cleanup(&priv->subdev);
 
 	pm_runtime_disable(&pdev->dev);
 
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
index ef5adffae197..8bfb020b2f26 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
@@ -665,12 +665,22 @@ static int rvin_setup(struct rvin_dev *vin)
 	 */
 	switch (vin->mbus_code) {
 	case MEDIA_BUS_FMT_YUYV8_1X16:
-		/* BT.601/BT.1358 16bit YCbCr422 */
-		vnmc |= VNMC_INF_YUV16;
+		if (vin->is_csi)
+			/* YCbCr422 8-bit */
+			vnmc |= VNMC_INF_YUV8_BT601;
+		else
+			/* BT.601/BT.1358 16bit YCbCr422 */
+			vnmc |= VNMC_INF_YUV16;
 		input_is_yuv = true;
 		break;
 	case MEDIA_BUS_FMT_UYVY8_1X16:
-		vnmc |= VNMC_INF_YUV16 | VNMC_YCAL;
+		if (vin->is_csi)
+			/* YCbCr422 8-bit */
+			vnmc |= VNMC_INF_YUV8_BT601;
+		else
+			/* BT.601/BT.1358 16bit YCbCr422 */
+			vnmc |= VNMC_INF_YUV16;
+		vnmc |= VNMC_YCAL;
 		input_is_yuv = true;
 		break;
 	case MEDIA_BUS_FMT_UYVY8_2X8:
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_histo.c b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
index f22449dd654c..c0f1002f4ecf 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_histo.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
@@ -36,9 +36,8 @@ struct vsp1_histogram_buffer *
 vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
 {
 	struct vsp1_histogram_buffer *buf = NULL;
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock(&histo->irqlock);
 
 	if (list_empty(&histo->irqqueue))
 		goto done;
@@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
 	histo->readout = true;
 
 done:
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock(&histo->irqlock);
 	return buf;
 }
 
@@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
 				    size_t size)
 {
 	struct vsp1_pipeline *pipe = histo->entity.pipe;
-	unsigned long flags;
 
 	/*
 	 * The pipeline pointer is guaranteed to be valid as this function is
@@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
 	vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size);
 	vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE);
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock(&histo->irqlock);
 	histo->readout = false;
 	wake_up(&histo->wait_queue);
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock(&histo->irqlock);
 }
 
 /* -----------------------------------------------------------------------------
@@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb)
 	struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb);
 	struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue);
 	struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf);
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock_irq(&histo->irqlock);
 	list_add_tail(&buf->queue, &histo->irqqueue);
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock_irq(&histo->irqlock);
 }
 
 static int histo_start_streaming(struct vb2_queue *vq, unsigned int count)
@@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq)
 {
 	struct vsp1_histogram *histo = vb2_get_drv_priv(vq);
 	struct vsp1_histogram_buffer *buffer;
-	unsigned long flags;
 
-	spin_lock_irqsave(&histo->irqlock, flags);
+	spin_lock_irq(&histo->irqlock);
 
 	/* Remove all buffers from the IRQ queue. */
 	list_for_each_entry(buffer, &histo->irqqueue, queue)
@@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq)
 	/* Wait for the buffer being read out (if any) to complete. */
 	wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock);
 
-	spin_unlock_irqrestore(&histo->irqlock, flags);
+	spin_unlock_irq(&histo->irqlock);
 }
 
 static const struct vb2_ops histo_video_queue_qops = {
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
index ae646c9ef337..15daf35bda21 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
+++ b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
@@ -73,7 +73,7 @@ struct vsp1_partition_window {
  * @wpf: The WPF partition window configuration
  */
 struct vsp1_partition {
-	struct vsp1_partition_window rpf;
+	struct vsp1_partition_window rpf[VSP1_MAX_RPF];
 	struct vsp1_partition_window uds_sink;
 	struct vsp1_partition_window uds_source;
 	struct vsp1_partition_window sru;
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
index 75083cb234fe..996a3058d5b7 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
@@ -271,8 +271,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity,
 	 * 'width' need to be adjusted.
 	 */
 	if (pipe->partitions > 1) {
-		crop.width = pipe->partition->rpf.width;
-		crop.left += pipe->partition->rpf.left;
+		crop.width = pipe->partition->rpf[rpf->entity.index].width;
+		crop.left += pipe->partition->rpf[rpf->entity.index].left;
 	}
 
 	if (pipe->interlaced) {
@@ -327,7 +327,9 @@ static void rpf_partition(struct vsp1_entity *entity,
 			  unsigned int partition_idx,
 			  struct vsp1_partition_window *window)
 {
-	partition->rpf = *window;
+	struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev);
+
+	partition->rpf[rpf->entity.index] = *window;
 }
 
 static const struct vsp1_entity_operations rpf_entity_ops = {
diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c
index 5719dda6e0f0..e5590a708f1c 100644
--- a/drivers/media/rc/imon.c
+++ b/drivers/media/rc/imon.c
@@ -1148,10 +1148,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto)
 
 	memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet));
 
-	if (!mutex_is_locked(&ictx->lock)) {
-		unlock = true;
-		mutex_lock(&ictx->lock);
-	}
+	unlock = mutex_trylock(&ictx->lock);
 
 	retval = send_packet(ictx);
 	if (retval)
diff --git a/drivers/media/rc/lirc_dev.c b/drivers/media/rc/lirc_dev.c
index adb8c794a2d7..d9a9017b96ea 100644
--- a/drivers/media/rc/lirc_dev.c
+++ b/drivers/media/rc/lirc_dev.c
@@ -828,8 +828,10 @@ struct rc_dev *rc_dev_get_from_fd(int fd, bool write)
 		return ERR_PTR(-EINVAL);
 	}
 
-	if (write && !(f.file->f_mode & FMODE_WRITE))
+	if (write && !(f.file->f_mode & FMODE_WRITE)) {
+		fdput(f);
 		return ERR_PTR(-EPERM);
+	}
 
 	fh = f.file->private_data;
 	dev = fh->rc;
diff --git a/drivers/media/usb/dvb-usb/dvb-usb-init.c b/drivers/media/usb/dvb-usb/dvb-usb-init.c
index 58eea8ab5477..6cf6d08cc4ec 100644
--- a/drivers/media/usb/dvb-usb/dvb-usb-init.c
+++ b/drivers/media/usb/dvb-usb/dvb-usb-init.c
@@ -23,11 +23,40 @@ static int dvb_usb_force_pid_filter_usage;
 module_param_named(force_pid_filter_usage, dvb_usb_force_pid_filter_usage, int, 0444);
 MODULE_PARM_DESC(force_pid_filter_usage, "force all dvb-usb-devices to use a PID filter, if any (default: 0).");
 
+static int dvb_usb_check_bulk_endpoint(struct dvb_usb_device *d, u8 endpoint)
+{
+	if (endpoint) {
+		int ret;
+
+		ret = usb_pipe_type_check(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+		if (ret)
+			return ret;
+		ret = usb_pipe_type_check(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+		if (ret)
+			return ret;
+	}
+	return 0;
+}
+
+static void dvb_usb_clear_halt(struct dvb_usb_device *d, u8 endpoint)
+{
+	if (endpoint) {
+		usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+		usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+	}
+}
+
 static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
 {
 	struct dvb_usb_adapter *adap;
 	int ret, n, o;
 
+	ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint);
+	if (ret)
+		return ret;
+	ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint_response);
+	if (ret)
+		return ret;
 	for (n = 0; n < d->props.num_adapters; n++) {
 		adap = &d->adapter[n];
 		adap->dev = d;
@@ -103,10 +132,8 @@ static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
 	 * when reloading the driver w/o replugging the device
 	 * sometimes a timeout occurs, this helps
 	 */
-	if (d->props.generic_bulk_ctrl_endpoint != 0) {
-		usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
-		usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
-	}
+	dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint);
+	dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint_response);
 
 	return 0;
 
diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c
index 6d7535efc09d..dffc9d03235c 100644
--- a/drivers/media/usb/uvc/uvc_ctrl.c
+++ b/drivers/media/usb/uvc/uvc_ctrl.c
@@ -1959,7 +1959,13 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
 	else
 		ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id,
 				     dev->intfnum, info->selector, data, 1);
-	if (!ret)
+
+	if (!ret) {
+		info->flags &= ~(UVC_CTRL_FLAG_GET_CUR |
+				 UVC_CTRL_FLAG_SET_CUR |
+				 UVC_CTRL_FLAG_AUTO_UPDATE |
+				 UVC_CTRL_FLAG_ASYNCHRONOUS);
+
 		info->flags |= (data[0] & UVC_CONTROL_CAP_GET ?
 				UVC_CTRL_FLAG_GET_CUR : 0)
 			    |  (data[0] & UVC_CONTROL_CAP_SET ?
@@ -1968,6 +1974,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
 				UVC_CTRL_FLAG_AUTO_UPDATE : 0)
 			    |  (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ?
 				UVC_CTRL_FLAG_ASYNCHRONOUS : 0);
+	}
 
 	kfree(data);
 	return ret;
diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c
index 0d3a3b697b2d..a5ad3ff8bdbb 100644
--- a/drivers/media/usb/uvc/uvc_video.c
+++ b/drivers/media/usb/uvc/uvc_video.c
@@ -705,11 +705,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	unsigned long flags;
 	u64 timestamp;
 	u32 delta_stc;
-	u32 y1, y2;
+	u32 y1;
 	u32 x1, x2;
 	u32 mean;
 	u32 sof;
-	u64 y;
+	u64 y, y2;
 
 	if (!uvc_hw_timestamps_param)
 		return;
@@ -749,7 +749,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	sof = y;
 
 	uvc_dbg(stream->dev, CLOCK,
-		"%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n",
+		"%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n",
 		stream->dev->name, buf->pts,
 		y >> 16, div_u64((y & 0xffff) * 1000000, 65536),
 		sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
@@ -764,7 +764,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 		goto done;
 
 	y1 = NSEC_PER_SEC;
-	y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
+	y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
 
 	/*
 	 * Interpolated and host SOF timestamps can wrap around at slightly
@@ -785,7 +785,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
 	timestamp = ktime_to_ns(first->host_time) + y - y1;
 
 	uvc_dbg(stream->dev, CLOCK,
-		"%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n",
+		"%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n",
 		stream->dev->name,
 		sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
 		y, timestamp, vbuf->vb2_buf.timestamp,
diff --git a/drivers/media/v4l2-core/v4l2-async.c b/drivers/media/v4l2-core/v4l2-async.c
index 008a2a3e312e..7471dbd14040 100644
--- a/drivers/media/v4l2-core/v4l2-async.c
+++ b/drivers/media/v4l2-core/v4l2-async.c
@@ -302,6 +302,9 @@ static int v4l2_async_create_ancillary_links(struct v4l2_async_notifier *n,
 	    sd->entity.function != MEDIA_ENT_F_FLASH)
 		return 0;
 
+	if (!n->sd)
+		return 0;
+
 	link = media_create_ancillary_link(&n->sd->entity, &sd->entity);
 
 #endif
diff --git a/drivers/memory/Kconfig b/drivers/memory/Kconfig
index fac290e48e0b..15a9e66f031d 100644
--- a/drivers/memory/Kconfig
+++ b/drivers/memory/Kconfig
@@ -178,7 +178,7 @@ config FSL_CORENET_CF
 	  represents a coherency violation.
 
 config FSL_IFC
-	bool "Freescale IFC driver" if COMPILE_TEST
+	bool "Freescale IFC driver"
 	depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
 	depends on HAS_IOMEM
 
diff --git a/drivers/mfd/Makefile b/drivers/mfd/Makefile
index 7ed3ef4a698c..e26c64bf7cb7 100644
--- a/drivers/mfd/Makefile
+++ b/drivers/mfd/Makefile
@@ -276,7 +276,5 @@ obj-$(CONFIG_MFD_INTEL_M10_BMC)   += intel-m10-bmc.o
 obj-$(CONFIG_MFD_ATC260X)	+= atc260x-core.o
 obj-$(CONFIG_MFD_ATC260X_I2C)	+= atc260x-i2c.o
 
-rsmu-i2c-objs			:= rsmu_core.o rsmu_i2c.o
-rsmu-spi-objs			:= rsmu_core.o rsmu_spi.o
-obj-$(CONFIG_MFD_RSMU_I2C)	+= rsmu-i2c.o
-obj-$(CONFIG_MFD_RSMU_SPI)	+= rsmu-spi.o
+obj-$(CONFIG_MFD_RSMU_I2C)	+= rsmu_i2c.o rsmu_core.o
+obj-$(CONFIG_MFD_RSMU_SPI)	+= rsmu_spi.o rsmu_core.o
diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c
index 080d7970a377..5971b5cb290a 100644
--- a/drivers/mfd/omap-usb-tll.c
+++ b/drivers/mfd/omap-usb-tll.c
@@ -237,8 +237,7 @@ static int usbtll_omap_probe(struct platform_device *pdev)
 		break;
 	}
 
-	tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]),
-			   GFP_KERNEL);
+	tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL);
 	if (!tll) {
 		pm_runtime_put_sync(dev);
 		pm_runtime_disable(dev);
diff --git a/drivers/mfd/rsmu_core.c b/drivers/mfd/rsmu_core.c
index 29437fd0bd5b..fd04a6e5dfa3 100644
--- a/drivers/mfd/rsmu_core.c
+++ b/drivers/mfd/rsmu_core.c
@@ -78,11 +78,13 @@ int rsmu_core_init(struct rsmu_ddata *rsmu)
 
 	return ret;
 }
+EXPORT_SYMBOL_GPL(rsmu_core_init);
 
 void rsmu_core_exit(struct rsmu_ddata *rsmu)
 {
 	mutex_destroy(&rsmu->lock);
 }
+EXPORT_SYMBOL_GPL(rsmu_core_exit);
 
 MODULE_DESCRIPTION("Renesas SMU core driver");
 MODULE_LICENSE("GPL");
diff --git a/drivers/mtd/nand/raw/Kconfig b/drivers/mtd/nand/raw/Kconfig
index 4cd40af362de..900b12121939 100644
--- a/drivers/mtd/nand/raw/Kconfig
+++ b/drivers/mtd/nand/raw/Kconfig
@@ -248,8 +248,7 @@ config MTD_NAND_FSL_IFC
 	tristate "Freescale IFC NAND controller"
 	depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
 	depends on HAS_IOMEM
-	select FSL_IFC
-	select MEMORY
+	depends on FSL_IFC
 	help
 	  Various Freescale chips e.g P1010, include a NAND Flash machine
 	  with built-in hardware ECC capabilities.
diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile
index 5de0378f90db..7dae831ee8b6 100644
--- a/drivers/mtd/tests/Makefile
+++ b/drivers/mtd/tests/Makefile
@@ -1,19 +1,19 @@
 # SPDX-License-Identifier: GPL-2.0
-obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o
+obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o
 
-mtd_oobtest-objs := oobtest.o mtd_test.o
-mtd_pagetest-objs := pagetest.o mtd_test.o
-mtd_readtest-objs := readtest.o mtd_test.o
-mtd_speedtest-objs := speedtest.o mtd_test.o
-mtd_stresstest-objs := stresstest.o mtd_test.o
-mtd_subpagetest-objs := subpagetest.o mtd_test.o
-mtd_torturetest-objs := torturetest.o mtd_test.o
-mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o
+mtd_oobtest-objs := oobtest.o
+mtd_pagetest-objs := pagetest.o
+mtd_readtest-objs := readtest.o
+mtd_speedtest-objs := speedtest.o
+mtd_stresstest-objs := stresstest.o
+mtd_subpagetest-objs := subpagetest.o
+mtd_torturetest-objs := torturetest.o
+mtd_nandbiterrs-objs := nandbiterrs.o
diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c
index c84250beffdc..f391e0300cdc 100644
--- a/drivers/mtd/tests/mtd_test.c
+++ b/drivers/mtd/tests/mtd_test.c
@@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum)
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock);
 
 static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum)
 {
@@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks);
 
 int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 				unsigned int eb, int ebcnt)
@@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
 
 	return 0;
 }
+EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks);
 
 int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
 {
@@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
 
 	return err;
 }
+EXPORT_SYMBOL_GPL(mtdtest_read);
 
 int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
 		const void *buf)
@@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
 
 	return err;
 }
+EXPORT_SYMBOL_GPL(mtdtest_write);
+
+MODULE_LICENSE("GPL");
+MODULE_DESCRIPTION("MTD function test helpers");
+MODULE_AUTHOR("Akinobu Mita");
diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c
index 4e1d80746b04..38f41ce72b6a 100644
--- a/drivers/mtd/ubi/eba.c
+++ b/drivers/mtd/ubi/eba.c
@@ -1560,6 +1560,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
 					  GFP_KERNEL);
 		if (!fm_eba[i]) {
 			ret = -ENOMEM;
+			kfree(scan_eba[i]);
 			goto out_free;
 		}
 
@@ -1595,7 +1596,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
 	}
 
 out_free:
-	for (i = 0; i < num_volumes; i++) {
+	while (--i >= 0) {
 		if (!ubi->volumes[i])
 			continue;
 
diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c
index 710734a5af9b..be5348d0b22e 100644
--- a/drivers/net/bonding/bond_main.c
+++ b/drivers/net/bonding/bond_main.c
@@ -1117,13 +1117,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond)
 	return bestslave;
 }
 
+/* must be called in RCU critical section or with RTNL held */
 static bool bond_should_notify_peers(struct bonding *bond)
 {
-	struct slave *slave;
-
-	rcu_read_lock();
-	slave = rcu_dereference(bond->curr_active_slave);
-	rcu_read_unlock();
+	struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave);
 
 	if (!slave || !bond->send_peer_notif ||
 	    bond->send_peer_notif %
diff --git a/drivers/net/dsa/b53/b53_common.c b/drivers/net/dsa/b53/b53_common.c
index 59cdfc51ce06..922e5934de73 100644
--- a/drivers/net/dsa/b53/b53_common.c
+++ b/drivers/net/dsa/b53/b53_common.c
@@ -2221,6 +2221,9 @@ static int b53_change_mtu(struct dsa_switch *ds, int port, int mtu)
 	if (is5325(dev) || is5365(dev))
 		return -EOPNOTSUPP;
 
+	if (!dsa_is_cpu_port(ds, port))
+		return 0;
+
 	enable_jumbo = (mtu >= JMS_MIN_SIZE);
 	allow_10_100 = (dev->chip_id == BCM583XX_DEVICE_ID);
 
diff --git a/drivers/net/dsa/mv88e6xxx/chip.c b/drivers/net/dsa/mv88e6xxx/chip.c
index 4938550a67c0..d94b46316a11 100644
--- a/drivers/net/dsa/mv88e6xxx/chip.c
+++ b/drivers/net/dsa/mv88e6xxx/chip.c
@@ -3606,7 +3606,8 @@ static int mv88e6xxx_change_mtu(struct dsa_switch *ds, int port, int new_mtu)
 	mv88e6xxx_reg_lock(chip);
 	if (chip->info->ops->port_set_jumbo_size)
 		ret = chip->info->ops->port_set_jumbo_size(chip, port, new_mtu);
-	else if (chip->info->ops->set_max_frame_size)
+	else if (chip->info->ops->set_max_frame_size &&
+		 dsa_is_cpu_port(ds, port))
 		ret = chip->info->ops->set_max_frame_size(chip, new_mtu);
 	mv88e6xxx_reg_unlock(chip);
 
diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h
index 666b6922e24d..ebf54d74c2bb 100644
--- a/drivers/net/ethernet/brocade/bna/bna_types.h
+++ b/drivers/net/ethernet/brocade/bna/bna_types.h
@@ -410,7 +410,7 @@ struct bna_ib {
 /* Tx object */
 
 /* Tx datapath control structure */
-#define BNA_Q_NAME_SIZE		16
+#define BNA_Q_NAME_SIZE		(IFNAMSIZ + 6)
 struct bna_tcb {
 	/* Fast path */
 	void			**sw_qpt;
diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c
index d6d90f9722a7..aecdb98f8a9c 100644
--- a/drivers/net/ethernet/brocade/bna/bnad.c
+++ b/drivers/net/ethernet/brocade/bna/bnad.c
@@ -1535,8 +1535,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info,
 
 	for (i = 0; i < num_txqs; i++) {
 		vector_num = tx_info->tcb[i]->intr_vector;
-		sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name,
-				tx_id + tx_info->tcb[i]->id);
+		snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d",
+			 bnad->netdev->name,
+			 tx_id + tx_info->tcb[i]->id);
 		err = request_irq(bnad->msix_table[vector_num].vector,
 				  (irq_handler_t)bnad_msix_tx, 0,
 				  tx_info->tcb[i]->name,
@@ -1586,9 +1587,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info,
 
 	for (i = 0; i < num_rxps; i++) {
 		vector_num = rx_info->rx_ctrl[i].ccb->intr_vector;
-		sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d",
-			bnad->netdev->name,
-			rx_id + rx_info->rx_ctrl[i].ccb->id);
+		snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE,
+			 "%s CQ %d", bnad->netdev->name,
+			 rx_id + rx_info->rx_ctrl[i].ccb->id);
 		err = request_irq(bnad->msix_table[vector_num].vector,
 				  (irq_handler_t)bnad_msix_rx, 0,
 				  rx_info->rx_ctrl[i].ccb->name,
diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c
index 0a3df468316e..0a5c3d27ed3b 100644
--- a/drivers/net/ethernet/freescale/fec_main.c
+++ b/drivers/net/ethernet/freescale/fec_main.c
@@ -267,8 +267,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
 #define PKT_MINBUF_SIZE		64
 
 /* FEC receive acceleration */
-#define FEC_RACC_IPDIS		(1 << 1)
-#define FEC_RACC_PRODIS		(1 << 2)
+#define FEC_RACC_IPDIS		BIT(1)
+#define FEC_RACC_PRODIS		BIT(2)
 #define FEC_RACC_SHIFT16	BIT(7)
 #define FEC_RACC_OPTIONS	(FEC_RACC_IPDIS | FEC_RACC_PRODIS)
 
@@ -300,8 +300,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
 #define FEC_MMFR_TA		(2 << 16)
 #define FEC_MMFR_DATA(v)	(v & 0xffff)
 /* FEC ECR bits definition */
-#define FEC_ECR_MAGICEN		(1 << 2)
-#define FEC_ECR_SLEEP		(1 << 3)
+#define FEC_ECR_RESET           BIT(0)
+#define FEC_ECR_ETHEREN         BIT(1)
+#define FEC_ECR_MAGICEN         BIT(2)
+#define FEC_ECR_SLEEP           BIT(3)
+#define FEC_ECR_EN1588          BIT(4)
+#define FEC_ECR_BYTESWP         BIT(8)
+/* FEC RCR bits definition */
+#define FEC_RCR_LOOP            BIT(0)
+#define FEC_RCR_HALFDPX         BIT(1)
+#define FEC_RCR_MII             BIT(2)
+#define FEC_RCR_PROMISC         BIT(3)
+#define FEC_RCR_BC_REJ          BIT(4)
+#define FEC_RCR_FLOWCTL         BIT(5)
+#define FEC_RCR_RMII            BIT(8)
+#define FEC_RCR_10BASET         BIT(9)
+/* TX WMARK bits */
+#define FEC_TXWMRK_STRFWD       BIT(8)
 
 #define FEC_MII_TIMEOUT		30000 /* us */
 
@@ -1038,7 +1053,7 @@ fec_restart(struct net_device *ndev)
 	struct fec_enet_private *fep = netdev_priv(ndev);
 	u32 temp_mac[2];
 	u32 rcntl = OPT_FRAME_SIZE | 0x04;
-	u32 ecntl = 0x2; /* ETHEREN */
+	u32 ecntl = FEC_ECR_ETHEREN;
 
 	/* Whack a reset.  We should wait for this.
 	 * For i.MX6SX SOC, enet use AXI bus, we use disable MAC
@@ -1116,18 +1131,18 @@ fec_restart(struct net_device *ndev)
 		    fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID)
 			rcntl |= (1 << 6);
 		else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII)
-			rcntl |= (1 << 8);
+			rcntl |= FEC_RCR_RMII;
 		else
-			rcntl &= ~(1 << 8);
+			rcntl &= ~FEC_RCR_RMII;
 
 		/* 1G, 100M or 10M */
 		if (ndev->phydev) {
 			if (ndev->phydev->speed == SPEED_1000)
 				ecntl |= (1 << 5);
 			else if (ndev->phydev->speed == SPEED_100)
-				rcntl &= ~(1 << 9);
+				rcntl &= ~FEC_RCR_10BASET;
 			else
-				rcntl |= (1 << 9);
+				rcntl |= FEC_RCR_10BASET;
 		}
 	} else {
 #ifdef FEC_MIIGSK_ENR
@@ -1186,13 +1201,13 @@ fec_restart(struct net_device *ndev)
 
 	if (fep->quirks & FEC_QUIRK_ENET_MAC) {
 		/* enable ENET endian swap */
-		ecntl |= (1 << 8);
+		ecntl |= FEC_ECR_BYTESWP;
 		/* enable ENET store and forward mode */
-		writel(1 << 8, fep->hwp + FEC_X_WMRK);
+		writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK);
 	}
 
 	if (fep->bufdesc_ex)
-		ecntl |= (1 << 4);
+		ecntl |= FEC_ECR_EN1588;
 
 	if (fep->quirks & FEC_QUIRK_DELAYED_CLKS_SUPPORT &&
 	    fep->rgmii_txc_dly)
@@ -1291,7 +1306,7 @@ static void
 fec_stop(struct net_device *ndev)
 {
 	struct fec_enet_private *fep = netdev_priv(ndev);
-	u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8);
+	u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII;
 	u32 val;
 
 	/* We cannot expect a graceful transmit stop without link !!! */
@@ -1310,7 +1325,7 @@ fec_stop(struct net_device *ndev)
 		if (fep->quirks & FEC_QUIRK_HAS_MULTI_QUEUES) {
 			writel(0, fep->hwp + FEC_ECNTRL);
 		} else {
-			writel(1, fep->hwp + FEC_ECNTRL);
+			writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL);
 			udelay(10);
 		}
 	} else {
@@ -1324,11 +1339,16 @@ fec_stop(struct net_device *ndev)
 	/* We have to keep ENET enabled to have MII interrupt stay working */
 	if (fep->quirks & FEC_QUIRK_ENET_MAC &&
 		!(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) {
-		writel(2, fep->hwp + FEC_ECNTRL);
+		writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL);
 		writel(rmii_mode, fep->hwp + FEC_R_CNTRL);
 	}
-}
 
+	if (fep->bufdesc_ex) {
+		val = readl(fep->hwp + FEC_ECNTRL);
+		val |= FEC_ECR_EN1588;
+		writel(val, fep->hwp + FEC_ECNTRL);
+	}
+}
 
 static void
 fec_timeout(struct net_device *ndev, unsigned int txqueue)
diff --git a/drivers/net/ethernet/google/gve/gve_tx_dqo.c b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
index 5147fb37929e..eabed3deca76 100644
--- a/drivers/net/ethernet/google/gve/gve_tx_dqo.c
+++ b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
@@ -596,22 +596,42 @@ static bool gve_can_send_tso(const struct sk_buff *skb)
 	const int header_len = skb_tcp_all_headers(skb);
 	const int gso_size = shinfo->gso_size;
 	int cur_seg_num_bufs;
+	int prev_frag_size;
 	int cur_seg_size;
 	int i;
 
 	cur_seg_size = skb_headlen(skb) - header_len;
+	prev_frag_size = skb_headlen(skb);
 	cur_seg_num_bufs = cur_seg_size > 0;
 
 	for (i = 0; i < shinfo->nr_frags; i++) {
 		if (cur_seg_size >= gso_size) {
 			cur_seg_size %= gso_size;
 			cur_seg_num_bufs = cur_seg_size > 0;
+
+			if (prev_frag_size > GVE_TX_MAX_BUF_SIZE_DQO) {
+				int prev_frag_remain = prev_frag_size %
+					GVE_TX_MAX_BUF_SIZE_DQO;
+
+				/* If the last descriptor of the previous frag
+				 * is less than cur_seg_size, the segment will
+				 * span two descriptors in the previous frag.
+				 * Since max gso size (9728) is less than
+				 * GVE_TX_MAX_BUF_SIZE_DQO, it is impossible
+				 * for the segment to span more than two
+				 * descriptors.
+				 */
+				if (prev_frag_remain &&
+				    cur_seg_size > prev_frag_remain)
+					cur_seg_num_bufs++;
+			}
 		}
 
 		if (unlikely(++cur_seg_num_bufs > max_bufs_per_seg))
 			return false;
 
-		cur_seg_size += skb_frag_size(&shinfo->frags[i]);
+		prev_frag_size = skb_frag_size(&shinfo->frags[i]);
+		cur_seg_size += prev_frag_size;
 	}
 
 	return true;
diff --git a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
index 8c6e13f87b7d..1839a37139dc 100644
--- a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
@@ -531,7 +531,7 @@ ice_parse_rx_flow_user_data(struct ethtool_rx_flow_spec *fsp,
  *
  * Returns the number of available flow director filters to this VSI
  */
-static int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
 {
 	u16 vsi_num = ice_get_hw_vsi_num(hw, vsi->idx);
 	u16 num_guar;
diff --git a/drivers/net/ethernet/intel/ice/ice_fdir.h b/drivers/net/ethernet/intel/ice/ice_fdir.h
index 1b9b84490689..b384d2a4ab19 100644
--- a/drivers/net/ethernet/intel/ice/ice_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_fdir.h
@@ -202,6 +202,8 @@ struct ice_fdir_base_pkt {
 	const u8 *tun_pkt;
 };
 
+struct ice_vsi;
+
 int ice_alloc_fd_res_cntr(struct ice_hw *hw, u16 *cntr_id);
 int ice_free_fd_res_cntr(struct ice_hw *hw, u16 cntr_id);
 int ice_alloc_fd_guar_item(struct ice_hw *hw, u16 *cntr_id, u16 num_fltr);
@@ -213,6 +215,7 @@ int
 ice_fdir_get_gen_prgm_pkt(struct ice_hw *hw, struct ice_fdir_fltr *input,
 			  u8 *pkt, bool frag, bool tun);
 int ice_get_fdir_cnt_all(struct ice_hw *hw);
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi);
 bool ice_fdir_is_dup_fltr(struct ice_hw *hw, struct ice_fdir_fltr *input);
 bool ice_fdir_has_frag(enum ice_fltr_ptype flow);
 struct ice_fdir_fltr *
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
index fb8e85693309..bff3e9662a8f 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
@@ -551,6 +551,8 @@ static void ice_vc_fdir_reset_cnt_all(struct ice_vf_fdir *fdir)
 		fdir->fdir_fltr_cnt[flow][0] = 0;
 		fdir->fdir_fltr_cnt[flow][1] = 0;
 	}
+
+	fdir->fdir_fltr_cnt_total = 0;
 }
 
 /**
@@ -1567,6 +1569,7 @@ ice_vc_add_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
 	resp->status = status;
 	resp->flow_id = conf->flow_id;
 	vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]++;
+	vf->fdir.fdir_fltr_cnt_total++;
 
 	ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
 				    (u8 *)resp, len);
@@ -1631,6 +1634,7 @@ ice_vc_del_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
 	resp->status = status;
 	ice_vc_fdir_remove_entry(vf, conf, conf->flow_id);
 	vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]--;
+	vf->fdir.fdir_fltr_cnt_total--;
 
 	ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
 				    (u8 *)resp, len);
@@ -1797,6 +1801,7 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
 	struct virtchnl_fdir_add *stat = NULL;
 	struct virtchnl_fdir_fltr_conf *conf;
 	enum virtchnl_status_code v_ret;
+	struct ice_vsi *vf_vsi;
 	struct device *dev;
 	struct ice_pf *pf;
 	int is_tun = 0;
@@ -1805,6 +1810,17 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
 
 	pf = vf->pf;
 	dev = ice_pf_to_dev(pf);
+	vf_vsi = ice_get_vf_vsi(vf);
+
+#define ICE_VF_MAX_FDIR_FILTERS	128
+	if (!ice_fdir_num_avail_fltr(&pf->hw, vf_vsi) ||
+	    vf->fdir.fdir_fltr_cnt_total >= ICE_VF_MAX_FDIR_FILTERS) {
+		v_ret = VIRTCHNL_STATUS_ERR_PARAM;
+		dev_err(dev, "Max number of FDIR filters for VF %d is reached\n",
+			vf->vf_id);
+		goto err_exit;
+	}
+
 	ret = ice_vc_fdir_param_check(vf, fltr->vsi_id);
 	if (ret) {
 		v_ret = VIRTCHNL_STATUS_ERR_PARAM;
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
index c5bcc8d7481c..ac6dcab454b4 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
@@ -29,6 +29,7 @@ struct ice_vf_fdir_ctx {
 struct ice_vf_fdir {
 	u16 fdir_fltr_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
 	int prof_entry_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
+	u16 fdir_fltr_cnt_total;
 	struct ice_fd_hw_prof **fdir_prof;
 
 	struct idr fdir_rule_idr;
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
index 4b713832fdd5..f5c0a4214c4e 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
@@ -391,7 +391,8 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
 	if (err)
 		return err;
 
-	lkey_id = aregion->ops->lkey_id_get(aregion, aentry->enc_key, erp_id);
+	lkey_id = aregion->ops->lkey_id_get(aregion, aentry->ht_key.enc_key,
+					    erp_id);
 	if (IS_ERR(lkey_id))
 		return PTR_ERR(lkey_id);
 	aentry->lkey_id = lkey_id;
@@ -399,7 +400,7 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
 	kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
 	mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_WRITE,
 			     priority, region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -428,7 +429,7 @@ mlxsw_sp_acl_atcam_region_entry_remove(struct mlxsw_sp *mlxsw_sp,
 
 	mlxsw_reg_ptce3_pack(ptce3_pl, false, MLXSW_REG_PTCE3_OP_WRITE_WRITE, 0,
 			     region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -457,7 +458,7 @@ mlxsw_sp_acl_atcam_region_entry_action_replace(struct mlxsw_sp *mlxsw_sp,
 	kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
 	mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_UPDATE,
 			     priority, region->tcam_region_info,
-			     aentry->enc_key, erp_id,
+			     aentry->ht_key.enc_key, erp_id,
 			     aentry->delta_info.start,
 			     aentry->delta_info.mask,
 			     aentry->delta_info.value,
@@ -480,15 +481,13 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
 	int err;
 
 	mlxsw_afk_encode(afk, region->key_info, &rulei->values,
-			 aentry->ht_key.full_enc_key, mask);
+			 aentry->ht_key.enc_key, mask);
 
 	erp_mask = mlxsw_sp_acl_erp_mask_get(aregion, mask, false);
 	if (IS_ERR(erp_mask))
 		return PTR_ERR(erp_mask);
 	aentry->erp_mask = erp_mask;
 	aentry->ht_key.erp_id = mlxsw_sp_acl_erp_mask_erp_id(erp_mask);
-	memcpy(aentry->enc_key, aentry->ht_key.full_enc_key,
-	       sizeof(aentry->enc_key));
 
 	/* Compute all needed delta information and clear the delta bits
 	 * from the encrypted key.
@@ -497,9 +496,8 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
 	aentry->delta_info.start = mlxsw_sp_acl_erp_delta_start(delta);
 	aentry->delta_info.mask = mlxsw_sp_acl_erp_delta_mask(delta);
 	aentry->delta_info.value =
-		mlxsw_sp_acl_erp_delta_value(delta,
-					     aentry->ht_key.full_enc_key);
-	mlxsw_sp_acl_erp_delta_clear(delta, aentry->enc_key);
+		mlxsw_sp_acl_erp_delta_value(delta, aentry->ht_key.enc_key);
+	mlxsw_sp_acl_erp_delta_clear(delta, aentry->ht_key.enc_key);
 
 	/* Add rule to the list of A-TCAM rules, assuming this
 	 * rule is intended to A-TCAM. In case this rule does
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
index 95f63fcf4ba1..a54eedb69a3f 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
@@ -249,7 +249,7 @@ __mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion,
 		memcpy(chunk + pad_bytes, &erp_region_id,
 		       sizeof(erp_region_id));
 		memcpy(chunk + key_offset,
-		       &aentry->enc_key[chunk_key_offsets[chunk_index]],
+		       &aentry->ht_key.enc_key[chunk_key_offsets[chunk_index]],
 		       chunk_key_len);
 		chunk += chunk_len;
 	}
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
index d231f4d2888b..9eee229303cc 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
@@ -1217,18 +1217,6 @@ static bool mlxsw_sp_acl_erp_delta_check(void *priv, const void *parent_obj,
 	return err ? false : true;
 }
 
-static int mlxsw_sp_acl_erp_hints_obj_cmp(const void *obj1, const void *obj2)
-{
-	const struct mlxsw_sp_acl_erp_key *key1 = obj1;
-	const struct mlxsw_sp_acl_erp_key *key2 = obj2;
-
-	/* For hints purposes, two objects are considered equal
-	 * in case the masks are the same. Does not matter what
-	 * the "ctcam" value is.
-	 */
-	return memcmp(key1->mask, key2->mask, sizeof(key1->mask));
-}
-
 static void *mlxsw_sp_acl_erp_delta_create(void *priv, void *parent_obj,
 					   void *obj)
 {
@@ -1308,7 +1296,6 @@ static void mlxsw_sp_acl_erp_root_destroy(void *priv, void *root_priv)
 static const struct objagg_ops mlxsw_sp_acl_erp_objagg_ops = {
 	.obj_size = sizeof(struct mlxsw_sp_acl_erp_key),
 	.delta_check = mlxsw_sp_acl_erp_delta_check,
-	.hints_obj_cmp = mlxsw_sp_acl_erp_hints_obj_cmp,
 	.delta_create = mlxsw_sp_acl_erp_delta_create,
 	.delta_destroy = mlxsw_sp_acl_erp_delta_destroy,
 	.root_create = mlxsw_sp_acl_erp_root_create,
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
index edbbc89e7a71..24ba15d8b416 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
@@ -171,9 +171,9 @@ struct mlxsw_sp_acl_atcam_region {
 };
 
 struct mlxsw_sp_acl_atcam_entry_ht_key {
-	char full_enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded
-								 * key.
-								 */
+	char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key, minus
+							    * delta bits.
+							    */
 	u8 erp_id;
 };
 
@@ -185,9 +185,6 @@ struct mlxsw_sp_acl_atcam_entry {
 	struct rhash_head ht_node;
 	struct list_head list; /* Member in entries_list */
 	struct mlxsw_sp_acl_atcam_entry_ht_key ht_key;
-	char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key,
-							    * minus delta bits.
-							    */
 	struct {
 		u16 start;
 		u8 mask;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
index 39112d5cb5b8..687eb17e41c6 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
@@ -971,7 +971,7 @@ static void dwmac4_set_mac_loopback(void __iomem *ioaddr, bool enable)
 }
 
 static void dwmac4_update_vlan_hash(struct mac_device_info *hw, u32 hash,
-				    __le16 perfect_match, bool is_double)
+				    u16 perfect_match, bool is_double)
 {
 	void __iomem *ioaddr = hw->pcsr;
 	u32 value;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
index dd73f38ec08d..813327d04c56 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
@@ -582,7 +582,7 @@ static int dwxgmac2_rss_configure(struct mac_device_info *hw,
 }
 
 static void dwxgmac2_update_vlan_hash(struct mac_device_info *hw, u32 hash,
-				      __le16 perfect_match, bool is_double)
+				      u16 perfect_match, bool is_double)
 {
 	void __iomem *ioaddr = hw->pcsr;
 
diff --git a/drivers/net/ethernet/stmicro/stmmac/hwif.h b/drivers/net/ethernet/stmicro/stmmac/hwif.h
index b2b9cf04bc72..820e2251b7c8 100644
--- a/drivers/net/ethernet/stmicro/stmmac/hwif.h
+++ b/drivers/net/ethernet/stmicro/stmmac/hwif.h
@@ -366,7 +366,7 @@ struct stmmac_ops {
 			     struct stmmac_rss *cfg, u32 num_rxq);
 	/* VLAN */
 	void (*update_vlan_hash)(struct mac_device_info *hw, u32 hash,
-				 __le16 perfect_match, bool is_double);
+				 u16 perfect_match, bool is_double);
 	void (*enable_vlan)(struct mac_device_info *hw, u32 type);
 	int (*add_hw_vlan_rx_fltr)(struct net_device *dev,
 				   struct mac_device_info *hw,
diff --git a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
index e2d51014ab4b..93630840309e 100644
--- a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
+++ b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
@@ -6311,7 +6311,7 @@ static u32 stmmac_vid_crc32_le(__le16 vid_le)
 static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
 {
 	u32 crc, hash = 0;
-	__le16 pmatch = 0;
+	u16 pmatch = 0;
 	int count = 0;
 	u16 vid = 0;
 
@@ -6326,7 +6326,7 @@ static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
 		if (count > 2) /* VID = 0 always passes filter */
 			return -EOPNOTSUPP;
 
-		pmatch = cpu_to_le16(vid);
+		pmatch = vid;
 		hash = 0;
 	}
 
diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c
index bdff9ac5056d..1e797f1ddc31 100644
--- a/drivers/net/netconsole.c
+++ b/drivers/net/netconsole.c
@@ -716,6 +716,7 @@ static int netconsole_netdev_event(struct notifier_block *this,
 				/* rtnl_lock already held
 				 * we might sleep in __netpoll_cleanup()
 				 */
+				nt->enabled = false;
 				spin_unlock_irqrestore(&target_list_lock, flags);
 
 				__netpoll_cleanup(&nt->np);
@@ -723,7 +724,6 @@ static int netconsole_netdev_event(struct notifier_block *this,
 				spin_lock_irqsave(&target_list_lock, flags);
 				netdev_put(nt->np.dev, &nt->np.dev_tracker);
 				nt->np.dev = NULL;
-				nt->enabled = false;
 				stopped = true;
 				netconsole_target_put(nt);
 				goto restart;
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.c b/drivers/net/wireless/ath/ath11k/dp_rx.c
index b1067bcdf88a..3746f9c95696 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.c
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.c
@@ -1879,8 +1879,7 @@ static void ath11k_dp_rx_h_csum_offload(struct ath11k *ar, struct sk_buff *msdu)
 			  CHECKSUM_NONE : CHECKSUM_UNNECESSARY;
 }
 
-static int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar,
-				       enum hal_encrypt_type enctype)
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype)
 {
 	switch (enctype) {
 	case HAL_ENCRYPT_TYPE_OPEN:
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.h b/drivers/net/wireless/ath/ath11k/dp_rx.h
index 623da3bf9dc8..c322e30caa96 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.h
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.h
@@ -1,6 +1,7 @@
 /* SPDX-License-Identifier: BSD-3-Clause-Clear */
 /*
  * Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2024 Qualcomm Innovation Center, Inc. All rights reserved.
  */
 #ifndef ATH11K_DP_RX_H
 #define ATH11K_DP_RX_H
@@ -95,4 +96,6 @@ int ath11k_peer_rx_frag_setup(struct ath11k *ar, const u8 *peer_mac, int vdev_id
 int ath11k_dp_rx_pktlog_start(struct ath11k_base *ab);
 int ath11k_dp_rx_pktlog_stop(struct ath11k_base *ab, bool stop_timer);
 
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype);
+
 #endif /* ATH11K_DP_RX_H */
diff --git a/drivers/net/wireless/ath/ath11k/mac.c b/drivers/net/wireless/ath/ath11k/mac.c
index b863ead198bd..8234e34269ed 100644
--- a/drivers/net/wireless/ath/ath11k/mac.c
+++ b/drivers/net/wireless/ath/ath11k/mac.c
@@ -3748,6 +3748,7 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
 
 	switch (key->cipher) {
 	case WLAN_CIPHER_SUITE_CCMP:
+	case WLAN_CIPHER_SUITE_CCMP_256:
 		arg.key_cipher = WMI_CIPHER_AES_CCM;
 		/* TODO: Re-check if flag is valid */
 		key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
@@ -3757,12 +3758,10 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
 		arg.key_txmic_len = 8;
 		arg.key_rxmic_len = 8;
 		break;
-	case WLAN_CIPHER_SUITE_CCMP_256:
-		arg.key_cipher = WMI_CIPHER_AES_CCM;
-		break;
 	case WLAN_CIPHER_SUITE_GCMP:
 	case WLAN_CIPHER_SUITE_GCMP_256:
 		arg.key_cipher = WMI_CIPHER_AES_GCM;
+		key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
 		break;
 	default:
 		ath11k_warn(ar->ab, "cipher %d is not supported\n", key->cipher);
@@ -5542,7 +5541,10 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
 {
 	struct ath11k_base *ab = ar->ab;
 	struct ieee80211_hdr *hdr = (struct ieee80211_hdr *)skb->data;
+	struct ath11k_skb_cb *skb_cb = ATH11K_SKB_CB(skb);
 	struct ieee80211_tx_info *info;
+	enum hal_encrypt_type enctype;
+	unsigned int mic_len;
 	dma_addr_t paddr;
 	int buf_id;
 	int ret;
@@ -5566,7 +5568,12 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
 		     ieee80211_is_deauth(hdr->frame_control) ||
 		     ieee80211_is_disassoc(hdr->frame_control)) &&
 		     ieee80211_has_protected(hdr->frame_control)) {
-			skb_put(skb, IEEE80211_CCMP_MIC_LEN);
+			if (!(skb_cb->flags & ATH11K_SKB_CIPHER_SET))
+				ath11k_warn(ab, "WMI management tx frame without ATH11K_SKB_CIPHER_SET");
+
+			enctype = ath11k_dp_tx_get_encrypt_type(skb_cb->cipher);
+			mic_len = ath11k_dp_rx_crypto_mic_len(ar, enctype);
+			skb_put(skb, mic_len);
 		}
 	}
 
diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
index 7717eb85a1db..47c0e8e429e5 100644
--- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
+++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
@@ -2567,7 +2567,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 
 	struct lcnphy_txgains cal_gains, temp_gains;
 	u16 hash;
-	u8 band_idx;
 	int j;
 	u16 ncorr_override[5];
 	u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000,
@@ -2599,6 +2598,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 	u16 *values_to_save;
 	struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy;
 
+	if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec)))
+		return;
+
 	values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC);
 	if (NULL == values_to_save)
 		return;
@@ -2662,20 +2664,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
 	hash = (target_gains->gm_gain << 8) |
 	       (target_gains->pga_gain << 4) | (target_gains->pad_gain);
 
-	band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0);
-
 	cal_gains = *target_gains;
 	memset(ncorr_override, 0, sizeof(ncorr_override));
-	for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) {
-		if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) {
+	for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) {
+		if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) {
 			cal_gains.gm_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][1];
+				tbl_iqcal_gainparams_lcnphy[0][j][1];
 			cal_gains.pga_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][2];
+				tbl_iqcal_gainparams_lcnphy[0][j][2];
 			cal_gains.pad_gain =
-				tbl_iqcal_gainparams_lcnphy[band_idx][j][3];
+				tbl_iqcal_gainparams_lcnphy[0][j][3];
 			memcpy(ncorr_override,
-			       &tbl_iqcal_gainparams_lcnphy[band_idx][j][3],
+			       &tbl_iqcal_gainparams_lcnphy[0][j][3],
 			       sizeof(ncorr_override));
 			break;
 		}
diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
index c907da2a4789..d1b23dba5ad5 100644
--- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c
+++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
@@ -926,6 +926,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv,
 		return -EOPNOTSUPP;
 	}
 
+	priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type);
+
 	spin_lock_irqsave(&adapter->main_proc_lock, flags);
 	adapter->main_locked = false;
 	spin_unlock_irqrestore(&adapter->main_proc_lock, flags);
diff --git a/drivers/net/wireless/realtek/rtw89/debug.c b/drivers/net/wireless/realtek/rtw89/debug.c
index 3a8fe60d0bb7..0e014d6afb84 100644
--- a/drivers/net/wireless/realtek/rtw89/debug.c
+++ b/drivers/net/wireless/realtek/rtw89/debug.c
@@ -2386,7 +2386,7 @@ static void rtw89_sta_info_get_iter(void *data, struct ieee80211_sta *sta)
 	case RX_ENC_HE:
 		seq_printf(m, "HE %dSS MCS-%d GI:%s", status->nss, status->rate_idx,
 			   status->he_gi <= NL80211_RATE_INFO_HE_GI_3_2 ?
-			   he_gi_str[rate->he_gi] : "N/A");
+			   he_gi_str[status->he_gi] : "N/A");
 		break;
 	}
 	seq_printf(m, "\t(hw_rate=0x%x)\n", rtwsta->rx_hw_rate);
diff --git a/drivers/net/wireless/virt_wifi.c b/drivers/net/wireless/virt_wifi.c
index ba14d83353a4..fb4d95a027fe 100644
--- a/drivers/net/wireless/virt_wifi.c
+++ b/drivers/net/wireless/virt_wifi.c
@@ -136,6 +136,9 @@ static struct ieee80211_supported_band band_5ghz = {
 /* Assigned at module init. Guaranteed locally-administered and unicast. */
 static u8 fake_router_bssid[ETH_ALEN] __ro_after_init = {};
 
+#define VIRT_WIFI_SSID "VirtWifi"
+#define VIRT_WIFI_SSID_LEN 8
+
 static void virt_wifi_inform_bss(struct wiphy *wiphy)
 {
 	u64 tsf = div_u64(ktime_get_boottime_ns(), 1000);
@@ -146,8 +149,8 @@ static void virt_wifi_inform_bss(struct wiphy *wiphy)
 		u8 ssid[8];
 	} __packed ssid = {
 		.tag = WLAN_EID_SSID,
-		.len = 8,
-		.ssid = "VirtWifi",
+		.len = VIRT_WIFI_SSID_LEN,
+		.ssid = VIRT_WIFI_SSID,
 	};
 
 	informed_bss = cfg80211_inform_bss(wiphy, &channel_5ghz,
@@ -213,6 +216,8 @@ struct virt_wifi_netdev_priv {
 	struct net_device *upperdev;
 	u32 tx_packets;
 	u32 tx_failed;
+	u32 connect_requested_ssid_len;
+	u8 connect_requested_ssid[IEEE80211_MAX_SSID_LEN];
 	u8 connect_requested_bss[ETH_ALEN];
 	bool is_up;
 	bool is_connected;
@@ -229,6 +234,12 @@ static int virt_wifi_connect(struct wiphy *wiphy, struct net_device *netdev,
 	if (priv->being_deleted || !priv->is_up)
 		return -EBUSY;
 
+	if (!sme->ssid)
+		return -EINVAL;
+
+	priv->connect_requested_ssid_len = sme->ssid_len;
+	memcpy(priv->connect_requested_ssid, sme->ssid, sme->ssid_len);
+
 	could_schedule = schedule_delayed_work(&priv->connect, HZ * 2);
 	if (!could_schedule)
 		return -EBUSY;
@@ -252,12 +263,15 @@ static void virt_wifi_connect_complete(struct work_struct *work)
 		container_of(work, struct virt_wifi_netdev_priv, connect.work);
 	u8 *requested_bss = priv->connect_requested_bss;
 	bool right_addr = ether_addr_equal(requested_bss, fake_router_bssid);
+	bool right_ssid = priv->connect_requested_ssid_len == VIRT_WIFI_SSID_LEN &&
+			  !memcmp(priv->connect_requested_ssid, VIRT_WIFI_SSID,
+				  priv->connect_requested_ssid_len);
 	u16 status = WLAN_STATUS_SUCCESS;
 
 	if (is_zero_ether_addr(requested_bss))
 		requested_bss = NULL;
 
-	if (!priv->is_up || (requested_bss && !right_addr))
+	if (!priv->is_up || (requested_bss && !right_addr) || !right_ssid)
 		status = WLAN_STATUS_UNSPECIFIED_FAILURE;
 	else
 		priv->is_connected = true;
diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c
index 32e89ea853a4..27446fa84752 100644
--- a/drivers/nvme/host/pci.c
+++ b/drivers/nvme/host/pci.c
@@ -910,7 +910,8 @@ static blk_status_t nvme_prep_rq(struct nvme_dev *dev, struct request *req)
 	blk_mq_start_request(req);
 	return BLK_STS_OK;
 out_unmap_data:
-	nvme_unmap_data(dev, req);
+	if (blk_rq_nr_phys_segments(req))
+		nvme_unmap_data(dev, req);
 out_free_cmd:
 	nvme_cleanup_cmd(req);
 	return ret;
@@ -1322,7 +1323,7 @@ static void nvme_warn_reset(struct nvme_dev *dev, u32 csts)
 	dev_warn(dev->ctrl.device,
 		 "Does your device have a faulty power saving mode enabled?\n");
 	dev_warn(dev->ctrl.device,
-		 "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off\" and report a bug\n");
+		 "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off pcie_port_pm=off\" and report a bug\n");
 }
 
 static enum blk_eh_timer_return nvme_timeout(struct request *req)
diff --git a/drivers/nvme/target/auth.c b/drivers/nvme/target/auth.c
index e900525b7866..aacc05ec00c2 100644
--- a/drivers/nvme/target/auth.c
+++ b/drivers/nvme/target/auth.c
@@ -314,7 +314,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 						    req->sq->dhchap_c1,
 						    challenge, shash_len);
 		if (ret)
-			goto out_free_response;
+			goto out_free_challenge;
 	}
 
 	pr_debug("ctrl %d qid %d host response seq %u transaction %d\n",
@@ -325,7 +325,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 			GFP_KERNEL);
 	if (!shash) {
 		ret = -ENOMEM;
-		goto out_free_response;
+		goto out_free_challenge;
 	}
 	shash->tfm = shash_tfm;
 	ret = crypto_shash_init(shash);
@@ -361,9 +361,10 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
 		goto out;
 	ret = crypto_shash_final(shash, response);
 out:
+	kfree(shash);
+out_free_challenge:
 	if (challenge != req->sq->dhchap_c1)
 		kfree(challenge);
-	kfree(shash);
 out_free_response:
 	kfree_sensitive(host_response);
 out_free_tfm:
@@ -426,14 +427,14 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
 						    req->sq->dhchap_c2,
 						    challenge, shash_len);
 		if (ret)
-			goto out_free_response;
+			goto out_free_challenge;
 	}
 
 	shash = kzalloc(sizeof(*shash) + crypto_shash_descsize(shash_tfm),
 			GFP_KERNEL);
 	if (!shash) {
 		ret = -ENOMEM;
-		goto out_free_response;
+		goto out_free_challenge;
 	}
 	shash->tfm = shash_tfm;
 
@@ -470,9 +471,10 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
 		goto out;
 	ret = crypto_shash_final(shash, response);
 out:
+	kfree(shash);
+out_free_challenge:
 	if (challenge != req->sq->dhchap_c2)
 		kfree(challenge);
-	kfree(shash);
 out_free_response:
 	kfree_sensitive(ctrl_response);
 out_free_tfm:
diff --git a/drivers/opp/ti-opp-supply.c b/drivers/opp/ti-opp-supply.c
index 8f3f13fbbb25..a8a696d2e03a 100644
--- a/drivers/opp/ti-opp-supply.c
+++ b/drivers/opp/ti-opp-supply.c
@@ -400,10 +400,12 @@ static int ti_opp_supply_probe(struct platform_device *pdev)
 	}
 
 	ret = dev_pm_opp_set_config_regulators(cpu_dev, ti_opp_config_regulators);
-	if (ret < 0)
+	if (ret < 0) {
 		_free_optimized_voltages(dev, &opp_data);
+		return ret;
+	}
 
-	return ret;
+	return 0;
 }
 
 static struct platform_driver ti_opp_supply_driver = {
diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c
index d740eba3c099..8400a379186e 100644
--- a/drivers/parport/procfs.c
+++ b/drivers/parport/procfs.c
@@ -51,12 +51,12 @@ static int do_active_device(struct ctl_table *table, int write,
 	
 	for (dev = port->devices; dev ; dev = dev->next) {
 		if(dev == port->cad) {
-			len += sprintf(buffer, "%s\n", dev->name);
+			len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name);
 		}
 	}
 
 	if(!len) {
-		len += sprintf(buffer, "%s\n", "none");
+		len += snprintf(buffer, sizeof(buffer), "%s\n", "none");
 	}
 
 	if (len > *lenp)
@@ -87,19 +87,19 @@ static int do_autoprobe(struct ctl_table *table, int write,
 	}
 	
 	if ((str = info->class_name) != NULL)
-		len += sprintf (buffer + len, "CLASS:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str);
 
 	if ((str = info->model) != NULL)
-		len += sprintf (buffer + len, "MODEL:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str);
 
 	if ((str = info->mfr) != NULL)
-		len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str);
 
 	if ((str = info->description) != NULL)
-		len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str);
 
 	if ((str = info->cmdset) != NULL)
-		len += sprintf (buffer + len, "COMMAND SET:%s;\n", str);
+		len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -117,7 +117,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
 				 void *result, size_t *lenp, loff_t *ppos)
 {
 	struct parport *port = (struct parport *)table->extra1;
-	char buffer[20];
+	char buffer[64];
 	int len = 0;
 
 	if (*ppos) {
@@ -128,7 +128,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi);
+	len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -155,7 +155,7 @@ static int do_hardware_irq(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%d\n", port->irq);
+	len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -182,7 +182,7 @@ static int do_hardware_dma(struct ctl_table *table, int write,
 	if (write) /* permissions prevent this anyway */
 		return -EACCES;
 
-	len += sprintf (buffer, "%d\n", port->dma);
+	len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma);
 
 	if (len > *lenp)
 		len = *lenp;
@@ -213,7 +213,7 @@ static int do_hardware_modes(struct ctl_table *table, int write,
 #define printmode(x)							\
 do {									\
 	if (port->modes & PARPORT_MODE_##x)				\
-		len += sprintf(buffer + len, "%s%s", f++ ? "," : "", #x); \
+		len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \
 } while (0)
 		int f = 0;
 		printmode(PCSPP);
diff --git a/drivers/pci/controller/dwc/pci-keystone.c b/drivers/pci/controller/dwc/pci-keystone.c
index 7ecad72cff7e..6007ffcb4752 100644
--- a/drivers/pci/controller/dwc/pci-keystone.c
+++ b/drivers/pci/controller/dwc/pci-keystone.c
@@ -247,8 +247,68 @@ static struct irq_chip ks_pcie_msi_irq_chip = {
 	.irq_unmask = ks_pcie_msi_unmask,
 };
 
+/**
+ * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ *	     PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+	u32 val;
+
+	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	val |= DBI_CS2;
+	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	do {
+		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	} while (!(val & DBI_CS2));
+}
+
+/**
+ * ks_pcie_clear_dbi_mode() - Disable DBI mode
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ *	     PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+	u32 val;
+
+	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	val &= ~DBI_CS2;
+	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	do {
+		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+	} while (val & DBI_CS2);
+}
+
 static int ks_pcie_msi_host_init(struct dw_pcie_rp *pp)
 {
+	struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
+	struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
+
+	/* Configure and set up BAR0 */
+	ks_pcie_set_dbi_mode(ks_pcie);
+
+	/* Enable BAR0 */
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
+
+	ks_pcie_clear_dbi_mode(ks_pcie);
+
+	/*
+	 * For BAR0, just setting bus address for inbound writes (MSI) should
+	 * be sufficient.  Use physical address to avoid any conflicts.
+	 */
+	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
+
 	pp->msi_irq_chip = &ks_pcie_msi_irq_chip;
 	return dw_pcie_allocate_domains(pp);
 }
@@ -343,59 +403,22 @@ static const struct irq_domain_ops ks_pcie_legacy_irq_domain_ops = {
 	.xlate = irq_domain_xlate_onetwocell,
 };
 
-/**
- * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- *	     PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
-{
-	u32 val;
-
-	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	val |= DBI_CS2;
-	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
-	do {
-		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	} while (!(val & DBI_CS2));
-}
-
-/**
- * ks_pcie_clear_dbi_mode() - Disable DBI mode
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- *	     PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
-{
-	u32 val;
-
-	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	val &= ~DBI_CS2;
-	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
-	do {
-		val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
-	} while (val & DBI_CS2);
-}
-
-static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
+static int ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 {
 	u32 val;
 	u32 num_viewport = ks_pcie->num_viewport;
 	struct dw_pcie *pci = ks_pcie->pci;
 	struct dw_pcie_rp *pp = &pci->pp;
-	u64 start, end;
+	struct resource_entry *entry;
 	struct resource *mem;
+	u64 start, end;
 	int i;
 
-	mem = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM)->res;
+	entry = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM);
+	if (!entry)
+		return -ENODEV;
+
+	mem = entry->res;
 	start = mem->start;
 	end = mem->end;
 
@@ -406,7 +429,7 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 	ks_pcie_clear_dbi_mode(ks_pcie);
 
 	if (ks_pcie->is_am6)
-		return;
+		return 0;
 
 	val = ilog2(OB_WIN_SIZE);
 	ks_pcie_app_writel(ks_pcie, OB_SIZE, val);
@@ -423,6 +446,8 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
 	val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
 	val |= OB_XLAT_EN_VAL;
 	ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+	return 0;
 }
 
 static void __iomem *ks_pcie_other_map_bus(struct pci_bus *bus,
@@ -448,44 +473,10 @@ static struct pci_ops ks_child_pcie_ops = {
 	.write = pci_generic_config_write,
 };
 
-/**
- * ks_pcie_v3_65_add_bus() - keystone add_bus post initialization
- * @bus: A pointer to the PCI bus structure.
- *
- * This sets BAR0 to enable inbound access for MSI_IRQ register
- */
-static int ks_pcie_v3_65_add_bus(struct pci_bus *bus)
-{
-	struct dw_pcie_rp *pp = bus->sysdata;
-	struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
-	struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
-
-	if (!pci_is_root_bus(bus))
-		return 0;
-
-	/* Configure and set up BAR0 */
-	ks_pcie_set_dbi_mode(ks_pcie);
-
-	/* Enable BAR0 */
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
-
-	ks_pcie_clear_dbi_mode(ks_pcie);
-
-	 /*
-	  * For BAR0, just setting bus address for inbound writes (MSI) should
-	  * be sufficient.  Use physical address to avoid any conflicts.
-	  */
-	dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
-
-	return 0;
-}
-
 static struct pci_ops ks_pcie_ops = {
 	.map_bus = dw_pcie_own_conf_map_bus,
 	.read = pci_generic_config_read,
 	.write = pci_generic_config_write,
-	.add_bus = ks_pcie_v3_65_add_bus,
 };
 
 /**
@@ -818,7 +809,10 @@ static int __init ks_pcie_host_init(struct dw_pcie_rp *pp)
 		return ret;
 
 	ks_pcie_stop_link(pci);
-	ks_pcie_setup_rc_app_regs(ks_pcie);
+	ret = ks_pcie_setup_rc_app_regs(ks_pcie);
+	if (ret)
+		return ret;
+
 	writew(PCI_IO_RANGE_TYPE_32 | (PCI_IO_RANGE_TYPE_32 << 8),
 			pci->dbi_base + PCI_IO_BASE);
 
diff --git a/drivers/pci/controller/dwc/pcie-designware-ep.c b/drivers/pci/controller/dwc/pcie-designware-ep.c
index 506d6d061d4c..449ad709495d 100644
--- a/drivers/pci/controller/dwc/pcie-designware-ep.c
+++ b/drivers/pci/controller/dwc/pcie-designware-ep.c
@@ -165,7 +165,7 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
 	if (!ep->bar_to_atu[bar])
 		free_win = find_first_zero_bit(ep->ib_window_map, pci->num_ib_windows);
 	else
-		free_win = ep->bar_to_atu[bar];
+		free_win = ep->bar_to_atu[bar] - 1;
 
 	if (free_win >= pci->num_ib_windows) {
 		dev_err(pci->dev, "No free inbound window\n");
@@ -179,7 +179,11 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
 		return ret;
 	}
 
-	ep->bar_to_atu[bar] = free_win;
+	/*
+	 * Always increment free_win before assignment, since value 0 is used to identify
+	 * unallocated mapping.
+	 */
+	ep->bar_to_atu[bar] = free_win + 1;
 	set_bit(free_win, ep->ib_window_map);
 
 	return 0;
@@ -216,7 +220,10 @@ static void dw_pcie_ep_clear_bar(struct pci_epc *epc, u8 func_no, u8 vfunc_no,
 	struct dw_pcie_ep *ep = epc_get_drvdata(epc);
 	struct dw_pcie *pci = to_dw_pcie_from_ep(ep);
 	enum pci_barno bar = epf_bar->barno;
-	u32 atu_index = ep->bar_to_atu[bar];
+	u32 atu_index = ep->bar_to_atu[bar] - 1;
+
+	if (!ep->bar_to_atu[bar])
+		return;
 
 	__dw_pcie_ep_reset_bar(pci, func_no, bar, epf_bar->flags);
 
diff --git a/drivers/pci/controller/dwc/pcie-dw-rockchip.c b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
index c1e7653e508e..4332370fefa0 100644
--- a/drivers/pci/controller/dwc/pcie-dw-rockchip.c
+++ b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
@@ -240,7 +240,7 @@ static int rockchip_pcie_resource_get(struct platform_device *pdev,
 		return PTR_ERR(rockchip->apb_base);
 
 	rockchip->rst_gpio = devm_gpiod_get_optional(&pdev->dev, "reset",
-						     GPIOD_OUT_HIGH);
+						     GPIOD_OUT_LOW);
 	if (IS_ERR(rockchip->rst_gpio))
 		return PTR_ERR(rockchip->rst_gpio);
 
diff --git a/drivers/pci/controller/dwc/pcie-qcom-ep.c b/drivers/pci/controller/dwc/pcie-qcom-ep.c
index 1c7fd05ce028..f2bf3eba2254 100644
--- a/drivers/pci/controller/dwc/pcie-qcom-ep.c
+++ b/drivers/pci/controller/dwc/pcie-qcom-ep.c
@@ -446,12 +446,6 @@ static int qcom_pcie_perst_deassert(struct dw_pcie *pci)
 static void qcom_pcie_perst_assert(struct dw_pcie *pci)
 {
 	struct qcom_pcie_ep *pcie_ep = to_pcie_ep(pci);
-	struct device *dev = pci->dev;
-
-	if (pcie_ep->link_status == QCOM_PCIE_EP_LINK_DISABLED) {
-		dev_dbg(dev, "Link is already disabled\n");
-		return;
-	}
 
 	qcom_pcie_disable_resources(pcie_ep);
 	pcie_ep->link_status = QCOM_PCIE_EP_LINK_DISABLED;
diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c
index b36cbc9136ae..09491d06589e 100644
--- a/drivers/pci/controller/pci-hyperv.c
+++ b/drivers/pci/controller/pci-hyperv.c
@@ -1092,8 +1092,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where,
 		   PCI_CAPABILITY_LIST) {
 		/* ROM BARs are unimplemented */
 		*val = 0;
-	} else if (where >= PCI_INTERRUPT_LINE && where + size <=
-		   PCI_INTERRUPT_PIN) {
+	} else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) ||
+		   (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) {
 		/*
 		 * Interrupt Line and Interrupt PIN are hard-wired to zero
 		 * because this front-end only supports message-signaled
diff --git a/drivers/pci/controller/pci-loongson.c b/drivers/pci/controller/pci-loongson.c
index a860f25473df..76f125d556eb 100644
--- a/drivers/pci/controller/pci-loongson.c
+++ b/drivers/pci/controller/pci-loongson.c
@@ -163,6 +163,19 @@ DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
 DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
 			DEV_LS7A_HDMI, loongson_pci_pin_quirk);
 
+static void loongson_pci_msi_quirk(struct pci_dev *dev)
+{
+	u16 val, class = dev->class >> 8;
+
+	if (class != PCI_CLASS_BRIDGE_HOST)
+		return;
+
+	pci_read_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, &val);
+	val |= PCI_MSI_FLAGS_ENABLE;
+	pci_write_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, val);
+}
+DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON, DEV_LS7A_PCIE_PORT5, loongson_pci_msi_quirk);
+
 static struct loongson_pci *pci_bus_to_loongson_pci(struct pci_bus *bus)
 {
 	struct pci_config_window *cfg;
diff --git a/drivers/pci/controller/pcie-rcar-host.c b/drivers/pci/controller/pcie-rcar-host.c
index e4faf90feaf5..d0fe5076d977 100644
--- a/drivers/pci/controller/pcie-rcar-host.c
+++ b/drivers/pci/controller/pcie-rcar-host.c
@@ -92,7 +92,11 @@ static int rcar_pcie_wakeup(struct device *pcie_dev, void __iomem *pcie_base)
 		writel(L1IATN, pcie_base + PMCTLR);
 		ret = readl_poll_timeout_atomic(pcie_base + PMSR, val,
 						val & L1FAEG, 10, 1000);
-		WARN(ret, "Timeout waiting for L1 link state, ret=%d\n", ret);
+		if (ret) {
+			dev_warn_ratelimited(pcie_dev,
+					     "Timeout waiting for L1 link state, ret=%d\n",
+					     ret);
+		}
 		writel(L1FAEG | PMEL1RX, pcie_base + PMSR);
 	}
 
diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c
index 1aa84035a8bc..bdce1ba7c1bc 100644
--- a/drivers/pci/controller/pcie-rockchip.c
+++ b/drivers/pci/controller/pcie-rockchip.c
@@ -120,7 +120,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip)
 
 	if (rockchip->is_rc) {
 		rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep",
-							    GPIOD_OUT_HIGH);
+							    GPIOD_OUT_LOW);
 		if (IS_ERR(rockchip->ep_gpio))
 			return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio),
 					     "failed to get ep GPIO\n");
diff --git a/drivers/pci/endpoint/functions/pci-epf-vntb.c b/drivers/pci/endpoint/functions/pci-epf-vntb.c
index b4c1a4f6029d..6708d2e789cb 100644
--- a/drivers/pci/endpoint/functions/pci-epf-vntb.c
+++ b/drivers/pci/endpoint/functions/pci-epf-vntb.c
@@ -813,8 +813,9 @@ static int epf_ntb_epc_init(struct epf_ntb *ntb)
  */
 static void epf_ntb_epc_cleanup(struct epf_ntb *ntb)
 {
-	epf_ntb_db_bar_clear(ntb);
 	epf_ntb_mw_bar_clear(ntb, ntb->num_mws);
+	epf_ntb_db_bar_clear(ntb);
+	epf_ntb_config_sspad_bar_clear(ntb);
 }
 
 #define EPF_NTB_R(_name)						\
@@ -1032,8 +1033,10 @@ static int vpci_scan_bus(void *sysdata)
 	struct epf_ntb *ndev = sysdata;
 
 	vpci_bus = pci_scan_bus(ndev->vbus_number, &vpci_ops, sysdata);
-	if (vpci_bus)
-		pr_err("create pci bus\n");
+	if (!vpci_bus) {
+		pr_err("create pci bus failed\n");
+		return -EINVAL;
+	}
 
 	pci_bus_add_devices(vpci_bus);
 
@@ -1352,13 +1355,19 @@ static int epf_ntb_bind(struct pci_epf *epf)
 	ret = pci_register_driver(&vntb_pci_driver);
 	if (ret) {
 		dev_err(dev, "failure register vntb pci driver\n");
-		goto err_bar_alloc;
+		goto err_epc_cleanup;
 	}
 
-	vpci_scan_bus(ntb);
+	ret = vpci_scan_bus(ntb);
+	if (ret)
+		goto err_unregister;
 
 	return 0;
 
+err_unregister:
+	pci_unregister_driver(&vntb_pci_driver);
+err_epc_cleanup:
+	epf_ntb_epc_cleanup(ntb);
 err_bar_alloc:
 	epf_ntb_config_spad_bar_free(ntb);
 
diff --git a/drivers/pci/pci.c b/drivers/pci/pci.c
index 0399204941db..2d373ab3ccb3 100644
--- a/drivers/pci/pci.c
+++ b/drivers/pci/pci.c
@@ -5007,7 +5007,7 @@ static int pci_bus_max_d3cold_delay(const struct pci_bus *bus)
 int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type,
 				      int timeout)
 {
-	struct pci_dev *child;
+	struct pci_dev *child __free(pci_dev_put) = NULL;
 	int delay;
 
 	if (pci_dev_is_disconnected(dev))
@@ -5036,8 +5036,8 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type,
 		return 0;
 	}
 
-	child = list_first_entry(&dev->subordinate->devices, struct pci_dev,
-				 bus_list);
+	child = pci_dev_get(list_first_entry(&dev->subordinate->devices,
+					     struct pci_dev, bus_list));
 	up_read(&pci_bus_sem);
 
 	/*
diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c
index c690572b10ce..b8cb990044fb 100644
--- a/drivers/pci/setup-bus.c
+++ b/drivers/pci/setup-bus.c
@@ -824,11 +824,9 @@ static resource_size_t calculate_memsize(resource_size_t size,
 		size = min_size;
 	if (old_size == 1)
 		old_size = 0;
-	if (size < old_size)
-		size = old_size;
 
-	size = ALIGN(max(size, add_size) + children_add_size, align);
-	return size;
+	size = max(size, add_size) + children_add_size;
+	return ALIGN(max(size, old_size), align);
 }
 
 resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus,
diff --git a/drivers/phy/cadence/phy-cadence-torrent.c b/drivers/phy/cadence/phy-cadence-torrent.c
index f099053c583c..34a380ce533a 100644
--- a/drivers/phy/cadence/phy-cadence-torrent.c
+++ b/drivers/phy/cadence/phy-cadence-torrent.c
@@ -1087,6 +1087,9 @@ static int cdns_torrent_dp_set_power_state(struct cdns_torrent_phy *cdns_phy,
 	ret = regmap_read_poll_timeout(regmap, PHY_PMA_XCVR_POWER_STATE_ACK,
 				       read_val, (read_val & mask) == value, 0,
 				       POLL_TIMEOUT_US);
+	if (ret)
+		return ret;
+
 	cdns_torrent_dp_write(regmap, PHY_PMA_XCVR_POWER_STATE_REQ, 0x00000000);
 	ndelay(100);
 
diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c
index db5fc55a5c96..3b6051d63218 100644
--- a/drivers/pinctrl/core.c
+++ b/drivers/pinctrl/core.c
@@ -2062,6 +2062,14 @@ pinctrl_init_controller(struct pinctrl_desc *pctldesc, struct device *dev,
 	return ERR_PTR(ret);
 }
 
+static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc)
+{
+	pinctrl_free_pindescs(pctldev, pctldesc->pins,
+			      pctldesc->npins);
+	mutex_destroy(&pctldev->mutex);
+	kfree(pctldev);
+}
+
 static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev)
 {
 	pctldev->p = create_pinctrl(pctldev->dev, pctldev);
@@ -2142,8 +2150,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc,
 		return pctldev;
 
 	error = pinctrl_enable(pctldev);
-	if (error)
+	if (error) {
+		pinctrl_uninit_controller(pctldev, pctldesc);
 		return ERR_PTR(error);
+	}
 
 	return pctldev;
 }
diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c
index 735cedd0958a..5b0fcf15f280 100644
--- a/drivers/pinctrl/freescale/pinctrl-mxs.c
+++ b/drivers/pinctrl/freescale/pinctrl-mxs.c
@@ -405,8 +405,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev,
 	int ret;
 	u32 val;
 
-	child = of_get_next_child(np, NULL);
-	if (!child) {
+	val = of_get_child_count(np);
+	if (val == 0) {
 		dev_err(&pdev->dev, "no group is defined\n");
 		return -ENOENT;
 	}
diff --git a/drivers/pinctrl/pinctrl-rockchip.c b/drivers/pinctrl/pinctrl-rockchip.c
index d26682f21ad1..6d140a60888c 100644
--- a/drivers/pinctrl/pinctrl-rockchip.c
+++ b/drivers/pinctrl/pinctrl-rockchip.c
@@ -916,9 +916,8 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
 	RK_MUXROUTE_SAME(0, RK_PC3, 1, 0x314, BIT(16 + 0) | BIT(0)), /* rtc_clk */
 	RK_MUXROUTE_SAME(1, RK_PC6, 2, 0x314, BIT(16 + 2) | BIT(16 + 3)), /* uart2_rxm0 */
 	RK_MUXROUTE_SAME(4, RK_PD2, 2, 0x314, BIT(16 + 2) | BIT(16 + 3) | BIT(2)), /* uart2_rxm1 */
-	RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x608, BIT(16 + 8) | BIT(16 + 9)), /* i2c3_sdam0 */
-	RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(8)), /* i2c3_sdam1 */
-	RK_MUXROUTE_SAME(2, RK_PA0, 3, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(9)), /* i2c3_sdam2 */
+	RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x314, BIT(16 + 4)), /* i2c3_sdam0 */
+	RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x314, BIT(16 + 4) | BIT(4)), /* i2c3_sdam1 */
 	RK_MUXROUTE_SAME(1, RK_PA3, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclktxm0 */
 	RK_MUXROUTE_SAME(1, RK_PA4, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclkrxm0 */
 	RK_MUXROUTE_SAME(1, RK_PB5, 2, 0x308, BIT(16 + 3) | BIT(3)), /* i2s-8ch-1-sclktxm1 */
@@ -927,18 +926,6 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
 	RK_MUXROUTE_SAME(1, RK_PB6, 4, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* pdm-clkm1 */
 	RK_MUXROUTE_SAME(2, RK_PA6, 2, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* pdm-clkm2 */
 	RK_MUXROUTE_SAME(2, RK_PA4, 3, 0x600, BIT(16 + 2) | BIT(2)), /* pdm-clkm-m2 */
-	RK_MUXROUTE_SAME(3, RK_PB2, 3, 0x314, BIT(16 + 9)), /* spi1_miso */
-	RK_MUXROUTE_SAME(2, RK_PA4, 2, 0x314, BIT(16 + 9) | BIT(9)), /* spi1_miso_m1 */
-	RK_MUXROUTE_SAME(0, RK_PB3, 3, 0x314, BIT(16 + 10) | BIT(16 + 11)), /* owire_m0 */
-	RK_MUXROUTE_SAME(1, RK_PC6, 7, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(10)), /* owire_m1 */
-	RK_MUXROUTE_SAME(2, RK_PA2, 5, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(11)), /* owire_m2 */
-	RK_MUXROUTE_SAME(0, RK_PB3, 2, 0x314, BIT(16 + 12) | BIT(16 + 13)), /* can_rxd_m0 */
-	RK_MUXROUTE_SAME(1, RK_PC6, 5, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* can_rxd_m1 */
-	RK_MUXROUTE_SAME(2, RK_PA2, 4, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* can_rxd_m2 */
-	RK_MUXROUTE_SAME(1, RK_PC4, 3, 0x314, BIT(16 + 14)), /* mac_rxd0_m0 */
-	RK_MUXROUTE_SAME(4, RK_PA2, 2, 0x314, BIT(16 + 14) | BIT(14)), /* mac_rxd0_m1 */
-	RK_MUXROUTE_SAME(3, RK_PB4, 4, 0x314, BIT(16 + 15)), /* uart3_rx */
-	RK_MUXROUTE_SAME(0, RK_PC1, 3, 0x314, BIT(16 + 15) | BIT(15)), /* uart3_rx_m1 */
 };
 
 static struct rockchip_mux_route_data rk3328_mux_route_data[] = {
diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c
index 9ad8f7020614..cd23479f352a 100644
--- a/drivers/pinctrl/pinctrl-single.c
+++ b/drivers/pinctrl/pinctrl-single.c
@@ -1328,7 +1328,6 @@ static void pcs_irq_free(struct pcs_device *pcs)
 static void pcs_free_resources(struct pcs_device *pcs)
 {
 	pcs_irq_free(pcs);
-	pinctrl_unregister(pcs->pctl);
 
 #if IS_BUILTIN(CONFIG_PINCTRL_SINGLE)
 	if (pcs->missing_nr_pinctrl_cells)
@@ -1885,7 +1884,7 @@ static int pcs_probe(struct platform_device *pdev)
 	if (ret < 0)
 		goto free;
 
-	ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl);
+	ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl);
 	if (ret) {
 		dev_err(pcs->dev, "could not register single pinctrl driver\n");
 		goto free;
@@ -1918,8 +1917,10 @@ static int pcs_probe(struct platform_device *pdev)
 
 	dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size);
 
-	return pinctrl_enable(pcs->pctl);
+	if (pinctrl_enable(pcs->pctl))
+		goto free;
 
+	return 0;
 free:
 	pcs_free_resources(pcs);
 
diff --git a/drivers/pinctrl/renesas/pfc-r8a779g0.c b/drivers/pinctrl/renesas/pfc-r8a779g0.c
index acf7664ea835..595a5a4b02ec 100644
--- a/drivers/pinctrl/renesas/pfc-r8a779g0.c
+++ b/drivers/pinctrl/renesas/pfc-r8a779g0.c
@@ -62,20 +62,20 @@
 #define GPSR0_9		F_(MSIOF5_SYNC,		IP1SR0_7_4)
 #define GPSR0_8		F_(MSIOF5_SS1,		IP1SR0_3_0)
 #define GPSR0_7		F_(MSIOF5_SS2,		IP0SR0_31_28)
-#define GPSR0_6		F_(IRQ0,		IP0SR0_27_24)
-#define GPSR0_5		F_(IRQ1,		IP0SR0_23_20)
-#define GPSR0_4		F_(IRQ2,		IP0SR0_19_16)
-#define GPSR0_3		F_(IRQ3,		IP0SR0_15_12)
+#define GPSR0_6		F_(IRQ0_A,		IP0SR0_27_24)
+#define GPSR0_5		F_(IRQ1_A,		IP0SR0_23_20)
+#define GPSR0_4		F_(IRQ2_A,		IP0SR0_19_16)
+#define GPSR0_3		F_(IRQ3_A,		IP0SR0_15_12)
 #define GPSR0_2		F_(GP0_02,		IP0SR0_11_8)
 #define GPSR0_1		F_(GP0_01,		IP0SR0_7_4)
 #define GPSR0_0		F_(GP0_00,		IP0SR0_3_0)
 
 /* GPSR1 */
-#define GPSR1_28	F_(HTX3,		IP3SR1_19_16)
-#define GPSR1_27	F_(HCTS3_N,		IP3SR1_15_12)
-#define GPSR1_26	F_(HRTS3_N,		IP3SR1_11_8)
-#define GPSR1_25	F_(HSCK3,		IP3SR1_7_4)
-#define GPSR1_24	F_(HRX3,		IP3SR1_3_0)
+#define GPSR1_28	F_(HTX3_A,		IP3SR1_19_16)
+#define GPSR1_27	F_(HCTS3_N_A,		IP3SR1_15_12)
+#define GPSR1_26	F_(HRTS3_N_A,		IP3SR1_11_8)
+#define GPSR1_25	F_(HSCK3_A,		IP3SR1_7_4)
+#define GPSR1_24	F_(HRX3_A,		IP3SR1_3_0)
 #define GPSR1_23	F_(GP1_23,		IP2SR1_31_28)
 #define GPSR1_22	F_(AUDIO_CLKIN,		IP2SR1_27_24)
 #define GPSR1_21	F_(AUDIO_CLKOUT,	IP2SR1_23_20)
@@ -113,14 +113,14 @@
 #define GPSR2_11	F_(CANFD0_RX,		IP1SR2_15_12)
 #define GPSR2_10	F_(CANFD0_TX,		IP1SR2_11_8)
 #define GPSR2_9		F_(CAN_CLK,		IP1SR2_7_4)
-#define GPSR2_8		F_(TPU0TO0,		IP1SR2_3_0)
-#define GPSR2_7		F_(TPU0TO1,		IP0SR2_31_28)
+#define GPSR2_8		F_(TPU0TO0_A,		IP1SR2_3_0)
+#define GPSR2_7		F_(TPU0TO1_A,		IP0SR2_31_28)
 #define GPSR2_6		F_(FXR_TXDB,		IP0SR2_27_24)
-#define GPSR2_5		F_(FXR_TXENB_N,		IP0SR2_23_20)
+#define GPSR2_5		F_(FXR_TXENB_N_A,	IP0SR2_23_20)
 #define GPSR2_4		F_(RXDB_EXTFXR,		IP0SR2_19_16)
 #define GPSR2_3		F_(CLK_EXTFXR,		IP0SR2_15_12)
 #define GPSR2_2		F_(RXDA_EXTFXR,		IP0SR2_11_8)
-#define GPSR2_1		F_(FXR_TXENA_N,		IP0SR2_7_4)
+#define GPSR2_1		F_(FXR_TXENA_N_A,	IP0SR2_7_4)
 #define GPSR2_0		F_(FXR_TXDA,		IP0SR2_3_0)
 
 /* GPSR3 */
@@ -269,13 +269,13 @@
 
 /* SR0 */
 /* IP0SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR0_3_0	F_(0, 0)		FM(ERROROUTC_N_B)	FM(TCLK2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_3_0	F_(0, 0)		FM(ERROROUTC_N_B)	FM(TCLK2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_7_4	F_(0, 0)		FM(MSIOF3_SS1)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_11_8	F_(0, 0)		FM(MSIOF3_SS2)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_15_12	FM(IRQ3)		FM(MSIOF3_SCK)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_19_16	FM(IRQ2)		FM(MSIOF3_TXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_23_20	FM(IRQ1)		FM(MSIOF3_RXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_27_24	FM(IRQ0)		FM(MSIOF3_SYNC)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_15_12	FM(IRQ3_A)		FM(MSIOF3_SCK)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_19_16	FM(IRQ2_A)		FM(MSIOF3_TXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_23_20	FM(IRQ1_A)		FM(MSIOF3_RXD)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_27_24	FM(IRQ0_A)		FM(MSIOF3_SYNC)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR0_31_28	FM(MSIOF5_SS2)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -284,72 +284,72 @@
 #define IP1SR0_11_8	FM(MSIOF5_TXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR0_15_12	FM(MSIOF5_SCK)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR0_19_16	FM(MSIOF5_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_23_20	FM(MSIOF2_SS2)		FM(TCLK1)		FM(IRQ2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_27_24	FM(MSIOF2_SS1)		FM(HTX1)		FM(TX1)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_31_28	FM(MSIOF2_SYNC)		FM(HRX1)		FM(RX1)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_23_20	FM(MSIOF2_SS2)		FM(TCLK1_A)		FM(IRQ2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_27_24	FM(MSIOF2_SS1)		FM(HTX1_A)		FM(TX1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_31_28	FM(MSIOF2_SYNC)		FM(HRX1_A)		FM(RX1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR0 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP2SR0_3_0	FM(MSIOF2_TXD)		FM(HCTS1_N)		FM(CTS1_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_7_4	FM(MSIOF2_SCK)		FM(HRTS1_N)		FM(RTS1_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_11_8	FM(MSIOF2_RXD)		FM(HSCK1)		FM(SCK1)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_3_0	FM(MSIOF2_TXD)		FM(HCTS1_N_A)		FM(CTS1_N_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_7_4	FM(MSIOF2_SCK)		FM(HRTS1_N_A)		FM(RTS1_N_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_11_8	FM(MSIOF2_RXD)		FM(HSCK1_A)		FM(SCK1_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* SR1 */
 /* IP0SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR1_3_0	FM(MSIOF1_SS2)		FM(HTX3_A)		FM(TX3)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_7_4	FM(MSIOF1_SS1)		FM(HCTS3_N_A)		FM(RX3)			F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_11_8	FM(MSIOF1_SYNC)		FM(HRTS3_N_A)		FM(RTS3_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_15_12	FM(MSIOF1_SCK)		FM(HSCK3_A)		FM(CTS3_N)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_19_16	FM(MSIOF1_TXD)		FM(HRX3_A)		FM(SCK3)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_3_0	FM(MSIOF1_SS2)		FM(HTX3_B)		FM(TX3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_7_4	FM(MSIOF1_SS1)		FM(HCTS3_N_B)		FM(RX3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_11_8	FM(MSIOF1_SYNC)		FM(HRTS3_N_B)		FM(RTS3_N_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_15_12	FM(MSIOF1_SCK)		FM(HSCK3_B)		FM(CTS3_N_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_19_16	FM(MSIOF1_TXD)		FM(HRX3_B)		FM(SCK3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR1_23_20	FM(MSIOF1_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_27_24	FM(MSIOF0_SS2)		FM(HTX1_X)		FM(TX1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_31_28	FM(MSIOF0_SS1)		FM(HRX1_X)		FM(RX1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_27_24	FM(MSIOF0_SS2)		FM(HTX1_B)		FM(TX1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_31_28	FM(MSIOF0_SS1)		FM(HRX1_B)		FM(RX1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP1SR1_3_0	FM(MSIOF0_SYNC)		FM(HCTS1_N_X)		FM(CTS1_N_X)		FM(CANFD5_TX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_7_4	FM(MSIOF0_TXD)		FM(HRTS1_N_X)		FM(RTS1_N_X)		FM(CANFD5_RX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_11_8	FM(MSIOF0_SCK)		FM(HSCK1_X)		FM(SCK1_X)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_3_0	FM(MSIOF0_SYNC)		FM(HCTS1_N_B)		FM(CTS1_N_B)		FM(CANFD5_TX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_7_4	FM(MSIOF0_TXD)		FM(HRTS1_N_B)		FM(RTS1_N_B)		FM(CANFD5_RX_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_11_8	FM(MSIOF0_SCK)		FM(HSCK1_B)		FM(SCK1_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR1_15_12	FM(MSIOF0_RXD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR1_19_16	FM(HTX0)		FM(TX0)			F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_23_20	FM(HCTS0_N)		FM(CTS0_N)		FM(PWM8_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_27_24	FM(HRTS0_N)		FM(RTS0_N)		FM(PWM9_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_31_28	FM(HSCK0)		FM(SCK0)		FM(PWM0_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_23_20	FM(HCTS0_N)		FM(CTS0_N)		FM(PWM8)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_27_24	FM(HRTS0_N)		FM(RTS0_N)		FM(PWM9)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_31_28	FM(HSCK0)		FM(SCK0)		FM(PWM0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
 #define IP2SR1_3_0	FM(HRX0)		FM(RX0)			F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP2SR1_7_4	FM(SCIF_CLK)		FM(IRQ4_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_11_8	FM(SSI_SCK)		FM(TCLK3)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_15_12	FM(SSI_WS)		FM(TCLK4)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_19_16	FM(SSI_SD)		FM(IRQ0_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_23_20	FM(AUDIO_CLKOUT)	FM(IRQ1_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_11_8	FM(SSI_SCK)		FM(TCLK3_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_15_12	FM(SSI_WS)		FM(TCLK4_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_19_16	FM(SSI_SD)		FM(IRQ0_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_23_20	FM(AUDIO_CLKOUT)	FM(IRQ1_B)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP2SR1_27_24	FM(AUDIO_CLKIN)		FM(PWM3_A)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_31_28	F_(0, 0)		FM(TCLK2)		FM(MSIOF4_SS1)		FM(IRQ3_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_31_28	F_(0, 0)		FM(TCLK2_A)		FM(MSIOF4_SS1)		FM(IRQ3_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP3SR1 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP3SR1_3_0	FM(HRX3)		FM(SCK3_A)		FM(MSIOF4_SS2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_7_4	FM(HSCK3)		FM(CTS3_N_A)		FM(MSIOF4_SCK)		FM(TPU0TO0_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_11_8	FM(HRTS3_N)		FM(RTS3_N_A)		FM(MSIOF4_TXD)		FM(TPU0TO1_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_15_12	FM(HCTS3_N)		FM(RX3_A)		FM(MSIOF4_RXD)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_19_16	FM(HTX3)		FM(TX3_A)		FM(MSIOF4_SYNC)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_3_0	FM(HRX3_A)		FM(SCK3_A)		FM(MSIOF4_SS2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_7_4	FM(HSCK3_A)		FM(CTS3_N_A)		FM(MSIOF4_SCK)		FM(TPU0TO0_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_11_8	FM(HRTS3_N_A)		FM(RTS3_N_A)		FM(MSIOF4_TXD)		FM(TPU0TO1_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_15_12	FM(HCTS3_N_A)		FM(RX3_A)		FM(MSIOF4_RXD)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_19_16	FM(HTX3_A)		FM(TX3_A)		FM(MSIOF4_SYNC)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* SR2 */
 /* IP0SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP0SR2_3_0	FM(FXR_TXDA)		FM(CANFD1_TX)		FM(TPU0TO2_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_7_4	FM(FXR_TXENA_N)		FM(CANFD1_RX)		FM(TPU0TO3_A)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_11_8	FM(RXDA_EXTFXR)		FM(CANFD5_TX)		FM(IRQ5)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_15_12	FM(CLK_EXTFXR)		FM(CANFD5_RX)		FM(IRQ4_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_3_0	FM(FXR_TXDA)		FM(CANFD1_TX)		FM(TPU0TO2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_7_4	FM(FXR_TXENA_N_A)	FM(CANFD1_RX)		FM(TPU0TO3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_11_8	FM(RXDA_EXTFXR)		FM(CANFD5_TX_A)		FM(IRQ5)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_15_12	FM(CLK_EXTFXR)		FM(CANFD5_RX_A)		FM(IRQ4_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR2_19_16	FM(RXDB_EXTFXR)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_23_20	FM(FXR_TXENB_N)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_23_20	FM(FXR_TXENB_N_A)	F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP0SR2_27_24	FM(FXR_TXDB)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_31_28	FM(TPU0TO1)		FM(CANFD6_TX)		F_(0, 0)		FM(TCLK2_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_31_28	FM(TPU0TO1_A)		FM(CANFD6_TX)		F_(0, 0)		FM(TCLK2_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP1SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
-#define IP1SR2_3_0	FM(TPU0TO0)		FM(CANFD6_RX)		F_(0, 0)		FM(TCLK1_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_7_4	FM(CAN_CLK)		FM(FXR_TXENA_N_X)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_11_8	FM(CANFD0_TX)		FM(FXR_TXENB_N_X)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_3_0	FM(TPU0TO0_A)		FM(CANFD6_RX)		F_(0, 0)		FM(TCLK1_B)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_7_4	FM(CAN_CLK)		FM(FXR_TXENA_N_B)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_11_8	FM(CANFD0_TX)		FM(FXR_TXENB_N_B)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR2_15_12	FM(CANFD0_RX)		FM(STPWT_EXTFXR)	F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_19_16	FM(CANFD2_TX)		FM(TPU0TO2)		F_(0, 0)		FM(TCLK3_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_23_20	FM(CANFD2_RX)		FM(TPU0TO3)		FM(PWM1_B)		FM(TCLK4_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_27_24	FM(CANFD3_TX)		F_(0, 0)		FM(PWM2_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_19_16	FM(CANFD2_TX)		FM(TPU0TO2_A)		F_(0, 0)		FM(TCLK3_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_23_20	FM(CANFD2_RX)		FM(TPU0TO3_A)		FM(PWM1_B)		FM(TCLK4_C)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_27_24	FM(CANFD3_TX)		F_(0, 0)		FM(PWM2)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR2_31_28	FM(CANFD3_RX)		F_(0, 0)		FM(PWM3_B)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR2 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -375,8 +375,8 @@
 #define IP1SR3_11_8	FM(MMC_SD_CMD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_15_12	FM(SD_CD)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_19_16	FM(SD_WP)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_23_20	FM(IPC_CLKIN)		FM(IPC_CLKEN_IN)	FM(PWM1_A)		FM(TCLK3_X)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_27_24	FM(IPC_CLKOUT)		FM(IPC_CLKEN_OUT)	FM(ERROROUTC_N_A)	FM(TCLK4_X)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_23_20	FM(IPC_CLKIN)		FM(IPC_CLKEN_IN)	FM(PWM1_A)		FM(TCLK3_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_27_24	FM(IPC_CLKOUT)		FM(IPC_CLKEN_OUT)	FM(ERROROUTC_N_A)	FM(TCLK4_A)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 #define IP1SR3_31_28	FM(QSPI0_SSL)		F_(0, 0)		F_(0, 0)		F_(0, 0)	F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
 
 /* IP2SR3 */		/* 0 */			/* 1 */			/* 2 */			/* 3		4	 5	  6	   7	    8	     9	      A	       B	C	 D	  E	   F */
@@ -712,22 +712,22 @@ static const u16 pinmux_data[] = {
 
 	/* IP0SR0 */
 	PINMUX_IPSR_GPSR(IP0SR0_3_0,	ERROROUTC_N_B),
-	PINMUX_IPSR_GPSR(IP0SR0_3_0,	TCLK2_A),
+	PINMUX_IPSR_GPSR(IP0SR0_3_0,	TCLK2_B),
 
 	PINMUX_IPSR_GPSR(IP0SR0_7_4,	MSIOF3_SS1),
 
 	PINMUX_IPSR_GPSR(IP0SR0_11_8,	MSIOF3_SS2),
 
-	PINMUX_IPSR_GPSR(IP0SR0_15_12,	IRQ3),
+	PINMUX_IPSR_GPSR(IP0SR0_15_12,	IRQ3_A),
 	PINMUX_IPSR_GPSR(IP0SR0_15_12,	MSIOF3_SCK),
 
-	PINMUX_IPSR_GPSR(IP0SR0_19_16,	IRQ2),
+	PINMUX_IPSR_GPSR(IP0SR0_19_16,	IRQ2_A),
 	PINMUX_IPSR_GPSR(IP0SR0_19_16,	MSIOF3_TXD),
 
-	PINMUX_IPSR_GPSR(IP0SR0_23_20,	IRQ1),
+	PINMUX_IPSR_GPSR(IP0SR0_23_20,	IRQ1_A),
 	PINMUX_IPSR_GPSR(IP0SR0_23_20,	MSIOF3_RXD),
 
-	PINMUX_IPSR_GPSR(IP0SR0_27_24,	IRQ0),
+	PINMUX_IPSR_GPSR(IP0SR0_27_24,	IRQ0_A),
 	PINMUX_IPSR_GPSR(IP0SR0_27_24,	MSIOF3_SYNC),
 
 	PINMUX_IPSR_GPSR(IP0SR0_31_28,	MSIOF5_SS2),
@@ -744,75 +744,75 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP1SR0_19_16,	MSIOF5_RXD),
 
 	PINMUX_IPSR_GPSR(IP1SR0_23_20,	MSIOF2_SS2),
-	PINMUX_IPSR_GPSR(IP1SR0_23_20,	TCLK1),
-	PINMUX_IPSR_GPSR(IP1SR0_23_20,	IRQ2_A),
+	PINMUX_IPSR_GPSR(IP1SR0_23_20,	TCLK1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_23_20,	IRQ2_B),
 
 	PINMUX_IPSR_GPSR(IP1SR0_27_24,	MSIOF2_SS1),
-	PINMUX_IPSR_GPSR(IP1SR0_27_24,	HTX1),
-	PINMUX_IPSR_GPSR(IP1SR0_27_24,	TX1),
+	PINMUX_IPSR_GPSR(IP1SR0_27_24,	HTX1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_27_24,	TX1_A),
 
 	PINMUX_IPSR_GPSR(IP1SR0_31_28,	MSIOF2_SYNC),
-	PINMUX_IPSR_GPSR(IP1SR0_31_28,	HRX1),
-	PINMUX_IPSR_GPSR(IP1SR0_31_28,	RX1),
+	PINMUX_IPSR_GPSR(IP1SR0_31_28,	HRX1_A),
+	PINMUX_IPSR_GPSR(IP1SR0_31_28,	RX1_A),
 
 	/* IP2SR0 */
 	PINMUX_IPSR_GPSR(IP2SR0_3_0,	MSIOF2_TXD),
-	PINMUX_IPSR_GPSR(IP2SR0_3_0,	HCTS1_N),
-	PINMUX_IPSR_GPSR(IP2SR0_3_0,	CTS1_N),
+	PINMUX_IPSR_GPSR(IP2SR0_3_0,	HCTS1_N_A),
+	PINMUX_IPSR_GPSR(IP2SR0_3_0,	CTS1_N_A),
 
 	PINMUX_IPSR_GPSR(IP2SR0_7_4,	MSIOF2_SCK),
-	PINMUX_IPSR_GPSR(IP2SR0_7_4,	HRTS1_N),
-	PINMUX_IPSR_GPSR(IP2SR0_7_4,	RTS1_N),
+	PINMUX_IPSR_GPSR(IP2SR0_7_4,	HRTS1_N_A),
+	PINMUX_IPSR_GPSR(IP2SR0_7_4,	RTS1_N_A),
 
 	PINMUX_IPSR_GPSR(IP2SR0_11_8,	MSIOF2_RXD),
-	PINMUX_IPSR_GPSR(IP2SR0_11_8,	HSCK1),
-	PINMUX_IPSR_GPSR(IP2SR0_11_8,	SCK1),
+	PINMUX_IPSR_GPSR(IP2SR0_11_8,	HSCK1_A),
+	PINMUX_IPSR_GPSR(IP2SR0_11_8,	SCK1_A),
 
 	/* IP0SR1 */
 	PINMUX_IPSR_GPSR(IP0SR1_3_0,	MSIOF1_SS2),
-	PINMUX_IPSR_GPSR(IP0SR1_3_0,	HTX3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_3_0,	TX3),
+	PINMUX_IPSR_GPSR(IP0SR1_3_0,	HTX3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_3_0,	TX3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_7_4,	MSIOF1_SS1),
-	PINMUX_IPSR_GPSR(IP0SR1_7_4,	HCTS3_N_A),
-	PINMUX_IPSR_GPSR(IP0SR1_7_4,	RX3),
+	PINMUX_IPSR_GPSR(IP0SR1_7_4,	HCTS3_N_B),
+	PINMUX_IPSR_GPSR(IP0SR1_7_4,	RX3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_11_8,	MSIOF1_SYNC),
-	PINMUX_IPSR_GPSR(IP0SR1_11_8,	HRTS3_N_A),
-	PINMUX_IPSR_GPSR(IP0SR1_11_8,	RTS3_N),
+	PINMUX_IPSR_GPSR(IP0SR1_11_8,	HRTS3_N_B),
+	PINMUX_IPSR_GPSR(IP0SR1_11_8,	RTS3_N_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_15_12,	MSIOF1_SCK),
-	PINMUX_IPSR_GPSR(IP0SR1_15_12,	HSCK3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_15_12,	CTS3_N),
+	PINMUX_IPSR_GPSR(IP0SR1_15_12,	HSCK3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_15_12,	CTS3_N_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_19_16,	MSIOF1_TXD),
-	PINMUX_IPSR_GPSR(IP0SR1_19_16,	HRX3_A),
-	PINMUX_IPSR_GPSR(IP0SR1_19_16,	SCK3),
+	PINMUX_IPSR_GPSR(IP0SR1_19_16,	HRX3_B),
+	PINMUX_IPSR_GPSR(IP0SR1_19_16,	SCK3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_23_20,	MSIOF1_RXD),
 
 	PINMUX_IPSR_GPSR(IP0SR1_27_24,	MSIOF0_SS2),
-	PINMUX_IPSR_GPSR(IP0SR1_27_24,	HTX1_X),
-	PINMUX_IPSR_GPSR(IP0SR1_27_24,	TX1_X),
+	PINMUX_IPSR_GPSR(IP0SR1_27_24,	HTX1_B),
+	PINMUX_IPSR_GPSR(IP0SR1_27_24,	TX1_B),
 
 	PINMUX_IPSR_GPSR(IP0SR1_31_28,	MSIOF0_SS1),
-	PINMUX_IPSR_GPSR(IP0SR1_31_28,	HRX1_X),
-	PINMUX_IPSR_GPSR(IP0SR1_31_28,	RX1_X),
+	PINMUX_IPSR_GPSR(IP0SR1_31_28,	HRX1_B),
+	PINMUX_IPSR_GPSR(IP0SR1_31_28,	RX1_B),
 
 	/* IP1SR1 */
 	PINMUX_IPSR_GPSR(IP1SR1_3_0,	MSIOF0_SYNC),
-	PINMUX_IPSR_GPSR(IP1SR1_3_0,	HCTS1_N_X),
-	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CTS1_N_X),
+	PINMUX_IPSR_GPSR(IP1SR1_3_0,	HCTS1_N_B),
+	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CTS1_N_B),
 	PINMUX_IPSR_GPSR(IP1SR1_3_0,	CANFD5_TX_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_7_4,	MSIOF0_TXD),
-	PINMUX_IPSR_GPSR(IP1SR1_7_4,	HRTS1_N_X),
-	PINMUX_IPSR_GPSR(IP1SR1_7_4,	RTS1_N_X),
+	PINMUX_IPSR_GPSR(IP1SR1_7_4,	HRTS1_N_B),
+	PINMUX_IPSR_GPSR(IP1SR1_7_4,	RTS1_N_B),
 	PINMUX_IPSR_GPSR(IP1SR1_7_4,	CANFD5_RX_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_11_8,	MSIOF0_SCK),
-	PINMUX_IPSR_GPSR(IP1SR1_11_8,	HSCK1_X),
-	PINMUX_IPSR_GPSR(IP1SR1_11_8,	SCK1_X),
+	PINMUX_IPSR_GPSR(IP1SR1_11_8,	HSCK1_B),
+	PINMUX_IPSR_GPSR(IP1SR1_11_8,	SCK1_B),
 
 	PINMUX_IPSR_GPSR(IP1SR1_15_12,	MSIOF0_RXD),
 
@@ -821,15 +821,15 @@ static const u16 pinmux_data[] = {
 
 	PINMUX_IPSR_GPSR(IP1SR1_23_20,	HCTS0_N),
 	PINMUX_IPSR_GPSR(IP1SR1_23_20,	CTS0_N),
-	PINMUX_IPSR_GPSR(IP1SR1_23_20,	PWM8_A),
+	PINMUX_IPSR_GPSR(IP1SR1_23_20,	PWM8),
 
 	PINMUX_IPSR_GPSR(IP1SR1_27_24,	HRTS0_N),
 	PINMUX_IPSR_GPSR(IP1SR1_27_24,	RTS0_N),
-	PINMUX_IPSR_GPSR(IP1SR1_27_24,	PWM9_A),
+	PINMUX_IPSR_GPSR(IP1SR1_27_24,	PWM9),
 
 	PINMUX_IPSR_GPSR(IP1SR1_31_28,	HSCK0),
 	PINMUX_IPSR_GPSR(IP1SR1_31_28,	SCK0),
-	PINMUX_IPSR_GPSR(IP1SR1_31_28,	PWM0_A),
+	PINMUX_IPSR_GPSR(IP1SR1_31_28,	PWM0),
 
 	/* IP2SR1 */
 	PINMUX_IPSR_GPSR(IP2SR1_3_0,	HRX0),
@@ -839,99 +839,99 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP2SR1_7_4,	IRQ4_A),
 
 	PINMUX_IPSR_GPSR(IP2SR1_11_8,	SSI_SCK),
-	PINMUX_IPSR_GPSR(IP2SR1_11_8,	TCLK3),
+	PINMUX_IPSR_GPSR(IP2SR1_11_8,	TCLK3_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_15_12,	SSI_WS),
-	PINMUX_IPSR_GPSR(IP2SR1_15_12,	TCLK4),
+	PINMUX_IPSR_GPSR(IP2SR1_15_12,	TCLK4_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_19_16,	SSI_SD),
-	PINMUX_IPSR_GPSR(IP2SR1_19_16,	IRQ0_A),
+	PINMUX_IPSR_GPSR(IP2SR1_19_16,	IRQ0_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_23_20,	AUDIO_CLKOUT),
-	PINMUX_IPSR_GPSR(IP2SR1_23_20,	IRQ1_A),
+	PINMUX_IPSR_GPSR(IP2SR1_23_20,	IRQ1_B),
 
 	PINMUX_IPSR_GPSR(IP2SR1_27_24,	AUDIO_CLKIN),
 	PINMUX_IPSR_GPSR(IP2SR1_27_24,	PWM3_A),
 
-	PINMUX_IPSR_GPSR(IP2SR1_31_28,	TCLK2),
+	PINMUX_IPSR_GPSR(IP2SR1_31_28,	TCLK2_A),
 	PINMUX_IPSR_GPSR(IP2SR1_31_28,	MSIOF4_SS1),
 	PINMUX_IPSR_GPSR(IP2SR1_31_28,	IRQ3_B),
 
 	/* IP3SR1 */
-	PINMUX_IPSR_GPSR(IP3SR1_3_0,	HRX3),
+	PINMUX_IPSR_GPSR(IP3SR1_3_0,	HRX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_3_0,	SCK3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_3_0,	MSIOF4_SS2),
 
-	PINMUX_IPSR_GPSR(IP3SR1_7_4,	HSCK3),
+	PINMUX_IPSR_GPSR(IP3SR1_7_4,	HSCK3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_7_4,	CTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_7_4,	MSIOF4_SCK),
-	PINMUX_IPSR_GPSR(IP3SR1_7_4,	TPU0TO0_A),
+	PINMUX_IPSR_GPSR(IP3SR1_7_4,	TPU0TO0_B),
 
-	PINMUX_IPSR_GPSR(IP3SR1_11_8,	HRTS3_N),
+	PINMUX_IPSR_GPSR(IP3SR1_11_8,	HRTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_11_8,	RTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_11_8,	MSIOF4_TXD),
-	PINMUX_IPSR_GPSR(IP3SR1_11_8,	TPU0TO1_A),
+	PINMUX_IPSR_GPSR(IP3SR1_11_8,	TPU0TO1_B),
 
-	PINMUX_IPSR_GPSR(IP3SR1_15_12,	HCTS3_N),
+	PINMUX_IPSR_GPSR(IP3SR1_15_12,	HCTS3_N_A),
 	PINMUX_IPSR_GPSR(IP3SR1_15_12,	RX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_15_12,	MSIOF4_RXD),
 
-	PINMUX_IPSR_GPSR(IP3SR1_19_16,	HTX3),
+	PINMUX_IPSR_GPSR(IP3SR1_19_16,	HTX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_19_16,	TX3_A),
 	PINMUX_IPSR_GPSR(IP3SR1_19_16,	MSIOF4_SYNC),
 
 	/* IP0SR2 */
 	PINMUX_IPSR_GPSR(IP0SR2_3_0,	FXR_TXDA),
 	PINMUX_IPSR_GPSR(IP0SR2_3_0,	CANFD1_TX),
-	PINMUX_IPSR_GPSR(IP0SR2_3_0,	TPU0TO2_A),
+	PINMUX_IPSR_GPSR(IP0SR2_3_0,	TPU0TO2_B),
 
-	PINMUX_IPSR_GPSR(IP0SR2_7_4,	FXR_TXENA_N),
+	PINMUX_IPSR_GPSR(IP0SR2_7_4,	FXR_TXENA_N_A),
 	PINMUX_IPSR_GPSR(IP0SR2_7_4,	CANFD1_RX),
-	PINMUX_IPSR_GPSR(IP0SR2_7_4,	TPU0TO3_A),
+	PINMUX_IPSR_GPSR(IP0SR2_7_4,	TPU0TO3_B),
 
 	PINMUX_IPSR_GPSR(IP0SR2_11_8,	RXDA_EXTFXR),
-	PINMUX_IPSR_GPSR(IP0SR2_11_8,	CANFD5_TX),
+	PINMUX_IPSR_GPSR(IP0SR2_11_8,	CANFD5_TX_A),
 	PINMUX_IPSR_GPSR(IP0SR2_11_8,	IRQ5),
 
 	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CLK_EXTFXR),
-	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CANFD5_RX),
+	PINMUX_IPSR_GPSR(IP0SR2_15_12,	CANFD5_RX_A),
 	PINMUX_IPSR_GPSR(IP0SR2_15_12,	IRQ4_B),
 
 	PINMUX_IPSR_GPSR(IP0SR2_19_16,	RXDB_EXTFXR),
 
-	PINMUX_IPSR_GPSR(IP0SR2_23_20,	FXR_TXENB_N),
+	PINMUX_IPSR_GPSR(IP0SR2_23_20,	FXR_TXENB_N_A),
 
 	PINMUX_IPSR_GPSR(IP0SR2_27_24,	FXR_TXDB),
 
-	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TPU0TO1),
+	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TPU0TO1_A),
 	PINMUX_IPSR_GPSR(IP0SR2_31_28,	CANFD6_TX),
-	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TCLK2_B),
+	PINMUX_IPSR_GPSR(IP0SR2_31_28,	TCLK2_C),
 
 	/* IP1SR2 */
-	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TPU0TO0),
+	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TPU0TO0_A),
 	PINMUX_IPSR_GPSR(IP1SR2_3_0,	CANFD6_RX),
-	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TCLK1_A),
+	PINMUX_IPSR_GPSR(IP1SR2_3_0,	TCLK1_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_7_4,	CAN_CLK),
-	PINMUX_IPSR_GPSR(IP1SR2_7_4,	FXR_TXENA_N_X),
+	PINMUX_IPSR_GPSR(IP1SR2_7_4,	FXR_TXENA_N_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_11_8,	CANFD0_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_11_8,	FXR_TXENB_N_X),
+	PINMUX_IPSR_GPSR(IP1SR2_11_8,	FXR_TXENB_N_B),
 
 	PINMUX_IPSR_GPSR(IP1SR2_15_12,	CANFD0_RX),
 	PINMUX_IPSR_GPSR(IP1SR2_15_12,	STPWT_EXTFXR),
 
 	PINMUX_IPSR_GPSR(IP1SR2_19_16,	CANFD2_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TPU0TO2),
-	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TCLK3_A),
+	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TPU0TO2_A),
+	PINMUX_IPSR_GPSR(IP1SR2_19_16,	TCLK3_C),
 
 	PINMUX_IPSR_GPSR(IP1SR2_23_20,	CANFD2_RX),
-	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TPU0TO3),
+	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TPU0TO3_A),
 	PINMUX_IPSR_GPSR(IP1SR2_23_20,	PWM1_B),
-	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TCLK4_A),
+	PINMUX_IPSR_GPSR(IP1SR2_23_20,	TCLK4_C),
 
 	PINMUX_IPSR_GPSR(IP1SR2_27_24,	CANFD3_TX),
-	PINMUX_IPSR_GPSR(IP1SR2_27_24,	PWM2_B),
+	PINMUX_IPSR_GPSR(IP1SR2_27_24,	PWM2),
 
 	PINMUX_IPSR_GPSR(IP1SR2_31_28,	CANFD3_RX),
 	PINMUX_IPSR_GPSR(IP1SR2_31_28,	PWM3_B),
@@ -973,12 +973,12 @@ static const u16 pinmux_data[] = {
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	IPC_CLKIN),
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	IPC_CLKEN_IN),
 	PINMUX_IPSR_GPSR(IP1SR3_23_20,	PWM1_A),
-	PINMUX_IPSR_GPSR(IP1SR3_23_20,	TCLK3_X),
+	PINMUX_IPSR_GPSR(IP1SR3_23_20,	TCLK3_A),
 
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	IPC_CLKOUT),
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	IPC_CLKEN_OUT),
 	PINMUX_IPSR_GPSR(IP1SR3_27_24,	ERROROUTC_N_A),
-	PINMUX_IPSR_GPSR(IP1SR3_27_24,	TCLK4_X),
+	PINMUX_IPSR_GPSR(IP1SR3_27_24,	TCLK4_A),
 
 	PINMUX_IPSR_GPSR(IP1SR3_31_28,	QSPI0_SSL),
 
@@ -1507,15 +1507,14 @@ static const unsigned int canfd4_data_mux[] = {
 };
 
 /* - CANFD5 ----------------------------------------------------------------- */
-static const unsigned int canfd5_data_pins[] = {
-	/* CANFD5_TX, CANFD5_RX */
+static const unsigned int canfd5_data_a_pins[] = {
+	/* CANFD5_TX_A, CANFD5_RX_A */
 	RCAR_GP_PIN(2, 2), RCAR_GP_PIN(2, 3),
 };
-static const unsigned int canfd5_data_mux[] = {
-	CANFD5_TX_MARK, CANFD5_RX_MARK,
+static const unsigned int canfd5_data_a_mux[] = {
+	CANFD5_TX_A_MARK, CANFD5_RX_A_MARK,
 };
 
-/* - CANFD5_B ----------------------------------------------------------------- */
 static const unsigned int canfd5_data_b_pins[] = {
 	/* CANFD5_TX_B, CANFD5_RX_B */
 	RCAR_GP_PIN(1, 8), RCAR_GP_PIN(1, 9),
@@ -1575,49 +1574,48 @@ static const unsigned int hscif0_ctrl_mux[] = {
 };
 
 /* - HSCIF1 ----------------------------------------------------------------- */
-static const unsigned int hscif1_data_pins[] = {
-	/* HRX1, HTX1 */
+static const unsigned int hscif1_data_a_pins[] = {
+	/* HRX1_A, HTX1_A */
 	RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
 };
-static const unsigned int hscif1_data_mux[] = {
-	HRX1_MARK, HTX1_MARK,
+static const unsigned int hscif1_data_a_mux[] = {
+	HRX1_A_MARK, HTX1_A_MARK,
 };
-static const unsigned int hscif1_clk_pins[] = {
-	/* HSCK1 */
+static const unsigned int hscif1_clk_a_pins[] = {
+	/* HSCK1_A */
 	RCAR_GP_PIN(0, 18),
 };
-static const unsigned int hscif1_clk_mux[] = {
-	HSCK1_MARK,
+static const unsigned int hscif1_clk_a_mux[] = {
+	HSCK1_A_MARK,
 };
-static const unsigned int hscif1_ctrl_pins[] = {
-	/* HRTS1_N, HCTS1_N */
+static const unsigned int hscif1_ctrl_a_pins[] = {
+	/* HRTS1_N_A, HCTS1_N_A */
 	RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
 };
-static const unsigned int hscif1_ctrl_mux[] = {
-	HRTS1_N_MARK, HCTS1_N_MARK,
+static const unsigned int hscif1_ctrl_a_mux[] = {
+	HRTS1_N_A_MARK, HCTS1_N_A_MARK,
 };
 
-/* - HSCIF1_X---------------------------------------------------------------- */
-static const unsigned int hscif1_data_x_pins[] = {
-	/* HRX1_X, HTX1_X */
+static const unsigned int hscif1_data_b_pins[] = {
+	/* HRX1_B, HTX1_B */
 	RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
 };
-static const unsigned int hscif1_data_x_mux[] = {
-	HRX1_X_MARK, HTX1_X_MARK,
+static const unsigned int hscif1_data_b_mux[] = {
+	HRX1_B_MARK, HTX1_B_MARK,
 };
-static const unsigned int hscif1_clk_x_pins[] = {
-	/* HSCK1_X */
+static const unsigned int hscif1_clk_b_pins[] = {
+	/* HSCK1_B */
 	RCAR_GP_PIN(1, 10),
 };
-static const unsigned int hscif1_clk_x_mux[] = {
-	HSCK1_X_MARK,
+static const unsigned int hscif1_clk_b_mux[] = {
+	HSCK1_B_MARK,
 };
-static const unsigned int hscif1_ctrl_x_pins[] = {
-	/* HRTS1_N_X, HCTS1_N_X */
+static const unsigned int hscif1_ctrl_b_pins[] = {
+	/* HRTS1_N_B, HCTS1_N_B */
 	RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
 };
-static const unsigned int hscif1_ctrl_x_mux[] = {
-	HRTS1_N_X_MARK, HCTS1_N_X_MARK,
+static const unsigned int hscif1_ctrl_b_mux[] = {
+	HRTS1_N_B_MARK, HCTS1_N_B_MARK,
 };
 
 /* - HSCIF2 ----------------------------------------------------------------- */
@@ -1644,49 +1642,48 @@ static const unsigned int hscif2_ctrl_mux[] = {
 };
 
 /* - HSCIF3 ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_pins[] = {
-	/* HRX3, HTX3 */
+static const unsigned int hscif3_data_a_pins[] = {
+	/* HRX3_A, HTX3_A */
 	RCAR_GP_PIN(1, 24), RCAR_GP_PIN(1, 28),
 };
-static const unsigned int hscif3_data_mux[] = {
-	HRX3_MARK, HTX3_MARK,
+static const unsigned int hscif3_data_a_mux[] = {
+	HRX3_A_MARK, HTX3_A_MARK,
 };
-static const unsigned int hscif3_clk_pins[] = {
-	/* HSCK3 */
+static const unsigned int hscif3_clk_a_pins[] = {
+	/* HSCK3_A */
 	RCAR_GP_PIN(1, 25),
 };
-static const unsigned int hscif3_clk_mux[] = {
-	HSCK3_MARK,
+static const unsigned int hscif3_clk_a_mux[] = {
+	HSCK3_A_MARK,
 };
-static const unsigned int hscif3_ctrl_pins[] = {
-	/* HRTS3_N, HCTS3_N */
+static const unsigned int hscif3_ctrl_a_pins[] = {
+	/* HRTS3_N_A, HCTS3_N_A */
 	RCAR_GP_PIN(1, 26), RCAR_GP_PIN(1, 27),
 };
-static const unsigned int hscif3_ctrl_mux[] = {
-	HRTS3_N_MARK, HCTS3_N_MARK,
+static const unsigned int hscif3_ctrl_a_mux[] = {
+	HRTS3_N_A_MARK, HCTS3_N_A_MARK,
 };
 
-/* - HSCIF3_A ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_a_pins[] = {
-	/* HRX3_A, HTX3_A */
+static const unsigned int hscif3_data_b_pins[] = {
+	/* HRX3_B, HTX3_B */
 	RCAR_GP_PIN(1, 4), RCAR_GP_PIN(1, 0),
 };
-static const unsigned int hscif3_data_a_mux[] = {
-	HRX3_A_MARK, HTX3_A_MARK,
+static const unsigned int hscif3_data_b_mux[] = {
+	HRX3_B_MARK, HTX3_B_MARK,
 };
-static const unsigned int hscif3_clk_a_pins[] = {
-	/* HSCK3_A */
+static const unsigned int hscif3_clk_b_pins[] = {
+	/* HSCK3_B */
 	RCAR_GP_PIN(1, 3),
 };
-static const unsigned int hscif3_clk_a_mux[] = {
-	HSCK3_A_MARK,
+static const unsigned int hscif3_clk_b_mux[] = {
+	HSCK3_B_MARK,
 };
-static const unsigned int hscif3_ctrl_a_pins[] = {
-	/* HRTS3_N_A, HCTS3_N_A */
+static const unsigned int hscif3_ctrl_b_pins[] = {
+	/* HRTS3_N_B, HCTS3_N_B */
 	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 1),
 };
-static const unsigned int hscif3_ctrl_a_mux[] = {
-	HRTS3_N_A_MARK, HCTS3_N_A_MARK,
+static const unsigned int hscif3_ctrl_b_mux[] = {
+	HRTS3_N_B_MARK, HCTS3_N_B_MARK,
 };
 
 /* - I2C0 ------------------------------------------------------------------- */
@@ -2069,13 +2066,13 @@ static const unsigned int pcie1_clkreq_n_mux[] = {
 	PCIE1_CLKREQ_N_MARK,
 };
 
-/* - PWM0_A ------------------------------------------------------------------- */
-static const unsigned int pwm0_a_pins[] = {
-	/* PWM0_A */
+/* - PWM0 ------------------------------------------------------------------- */
+static const unsigned int pwm0_pins[] = {
+	/* PWM0 */
 	RCAR_GP_PIN(1, 15),
 };
-static const unsigned int pwm0_a_mux[] = {
-	PWM0_A_MARK,
+static const unsigned int pwm0_mux[] = {
+	PWM0_MARK,
 };
 
 /* - PWM1_A ------------------------------------------------------------------- */
@@ -2096,13 +2093,13 @@ static const unsigned int pwm1_b_mux[] = {
 	PWM1_B_MARK,
 };
 
-/* - PWM2_B ------------------------------------------------------------------- */
-static const unsigned int pwm2_b_pins[] = {
-	/* PWM2_B */
+/* - PWM2 ------------------------------------------------------------------- */
+static const unsigned int pwm2_pins[] = {
+	/* PWM2 */
 	RCAR_GP_PIN(2, 14),
 };
-static const unsigned int pwm2_b_mux[] = {
-	PWM2_B_MARK,
+static const unsigned int pwm2_mux[] = {
+	PWM2_MARK,
 };
 
 /* - PWM3_A ------------------------------------------------------------------- */
@@ -2159,22 +2156,22 @@ static const unsigned int pwm7_mux[] = {
 	PWM7_MARK,
 };
 
-/* - PWM8_A ------------------------------------------------------------------- */
-static const unsigned int pwm8_a_pins[] = {
-	/* PWM8_A */
+/* - PWM8 ------------------------------------------------------------------- */
+static const unsigned int pwm8_pins[] = {
+	/* PWM8 */
 	RCAR_GP_PIN(1, 13),
 };
-static const unsigned int pwm8_a_mux[] = {
-	PWM8_A_MARK,
+static const unsigned int pwm8_mux[] = {
+	PWM8_MARK,
 };
 
-/* - PWM9_A ------------------------------------------------------------------- */
-static const unsigned int pwm9_a_pins[] = {
-	/* PWM9_A */
+/* - PWM9 ------------------------------------------------------------------- */
+static const unsigned int pwm9_pins[] = {
+	/* PWM9 */
 	RCAR_GP_PIN(1, 14),
 };
-static const unsigned int pwm9_a_mux[] = {
-	PWM9_A_MARK,
+static const unsigned int pwm9_mux[] = {
+	PWM9_MARK,
 };
 
 /* - QSPI0 ------------------------------------------------------------------ */
@@ -2237,75 +2234,51 @@ static const unsigned int scif0_ctrl_mux[] = {
 };
 
 /* - SCIF1 ------------------------------------------------------------------ */
-static const unsigned int scif1_data_pins[] = {
-	/* RX1, TX1 */
+static const unsigned int scif1_data_a_pins[] = {
+	/* RX1_A, TX1_A */
 	RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
 };
-static const unsigned int scif1_data_mux[] = {
-	RX1_MARK, TX1_MARK,
+static const unsigned int scif1_data_a_mux[] = {
+	RX1_A_MARK, TX1_A_MARK,
 };
-static const unsigned int scif1_clk_pins[] = {
-	/* SCK1 */
+static const unsigned int scif1_clk_a_pins[] = {
+	/* SCK1_A */
 	RCAR_GP_PIN(0, 18),
 };
-static const unsigned int scif1_clk_mux[] = {
-	SCK1_MARK,
+static const unsigned int scif1_clk_a_mux[] = {
+	SCK1_A_MARK,
 };
-static const unsigned int scif1_ctrl_pins[] = {
-	/* RTS1_N, CTS1_N */
+static const unsigned int scif1_ctrl_a_pins[] = {
+	/* RTS1_N_A, CTS1_N_A */
 	RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
 };
-static const unsigned int scif1_ctrl_mux[] = {
-	RTS1_N_MARK, CTS1_N_MARK,
+static const unsigned int scif1_ctrl_a_mux[] = {
+	RTS1_N_A_MARK, CTS1_N_A_MARK,
 };
 
-/* - SCIF1_X ------------------------------------------------------------------ */
-static const unsigned int scif1_data_x_pins[] = {
-	/* RX1_X, TX1_X */
+static const unsigned int scif1_data_b_pins[] = {
+	/* RX1_B, TX1_B */
 	RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
 };
-static const unsigned int scif1_data_x_mux[] = {
-	RX1_X_MARK, TX1_X_MARK,
+static const unsigned int scif1_data_b_mux[] = {
+	RX1_B_MARK, TX1_B_MARK,
 };
-static const unsigned int scif1_clk_x_pins[] = {
-	/* SCK1_X */
+static const unsigned int scif1_clk_b_pins[] = {
+	/* SCK1_B */
 	RCAR_GP_PIN(1, 10),
 };
-static const unsigned int scif1_clk_x_mux[] = {
-	SCK1_X_MARK,
+static const unsigned int scif1_clk_b_mux[] = {
+	SCK1_B_MARK,
 };
-static const unsigned int scif1_ctrl_x_pins[] = {
-	/* RTS1_N_X, CTS1_N_X */
+static const unsigned int scif1_ctrl_b_pins[] = {
+	/* RTS1_N_B, CTS1_N_B */
 	RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
 };
-static const unsigned int scif1_ctrl_x_mux[] = {
-	RTS1_N_X_MARK, CTS1_N_X_MARK,
+static const unsigned int scif1_ctrl_b_mux[] = {
+	RTS1_N_B_MARK, CTS1_N_B_MARK,
 };
 
 /* - SCIF3 ------------------------------------------------------------------ */
-static const unsigned int scif3_data_pins[] = {
-	/* RX3, TX3 */
-	RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
-};
-static const unsigned int scif3_data_mux[] = {
-	RX3_MARK, TX3_MARK,
-};
-static const unsigned int scif3_clk_pins[] = {
-	/* SCK3 */
-	RCAR_GP_PIN(1, 4),
-};
-static const unsigned int scif3_clk_mux[] = {
-	SCK3_MARK,
-};
-static const unsigned int scif3_ctrl_pins[] = {
-	/* RTS3_N, CTS3_N */
-	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
-};
-static const unsigned int scif3_ctrl_mux[] = {
-	RTS3_N_MARK, CTS3_N_MARK,
-};
-
-/* - SCIF3_A ------------------------------------------------------------------ */
 static const unsigned int scif3_data_a_pins[] = {
 	/* RX3_A, TX3_A */
 	RCAR_GP_PIN(1, 27), RCAR_GP_PIN(1, 28),
@@ -2328,6 +2301,28 @@ static const unsigned int scif3_ctrl_a_mux[] = {
 	RTS3_N_A_MARK, CTS3_N_A_MARK,
 };
 
+static const unsigned int scif3_data_b_pins[] = {
+	/* RX3_B, TX3_B */
+	RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
+};
+static const unsigned int scif3_data_b_mux[] = {
+	RX3_B_MARK, TX3_B_MARK,
+};
+static const unsigned int scif3_clk_b_pins[] = {
+	/* SCK3_B */
+	RCAR_GP_PIN(1, 4),
+};
+static const unsigned int scif3_clk_b_mux[] = {
+	SCK3_B_MARK,
+};
+static const unsigned int scif3_ctrl_b_pins[] = {
+	/* RTS3_N_B, CTS3_N_B */
+	RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
+};
+static const unsigned int scif3_ctrl_b_mux[] = {
+	RTS3_N_B_MARK, CTS3_N_B_MARK,
+};
+
 /* - SCIF4 ------------------------------------------------------------------ */
 static const unsigned int scif4_data_pins[] = {
 	/* RX4, TX4 */
@@ -2384,64 +2379,63 @@ static const unsigned int ssi_ctrl_mux[] = {
 	SSI_SCK_MARK, SSI_WS_MARK,
 };
 
-/* - TPU ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_pins[] = {
-	/* TPU0TO0 */
+/* - TPU -------------------------------------------------------------------- */
+static const unsigned int tpu_to0_a_pins[] = {
+	/* TPU0TO0_A */
 	RCAR_GP_PIN(2, 8),
 };
-static const unsigned int tpu_to0_mux[] = {
-	TPU0TO0_MARK,
+static const unsigned int tpu_to0_a_mux[] = {
+	TPU0TO0_A_MARK,
 };
-static const unsigned int tpu_to1_pins[] = {
-	/* TPU0TO1 */
+static const unsigned int tpu_to1_a_pins[] = {
+	/* TPU0TO1_A */
 	RCAR_GP_PIN(2, 7),
 };
-static const unsigned int tpu_to1_mux[] = {
-	TPU0TO1_MARK,
+static const unsigned int tpu_to1_a_mux[] = {
+	TPU0TO1_A_MARK,
 };
-static const unsigned int tpu_to2_pins[] = {
-	/* TPU0TO2 */
+static const unsigned int tpu_to2_a_pins[] = {
+	/* TPU0TO2_A */
 	RCAR_GP_PIN(2, 12),
 };
-static const unsigned int tpu_to2_mux[] = {
-	TPU0TO2_MARK,
+static const unsigned int tpu_to2_a_mux[] = {
+	TPU0TO2_A_MARK,
 };
-static const unsigned int tpu_to3_pins[] = {
-	/* TPU0TO3 */
+static const unsigned int tpu_to3_a_pins[] = {
+	/* TPU0TO3_A */
 	RCAR_GP_PIN(2, 13),
 };
-static const unsigned int tpu_to3_mux[] = {
-	TPU0TO3_MARK,
+static const unsigned int tpu_to3_a_mux[] = {
+	TPU0TO3_A_MARK,
 };
 
-/* - TPU_A ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_a_pins[] = {
-	/* TPU0TO0_A */
+static const unsigned int tpu_to0_b_pins[] = {
+	/* TPU0TO0_B */
 	RCAR_GP_PIN(1, 25),
 };
-static const unsigned int tpu_to0_a_mux[] = {
-	TPU0TO0_A_MARK,
+static const unsigned int tpu_to0_b_mux[] = {
+	TPU0TO0_B_MARK,
 };
-static const unsigned int tpu_to1_a_pins[] = {
-	/* TPU0TO1_A */
+static const unsigned int tpu_to1_b_pins[] = {
+	/* TPU0TO1_B */
 	RCAR_GP_PIN(1, 26),
 };
-static const unsigned int tpu_to1_a_mux[] = {
-	TPU0TO1_A_MARK,
+static const unsigned int tpu_to1_b_mux[] = {
+	TPU0TO1_B_MARK,
 };
-static const unsigned int tpu_to2_a_pins[] = {
-	/* TPU0TO2_A */
+static const unsigned int tpu_to2_b_pins[] = {
+	/* TPU0TO2_B */
 	RCAR_GP_PIN(2, 0),
 };
-static const unsigned int tpu_to2_a_mux[] = {
-	TPU0TO2_A_MARK,
+static const unsigned int tpu_to2_b_mux[] = {
+	TPU0TO2_B_MARK,
 };
-static const unsigned int tpu_to3_a_pins[] = {
-	/* TPU0TO3_A */
+static const unsigned int tpu_to3_b_pins[] = {
+	/* TPU0TO3_B */
 	RCAR_GP_PIN(2, 1),
 };
-static const unsigned int tpu_to3_a_mux[] = {
-	TPU0TO3_A_MARK,
+static const unsigned int tpu_to3_b_mux[] = {
+	TPU0TO3_B_MARK,
 };
 
 /* - TSN0 ------------------------------------------------ */
@@ -2551,8 +2545,8 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(canfd2_data),
 	SH_PFC_PIN_GROUP(canfd3_data),
 	SH_PFC_PIN_GROUP(canfd4_data),
-	SH_PFC_PIN_GROUP(canfd5_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(canfd5_data_b),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(canfd5_data_a),
+	SH_PFC_PIN_GROUP(canfd5_data_b),
 	SH_PFC_PIN_GROUP(canfd6_data),
 	SH_PFC_PIN_GROUP(canfd7_data),
 	SH_PFC_PIN_GROUP(can_clk),
@@ -2560,21 +2554,21 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(hscif0_data),
 	SH_PFC_PIN_GROUP(hscif0_clk),
 	SH_PFC_PIN_GROUP(hscif0_ctrl),
-	SH_PFC_PIN_GROUP(hscif1_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_data_x),	/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_clk_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif1_ctrl_x),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(hscif1_data_a),
+	SH_PFC_PIN_GROUP(hscif1_clk_a),
+	SH_PFC_PIN_GROUP(hscif1_ctrl_a),
+	SH_PFC_PIN_GROUP(hscif1_data_b),
+	SH_PFC_PIN_GROUP(hscif1_clk_b),
+	SH_PFC_PIN_GROUP(hscif1_ctrl_b),
 	SH_PFC_PIN_GROUP(hscif2_data),
 	SH_PFC_PIN_GROUP(hscif2_clk),
 	SH_PFC_PIN_GROUP(hscif2_ctrl),
-	SH_PFC_PIN_GROUP(hscif3_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_data_a),	/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_clk_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(hscif3_ctrl_a),	/* suffix might be updated */
+	SH_PFC_PIN_GROUP(hscif3_data_a),
+	SH_PFC_PIN_GROUP(hscif3_clk_a),
+	SH_PFC_PIN_GROUP(hscif3_ctrl_a),
+	SH_PFC_PIN_GROUP(hscif3_data_b),
+	SH_PFC_PIN_GROUP(hscif3_clk_b),
+	SH_PFC_PIN_GROUP(hscif3_ctrl_b),
 
 	SH_PFC_PIN_GROUP(i2c0),
 	SH_PFC_PIN_GROUP(i2c1),
@@ -2636,18 +2630,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(pcie0_clkreq_n),
 	SH_PFC_PIN_GROUP(pcie1_clkreq_n),
 
-	SH_PFC_PIN_GROUP(pwm0_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm0),
 	SH_PFC_PIN_GROUP(pwm1_a),
 	SH_PFC_PIN_GROUP(pwm1_b),
-	SH_PFC_PIN_GROUP(pwm2_b),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm2),
 	SH_PFC_PIN_GROUP(pwm3_a),
 	SH_PFC_PIN_GROUP(pwm3_b),
 	SH_PFC_PIN_GROUP(pwm4),
 	SH_PFC_PIN_GROUP(pwm5),
 	SH_PFC_PIN_GROUP(pwm6),
 	SH_PFC_PIN_GROUP(pwm7),
-	SH_PFC_PIN_GROUP(pwm8_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(pwm9_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(pwm8),
+	SH_PFC_PIN_GROUP(pwm9),
 
 	SH_PFC_PIN_GROUP(qspi0_ctrl),
 	BUS_DATA_PIN_GROUP(qspi0_data, 2),
@@ -2659,18 +2653,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(scif0_data),
 	SH_PFC_PIN_GROUP(scif0_clk),
 	SH_PFC_PIN_GROUP(scif0_ctrl),
-	SH_PFC_PIN_GROUP(scif1_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_data_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_clk_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif1_ctrl_x),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_data),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_clk),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_ctrl),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_data_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_clk_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(scif3_ctrl_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(scif1_data_a),
+	SH_PFC_PIN_GROUP(scif1_clk_a),
+	SH_PFC_PIN_GROUP(scif1_ctrl_a),
+	SH_PFC_PIN_GROUP(scif1_data_b),
+	SH_PFC_PIN_GROUP(scif1_clk_b),
+	SH_PFC_PIN_GROUP(scif1_ctrl_b),
+	SH_PFC_PIN_GROUP(scif3_data_a),
+	SH_PFC_PIN_GROUP(scif3_clk_a),
+	SH_PFC_PIN_GROUP(scif3_ctrl_a),
+	SH_PFC_PIN_GROUP(scif3_data_b),
+	SH_PFC_PIN_GROUP(scif3_clk_b),
+	SH_PFC_PIN_GROUP(scif3_ctrl_b),
 	SH_PFC_PIN_GROUP(scif4_data),
 	SH_PFC_PIN_GROUP(scif4_clk),
 	SH_PFC_PIN_GROUP(scif4_ctrl),
@@ -2680,14 +2674,14 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
 	SH_PFC_PIN_GROUP(ssi_data),
 	SH_PFC_PIN_GROUP(ssi_ctrl),
 
-	SH_PFC_PIN_GROUP(tpu_to0),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to0_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to1),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to1_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to2),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to2_a),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to3),		/* suffix might be updated */
-	SH_PFC_PIN_GROUP(tpu_to3_a),		/* suffix might be updated */
+	SH_PFC_PIN_GROUP(tpu_to0_a),
+	SH_PFC_PIN_GROUP(tpu_to0_b),
+	SH_PFC_PIN_GROUP(tpu_to1_a),
+	SH_PFC_PIN_GROUP(tpu_to1_b),
+	SH_PFC_PIN_GROUP(tpu_to2_a),
+	SH_PFC_PIN_GROUP(tpu_to2_b),
+	SH_PFC_PIN_GROUP(tpu_to3_a),
+	SH_PFC_PIN_GROUP(tpu_to3_b),
 
 	SH_PFC_PIN_GROUP(tsn0_link),
 	SH_PFC_PIN_GROUP(tsn0_phy_int),
@@ -2756,8 +2750,7 @@ static const char * const canfd4_groups[] = {
 };
 
 static const char * const canfd5_groups[] = {
-	/* suffix might be updated */
-	"canfd5_data",
+	"canfd5_data_a",
 	"canfd5_data_b",
 };
 
@@ -2780,13 +2773,12 @@ static const char * const hscif0_groups[] = {
 };
 
 static const char * const hscif1_groups[] = {
-	/* suffix might be updated */
-	"hscif1_data",
-	"hscif1_clk",
-	"hscif1_ctrl",
-	"hscif1_data_x",
-	"hscif1_clk_x",
-	"hscif1_ctrl_x",
+	"hscif1_data_a",
+	"hscif1_clk_a",
+	"hscif1_ctrl_a",
+	"hscif1_data_b",
+	"hscif1_clk_b",
+	"hscif1_ctrl_b",
 };
 
 static const char * const hscif2_groups[] = {
@@ -2796,13 +2788,12 @@ static const char * const hscif2_groups[] = {
 };
 
 static const char * const hscif3_groups[] = {
-	/* suffix might be updated */
-	"hscif3_data",
-	"hscif3_clk",
-	"hscif3_ctrl",
 	"hscif3_data_a",
 	"hscif3_clk_a",
 	"hscif3_ctrl_a",
+	"hscif3_data_b",
+	"hscif3_clk_b",
+	"hscif3_ctrl_b",
 };
 
 static const char * const i2c0_groups[] = {
@@ -2899,8 +2890,7 @@ static const char * const pcie_groups[] = {
 };
 
 static const char * const pwm0_groups[] = {
-	/* suffix might be updated */
-	"pwm0_a",
+	"pwm0",
 };
 
 static const char * const pwm1_groups[] = {
@@ -2909,8 +2899,7 @@ static const char * const pwm1_groups[] = {
 };
 
 static const char * const pwm2_groups[] = {
-	/* suffix might be updated */
-	"pwm2_b",
+	"pwm2",
 };
 
 static const char * const pwm3_groups[] = {
@@ -2935,13 +2924,11 @@ static const char * const pwm7_groups[] = {
 };
 
 static const char * const pwm8_groups[] = {
-	/* suffix might be updated */
-	"pwm8_a",
+	"pwm8",
 };
 
 static const char * const pwm9_groups[] = {
-	/* suffix might be updated */
-	"pwm9_a",
+	"pwm9",
 };
 
 static const char * const qspi0_groups[] = {
@@ -2963,23 +2950,21 @@ static const char * const scif0_groups[] = {
 };
 
 static const char * const scif1_groups[] = {
-	/* suffix might be updated */
-	"scif1_data",
-	"scif1_clk",
-	"scif1_ctrl",
-	"scif1_data_x",
-	"scif1_clk_x",
-	"scif1_ctrl_x",
+	"scif1_data_a",
+	"scif1_clk_a",
+	"scif1_ctrl_a",
+	"scif1_data_b",
+	"scif1_clk_b",
+	"scif1_ctrl_b",
 };
 
 static const char * const scif3_groups[] = {
-	/* suffix might be updated */
-	"scif3_data",
-	"scif3_clk",
-	"scif3_ctrl",
 	"scif3_data_a",
 	"scif3_clk_a",
 	"scif3_ctrl_a",
+	"scif3_data_b",
+	"scif3_clk_b",
+	"scif3_ctrl_b",
 };
 
 static const char * const scif4_groups[] = {
@@ -3002,15 +2987,14 @@ static const char * const ssi_groups[] = {
 };
 
 static const char * const tpu_groups[] = {
-	/* suffix might be updated */
-	"tpu_to0",
 	"tpu_to0_a",
-	"tpu_to1",
+	"tpu_to0_b",
 	"tpu_to1_a",
-	"tpu_to2",
+	"tpu_to1_b",
 	"tpu_to2_a",
-	"tpu_to3",
+	"tpu_to2_b",
 	"tpu_to3_a",
+	"tpu_to3_b",
 };
 
 static const char * const tsn0_groups[] = {
diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
index 4e2382778d38..f3411e3eaf2e 100644
--- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
+++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
@@ -883,7 +883,7 @@ static int ti_iodelay_probe(struct platform_device *pdev)
 	iod->desc.name = dev_name(dev);
 	iod->desc.owner = THIS_MODULE;
 
-	ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl);
+	ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl);
 	if (ret) {
 		dev_err(dev, "Failed to register pinctrl\n");
 		goto exit_out;
@@ -891,7 +891,11 @@ static int ti_iodelay_probe(struct platform_device *pdev)
 
 	platform_set_drvdata(pdev, iod);
 
-	return pinctrl_enable(iod->pctl);
+	ret = pinctrl_enable(iod->pctl);
+	if (ret)
+		goto exit_out;
+
+	return 0;
 
 exit_out:
 	of_node_put(np);
@@ -908,12 +912,6 @@ static int ti_iodelay_remove(struct platform_device *pdev)
 {
 	struct ti_iodelay_device *iod = platform_get_drvdata(pdev);
 
-	if (!iod)
-		return 0;
-
-	if (iod->pctl)
-		pinctrl_unregister(iod->pctl);
-
 	ti_iodelay_pinconf_deinit_dev(iod);
 
 	/* Expect other allocations to be freed by devm */
diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c
index 4e63adf083ea..b19207f3aecf 100644
--- a/drivers/platform/chrome/cros_ec_debugfs.c
+++ b/drivers/platform/chrome/cros_ec_debugfs.c
@@ -326,6 +326,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec)
 	if (!msg)
 		return 0;
 
+	msg->version = 1;
 	msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset;
 	msg->outsize = sizeof(*params);
 	msg->insize = sizeof(*response);
diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c
index d8c5f9195f85..2ac2f31090f9 100644
--- a/drivers/platform/mips/cpu_hwmon.c
+++ b/drivers/platform/mips/cpu_hwmon.c
@@ -139,6 +139,9 @@ static int __init loongson_hwmon_init(void)
 		csr_temp_enable = csr_readl(LOONGSON_CSR_FEATURES) &
 				  LOONGSON_CSRF_TEMP;
 
+	if (!csr_temp_enable && !loongson_chiptemp[0])
+		return -ENODEV;
+
 	nr_packages = loongson_sysconf.nr_cpus /
 		loongson_sysconf.cores_per_package;
 
diff --git a/drivers/pwm/pwm-atmel-tcb.c b/drivers/pwm/pwm-atmel-tcb.c
index 2826fc216d29..e74b45f00a9a 100644
--- a/drivers/pwm/pwm-atmel-tcb.c
+++ b/drivers/pwm/pwm-atmel-tcb.c
@@ -34,7 +34,6 @@
 				 ATMEL_TC_BEEVT | ATMEL_TC_BSWTRG)
 
 struct atmel_tcb_pwm_device {
-	enum pwm_polarity polarity;	/* PWM polarity */
 	unsigned div;			/* PWM clock divider */
 	unsigned duty;			/* PWM duty expressed in clk cycles */
 	unsigned period;		/* PWM period expressed in clk cycles */
@@ -57,7 +56,7 @@ struct atmel_tcb_pwm_chip {
 	struct clk *clk;
 	struct clk *gclk;
 	struct clk *slow_clk;
-	struct atmel_tcb_pwm_device *pwms[NPWM];
+	struct atmel_tcb_pwm_device pwms[NPWM];
 	struct atmel_tcb_channel bkup;
 };
 
@@ -68,42 +67,24 @@ static inline struct atmel_tcb_pwm_chip *to_tcb_chip(struct pwm_chip *chip)
 	return container_of(chip, struct atmel_tcb_pwm_chip, chip);
 }
 
-static int atmel_tcb_pwm_set_polarity(struct pwm_chip *chip,
-				      struct pwm_device *pwm,
-				      enum pwm_polarity polarity)
-{
-	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
-
-	tcbpwm->polarity = polarity;
-
-	return 0;
-}
-
 static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 				 struct pwm_device *pwm)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm;
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	unsigned cmr;
 	int ret;
 
-	tcbpwm = devm_kzalloc(chip->dev, sizeof(*tcbpwm), GFP_KERNEL);
-	if (!tcbpwm)
-		return -ENOMEM;
-
 	ret = clk_prepare_enable(tcbpwmc->clk);
-	if (ret) {
-		devm_kfree(chip->dev, tcbpwm);
+	if (ret)
 		return ret;
-	}
 
-	tcbpwm->polarity = PWM_POLARITY_NORMAL;
 	tcbpwm->duty = 0;
 	tcbpwm->period = 0;
 	tcbpwm->div = 0;
 
-	spin_lock(&tcbpwmc->lock);
+	guard(spinlock)(&tcbpwmc->lock);
+
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 	/*
 	 * Get init config from Timer Counter registers if
@@ -129,9 +110,6 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 
 	cmr |= ATMEL_TC_WAVE | ATMEL_TC_WAVESEL_UP_AUTO | ATMEL_TC_EEVT_XC0;
 	regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), cmr);
-	spin_unlock(&tcbpwmc->lock);
-
-	tcbpwmc->pwms[pwm->hwpwm] = tcbpwm;
 
 	return 0;
 }
@@ -139,19 +117,16 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
 static void atmel_tcb_pwm_free(struct pwm_chip *chip, struct pwm_device *pwm)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
 
 	clk_disable_unprepare(tcbpwmc->clk);
-	tcbpwmc->pwms[pwm->hwpwm] = NULL;
-	devm_kfree(chip->dev, tcbpwm);
 }
 
-static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
+static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm,
+				  enum pwm_polarity polarity)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	unsigned cmr;
-	enum pwm_polarity polarity = tcbpwm->polarity;
 
 	/*
 	 * If duty is 0 the timer will be stopped and we have to
@@ -164,7 +139,6 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
 	if (tcbpwm->duty == 0)
 		polarity = !polarity;
 
-	spin_lock(&tcbpwmc->lock);
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 
 	/* flush old setting and set the new one */
@@ -199,16 +173,14 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
 			     ATMEL_TC_SWTRG);
 		tcbpwmc->bkup.enabled = 0;
 	}
-
-	spin_unlock(&tcbpwmc->lock);
 }
 
-static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
+static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
+				enum pwm_polarity polarity)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	u32 cmr;
-	enum pwm_polarity polarity = tcbpwm->polarity;
 
 	/*
 	 * If duty is 0 the timer will be stopped and we have to
@@ -221,7 +193,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
 	if (tcbpwm->duty == 0)
 		polarity = !polarity;
 
-	spin_lock(&tcbpwmc->lock);
 	regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
 
 	/* flush old setting and set the new one */
@@ -283,7 +254,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
 	regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CCR),
 		     ATMEL_TC_SWTRG | ATMEL_TC_CLKEN);
 	tcbpwmc->bkup.enabled = 1;
-	spin_unlock(&tcbpwmc->lock);
 	return 0;
 }
 
@@ -291,7 +261,7 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
 				int duty_ns, int period_ns)
 {
 	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
-	struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+	struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
 	struct atmel_tcb_pwm_device *atcbpwm = NULL;
 	int i = 0;
 	int slowclk = 0;
@@ -338,9 +308,9 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
 	period = div_u64(period_ns, min);
 
 	if (pwm->hwpwm == 0)
-		atcbpwm = tcbpwmc->pwms[1];
+		atcbpwm = &tcbpwmc->pwms[1];
 	else
-		atcbpwm = tcbpwmc->pwms[0];
+		atcbpwm = &tcbpwmc->pwms[0];
 
 	/*
 	 * PWM devices provided by the TCB driver are grouped by 2.
@@ -368,14 +338,14 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
 static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 			       const struct pwm_state *state)
 {
+	struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
 	int duty_cycle, period;
 	int ret;
 
-	/* This function only sets a flag in driver data */
-	atmel_tcb_pwm_set_polarity(chip, pwm, state->polarity);
+	guard(spinlock)(&tcbpwmc->lock);
 
 	if (!state->enabled) {
-		atmel_tcb_pwm_disable(chip, pwm);
+		atmel_tcb_pwm_disable(chip, pwm, state->polarity);
 		return 0;
 	}
 
@@ -386,7 +356,7 @@ static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 	if (ret)
 		return ret;
 
-	return atmel_tcb_pwm_enable(chip, pwm);
+	return atmel_tcb_pwm_enable(chip, pwm, state->polarity);
 }
 
 static const struct pwm_ops atmel_tcb_pwm_ops = {
diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c
index c40a6548ce7d..2070d107c632 100644
--- a/drivers/pwm/pwm-stm32.c
+++ b/drivers/pwm/pwm-stm32.c
@@ -452,8 +452,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
 
 	enabled = pwm->state.enabled;
 
-	if (enabled && !state->enabled) {
-		stm32_pwm_disable(priv, pwm->hwpwm);
+	if (!state->enabled) {
+		if (enabled)
+			stm32_pwm_disable(priv, pwm->hwpwm);
 		return 0;
 	}
 
diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c
index 8a2a7112678c..bc26fe541662 100644
--- a/drivers/remoteproc/imx_rproc.c
+++ b/drivers/remoteproc/imx_rproc.c
@@ -596,31 +596,37 @@ static int imx_rproc_addr_init(struct imx_rproc *priv,
 		struct resource res;
 
 		node = of_parse_phandle(np, "memory-region", a);
+		if (!node)
+			continue;
 		/* Not map vdevbuffer, vdevring region */
 		if (!strncmp(node->name, "vdev", strlen("vdev"))) {
 			of_node_put(node);
 			continue;
 		}
 		err = of_address_to_resource(node, 0, &res);
-		of_node_put(node);
 		if (err) {
 			dev_err(dev, "unable to resolve memory region\n");
+			of_node_put(node);
 			return err;
 		}
 
-		if (b >= IMX_RPROC_MEM_MAX)
+		if (b >= IMX_RPROC_MEM_MAX) {
+			of_node_put(node);
 			break;
+		}
 
 		/* Not use resource version, because we might share region */
 		priv->mem[b].cpu_addr = devm_ioremap_wc(&pdev->dev, res.start, resource_size(&res));
 		if (!priv->mem[b].cpu_addr) {
 			dev_err(dev, "failed to remap %pr\n", &res);
+			of_node_put(node);
 			return -ENOMEM;
 		}
 		priv->mem[b].sys_addr = res.start;
 		priv->mem[b].size = resource_size(&res);
 		if (!strcmp(node->name, "rsc-table"))
 			priv->rsc_table = priv->mem[b].cpu_addr;
+		of_node_put(node);
 		b++;
 	}
 
diff --git a/drivers/remoteproc/stm32_rproc.c b/drivers/remoteproc/stm32_rproc.c
index 74da0393172c..d88220a8fb0c 100644
--- a/drivers/remoteproc/stm32_rproc.c
+++ b/drivers/remoteproc/stm32_rproc.c
@@ -293,7 +293,7 @@ static void stm32_rproc_mb_vq_work(struct work_struct *work)
 
 	mutex_lock(&rproc->lock);
 
-	if (rproc->state != RPROC_RUNNING)
+	if (rproc->state != RPROC_RUNNING && rproc->state != RPROC_ATTACHED)
 		goto unlock_mutex;
 
 	if (rproc_vq_interrupt(rproc, mb->vq_id) == IRQ_NONE)
diff --git a/drivers/rtc/interface.c b/drivers/rtc/interface.c
index 3d0fbc644f57..c928037bf6f3 100644
--- a/drivers/rtc/interface.c
+++ b/drivers/rtc/interface.c
@@ -274,10 +274,9 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
 			return err;
 
 		/* full-function RTCs won't have such missing fields */
-		if (rtc_valid_tm(&alarm->time) == 0) {
-			rtc_add_offset(rtc, &alarm->time);
-			return 0;
-		}
+		err = rtc_valid_tm(&alarm->time);
+		if (!err)
+			goto done;
 
 		/* get the "after" timestamp, to detect wrapped fields */
 		err = rtc_read_time(rtc, &now);
@@ -379,6 +378,8 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
 	if (err)
 		dev_warn(&rtc->dev, "invalid alarm value: %ptR\n",
 			 &alarm->time);
+	else
+		rtc_add_offset(rtc, &alarm->time);
 
 	return err;
 }
diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c
index e0a798923ce0..542568cd72b3 100644
--- a/drivers/rtc/rtc-cmos.c
+++ b/drivers/rtc/rtc-cmos.c
@@ -643,11 +643,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
 			   size_t count)
 {
 	unsigned char *buf = val;
-	int	retval;
 
 	off += NVRAM_OFFSET;
 	spin_lock_irq(&rtc_lock);
-	for (retval = 0; count; count--, off++, retval++) {
+	for (; count; count--, off++) {
 		if (off < 128)
 			*buf++ = CMOS_READ(off);
 		else if (can_bank2)
@@ -657,7 +656,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
 	}
 	spin_unlock_irq(&rtc_lock);
 
-	return retval;
+	return count ? -EIO : 0;
 }
 
 static int cmos_nvram_write(void *priv, unsigned int off, void *val,
@@ -665,7 +664,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 {
 	struct cmos_rtc	*cmos = priv;
 	unsigned char	*buf = val;
-	int		retval;
 
 	/* NOTE:  on at least PCs and Ataris, the boot firmware uses a
 	 * checksum on part of the NVRAM data.  That's currently ignored
@@ -674,7 +672,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 	 */
 	off += NVRAM_OFFSET;
 	spin_lock_irq(&rtc_lock);
-	for (retval = 0; count; count--, off++, retval++) {
+	for (; count; count--, off++) {
 		/* don't trash RTC registers */
 		if (off == cmos->day_alrm
 				|| off == cmos->mon_alrm
@@ -689,7 +687,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
 	}
 	spin_unlock_irq(&rtc_lock);
 
-	return retval;
+	return count ? -EIO : 0;
 }
 
 /*----------------------------------------------------------------*/
diff --git a/drivers/rtc/rtc-isl1208.c b/drivers/rtc/rtc-isl1208.c
index f448a525333e..2615b2cf8334 100644
--- a/drivers/rtc/rtc-isl1208.c
+++ b/drivers/rtc/rtc-isl1208.c
@@ -743,14 +743,13 @@ static int isl1208_nvmem_read(void *priv, unsigned int off, void *buf,
 {
 	struct isl1208_state *isl1208 = priv;
 	struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
-	int ret;
 
 	/* nvmem sanitizes offset/count for us, but count==0 is possible */
 	if (!count)
 		return count;
-	ret = isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
+
+	return isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
 				    count);
-	return ret == 0 ? count : ret;
 }
 
 static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
@@ -758,15 +757,13 @@ static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
 {
 	struct isl1208_state *isl1208 = priv;
 	struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
-	int ret;
 
 	/* nvmem sanitizes off/count for us, but count==0 is possible */
 	if (!count)
 		return count;
-	ret = isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
-				   count);
 
-	return ret == 0 ? count : ret;
+	return isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
+				   count);
 }
 
 static const struct nvmem_config isl1208_nvmem_config = {
diff --git a/drivers/s390/block/dasd_devmap.c b/drivers/s390/block/dasd_devmap.c
index b2a4c3433057..1129f6ae98b5 100644
--- a/drivers/s390/block/dasd_devmap.c
+++ b/drivers/s390/block/dasd_devmap.c
@@ -2135,13 +2135,19 @@ static ssize_t dasd_copy_pair_store(struct device *dev,
 
 	/* allocate primary devmap if needed */
 	prim_devmap = dasd_find_busid(prim_busid);
-	if (IS_ERR(prim_devmap))
+	if (IS_ERR(prim_devmap)) {
 		prim_devmap = dasd_add_busid(prim_busid, DASD_FEATURE_DEFAULT);
+		if (IS_ERR(prim_devmap))
+			return PTR_ERR(prim_devmap);
+	}
 
 	/* allocate secondary devmap if needed */
 	sec_devmap = dasd_find_busid(sec_busid);
-	if (IS_ERR(sec_devmap))
+	if (IS_ERR(sec_devmap)) {
 		sec_devmap = dasd_add_busid(sec_busid, DASD_FEATURE_DEFAULT);
+		if (IS_ERR(sec_devmap))
+			return PTR_ERR(sec_devmap);
+	}
 
 	/* setting copy relation is only allowed for offline secondary */
 	if (sec_devmap->device)
diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c
index 19bb64bdd88b..52dc9604f567 100644
--- a/drivers/scsi/qla2xxx/qla_bsg.c
+++ b/drivers/scsi/qla2xxx/qla_bsg.c
@@ -324,7 +324,7 @@ qla2x00_process_els(struct bsg_job *bsg_job)
 		    "request_sg_cnt=%x reply_sg_cnt=%x.\n",
 		    bsg_job->request_payload.sg_cnt,
 		    bsg_job->reply_payload.sg_cnt);
-		rval = -EPERM;
+		rval = -ENOBUFS;
 		goto done;
 	}
 
@@ -3059,17 +3059,61 @@ qla24xx_bsg_request(struct bsg_job *bsg_job)
 	return ret;
 }
 
-int
-qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+static bool qla_bsg_found(struct qla_qpair *qpair, struct bsg_job *bsg_job)
 {
+	bool found = false;
 	struct fc_bsg_reply *bsg_reply = bsg_job->reply;
 	scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
 	struct qla_hw_data *ha = vha->hw;
-	srb_t *sp;
-	int cnt, que;
+	srb_t *sp = NULL;
+	int cnt;
 	unsigned long flags;
 	struct req_que *req;
 
+	spin_lock_irqsave(qpair->qp_lock_ptr, flags);
+	req = qpair->req;
+
+	for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
+		sp = req->outstanding_cmds[cnt];
+		if (sp &&
+		    (sp->type == SRB_CT_CMD ||
+		     sp->type == SRB_ELS_CMD_HST ||
+		     sp->type == SRB_ELS_CMD_HST_NOLOGIN) &&
+		    sp->u.bsg_job == bsg_job) {
+			req->outstanding_cmds[cnt] = NULL;
+			spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+			if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
+				ql_log(ql_log_warn, vha, 0x7089,
+						"mbx abort_command failed.\n");
+				bsg_reply->result = -EIO;
+			} else {
+				ql_dbg(ql_dbg_user, vha, 0x708a,
+						"mbx abort_command success.\n");
+				bsg_reply->result = 0;
+			}
+			/* ref: INIT */
+			kref_put(&sp->cmd_kref, qla2x00_sp_release);
+
+			found = true;
+			goto done;
+		}
+	}
+	spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+done:
+	return found;
+}
+
+int
+qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+{
+	struct fc_bsg_reply *bsg_reply = bsg_job->reply;
+	scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
+	struct qla_hw_data *ha = vha->hw;
+	int i;
+	struct qla_qpair *qpair;
+
 	ql_log(ql_log_info, vha, 0x708b, "%s CMD timeout. bsg ptr %p.\n",
 	    __func__, bsg_job);
 
@@ -3079,48 +3123,22 @@ qla24xx_bsg_timeout(struct bsg_job *bsg_job)
 		qla_pci_set_eeh_busy(vha);
 	}
 
+	if (qla_bsg_found(ha->base_qpair, bsg_job))
+		goto done;
+
 	/* find the bsg job from the active list of commands */
-	spin_lock_irqsave(&ha->hardware_lock, flags);
-	for (que = 0; que < ha->max_req_queues; que++) {
-		req = ha->req_q_map[que];
-		if (!req)
+	for (i = 0; i < ha->max_qpairs; i++) {
+		qpair = vha->hw->queue_pair_map[i];
+		if (!qpair)
 			continue;
-
-		for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
-			sp = req->outstanding_cmds[cnt];
-			if (sp &&
-			    (sp->type == SRB_CT_CMD ||
-			     sp->type == SRB_ELS_CMD_HST ||
-			     sp->type == SRB_ELS_CMD_HST_NOLOGIN ||
-			     sp->type == SRB_FXIOCB_BCMD) &&
-			    sp->u.bsg_job == bsg_job) {
-				req->outstanding_cmds[cnt] = NULL;
-				spin_unlock_irqrestore(&ha->hardware_lock, flags);
-
-				if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
-					ql_log(ql_log_warn, vha, 0x7089,
-					    "mbx abort_command failed.\n");
-					bsg_reply->result = -EIO;
-				} else {
-					ql_dbg(ql_dbg_user, vha, 0x708a,
-					    "mbx abort_command success.\n");
-					bsg_reply->result = 0;
-				}
-				spin_lock_irqsave(&ha->hardware_lock, flags);
-				goto done;
-
-			}
-		}
+		if (qla_bsg_found(qpair, bsg_job))
+			goto done;
 	}
-	spin_unlock_irqrestore(&ha->hardware_lock, flags);
+
 	ql_log(ql_log_info, vha, 0x708b, "SRB not found to abort.\n");
 	bsg_reply->result = -ENXIO;
-	return 0;
 
 done:
-	spin_unlock_irqrestore(&ha->hardware_lock, flags);
-	/* ref: INIT */
-	kref_put(&sp->cmd_kref, qla2x00_sp_release);
 	return 0;
 }
 
diff --git a/drivers/scsi/qla2xxx/qla_def.h b/drivers/scsi/qla2xxx/qla_def.h
index 31c451daeeb8..8490181424c7 100644
--- a/drivers/scsi/qla2xxx/qla_def.h
+++ b/drivers/scsi/qla2xxx/qla_def.h
@@ -3278,6 +3278,8 @@ struct fab_scan_rp {
 struct fab_scan {
 	struct fab_scan_rp *l;
 	u32 size;
+	u32 rscn_gen_start;
+	u32 rscn_gen_end;
 	u16 scan_retry;
 #define MAX_SCAN_RETRIES 5
 	enum scan_flags_t scan_flags;
@@ -4985,6 +4987,7 @@ typedef struct scsi_qla_host {
 
 	/* Counter to detect races between ELS and RSCN events */
 	atomic_t		generation_tick;
+	atomic_t		rscn_gen;
 	/* Time when global fcport update has been scheduled */
 	int			total_fcport_update_gen;
 	/* List of pending LOGOs, protected by tgt_mutex */
diff --git a/drivers/scsi/qla2xxx/qla_gs.c b/drivers/scsi/qla2xxx/qla_gs.c
index 64ab070b8716..9c707d677f64 100644
--- a/drivers/scsi/qla2xxx/qla_gs.c
+++ b/drivers/scsi/qla2xxx/qla_gs.c
@@ -1710,7 +1710,7 @@ qla2x00_hba_attributes(scsi_qla_host_t *vha, void *entries,
 	eiter->type = cpu_to_be16(FDMI_HBA_OPTION_ROM_VERSION);
 	alen = scnprintf(
 		eiter->a.orom_version, sizeof(eiter->a.orom_version),
-		"%d.%02d", ha->bios_revision[1], ha->bios_revision[0]);
+		"%d.%02d", ha->efi_revision[1], ha->efi_revision[0]);
 	alen += FDMI_ATTR_ALIGNMENT(alen);
 	alen += FDMI_ATTR_TYPELEN(eiter);
 	eiter->len = cpu_to_be16(alen);
@@ -3465,6 +3465,29 @@ static int qla2x00_is_a_vp(scsi_qla_host_t *vha, u64 wwn)
 	return rc;
 }
 
+static bool qla_ok_to_clear_rscn(scsi_qla_host_t *vha, fc_port_t *fcport)
+{
+	u32 rscn_gen;
+
+	rscn_gen = atomic_read(&vha->rscn_gen);
+	ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2017,
+	    "%s %d %8phC rscn_gen %x start %x end %x current %x\n",
+	    __func__, __LINE__, fcport->port_name, fcport->rscn_gen,
+	    vha->scan.rscn_gen_start, vha->scan.rscn_gen_end, rscn_gen);
+
+	if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_start,
+	    vha->scan.rscn_gen_end))
+		/* rscn came in before fabric scan */
+		return true;
+
+	if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_end, rscn_gen))
+		/* rscn came in after fabric scan */
+		return false;
+
+	/* rare: fcport's scan_needed + rscn_gen must be stale */
+	return true;
+}
+
 void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 {
 	fc_port_t *fcport;
@@ -3578,10 +3601,10 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 				   (fcport->scan_needed &&
 				    fcport->port_type != FCT_INITIATOR &&
 				    fcport->port_type != FCT_NVME_INITIATOR)) {
+				fcport->scan_needed = 0;
 				qlt_schedule_sess_for_deletion(fcport);
 			}
 			fcport->d_id.b24 = rp->id.b24;
-			fcport->scan_needed = 0;
 			break;
 		}
 
@@ -3622,7 +3645,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 				do_delete = true;
 			}
 
-			fcport->scan_needed = 0;
+			if (qla_ok_to_clear_rscn(vha, fcport))
+				fcport->scan_needed = 0;
+
 			if (((qla_dual_mode_enabled(vha) ||
 			      qla_ini_mode_enabled(vha)) &&
 			    atomic_read(&fcport->state) == FCS_ONLINE) ||
@@ -3652,7 +3677,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
 					    fcport->port_name, fcport->loop_id,
 					    fcport->login_retry);
 				}
-				fcport->scan_needed = 0;
+
+				if (qla_ok_to_clear_rscn(vha, fcport))
+					fcport->scan_needed = 0;
 				qla24xx_fcport_handle_login(vha, fcport);
 			}
 		}
diff --git a/drivers/scsi/qla2xxx/qla_init.c b/drivers/scsi/qla2xxx/qla_init.c
index 6dce3f166564..a65c60160820 100644
--- a/drivers/scsi/qla2xxx/qla_init.c
+++ b/drivers/scsi/qla2xxx/qla_init.c
@@ -1843,10 +1843,18 @@ int qla24xx_post_newsess_work(struct scsi_qla_host *vha, port_id_t *id,
 	return qla2x00_post_work(vha, e);
 }
 
+static void qla_rscn_gen_tick(scsi_qla_host_t *vha, u32 *ret_rscn_gen)
+{
+	*ret_rscn_gen = atomic_inc_return(&vha->rscn_gen);
+	/* memory barrier */
+	wmb();
+}
+
 void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 {
 	fc_port_t *fcport;
 	unsigned long flags;
+	u32 rscn_gen;
 
 	switch (ea->id.b.rsvd_1) {
 	case RSCN_PORT_ADDR:
@@ -1876,15 +1884,16 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 					 * Otherwise we're already in the middle of a relogin
 					 */
 					fcport->scan_needed = 1;
-					fcport->rscn_gen++;
+					qla_rscn_gen_tick(vha, &fcport->rscn_gen);
 				}
 			} else {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				qla_rscn_gen_tick(vha, &fcport->rscn_gen);
 			}
 		}
 		break;
 	case RSCN_AREA_ADDR:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1892,11 +1901,12 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 
 			if ((ea->id.b24 & 0xffff00) == (fcport->d_id.b24 & 0xffff00)) {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				fcport->rscn_gen = rscn_gen;
 			}
 		}
 		break;
 	case RSCN_DOM_ADDR:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1904,19 +1914,20 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 
 			if ((ea->id.b24 & 0xff0000) == (fcport->d_id.b24 & 0xff0000)) {
 				fcport->scan_needed = 1;
-				fcport->rscn_gen++;
+				fcport->rscn_gen = rscn_gen;
 			}
 		}
 		break;
 	case RSCN_FAB_ADDR:
 	default:
+		qla_rscn_gen_tick(vha, &rscn_gen);
 		list_for_each_entry(fcport, &vha->vp_fcports, list) {
 			if (fcport->flags & FCF_FCP2_DEVICE &&
 			    atomic_read(&fcport->state) == FCS_ONLINE)
 				continue;
 
 			fcport->scan_needed = 1;
-			fcport->rscn_gen++;
+			fcport->rscn_gen = rscn_gen;
 		}
 		break;
 	}
@@ -1925,6 +1936,7 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
 	if (vha->scan.scan_flags == 0) {
 		ql_dbg(ql_dbg_disc, vha, 0xffff, "%s: schedule\n", __func__);
 		vha->scan.scan_flags |= SF_QUEUED;
+		vha->scan.rscn_gen_start = atomic_read(&vha->rscn_gen);
 		schedule_delayed_work(&vha->scan.scan_work, 5);
 	}
 	spin_unlock_irqrestore(&vha->work_lock, flags);
@@ -6419,6 +6431,8 @@ qla2x00_configure_fabric(scsi_qla_host_t *vha)
 		qlt_do_generation_tick(vha, &discovery_gen);
 
 		if (USE_ASYNC_SCAN(ha)) {
+			/* start of scan begins here */
+			vha->scan.rscn_gen_end = atomic_read(&vha->rscn_gen);
 			rval = qla24xx_async_gpnft(vha, FC4_TYPE_FCP_SCSI,
 			    NULL);
 			if (rval)
@@ -8260,15 +8274,21 @@ qla28xx_get_aux_images(
 	struct qla27xx_image_status pri_aux_image_status, sec_aux_image_status;
 	bool valid_pri_image = false, valid_sec_image = false;
 	bool active_pri_image = false, active_sec_image = false;
+	int rc;
 
 	if (!ha->flt_region_aux_img_status_pri) {
 		ql_dbg(ql_dbg_init, vha, 0x018a, "Primary aux image not addressed\n");
 		goto check_sec_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
 	    ha->flt_region_aux_img_status_pri,
 	    sizeof(pri_aux_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a1,
+		    "Unable to read Primary aux image(%x).\n", rc);
+		goto check_sec_image;
+	}
 	qla27xx_print_image(vha, "Primary aux image", &pri_aux_image_status);
 
 	if (qla28xx_check_aux_image_status_signature(&pri_aux_image_status)) {
@@ -8299,9 +8319,15 @@ qla28xx_get_aux_images(
 		goto check_valid_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
 	    ha->flt_region_aux_img_status_sec,
 	    sizeof(sec_aux_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a2,
+		    "Unable to read Secondary aux image(%x).\n", rc);
+		goto check_valid_image;
+	}
+
 	qla27xx_print_image(vha, "Secondary aux image", &sec_aux_image_status);
 
 	if (qla28xx_check_aux_image_status_signature(&sec_aux_image_status)) {
@@ -8359,6 +8385,7 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
 	struct qla27xx_image_status pri_image_status, sec_image_status;
 	bool valid_pri_image = false, valid_sec_image = false;
 	bool active_pri_image = false, active_sec_image = false;
+	int rc;
 
 	if (!ha->flt_region_img_status_pri) {
 		ql_dbg(ql_dbg_init, vha, 0x018a, "Primary image not addressed\n");
@@ -8400,8 +8427,14 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
 		goto check_valid_image;
 	}
 
-	qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
+	rc = qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
 	    ha->flt_region_img_status_sec, sizeof(sec_image_status) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a3,
+		    "Unable to read Secondary image status(%x).\n", rc);
+		goto check_valid_image;
+	}
+
 	qla27xx_print_image(vha, "Secondary image", &sec_image_status);
 
 	if (qla27xx_check_image_status_signature(&sec_image_status)) {
@@ -8473,11 +8506,10 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 	    "FW: Loading firmware from flash (%x).\n", faddr);
 
 	dcode = (uint32_t *)req->ring;
-	qla24xx_read_flash_data(vha, dcode, faddr, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
+	rval = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+	if (rval || qla24xx_risc_firmware_invalid(dcode)) {
 		ql_log(ql_log_fatal, vha, 0x008c,
-		    "Unable to verify the integrity of flash firmware "
-		    "image.\n");
+		    "Unable to verify the integrity of flash firmware image (rval %x).\n", rval);
 		ql_log(ql_log_fatal, vha, 0x008d,
 		    "Firmware data: %08x %08x %08x %08x.\n",
 		    dcode[0], dcode[1], dcode[2], dcode[3]);
@@ -8491,7 +8523,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 	for (j = 0; j < segments; j++) {
 		ql_dbg(ql_dbg_init, vha, 0x008d,
 		    "-> Loading segment %u...\n", j);
-		qla24xx_read_flash_data(vha, dcode, faddr, 10);
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, 10);
+		if (rval) {
+			ql_log(ql_log_fatal, vha, 0x016a,
+			    "-> Unable to read segment addr + size .\n");
+			return QLA_FUNCTION_FAILED;
+		}
 		risc_addr = be32_to_cpu((__force __be32)dcode[2]);
 		risc_size = be32_to_cpu((__force __be32)dcode[3]);
 		if (!*srisc_addr) {
@@ -8507,7 +8544,13 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 			ql_dbg(ql_dbg_init, vha, 0x008e,
 			    "-> Loading fragment %u: %#x <- %#x (%#lx dwords)...\n",
 			    fragment, risc_addr, faddr, dlen);
-			qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+			rval = qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+			if (rval) {
+				ql_log(ql_log_fatal, vha, 0x016b,
+				    "-> Unable to read fragment(faddr %#x dlen %#lx).\n",
+				    faddr, dlen);
+				return QLA_FUNCTION_FAILED;
+			}
 			for (i = 0; i < dlen; i++)
 				dcode[i] = swab32(dcode[i]);
 
@@ -8536,7 +8579,14 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 		fwdt->length = 0;
 
 		dcode = (uint32_t *)req->ring;
-		qla24xx_read_flash_data(vha, dcode, faddr, 7);
+
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, 7);
+		if (rval) {
+			ql_log(ql_log_fatal, vha, 0x016c,
+			    "-> Unable to read template size.\n");
+			goto failed;
+		}
+
 		risc_size = be32_to_cpu((__force __be32)dcode[2]);
 		ql_dbg(ql_dbg_init, vha, 0x0161,
 		    "-> fwdt%u template array at %#x (%#x dwords)\n",
@@ -8562,11 +8612,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
 		}
 
 		dcode = fwdt->template;
-		qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
+		rval = qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
 
-		if (!qla27xx_fwdt_template_valid(dcode)) {
+		if (rval || !qla27xx_fwdt_template_valid(dcode)) {
 			ql_log(ql_log_warn, vha, 0x0165,
-			    "-> fwdt%u failed template validate\n", j);
+			    "-> fwdt%u failed template validate (rval %x)\n",
+			    j, rval);
 			goto failed;
 		}
 
diff --git a/drivers/scsi/qla2xxx/qla_inline.h b/drivers/scsi/qla2xxx/qla_inline.h
index a4a56ab0ba74..ef4b3cc1cd77 100644
--- a/drivers/scsi/qla2xxx/qla_inline.h
+++ b/drivers/scsi/qla2xxx/qla_inline.h
@@ -631,3 +631,11 @@ static inline int qla_mapq_alloc_qp_cpu_map(struct qla_hw_data *ha)
 	}
 	return 0;
 }
+
+static inline bool val_is_in_range(u32 val, u32 start, u32 end)
+{
+	if (val >= start && val <= end)
+		return true;
+	else
+		return false;
+}
diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c
index 16a9f22bb860..9e8df452ee14 100644
--- a/drivers/scsi/qla2xxx/qla_mid.c
+++ b/drivers/scsi/qla2xxx/qla_mid.c
@@ -180,7 +180,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha)
 	atomic_set(&vha->loop_state, LOOP_DOWN);
 	atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME);
 	list_for_each_entry(fcport, &vha->vp_fcports, list)
-		fcport->logout_on_delete = 0;
+		fcport->logout_on_delete = 1;
 
 	if (!vha->hw->flags.edif_enabled)
 		qla2x00_wait_for_sess_deletion(vha);
diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c
index 9941b38eac93..622b11660b67 100644
--- a/drivers/scsi/qla2xxx/qla_nvme.c
+++ b/drivers/scsi/qla2xxx/qla_nvme.c
@@ -29,7 +29,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport)
 		return 0;
 	}
 
-	if (!vha->nvme_local_port && qla_nvme_register_hba(vha))
+	if (qla_nvme_register_hba(vha))
+		return 0;
+
+	if (!vha->nvme_local_port)
 		return 0;
 
 	if (!(fcport->nvme_prli_service_param &
diff --git a/drivers/scsi/qla2xxx/qla_os.c b/drivers/scsi/qla2xxx/qla_os.c
index 25d0c2bfdd74..41a7ffaabfd1 100644
--- a/drivers/scsi/qla2xxx/qla_os.c
+++ b/drivers/scsi/qla2xxx/qla_os.c
@@ -1869,14 +1869,9 @@ __qla2x00_abort_all_cmds(struct qla_qpair *qp, int res)
 	for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
 		sp = req->outstanding_cmds[cnt];
 		if (sp) {
-			/*
-			 * perform lockless completion during driver unload
-			 */
 			if (qla2x00_chip_is_down(vha)) {
 				req->outstanding_cmds[cnt] = NULL;
-				spin_unlock_irqrestore(qp->qp_lock_ptr, flags);
 				sp->done(sp, res);
-				spin_lock_irqsave(qp->qp_lock_ptr, flags);
 				continue;
 			}
 
@@ -4667,7 +4662,7 @@ static void
 qla2x00_number_of_exch(scsi_qla_host_t *vha, u32 *ret_cnt, u16 max_cnt)
 {
 	u32 temp;
-	struct init_cb_81xx *icb = (struct init_cb_81xx *)&vha->hw->init_cb;
+	struct init_cb_81xx *icb = (struct init_cb_81xx *)vha->hw->init_cb;
 	*ret_cnt = FW_DEF_EXCHANGES_CNT;
 
 	if (max_cnt > vha->hw->max_exchg)
diff --git a/drivers/scsi/qla2xxx/qla_sup.c b/drivers/scsi/qla2xxx/qla_sup.c
index c092a6b1ced4..6d16546e1729 100644
--- a/drivers/scsi/qla2xxx/qla_sup.c
+++ b/drivers/scsi/qla2xxx/qla_sup.c
@@ -555,6 +555,7 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	struct qla_flt_location *fltl = (void *)req->ring;
 	uint32_t *dcode = (uint32_t *)req->ring;
 	uint8_t *buf = (void *)req->ring, *bcode,  last_image;
+	int rc;
 
 	/*
 	 * FLT-location structure resides after the last PCI region.
@@ -584,14 +585,24 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	pcihdr = 0;
 	do {
 		/* Verify PCI expansion ROM header. */
-		qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		if (rc) {
+			ql_log(ql_log_info, vha, 0x016d,
+			    "Unable to read PCI Expansion Rom Header (%x).\n", rc);
+			return QLA_FUNCTION_FAILED;
+		}
 		bcode = buf + (pcihdr % 4);
 		if (bcode[0x0] != 0x55 || bcode[0x1] != 0xaa)
 			goto end;
 
 		/* Locate PCI data structure. */
 		pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
-		qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		rc = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		if (rc) {
+			ql_log(ql_log_info, vha, 0x0179,
+			    "Unable to read PCI Data Structure (%x).\n", rc);
+			return QLA_FUNCTION_FAILED;
+		}
 		bcode = buf + (pcihdr % 4);
 
 		/* Validate signature of PCI data structure. */
@@ -606,7 +617,12 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
 	} while (!last_image);
 
 	/* Now verify FLT-location structure. */
-	qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+	rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x017a,
+		    "Unable to read FLT (%x).\n", rc);
+		return QLA_FUNCTION_FAILED;
+	}
 	if (memcmp(fltl->sig, "QFLT", 4))
 		goto end;
 
@@ -2605,13 +2621,18 @@ qla24xx_read_optrom_data(struct scsi_qla_host *vha, void *buf,
     uint32_t offset, uint32_t length)
 {
 	struct qla_hw_data *ha = vha->hw;
+	int rc;
 
 	/* Suspend HBA. */
 	scsi_block_requests(vha->host);
 	set_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
 
 	/* Go with read. */
-	qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+	rc = qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+	if (rc) {
+		ql_log(ql_log_info, vha, 0x01a0,
+		    "Unable to perform optrom read(%x).\n", rc);
+	}
 
 	/* Resume HBA. */
 	clear_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
@@ -3412,7 +3433,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 	struct active_regions active_regions = { };
 
 	if (IS_P3P_TYPE(ha))
-		return ret;
+		return QLA_SUCCESS;
 
 	if (!mbuf)
 		return QLA_FUNCTION_FAILED;
@@ -3432,20 +3453,31 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 
 	do {
 		/* Verify PCI expansion ROM header. */
-		qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		ret = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+		if (ret) {
+			ql_log(ql_log_info, vha, 0x017d,
+			    "Unable to read PCI EXP Rom Header(%x).\n", ret);
+			return QLA_FUNCTION_FAILED;
+		}
+
 		bcode = mbuf + (pcihdr % 4);
 		if (memcmp(bcode, "\x55\xaa", 2)) {
 			/* No signature */
 			ql_log(ql_log_fatal, vha, 0x0059,
 			    "No matching ROM signature.\n");
-			ret = QLA_FUNCTION_FAILED;
-			break;
+			return QLA_FUNCTION_FAILED;
 		}
 
 		/* Locate PCI data structure. */
 		pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
 
-		qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		ret = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+		if (ret) {
+			ql_log(ql_log_info, vha, 0x018e,
+			    "Unable to read PCI Data Structure (%x).\n", ret);
+			return QLA_FUNCTION_FAILED;
+		}
+
 		bcode = mbuf + (pcihdr % 4);
 
 		/* Validate signature of PCI data structure. */
@@ -3454,8 +3486,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 			ql_log(ql_log_fatal, vha, 0x005a,
 			    "PCI data struct not found pcir_adr=%x.\n", pcids);
 			ql_dump_buffer(ql_dbg_init, vha, 0x0059, dcode, 32);
-			ret = QLA_FUNCTION_FAILED;
-			break;
+			return QLA_FUNCTION_FAILED;
 		}
 
 		/* Read version */
@@ -3507,20 +3538,26 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 			faddr = ha->flt_region_fw_sec;
 	}
 
-	qla24xx_read_flash_data(vha, dcode, faddr, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
-		ql_log(ql_log_warn, vha, 0x005f,
-		    "Unrecognized fw revision at %x.\n",
-		    ha->flt_region_fw * 4);
-		ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+	ret = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+	if (ret) {
+		ql_log(ql_log_info, vha, 0x019e,
+		    "Unable to read FW version (%x).\n", ret);
+		return ret;
 	} else {
-		for (i = 0; i < 4; i++)
-			ha->fw_revision[i] =
+		if (qla24xx_risc_firmware_invalid(dcode)) {
+			ql_log(ql_log_warn, vha, 0x005f,
+			    "Unrecognized fw revision at %x.\n",
+			    ha->flt_region_fw * 4);
+			ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+		} else {
+			for (i = 0; i < 4; i++)
+				ha->fw_revision[i] =
 				be32_to_cpu((__force __be32)dcode[4+i]);
-		ql_dbg(ql_dbg_init, vha, 0x0060,
-		    "Firmware revision (flash) %u.%u.%u (%x).\n",
-		    ha->fw_revision[0], ha->fw_revision[1],
-		    ha->fw_revision[2], ha->fw_revision[3]);
+			ql_dbg(ql_dbg_init, vha, 0x0060,
+			    "Firmware revision (flash) %u.%u.%u (%x).\n",
+			    ha->fw_revision[0], ha->fw_revision[1],
+			    ha->fw_revision[2], ha->fw_revision[3]);
+		}
 	}
 
 	/* Check for golden firmware and get version if available */
@@ -3531,18 +3568,23 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
 
 	memset(ha->gold_fw_version, 0, sizeof(ha->gold_fw_version));
 	faddr = ha->flt_region_gold_fw;
-	qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
-	if (qla24xx_risc_firmware_invalid(dcode)) {
-		ql_log(ql_log_warn, vha, 0x0056,
-		    "Unrecognized golden fw at %#x.\n", faddr);
-		ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+	ret = qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
+	if (ret) {
+		ql_log(ql_log_info, vha, 0x019f,
+		    "Unable to read Gold FW version (%x).\n", ret);
 		return ret;
-	}
-
-	for (i = 0; i < 4; i++)
-		ha->gold_fw_version[i] =
-			be32_to_cpu((__force __be32)dcode[4+i]);
+	} else {
+		if (qla24xx_risc_firmware_invalid(dcode)) {
+			ql_log(ql_log_warn, vha, 0x0056,
+			    "Unrecognized golden fw at %#x.\n", faddr);
+			ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+			return QLA_FUNCTION_FAILED;
+		}
 
+		for (i = 0; i < 4; i++)
+			ha->gold_fw_version[i] =
+			   be32_to_cpu((__force __be32)dcode[4+i]);
+	}
 	return ret;
 }
 
diff --git a/drivers/soc/qcom/pdr_interface.c b/drivers/soc/qcom/pdr_interface.c
index 0034af927b48..c7cd4daa10b0 100644
--- a/drivers/soc/qcom/pdr_interface.c
+++ b/drivers/soc/qcom/pdr_interface.c
@@ -76,12 +76,12 @@ static int pdr_locator_new_server(struct qmi_handle *qmi,
 					      locator_hdl);
 	struct pdr_service *pds;
 
+	mutex_lock(&pdr->lock);
 	/* Create a local client port for QMI communication */
 	pdr->locator_addr.sq_family = AF_QIPCRTR;
 	pdr->locator_addr.sq_node = svc->node;
 	pdr->locator_addr.sq_port = svc->port;
 
-	mutex_lock(&pdr->lock);
 	pdr->locator_init_complete = true;
 	mutex_unlock(&pdr->lock);
 
@@ -104,10 +104,10 @@ static void pdr_locator_del_server(struct qmi_handle *qmi,
 
 	mutex_lock(&pdr->lock);
 	pdr->locator_init_complete = false;
-	mutex_unlock(&pdr->lock);
 
 	pdr->locator_addr.sq_node = 0;
 	pdr->locator_addr.sq_port = 0;
+	mutex_unlock(&pdr->lock);
 }
 
 static const struct qmi_ops pdr_locator_ops = {
@@ -365,12 +365,14 @@ static int pdr_get_domain_list(struct servreg_get_domain_list_req *req,
 	if (ret < 0)
 		return ret;
 
+	mutex_lock(&pdr->lock);
 	ret = qmi_send_request(&pdr->locator_hdl,
 			       &pdr->locator_addr,
 			       &txn, SERVREG_GET_DOMAIN_LIST_REQ,
 			       SERVREG_GET_DOMAIN_LIST_REQ_MAX_LEN,
 			       servreg_get_domain_list_req_ei,
 			       req);
+	mutex_unlock(&pdr->lock);
 	if (ret < 0) {
 		qmi_txn_cancel(&txn);
 		return ret;
@@ -415,7 +417,7 @@ static int pdr_locate_service(struct pdr_handle *pdr, struct pdr_service *pds)
 		if (ret < 0)
 			goto out;
 
-		for (i = domains_read; i < resp->domain_list_len; i++) {
+		for (i = 0; i < resp->domain_list_len; i++) {
 			entry = &resp->domain_list[i];
 
 			if (strnlen(entry->name, sizeof(entry->name)) == sizeof(entry->name))
diff --git a/drivers/soc/qcom/rpmh-rsc.c b/drivers/soc/qcom/rpmh-rsc.c
index 5e7bb6338707..ff2b9eb9f669 100644
--- a/drivers/soc/qcom/rpmh-rsc.c
+++ b/drivers/soc/qcom/rpmh-rsc.c
@@ -608,13 +608,14 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
 {
 	struct tcs_group *tcs;
 	int tcs_id;
-	unsigned long flags;
+
+	might_sleep();
 
 	tcs = get_tcs_for_msg(drv, msg);
 	if (IS_ERR(tcs))
 		return PTR_ERR(tcs);
 
-	spin_lock_irqsave(&drv->lock, flags);
+	spin_lock_irq(&drv->lock);
 
 	/* Wait forever for a free tcs. It better be there eventually! */
 	wait_event_lock_irq(drv->tcs_wait,
@@ -632,7 +633,7 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
 		write_tcs_reg_sync(drv, RSC_DRV_CMD_ENABLE, tcs_id, 0);
 		enable_tcs_irq(drv, tcs_id, true);
 	}
-	spin_unlock_irqrestore(&drv->lock, flags);
+	spin_unlock_irq(&drv->lock);
 
 	/*
 	 * These two can be done after the lock is released because:
diff --git a/drivers/soc/qcom/rpmh.c b/drivers/soc/qcom/rpmh.c
index 01765ee9cdfb..c6df7ac0afeb 100644
--- a/drivers/soc/qcom/rpmh.c
+++ b/drivers/soc/qcom/rpmh.c
@@ -189,7 +189,6 @@ static int __rpmh_write(const struct device *dev, enum rpmh_state state,
 	}
 
 	if (state == RPMH_ACTIVE_ONLY_STATE) {
-		WARN_ON(irqs_disabled());
 		ret = rpmh_rsc_send_data(ctrlr_to_drv(ctrlr), &rpm_msg->msg);
 	} else {
 		/* Clean up our call by spoofing tx_done */
diff --git a/drivers/soc/xilinx/xlnx_event_manager.c b/drivers/soc/xilinx/xlnx_event_manager.c
index 8293cc40047f..82e317474023 100644
--- a/drivers/soc/xilinx/xlnx_event_manager.c
+++ b/drivers/soc/xilinx/xlnx_event_manager.c
@@ -3,6 +3,7 @@
  * Xilinx Event Management Driver
  *
  *  Copyright (C) 2021 Xilinx, Inc.
+ *  Copyright (C) 2024 Advanced Micro Devices, Inc.
  *
  *  Abhyuday Godhasara <abhyuday.godhasara@xilinx.com>
  */
@@ -19,7 +20,7 @@
 #include <linux/platform_device.h>
 #include <linux/slab.h>
 
-static DEFINE_PER_CPU_READ_MOSTLY(int, cpu_number1);
+static DEFINE_PER_CPU_READ_MOSTLY(int, dummy_cpu_number);
 
 static int virq_sgi;
 static int event_manager_availability = -EACCES;
@@ -555,7 +556,6 @@ static void xlnx_disable_percpu_irq(void *data)
 static int xlnx_event_init_sgi(struct platform_device *pdev)
 {
 	int ret = 0;
-	int cpu;
 	/*
 	 * IRQ related structures are used for the following:
 	 * for each SGI interrupt ensure its mapped by GIC IRQ domain
@@ -592,11 +592,8 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
 	sgi_fwspec.param[0] = sgi_num;
 	virq_sgi = irq_create_fwspec_mapping(&sgi_fwspec);
 
-	cpu = get_cpu();
-	per_cpu(cpu_number1, cpu) = cpu;
 	ret = request_percpu_irq(virq_sgi, xlnx_event_handler, "xlnx_event_mgmt",
-				 &cpu_number1);
-	put_cpu();
+				 &dummy_cpu_number);
 
 	WARN_ON(ret);
 	if (ret) {
@@ -612,16 +609,12 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
 
 static void xlnx_event_cleanup_sgi(struct platform_device *pdev)
 {
-	int cpu = smp_processor_id();
-
-	per_cpu(cpu_number1, cpu) = cpu;
-
 	cpuhp_remove_state(CPUHP_AP_ONLINE_DYN);
 
 	on_each_cpu(xlnx_disable_percpu_irq, NULL, 1);
 
 	irq_clear_status_flags(virq_sgi, IRQ_PER_CPU);
-	free_percpu_irq(virq_sgi, &cpu_number1);
+	free_percpu_irq(virq_sgi, &dummy_cpu_number);
 	irq_dispose_mapping(virq_sgi);
 }
 
diff --git a/drivers/soc/xilinx/zynqmp_power.c b/drivers/soc/xilinx/zynqmp_power.c
index 78a8a7545d1e..5d41763414ad 100644
--- a/drivers/soc/xilinx/zynqmp_power.c
+++ b/drivers/soc/xilinx/zynqmp_power.c
@@ -187,7 +187,9 @@ static int zynqmp_pm_probe(struct platform_device *pdev)
 	u32 pm_api_version;
 	struct mbox_client *client;
 
-	zynqmp_pm_get_api_version(&pm_api_version);
+	ret = zynqmp_pm_get_api_version(&pm_api_version);
+	if (ret)
+		return ret;
 
 	/* Check PM API version number */
 	if (pm_api_version < ZYNQMP_PM_VERSION)
diff --git a/drivers/spi/atmel-quadspi.c b/drivers/spi/atmel-quadspi.c
index 7e05b48dbd71..1f1aee28b1f7 100644
--- a/drivers/spi/atmel-quadspi.c
+++ b/drivers/spi/atmel-quadspi.c
@@ -724,8 +724,15 @@ static int __maybe_unused atmel_qspi_resume(struct device *dev)
 	struct atmel_qspi *aq = spi_controller_get_devdata(ctrl);
 	int ret;
 
-	clk_prepare(aq->pclk);
-	clk_prepare(aq->qspick);
+	ret = clk_prepare(aq->pclk);
+	if (ret)
+		return ret;
+
+	ret = clk_prepare(aq->qspick);
+	if (ret) {
+		clk_unprepare(aq->pclk);
+		return ret;
+	}
 
 	ret = pm_runtime_force_resume(dev);
 	if (ret < 0)
diff --git a/drivers/spi/spi-microchip-core.c b/drivers/spi/spi-microchip-core.c
index d352844c798c..bfad0fe743ad 100644
--- a/drivers/spi/spi-microchip-core.c
+++ b/drivers/spi/spi-microchip-core.c
@@ -21,7 +21,7 @@
 #include <linux/spi/spi.h>
 
 #define MAX_LEN				(0xffff)
-#define MAX_CS				(8)
+#define MAX_CS				(1)
 #define DEFAULT_FRAMESIZE		(8)
 #define FIFO_DEPTH			(32)
 #define CLK_GEN_MODE1_MAX		(255)
@@ -75,6 +75,7 @@
 
 #define REG_CONTROL		(0x00)
 #define REG_FRAME_SIZE		(0x04)
+#define  FRAME_SIZE_MASK	GENMASK(5, 0)
 #define REG_STATUS		(0x08)
 #define REG_INT_CLEAR		(0x0c)
 #define REG_RX_DATA		(0x10)
@@ -89,6 +90,7 @@
 #define REG_RIS			(0x24)
 #define REG_CONTROL2		(0x28)
 #define REG_COMMAND		(0x2c)
+#define  COMMAND_CLRFRAMECNT	BIT(4)
 #define REG_PKTSIZE		(0x30)
 #define REG_CMD_SIZE		(0x34)
 #define REG_HWSTATUS		(0x38)
@@ -157,62 +159,59 @@ static inline void mchp_corespi_read_fifo(struct mchp_corespi *spi)
 
 static void mchp_corespi_enable_ints(struct mchp_corespi *spi)
 {
-	u32 control, mask = INT_ENABLE_MASK;
-
-	mchp_corespi_disable(spi);
-
-	control = mchp_corespi_read(spi, REG_CONTROL);
-
-	control |= mask;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_ENABLE;
+	control |= INT_ENABLE_MASK;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
 
 static void mchp_corespi_disable_ints(struct mchp_corespi *spi)
 {
-	u32 control, mask = INT_ENABLE_MASK;
-
-	mchp_corespi_disable(spi);
-
-	control = mchp_corespi_read(spi, REG_CONTROL);
-	control &= ~mask;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_ENABLE;
+	control &= ~INT_ENABLE_MASK;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
 
 static inline void mchp_corespi_set_xfer_size(struct mchp_corespi *spi, int len)
 {
 	u32 control;
-	u16 lenpart;
+	u32 lenpart;
+	u32 frames = mchp_corespi_read(spi, REG_FRAMESUP);
 
 	/*
-	 * Disable the SPI controller. Writes to transfer length have
-	 * no effect when the controller is enabled.
+	 * Writing to FRAMECNT in REG_CONTROL will reset the frame count, taking
+	 * a shortcut requires an explicit clear.
 	 */
-	mchp_corespi_disable(spi);
+	if (frames == len) {
+		mchp_corespi_write(spi, REG_COMMAND, COMMAND_CLRFRAMECNT);
+		return;
+	}
 
 	/*
 	 * The lower 16 bits of the frame count are stored in the control reg
 	 * for legacy reasons, but the upper 16 written to a different register:
 	 * FRAMESUP. While both the upper and lower bits can be *READ* from the
-	 * FRAMESUP register, writing to the lower 16 bits is a NOP
+	 * FRAMESUP register, writing to the lower 16 bits is (supposedly) a NOP.
+	 *
+	 * The driver used to disable the controller while modifying the frame
+	 * count, and mask off the lower 16 bits of len while writing to
+	 * FRAMES_UP. When the driver was changed to disable the controller as
+	 * infrequently as possible, it was discovered that the logic of
+	 * lenpart = len & 0xffff_0000
+	 * write(REG_FRAMESUP, lenpart)
+	 * would actually write zeros into the lower 16 bits on an mpfs250t-es,
+	 * despite documentation stating these bits were read-only.
+	 * Writing len unmasked into FRAMES_UP ensures those bits aren't zeroed
+	 * on an mpfs250t-es and will be a NOP for the lower 16 bits on hardware
+	 * that matches the documentation.
 	 */
 	lenpart = len & 0xffff;
-
 	control = mchp_corespi_read(spi, REG_CONTROL);
 	control &= ~CONTROL_FRAMECNT_MASK;
 	control |= lenpart << CONTROL_FRAMECNT_SHIFT;
 	mchp_corespi_write(spi, REG_CONTROL, control);
-
-	lenpart = len & 0xffff0000;
-	mchp_corespi_write(spi, REG_FRAMESUP, lenpart);
-
-	control |= CONTROL_ENABLE;
-	mchp_corespi_write(spi, REG_CONTROL, control);
+	mchp_corespi_write(spi, REG_FRAMESUP, len);
 }
 
 static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
@@ -235,17 +234,22 @@ static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
 
 static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
 {
+	u32 frame_size = mchp_corespi_read(spi, REG_FRAME_SIZE);
 	u32 control;
 
+	if ((frame_size & FRAME_SIZE_MASK) == bt)
+		return;
+
 	/*
 	 * Disable the SPI controller. Writes to the frame size have
 	 * no effect when the controller is enabled.
 	 */
-	mchp_corespi_disable(spi);
+	control = mchp_corespi_read(spi, REG_CONTROL);
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
 
 	mchp_corespi_write(spi, REG_FRAME_SIZE, bt);
 
-	control = mchp_corespi_read(spi, REG_CONTROL);
 	control |= CONTROL_ENABLE;
 	mchp_corespi_write(spi, REG_CONTROL, control);
 }
@@ -253,7 +257,7 @@ static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
 static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
 {
 	u32 reg;
-	struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+	struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
 
 	reg = mchp_corespi_read(corespi, REG_SLAVE_SELECT);
 	reg &= ~BIT(spi->chip_select);
@@ -264,11 +268,11 @@ static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
 
 static int mchp_corespi_setup(struct spi_device *spi)
 {
-	struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+	struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
 	u32 reg;
 
 	/*
-	 * Active high slaves need to be specifically set to their inactive
+	 * Active high targets need to be specifically set to their inactive
 	 * states during probe by adding them to the "control group" & thus
 	 * driving their select line low.
 	 */
@@ -280,22 +284,18 @@ static int mchp_corespi_setup(struct spi_device *spi)
 	return 0;
 }
 
-static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *spi)
+static void mchp_corespi_init(struct spi_controller *host, struct mchp_corespi *spi)
 {
 	unsigned long clk_hz;
 	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
-	control |= CONTROL_MASTER;
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
 
+	control |= CONTROL_MASTER;
 	control &= ~CONTROL_MODE_MASK;
 	control |= MOTOROLA_MODE;
 
-	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
-
-	/* max. possible spi clock rate is the apb clock rate */
-	clk_hz = clk_get_rate(spi->clk);
-	master->max_speed_hz = clk_hz;
-
 	/*
 	 * The controller must be configured so that it doesn't remove Chip
 	 * Select until the entire message has been transferred, even if at
@@ -304,17 +304,22 @@ static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *sp
 	 * BIGFIFO mode is also enabled, which sets the fifo depth to 32 frames
 	 * for the 8 bit transfers that this driver uses.
 	 */
-	control = mchp_corespi_read(spi, REG_CONTROL);
 	control |= CONTROL_SPS | CONTROL_BIGFIFO;
 
 	mchp_corespi_write(spi, REG_CONTROL, control);
 
+	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
+
+	/* max. possible spi clock rate is the apb clock rate */
+	clk_hz = clk_get_rate(spi->clk);
+	host->max_speed_hz = clk_hz;
+
 	mchp_corespi_enable_ints(spi);
 
 	/*
 	 * It is required to enable direct mode, otherwise control over the chip
 	 * select is relinquished to the hardware. SSELOUT is enabled too so we
-	 * can deal with active high slaves.
+	 * can deal with active high targets.
 	 */
 	mchp_corespi_write(spi, REG_SLAVE_SELECT, SSELOUT | SSEL_DIRECT);
 
@@ -330,8 +335,6 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
 {
 	u32 control;
 
-	mchp_corespi_disable(spi);
-
 	control = mchp_corespi_read(spi, REG_CONTROL);
 	if (spi->clk_mode)
 		control |= CONTROL_CLKMODE;
@@ -340,12 +343,12 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
 
 	mchp_corespi_write(spi, REG_CLK_GEN, spi->clk_gen);
 	mchp_corespi_write(spi, REG_CONTROL, control);
-	mchp_corespi_write(spi, REG_CONTROL, control | CONTROL_ENABLE);
 }
 
 static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int mode)
 {
-	u32 control, mode_val;
+	u32 mode_val;
+	u32 control = mchp_corespi_read(spi, REG_CONTROL);
 
 	switch (mode & SPI_MODE_X_MASK) {
 	case SPI_MODE_0:
@@ -363,12 +366,13 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
 	}
 
 	/*
-	 * Disable the SPI controller. Writes to the frame size have
+	 * Disable the SPI controller. Writes to the frame protocol have
 	 * no effect when the controller is enabled.
 	 */
-	mchp_corespi_disable(spi);
 
-	control = mchp_corespi_read(spi, REG_CONTROL);
+	control &= ~CONTROL_ENABLE;
+	mchp_corespi_write(spi, REG_CONTROL, control);
+
 	control &= ~(SPI_MODE_X_MASK << MODE_X_MASK_SHIFT);
 	control |= mode_val;
 
@@ -380,8 +384,8 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
 
 static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 {
-	struct spi_master *master = dev_id;
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct spi_controller *host = dev_id;
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 	u32 intfield = mchp_corespi_read(spi, REG_MIS) & 0xf;
 	bool finalise = false;
 
@@ -389,26 +393,23 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 	if (intfield == 0)
 		return IRQ_NONE;
 
-	if (intfield & INT_TXDONE) {
+	if (intfield & INT_TXDONE)
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_TXDONE);
 
+	if (intfield & INT_RXRDY) {
+		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+
 		if (spi->rx_len)
 			mchp_corespi_read_fifo(spi);
-
-		if (spi->tx_len)
-			mchp_corespi_write_fifo(spi);
-
-		if (!spi->rx_len)
-			finalise = true;
 	}
 
-	if (intfield & INT_RXRDY)
-		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+	if (!spi->rx_len && !spi->tx_len)
+		finalise = true;
 
 	if (intfield & INT_RX_CHANNEL_OVERFLOW) {
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_RX_CHANNEL_OVERFLOW);
 		finalise = true;
-		dev_err(&master->dev,
+		dev_err(&host->dev,
 			"%s: RX OVERFLOW: rxlen: %d, txlen: %d\n", __func__,
 			spi->rx_len, spi->tx_len);
 	}
@@ -416,13 +417,13 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
 	if (intfield & INT_TX_CHANNEL_UNDERRUN) {
 		mchp_corespi_write(spi, REG_INT_CLEAR, INT_TX_CHANNEL_UNDERRUN);
 		finalise = true;
-		dev_err(&master->dev,
+		dev_err(&host->dev,
 			"%s: TX UNDERFLOW: rxlen: %d, txlen: %d\n", __func__,
 			spi->rx_len, spi->tx_len);
 	}
 
 	if (finalise)
-		spi_finalize_current_transfer(master);
+		spi_finalize_current_transfer(host);
 
 	return IRQ_HANDLED;
 }
@@ -464,16 +465,16 @@ static int mchp_corespi_calculate_clkgen(struct mchp_corespi *spi,
 	return 0;
 }
 
-static int mchp_corespi_transfer_one(struct spi_master *master,
+static int mchp_corespi_transfer_one(struct spi_controller *host,
 				     struct spi_device *spi_dev,
 				     struct spi_transfer *xfer)
 {
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 	int ret;
 
 	ret = mchp_corespi_calculate_clkgen(spi, (unsigned long)xfer->speed_hz);
 	if (ret) {
-		dev_err(&master->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
+		dev_err(&host->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
 		return ret;
 	}
 
@@ -488,16 +489,17 @@ static int mchp_corespi_transfer_one(struct spi_master *master,
 	mchp_corespi_set_xfer_size(spi, (spi->tx_len > FIFO_DEPTH)
 				   ? FIFO_DEPTH : spi->tx_len);
 
-	if (spi->tx_len)
+	while (spi->tx_len)
 		mchp_corespi_write_fifo(spi);
+
 	return 1;
 }
 
-static int mchp_corespi_prepare_message(struct spi_master *master,
+static int mchp_corespi_prepare_message(struct spi_controller *host,
 					struct spi_message *msg)
 {
 	struct spi_device *spi_dev = msg->spi;
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 
 	mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
 	mchp_corespi_set_mode(spi, spi_dev->mode);
@@ -507,32 +509,32 @@ static int mchp_corespi_prepare_message(struct spi_master *master,
 
 static int mchp_corespi_probe(struct platform_device *pdev)
 {
-	struct spi_master *master;
+	struct spi_controller *host;
 	struct mchp_corespi *spi;
 	struct resource *res;
 	u32 num_cs;
 	int ret = 0;
 
-	master = devm_spi_alloc_master(&pdev->dev, sizeof(*spi));
-	if (!master)
+	host = devm_spi_alloc_host(&pdev->dev, sizeof(*spi));
+	if (!host)
 		return dev_err_probe(&pdev->dev, -ENOMEM,
-				     "unable to allocate master for SPI controller\n");
+				     "unable to allocate host for SPI controller\n");
 
-	platform_set_drvdata(pdev, master);
+	platform_set_drvdata(pdev, host);
 
 	if (of_property_read_u32(pdev->dev.of_node, "num-cs", &num_cs))
 		num_cs = MAX_CS;
 
-	master->num_chipselect = num_cs;
-	master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
-	master->setup = mchp_corespi_setup;
-	master->bits_per_word_mask = SPI_BPW_MASK(8);
-	master->transfer_one = mchp_corespi_transfer_one;
-	master->prepare_message = mchp_corespi_prepare_message;
-	master->set_cs = mchp_corespi_set_cs;
-	master->dev.of_node = pdev->dev.of_node;
+	host->num_chipselect = num_cs;
+	host->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
+	host->setup = mchp_corespi_setup;
+	host->bits_per_word_mask = SPI_BPW_MASK(8);
+	host->transfer_one = mchp_corespi_transfer_one;
+	host->prepare_message = mchp_corespi_prepare_message;
+	host->set_cs = mchp_corespi_set_cs;
+	host->dev.of_node = pdev->dev.of_node;
 
-	spi = spi_master_get_devdata(master);
+	spi = spi_controller_get_devdata(host);
 
 	spi->regs = devm_platform_get_and_ioremap_resource(pdev, 0, &res);
 	if (IS_ERR(spi->regs))
@@ -545,7 +547,7 @@ static int mchp_corespi_probe(struct platform_device *pdev)
 				     spi->irq);
 
 	ret = devm_request_irq(&pdev->dev, spi->irq, mchp_corespi_interrupt,
-			       IRQF_SHARED, dev_name(&pdev->dev), master);
+			       IRQF_SHARED, dev_name(&pdev->dev), host);
 	if (ret)
 		return dev_err_probe(&pdev->dev, ret,
 				     "could not request irq\n");
@@ -560,25 +562,25 @@ static int mchp_corespi_probe(struct platform_device *pdev)
 		return dev_err_probe(&pdev->dev, ret,
 				     "failed to enable clock\n");
 
-	mchp_corespi_init(master, spi);
+	mchp_corespi_init(host, spi);
 
-	ret = devm_spi_register_master(&pdev->dev, master);
+	ret = devm_spi_register_controller(&pdev->dev, host);
 	if (ret) {
 		mchp_corespi_disable(spi);
 		clk_disable_unprepare(spi->clk);
 		return dev_err_probe(&pdev->dev, ret,
-				     "unable to register master for SPI controller\n");
+				     "unable to register host for SPI controller\n");
 	}
 
-	dev_info(&pdev->dev, "Registered SPI controller %d\n", master->bus_num);
+	dev_info(&pdev->dev, "Registered SPI controller %d\n", host->bus_num);
 
 	return 0;
 }
 
 static int mchp_corespi_remove(struct platform_device *pdev)
 {
-	struct spi_master *master  = platform_get_drvdata(pdev);
-	struct mchp_corespi *spi = spi_master_get_devdata(master);
+	struct spi_controller *host  = platform_get_drvdata(pdev);
+	struct mchp_corespi *spi = spi_controller_get_devdata(host);
 
 	mchp_corespi_disable_ints(spi);
 	clk_disable_unprepare(spi->clk);
diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c
index 71c3db60e968..00612efc2277 100644
--- a/drivers/spi/spidev.c
+++ b/drivers/spi/spidev.c
@@ -700,6 +700,7 @@ static const struct spi_device_id spidev_spi_ids[] = {
 	{ .name = "m53cpld" },
 	{ .name = "spi-petra" },
 	{ .name = "spi-authenta" },
+	{ .name = "em3581" },
 	{},
 };
 MODULE_DEVICE_TABLE(spi, spidev_spi_ids);
@@ -718,14 +719,16 @@ static int spidev_of_check(struct device *dev)
 }
 
 static const struct of_device_id spidev_dt_ids[] = {
-	{ .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
+	{ .compatible = "cisco,spi-petra", .data = &spidev_of_check },
+	{ .compatible = "dh,dhcom-board", .data = &spidev_of_check },
 	{ .compatible = "lineartechnology,ltc2488", .data = &spidev_of_check },
-	{ .compatible = "semtech,sx1301", .data = &spidev_of_check },
 	{ .compatible = "lwn,bk4", .data = &spidev_of_check },
-	{ .compatible = "dh,dhcom-board", .data = &spidev_of_check },
 	{ .compatible = "menlo,m53cpld", .data = &spidev_of_check },
-	{ .compatible = "cisco,spi-petra", .data = &spidev_of_check },
 	{ .compatible = "micron,spi-authenta", .data = &spidev_of_check },
+	{ .compatible = "rohm,bh2228fv", .data = &spidev_of_check },
+	{ .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
+	{ .compatible = "semtech,sx1301", .data = &spidev_of_check },
+	{ .compatible = "silabs,em3581", .data = &spidev_of_check },
 	{},
 };
 MODULE_DEVICE_TABLE(of, spidev_dt_ids);
diff --git a/drivers/vhost/vsock.c b/drivers/vhost/vsock.c
index 1f3b89c885cc..c00f5821d6ec 100644
--- a/drivers/vhost/vsock.c
+++ b/drivers/vhost/vsock.c
@@ -654,6 +654,7 @@ static int vhost_vsock_dev_open(struct inode *inode, struct file *file)
 	}
 
 	vsock->guest_cid = 0; /* no CID assigned yet */
+	vsock->seqpacket_allow = false;
 
 	atomic_set(&vsock->queued_replies, 0);
 
@@ -797,8 +798,7 @@ static int vhost_vsock_set_features(struct vhost_vsock *vsock, u64 features)
 			goto err;
 	}
 
-	if (features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET))
-		vsock->seqpacket_allow = true;
+	vsock->seqpacket_allow = features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET);
 
 	for (i = 0; i < ARRAY_SIZE(vsock->vqs); i++) {
 		vq = &vsock->vqs[i];
diff --git a/drivers/watchdog/rzg2l_wdt.c b/drivers/watchdog/rzg2l_wdt.c
index d404953d0e0f..9b2698a4fc1a 100644
--- a/drivers/watchdog/rzg2l_wdt.c
+++ b/drivers/watchdog/rzg2l_wdt.c
@@ -123,8 +123,11 @@ static void rzg2l_wdt_init_timeout(struct watchdog_device *wdev)
 static int rzg2l_wdt_start(struct watchdog_device *wdev)
 {
 	struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+	int ret;
 
-	pm_runtime_get_sync(wdev->parent);
+	ret = pm_runtime_resume_and_get(wdev->parent);
+	if (ret)
+		return ret;
 
 	/* Initialize time out */
 	rzg2l_wdt_init_timeout(wdev);
@@ -141,15 +144,21 @@ static int rzg2l_wdt_start(struct watchdog_device *wdev)
 static int rzg2l_wdt_stop(struct watchdog_device *wdev)
 {
 	struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+	int ret;
 
 	rzg2l_wdt_reset(priv);
-	pm_runtime_put(wdev->parent);
+
+	ret = pm_runtime_put(wdev->parent);
+	if (ret < 0)
+		return ret;
 
 	return 0;
 }
 
 static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int timeout)
 {
+	int ret = 0;
+
 	wdev->timeout = timeout;
 
 	/*
@@ -158,11 +167,14 @@ static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int time
 	 * to reset the module) so that it is updated with new timeout values.
 	 */
 	if (watchdog_active(wdev)) {
-		rzg2l_wdt_stop(wdev);
-		rzg2l_wdt_start(wdev);
+		ret = rzg2l_wdt_stop(wdev);
+		if (ret)
+			return ret;
+
+		ret = rzg2l_wdt_start(wdev);
 	}
 
-	return 0;
+	return ret;
 }
 
 static int rzg2l_wdt_restart(struct watchdog_device *wdev,
diff --git a/fs/ceph/super.c b/fs/ceph/super.c
index 281b493fdac8..aa75aa796e43 100644
--- a/fs/ceph/super.c
+++ b/fs/ceph/super.c
@@ -924,7 +924,8 @@ static int __init init_caches(void)
 	if (!ceph_mds_request_cachep)
 		goto bad_mds_req;
 
-	ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10, CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT);
+	ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10,
+	    (CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT) * sizeof(struct page *));
 	if (!ceph_wb_pagevec_pool)
 		goto bad_pagevec_pool;
 
diff --git a/fs/ext2/balloc.c b/fs/ext2/balloc.c
index 5dc0a31f4a08..d2eb4d291985 100644
--- a/fs/ext2/balloc.c
+++ b/fs/ext2/balloc.c
@@ -79,26 +79,33 @@ static int ext2_valid_block_bitmap(struct super_block *sb,
 	ext2_grpblk_t next_zero_bit;
 	ext2_fsblk_t bitmap_blk;
 	ext2_fsblk_t group_first_block;
+	ext2_grpblk_t max_bit;
 
 	group_first_block = ext2_group_first_block_no(sb, block_group);
+	max_bit = ext2_group_last_block_no(sb, block_group) - group_first_block;
 
 	/* check whether block bitmap block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_block_bitmap);
 	offset = bitmap_blk - group_first_block;
-	if (!ext2_test_bit(offset, bh->b_data))
+	if (offset < 0 || offset > max_bit ||
+	    !ext2_test_bit(offset, bh->b_data))
 		/* bad block bitmap */
 		goto err_out;
 
 	/* check whether the inode bitmap block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_inode_bitmap);
 	offset = bitmap_blk - group_first_block;
-	if (!ext2_test_bit(offset, bh->b_data))
+	if (offset < 0 || offset > max_bit ||
+	    !ext2_test_bit(offset, bh->b_data))
 		/* bad block bitmap */
 		goto err_out;
 
 	/* check whether the inode table block number is set */
 	bitmap_blk = le32_to_cpu(desc->bg_inode_table);
 	offset = bitmap_blk - group_first_block;
+	if (offset < 0 || offset > max_bit ||
+	    offset + EXT2_SB(sb)->s_itb_per_group - 1 > max_bit)
+		goto err_out;
 	next_zero_bit = ext2_find_next_zero_bit(bh->b_data,
 				offset + EXT2_SB(sb)->s_itb_per_group,
 				offset);
diff --git a/fs/ext4/extents_status.c b/fs/ext4/extents_status.c
index 470d29fb407a..9766d3b21ca2 100644
--- a/fs/ext4/extents_status.c
+++ b/fs/ext4/extents_status.c
@@ -312,6 +312,8 @@ void ext4_es_find_extent_range(struct inode *inode,
 			       ext4_lblk_t lblk, ext4_lblk_t end,
 			       struct extent_status *es)
 {
+	es->es_lblk = es->es_len = es->es_pblk = 0;
+
 	if (EXT4_SB(inode->i_sb)->s_mount_state & EXT4_FC_REPLAY)
 		return;
 
diff --git a/fs/ext4/fast_commit.c b/fs/ext4/fast_commit.c
index 1110bfa0a5b7..19353a2f44bb 100644
--- a/fs/ext4/fast_commit.c
+++ b/fs/ext4/fast_commit.c
@@ -649,6 +649,12 @@ void ext4_fc_track_range(handle_t *handle, struct inode *inode, ext4_lblk_t star
 	if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE))
 		return;
 
+	if (ext4_has_inline_data(inode)) {
+		ext4_fc_mark_ineligible(inode->i_sb, EXT4_FC_REASON_XATTR,
+					handle);
+		return;
+	}
+
 	args.start = start;
 	args.end = end;
 
diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c
index 8b1383223848..173f46fa1068 100644
--- a/fs/ext4/namei.c
+++ b/fs/ext4/namei.c
@@ -151,10 +151,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode,
 
 		return bh;
 	}
-	if (!bh && (type == INDEX || type == DIRENT_HTREE)) {
+	/* The first directory block must not be a hole. */
+	if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) {
 		ext4_error_inode(inode, func, line, block,
-				 "Directory hole found for htree %s block",
-				 (type == INDEX) ? "index" : "leaf");
+				 "Directory hole found for htree %s block %u",
+				 (type == INDEX) ? "index" : "leaf", block);
 		return ERR_PTR(-EFSCORRUPTED);
 	}
 	if (!bh)
@@ -2218,6 +2219,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname,
 	return err ? err : err2;
 }
 
+static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root)
+{
+	struct fake_dirent *fde;
+	const char *error_msg;
+	unsigned int rlen;
+	unsigned int blocksize = dir->i_sb->s_blocksize;
+	char *blockend = (char *)root + dir->i_sb->s_blocksize;
+
+	fde = &root->dot;
+	if (unlikely(fde->name_len != 1)) {
+		error_msg = "invalid name_len for '.'";
+		goto corrupted;
+	}
+	if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) {
+		error_msg = "invalid name for '.'";
+		goto corrupted;
+	}
+	rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+	if (unlikely((char *)fde + rlen >= blockend)) {
+		error_msg = "invalid rec_len for '.'";
+		goto corrupted;
+	}
+
+	fde = &root->dotdot;
+	if (unlikely(fde->name_len != 2)) {
+		error_msg = "invalid name_len for '..'";
+		goto corrupted;
+	}
+	if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) {
+		error_msg = "invalid name for '..'";
+		goto corrupted;
+	}
+	rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+	if (unlikely((char *)fde + rlen >= blockend)) {
+		error_msg = "invalid rec_len for '..'";
+		goto corrupted;
+	}
+
+	return true;
+
+corrupted:
+	EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended",
+			 error_msg);
+	return false;
+}
+
 /*
  * This converts a one block unindexed directory to a 3 block indexed
  * directory, and adds the dentry to the indexed directory.
@@ -2252,17 +2299,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname,
 		brelse(bh);
 		return retval;
 	}
+
 	root = (struct dx_root *) bh->b_data;
+	if (!ext4_check_dx_root(dir, root)) {
+		brelse(bh);
+		return -EFSCORRUPTED;
+	}
 
 	/* The 0th block becomes the root, move the dirents out */
 	fde = &root->dotdot;
 	de = (struct ext4_dir_entry_2 *)((char *)fde +
 		ext4_rec_len_from_disk(fde->rec_len, blocksize));
-	if ((char *) de >= (((char *) root) + blocksize)) {
-		EXT4_ERROR_INODE(dir, "invalid rec_len for '..'");
-		brelse(bh);
-		return -EFSCORRUPTED;
-	}
 	len = ((char *) root) + (blocksize - csum_size) - (char *) de;
 
 	/* Allocate new block for the 0th block's dirents */
@@ -3087,10 +3134,7 @@ bool ext4_empty_dir(struct inode *inode)
 		EXT4_ERROR_INODE(inode, "invalid size");
 		return false;
 	}
-	/* The first directory block must not be a hole,
-	 * so treat it as DIRENT_HTREE
-	 */
-	bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+	bh = ext4_read_dirblock(inode, 0, EITHER);
 	if (IS_ERR(bh))
 		return false;
 
@@ -3534,10 +3578,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle,
 		struct ext4_dir_entry_2 *de;
 		unsigned int offset;
 
-		/* The first directory block must not be a hole, so
-		 * treat it as DIRENT_HTREE
-		 */
-		bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+		bh = ext4_read_dirblock(inode, 0, EITHER);
 		if (IS_ERR(bh)) {
 			*retval = PTR_ERR(bh);
 			return NULL;
diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c
index 28d00ed833db..f0a45d3ec4eb 100644
--- a/fs/ext4/xattr.c
+++ b/fs/ext4/xattr.c
@@ -1384,6 +1384,12 @@ static int ext4_xattr_inode_write(handle_t *handle, struct inode *ea_inode,
 			goto out;
 
 		memcpy(bh->b_data, buf, csize);
+		/*
+		 * Zero out block tail to avoid writing uninitialized memory
+		 * to disk.
+		 */
+		if (csize < blocksize)
+			memset(bh->b_data + csize, 0, blocksize - csize);
 		set_buffer_uptodate(bh);
 		ext4_handle_dirty_metadata(handle, ea_inode, bh);
 
diff --git a/fs/f2fs/checkpoint.c b/fs/f2fs/checkpoint.c
index 13d877470675..ad4073cde397 100644
--- a/fs/f2fs/checkpoint.c
+++ b/fs/f2fs/checkpoint.c
@@ -1178,6 +1178,11 @@ static void __prepare_cp_block(struct f2fs_sb_info *sbi)
 	ckpt->valid_node_count = cpu_to_le32(valid_node_count(sbi));
 	ckpt->valid_inode_count = cpu_to_le32(valid_inode_count(sbi));
 	ckpt->next_free_nid = cpu_to_le32(last_nid);
+
+	/* update user_block_counts */
+	sbi->last_valid_block_count = sbi->total_valid_block_count;
+	percpu_counter_set(&sbi->alloc_valid_block_count, 0);
+	percpu_counter_set(&sbi->rf_node_block_count, 0);
 }
 
 static bool __need_flush_quota(struct f2fs_sb_info *sbi)
@@ -1569,11 +1574,6 @@ static int do_checkpoint(struct f2fs_sb_info *sbi, struct cp_control *cpc)
 		start_blk += NR_CURSEG_NODE_TYPE;
 	}
 
-	/* update user_block_counts */
-	sbi->last_valid_block_count = sbi->total_valid_block_count;
-	percpu_counter_set(&sbi->alloc_valid_block_count, 0);
-	percpu_counter_set(&sbi->rf_node_block_count, 0);
-
 	/* Here, we have one bio having CP pack except cp pack 2 page */
 	f2fs_sync_meta_pages(sbi, META, LONG_MAX, FS_CP_META_IO);
 	/* Wait for all dirty meta pages to be submitted for IO */
diff --git a/fs/f2fs/file.c b/fs/f2fs/file.c
index 1d73582d1f63..c6fb179f9d4a 100644
--- a/fs/f2fs/file.c
+++ b/fs/f2fs/file.c
@@ -812,6 +812,8 @@ static bool f2fs_force_buffered_io(struct inode *inode, int rw)
 		return true;
 	if (f2fs_compressed_file(inode))
 		return true;
+	if (f2fs_has_inline_data(inode))
+		return true;
 
 	/* disallow direct IO if any of devices has unaligned blksize */
 	if (f2fs_is_multi_device(sbi) && !sbi->aligned_blksize)
diff --git a/fs/f2fs/inline.c b/fs/f2fs/inline.c
index 8747eec3d0a3..7a2fb9789e5e 100644
--- a/fs/f2fs/inline.c
+++ b/fs/f2fs/inline.c
@@ -204,8 +204,10 @@ int f2fs_convert_inline_inode(struct inode *inode)
 	struct page *ipage, *page;
 	int err = 0;
 
-	if (!f2fs_has_inline_data(inode) ||
-			f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+	if (f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+		return -EROFS;
+
+	if (!f2fs_has_inline_data(inode))
 		return 0;
 
 	err = f2fs_dquot_initialize(inode);
diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c
index 35b1c672644e..ff4a4e92a40c 100644
--- a/fs/f2fs/inode.c
+++ b/fs/f2fs/inode.c
@@ -27,6 +27,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync)
 	if (is_inode_flag_set(inode, FI_NEW_INODE))
 		return;
 
+	if (f2fs_readonly(F2FS_I_SB(inode)->sb))
+		return;
+
 	if (f2fs_inode_dirtied(inode, sync))
 		return;
 
diff --git a/fs/f2fs/segment.h b/fs/f2fs/segment.h
index aa9ad85e0901..17d1723d98a0 100644
--- a/fs/f2fs/segment.h
+++ b/fs/f2fs/segment.h
@@ -373,7 +373,8 @@ static inline unsigned int get_ckpt_valid_blocks(struct f2fs_sb_info *sbi,
 				unsigned int segno, bool use_section)
 {
 	if (use_section && __is_large_section(sbi)) {
-		unsigned int start_segno = START_SEGNO(segno);
+		unsigned int secno = GET_SEC_FROM_SEG(sbi, segno);
+		unsigned int start_segno = GET_SEG_FROM_SEC(sbi, secno);
 		unsigned int blocks = 0;
 		int i;
 
diff --git a/fs/fuse/inode.c b/fs/fuse/inode.c
index 367e3b276092..f19bdd7cbd77 100644
--- a/fs/fuse/inode.c
+++ b/fs/fuse/inode.c
@@ -724,6 +724,8 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
 	struct fs_parse_result result;
 	struct fuse_fs_context *ctx = fsc->fs_private;
 	int opt;
+	kuid_t kuid;
+	kgid_t kgid;
 
 	if (fsc->purpose == FS_CONTEXT_FOR_RECONFIGURE) {
 		/*
@@ -768,16 +770,30 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
 		break;
 
 	case OPT_USER_ID:
-		ctx->user_id = make_kuid(fsc->user_ns, result.uint_32);
-		if (!uid_valid(ctx->user_id))
+		kuid =  make_kuid(fsc->user_ns, result.uint_32);
+		if (!uid_valid(kuid))
 			return invalfc(fsc, "Invalid user_id");
+		/*
+		 * The requested uid must be representable in the
+		 * filesystem's idmapping.
+		 */
+		if (!kuid_has_mapping(fsc->user_ns, kuid))
+			return invalfc(fsc, "Invalid user_id");
+		ctx->user_id = kuid;
 		ctx->user_id_present = true;
 		break;
 
 	case OPT_GROUP_ID:
-		ctx->group_id = make_kgid(fsc->user_ns, result.uint_32);
-		if (!gid_valid(ctx->group_id))
+		kgid = make_kgid(fsc->user_ns, result.uint_32);;
+		if (!gid_valid(kgid))
+			return invalfc(fsc, "Invalid group_id");
+		/*
+		 * The requested gid must be representable in the
+		 * filesystem's idmapping.
+		 */
+		if (!kgid_has_mapping(fsc->user_ns, kgid))
 			return invalfc(fsc, "Invalid group_id");
+		ctx->group_id = kgid;
 		ctx->group_id_present = true;
 		break;
 
diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c
index 80d17c520d0b..aedb4b262189 100644
--- a/fs/hfs/inode.c
+++ b/fs/hfs/inode.c
@@ -204,6 +204,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t
 	HFS_I(inode)->flags = 0;
 	HFS_I(inode)->rsrc_inode = NULL;
 	HFS_I(inode)->fs_blocks = 0;
+	HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60;
 	if (S_ISDIR(mode)) {
 		inode->i_size = 2;
 		HFS_SB(sb)->folder_count++;
@@ -279,6 +280,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext,
 	for (count = 0, i = 0; i < 3; i++)
 		count += be16_to_cpu(ext[i].count);
 	HFS_I(inode)->first_blocks = count;
+	HFS_I(inode)->cached_start = 0;
+	HFS_I(inode)->cached_blocks = 0;
 
 	inode->i_size = HFS_I(inode)->phys_size = log_size;
 	HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits;
diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c
index ca2ba8c9f82e..901e83d65d20 100644
--- a/fs/hfsplus/bfind.c
+++ b/fs/hfsplus/bfind.c
@@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd)
 	fd->key = ptr + tree->max_key_len + 2;
 	hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n",
 		tree->cnid, __builtin_return_address(0));
-	switch (tree->cnid) {
-	case HFSPLUS_CAT_CNID:
-		mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX);
-		break;
-	case HFSPLUS_EXT_CNID:
-		mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX);
-		break;
-	case HFSPLUS_ATTR_CNID:
-		mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX);
-		break;
-	default:
-		BUG();
-	}
+	mutex_lock_nested(&tree->tree_lock,
+			hfsplus_btree_lock_class(tree));
 	return 0;
 }
 
diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c
index 721f779b4ec3..91354e769642 100644
--- a/fs/hfsplus/extents.c
+++ b/fs/hfsplus/extents.c
@@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid,
 		hfsplus_free_extents(sb, ext_entry, total_blocks - start,
 				     total_blocks);
 		total_blocks = start;
-		mutex_lock(&fd.tree->tree_lock);
+		mutex_lock_nested(&fd.tree->tree_lock,
+			hfsplus_btree_lock_class(fd.tree));
 	} while (total_blocks > blocks);
 	hfs_find_exit(&fd);
 
@@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode)
 					     alloc_cnt, alloc_cnt - blk_cnt);
 			hfsplus_dump_extent(hip->first_extents);
 			hip->first_blocks = blk_cnt;
-			mutex_lock(&fd.tree->tree_lock);
+			mutex_lock_nested(&fd.tree->tree_lock,
+				hfsplus_btree_lock_class(fd.tree));
 			break;
 		}
 		res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt);
@@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode)
 		hfsplus_free_extents(sb, hip->cached_extents,
 				     alloc_cnt - start, alloc_cnt - blk_cnt);
 		hfsplus_dump_extent(hip->cached_extents);
-		mutex_lock(&fd.tree->tree_lock);
+		mutex_lock_nested(&fd.tree->tree_lock,
+				hfsplus_btree_lock_class(fd.tree));
 		if (blk_cnt > start) {
 			hip->extent_state |= HFSPLUS_EXT_DIRTY;
 			break;
diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h
index 6aa919e59483..7db213cd1eea 100644
--- a/fs/hfsplus/hfsplus_fs.h
+++ b/fs/hfsplus/hfsplus_fs.h
@@ -552,6 +552,27 @@ static inline __be32 __hfsp_ut2mt(time64_t ut)
 	return cpu_to_be32(lower_32_bits(ut) + HFSPLUS_UTC_OFFSET);
 }
 
+static inline enum hfsplus_btree_mutex_classes
+hfsplus_btree_lock_class(struct hfs_btree *tree)
+{
+	enum hfsplus_btree_mutex_classes class;
+
+	switch (tree->cnid) {
+	case HFSPLUS_CAT_CNID:
+		class = CATALOG_BTREE_MUTEX;
+		break;
+	case HFSPLUS_EXT_CNID:
+		class = EXTENTS_BTREE_MUTEX;
+		break;
+	case HFSPLUS_ATTR_CNID:
+		class = ATTR_BTREE_MUTEX;
+		break;
+	default:
+		BUG();
+	}
+	return class;
+}
+
 /* compatibility */
 #define hfsp_mt2ut(t)		(struct timespec64){ .tv_sec = __hfsp_mt2ut(t) }
 #define hfsp_ut2mt(t)		__hfsp_ut2mt((t).tv_sec)
diff --git a/fs/jbd2/commit.c b/fs/jbd2/commit.c
index 556b259a00ba..7b34deec8b87 100644
--- a/fs/jbd2/commit.c
+++ b/fs/jbd2/commit.c
@@ -801,7 +801,7 @@ void jbd2_journal_commit_transaction(journal_t *journal)
 		if (first_block < journal->j_tail)
 			freed += journal->j_last - journal->j_first;
 		/* Update tail only if we free significant amount of space */
-		if (freed < jbd2_journal_get_max_txn_bufs(journal))
+		if (freed < journal->j_max_transaction_buffers)
 			update_tail = 0;
 	}
 	J_ASSERT(commit_transaction->t_state == T_COMMIT);
diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c
index 3df45e4699f1..b136b46b63bc 100644
--- a/fs/jbd2/journal.c
+++ b/fs/jbd2/journal.c
@@ -1532,6 +1532,11 @@ static void journal_fail_superblock(journal_t *journal)
 	journal->j_sb_buffer = NULL;
 }
 
+static int jbd2_journal_get_max_txn_bufs(journal_t *journal)
+{
+	return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
+}
+
 /*
  * Given a journal_t structure, initialise the various fields for
  * startup of a new journaling session.  We use this both when creating
diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c
index ac42f8ee553f..ba6f28521360 100644
--- a/fs/jfs/jfs_imap.c
+++ b/fs/jfs/jfs_imap.c
@@ -290,7 +290,7 @@ int diSync(struct inode *ipimap)
 int diRead(struct inode *ip)
 {
 	struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb);
-	int iagno, ino, extno, rc;
+	int iagno, ino, extno, rc, agno;
 	struct inode *ipimap;
 	struct dinode *dp;
 	struct iag *iagp;
@@ -339,8 +339,11 @@ int diRead(struct inode *ip)
 
 	/* get the ag for the iag */
 	agstart = le64_to_cpu(iagp->agstart);
+	agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb));
 
 	release_metapage(mp);
+	if (agno >= MAXAG || agno < 0)
+		return -EIO;
 
 	rel_inode = (ino & (INOSPERPAGE - 1));
 	pageno = blkno >> sbi->l2nbperpage;
diff --git a/fs/kernfs/dir.c b/fs/kernfs/dir.c
index a00e11ebfa77..2c74b24fc22a 100644
--- a/fs/kernfs/dir.c
+++ b/fs/kernfs/dir.c
@@ -125,9 +125,9 @@ static struct kernfs_node *kernfs_common_ancestor(struct kernfs_node *a,
  * kn_to:   /n1/n2/n3         [depth=3]
  * result:  /../..
  *
- * [3] when @kn_to is NULL result will be "(null)"
+ * [3] when @kn_to is %NULL result will be "(null)"
  *
- * Returns the length of the full path.  If the full length is equal to or
+ * Return: the length of the constructed path.  If the path would have been
  * greater than @buflen, @buf contains the truncated path with the trailing
  * '\0'.  On error, -errno is returned.
  */
@@ -138,16 +138,17 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
 	struct kernfs_node *kn, *common;
 	const char parent_str[] = "/..";
 	size_t depth_from, depth_to, len = 0;
+	ssize_t copied;
 	int i, j;
 
 	if (!kn_to)
-		return strlcpy(buf, "(null)", buflen);
+		return strscpy(buf, "(null)", buflen);
 
 	if (!kn_from)
 		kn_from = kernfs_root(kn_to)->kn;
 
 	if (kn_from == kn_to)
-		return strlcpy(buf, "/", buflen);
+		return strscpy(buf, "/", buflen);
 
 	if (!buf)
 		return -EINVAL;
@@ -161,18 +162,19 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
 
 	buf[0] = '\0';
 
-	for (i = 0; i < depth_from; i++)
-		len += strlcpy(buf + len, parent_str,
-			       len < buflen ? buflen - len : 0);
+	for (i = 0; i < depth_from; i++) {
+		copied = strscpy(buf + len, parent_str, buflen - len);
+		if (copied < 0)
+			return copied;
+		len += copied;
+	}
 
 	/* Calculate how many bytes we need for the rest */
 	for (i = depth_to - 1; i >= 0; i--) {
 		for (kn = kn_to, j = 0; j < i; j++)
 			kn = kn->parent;
-		len += strlcpy(buf + len, "/",
-			       len < buflen ? buflen - len : 0);
-		len += strlcpy(buf + len, kn->name,
-			       len < buflen ? buflen - len : 0);
+
+		len += scnprintf(buf + len, buflen - len, "/%s", kn->name);
 	}
 
 	return len;
@@ -185,10 +187,12 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
  * @buflen: size of @buf
  *
  * Copies the name of @kn into @buf of @buflen bytes.  The behavior is
- * similar to strlcpy().  It returns the length of @kn's name and if @buf
- * isn't long enough, it's filled upto @buflen-1 and nul terminated.
+ * similar to strlcpy().
  *
- * Fills buffer with "(null)" if @kn is NULL.
+ * Fills buffer with "(null)" if @kn is %NULL.
+ *
+ * Return: the length of @kn's name and if @buf isn't long enough,
+ * it's filled up to @buflen-1 and nul terminated.
  *
  * This function can be called from any context.
  */
@@ -215,7 +219,7 @@ int kernfs_name(struct kernfs_node *kn, char *buf, size_t buflen)
  * path (which includes '..'s) as needed to reach from @from to @to is
  * returned.
  *
- * Returns the length of the full path.  If the full length is equal to or
+ * Return: the length of the constructed path.  If the path would have been
  * greater than @buflen, @buf contains the truncated path with the trailing
  * '\0'.  On error, -errno is returned.
  */
@@ -266,12 +270,10 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
 	sz = kernfs_path_from_node(kn, NULL, kernfs_pr_cont_buf,
 				   sizeof(kernfs_pr_cont_buf));
 	if (sz < 0) {
-		pr_cont("(error)");
-		goto out;
-	}
-
-	if (sz >= sizeof(kernfs_pr_cont_buf)) {
-		pr_cont("(name too long)");
+		if (sz == -E2BIG)
+			pr_cont("(name too long)");
+		else
+			pr_cont("(error)");
 		goto out;
 	}
 
@@ -287,6 +289,8 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
  *
  * Determines @kn's parent, pins and returns it.  This function can be
  * called from any context.
+ *
+ * Return: parent node of @kn
  */
 struct kernfs_node *kernfs_get_parent(struct kernfs_node *kn)
 {
@@ -302,11 +306,11 @@ struct kernfs_node *kernfs_get_parent(struct kernfs_node *kn)
 }
 
 /**
- *	kernfs_name_hash
+ *	kernfs_name_hash - calculate hash of @ns + @name
  *	@name: Null terminated string to hash
  *	@ns:   Namespace tag to hash
  *
- *	Returns 31 bit hash of ns + name (so it fits in an off_t )
+ *	Return: 31-bit hash of ns + name (so it fits in an off_t)
  */
 static unsigned int kernfs_name_hash(const char *name, const void *ns)
 {
@@ -354,8 +358,8 @@ static int kernfs_sd_compare(const struct kernfs_node *left,
  *	Locking:
  *	kernfs_rwsem held exclusive
  *
- *	RETURNS:
- *	0 on susccess -EEXIST on failure.
+ *	Return:
+ *	%0 on success, -EEXIST on failure.
  */
 static int kernfs_link_sibling(struct kernfs_node *kn)
 {
@@ -394,8 +398,10 @@ static int kernfs_link_sibling(struct kernfs_node *kn)
  *	@kn: kernfs_node of interest
  *
  *	Try to unlink @kn from its sibling rbtree which starts from
- *	kn->parent->dir.children.  Returns %true if @kn was actually
- *	removed, %false if @kn wasn't on the rbtree.
+ *	kn->parent->dir.children.
+ *
+ *	Return: %true if @kn was actually removed,
+ *	%false if @kn wasn't on the rbtree.
  *
  *	Locking:
  *	kernfs_rwsem held exclusive
@@ -419,10 +425,10 @@ static bool kernfs_unlink_sibling(struct kernfs_node *kn)
  *	@kn: kernfs_node to get an active reference to
  *
  *	Get an active reference of @kn.  This function is noop if @kn
- *	is NULL.
+ *	is %NULL.
  *
- *	RETURNS:
- *	Pointer to @kn on success, NULL on failure.
+ *	Return:
+ *	Pointer to @kn on success, %NULL on failure.
  */
 struct kernfs_node *kernfs_get_active(struct kernfs_node *kn)
 {
@@ -442,7 +448,7 @@ struct kernfs_node *kernfs_get_active(struct kernfs_node *kn)
  *	@kn: kernfs_node to put an active reference to
  *
  *	Put an active reference to @kn.  This function is noop if @kn
- *	is NULL.
+ *	is %NULL.
  */
 void kernfs_put_active(struct kernfs_node *kn)
 {
@@ -464,7 +470,7 @@ void kernfs_put_active(struct kernfs_node *kn)
  * kernfs_drain - drain kernfs_node
  * @kn: kernfs_node to drain
  *
- * Drain existing usages and nuke all existing mmaps of @kn.  Mutiple
+ * Drain existing usages and nuke all existing mmaps of @kn.  Multiple
  * removers may invoke this function concurrently on @kn and all will
  * return after draining is complete.
  */
@@ -577,7 +583,7 @@ EXPORT_SYMBOL_GPL(kernfs_put);
  * kernfs_node_from_dentry - determine kernfs_node associated with a dentry
  * @dentry: the dentry in question
  *
- * Return the kernfs_node associated with @dentry.  If @dentry is not a
+ * Return: the kernfs_node associated with @dentry.  If @dentry is not a
  * kernfs one, %NULL is returned.
  *
  * While the returned kernfs_node will stay accessible as long as @dentry
@@ -698,8 +704,8 @@ struct kernfs_node *kernfs_new_node(struct kernfs_node *parent,
  * @id's lower 32bits encode ino and upper gen.  If the gen portion is
  * zero, all generations are matched.
  *
- * RETURNS:
- * NULL on failure. Return a kernfs node with reference counter incremented
+ * Return: %NULL on failure,
+ * otherwise a kernfs node with reference counter incremented.
  */
 struct kernfs_node *kernfs_find_and_get_node_by_id(struct kernfs_root *root,
 						   u64 id)
@@ -747,8 +753,8 @@ struct kernfs_node *kernfs_find_and_get_node_by_id(struct kernfs_root *root,
  *	function increments nlink of the parent's inode if @kn is a
  *	directory and link into the children list of the parent.
  *
- *	RETURNS:
- *	0 on success, -EEXIST if entry with the given name already
+ *	Return:
+ *	%0 on success, -EEXIST if entry with the given name already
  *	exists.
  */
 int kernfs_add_one(struct kernfs_node *kn)
@@ -811,8 +817,9 @@ int kernfs_add_one(struct kernfs_node *kn)
  * @name: name to look for
  * @ns: the namespace tag to use
  *
- * Look for kernfs_node with name @name under @parent.  Returns pointer to
- * the found kernfs_node on success, %NULL on failure.
+ * Look for kernfs_node with name @name under @parent.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
  */
 static struct kernfs_node *kernfs_find_ns(struct kernfs_node *parent,
 					  const unsigned char *name,
@@ -885,8 +892,9 @@ static struct kernfs_node *kernfs_walk_ns(struct kernfs_node *parent,
  * @ns: the namespace tag to use
  *
  * Look for kernfs_node with name @name under @parent and get a reference
- * if found.  This function may sleep and returns pointer to the found
- * kernfs_node on success, %NULL on failure.
+ * if found.  This function may sleep.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
  */
 struct kernfs_node *kernfs_find_and_get_ns(struct kernfs_node *parent,
 					   const char *name, const void *ns)
@@ -910,8 +918,9 @@ EXPORT_SYMBOL_GPL(kernfs_find_and_get_ns);
  * @ns: the namespace tag to use
  *
  * Look for kernfs_node with path @path under @parent and get a reference
- * if found.  This function may sleep and returns pointer to the found
- * kernfs_node on success, %NULL on failure.
+ * if found.  This function may sleep.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
  */
 struct kernfs_node *kernfs_walk_and_get_ns(struct kernfs_node *parent,
 					   const char *path, const void *ns)
@@ -933,7 +942,7 @@ struct kernfs_node *kernfs_walk_and_get_ns(struct kernfs_node *parent,
  * @flags: KERNFS_ROOT_* flags
  * @priv: opaque data associated with the new directory
  *
- * Returns the root of the new hierarchy on success, ERR_PTR() value on
+ * Return: the root of the new hierarchy on success, ERR_PTR() value on
  * failure.
  */
 struct kernfs_root *kernfs_create_root(struct kernfs_syscall_ops *scops,
@@ -1005,6 +1014,8 @@ void kernfs_destroy_root(struct kernfs_root *root)
 /**
  * kernfs_root_to_node - return the kernfs_node associated with a kernfs_root
  * @root: root to use to lookup
+ *
+ * Return: @root's kernfs_node
  */
 struct kernfs_node *kernfs_root_to_node(struct kernfs_root *root)
 {
@@ -1021,7 +1032,7 @@ struct kernfs_node *kernfs_root_to_node(struct kernfs_root *root)
  * @priv: opaque data associated with the new directory
  * @ns: optional namespace tag of the directory
  *
- * Returns the created node on success, ERR_PTR() value on failure.
+ * Return: the created node on success, ERR_PTR() value on failure.
  */
 struct kernfs_node *kernfs_create_dir_ns(struct kernfs_node *parent,
 					 const char *name, umode_t mode,
@@ -1055,7 +1066,7 @@ struct kernfs_node *kernfs_create_dir_ns(struct kernfs_node *parent,
  * @parent: parent in which to create a new directory
  * @name: name of the new directory
  *
- * Returns the created node on success, ERR_PTR() value on failure.
+ * Return: the created node on success, ERR_PTR() value on failure.
  */
 struct kernfs_node *kernfs_create_empty_dir(struct kernfs_node *parent,
 					    const char *name)
@@ -1304,6 +1315,8 @@ static struct kernfs_node *kernfs_leftmost_descendant(struct kernfs_node *pos)
  * Find the next descendant to visit for post-order traversal of @root's
  * descendants.  @root is included in the iteration and the last node to be
  * visited.
+ *
+ * Return: the next descendant to visit or %NULL when done.
  */
 static struct kernfs_node *kernfs_next_descendant_post(struct kernfs_node *pos,
 						       struct kernfs_node *root)
@@ -1567,6 +1580,8 @@ void kernfs_unbreak_active_protection(struct kernfs_node *kn)
  * the whole kernfs_ops which won the arbitration.  This can be used to
  * guarantee, for example, all concurrent writes to a "delete" file to
  * finish only after the whole operation is complete.
+ *
+ * Return: %true if @kn is removed by this call, otherwise %false.
  */
 bool kernfs_remove_self(struct kernfs_node *kn)
 {
@@ -1627,7 +1642,8 @@ bool kernfs_remove_self(struct kernfs_node *kn)
  * @ns: namespace tag of the kernfs_node to remove
  *
  * Look for the kernfs_node with @name and @ns under @parent and remove it.
- * Returns 0 on success, -ENOENT if such entry doesn't exist.
+ *
+ * Return: %0 on success, -ENOENT if such entry doesn't exist.
  */
 int kernfs_remove_by_name_ns(struct kernfs_node *parent, const char *name,
 			     const void *ns)
@@ -1665,6 +1681,8 @@ int kernfs_remove_by_name_ns(struct kernfs_node *parent, const char *name,
  * @new_parent: new parent to put @sd under
  * @new_name: new name
  * @new_ns: new namespace tag
+ *
+ * Return: %0 on success, -errno on failure.
  */
 int kernfs_rename_ns(struct kernfs_node *kn, struct kernfs_node *new_parent,
 		     const char *new_name, const void *new_ns)
diff --git a/fs/kernfs/file.c b/fs/kernfs/file.c
index 9ab6c92e02da..e4a50e4ff0d2 100644
--- a/fs/kernfs/file.c
+++ b/fs/kernfs/file.c
@@ -33,7 +33,7 @@ struct kernfs_open_node {
  * pending queue is implemented as a singly linked list of kernfs_nodes.
  * The list is terminated with the self pointer so that whether a
  * kernfs_node is on the list or not can be determined by testing the next
- * pointer for NULL.
+ * pointer for %NULL.
  */
 #define KERNFS_NOTIFY_EOL			((void *)&kernfs_notify_list)
 
@@ -59,8 +59,10 @@ static inline struct mutex *kernfs_open_file_mutex_lock(struct kernfs_node *kn)
 }
 
 /**
- * of_on - Return the kernfs_open_node of the specified kernfs_open_file
- * @of: taret kernfs_open_file
+ * of_on - Get the kernfs_open_node of the specified kernfs_open_file
+ * @of: target kernfs_open_file
+ *
+ * Return: the kernfs_open_node of the kernfs_open_file
  */
 static struct kernfs_open_node *of_on(struct kernfs_open_file *of)
 {
@@ -82,6 +84,8 @@ static struct kernfs_open_node *of_on(struct kernfs_open_file *of)
  * outside RCU read-side critical section.
  *
  * The caller needs to make sure that kernfs_open_file_mutex is held.
+ *
+ * Return: @kn->attr.open when kernfs_open_file_mutex is held.
  */
 static struct kernfs_open_node *
 kernfs_deref_open_node_locked(struct kernfs_node *kn)
@@ -548,11 +552,11 @@ static int kernfs_fop_mmap(struct file *file, struct vm_area_struct *vma)
  *	If @kn->attr.open exists, increment its reference count; otherwise,
  *	create one.  @of is chained to the files list.
  *
- *	LOCKING:
+ *	Locking:
  *	Kernel thread context (may sleep).
  *
- *	RETURNS:
- *	0 on success, -errno on failure.
+ *	Return:
+ *	%0 on success, -errno on failure.
  */
 static int kernfs_get_open_node(struct kernfs_node *kn,
 				struct kernfs_open_file *of)
@@ -1024,7 +1028,7 @@ const struct file_operations kernfs_file_fops = {
  * @ns: optional namespace tag of the file
  * @key: lockdep key for the file's active_ref, %NULL to disable lockdep
  *
- * Returns the created node on success, ERR_PTR() value on error.
+ * Return: the created node on success, ERR_PTR() value on error.
  */
 struct kernfs_node *__kernfs_create_file(struct kernfs_node *parent,
 					 const char *name,
diff --git a/fs/kernfs/inode.c b/fs/kernfs/inode.c
index 3d783d80f5da..076ba9884916 100644
--- a/fs/kernfs/inode.c
+++ b/fs/kernfs/inode.c
@@ -94,7 +94,7 @@ int __kernfs_setattr(struct kernfs_node *kn, const struct iattr *iattr)
  * @kn: target node
  * @iattr: iattr to set
  *
- * Returns 0 on success, -errno on failure.
+ * Return: %0 on success, -errno on failure.
  */
 int kernfs_setattr(struct kernfs_node *kn, const struct iattr *iattr)
 {
@@ -241,11 +241,11 @@ static void kernfs_init_inode(struct kernfs_node *kn, struct inode *inode)
  *	allocated and basics are initialized.  New inode is returned
  *	locked.
  *
- *	LOCKING:
+ *	Locking:
  *	Kernel thread context (may sleep).
  *
- *	RETURNS:
- *	Pointer to allocated inode on success, NULL on failure.
+ *	Return:
+ *	Pointer to allocated inode on success, %NULL on failure.
  */
 struct inode *kernfs_get_inode(struct super_block *sb, struct kernfs_node *kn)
 {
diff --git a/fs/kernfs/kernfs-internal.h b/fs/kernfs/kernfs-internal.h
index fc5821effd97..9046d9f39e63 100644
--- a/fs/kernfs/kernfs-internal.h
+++ b/fs/kernfs/kernfs-internal.h
@@ -58,7 +58,7 @@ struct kernfs_root {
  * kernfs_root - find out the kernfs_root a kernfs_node belongs to
  * @kn: kernfs_node of interest
  *
- * Return the kernfs_root @kn belongs to.
+ * Return: the kernfs_root @kn belongs to.
  */
 static inline struct kernfs_root *kernfs_root(struct kernfs_node *kn)
 {
diff --git a/fs/kernfs/mount.c b/fs/kernfs/mount.c
index d0859f72d2d6..e08e8d999807 100644
--- a/fs/kernfs/mount.c
+++ b/fs/kernfs/mount.c
@@ -153,7 +153,7 @@ static const struct export_operations kernfs_export_ops = {
  * kernfs_root_from_sb - determine kernfs_root associated with a super_block
  * @sb: the super_block in question
  *
- * Return the kernfs_root associated with @sb.  If @sb is not a kernfs one,
+ * Return: the kernfs_root associated with @sb.  If @sb is not a kernfs one,
  * %NULL is returned.
  */
 struct kernfs_root *kernfs_root_from_sb(struct super_block *sb)
@@ -167,7 +167,7 @@ struct kernfs_root *kernfs_root_from_sb(struct super_block *sb)
  * find the next ancestor in the path down to @child, where @parent was the
  * ancestor whose descendant we want to find.
  *
- * Say the path is /a/b/c/d.  @child is d, @parent is NULL.  We return the root
+ * Say the path is /a/b/c/d.  @child is d, @parent is %NULL.  We return the root
  * node.  If @parent is b, then we return the node for c.
  * Passing in d as @parent is not ok.
  */
@@ -192,6 +192,8 @@ static struct kernfs_node *find_next_ancestor(struct kernfs_node *child,
  * kernfs_node_dentry - get a dentry for the given kernfs_node
  * @kn: kernfs_node for which a dentry is needed
  * @sb: the kernfs super_block
+ *
+ * Return: the dentry pointer
  */
 struct dentry *kernfs_node_dentry(struct kernfs_node *kn,
 				  struct super_block *sb)
@@ -296,7 +298,7 @@ static int kernfs_set_super(struct super_block *sb, struct fs_context *fc)
  * kernfs_super_ns - determine the namespace tag of a kernfs super_block
  * @sb: super_block of interest
  *
- * Return the namespace tag associated with kernfs super_block @sb.
+ * Return: the namespace tag associated with kernfs super_block @sb.
  */
 const void *kernfs_super_ns(struct super_block *sb)
 {
@@ -313,6 +315,8 @@ const void *kernfs_super_ns(struct super_block *sb)
  * implementation, which should set the specified ->@fs_type and ->@flags, and
  * specify the hierarchy and namespace tag to mount via ->@root and ->@ns,
  * respectively.
+ *
+ * Return: %0 on success, -errno on failure.
  */
 int kernfs_get_tree(struct fs_context *fc)
 {
diff --git a/fs/kernfs/symlink.c b/fs/kernfs/symlink.c
index 0ab13824822f..45371a70caa7 100644
--- a/fs/kernfs/symlink.c
+++ b/fs/kernfs/symlink.c
@@ -19,7 +19,7 @@
  * @name: name of the symlink
  * @target: target node for the symlink to point to
  *
- * Returns the created node on success, ERR_PTR() value on error.
+ * Return: the created node on success, ERR_PTR() value on error.
  * Ownership of the link matches ownership of the target.
  */
 struct kernfs_node *kernfs_create_link(struct kernfs_node *parent,
diff --git a/fs/nfs/nfs4client.c b/fs/nfs/nfs4client.c
index 84b345efcec0..02caeec2c173 100644
--- a/fs/nfs/nfs4client.c
+++ b/fs/nfs/nfs4client.c
@@ -230,9 +230,8 @@ struct nfs_client *nfs4_alloc_client(const struct nfs_client_initdata *cl_init)
 		__set_bit(NFS_CS_INFINITE_SLOTS, &clp->cl_flags);
 	__set_bit(NFS_CS_DISCRTRY, &clp->cl_flags);
 	__set_bit(NFS_CS_NO_RETRANS_TIMEOUT, &clp->cl_flags);
-
-	if (test_bit(NFS_CS_DS, &cl_init->init_flags))
-		__set_bit(NFS_CS_DS, &clp->cl_flags);
+	if (test_bit(NFS_CS_PNFS, &cl_init->init_flags))
+		__set_bit(NFS_CS_PNFS, &clp->cl_flags);
 	/*
 	 * Set up the connection to the server before we add add to the
 	 * global list.
@@ -997,7 +996,6 @@ struct nfs_client *nfs4_set_ds_client(struct nfs_server *mds_srv,
 	if (mds_srv->flags & NFS_MOUNT_NORESVPORT)
 		__set_bit(NFS_CS_NORESVPORT, &cl_init.init_flags);
 
-	__set_bit(NFS_CS_DS, &cl_init.init_flags);
 	__set_bit(NFS_CS_PNFS, &cl_init.init_flags);
 	cl_init.max_connect = NFS_MAX_TRANSPORTS;
 	/*
diff --git a/fs/nfs/nfs4proc.c b/fs/nfs/nfs4proc.c
index cc620fc7aaf7..467e9439eded 100644
--- a/fs/nfs/nfs4proc.c
+++ b/fs/nfs/nfs4proc.c
@@ -8821,7 +8821,7 @@ nfs4_run_exchange_id(struct nfs_client *clp, const struct cred *cred,
 #ifdef CONFIG_NFS_V4_1_MIGRATION
 	calldata->args.flags |= EXCHGID4_FLAG_SUPP_MOVED_MIGR;
 #endif
-	if (test_bit(NFS_CS_DS, &clp->cl_flags))
+	if (test_bit(NFS_CS_PNFS, &clp->cl_flags))
 		calldata->args.flags |= EXCHGID4_FLAG_USE_PNFS_DS;
 	msg.rpc_argp = &calldata->args;
 	msg.rpc_resp = &calldata->res;
diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c
index ee2cde07264b..19ed9015bd66 100644
--- a/fs/nilfs2/btnode.c
+++ b/fs/nilfs2/btnode.c
@@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
 
 	bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node));
 	if (unlikely(!bh))
-		return NULL;
+		return ERR_PTR(-ENOMEM);
 
 	if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) ||
 		     buffer_dirty(bh))) {
-		brelse(bh);
-		BUG();
+		/*
+		 * The block buffer at the specified new address was already
+		 * in use.  This can happen if it is a virtual block number
+		 * and has been reallocated due to corruption of the bitmap
+		 * used to manage its allocation state (if not, the buffer
+		 * clearing of an abandoned b-tree node is missing somewhere).
+		 */
+		nilfs_error(inode->i_sb,
+			    "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)",
+			    (unsigned long long)blocknr, inode->i_ino);
+		goto failed;
 	}
 	memset(bh->b_data, 0, i_blocksize(inode));
 	bh->b_bdev = inode->i_sb->s_bdev;
@@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
 	unlock_page(bh->b_page);
 	put_page(bh->b_page);
 	return bh;
+
+failed:
+	unlock_page(bh->b_page);
+	put_page(bh->b_page);
+	brelse(bh);
+	return ERR_PTR(-EIO);
 }
 
 int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr,
@@ -217,8 +232,8 @@ int nilfs_btnode_prepare_change_key(struct address_space *btnc,
 	}
 
 	nbh = nilfs_btnode_create_block(btnc, newkey);
-	if (!nbh)
-		return -ENOMEM;
+	if (IS_ERR(nbh))
+		return PTR_ERR(nbh);
 
 	BUG_ON(nbh == obh);
 	ctxt->newbh = nbh;
diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c
index 146640f0607a..bd24a33fc72e 100644
--- a/fs/nilfs2/btree.c
+++ b/fs/nilfs2/btree.c
@@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree,
 	struct buffer_head *bh;
 
 	bh = nilfs_btnode_create_block(btnc, ptr);
-	if (!bh)
-		return -ENOMEM;
+	if (IS_ERR(bh))
+		return PTR_ERR(bh);
 
 	set_buffer_nilfs_volatile(bh);
 	*bhp = bh;
diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c
index 04943ab40a01..5110c50be291 100644
--- a/fs/nilfs2/segment.c
+++ b/fs/nilfs2/segment.c
@@ -136,7 +136,7 @@ static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int);
 
 #define nilfs_cnt32_ge(a, b)   \
 	(typecheck(__u32, a) && typecheck(__u32, b) && \
-	 ((__s32)(a) - (__s32)(b) >= 0))
+	 ((__s32)((a) - (b)) >= 0))
 
 static int nilfs_prepare_segment_lock(struct super_block *sb,
 				      struct nilfs_transaction_info *ti)
diff --git a/fs/ntfs3/attrib.c b/fs/ntfs3/attrib.c
index 2618bf5a3789..0388e6b42100 100644
--- a/fs/ntfs3/attrib.c
+++ b/fs/ntfs3/attrib.c
@@ -242,7 +242,7 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
 	struct ntfs_sb_info *sbi;
 	struct ATTRIB *attr_s;
 	struct MFT_REC *rec;
-	u32 used, asize, rsize, aoff, align;
+	u32 used, asize, rsize, aoff;
 	bool is_data;
 	CLST len, alen;
 	char *next;
@@ -263,10 +263,13 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
 	rsize = le32_to_cpu(attr->res.data_size);
 	is_data = attr->type == ATTR_DATA && !attr->name_len;
 
-	align = sbi->cluster_size;
-	if (is_attr_compressed(attr))
-		align <<= COMPRESSION_UNIT;
-	len = (rsize + align - 1) >> sbi->cluster_bits;
+	/* len - how many clusters required to store 'rsize' bytes */
+	if (is_attr_compressed(attr)) {
+		u8 shift = sbi->cluster_bits + NTFS_LZNT_CUNIT;
+		len = ((rsize + (1u << shift) - 1) >> shift) << NTFS_LZNT_CUNIT;
+	} else {
+		len = bytes_to_cluster(sbi, rsize);
+	}
 
 	run_init(run);
 
@@ -678,7 +681,8 @@ int attr_set_size(struct ntfs_inode *ni, enum ATTR_TYPE type,
 			goto undo_2;
 		}
 
-		if (!is_mft)
+		/* keep runs for $MFT::$ATTR_DATA and $MFT::$ATTR_BITMAP. */
+		if (ni->mi.rno != MFT_REC_MFT)
 			run_truncate_head(run, evcn + 1);
 
 		svcn = le64_to_cpu(attr->nres.svcn);
@@ -1637,6 +1641,7 @@ int attr_allocate_frame(struct ntfs_inode *ni, CLST frame, size_t compr_size,
 
 	attr_b->nres.total_size = cpu_to_le64(total_size);
 	inode_set_bytes(&ni->vfs_inode, total_size);
+	ni->ni_flags |= NI_FLAG_UPDATE_PARENT;
 
 	mi_b->dirty = true;
 	mark_inode_dirty(&ni->vfs_inode);
diff --git a/fs/ntfs3/bitmap.c b/fs/ntfs3/bitmap.c
index c055bbdfe0f7..dfe4930ccec6 100644
--- a/fs/ntfs3/bitmap.c
+++ b/fs/ntfs3/bitmap.c
@@ -1356,7 +1356,7 @@ int wnd_extend(struct wnd_bitmap *wnd, size_t new_bits)
 
 		err = ntfs_vbo_to_lbo(sbi, &wnd->run, vbo, &lbo, &bytes);
 		if (err)
-			break;
+			return err;
 
 		bh = ntfs_bread(sb, lbo >> sb->s_blocksize_bits);
 		if (!bh)
diff --git a/fs/ntfs3/dir.c b/fs/ntfs3/dir.c
index 98f57d0c702e..dcd689ed4baa 100644
--- a/fs/ntfs3/dir.c
+++ b/fs/ntfs3/dir.c
@@ -326,7 +326,8 @@ static inline int ntfs_filldir(struct ntfs_sb_info *sbi, struct ntfs_inode *ni,
 	 * It does additional locks/reads just to get the type of name.
 	 * Should we use additional mount option to enable branch below?
 	 */
-	if ((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) &&
+	if (((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) ||
+	     fname->dup.ea_size) &&
 	    ino != ni->mi.rno) {
 		struct inode *inode = ntfs_iget5(sbi->sb, &e->ref, NULL);
 		if (!IS_ERR_OR_NULL(inode)) {
diff --git a/fs/ntfs3/file.c b/fs/ntfs3/file.c
index 14efe46df91e..6f03de747e37 100644
--- a/fs/ntfs3/file.c
+++ b/fs/ntfs3/file.c
@@ -396,10 +396,7 @@ static int ntfs_file_mmap(struct file *file, struct vm_area_struct *vma)
 		}
 
 		if (ni->i_valid < to) {
-			if (!inode_trylock(inode)) {
-				err = -EAGAIN;
-				goto out;
-			}
+			inode_lock(inode);
 			err = ntfs_extend_initialized_size(file, ni,
 							   ni->i_valid, to);
 			inode_unlock(inode);
diff --git a/fs/ntfs3/frecord.c b/fs/ntfs3/frecord.c
index d26026090024..02465ab3f398 100644
--- a/fs/ntfs3/frecord.c
+++ b/fs/ntfs3/frecord.c
@@ -1501,7 +1501,7 @@ int ni_insert_nonresident(struct ntfs_inode *ni, enum ATTR_TYPE type,
 
 	if (is_ext) {
 		if (flags & ATTR_FLAG_COMPRESSED)
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 		attr->nres.total_size = attr->nres.alloc_size;
 	}
 
diff --git a/fs/ntfs3/fslog.c b/fs/ntfs3/fslog.c
index 6d0d9b1c3b2e..8e23bd6cd0f2 100644
--- a/fs/ntfs3/fslog.c
+++ b/fs/ntfs3/fslog.c
@@ -2999,7 +2999,7 @@ static struct ATTRIB *attr_create_nonres_log(struct ntfs_sb_info *sbi,
 	if (is_ext) {
 		attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
 		if (is_attr_compressed(attr))
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 
 		attr->nres.run_off =
 			cpu_to_le16(SIZEOF_NONRESIDENT_EX + name_size);
@@ -3937,6 +3937,9 @@ int log_replay(struct ntfs_inode *ni, bool *initialized)
 		goto out;
 	}
 
+	log->page_mask = log->page_size - 1;
+	log->page_bits = blksize_bits(log->page_size);
+
 	/* If the file size has shrunk then we won't mount it. */
 	if (l_size < le64_to_cpu(ra2->l_size)) {
 		err = -EINVAL;
diff --git a/fs/ntfs3/fsntfs.c b/fs/ntfs3/fsntfs.c
index 4c2d079b3d49..97723a839c81 100644
--- a/fs/ntfs3/fsntfs.c
+++ b/fs/ntfs3/fsntfs.c
@@ -475,7 +475,7 @@ static int ntfs_extend_mft(struct ntfs_sb_info *sbi)
 	struct ATTRIB *attr;
 	struct wnd_bitmap *wnd = &sbi->mft.bitmap;
 
-	new_mft_total = (wnd->nbits + MFT_INCREASE_CHUNK + 127) & (CLST)~127;
+	new_mft_total = ALIGN(wnd->nbits + NTFS_MFT_INCREASE_STEP, 128);
 	new_mft_bytes = (u64)new_mft_total << sbi->record_bits;
 
 	/* Step 1: Resize $MFT::DATA. */
diff --git a/fs/ntfs3/index.c b/fs/ntfs3/index.c
index 730629235ffa..9c36e0f3468d 100644
--- a/fs/ntfs3/index.c
+++ b/fs/ntfs3/index.c
@@ -979,7 +979,7 @@ static struct indx_node *indx_new(struct ntfs_index *indx,
 		hdr->used =
 			cpu_to_le32(eo + sizeof(struct NTFS_DE) + sizeof(u64));
 		de_set_vbn_le(e, *sub_vbn);
-		hdr->flags = 1;
+		hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
 	} else {
 		e->size = cpu_to_le16(sizeof(struct NTFS_DE));
 		hdr->used = cpu_to_le32(eo + sizeof(struct NTFS_DE));
@@ -1677,7 +1677,7 @@ static int indx_insert_into_root(struct ntfs_index *indx, struct ntfs_inode *ni,
 	e->size = cpu_to_le16(sizeof(struct NTFS_DE) + sizeof(u64));
 	e->flags = NTFS_IE_HAS_SUBNODES | NTFS_IE_LAST;
 
-	hdr->flags = 1;
+	hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
 	hdr->used = hdr->total =
 		cpu_to_le32(new_root_size - offsetof(struct INDEX_ROOT, ihdr));
 
diff --git a/fs/ntfs3/inode.c b/fs/ntfs3/inode.c
index 2c8c32d9fcaa..28cbae395431 100644
--- a/fs/ntfs3/inode.c
+++ b/fs/ntfs3/inode.c
@@ -1459,7 +1459,7 @@ struct inode *ntfs_create_inode(struct user_namespace *mnt_userns,
 			attr->size = cpu_to_le32(SIZEOF_NONRESIDENT_EX + 8);
 			attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
 			attr->flags = ATTR_FLAG_COMPRESSED;
-			attr->nres.c_unit = COMPRESSION_UNIT;
+			attr->nres.c_unit = NTFS_LZNT_CUNIT;
 			asize = SIZEOF_NONRESIDENT_EX + 8;
 		} else {
 			attr->size = cpu_to_le32(SIZEOF_NONRESIDENT + 8);
@@ -1967,5 +1967,6 @@ const struct address_space_operations ntfs_aops = {
 const struct address_space_operations ntfs_aops_cmpr = {
 	.read_folio	= ntfs_read_folio,
 	.readahead	= ntfs_readahead,
+	.dirty_folio	= block_dirty_folio,
 };
 // clang-format on
diff --git a/fs/ntfs3/ntfs.h b/fs/ntfs3/ntfs.h
index 324c0b036fdc..625f2b52bd58 100644
--- a/fs/ntfs3/ntfs.h
+++ b/fs/ntfs3/ntfs.h
@@ -82,10 +82,6 @@ typedef u32 CLST;
 #define RESIDENT_LCN   ((CLST)-2)
 #define COMPRESSED_LCN ((CLST)-3)
 
-#define COMPRESSION_UNIT     4
-#define COMPRESS_MAX_CLUSTER 0x1000
-#define MFT_INCREASE_CHUNK   1024
-
 enum RECORD_NUM {
 	MFT_REC_MFT		= 0,
 	MFT_REC_MIRR		= 1,
@@ -690,14 +686,15 @@ static inline bool de_has_vcn_ex(const struct NTFS_DE *e)
 	      offsetof(struct ATTR_FILE_NAME, name) + \
 	      NTFS_NAME_LEN * sizeof(short), 8)
 
+#define NTFS_INDEX_HDR_HAS_SUBNODES cpu_to_le32(1)
+
 struct INDEX_HDR {
 	__le32 de_off;	// 0x00: The offset from the start of this structure
 			// to the first NTFS_DE.
 	__le32 used;	// 0x04: The size of this structure plus all
 			// entries (quad-word aligned).
 	__le32 total;	// 0x08: The allocated size of for this structure plus all entries.
-	u8 flags;	// 0x0C: 0x00 = Small directory, 0x01 = Large directory.
-	u8 res[3];
+	__le32 flags;	// 0x0C: 0x00 = Small directory, 0x01 = Large directory.
 
 	//
 	// de_off + used <= total
@@ -744,7 +741,7 @@ static inline struct NTFS_DE *hdr_next_de(const struct INDEX_HDR *hdr,
 
 static inline bool hdr_has_subnode(const struct INDEX_HDR *hdr)
 {
-	return hdr->flags & 1;
+	return hdr->flags & NTFS_INDEX_HDR_HAS_SUBNODES;
 }
 
 struct INDEX_BUFFER {
@@ -764,7 +761,7 @@ static inline bool ib_is_empty(const struct INDEX_BUFFER *ib)
 
 static inline bool ib_is_leaf(const struct INDEX_BUFFER *ib)
 {
-	return !(ib->ihdr.flags & 1);
+	return !(ib->ihdr.flags & NTFS_INDEX_HDR_HAS_SUBNODES);
 }
 
 /* Index root structure ( 0x90 ). */
diff --git a/fs/ntfs3/ntfs_fs.h b/fs/ntfs3/ntfs_fs.h
index 0f9bec29f2b7..3e65ccccdb89 100644
--- a/fs/ntfs3/ntfs_fs.h
+++ b/fs/ntfs3/ntfs_fs.h
@@ -197,6 +197,8 @@ struct ntfs_index {
 
 /* Minimum MFT zone. */
 #define NTFS_MIN_MFT_ZONE 100
+/* Step to increase the MFT. */
+#define NTFS_MFT_INCREASE_STEP 1024
 
 /* Ntfs file system in-core superblock data. */
 struct ntfs_sb_info {
diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c
index a954305fbc31..484886cdd272 100644
--- a/fs/proc/task_mmu.c
+++ b/fs/proc/task_mmu.c
@@ -1513,6 +1513,8 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
 		}
 #endif
 
+		if (page && !PageAnon(page))
+			flags |= PM_FILE;
 		if (page && !migration && page_mapcount(page) == 1)
 			flags |= PM_MMAP_EXCLUSIVE;
 
diff --git a/fs/smb/client/cifsfs.c b/fs/smb/client/cifsfs.c
index 78340d904c7b..6384e1b2b2ef 100644
--- a/fs/smb/client/cifsfs.c
+++ b/fs/smb/client/cifsfs.c
@@ -1872,12 +1872,12 @@ init_cifs(void)
 					   WQ_FREEZABLE|WQ_MEM_RECLAIM, 0);
 	if (!serverclose_wq) {
 		rc = -ENOMEM;
-		goto out_destroy_serverclose_wq;
+		goto out_destroy_deferredclose_wq;
 	}
 
 	rc = cifs_init_inodecache();
 	if (rc)
-		goto out_destroy_deferredclose_wq;
+		goto out_destroy_serverclose_wq;
 
 	rc = init_mids();
 	if (rc)
@@ -1939,6 +1939,8 @@ init_cifs(void)
 	destroy_mids();
 out_destroy_inodecache:
 	cifs_destroy_inodecache();
+out_destroy_serverclose_wq:
+	destroy_workqueue(serverclose_wq);
 out_destroy_deferredclose_wq:
 	destroy_workqueue(deferredclose_wq);
 out_destroy_cifsoplockd_wq:
@@ -1949,8 +1951,6 @@ init_cifs(void)
 	destroy_workqueue(decrypt_wq);
 out_destroy_cifsiod_wq:
 	destroy_workqueue(cifsiod_wq);
-out_destroy_serverclose_wq:
-	destroy_workqueue(serverclose_wq);
 out_clean_proc:
 	cifs_proc_clean();
 	return rc;
diff --git a/fs/smb/client/connect.c b/fs/smb/client/connect.c
index 8c2a784200ec..21b344762d0f 100644
--- a/fs/smb/client/connect.c
+++ b/fs/smb/client/connect.c
@@ -2592,6 +2592,13 @@ cifs_get_tcon(struct cifs_ses *ses, struct smb3_fs_context *ctx)
 			cifs_dbg(VFS, "Server does not support mounting with posix SMB3.11 extensions\n");
 			rc = -EOPNOTSUPP;
 			goto out_fail;
+		} else if (ses->server->vals->protocol_id == SMB10_PROT_ID)
+			if (cap_unix(ses))
+				cifs_dbg(FYI, "Unix Extensions requested on SMB1 mount\n");
+			else {
+				cifs_dbg(VFS, "SMB1 Unix Extensions not supported by server\n");
+				rc = -EOPNOTSUPP;
+				goto out_fail;
 		} else {
 			cifs_dbg(VFS, "Check vers= mount option. SMB3.11 "
 				"disabled but required for POSIX extensions\n");
@@ -3975,6 +3982,7 @@ int cifs_mount(struct cifs_sb_info *cifs_sb, struct smb3_fs_context *ctx)
 }
 #endif
 
+#ifdef CONFIG_CIFS_ALLOW_INSECURE_LEGACY
 /*
  * Issue a TREE_CONNECT request.
  */
@@ -4096,11 +4104,25 @@ CIFSTCon(const unsigned int xid, struct cifs_ses *ses,
 		else
 			tcon->Flags = 0;
 		cifs_dbg(FYI, "Tcon flags: 0x%x\n", tcon->Flags);
-	}
 
+		/*
+		 * reset_cifs_unix_caps calls QFSInfo which requires
+		 * need_reconnect to be false, but we would not need to call
+		 * reset_caps if this were not a reconnect case so must check
+		 * need_reconnect flag here.  The caller will also clear
+		 * need_reconnect when tcon was successful but needed to be
+		 * cleared earlier in the case of unix extensions reconnect
+		 */
+		if (tcon->need_reconnect && tcon->unix_ext) {
+			cifs_dbg(FYI, "resetting caps for %s\n", tcon->tree_name);
+			tcon->need_reconnect = false;
+			reset_cifs_unix_caps(xid, tcon, NULL, NULL);
+		}
+	}
 	cifs_buf_release(smb_buffer);
 	return rc;
 }
+#endif /* CONFIG_CIFS_ALLOW_INSECURE_LEGACY */
 
 static void delayed_free(struct rcu_head *p)
 {
diff --git a/fs/super.c b/fs/super.c
index d138332e57a9..b116f72cd122 100644
--- a/fs/super.c
+++ b/fs/super.c
@@ -569,6 +569,17 @@ struct super_block *sget_fc(struct fs_context *fc,
 	struct user_namespace *user_ns = fc->global ? &init_user_ns : fc->user_ns;
 	int err;
 
+	/*
+	 * Never allow s_user_ns != &init_user_ns when FS_USERNS_MOUNT is
+	 * not set, as the filesystem is likely unprepared to handle it.
+	 * This can happen when fsconfig() is called from init_user_ns with
+	 * an fs_fd opened in another user namespace.
+	 */
+	if (user_ns != &init_user_ns && !(fc->fs_type->fs_flags & FS_USERNS_MOUNT)) {
+		errorfc(fc, "VFS: Mounting from non-initial user namespace is not allowed");
+		return ERR_PTR(-EPERM);
+	}
+
 retry:
 	spin_lock(&sb_lock);
 	if (test) {
diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c
index f416b7fe092f..c4c18eeacb60 100644
--- a/fs/udf/balloc.c
+++ b/fs/udf/balloc.c
@@ -68,8 +68,12 @@ static int read_block_bitmap(struct super_block *sb,
 	}
 
 	for (i = 0; i < count; i++)
-		if (udf_test_bit(i + off, bh->b_data))
+		if (udf_test_bit(i + off, bh->b_data)) {
+			bitmap->s_block_bitmap[bitmap_nr] =
+							ERR_PTR(-EFSCORRUPTED);
+			brelse(bh);
 			return -EFSCORRUPTED;
+		}
 	return 0;
 }
 
@@ -85,8 +89,15 @@ static int __load_block_bitmap(struct super_block *sb,
 			  block_group, nr_groups);
 	}
 
-	if (bitmap->s_block_bitmap[block_group])
+	if (bitmap->s_block_bitmap[block_group]) {
+		/*
+		 * The bitmap failed verification in the past. No point in
+		 * trying again.
+		 */
+		if (IS_ERR(bitmap->s_block_bitmap[block_group]))
+			return PTR_ERR(bitmap->s_block_bitmap[block_group]);
 		return block_group;
+	}
 
 	retval = read_block_bitmap(sb, bitmap, block_group, block_group);
 	if (retval < 0)
diff --git a/fs/udf/super.c b/fs/udf/super.c
index 6dc9d8dad88e..65fbc60a88e4 100644
--- a/fs/udf/super.c
+++ b/fs/udf/super.c
@@ -266,7 +266,8 @@ static void udf_sb_free_bitmap(struct udf_bitmap *bitmap)
 	int nr_groups = bitmap->s_nr_groups;
 
 	for (i = 0; i < nr_groups; i++)
-		brelse(bitmap->s_block_bitmap[i]);
+		if (!IS_ERR_OR_NULL(bitmap->s_block_bitmap[i]))
+			brelse(bitmap->s_block_bitmap[i]);
 
 	kvfree(bitmap);
 }
diff --git a/include/asm-generic/vmlinux.lds.h b/include/asm-generic/vmlinux.lds.h
index 1d1f480a5e9e..e7539dc02498 100644
--- a/include/asm-generic/vmlinux.lds.h
+++ b/include/asm-generic/vmlinux.lds.h
@@ -101,7 +101,7 @@
 #define DATA_MAIN .data .data.[0-9a-zA-Z_]* .data..L* .data..compoundliteral* .data.$__unnamed_* .data.$L*
 #define SDATA_MAIN .sdata .sdata.[0-9a-zA-Z_]*
 #define RODATA_MAIN .rodata .rodata.[0-9a-zA-Z_]* .rodata..L*
-#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..compoundliteral*
+#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..L* .bss..compoundliteral*
 #define SBSS_MAIN .sbss .sbss.[0-9a-zA-Z_]*
 #else
 #define TEXT_MAIN .text
diff --git a/include/drm/drm_mipi_dsi.h b/include/drm/drm_mipi_dsi.h
index 66a7e01c6260..1a921e8943a0 100644
--- a/include/drm/drm_mipi_dsi.h
+++ b/include/drm/drm_mipi_dsi.h
@@ -309,15 +309,18 @@ int mipi_dsi_dcs_get_display_brightness_large(struct mipi_dsi_device *dsi,
  * @cmd: Command
  * @seq: buffer containing data to be transmitted
  */
-#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...) do {				\
-		static const u8 d[] = { cmd, seq };				\
-		struct device *dev = &dsi->dev;	\
-		int ret;						\
-		ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d));	\
-		if (ret < 0) {						\
-			dev_err_ratelimited(dev, "sending command %#02x failed: %d\n", cmd, ret); \
-			return ret;						\
-		}						\
+#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...)                            \
+	do {                                                                \
+		static const u8 d[] = { cmd, seq };                         \
+		struct device *dev = &dsi->dev;                             \
+		ssize_t ret;                                                \
+		ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d));     \
+		if (ret < 0) {                                              \
+			dev_err_ratelimited(                                \
+				dev, "sending command %#02x failed: %zd\n", \
+				cmd, ret);                                  \
+			return ret;                                         \
+		}                                                           \
 	} while (0)
 
 /**
diff --git a/include/linux/bpf_verifier.h b/include/linux/bpf_verifier.h
index f080ccf27d25..6a524c5462a6 100644
--- a/include/linux/bpf_verifier.h
+++ b/include/linux/bpf_verifier.h
@@ -645,7 +645,7 @@ static inline u32 type_flag(u32 type)
 /* only use after check_attach_btf_id() */
 static inline enum bpf_prog_type resolve_prog_type(const struct bpf_prog *prog)
 {
-	return prog->type == BPF_PROG_TYPE_EXT ?
+	return (prog->type == BPF_PROG_TYPE_EXT && prog->aux->dst_prog) ?
 		prog->aux->dst_prog->type : prog->type;
 }
 
diff --git a/include/linux/hugetlb.h b/include/linux/hugetlb.h
index 37eeef9841c4..cc555072940f 100644
--- a/include/linux/hugetlb.h
+++ b/include/linux/hugetlb.h
@@ -694,6 +694,7 @@ HPAGEFLAG(RawHwpUnreliable, raw_hwp_unreliable)
 /* Defines one hugetlb page size */
 struct hstate {
 	struct mutex resize_lock;
+	struct lock_class_key resize_key;
 	int next_nid_to_alloc;
 	int next_nid_to_free;
 	unsigned int order;
diff --git a/include/linux/jbd2.h b/include/linux/jbd2.h
index 6611af5f1d0c..e301d323108d 100644
--- a/include/linux/jbd2.h
+++ b/include/linux/jbd2.h
@@ -1665,11 +1665,6 @@ int jbd2_wait_inode_data(journal_t *journal, struct jbd2_inode *jinode);
 int jbd2_fc_wait_bufs(journal_t *journal, int num_blks);
 int jbd2_fc_release_bufs(journal_t *journal);
 
-static inline int jbd2_journal_get_max_txn_bufs(journal_t *journal)
-{
-	return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
-}
-
 /*
  * is_journal_abort
  *
diff --git a/include/linux/jump_label.h b/include/linux/jump_label.h
index 570831ca9951..4e968ebadce6 100644
--- a/include/linux/jump_label.h
+++ b/include/linux/jump_label.h
@@ -224,9 +224,10 @@ extern bool arch_jump_label_transform_queue(struct jump_entry *entry,
 					    enum jump_label_type type);
 extern void arch_jump_label_transform_apply(void);
 extern int jump_label_text_reserved(void *start, void *end);
-extern void static_key_slow_inc(struct static_key *key);
+extern bool static_key_slow_inc(struct static_key *key);
+extern bool static_key_fast_inc_not_disabled(struct static_key *key);
 extern void static_key_slow_dec(struct static_key *key);
-extern void static_key_slow_inc_cpuslocked(struct static_key *key);
+extern bool static_key_slow_inc_cpuslocked(struct static_key *key);
 extern void static_key_slow_dec_cpuslocked(struct static_key *key);
 extern int static_key_count(struct static_key *key);
 extern void static_key_enable(struct static_key *key);
@@ -278,11 +279,23 @@ static __always_inline bool static_key_true(struct static_key *key)
 	return false;
 }
 
-static inline void static_key_slow_inc(struct static_key *key)
+static inline bool static_key_fast_inc_not_disabled(struct static_key *key)
 {
+	int v;
+
 	STATIC_KEY_CHECK_USE(key);
-	atomic_inc(&key->enabled);
+	/*
+	 * Prevent key->enabled getting negative to follow the same semantics
+	 * as for CONFIG_JUMP_LABEL=y, see kernel/jump_label.c comment.
+	 */
+	v = atomic_read(&key->enabled);
+	do {
+		if (v < 0 || (v + 1) < 0)
+			return false;
+	} while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v + 1)));
+	return true;
 }
+#define static_key_slow_inc(key)	static_key_fast_inc_not_disabled(key)
 
 static inline void static_key_slow_dec(struct static_key *key)
 {
diff --git a/include/linux/mlx5/qp.h b/include/linux/mlx5/qp.h
index ca0eee571ad7..15e8d7fd3879 100644
--- a/include/linux/mlx5/qp.h
+++ b/include/linux/mlx5/qp.h
@@ -566,9 +566,12 @@ static inline const char *mlx5_qp_state_str(int state)
 
 static inline int mlx5_get_qp_default_ts(struct mlx5_core_dev *dev)
 {
-	return !MLX5_CAP_ROCE(dev, qp_ts_format) ?
-		       MLX5_TIMESTAMP_FORMAT_FREE_RUNNING :
-		       MLX5_TIMESTAMP_FORMAT_DEFAULT;
+	u8 supported_ts_cap = mlx5_get_roce_state(dev) ?
+			      MLX5_CAP_ROCE(dev, qp_ts_format) :
+			      MLX5_CAP_GEN(dev, sq_ts_format);
+
+	return supported_ts_cap ? MLX5_TIMESTAMP_FORMAT_DEFAULT :
+	       MLX5_TIMESTAMP_FORMAT_FREE_RUNNING;
 }
 
 #endif /* MLX5_QP_H */
diff --git a/include/linux/objagg.h b/include/linux/objagg.h
index 78021777df46..6df5b887dc54 100644
--- a/include/linux/objagg.h
+++ b/include/linux/objagg.h
@@ -8,7 +8,6 @@ struct objagg_ops {
 	size_t obj_size;
 	bool (*delta_check)(void *priv, const void *parent_obj,
 			    const void *obj);
-	int (*hints_obj_cmp)(const void *obj1, const void *obj2);
 	void * (*delta_create)(void *priv, void *parent_obj, void *obj);
 	void (*delta_destroy)(void *priv, void *delta_priv);
 	void * (*root_create)(void *priv, void *obj, unsigned int root_id);
diff --git a/include/linux/pci.h b/include/linux/pci.h
index 4da7411da9ba..df73fb26b825 100644
--- a/include/linux/pci.h
+++ b/include/linux/pci.h
@@ -1138,6 +1138,7 @@ int pci_get_interrupt_pin(struct pci_dev *dev, struct pci_dev **bridge);
 u8 pci_common_swizzle(struct pci_dev *dev, u8 *pinp);
 struct pci_dev *pci_dev_get(struct pci_dev *dev);
 void pci_dev_put(struct pci_dev *dev);
+DEFINE_FREE(pci_dev_put, struct pci_dev *, if (_T) pci_dev_put(_T))
 void pci_remove_bus(struct pci_bus *b);
 void pci_stop_and_remove_bus_device(struct pci_dev *dev);
 void pci_stop_and_remove_bus_device_locked(struct pci_dev *dev);
@@ -1746,6 +1747,7 @@ void pci_cfg_access_unlock(struct pci_dev *dev);
 void pci_dev_lock(struct pci_dev *dev);
 int pci_dev_trylock(struct pci_dev *dev);
 void pci_dev_unlock(struct pci_dev *dev);
+DEFINE_GUARD(pci_dev, struct pci_dev *, pci_dev_lock(_T), pci_dev_unlock(_T))
 
 /*
  * PCI domain support.  Sometimes called PCI segment (eg by ACPI),
diff --git a/include/linux/perf_event.h b/include/linux/perf_event.h
index 1578a4de1f3c..27b694552d58 100644
--- a/include/linux/perf_event.h
+++ b/include/linux/perf_event.h
@@ -765,6 +765,7 @@ struct perf_event {
 	struct irq_work			pending_irq;
 	struct callback_head		pending_task;
 	unsigned int			pending_work;
+	struct rcuwait			pending_work_wait;
 
 	atomic_t			event_limit;
 
diff --git a/include/linux/sbitmap.h b/include/linux/sbitmap.h
index d662cf136021..c09cdcc99471 100644
--- a/include/linux/sbitmap.h
+++ b/include/linux/sbitmap.h
@@ -36,6 +36,11 @@ struct sbitmap_word {
 	 * @cleared: word holding cleared bits
 	 */
 	unsigned long cleared ____cacheline_aligned_in_smp;
+
+	/**
+	 * @swap_lock: serializes simultaneous updates of ->word and ->cleared
+	 */
+	spinlock_t swap_lock;
 } ____cacheline_aligned_in_smp;
 
 /**
diff --git a/include/linux/task_work.h b/include/linux/task_work.h
index 795ef5a68429..26b8a47f41fc 100644
--- a/include/linux/task_work.h
+++ b/include/linux/task_work.h
@@ -30,7 +30,8 @@ int task_work_add(struct task_struct *task, struct callback_head *twork,
 
 struct callback_head *task_work_cancel_match(struct task_struct *task,
 	bool (*match)(struct callback_head *, void *data), void *data);
-struct callback_head *task_work_cancel(struct task_struct *, task_work_func_t);
+struct callback_head *task_work_cancel_func(struct task_struct *, task_work_func_t);
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb);
 void task_work_run(void);
 
 static inline void exit_task_work(struct task_struct *task)
diff --git a/include/linux/virtio_net.h b/include/linux/virtio_net.h
index 6047058d6703..29b19d0a324c 100644
--- a/include/linux/virtio_net.h
+++ b/include/linux/virtio_net.h
@@ -51,6 +51,7 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
 	unsigned int thlen = 0;
 	unsigned int p_off = 0;
 	unsigned int ip_proto;
+	u64 ret, remainder, gso_size;
 
 	if (hdr->gso_type != VIRTIO_NET_HDR_GSO_NONE) {
 		switch (hdr->gso_type & ~VIRTIO_NET_HDR_GSO_ECN) {
@@ -87,6 +88,16 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
 		u32 off = __virtio16_to_cpu(little_endian, hdr->csum_offset);
 		u32 needed = start + max_t(u32, thlen, off + sizeof(__sum16));
 
+		if (hdr->gso_size) {
+			gso_size = __virtio16_to_cpu(little_endian, hdr->gso_size);
+			ret = div64_u64_rem(skb->len, gso_size, &remainder);
+			if (!(ret && (hdr->gso_size > needed) &&
+						((remainder > needed) || (remainder == 0)))) {
+				return -EINVAL;
+			}
+			skb_shinfo(skb)->tx_flags |= SKBFL_SHARED_FRAG;
+		}
+
 		if (!pskb_may_pull(skb, needed))
 			return -EINVAL;
 
diff --git a/include/net/ip_fib.h b/include/net/ip_fib.h
index 15de07d36540..ca1700c2a573 100644
--- a/include/net/ip_fib.h
+++ b/include/net/ip_fib.h
@@ -173,6 +173,7 @@ struct fib_result {
 	unsigned char		type;
 	unsigned char		scope;
 	u32			tclassid;
+	dscp_t			dscp;
 	struct fib_nh_common	*nhc;
 	struct fib_info		*fi;
 	struct fib_table	*table;
diff --git a/include/net/tcp.h b/include/net/tcp.h
index 8ea1fba84eff..cc314c383c53 100644
--- a/include/net/tcp.h
+++ b/include/net/tcp.h
@@ -633,6 +633,7 @@ void tcp_skb_collapse_tstamp(struct sk_buff *skb,
 /* tcp_input.c */
 void tcp_rearm_rto(struct sock *sk);
 void tcp_synack_rtt_meas(struct sock *sk, struct request_sock *req);
+void tcp_done_with_error(struct sock *sk, int err);
 void tcp_reset(struct sock *sk, struct sk_buff *skb);
 void tcp_skb_mark_lost_uncond_verify(struct tcp_sock *tp, struct sk_buff *skb);
 void tcp_fin(struct sock *sk);
diff --git a/include/trace/events/rpcgss.h b/include/trace/events/rpcgss.h
index 894d9fc8bd94..e228a44af291 100644
--- a/include/trace/events/rpcgss.h
+++ b/include/trace/events/rpcgss.h
@@ -54,7 +54,7 @@ TRACE_DEFINE_ENUM(GSS_S_UNSEQ_TOKEN);
 TRACE_DEFINE_ENUM(GSS_S_GAP_TOKEN);
 
 #define show_gss_status(x)						\
-	__print_flags(x, "|",						\
+	__print_symbolic(x, 						\
 		{ GSS_S_BAD_MECH, "GSS_S_BAD_MECH" },			\
 		{ GSS_S_BAD_NAME, "GSS_S_BAD_NAME" },			\
 		{ GSS_S_BAD_NAMETYPE, "GSS_S_BAD_NAMETYPE" },		\
diff --git a/include/uapi/linux/netfilter/nf_tables.h b/include/uapi/linux/netfilter/nf_tables.h
index 707af820f1a9..672b2e1b47f2 100644
--- a/include/uapi/linux/netfilter/nf_tables.h
+++ b/include/uapi/linux/netfilter/nf_tables.h
@@ -1324,7 +1324,7 @@ enum nft_secmark_attributes {
 #define NFTA_SECMARK_MAX	(__NFTA_SECMARK_MAX - 1)
 
 /* Max security context length */
-#define NFT_SECMARK_CTX_MAXLEN		256
+#define NFT_SECMARK_CTX_MAXLEN		4096
 
 /**
  * enum nft_reject_types - nf_tables reject expression reject types
diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h
index 6e574d7b7d79..393f2ee9c042 100644
--- a/include/uapi/linux/zorro_ids.h
+++ b/include/uapi/linux/zorro_ids.h
@@ -449,6 +449,9 @@
 #define  ZORRO_PROD_VMC_ISDN_BLASTER_Z2				ZORRO_ID(VMC, 0x01, 0)
 #define  ZORRO_PROD_VMC_HYPERCOM_4				ZORRO_ID(VMC, 0x02, 0)
 
+#define ZORRO_MANUF_CSLAB					0x1400
+#define  ZORRO_PROD_CSLAB_WARP_1260				ZORRO_ID(CSLAB, 0x65, 0)
+
 #define ZORRO_MANUF_INFORMATION					0x157C
 #define  ZORRO_PROD_INFORMATION_ISDN_ENGINE_I			ZORRO_ID(INFORMATION, 0x64, 0)
 
diff --git a/io_uring/io-wq.c b/io_uring/io-wq.c
index 98ac9dbcec2f..04503118cdc1 100644
--- a/io_uring/io-wq.c
+++ b/io_uring/io-wq.c
@@ -22,6 +22,7 @@
 #include "io_uring.h"
 
 #define WORKER_IDLE_TIMEOUT	(5 * HZ)
+#define WORKER_INIT_LIMIT	3
 
 enum {
 	IO_WORKER_F_UP		= 1,	/* up and active */
@@ -58,6 +59,7 @@ struct io_worker {
 	unsigned long create_state;
 	struct callback_head create_work;
 	int create_index;
+	int init_retries;
 
 	union {
 		struct rcu_head rcu;
@@ -729,7 +731,7 @@ static bool io_wq_work_match_all(struct io_wq_work *work, void *data)
 	return true;
 }
 
-static inline bool io_should_retry_thread(long err)
+static inline bool io_should_retry_thread(struct io_worker *worker, long err)
 {
 	/*
 	 * Prevent perpetual task_work retry, if the task (or its group) is
@@ -737,6 +739,8 @@ static inline bool io_should_retry_thread(long err)
 	 */
 	if (fatal_signal_pending(current))
 		return false;
+	if (worker->init_retries++ >= WORKER_INIT_LIMIT)
+		return false;
 
 	switch (err) {
 	case -EAGAIN:
@@ -763,7 +767,7 @@ static void create_worker_cont(struct callback_head *cb)
 		io_init_new_worker(wqe, worker, tsk);
 		io_worker_release(worker);
 		return;
-	} else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+	} else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
 		struct io_wqe_acct *acct = io_wqe_get_acct(worker);
 
 		atomic_dec(&acct->nr_running);
@@ -830,7 +834,7 @@ static bool create_io_worker(struct io_wq *wq, struct io_wqe *wqe, int index)
 	tsk = create_io_thread(io_wqe_worker, worker, wqe->node);
 	if (!IS_ERR(tsk)) {
 		io_init_new_worker(wqe, worker, tsk);
-	} else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+	} else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
 		kfree(worker);
 		goto fail;
 	} else {
diff --git a/io_uring/io_uring.c b/io_uring/io_uring.c
index 958c3b619020..b21f2bafaeb0 100644
--- a/io_uring/io_uring.c
+++ b/io_uring/io_uring.c
@@ -3000,8 +3000,11 @@ __cold void io_uring_cancel_generic(bool cancel_all, struct io_sq_data *sqd)
 		bool loop = false;
 
 		io_uring_drop_tctx_refs(current);
+		if (!tctx_inflight(tctx, !cancel_all))
+			break;
+
 		/* read completions before cancelations */
-		inflight = tctx_inflight(tctx, !cancel_all);
+		inflight = tctx_inflight(tctx, false);
 		if (!inflight)
 			break;
 
diff --git a/io_uring/timeout.c b/io_uring/timeout.c
index b0cf05ebcbcc..7cdc234c5f53 100644
--- a/io_uring/timeout.c
+++ b/io_uring/timeout.c
@@ -601,7 +601,7 @@ void io_queue_linked_timeout(struct io_kiocb *req)
 
 static bool io_match_task(struct io_kiocb *head, struct task_struct *task,
 			  bool cancel_all)
-	__must_hold(&req->ctx->timeout_lock)
+	__must_hold(&head->ctx->timeout_lock)
 {
 	struct io_kiocb *req;
 
diff --git a/kernel/bpf/btf.c b/kernel/bpf/btf.c
index 7582ec4fd413..bb88fd2266a8 100644
--- a/kernel/bpf/btf.c
+++ b/kernel/bpf/btf.c
@@ -378,7 +378,7 @@ const char *btf_type_str(const struct btf_type *t)
 struct btf_show {
 	u64 flags;
 	void *target;	/* target of show operation (seq file, buffer) */
-	void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
+	__printf(2, 0) void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
 	const struct btf *btf;
 	/* below are used during iteration */
 	struct {
@@ -6792,8 +6792,8 @@ static void btf_type_show(const struct btf *btf, u32 type_id, void *obj,
 	btf_type_ops(t)->show(btf, t, type_id, obj, 0, show);
 }
 
-static void btf_seq_show(struct btf_show *show, const char *fmt,
-			 va_list args)
+__printf(2, 0) static void btf_seq_show(struct btf_show *show, const char *fmt,
+					va_list args)
 {
 	seq_vprintf((struct seq_file *)show->target, fmt, args);
 }
@@ -6826,8 +6826,8 @@ struct btf_show_snprintf {
 	int len;		/* length we would have written */
 };
 
-static void btf_snprintf_show(struct btf_show *show, const char *fmt,
-			      va_list args)
+__printf(2, 0) static void btf_snprintf_show(struct btf_show *show, const char *fmt,
+					     va_list args)
 {
 	struct btf_show_snprintf *ssnprintf = (struct btf_show_snprintf *)show;
 	int len;
diff --git a/kernel/bpf/dispatcher.c b/kernel/bpf/dispatcher.c
index c19719f48ce0..fa3e9225aedc 100644
--- a/kernel/bpf/dispatcher.c
+++ b/kernel/bpf/dispatcher.c
@@ -125,6 +125,11 @@ static void bpf_dispatcher_update(struct bpf_dispatcher *d, int prev_num_progs)
 
 	__BPF_DISPATCHER_UPDATE(d, new ?: (void *)&bpf_dispatcher_nop_func);
 
+	/* Make sure all the callers executing the previous/old half of the
+	 * image leave it, so following update call can modify it safely.
+	 */
+	synchronize_rcu();
+
 	if (new)
 		d->image_off = noff;
 }
diff --git a/kernel/cgroup/cgroup-v1.c b/kernel/cgroup/cgroup-v1.c
index 289cc873cb71..c2d28ffee3b7 100644
--- a/kernel/cgroup/cgroup-v1.c
+++ b/kernel/cgroup/cgroup-v1.c
@@ -802,7 +802,7 @@ void cgroup1_release_agent(struct work_struct *work)
 		goto out_free;
 
 	ret = cgroup_path_ns(cgrp, pathbuf, PATH_MAX, &init_cgroup_ns);
-	if (ret < 0 || ret >= PATH_MAX)
+	if (ret < 0)
 		goto out_free;
 
 	argv[0] = agentbuf;
diff --git a/kernel/cgroup/cgroup.c b/kernel/cgroup/cgroup.c
index 97ecca43386d..1e008ea467c0 100644
--- a/kernel/cgroup/cgroup.c
+++ b/kernel/cgroup/cgroup.c
@@ -1910,7 +1910,7 @@ int cgroup_show_path(struct seq_file *sf, struct kernfs_node *kf_node,
 	len = kernfs_path_from_node(kf_node, ns_cgroup->kn, buf, PATH_MAX);
 	spin_unlock_irq(&css_set_lock);
 
-	if (len >= PATH_MAX)
+	if (len == -E2BIG)
 		len = -ERANGE;
 	else if (len > 0) {
 		seq_escape(sf, buf, " \t\n\\");
@@ -6287,7 +6287,7 @@ int proc_cgroup_show(struct seq_file *m, struct pid_namespace *ns,
 		if (cgroup_on_dfl(cgrp) || !(tsk->flags & PF_EXITING)) {
 			retval = cgroup_path_ns_locked(cgrp, buf, PATH_MAX,
 						current->nsproxy->cgroup_ns);
-			if (retval >= PATH_MAX)
+			if (retval == -E2BIG)
 				retval = -ENAMETOOLONG;
 			if (retval < 0)
 				goto out_unlock;
diff --git a/kernel/cgroup/cpuset.c b/kernel/cgroup/cpuset.c
index 01f5a019e0f5..370a6bce20a8 100644
--- a/kernel/cgroup/cpuset.c
+++ b/kernel/cgroup/cpuset.c
@@ -21,6 +21,7 @@
  *  License.  See the file COPYING in the main directory of the Linux
  *  distribution for more details.
  */
+#include "cgroup-internal.h"
 
 #include <linux/cpu.h>
 #include <linux/cpumask.h>
@@ -4213,11 +4214,15 @@ int proc_cpuset_show(struct seq_file *m, struct pid_namespace *ns,
 	if (!buf)
 		goto out;
 
-	css = task_get_css(tsk, cpuset_cgrp_id);
-	retval = cgroup_path_ns(css->cgroup, buf, PATH_MAX,
-				current->nsproxy->cgroup_ns);
-	css_put(css);
-	if (retval >= PATH_MAX)
+	rcu_read_lock();
+	spin_lock_irq(&css_set_lock);
+	css = task_css(tsk, cpuset_cgrp_id);
+	retval = cgroup_path_ns_locked(css->cgroup, buf, PATH_MAX,
+				       current->nsproxy->cgroup_ns);
+	spin_unlock_irq(&css_set_lock);
+	rcu_read_unlock();
+
+	if (retval == -E2BIG)
 		retval = -ENAMETOOLONG;
 	if (retval < 0)
 		goto out_free;
diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c
index b1f79d5a5a60..d545abe08087 100644
--- a/kernel/debug/kdb/kdb_io.c
+++ b/kernel/debug/kdb/kdb_io.c
@@ -193,7 +193,7 @@ char kdb_getchar(void)
  */
 static void kdb_position_cursor(char *prompt, char *buffer, char *cp)
 {
-	kdb_printf("\r%s", kdb_prompt_str);
+	kdb_printf("\r%s", prompt);
 	if (cp > buffer)
 		kdb_printf("%.*s", (int)(cp - buffer), buffer);
 }
@@ -357,7 +357,7 @@ static char *kdb_read(char *buffer, size_t bufsize)
 			if (i >= dtab_count)
 				kdb_printf("...");
 			kdb_printf("\n");
-			kdb_printf(kdb_prompt_str);
+			kdb_printf("%s",  kdb_prompt_str);
 			kdb_printf("%s", buffer);
 			if (cp != lastchar)
 				kdb_position_cursor(kdb_prompt_str, buffer, cp);
@@ -449,7 +449,7 @@ char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt)
 {
 	if (prompt && kdb_prompt_str != prompt)
 		strscpy(kdb_prompt_str, prompt, CMD_BUFLEN);
-	kdb_printf(kdb_prompt_str);
+	kdb_printf("%s", kdb_prompt_str);
 	kdb_nextline = 1;	/* Prompt and input resets line number */
 	return kdb_read(buffer, bufsize);
 }
diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c
index 33437d620644..f1051ad0da7c 100644
--- a/kernel/dma/mapping.c
+++ b/kernel/dma/mapping.c
@@ -63,8 +63,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr,
 {
 	struct dma_devres match_data = { size, vaddr, dma_handle };
 
-	dma_free_coherent(dev, size, vaddr, dma_handle);
 	WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data));
+	dma_free_coherent(dev, size, vaddr, dma_handle);
 }
 EXPORT_SYMBOL(dmam_free_coherent);
 
diff --git a/kernel/events/core.c b/kernel/events/core.c
index 413a69aecf5c..ba099d5b41cd 100644
--- a/kernel/events/core.c
+++ b/kernel/events/core.c
@@ -2316,18 +2316,14 @@ event_sched_out(struct perf_event *event,
 	}
 
 	if (event->pending_sigtrap) {
-		bool dec = true;
-
 		event->pending_sigtrap = 0;
 		if (state != PERF_EVENT_STATE_OFF &&
-		    !event->pending_work) {
+		    !event->pending_work &&
+		    !task_work_add(current, &event->pending_task, TWA_RESUME)) {
 			event->pending_work = 1;
-			dec = false;
-			WARN_ON_ONCE(!atomic_long_inc_not_zero(&event->refcount));
-			task_work_add(current, &event->pending_task, TWA_RESUME);
-		}
-		if (dec)
+		} else {
 			local_dec(&event->ctx->nr_pending);
+		}
 	}
 
 	perf_event_set_state(event, state);
@@ -5007,9 +5003,35 @@ static bool exclusive_event_installable(struct perf_event *event,
 static void perf_addr_filters_splice(struct perf_event *event,
 				       struct list_head *head);
 
+static void perf_pending_task_sync(struct perf_event *event)
+{
+	struct callback_head *head = &event->pending_task;
+
+	if (!event->pending_work)
+		return;
+	/*
+	 * If the task is queued to the current task's queue, we
+	 * obviously can't wait for it to complete. Simply cancel it.
+	 */
+	if (task_work_cancel(current, head)) {
+		event->pending_work = 0;
+		local_dec(&event->ctx->nr_pending);
+		return;
+	}
+
+	/*
+	 * All accesses related to the event are within the same
+	 * non-preemptible section in perf_pending_task(). The RCU
+	 * grace period before the event is freed will make sure all
+	 * those accesses are complete by then.
+	 */
+	rcuwait_wait_event(&event->pending_work_wait, !event->pending_work, TASK_UNINTERRUPTIBLE);
+}
+
 static void _free_event(struct perf_event *event)
 {
 	irq_work_sync(&event->pending_irq);
+	perf_pending_task_sync(event);
 
 	unaccount_event(event);
 
@@ -6307,6 +6329,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma)
 			return -EINVAL;
 
 		nr_pages = vma_size / PAGE_SIZE;
+		if (nr_pages > INT_MAX)
+			return -ENOMEM;
 
 		mutex_lock(&event->mmap_mutex);
 		ret = -EINVAL;
@@ -6637,24 +6661,28 @@ static void perf_pending_task(struct callback_head *head)
 	struct perf_event *event = container_of(head, struct perf_event, pending_task);
 	int rctx;
 
+	/*
+	 * All accesses to the event must belong to the same implicit RCU read-side
+	 * critical section as the ->pending_work reset. See comment in
+	 * perf_pending_task_sync().
+	 */
+	preempt_disable_notrace();
 	/*
 	 * If we 'fail' here, that's OK, it means recursion is already disabled
 	 * and we won't recurse 'further'.
 	 */
-	preempt_disable_notrace();
 	rctx = perf_swevent_get_recursion_context();
 
 	if (event->pending_work) {
 		event->pending_work = 0;
 		perf_sigtrap(event);
 		local_dec(&event->ctx->nr_pending);
+		rcuwait_wake_up(&event->pending_work_wait);
 	}
 
 	if (rctx >= 0)
 		perf_swevent_put_recursion_context(rctx);
 	preempt_enable_notrace();
-
-	put_event(event);
 }
 
 #ifdef CONFIG_GUEST_PERF_EVENTS
@@ -9095,21 +9123,19 @@ static void perf_event_bpf_emit_ksymbols(struct bpf_prog *prog,
 	bool unregister = type == PERF_BPF_EVENT_PROG_UNLOAD;
 	int i;
 
-	if (prog->aux->func_cnt == 0) {
-		perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
-				   (u64)(unsigned long)prog->bpf_func,
-				   prog->jited_len, unregister,
-				   prog->aux->ksym.name);
-	} else {
-		for (i = 0; i < prog->aux->func_cnt; i++) {
-			struct bpf_prog *subprog = prog->aux->func[i];
-
-			perf_event_ksymbol(
-				PERF_RECORD_KSYMBOL_TYPE_BPF,
-				(u64)(unsigned long)subprog->bpf_func,
-				subprog->jited_len, unregister,
-				subprog->aux->ksym.name);
-		}
+	perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
+			   (u64)(unsigned long)prog->bpf_func,
+			   prog->jited_len, unregister,
+			   prog->aux->ksym.name);
+
+	for (i = 1; i < prog->aux->func_cnt; i++) {
+		struct bpf_prog *subprog = prog->aux->func[i];
+
+		perf_event_ksymbol(
+			PERF_RECORD_KSYMBOL_TYPE_BPF,
+			(u64)(unsigned long)subprog->bpf_func,
+			subprog->jited_len, unregister,
+			subprog->aux->ksym.name);
 	}
 }
 
@@ -11780,6 +11806,7 @@ perf_event_alloc(struct perf_event_attr *attr, int cpu,
 	init_waitqueue_head(&event->waitq);
 	init_irq_work(&event->pending_irq, perf_pending_irq);
 	init_task_work(&event->pending_task, perf_pending_task);
+	rcuwait_init(&event->pending_work_wait);
 
 	mutex_init(&event->mmap_mutex);
 	raw_spin_lock_init(&event->addr_filters.lock);
diff --git a/kernel/events/internal.h b/kernel/events/internal.h
index 5150d5f84c03..386d21c7edfa 100644
--- a/kernel/events/internal.h
+++ b/kernel/events/internal.h
@@ -128,7 +128,7 @@ static inline unsigned long perf_data_size(struct perf_buffer *rb)
 
 static inline unsigned long perf_aux_size(struct perf_buffer *rb)
 {
-	return rb->aux_nr_pages << PAGE_SHIFT;
+	return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT;
 }
 
 #define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...)	\
diff --git a/kernel/events/ring_buffer.c b/kernel/events/ring_buffer.c
index 45965f13757e..f3a3c294ff2b 100644
--- a/kernel/events/ring_buffer.c
+++ b/kernel/events/ring_buffer.c
@@ -683,7 +683,9 @@ int rb_alloc_aux(struct perf_buffer *rb, struct perf_event *event,
 		 * max_order, to aid PMU drivers in double buffering.
 		 */
 		if (!watermark)
-			watermark = nr_pages << (PAGE_SHIFT - 1);
+			watermark = min_t(unsigned long,
+					  U32_MAX,
+					  (unsigned long)nr_pages << (PAGE_SHIFT - 1));
 
 		/*
 		 * Use aux_watermark as the basis for chunking to
diff --git a/kernel/irq/manage.c b/kernel/irq/manage.c
index 40fe7806cc8c..a5843563d015 100644
--- a/kernel/irq/manage.c
+++ b/kernel/irq/manage.c
@@ -1324,7 +1324,7 @@ static int irq_thread(void *data)
 	 * synchronize_hardirq(). So neither IRQTF_RUNTHREAD nor the
 	 * oneshot mask bit can be set.
 	 */
-	task_work_cancel(current, irq_thread_dtor);
+	task_work_cancel_func(current, irq_thread_dtor);
 	return 0;
 }
 
diff --git a/kernel/jump_label.c b/kernel/jump_label.c
index 714ac4c3b556..eec802175ccc 100644
--- a/kernel/jump_label.c
+++ b/kernel/jump_label.c
@@ -113,30 +113,51 @@ int static_key_count(struct static_key *key)
 }
 EXPORT_SYMBOL_GPL(static_key_count);
 
-void static_key_slow_inc_cpuslocked(struct static_key *key)
+/*
+ * static_key_fast_inc_not_disabled - adds a user for a static key
+ * @key: static key that must be already enabled
+ *
+ * The caller must make sure that the static key can't get disabled while
+ * in this function. It doesn't patch jump labels, only adds a user to
+ * an already enabled static key.
+ *
+ * Returns true if the increment was done. Unlike refcount_t the ref counter
+ * is not saturated, but will fail to increment on overflow.
+ */
+bool static_key_fast_inc_not_disabled(struct static_key *key)
 {
-	int v, v1;
+	int v;
 
 	STATIC_KEY_CHECK_USE(key);
+	/*
+	 * Negative key->enabled has a special meaning: it sends
+	 * static_key_slow_inc/dec() down the slow path, and it is non-zero
+	 * so it counts as "enabled" in jump_label_update().  Note that
+	 * atomic_inc_unless_negative() checks >= 0, so roll our own.
+	 */
+	v = atomic_read(&key->enabled);
+	do {
+		if (v <= 0 || (v + 1) < 0)
+			return false;
+	} while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v + 1)));
+
+	return true;
+}
+EXPORT_SYMBOL_GPL(static_key_fast_inc_not_disabled);
+
+bool static_key_slow_inc_cpuslocked(struct static_key *key)
+{
 	lockdep_assert_cpus_held();
 
 	/*
-	 * Careful if we get concurrent static_key_slow_inc() calls;
+	 * Careful if we get concurrent static_key_slow_inc/dec() calls;
 	 * later calls must wait for the first one to _finish_ the
 	 * jump_label_update() process.  At the same time, however,
 	 * the jump_label_update() call below wants to see
 	 * static_key_enabled(&key) for jumps to be updated properly.
-	 *
-	 * So give a special meaning to negative key->enabled: it sends
-	 * static_key_slow_inc() down the slow path, and it is non-zero
-	 * so it counts as "enabled" in jump_label_update().  Note that
-	 * atomic_inc_unless_negative() checks >= 0, so roll our own.
 	 */
-	for (v = atomic_read(&key->enabled); v > 0; v = v1) {
-		v1 = atomic_cmpxchg(&key->enabled, v, v + 1);
-		if (likely(v1 == v))
-			return;
-	}
+	if (static_key_fast_inc_not_disabled(key))
+		return true;
 
 	jump_label_lock();
 	if (atomic_read(&key->enabled) == 0) {
@@ -148,16 +169,23 @@ void static_key_slow_inc_cpuslocked(struct static_key *key)
 		 */
 		atomic_set_release(&key->enabled, 1);
 	} else {
-		atomic_inc(&key->enabled);
+		if (WARN_ON_ONCE(!static_key_fast_inc_not_disabled(key))) {
+			jump_label_unlock();
+			return false;
+		}
 	}
 	jump_label_unlock();
+	return true;
 }
 
-void static_key_slow_inc(struct static_key *key)
+bool static_key_slow_inc(struct static_key *key)
 {
+	bool ret;
+
 	cpus_read_lock();
-	static_key_slow_inc_cpuslocked(key);
+	ret = static_key_slow_inc_cpuslocked(key);
 	cpus_read_unlock();
+	return ret;
 }
 EXPORT_SYMBOL_GPL(static_key_slow_inc);
 
@@ -219,20 +247,32 @@ EXPORT_SYMBOL_GPL(static_key_disable);
 
 static bool static_key_slow_try_dec(struct static_key *key)
 {
-	int val;
-
-	val = atomic_fetch_add_unless(&key->enabled, -1, 1);
-	if (val == 1)
-		return false;
+	int v;
 
 	/*
-	 * The negative count check is valid even when a negative
-	 * key->enabled is in use by static_key_slow_inc(); a
-	 * __static_key_slow_dec() before the first static_key_slow_inc()
-	 * returns is unbalanced, because all other static_key_slow_inc()
-	 * instances block while the update is in progress.
+	 * Go into the slow path if key::enabled is less than or equal than
+	 * one. One is valid to shut down the key, anything less than one
+	 * is an imbalance, which is handled at the call site.
+	 *
+	 * That includes the special case of '-1' which is set in
+	 * static_key_slow_inc_cpuslocked(), but that's harmless as it is
+	 * fully serialized in the slow path below. By the time this task
+	 * acquires the jump label lock the value is back to one and the
+	 * retry under the lock must succeed.
 	 */
-	WARN(val < 0, "jump label: negative count!\n");
+	v = atomic_read(&key->enabled);
+	do {
+		/*
+		 * Warn about the '-1' case though; since that means a
+		 * decrement is concurrent with a first (0->1) increment. IOW
+		 * people are trying to disable something that wasn't yet fully
+		 * enabled. This suggests an ordering problem on the user side.
+		 */
+		WARN_ON_ONCE(v < 0);
+		if (v <= 1)
+			return false;
+	} while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v - 1)));
+
 	return true;
 }
 
@@ -243,10 +283,11 @@ static void __static_key_slow_dec_cpuslocked(struct static_key *key)
 	if (static_key_slow_try_dec(key))
 		return;
 
-	jump_label_lock();
-	if (atomic_dec_and_test(&key->enabled))
+	guard(mutex)(&jump_label_mutex);
+	if (atomic_cmpxchg(&key->enabled, 1, 0))
 		jump_label_update(key);
-	jump_label_unlock();
+	else
+		WARN_ON_ONCE(!static_key_slow_try_dec(key));
 }
 
 static void __static_key_slow_dec(struct static_key *key)
diff --git a/kernel/locking/rwsem.c b/kernel/locking/rwsem.c
index 92d8e2c4edda..ffc2bbe39187 100644
--- a/kernel/locking/rwsem.c
+++ b/kernel/locking/rwsem.c
@@ -1308,7 +1308,7 @@ static inline int __down_read_trylock(struct rw_semaphore *sem)
 /*
  * lock for writing
  */
-static inline int __down_write_common(struct rw_semaphore *sem, int state)
+static __always_inline int __down_write_common(struct rw_semaphore *sem, int state)
 {
 	if (unlikely(!rwsem_write_trylock(sem))) {
 		if (IS_ERR(rwsem_down_write_slowpath(sem, state)))
@@ -1318,12 +1318,12 @@ static inline int __down_write_common(struct rw_semaphore *sem, int state)
 	return 0;
 }
 
-static inline void __down_write(struct rw_semaphore *sem)
+static __always_inline void __down_write(struct rw_semaphore *sem)
 {
 	__down_write_common(sem, TASK_UNINTERRUPTIBLE);
 }
 
-static inline int __down_write_killable(struct rw_semaphore *sem)
+static __always_inline int __down_write_killable(struct rw_semaphore *sem)
 {
 	return __down_write_common(sem, TASK_KILLABLE);
 }
diff --git a/kernel/rcu/tasks.h b/kernel/rcu/tasks.h
index 6f48f565e3ac..456c956f481e 100644
--- a/kernel/rcu/tasks.h
+++ b/kernel/rcu/tasks.h
@@ -1531,6 +1531,16 @@ static void rcu_tasks_trace_pregp_step(struct list_head *hop)
 	// allow safe access to the hop list.
 	for_each_online_cpu(cpu) {
 		rcu_read_lock();
+		// Note that cpu_curr_snapshot() picks up the target
+		// CPU's current task while its runqueue is locked with
+		// an smp_mb__after_spinlock().  This ensures that either
+		// the grace-period kthread will see that task's read-side
+		// critical section or the task will see the updater's pre-GP
+		// accesses.  The trailing smp_mb() in cpu_curr_snapshot()
+		// does not currently play a role other than simplify
+		// that function's ordering semantics.  If these simplified
+		// ordering semantics continue to be redundant, that smp_mb()
+		// might be removed.
 		t = cpu_curr_snapshot(cpu);
 		if (rcu_tasks_trace_pertask_prep(t, true))
 			trc_add_holdout(t, hop);
diff --git a/kernel/sched/core.c b/kernel/sched/core.c
index cac41c49bd2f..4a96bf1d2f37 100644
--- a/kernel/sched/core.c
+++ b/kernel/sched/core.c
@@ -1259,27 +1259,24 @@ int tg_nop(struct task_group *tg, void *data)
 static void set_load_weight(struct task_struct *p, bool update_load)
 {
 	int prio = p->static_prio - MAX_RT_PRIO;
-	struct load_weight *load = &p->se.load;
+	struct load_weight lw;
 
-	/*
-	 * SCHED_IDLE tasks get minimal weight:
-	 */
 	if (task_has_idle_policy(p)) {
-		load->weight = scale_load(WEIGHT_IDLEPRIO);
-		load->inv_weight = WMULT_IDLEPRIO;
-		return;
+		lw.weight = scale_load(WEIGHT_IDLEPRIO);
+		lw.inv_weight = WMULT_IDLEPRIO;
+	} else {
+		lw.weight = scale_load(sched_prio_to_weight[prio]);
+		lw.inv_weight = sched_prio_to_wmult[prio];
 	}
 
 	/*
 	 * SCHED_OTHER tasks have to update their load when changing their
 	 * weight
 	 */
-	if (update_load && p->sched_class == &fair_sched_class) {
-		reweight_task(p, prio);
-	} else {
-		load->weight = scale_load(sched_prio_to_weight[prio]);
-		load->inv_weight = sched_prio_to_wmult[prio];
-	}
+	if (update_load && p->sched_class == &fair_sched_class)
+		reweight_task(p, &lw);
+	else
+		p->se.load = lw;
 }
 
 #ifdef CONFIG_UCLAMP_TASK
@@ -4318,12 +4315,7 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
  * @cpu: The CPU on which to snapshot the task.
  *
  * Returns the task_struct pointer of the task "currently" running on
- * the specified CPU.  If the same task is running on that CPU throughout,
- * the return value will be a pointer to that task's task_struct structure.
- * If the CPU did any context switches even vaguely concurrently with the
- * execution of this function, the return value will be a pointer to the
- * task_struct structure of a randomly chosen task that was running on
- * that CPU somewhere around the time that this function was executing.
+ * the specified CPU.
  *
  * If the specified CPU was offline, the return value is whatever it
  * is, perhaps a pointer to the task_struct structure of that CPU's idle
@@ -4337,11 +4329,16 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
  */
 struct task_struct *cpu_curr_snapshot(int cpu)
 {
+	struct rq *rq = cpu_rq(cpu);
 	struct task_struct *t;
+	struct rq_flags rf;
 
-	smp_mb(); /* Pairing determined by caller's synchronization design. */
+	rq_lock_irqsave(rq, &rf);
+	smp_mb__after_spinlock(); /* Pairing determined by caller's synchronization design. */
 	t = rcu_dereference(cpu_curr(cpu));
+	rq_unlock_irqrestore(rq, &rf);
 	smp_mb(); /* Pairing determined by caller's synchronization design. */
+
 	return t;
 }
 
diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c
index d0851610cf46..1e12f731a033 100644
--- a/kernel/sched/fair.c
+++ b/kernel/sched/fair.c
@@ -3330,15 +3330,14 @@ static void reweight_entity(struct cfs_rq *cfs_rq, struct sched_entity *se,
 
 }
 
-void reweight_task(struct task_struct *p, int prio)
+void reweight_task(struct task_struct *p, const struct load_weight *lw)
 {
 	struct sched_entity *se = &p->se;
 	struct cfs_rq *cfs_rq = cfs_rq_of(se);
 	struct load_weight *load = &se->load;
-	unsigned long weight = scale_load(sched_prio_to_weight[prio]);
 
-	reweight_entity(cfs_rq, se, weight);
-	load->inv_weight = sched_prio_to_wmult[prio];
+	reweight_entity(cfs_rq, se, lw->weight);
+	load->inv_weight = lw->inv_weight;
 }
 
 static inline int throttled_hierarchy(struct cfs_rq *cfs_rq);
@@ -8525,7 +8524,7 @@ static int detach_tasks(struct lb_env *env)
 		case migrate_util:
 			util = task_util_est(p);
 
-			if (util > env->imbalance)
+			if (shr_bound(util, env->sd->nr_balance_failed) > env->imbalance)
 				goto next;
 
 			env->imbalance -= util;
diff --git a/kernel/sched/sched.h b/kernel/sched/sched.h
index 81d9698f0a1e..f0c3d0d4a0dd 100644
--- a/kernel/sched/sched.h
+++ b/kernel/sched/sched.h
@@ -2346,7 +2346,7 @@ extern void init_sched_dl_class(void);
 extern void init_sched_rt_class(void);
 extern void init_sched_fair_class(void);
 
-extern void reweight_task(struct task_struct *p, int prio);
+extern void reweight_task(struct task_struct *p, const struct load_weight *lw);
 
 extern void resched_curr(struct rq *rq);
 extern void resched_cpu(int cpu);
diff --git a/kernel/signal.c b/kernel/signal.c
index 5d45f5da2b36..4bebd2443cc3 100644
--- a/kernel/signal.c
+++ b/kernel/signal.c
@@ -2558,6 +2558,14 @@ static void do_freezer_trap(void)
 	spin_unlock_irq(&current->sighand->siglock);
 	cgroup_enter_frozen();
 	schedule();
+
+	/*
+	 * We could've been woken by task_work, run it to clear
+	 * TIF_NOTIFY_SIGNAL. The caller will retry if necessary.
+	 */
+	clear_notify_signal();
+	if (unlikely(task_work_pending(current)))
+		task_work_run();
 }
 
 static int ptrace_signal(int signr, kernel_siginfo_t *info, enum pid_type type)
diff --git a/kernel/task_work.c b/kernel/task_work.c
index 065e1ef8fc8d..ffba54734cdb 100644
--- a/kernel/task_work.c
+++ b/kernel/task_work.c
@@ -119,9 +119,9 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
 }
 
 /**
- * task_work_cancel - cancel a pending work added by task_work_add()
- * @task: the task which should execute the work
- * @func: identifies the work to remove
+ * task_work_cancel_func - cancel a pending work matching a function added by task_work_add()
+ * @task: the task which should execute the func's work
+ * @func: identifies the func to match with a work to remove
  *
  * Find the last queued pending work with ->func == @func and remove
  * it from queue.
@@ -130,11 +130,35 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
  * The found work or NULL if not found.
  */
 struct callback_head *
-task_work_cancel(struct task_struct *task, task_work_func_t func)
+task_work_cancel_func(struct task_struct *task, task_work_func_t func)
 {
 	return task_work_cancel_match(task, task_work_func_match, func);
 }
 
+static bool task_work_match(struct callback_head *cb, void *data)
+{
+	return cb == data;
+}
+
+/**
+ * task_work_cancel - cancel a pending work added by task_work_add()
+ * @task: the task which should execute the work
+ * @cb: the callback to remove if queued
+ *
+ * Remove a callback from a task's queue if queued.
+ *
+ * RETURNS:
+ * True if the callback was queued and got cancelled, false otherwise.
+ */
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb)
+{
+	struct callback_head *ret;
+
+	ret = task_work_cancel_match(task, task_work_match, cb);
+
+	return ret == cb;
+}
+
 /**
  * task_work_run - execute the works added by task_work_add()
  *
@@ -167,7 +191,7 @@ void task_work_run(void)
 		if (!work)
 			break;
 		/*
-		 * Synchronize with task_work_cancel(). It can not remove
+		 * Synchronize with task_work_cancel_match(). It can not remove
 		 * the first entry == work, cmpxchg(task_works) must fail.
 		 * But it can remove another entry from the ->next list.
 		 */
diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c
index 0916cc9adb82..ba551ec546f5 100644
--- a/kernel/time/tick-broadcast.c
+++ b/kernel/time/tick-broadcast.c
@@ -1137,6 +1137,7 @@ void tick_broadcast_switch_to_oneshot(void)
 #ifdef CONFIG_HOTPLUG_CPU
 void hotplug_cpu__broadcast_tick_pull(int deadcpu)
 {
+	struct tick_device *td = this_cpu_ptr(&tick_cpu_device);
 	struct clock_event_device *bc;
 	unsigned long flags;
 
@@ -1144,6 +1145,28 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu)
 	bc = tick_broadcast_device.evtdev;
 
 	if (bc && broadcast_needs_cpu(bc, deadcpu)) {
+		/*
+		 * If the broadcast force bit of the current CPU is set,
+		 * then the current CPU has not yet reprogrammed the local
+		 * timer device to avoid a ping-pong race. See
+		 * ___tick_broadcast_oneshot_control().
+		 *
+		 * If the broadcast device is hrtimer based then
+		 * programming the broadcast event below does not have any
+		 * effect because the local clockevent device is not
+		 * running and not programmed because the broadcast event
+		 * is not earlier than the pending event of the local clock
+		 * event device. As a consequence all CPUs waiting for a
+		 * broadcast event are stuck forever.
+		 *
+		 * Detect this condition and reprogram the cpu local timer
+		 * device to avoid the starvation.
+		 */
+		if (tick_check_broadcast_expired()) {
+			cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask);
+			tick_program_event(td->evtdev->next_event, 1);
+		}
+
 		/* This moves the broadcast assignment to this CPU: */
 		clockevents_program_event(bc, bc->next_event, 1);
 	}
diff --git a/kernel/trace/pid_list.c b/kernel/trace/pid_list.c
index 95106d02b32d..85de221c0b6f 100644
--- a/kernel/trace/pid_list.c
+++ b/kernel/trace/pid_list.c
@@ -354,7 +354,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
 	while (upper_count-- > 0) {
 		union upper_chunk *chunk;
 
-		chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+		chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
 		if (!chunk)
 			break;
 		*upper_next = chunk;
@@ -365,7 +365,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
 	while (lower_count-- > 0) {
 		union lower_chunk *chunk;
 
-		chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+		chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
 		if (!chunk)
 			break;
 		*lower_next = chunk;
diff --git a/kernel/watchdog_hld.c b/kernel/watchdog_hld.c
index 1e8a49dc956e..8ba4b269ab89 100644
--- a/kernel/watchdog_hld.c
+++ b/kernel/watchdog_hld.c
@@ -91,11 +91,15 @@ static bool watchdog_check_timestamp(void)
 	__this_cpu_write(last_timestamp, now);
 	return true;
 }
-#else
-static inline bool watchdog_check_timestamp(void)
+
+static void watchdog_init_timestamp(void)
 {
-	return true;
+	__this_cpu_write(nmi_rearmed, 0);
+	__this_cpu_write(last_timestamp, ktime_get_mono_fast_ns());
 }
+#else
+static inline bool watchdog_check_timestamp(void) { return true; }
+static inline void watchdog_init_timestamp(void) { }
 #endif
 
 static struct perf_event_attr wd_hw_attr = {
@@ -196,6 +200,7 @@ void hardlockup_detector_perf_enable(void)
 	if (!atomic_fetch_inc(&watchdog_cpus))
 		pr_info("Enabled. Permanently consumes one hw-PMU counter.\n");
 
+	watchdog_init_timestamp();
 	perf_event_enable(this_cpu_read(watchdog_ev));
 }
 
diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c
index 3518e7394eca..ca736166f100 100644
--- a/lib/decompress_bunzip2.c
+++ b/lib/decompress_bunzip2.c
@@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd)
 	   RUNB) */
 	symCount = symTotal+2;
 	for (j = 0; j < groupCount; j++) {
-		unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1];
+		unsigned char length[MAX_SYMBOLS];
+		unsigned short temp[MAX_HUFCODE_BITS+1];
 		int	minLen,	maxLen, pp;
 		/* Read Huffman code lengths for each symbol.  They're
 		   stored in a way similar to mtf; record a starting
diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c
index 7c44b7ae4c5c..d397b1ad5ccf 100644
--- a/lib/kobject_uevent.c
+++ b/lib/kobject_uevent.c
@@ -432,8 +432,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env)
 		len = strlen(env->envp[i]) + 1;
 
 		if (i != env->envp_idx - 1) {
+			/* @env->envp[] contains pointers to @env->buf[]
+			 * with @env->buflen chars, and we are removing
+			 * variable MODALIAS here pointed by @env->envp[i]
+			 * with length @len as shown below:
+			 *
+			 * 0               @env->buf[]      @env->buflen
+			 * ---------------------------------------------
+			 * ^             ^              ^              ^
+			 * |             |->   @len   <-| target block |
+			 * @env->envp[0] @env->envp[i]  @env->envp[i + 1]
+			 *
+			 * so the "target block" indicated above is moved
+			 * backward by @len, and its right size is
+			 * @env->buflen - (@env->envp[i + 1] - @env->envp[0]).
+			 */
 			memmove(env->envp[i], env->envp[i + 1],
-				env->buflen - len);
+				env->buflen - (env->envp[i + 1] - env->envp[0]));
 
 			for (j = i; j < env->envp_idx - 1; j++)
 				env->envp[j] = env->envp[j + 1] - len;
diff --git a/lib/objagg.c b/lib/objagg.c
index 1e248629ed64..1608895b009c 100644
--- a/lib/objagg.c
+++ b/lib/objagg.c
@@ -167,6 +167,9 @@ static int objagg_obj_parent_assign(struct objagg *objagg,
 {
 	void *delta_priv;
 
+	if (WARN_ON(!objagg_obj_is_root(parent)))
+		return -EINVAL;
+
 	delta_priv = objagg->ops->delta_create(objagg->priv, parent->obj,
 					       objagg_obj->obj);
 	if (IS_ERR(delta_priv))
@@ -903,20 +906,6 @@ static const struct objagg_opt_algo *objagg_opt_algos[] = {
 	[OBJAGG_OPT_ALGO_SIMPLE_GREEDY] = &objagg_opt_simple_greedy,
 };
 
-static int objagg_hints_obj_cmp(struct rhashtable_compare_arg *arg,
-				const void *obj)
-{
-	struct rhashtable *ht = arg->ht;
-	struct objagg_hints *objagg_hints =
-			container_of(ht, struct objagg_hints, node_ht);
-	const struct objagg_ops *ops = objagg_hints->ops;
-	const char *ptr = obj;
-
-	ptr += ht->p.key_offset;
-	return ops->hints_obj_cmp ? ops->hints_obj_cmp(ptr, arg->key) :
-				    memcmp(ptr, arg->key, ht->p.key_len);
-}
-
 /**
  * objagg_hints_get - obtains hints instance
  * @objagg:		objagg instance
@@ -955,7 +944,6 @@ struct objagg_hints *objagg_hints_get(struct objagg *objagg,
 				offsetof(struct objagg_hints_node, obj);
 	objagg_hints->ht_params.head_offset =
 				offsetof(struct objagg_hints_node, ht_node);
-	objagg_hints->ht_params.obj_cmpfn = objagg_hints_obj_cmp;
 
 	err = rhashtable_init(&objagg_hints->node_ht, &objagg_hints->ht_params);
 	if (err)
diff --git a/lib/sbitmap.c b/lib/sbitmap.c
index c515072eca29..61075535a807 100644
--- a/lib/sbitmap.c
+++ b/lib/sbitmap.c
@@ -60,12 +60,30 @@ static inline void update_alloc_hint_after_get(struct sbitmap *sb,
 /*
  * See if we have deferred clears that we can batch move
  */
-static inline bool sbitmap_deferred_clear(struct sbitmap_word *map)
+static inline bool sbitmap_deferred_clear(struct sbitmap_word *map,
+		unsigned int depth, unsigned int alloc_hint, bool wrap)
 {
-	unsigned long mask;
+	unsigned long mask, word_mask;
 
-	if (!READ_ONCE(map->cleared))
-		return false;
+	guard(spinlock_irqsave)(&map->swap_lock);
+
+	if (!map->cleared) {
+		if (depth == 0)
+			return false;
+
+		word_mask = (~0UL) >> (BITS_PER_LONG - depth);
+		/*
+		 * The current behavior is to always retry after moving
+		 * ->cleared to word, and we change it to retry in case
+		 * of any free bits. To avoid an infinite loop, we need
+		 * to take wrap & alloc_hint into account, otherwise a
+		 * soft lockup may occur.
+		 */
+		if (!wrap && alloc_hint)
+			word_mask &= ~((1UL << alloc_hint) - 1);
+
+		return (READ_ONCE(map->word) & word_mask) != word_mask;
+	}
 
 	/*
 	 * First get a stable cleared mask, setting the old mask to 0.
@@ -85,6 +103,7 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
 		      bool alloc_hint)
 {
 	unsigned int bits_per_word;
+	int i;
 
 	if (shift < 0)
 		shift = sbitmap_calculate_shift(depth);
@@ -116,6 +135,9 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
 		return -ENOMEM;
 	}
 
+	for (i = 0; i < sb->map_nr; i++)
+		spin_lock_init(&sb->map[i].swap_lock);
+
 	return 0;
 }
 EXPORT_SYMBOL_GPL(sbitmap_init_node);
@@ -126,7 +148,7 @@ void sbitmap_resize(struct sbitmap *sb, unsigned int depth)
 	unsigned int i;
 
 	for (i = 0; i < sb->map_nr; i++)
-		sbitmap_deferred_clear(&sb->map[i]);
+		sbitmap_deferred_clear(&sb->map[i], 0, 0, 0);
 
 	sb->depth = depth;
 	sb->map_nr = DIV_ROUND_UP(sb->depth, bits_per_word);
@@ -167,18 +189,19 @@ static int __sbitmap_get_word(unsigned long *word, unsigned long depth,
 	return nr;
 }
 
-static int sbitmap_find_bit_in_index(struct sbitmap *sb, int index,
-				     unsigned int alloc_hint)
+static int sbitmap_find_bit_in_word(struct sbitmap_word *map,
+				    unsigned int depth,
+				    unsigned int alloc_hint,
+				    bool wrap)
 {
-	struct sbitmap_word *map = &sb->map[index];
 	int nr;
 
 	do {
-		nr = __sbitmap_get_word(&map->word, __map_depth(sb, index),
-					alloc_hint, !sb->round_robin);
+		nr = __sbitmap_get_word(&map->word, depth,
+					alloc_hint, wrap);
 		if (nr != -1)
 			break;
-		if (!sbitmap_deferred_clear(map))
+		if (!sbitmap_deferred_clear(map, depth, alloc_hint, wrap))
 			break;
 	} while (1);
 
@@ -203,7 +226,9 @@ static int __sbitmap_get(struct sbitmap *sb, unsigned int alloc_hint)
 		alloc_hint = 0;
 
 	for (i = 0; i < sb->map_nr; i++) {
-		nr = sbitmap_find_bit_in_index(sb, index, alloc_hint);
+		nr = sbitmap_find_bit_in_word(&sb->map[index],
+					      __map_depth(sb, index),
+					      alloc_hint, !sb->round_robin);
 		if (nr != -1) {
 			nr += index << sb->shift;
 			break;
@@ -243,30 +268,24 @@ static int __sbitmap_get_shallow(struct sbitmap *sb,
 	int nr = -1;
 
 	index = SB_NR_TO_INDEX(sb, alloc_hint);
+	alloc_hint = SB_NR_TO_BIT(sb, alloc_hint);
 
 	for (i = 0; i < sb->map_nr; i++) {
-again:
-		nr = __sbitmap_get_word(&sb->map[index].word,
-					min_t(unsigned int,
-					      __map_depth(sb, index),
-					      shallow_depth),
-					SB_NR_TO_BIT(sb, alloc_hint), true);
+		nr = sbitmap_find_bit_in_word(&sb->map[index],
+					      min_t(unsigned int,
+						    __map_depth(sb, index),
+						    shallow_depth),
+					      alloc_hint, true);
+
 		if (nr != -1) {
 			nr += index << sb->shift;
 			break;
 		}
 
-		if (sbitmap_deferred_clear(&sb->map[index]))
-			goto again;
-
 		/* Jump to next index. */
-		index++;
-		alloc_hint = index << sb->shift;
-
-		if (index >= sb->map_nr) {
+		alloc_hint = 0;
+		if (++index >= sb->map_nr)
 			index = 0;
-			alloc_hint = 0;
-		}
 	}
 
 	return nr;
@@ -506,18 +525,18 @@ unsigned long __sbitmap_queue_get_batch(struct sbitmap_queue *sbq, int nr_tags,
 		struct sbitmap_word *map = &sb->map[index];
 		unsigned long get_mask;
 		unsigned int map_depth = __map_depth(sb, index);
+		unsigned long val;
 
-		sbitmap_deferred_clear(map);
-		if (map->word == (1UL << (map_depth - 1)) - 1)
+		sbitmap_deferred_clear(map, 0, 0, 0);
+		val = READ_ONCE(map->word);
+		if (val == (1UL << (map_depth - 1)) - 1)
 			goto next;
 
-		nr = find_first_zero_bit(&map->word, map_depth);
+		nr = find_first_zero_bit(&val, map_depth);
 		if (nr + nr_tags <= map_depth) {
 			atomic_long_t *ptr = (atomic_long_t *) &map->word;
-			unsigned long val;
 
 			get_mask = ((1UL << nr_tags) - 1) << nr;
-			val = READ_ONCE(map->word);
 			while (!atomic_long_try_cmpxchg(ptr, &val,
 							  get_mask | val))
 				;
diff --git a/mm/hugetlb.c b/mm/hugetlb.c
index 87a14638fad0..05b8797163b2 100644
--- a/mm/hugetlb.c
+++ b/mm/hugetlb.c
@@ -4353,7 +4353,7 @@ void __init hugetlb_add_hstate(unsigned int order)
 	BUG_ON(hugetlb_max_hstate >= HUGE_MAX_HSTATE);
 	BUG_ON(order == 0);
 	h = &hstates[hugetlb_max_hstate++];
-	mutex_init(&h->resize_lock);
+	__mutex_init(&h->resize_lock, "resize mutex", &h->resize_key);
 	h->order = order;
 	h->mask = ~(huge_page_size(h) - 1);
 	for (i = 0; i < MAX_NUMNODES; ++i)
diff --git a/mm/mempolicy.c b/mm/mempolicy.c
index 84e11c2caae4..399d8cb48813 100644
--- a/mm/mempolicy.c
+++ b/mm/mempolicy.c
@@ -3112,8 +3112,9 @@ int mpol_parse_str(char *str, struct mempolicy **mpol)
  * @pol:  pointer to mempolicy to be formatted
  *
  * Convert @pol into a string.  If @buffer is too short, truncate the string.
- * Recommend a @maxlen of at least 32 for the longest mode, "interleave", the
- * longest flag, "relative", and to display at least a few node ids.
+ * Recommend a @maxlen of at least 51 for the longest mode, "weighted
+ * interleave", plus the longest flag flags, "relative|balancing", and to
+ * display at least a few node ids.
  */
 void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 {
@@ -3122,7 +3123,10 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 	unsigned short mode = MPOL_DEFAULT;
 	unsigned short flags = 0;
 
-	if (pol && pol != &default_policy && !(pol->flags & MPOL_F_MORON)) {
+	if (pol &&
+	    pol != &default_policy &&
+	    !(pol >= &preferred_node_policy[0] &&
+	      pol <= &preferred_node_policy[ARRAY_SIZE(preferred_node_policy) - 1])) {
 		mode = pol->mode;
 		flags = pol->flags;
 	}
@@ -3149,12 +3153,18 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
 		p += snprintf(p, buffer + maxlen - p, "=");
 
 		/*
-		 * Currently, the only defined flags are mutually exclusive
+		 * Static and relative are mutually exclusive.
 		 */
 		if (flags & MPOL_F_STATIC_NODES)
 			p += snprintf(p, buffer + maxlen - p, "static");
 		else if (flags & MPOL_F_RELATIVE_NODES)
 			p += snprintf(p, buffer + maxlen - p, "relative");
+
+		if (flags & MPOL_F_NUMA_BALANCING) {
+			if (!is_power_of_2(flags & MPOL_MODE_FLAGS))
+				p += snprintf(p, buffer + maxlen - p, "|");
+			p += snprintf(p, buffer + maxlen - p, "balancing");
+		}
 	}
 
 	if (!nodes_empty(nodes))
diff --git a/mm/mmap_lock.c b/mm/mmap_lock.c
index 1854850b4b89..368b840e7508 100644
--- a/mm/mmap_lock.c
+++ b/mm/mmap_lock.c
@@ -19,14 +19,7 @@ EXPORT_TRACEPOINT_SYMBOL(mmap_lock_released);
 
 #ifdef CONFIG_MEMCG
 
-/*
- * Our various events all share the same buffer (because we don't want or need
- * to allocate a set of buffers *per event type*), so we need to protect against
- * concurrent _reg() and _unreg() calls, and count how many _reg() calls have
- * been made.
- */
-static DEFINE_MUTEX(reg_lock);
-static int reg_refcount; /* Protected by reg_lock. */
+static atomic_t reg_refcount;
 
 /*
  * Size of the buffer for memcg path names. Ignoring stack trace support,
@@ -34,136 +27,22 @@ static int reg_refcount; /* Protected by reg_lock. */
  */
 #define MEMCG_PATH_BUF_SIZE MAX_FILTER_STR_VAL
 
-/*
- * How many contexts our trace events might be called in: normal, softirq, irq,
- * and NMI.
- */
-#define CONTEXT_COUNT 4
-
-struct memcg_path {
-	local_lock_t lock;
-	char __rcu *buf;
-	local_t buf_idx;
-};
-static DEFINE_PER_CPU(struct memcg_path, memcg_paths) = {
-	.lock = INIT_LOCAL_LOCK(lock),
-	.buf_idx = LOCAL_INIT(0),
-};
-
-static char **tmp_bufs;
-
-/* Called with reg_lock held. */
-static void free_memcg_path_bufs(void)
-{
-	struct memcg_path *memcg_path;
-	int cpu;
-	char **old = tmp_bufs;
-
-	for_each_possible_cpu(cpu) {
-		memcg_path = per_cpu_ptr(&memcg_paths, cpu);
-		*(old++) = rcu_dereference_protected(memcg_path->buf,
-			lockdep_is_held(&reg_lock));
-		rcu_assign_pointer(memcg_path->buf, NULL);
-	}
-
-	/* Wait for inflight memcg_path_buf users to finish. */
-	synchronize_rcu();
-
-	old = tmp_bufs;
-	for_each_possible_cpu(cpu) {
-		kfree(*(old++));
-	}
-
-	kfree(tmp_bufs);
-	tmp_bufs = NULL;
-}
-
 int trace_mmap_lock_reg(void)
 {
-	int cpu;
-	char *new;
-
-	mutex_lock(&reg_lock);
-
-	/* If the refcount is going 0->1, proceed with allocating buffers. */
-	if (reg_refcount++)
-		goto out;
-
-	tmp_bufs = kmalloc_array(num_possible_cpus(), sizeof(*tmp_bufs),
-				 GFP_KERNEL);
-	if (tmp_bufs == NULL)
-		goto out_fail;
-
-	for_each_possible_cpu(cpu) {
-		new = kmalloc(MEMCG_PATH_BUF_SIZE * CONTEXT_COUNT, GFP_KERNEL);
-		if (new == NULL)
-			goto out_fail_free;
-		rcu_assign_pointer(per_cpu_ptr(&memcg_paths, cpu)->buf, new);
-		/* Don't need to wait for inflights, they'd have gotten NULL. */
-	}
-
-out:
-	mutex_unlock(&reg_lock);
+	atomic_inc(&reg_refcount);
 	return 0;
-
-out_fail_free:
-	free_memcg_path_bufs();
-out_fail:
-	/* Since we failed, undo the earlier ref increment. */
-	--reg_refcount;
-
-	mutex_unlock(&reg_lock);
-	return -ENOMEM;
 }
 
 void trace_mmap_lock_unreg(void)
 {
-	mutex_lock(&reg_lock);
-
-	/* If the refcount is going 1->0, proceed with freeing buffers. */
-	if (--reg_refcount)
-		goto out;
-
-	free_memcg_path_bufs();
-
-out:
-	mutex_unlock(&reg_lock);
-}
-
-static inline char *get_memcg_path_buf(void)
-{
-	struct memcg_path *memcg_path = this_cpu_ptr(&memcg_paths);
-	char *buf;
-	int idx;
-
-	rcu_read_lock();
-	buf = rcu_dereference(memcg_path->buf);
-	if (buf == NULL) {
-		rcu_read_unlock();
-		return NULL;
-	}
-	idx = local_add_return(MEMCG_PATH_BUF_SIZE, &memcg_path->buf_idx) -
-	      MEMCG_PATH_BUF_SIZE;
-	return &buf[idx];
+	atomic_dec(&reg_refcount);
 }
 
-static inline void put_memcg_path_buf(void)
-{
-	local_sub(MEMCG_PATH_BUF_SIZE, &this_cpu_ptr(&memcg_paths)->buf_idx);
-	rcu_read_unlock();
-}
-
-#define TRACE_MMAP_LOCK_EVENT(type, mm, ...)                                   \
-	do {                                                                   \
-		const char *memcg_path;                                        \
-		local_lock(&memcg_paths.lock);                                 \
-		memcg_path = get_mm_memcg_path(mm);                            \
-		trace_mmap_lock_##type(mm,                                     \
-				       memcg_path != NULL ? memcg_path : "",   \
-				       ##__VA_ARGS__);                         \
-		if (likely(memcg_path != NULL))                                \
-			put_memcg_path_buf();                                  \
-		local_unlock(&memcg_paths.lock);                               \
+#define TRACE_MMAP_LOCK_EVENT(type, mm, ...)                    \
+	do {                                                    \
+		char buf[MEMCG_PATH_BUF_SIZE];                  \
+		get_mm_memcg_path(mm, buf, sizeof(buf));        \
+		trace_mmap_lock_##type(mm, buf, ##__VA_ARGS__); \
 	} while (0)
 
 #else /* !CONFIG_MEMCG */
@@ -185,37 +64,23 @@ void trace_mmap_lock_unreg(void)
 #ifdef CONFIG_TRACING
 #ifdef CONFIG_MEMCG
 /*
- * Write the given mm_struct's memcg path to a percpu buffer, and return a
- * pointer to it. If the path cannot be determined, or no buffer was available
- * (because the trace event is being unregistered), NULL is returned.
- *
- * Note: buffers are allocated per-cpu to avoid locking, so preemption must be
- * disabled by the caller before calling us, and re-enabled only after the
- * caller is done with the pointer.
- *
- * The caller must call put_memcg_path_buf() once the buffer is no longer
- * needed. This must be done while preemption is still disabled.
+ * Write the given mm_struct's memcg path to a buffer. If the path cannot be
+ * determined or the trace event is being unregistered, empty string is written.
  */
-static const char *get_mm_memcg_path(struct mm_struct *mm)
+static void get_mm_memcg_path(struct mm_struct *mm, char *buf, size_t buflen)
 {
-	char *buf = NULL;
-	struct mem_cgroup *memcg = get_mem_cgroup_from_mm(mm);
+	struct mem_cgroup *memcg;
 
+	buf[0] = '\0';
+	/* No need to get path if no trace event is registered. */
+	if (!atomic_read(&reg_refcount))
+		return;
+	memcg = get_mem_cgroup_from_mm(mm);
 	if (memcg == NULL)
-		goto out;
-	if (unlikely(memcg->css.cgroup == NULL))
-		goto out_put;
-
-	buf = get_memcg_path_buf();
-	if (buf == NULL)
-		goto out_put;
-
-	cgroup_path(memcg->css.cgroup, buf, MEMCG_PATH_BUF_SIZE);
-
-out_put:
+		return;
+	if (memcg->css.cgroup)
+		cgroup_path(memcg->css.cgroup, buf, buflen);
 	css_put(&memcg->css);
-out:
-	return buf;
 }
 
 #endif /* CONFIG_MEMCG */
diff --git a/mm/vmscan.c b/mm/vmscan.c
index a3b1d8e5dbb3..4cd0cbf9c121 100644
--- a/mm/vmscan.c
+++ b/mm/vmscan.c
@@ -5065,7 +5065,6 @@ static int evict_folios(struct lruvec *lruvec, struct scan_control *sc, int swap
 
 		/* retry folios that may have missed folio_rotate_reclaimable() */
 		list_move(&folio->lru, &clean);
-		sc->nr_scanned -= folio_nr_pages(folio);
 	}
 
 	spin_lock_irq(&lruvec->lru_lock);
diff --git a/net/bridge/br_forward.c b/net/bridge/br_forward.c
index 9661698e86e4..a32d73f38155 100644
--- a/net/bridge/br_forward.c
+++ b/net/bridge/br_forward.c
@@ -25,8 +25,8 @@ static inline int should_deliver(const struct net_bridge_port *p,
 
 	vg = nbp_vlan_group_rcu(p);
 	return ((p->flags & BR_HAIRPIN_MODE) || skb->dev != p->dev) &&
-		p->state == BR_STATE_FORWARDING && br_allowed_egress(vg, skb) &&
-		nbp_switchdev_allowed_egress(p, skb) &&
+		(br_mst_is_enabled(p->br) || p->state == BR_STATE_FORWARDING) &&
+		br_allowed_egress(vg, skb) && nbp_switchdev_allowed_egress(p, skb) &&
 		!br_skb_isolated(p, skb);
 }
 
diff --git a/net/core/filter.c b/net/core/filter.c
index dc89c3424718..210b881cb50b 100644
--- a/net/core/filter.c
+++ b/net/core/filter.c
@@ -3518,13 +3518,20 @@ static int bpf_skb_net_grow(struct sk_buff *skb, u32 off, u32 len_diff,
 	if (skb_is_gso(skb)) {
 		struct skb_shared_info *shinfo = skb_shinfo(skb);
 
-		/* Due to header grow, MSS needs to be downgraded. */
-		if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO))
-			skb_decrease_gso_size(shinfo, len_diff);
-
 		/* Header must be checked, and gso_segs recomputed. */
 		shinfo->gso_type |= gso_type;
 		shinfo->gso_segs = 0;
+
+		/* Due to header growth, MSS needs to be downgraded.
+		 * There is a BUG_ON() when segmenting the frag_list with
+		 * head_frag true, so linearize the skb after downgrading
+		 * the MSS.
+		 */
+		if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) {
+			skb_decrease_gso_size(shinfo, len_diff);
+			if (shinfo->frag_list)
+				return skb_linearize(skb);
+		}
 	}
 
 	return 0;
diff --git a/net/core/flow_dissector.c b/net/core/flow_dissector.c
index 0c85c8a9e752..fba8eb1bb281 100644
--- a/net/core/flow_dissector.c
+++ b/net/core/flow_dissector.c
@@ -1013,7 +1013,7 @@ bool __skb_flow_dissect(const struct net *net,
 		}
 	}
 
-	WARN_ON_ONCE(!net);
+	DEBUG_NET_WARN_ON_ONCE(!net);
 	if (net) {
 		enum netns_bpf_attach_type type = NETNS_BPF_FLOW_DISSECTOR;
 		struct bpf_prog_array *run_array;
diff --git a/net/core/xdp.c b/net/core/xdp.c
index c3f6653b4274..90de33b7c9ce 100644
--- a/net/core/xdp.c
+++ b/net/core/xdp.c
@@ -124,10 +124,8 @@ void xdp_unreg_mem_model(struct xdp_mem_info *mem)
 		return;
 
 	if (type == MEM_TYPE_PAGE_POOL) {
-		rcu_read_lock();
-		xa = rhashtable_lookup(mem_id_ht, &id, mem_id_rht_params);
+		xa = rhashtable_lookup_fast(mem_id_ht, &id, mem_id_rht_params);
 		page_pool_destroy(xa->page_pool);
-		rcu_read_unlock();
 	}
 }
 EXPORT_SYMBOL_GPL(xdp_unreg_mem_model);
diff --git a/net/ipv4/esp4.c b/net/ipv4/esp4.c
index e2546961add3..419969b26822 100644
--- a/net/ipv4/esp4.c
+++ b/net/ipv4/esp4.c
@@ -238,8 +238,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 #else
 static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 {
-	kfree_skb(skb);
-
+	WARN_ON(1);
 	return -EOPNOTSUPP;
 }
 #endif
diff --git a/net/ipv4/fib_semantics.c b/net/ipv4/fib_semantics.c
index 5eb1b8d302bb..e3268615a65a 100644
--- a/net/ipv4/fib_semantics.c
+++ b/net/ipv4/fib_semantics.c
@@ -2270,6 +2270,15 @@ void fib_select_path(struct net *net, struct fib_result *res,
 		fib_select_default(fl4, res);
 
 check_saddr:
-	if (!fl4->saddr)
-		fl4->saddr = fib_result_prefsrc(net, res);
+	if (!fl4->saddr) {
+		struct net_device *l3mdev;
+
+		l3mdev = dev_get_by_index_rcu(net, fl4->flowi4_l3mdev);
+
+		if (!l3mdev ||
+		    l3mdev_master_dev_rcu(FIB_RES_DEV(*res)) == l3mdev)
+			fl4->saddr = fib_result_prefsrc(net, res);
+		else
+			fl4->saddr = inet_select_addr(l3mdev, 0, RT_SCOPE_LINK);
+	}
 }
diff --git a/net/ipv4/fib_trie.c b/net/ipv4/fib_trie.c
index 9bdfdab906fe..77b97c48da5e 100644
--- a/net/ipv4/fib_trie.c
+++ b/net/ipv4/fib_trie.c
@@ -1628,6 +1628,7 @@ int fib_table_lookup(struct fib_table *tb, const struct flowi4 *flp,
 			res->nhc = nhc;
 			res->type = fa->fa_type;
 			res->scope = fi->fib_scope;
+			res->dscp = fa->fa_dscp;
 			res->fi = fi;
 			res->table = tb;
 			res->fa_head = &n->leaf;
diff --git a/net/ipv4/nexthop.c b/net/ipv4/nexthop.c
index be5498f5dd31..bba955d82f72 100644
--- a/net/ipv4/nexthop.c
+++ b/net/ipv4/nexthop.c
@@ -676,9 +676,10 @@ static int nla_put_nh_group(struct sk_buff *skb, struct nh_group *nhg)
 
 	p = nla_data(nla);
 	for (i = 0; i < nhg->num_nh; ++i) {
-		p->id = nhg->nh_entries[i].nh->id;
-		p->weight = nhg->nh_entries[i].weight - 1;
-		p += 1;
+		*p++ = (struct nexthop_grp) {
+			.id = nhg->nh_entries[i].nh->id,
+			.weight = nhg->nh_entries[i].weight - 1,
+		};
 	}
 
 	if (nhg->resilient && nla_put_nh_group_res(skb, nhg))
diff --git a/net/ipv4/route.c b/net/ipv4/route.c
index fcbacd39febe..fda88894d020 100644
--- a/net/ipv4/route.c
+++ b/net/ipv4/route.c
@@ -1275,7 +1275,7 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt)
 		struct flowi4 fl4 = {
 			.daddr = iph->daddr,
 			.saddr = iph->saddr,
-			.flowi4_tos = RT_TOS(iph->tos),
+			.flowi4_tos = iph->tos & IPTOS_RT_MASK,
 			.flowi4_oif = rt->dst.dev->ifindex,
 			.flowi4_iif = skb->dev->ifindex,
 			.flowi4_mark = skb->mark,
@@ -2934,9 +2934,9 @@ EXPORT_SYMBOL_GPL(ip_route_output_tunnel);
 
 /* called with rcu_read_lock held */
 static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
-			struct rtable *rt, u32 table_id, struct flowi4 *fl4,
-			struct sk_buff *skb, u32 portid, u32 seq,
-			unsigned int flags)
+			struct rtable *rt, u32 table_id, dscp_t dscp,
+			struct flowi4 *fl4, struct sk_buff *skb, u32 portid,
+			u32 seq, unsigned int flags)
 {
 	struct rtmsg *r;
 	struct nlmsghdr *nlh;
@@ -2952,7 +2952,7 @@ static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
 	r->rtm_family	 = AF_INET;
 	r->rtm_dst_len	= 32;
 	r->rtm_src_len	= 0;
-	r->rtm_tos	= fl4 ? fl4->flowi4_tos : 0;
+	r->rtm_tos	= inet_dscp_to_dsfield(dscp);
 	r->rtm_table	= table_id < 256 ? table_id : RT_TABLE_COMPAT;
 	if (nla_put_u32(skb, RTA_TABLE, table_id))
 		goto nla_put_failure;
@@ -3102,7 +3102,7 @@ static int fnhe_dump_bucket(struct net *net, struct sk_buff *skb,
 				goto next;
 
 			err = rt_fill_info(net, fnhe->fnhe_daddr, 0, rt,
-					   table_id, NULL, skb,
+					   table_id, 0, NULL, skb,
 					   NETLINK_CB(cb->skb).portid,
 					   cb->nlh->nlmsg_seq, flags);
 			if (err)
@@ -3398,7 +3398,7 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
 		fri.tb_id = table_id;
 		fri.dst = res.prefix;
 		fri.dst_len = res.prefixlen;
-		fri.dscp = inet_dsfield_to_dscp(fl4.flowi4_tos);
+		fri.dscp = res.dscp;
 		fri.type = rt->rt_type;
 		fri.offload = 0;
 		fri.trap = 0;
@@ -3425,8 +3425,8 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
 		err = fib_dump_info(skb, NETLINK_CB(in_skb).portid,
 				    nlh->nlmsg_seq, RTM_NEWROUTE, &fri, 0);
 	} else {
-		err = rt_fill_info(net, dst, src, rt, table_id, &fl4, skb,
-				   NETLINK_CB(in_skb).portid,
+		err = rt_fill_info(net, dst, src, rt, table_id, res.dscp, &fl4,
+				   skb, NETLINK_CB(in_skb).portid,
 				   nlh->nlmsg_seq, 0);
 	}
 	if (err < 0)
diff --git a/net/ipv4/tcp.c b/net/ipv4/tcp.c
index 2d4f697d338f..cb79919323a6 100644
--- a/net/ipv4/tcp.c
+++ b/net/ipv4/tcp.c
@@ -589,9 +589,10 @@ __poll_t tcp_poll(struct file *file, struct socket *sock, poll_table *wait)
 		 */
 		mask |= EPOLLOUT | EPOLLWRNORM;
 	}
-	/* This barrier is coupled with smp_wmb() in tcp_reset() */
+	/* This barrier is coupled with smp_wmb() in tcp_done_with_error() */
 	smp_rmb();
-	if (sk->sk_err || !skb_queue_empty_lockless(&sk->sk_error_queue))
+	if (READ_ONCE(sk->sk_err) ||
+	    !skb_queue_empty_lockless(&sk->sk_error_queue))
 		mask |= EPOLLERR;
 
 	return mask;
@@ -3119,7 +3120,7 @@ int tcp_disconnect(struct sock *sk, int flags)
 	if (old_state == TCP_LISTEN) {
 		inet_csk_listen_stop(sk);
 	} else if (unlikely(tp->repair)) {
-		sk->sk_err = ECONNABORTED;
+		WRITE_ONCE(sk->sk_err, ECONNABORTED);
 	} else if (tcp_need_reset(old_state) ||
 		   (tp->snd_nxt != tp->write_seq &&
 		    (1 << old_state) & (TCPF_CLOSING | TCPF_LAST_ACK))) {
@@ -3127,9 +3128,9 @@ int tcp_disconnect(struct sock *sk, int flags)
 		 * states
 		 */
 		tcp_send_active_reset(sk, gfp_any());
-		sk->sk_err = ECONNRESET;
+		WRITE_ONCE(sk->sk_err, ECONNRESET);
 	} else if (old_state == TCP_SYN_SENT)
-		sk->sk_err = ECONNRESET;
+		WRITE_ONCE(sk->sk_err, ECONNRESET);
 
 	tcp_clear_xmit_timers(sk);
 	__skb_queue_purge(&sk->sk_receive_queue);
@@ -4735,7 +4736,7 @@ int tcp_abort(struct sock *sk, int err)
 	bh_lock_sock(sk);
 
 	if (!sock_flag(sk, SOCK_DEAD)) {
-		sk->sk_err = err;
+		WRITE_ONCE(sk->sk_err, err);
 		/* This barrier is coupled with smp_rmb() in tcp_poll() */
 		smp_wmb();
 		sk_error_report(sk);
diff --git a/net/ipv4/tcp_input.c b/net/ipv4/tcp_input.c
index 359ffda9b736..b1b4f44d2137 100644
--- a/net/ipv4/tcp_input.c
+++ b/net/ipv4/tcp_input.c
@@ -3922,7 +3922,7 @@ static int tcp_ack(struct sock *sk, const struct sk_buff *skb, int flag)
 	/* We passed data and got it acked, remove any soft error
 	 * log. Something worked...
 	 */
-	sk->sk_err_soft = 0;
+	WRITE_ONCE(sk->sk_err_soft, 0);
 	icsk->icsk_probes_out = 0;
 	tp->rcv_tstamp = tcp_jiffies32;
 	if (!prior_packets)
@@ -4356,9 +4356,26 @@ static inline bool tcp_sequence(const struct tcp_sock *tp, u32 seq, u32 end_seq)
 		!after(seq, tp->rcv_nxt + tcp_receive_window(tp));
 }
 
+
+void tcp_done_with_error(struct sock *sk, int err)
+{
+	/* This barrier is coupled with smp_rmb() in tcp_poll() */
+	WRITE_ONCE(sk->sk_err, err);
+	smp_wmb();
+
+	tcp_write_queue_purge(sk);
+	tcp_done(sk);
+
+	if (!sock_flag(sk, SOCK_DEAD))
+		sk_error_report(sk);
+}
+EXPORT_SYMBOL(tcp_done_with_error);
+
 /* When we get a reset we do this. */
 void tcp_reset(struct sock *sk, struct sk_buff *skb)
 {
+	int err;
+
 	trace_tcp_receive_reset(sk);
 
 	/* mptcp can't tell us to ignore reset pkts,
@@ -4370,24 +4387,17 @@ void tcp_reset(struct sock *sk, struct sk_buff *skb)
 	/* We want the right error as BSD sees it (and indeed as we do). */
 	switch (sk->sk_state) {
 	case TCP_SYN_SENT:
-		sk->sk_err = ECONNREFUSED;
+		err = ECONNREFUSED;
 		break;
 	case TCP_CLOSE_WAIT:
-		sk->sk_err = EPIPE;
+		err = EPIPE;
 		break;
 	case TCP_CLOSE:
 		return;
 	default:
-		sk->sk_err = ECONNRESET;
+		err = ECONNRESET;
 	}
-	/* This barrier is coupled with smp_rmb() in tcp_poll() */
-	smp_wmb();
-
-	tcp_write_queue_purge(sk);
-	tcp_done(sk);
-
-	if (!sock_flag(sk, SOCK_DEAD))
-		sk_error_report(sk);
+	tcp_done_with_error(sk, err);
 }
 
 /*
diff --git a/net/ipv4/tcp_ipv4.c b/net/ipv4/tcp_ipv4.c
index befa848fb820..c64ba4f8ddaa 100644
--- a/net/ipv4/tcp_ipv4.c
+++ b/net/ipv4/tcp_ipv4.c
@@ -368,7 +368,7 @@ void tcp_v4_mtu_reduced(struct sock *sk)
 	 * for the case, if this connection will not able to recover.
 	 */
 	if (mtu < dst_mtu(dst) && ip_dont_fragment(sk, dst))
-		sk->sk_err_soft = EMSGSIZE;
+		WRITE_ONCE(sk->sk_err_soft, EMSGSIZE);
 
 	mtu = dst_mtu(dst);
 
@@ -602,15 +602,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
 
 		ip_icmp_error(sk, skb, err, th->dest, info, (u8 *)th);
 
-		if (!sock_owned_by_user(sk)) {
-			sk->sk_err = err;
-
-			sk_error_report(sk);
-
-			tcp_done(sk);
-		} else {
-			sk->sk_err_soft = err;
-		}
+		if (!sock_owned_by_user(sk))
+			tcp_done_with_error(sk, err);
+		else
+			WRITE_ONCE(sk->sk_err_soft, err);
 		goto out;
 	}
 
@@ -632,10 +627,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
 
 	inet = inet_sk(sk);
 	if (!sock_owned_by_user(sk) && inet->recverr) {
-		sk->sk_err = err;
+		WRITE_ONCE(sk->sk_err, err);
 		sk_error_report(sk);
 	} else	{ /* Only an error on timeout */
-		sk->sk_err_soft = err;
+		WRITE_ONCE(sk->sk_err_soft, err);
 	}
 
 out:
diff --git a/net/ipv4/tcp_output.c b/net/ipv4/tcp_output.c
index 15f814c1e169..19b5a6179c06 100644
--- a/net/ipv4/tcp_output.c
+++ b/net/ipv4/tcp_output.c
@@ -3764,7 +3764,7 @@ static void tcp_connect_init(struct sock *sk)
 	tp->rx_opt.rcv_wscale = rcv_wscale;
 	tp->rcv_ssthresh = tp->rcv_wnd;
 
-	sk->sk_err = 0;
+	WRITE_ONCE(sk->sk_err, 0);
 	sock_reset_flag(sk, SOCK_DONE);
 	tp->snd_wnd = 0;
 	tcp_init_wl(tp, 0);
diff --git a/net/ipv4/tcp_timer.c b/net/ipv4/tcp_timer.c
index 016f9eff49b4..3662b49ce71a 100644
--- a/net/ipv4/tcp_timer.c
+++ b/net/ipv4/tcp_timer.c
@@ -67,11 +67,7 @@ u32 tcp_clamp_probe0_to_user_timeout(const struct sock *sk, u32 when)
 
 static void tcp_write_err(struct sock *sk)
 {
-	sk->sk_err = sk->sk_err_soft ? : ETIMEDOUT;
-	sk_error_report(sk);
-
-	tcp_write_queue_purge(sk);
-	tcp_done(sk);
+	tcp_done_with_error(sk, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT);
 	__NET_INC_STATS(sock_net(sk), LINUX_MIB_TCPABORTONTIMEOUT);
 }
 
@@ -110,7 +106,7 @@ static int tcp_out_of_resources(struct sock *sk, bool do_reset)
 		shift++;
 
 	/* If some dubious ICMP arrived, penalize even more. */
-	if (sk->sk_err_soft)
+	if (READ_ONCE(sk->sk_err_soft))
 		shift++;
 
 	if (tcp_check_oom(sk, shift)) {
@@ -146,7 +142,7 @@ static int tcp_orphan_retries(struct sock *sk, bool alive)
 	int retries = READ_ONCE(sock_net(sk)->ipv4.sysctl_tcp_orphan_retries); /* May be zero. */
 
 	/* We know from an ICMP that something is wrong. */
-	if (sk->sk_err_soft && !alive)
+	if (READ_ONCE(sk->sk_err_soft) && !alive)
 		retries = 0;
 
 	/* However, if socket sent something recently, select some safe
diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c
index 22e246ff910e..4e1e6ef72464 100644
--- a/net/ipv6/addrconf.c
+++ b/net/ipv6/addrconf.c
@@ -1831,7 +1831,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev,
 							    master, &dst,
 							    scores, hiscore_idx);
 
-			if (scores[hiscore_idx].ifa)
+			if (scores[hiscore_idx].ifa &&
+			    scores[hiscore_idx].scopedist >= 0)
 				goto out;
 		}
 
diff --git a/net/ipv6/esp6.c b/net/ipv6/esp6.c
index c2dcb5c613b6..a021c88d3d9b 100644
--- a/net/ipv6/esp6.c
+++ b/net/ipv6/esp6.c
@@ -255,8 +255,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 #else
 static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
 {
-	kfree_skb(skb);
-
+	WARN_ON(1);
 	return -EOPNOTSUPP;
 }
 #endif
diff --git a/net/ipv6/tcp_ipv6.c b/net/ipv6/tcp_ipv6.c
index 4b0e05349862..eb6fc0e2a453 100644
--- a/net/ipv6/tcp_ipv6.c
+++ b/net/ipv6/tcp_ipv6.c
@@ -492,13 +492,10 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
 
 		ipv6_icmp_error(sk, skb, err, th->dest, ntohl(info), (u8 *)th);
 
-		if (!sock_owned_by_user(sk)) {
-			sk->sk_err = err;
-			sk_error_report(sk);		/* Wake people up to see the error (see connect in sock.c) */
-
-			tcp_done(sk);
-		} else
-			sk->sk_err_soft = err;
+		if (!sock_owned_by_user(sk))
+			tcp_done_with_error(sk, err);
+		else
+			WRITE_ONCE(sk->sk_err_soft, err);
 		goto out;
 	case TCP_LISTEN:
 		break;
@@ -512,11 +509,11 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
 	}
 
 	if (!sock_owned_by_user(sk) && np->recverr) {
-		sk->sk_err = err;
+		WRITE_ONCE(sk->sk_err, err);
 		sk_error_report(sk);
-	} else
-		sk->sk_err_soft = err;
-
+	} else {
+		WRITE_ONCE(sk->sk_err_soft, err);
+	}
 out:
 	bh_unlock_sock(sk);
 	sock_put(sk);
diff --git a/net/mac80211/cfg.c b/net/mac80211/cfg.c
index 2c60fc165801..1ce8fefd7f0d 100644
--- a/net/mac80211/cfg.c
+++ b/net/mac80211/cfg.c
@@ -1775,7 +1775,7 @@ static int sta_link_apply_parameters(struct ieee80211_local *local,
 					      sband->band);
 	}
 
-	ieee80211_sta_set_rx_nss(link_sta);
+	ieee80211_sta_init_nss(link_sta);
 
 	return ret;
 }
@@ -2577,6 +2577,17 @@ static int ieee80211_change_bss(struct wiphy *wiphy,
 	if (!sband)
 		return -EINVAL;
 
+	if (params->basic_rates) {
+		if (!ieee80211_parse_bitrates(sdata->vif.bss_conf.chandef.width,
+					      wiphy->bands[sband->band],
+					      params->basic_rates,
+					      params->basic_rates_len,
+					      &sdata->vif.bss_conf.basic_rates))
+			return -EINVAL;
+		changed |= BSS_CHANGED_BASIC_RATES;
+		ieee80211_check_rate_mask(&sdata->deflink);
+	}
+
 	if (params->use_cts_prot >= 0) {
 		sdata->vif.bss_conf.use_cts_prot = params->use_cts_prot;
 		changed |= BSS_CHANGED_ERP_CTS_PROT;
@@ -2600,16 +2611,6 @@ static int ieee80211_change_bss(struct wiphy *wiphy,
 		changed |= BSS_CHANGED_ERP_SLOT;
 	}
 
-	if (params->basic_rates) {
-		ieee80211_parse_bitrates(sdata->vif.bss_conf.chandef.width,
-					 wiphy->bands[sband->band],
-					 params->basic_rates,
-					 params->basic_rates_len,
-					 &sdata->vif.bss_conf.basic_rates);
-		changed |= BSS_CHANGED_BASIC_RATES;
-		ieee80211_check_rate_mask(&sdata->deflink);
-	}
-
 	if (params->ap_isolate >= 0) {
 		if (params->ap_isolate)
 			sdata->flags |= IEEE80211_SDATA_DONT_BRIDGE_PACKETS;
diff --git a/net/mac80211/ieee80211_i.h b/net/mac80211/ieee80211_i.h
index 0d8a9bb92538..709eb7bfcf19 100644
--- a/net/mac80211/ieee80211_i.h
+++ b/net/mac80211/ieee80211_i.h
@@ -2071,7 +2071,7 @@ enum ieee80211_sta_rx_bandwidth
 ieee80211_sta_cap_rx_bw(struct link_sta_info *link_sta);
 enum ieee80211_sta_rx_bandwidth
 ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta);
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta);
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta);
 enum ieee80211_sta_rx_bandwidth
 ieee80211_chan_width_to_rx_bw(enum nl80211_chan_width width);
 enum nl80211_chan_width
diff --git a/net/mac80211/rate.c b/net/mac80211/rate.c
index a2bc9c5d92b8..3cf252418bd3 100644
--- a/net/mac80211/rate.c
+++ b/net/mac80211/rate.c
@@ -37,7 +37,7 @@ void rate_control_rate_init(struct sta_info *sta)
 	struct ieee80211_supported_band *sband;
 	struct ieee80211_chanctx_conf *chanctx_conf;
 
-	ieee80211_sta_set_rx_nss(&sta->deflink);
+	ieee80211_sta_init_nss(&sta->deflink);
 
 	if (!ref)
 		return;
diff --git a/net/mac80211/sta_info.h b/net/mac80211/sta_info.h
index 2517ea714dc4..4809756a43dd 100644
--- a/net/mac80211/sta_info.h
+++ b/net/mac80211/sta_info.h
@@ -3,7 +3,7 @@
  * Copyright 2002-2005, Devicescape Software, Inc.
  * Copyright 2013-2014  Intel Mobile Communications GmbH
  * Copyright(c) 2015-2017 Intel Deutschland GmbH
- * Copyright(c) 2020-2022 Intel Corporation
+ * Copyright(c) 2020-2024 Intel Corporation
  */
 
 #ifndef STA_INFO_H
@@ -485,6 +485,8 @@ struct ieee80211_fragment_cache {
  *	same for non-MLD STA. This is used as key for searching link STA
  * @link_id: Link ID uniquely identifying the link STA. This is 0 for non-MLD
  *	and set to the corresponding vif LinkId for MLD STA
+ * @op_mode_nss: NSS limit as set by operating mode notification, or 0
+ * @capa_nss: NSS limit as determined by local and peer capabilities
  * @link_hash_node: hash node for rhashtable
  * @sta: Points to the STA info
  * @gtk: group keys negotiated with this station, if any
@@ -520,6 +522,8 @@ struct link_sta_info {
 	u8 addr[ETH_ALEN];
 	u8 link_id;
 
+	u8 op_mode_nss, capa_nss;
+
 	struct rhlist_head link_hash_node;
 
 	struct sta_info *sta;
diff --git a/net/mac80211/vht.c b/net/mac80211/vht.c
index f7526be8a1c7..bc13b1419981 100644
--- a/net/mac80211/vht.c
+++ b/net/mac80211/vht.c
@@ -4,7 +4,7 @@
  *
  * Portions of this file
  * Copyright(c) 2015 - 2016 Intel Deutschland GmbH
- * Copyright (C) 2018 - 2023 Intel Corporation
+ * Copyright (C) 2018 - 2024 Intel Corporation
  */
 
 #include <linux/ieee80211.h>
@@ -541,15 +541,11 @@ ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta)
 	return bw;
 }
 
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta)
 {
 	u8 ht_rx_nss = 0, vht_rx_nss = 0, he_rx_nss = 0, eht_rx_nss = 0, rx_nss;
 	bool support_160;
 
-	/* if we received a notification already don't overwrite it */
-	if (link_sta->pub->rx_nss)
-		return;
-
 	if (link_sta->pub->eht_cap.has_eht) {
 		int i;
 		const u8 *rx_nss_mcs = (void *)&link_sta->pub->eht_cap.eht_mcs_nss_supp;
@@ -627,7 +623,15 @@ void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
 	rx_nss = max(vht_rx_nss, ht_rx_nss);
 	rx_nss = max(he_rx_nss, rx_nss);
 	rx_nss = max(eht_rx_nss, rx_nss);
-	link_sta->pub->rx_nss = max_t(u8, 1, rx_nss);
+	rx_nss = max_t(u8, 1, rx_nss);
+	link_sta->capa_nss = rx_nss;
+
+	/* that shouldn't be set yet, but we can handle it anyway */
+	if (link_sta->op_mode_nss)
+		link_sta->pub->rx_nss =
+			min_t(u8, rx_nss, link_sta->op_mode_nss);
+	else
+		link_sta->pub->rx_nss = rx_nss;
 }
 
 u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
@@ -647,11 +651,20 @@ u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
 	nss >>= IEEE80211_OPMODE_NOTIF_RX_NSS_SHIFT;
 	nss += 1;
 
-	if (link_sta->pub->rx_nss != nss) {
-		link_sta->pub->rx_nss = nss;
-		sta_opmode.rx_nss = nss;
-		changed |= IEEE80211_RC_NSS_CHANGED;
-		sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+	if (link_sta->op_mode_nss != nss) {
+		if (nss <= link_sta->capa_nss) {
+			link_sta->op_mode_nss = nss;
+
+			if (nss != link_sta->pub->rx_nss) {
+				link_sta->pub->rx_nss = nss;
+				changed |= IEEE80211_RC_NSS_CHANGED;
+				sta_opmode.rx_nss = link_sta->pub->rx_nss;
+				sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+			}
+		} else {
+			pr_warn_ratelimited("Ignoring NSS change in VHT Operating Mode Notification from %pM with invalid nss %d",
+					    link_sta->pub->addr, nss);
+		}
 	}
 
 	switch (opmode & IEEE80211_OPMODE_NOTIF_CHANWIDTH_MASK) {
diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c
index 1e689c714127..83e452916403 100644
--- a/net/netfilter/ipvs/ip_vs_proto_sctp.c
+++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c
@@ -126,7 +126,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
 	if (sctph->source != cp->vport || payload_csum ||
 	    skb->ip_summed == CHECKSUM_PARTIAL) {
 		sctph->source = cp->vport;
-		if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+		if (!skb_is_gso(skb))
 			sctp_nat_csum(skb, sctph, sctphoff);
 	} else {
 		skb->ip_summed = CHECKSUM_UNNECESSARY;
@@ -175,7 +175,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
 	    (skb->ip_summed == CHECKSUM_PARTIAL &&
 	     !(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) {
 		sctph->dest = cp->dport;
-		if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+		if (!skb_is_gso(skb))
 			sctp_nat_csum(skb, sctph, sctphoff);
 	} else if (skb->ip_summed != CHECKSUM_PARTIAL) {
 		skb->ip_summed = CHECKSUM_UNNECESSARY;
diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c
index 9ee8abd3e4b1..9672b0e00d6b 100644
--- a/net/netfilter/nf_conntrack_netlink.c
+++ b/net/netfilter/nf_conntrack_netlink.c
@@ -3415,7 +3415,8 @@ static int ctnetlink_del_expect(struct sk_buff *skb,
 
 		if (cda[CTA_EXPECT_ID]) {
 			__be32 id = nla_get_be32(cda[CTA_EXPECT_ID]);
-			if (ntohl(id) != (u32)(unsigned long)exp) {
+
+			if (id != nf_expect_get_id(exp)) {
 				nf_ct_expect_put(exp);
 				return -ENOENT;
 			}
diff --git a/net/netfilter/nft_set_pipapo.c b/net/netfilter/nft_set_pipapo.c
index a56ed216c223..d9c1c467ea68 100644
--- a/net/netfilter/nft_set_pipapo.c
+++ b/net/netfilter/nft_set_pipapo.c
@@ -360,7 +360,7 @@
  * Return: -1 on no match, bit position on 'match_only', 0 otherwise.
  */
 int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
-		  union nft_pipapo_map_bucket *mt, bool match_only)
+		  const union nft_pipapo_map_bucket *mt, bool match_only)
 {
 	unsigned long bitset;
 	int k, ret = -1;
@@ -412,9 +412,9 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
 	struct nft_pipapo_scratch *scratch;
 	unsigned long *res_map, *fill_map;
 	u8 genmask = nft_genmask_cur(net);
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	const u8 *rp = (const u8 *)key;
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
 	bool map_index;
 	int i;
 
@@ -432,7 +432,7 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
 	res_map  = scratch->map + (map_index ? m->bsize_max : 0);
 	fill_map = scratch->map + (map_index ? 0 : m->bsize_max);
 
-	memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+	pipapo_resmap_init(m, res_map);
 
 	nft_pipapo_for_each_field(f, i, m) {
 		bool last = i == m->field_count - 1;
@@ -519,11 +519,13 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
 {
 	struct nft_pipapo_elem *ret = ERR_PTR(-ENOENT);
 	struct nft_pipapo *priv = nft_set_priv(set);
-	struct nft_pipapo_match *m = priv->clone;
 	unsigned long *res_map, *fill_map = NULL;
-	struct nft_pipapo_field *f;
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	int i;
 
+	m = priv->clone;
+
 	res_map = kmalloc_array(m->bsize_max, sizeof(*res_map), GFP_ATOMIC);
 	if (!res_map) {
 		ret = ERR_PTR(-ENOMEM);
@@ -536,7 +538,7 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
 		goto out;
 	}
 
-	memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+	pipapo_resmap_init(m, res_map);
 
 	nft_pipapo_for_each_field(f, i, m) {
 		bool last = i == m->field_count - 1;
@@ -1595,7 +1597,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m)
 
 	while ((rules_f0 = pipapo_rules_same_key(m->f, first_rule))) {
 		union nft_pipapo_map_bucket rulemap[NFT_PIPAPO_MAX_FIELDS];
-		struct nft_pipapo_field *f;
+		const struct nft_pipapo_field *f;
 		int i, start, rules_fx;
 
 		start = first_rule;
@@ -2041,8 +2043,8 @@ static void nft_pipapo_walk(const struct nft_ctx *ctx, struct nft_set *set,
 {
 	struct nft_pipapo *priv = nft_set_priv(set);
 	struct net *net = read_pnet(&set->net);
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	int i, r;
 
 	rcu_read_lock();
diff --git a/net/netfilter/nft_set_pipapo.h b/net/netfilter/nft_set_pipapo.h
index 30a3d092cd84..519a2e6dc206 100644
--- a/net/netfilter/nft_set_pipapo.h
+++ b/net/netfilter/nft_set_pipapo.h
@@ -185,7 +185,7 @@ struct nft_pipapo_elem {
 };
 
 int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
-		  union nft_pipapo_map_bucket *mt, bool match_only);
+		  const union nft_pipapo_map_bucket *mt, bool match_only);
 
 /**
  * pipapo_and_field_buckets_4bit() - Intersect 4-bit buckets
@@ -193,7 +193,7 @@ int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
  * @dst:	Area to store result
  * @data:	Input data selecting table buckets
  */
-static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_4bit(const struct nft_pipapo_field *f,
 						 unsigned long *dst,
 						 const u8 *data)
 {
@@ -221,7 +221,7 @@ static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
  * @dst:	Area to store result
  * @data:	Input data selecting table buckets
  */
-static inline void pipapo_and_field_buckets_8bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_8bit(const struct nft_pipapo_field *f,
 						 unsigned long *dst,
 						 const u8 *data)
 {
@@ -285,4 +285,25 @@ static u64 pipapo_estimate_size(const struct nft_set_desc *desc)
 	return size;
 }
 
+/**
+ * pipapo_resmap_init() - Initialise result map before first use
+ * @m:		Matching data, including mapping table
+ * @res_map:	Result map
+ *
+ * Initialize all bits covered by the first field to one, so that after
+ * the first step, only the matching bits of the first bit group remain.
+ *
+ * If other fields have a large bitmap, set remainder of res_map to 0.
+ */
+static inline void pipapo_resmap_init(const struct nft_pipapo_match *m, unsigned long *res_map)
+{
+	const struct nft_pipapo_field *f = m->f;
+	int i;
+
+	for (i = 0; i < f->bsize; i++)
+		res_map[i] = ULONG_MAX;
+
+	for (i = f->bsize; i < m->bsize_max; i++)
+		res_map[i] = 0ul;
+}
 #endif /* _NFT_SET_PIPAPO_H */
diff --git a/net/netfilter/nft_set_pipapo_avx2.c b/net/netfilter/nft_set_pipapo_avx2.c
index a3a8ddca9918..b8d3c3213efe 100644
--- a/net/netfilter/nft_set_pipapo_avx2.c
+++ b/net/netfilter/nft_set_pipapo_avx2.c
@@ -212,8 +212,9 @@ static int nft_pipapo_avx2_refill(int offset, unsigned long *map,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	u8 pg[2] = { pkt[0] >> 4, pkt[0] & 0xf };
@@ -274,8 +275,9 @@ static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	u8 pg[4] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf };
@@ -350,8 +352,9 @@ static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	u8 pg[8] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		      pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -445,8 +448,9 @@ static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
-				        struct nft_pipapo_field *f, int offset,
-				        const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	u8 pg[12] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		       pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -534,8 +538,9 @@ static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	u8 pg[32] = {  pkt[0] >> 4,  pkt[0] & 0xf,  pkt[1] >> 4,  pkt[1] & 0xf,
 		       pkt[2] >> 4,  pkt[2] & 0xf,  pkt[3] >> 4,  pkt[3] & 0xf,
@@ -669,8 +674,9 @@ static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -726,8 +732,9 @@ static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -790,8 +797,9 @@ static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -865,8 +873,9 @@ static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
-				       struct nft_pipapo_field *f, int offset,
-				       const u8 *pkt, bool first, bool last)
+				       const struct nft_pipapo_field *f,
+				       int offset, const u8 *pkt,
+				       bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -950,8 +959,9 @@ static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
  * word index to be checked next (i.e. first filled word).
  */
 static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
 	unsigned long *lt = f->lt, bsize = f->bsize;
@@ -1026,6 +1036,7 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
 
 /**
  * nft_pipapo_avx2_lookup_slow() - Fallback function for uncommon field sizes
+ * @mdata:	Matching data, including mapping table
  * @map:	Previous match result, used as initial bitmap
  * @fill:	Destination bitmap to be filled with current match result
  * @f:		Field, containing lookup and mapping tables
@@ -1041,15 +1052,17 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
  * Return: -1 on no match, rule index of match if @last, otherwise first long
  * word index to be checked next (i.e. first filled word).
  */
-static int nft_pipapo_avx2_lookup_slow(unsigned long *map, unsigned long *fill,
-					struct nft_pipapo_field *f, int offset,
-					const u8 *pkt, bool first, bool last)
+static int nft_pipapo_avx2_lookup_slow(const struct nft_pipapo_match *mdata,
+					unsigned long *map, unsigned long *fill,
+					const struct nft_pipapo_field *f,
+					int offset, const u8 *pkt,
+					bool first, bool last)
 {
 	unsigned long bsize = f->bsize;
 	int i, ret = -1, b;
 
 	if (first)
-		memset(map, 0xff, bsize * sizeof(*map));
+		pipapo_resmap_init(mdata, map);
 
 	for (i = offset; i < bsize; i++) {
 		if (f->bb == 8)
@@ -1119,15 +1132,21 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	struct nft_pipapo *priv = nft_set_priv(set);
 	struct nft_pipapo_scratch *scratch;
 	u8 genmask = nft_genmask_cur(net);
+	const struct nft_pipapo_match *m;
+	const struct nft_pipapo_field *f;
 	const u8 *rp = (const u8 *)key;
-	struct nft_pipapo_match *m;
-	struct nft_pipapo_field *f;
 	unsigned long *res, *fill;
 	bool map_index;
 	int i, ret = 0;
 
-	if (unlikely(!irq_fpu_usable()))
-		return nft_pipapo_lookup(net, set, key, ext);
+	local_bh_disable();
+
+	if (unlikely(!irq_fpu_usable())) {
+		bool fallback_res = nft_pipapo_lookup(net, set, key, ext);
+
+		local_bh_enable();
+		return fallback_res;
+	}
 
 	m = rcu_dereference(priv->match);
 
@@ -1142,6 +1161,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	scratch = *raw_cpu_ptr(m->scratch);
 	if (unlikely(!scratch)) {
 		kernel_fpu_end();
+		local_bh_enable();
 		return false;
 	}
 
@@ -1175,7 +1195,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 			} else if (f->groups == 16) {
 				NFT_SET_PIPAPO_AVX2_LOOKUP(8, 16);
 			} else {
-				ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+				ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
 								  ret, rp,
 								  first, last);
 			}
@@ -1191,7 +1211,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 			} else if (f->groups == 32) {
 				NFT_SET_PIPAPO_AVX2_LOOKUP(4, 32);
 			} else {
-				ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+				ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
 								  ret, rp,
 								  first, last);
 			}
@@ -1222,6 +1242,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
 	if (i % 2)
 		scratch->map_index = !map_index;
 	kernel_fpu_end();
+	local_bh_enable();
 
 	return ret >= 0;
 }
diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c
index c48cb7664c55..c9c813f731c6 100644
--- a/net/packet/af_packet.c
+++ b/net/packet/af_packet.c
@@ -541,6 +541,61 @@ static void *packet_current_frame(struct packet_sock *po,
 	return packet_lookup_frame(po, rb, rb->head, status);
 }
 
+static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev)
+{
+	u8 *skb_orig_data = skb->data;
+	int skb_orig_len = skb->len;
+	struct vlan_hdr vhdr, *vh;
+	unsigned int header_len;
+
+	if (!dev)
+		return 0;
+
+	/* In the SOCK_DGRAM scenario, skb data starts at the network
+	 * protocol, which is after the VLAN headers. The outer VLAN
+	 * header is at the hard_header_len offset in non-variable
+	 * length link layer headers. If it's a VLAN device, the
+	 * min_header_len should be used to exclude the VLAN header
+	 * size.
+	 */
+	if (dev->min_header_len == dev->hard_header_len)
+		header_len = dev->hard_header_len;
+	else if (is_vlan_dev(dev))
+		header_len = dev->min_header_len;
+	else
+		return 0;
+
+	skb_push(skb, skb->data - skb_mac_header(skb));
+	vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr);
+	if (skb_orig_data != skb->data) {
+		skb->data = skb_orig_data;
+		skb->len = skb_orig_len;
+	}
+	if (unlikely(!vh))
+		return 0;
+
+	return ntohs(vh->h_vlan_TCI);
+}
+
+static __be16 vlan_get_protocol_dgram(struct sk_buff *skb)
+{
+	__be16 proto = skb->protocol;
+
+	if (unlikely(eth_type_vlan(proto))) {
+		u8 *skb_orig_data = skb->data;
+		int skb_orig_len = skb->len;
+
+		skb_push(skb, skb->data - skb_mac_header(skb));
+		proto = __vlan_get_protocol(skb, proto, NULL);
+		if (skb_orig_data != skb->data) {
+			skb->data = skb_orig_data;
+			skb->len = skb_orig_len;
+		}
+	}
+
+	return proto;
+}
+
 static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc)
 {
 	del_timer_sync(&pkc->retire_blk_timer);
@@ -1010,10 +1065,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc,
 static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc,
 			struct tpacket3_hdr *ppd)
 {
+	struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc);
+
 	if (skb_vlan_tag_present(pkc->skb)) {
 		ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb);
 		ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto);
 		ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+	} else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) {
+		ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev);
+		ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol);
+		ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
 	} else {
 		ppd->hv1.tp_vlan_tci = 0;
 		ppd->hv1.tp_vlan_tpid = 0;
@@ -2431,6 +2492,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
 			h.h2->tp_vlan_tci = skb_vlan_tag_get(skb);
 			h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto);
 			status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+		} else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+			h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev);
+			h.h2->tp_vlan_tpid = ntohs(skb->protocol);
+			status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
 		} else {
 			h.h2->tp_vlan_tci = 0;
 			h.h2->tp_vlan_tpid = 0;
@@ -2460,7 +2525,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
 	sll->sll_halen = dev_parse_header(skb, sll->sll_addr);
 	sll->sll_family = AF_PACKET;
 	sll->sll_hatype = dev->type;
-	sll->sll_protocol = skb->protocol;
+	sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ?
+		vlan_get_protocol_dgram(skb) : skb->protocol;
 	sll->sll_pkttype = skb->pkt_type;
 	if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV)))
 		sll->sll_ifindex = orig_dev->ifindex;
@@ -3481,7 +3547,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
 		/* Original length was stored in sockaddr_ll fields */
 		origlen = PACKET_SKB_CB(skb)->sa.origlen;
 		sll->sll_family = AF_PACKET;
-		sll->sll_protocol = skb->protocol;
+		sll->sll_protocol = (sock->type == SOCK_DGRAM) ?
+			vlan_get_protocol_dgram(skb) : skb->protocol;
 	}
 
 	sock_recv_cmsgs(msg, sk, skb);
@@ -3536,6 +3603,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
 			aux.tp_vlan_tci = skb_vlan_tag_get(skb);
 			aux.tp_vlan_tpid = ntohs(skb->vlan_proto);
 			aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+		} else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+			struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll;
+			struct net_device *dev;
+
+			rcu_read_lock();
+			dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex);
+			if (dev) {
+				aux.tp_vlan_tci = vlan_get_tci(skb, dev);
+				aux.tp_vlan_tpid = ntohs(skb->protocol);
+				aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+			} else {
+				aux.tp_vlan_tci = 0;
+				aux.tp_vlan_tpid = 0;
+			}
+			rcu_read_unlock();
 		} else {
 			aux.tp_vlan_tci = 0;
 			aux.tp_vlan_tpid = 0;
diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c
index 64b6dd439938..10d79cb55528 100644
--- a/net/smc/smc_core.c
+++ b/net/smc/smc_core.c
@@ -1959,7 +1959,6 @@ int smc_conn_create(struct smc_sock *smc, struct smc_init_info *ini)
  */
 static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
 {
-	const unsigned int max_scat = SG_MAX_SINGLE_ALLOC * PAGE_SIZE;
 	u8 compressed;
 
 	if (size <= SMC_BUF_MIN_SIZE)
@@ -1969,9 +1968,11 @@ static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
 	compressed = min_t(u8, ilog2(size) + 1,
 			   is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES);
 
+#ifdef CONFIG_ARCH_NO_SG_CHAIN
 	if (!is_smcd && is_rmb)
 		/* RMBs are backed by & limited to max size of scatterlists */
-		compressed = min_t(u8, compressed, ilog2(max_scat >> 14));
+		compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14));
+#endif
 
 	return compressed;
 }
diff --git a/net/sunrpc/auth_gss/gss_krb5_keys.c b/net/sunrpc/auth_gss/gss_krb5_keys.c
index 726c076950c0..fc4639687c0f 100644
--- a/net/sunrpc/auth_gss/gss_krb5_keys.c
+++ b/net/sunrpc/auth_gss/gss_krb5_keys.c
@@ -161,7 +161,7 @@ u32 krb5_derive_key(const struct gss_krb5_enctype *gk5e,
 	if (IS_ERR(cipher))
 		goto err_return;
 	if (crypto_sync_skcipher_setkey(cipher, inkey->data, inkey->len))
-		goto err_return;
+		goto err_free_cipher;
 
 	/* allocate and set up buffers */
 
diff --git a/net/sunrpc/clnt.c b/net/sunrpc/clnt.c
index 1dbad41c4614..b6529a9d37d3 100644
--- a/net/sunrpc/clnt.c
+++ b/net/sunrpc/clnt.c
@@ -2296,12 +2296,13 @@ call_transmit_status(struct rpc_task *task)
 		task->tk_action = call_transmit;
 		task->tk_status = 0;
 		break;
-	case -ECONNREFUSED:
 	case -EHOSTDOWN:
 	case -ENETDOWN:
 	case -EHOSTUNREACH:
 	case -ENETUNREACH:
 	case -EPERM:
+		break;
+	case -ECONNREFUSED:
 		if (RPC_IS_SOFTCONN(task)) {
 			if (!task->tk_msg.rpc_proc->p_proc)
 				trace_xprt_ping(task->tk_xprt,
diff --git a/net/sunrpc/xprtrdma/frwr_ops.c b/net/sunrpc/xprtrdma/frwr_ops.c
index ffbf99894970..47f33bb7bff8 100644
--- a/net/sunrpc/xprtrdma/frwr_ops.c
+++ b/net/sunrpc/xprtrdma/frwr_ops.c
@@ -92,7 +92,8 @@ static void frwr_mr_put(struct rpcrdma_mr *mr)
 	rpcrdma_mr_push(mr, &mr->mr_req->rl_free_mrs);
 }
 
-/* frwr_reset - Place MRs back on the free list
+/**
+ * frwr_reset - Place MRs back on @req's free list
  * @req: request to reset
  *
  * Used after a failed marshal. For FRWR, this means the MRs
diff --git a/net/sunrpc/xprtrdma/verbs.c b/net/sunrpc/xprtrdma/verbs.c
index 4f71627ba39c..cb909329a503 100644
--- a/net/sunrpc/xprtrdma/verbs.c
+++ b/net/sunrpc/xprtrdma/verbs.c
@@ -897,6 +897,8 @@ static int rpcrdma_reqs_setup(struct rpcrdma_xprt *r_xprt)
 
 static void rpcrdma_req_reset(struct rpcrdma_req *req)
 {
+	struct rpcrdma_mr *mr;
+
 	/* Credits are valid for only one connection */
 	req->rl_slot.rq_cong = 0;
 
@@ -906,7 +908,19 @@ static void rpcrdma_req_reset(struct rpcrdma_req *req)
 	rpcrdma_regbuf_dma_unmap(req->rl_sendbuf);
 	rpcrdma_regbuf_dma_unmap(req->rl_recvbuf);
 
-	frwr_reset(req);
+	/* The verbs consumer can't know the state of an MR on the
+	 * req->rl_registered list unless a successful completion
+	 * has occurred, so they cannot be re-used.
+	 */
+	while ((mr = rpcrdma_mr_pop(&req->rl_registered))) {
+		struct rpcrdma_buffer *buf = &mr->mr_xprt->rx_buf;
+
+		spin_lock(&buf->rb_lock);
+		list_del(&mr->mr_all);
+		spin_unlock(&buf->rb_lock);
+
+		frwr_mr_release(mr);
+	}
 }
 
 /* ASSUMPTION: the rb_allreqs list is stable for the duration,
diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c
index 0a85244fd618..73e461dc12d7 100644
--- a/net/tipc/udp_media.c
+++ b/net/tipc/udp_media.c
@@ -135,8 +135,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size)
 		snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port));
 	else if (ntohs(ua->proto) == ETH_P_IPV6)
 		snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port));
-	else
+	else {
 		pr_err("Invalid UDP media address\n");
+		return 1;
+	}
+
 	return 0;
 }
 
diff --git a/net/unix/af_unix.c b/net/unix/af_unix.c
index 3905cdcaa518..db71f35b67b8 100644
--- a/net/unix/af_unix.c
+++ b/net/unix/af_unix.c
@@ -2710,10 +2710,49 @@ static struct sk_buff *manage_oob(struct sk_buff *skb, struct sock *sk,
 
 static int unix_stream_read_skb(struct sock *sk, skb_read_actor_t recv_actor)
 {
+	struct unix_sock *u = unix_sk(sk);
+	struct sk_buff *skb;
+	int err;
+
 	if (unlikely(READ_ONCE(sk->sk_state) != TCP_ESTABLISHED))
 		return -ENOTCONN;
 
-	return unix_read_skb(sk, recv_actor);
+	mutex_lock(&u->iolock);
+	skb = skb_recv_datagram(sk, MSG_DONTWAIT, &err);
+	mutex_unlock(&u->iolock);
+	if (!skb)
+		return err;
+
+#if IS_ENABLED(CONFIG_AF_UNIX_OOB)
+	if (unlikely(skb == READ_ONCE(u->oob_skb))) {
+		bool drop = false;
+
+		unix_state_lock(sk);
+
+		if (sock_flag(sk, SOCK_DEAD)) {
+			unix_state_unlock(sk);
+			kfree_skb(skb);
+			return -ECONNRESET;
+		}
+
+		spin_lock(&sk->sk_receive_queue.lock);
+		if (likely(skb == u->oob_skb)) {
+			WRITE_ONCE(u->oob_skb, NULL);
+			drop = true;
+		}
+		spin_unlock(&sk->sk_receive_queue.lock);
+
+		unix_state_unlock(sk);
+
+		if (drop) {
+			WARN_ON_ONCE(skb_unref(skb));
+			kfree_skb(skb);
+			return -EAGAIN;
+		}
+	}
+#endif
+
+	return recv_actor(sk, skb);
 }
 
 static int unix_stream_read_generic(struct unix_stream_read_state *state,
diff --git a/net/unix/unix_bpf.c b/net/unix/unix_bpf.c
index bd84785bf8d6..bca2d86ba97d 100644
--- a/net/unix/unix_bpf.c
+++ b/net/unix/unix_bpf.c
@@ -54,6 +54,9 @@ static int unix_bpf_recvmsg(struct sock *sk, struct msghdr *msg,
 	struct sk_psock *psock;
 	int copied;
 
+	if (flags & MSG_OOB)
+		return -EOPNOTSUPP;
+
 	if (!len)
 		return 0;
 
diff --git a/net/wireless/util.c b/net/wireless/util.c
index 73b3648e1b4c..1665320d2214 100644
--- a/net/wireless/util.c
+++ b/net/wireless/util.c
@@ -1373,7 +1373,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
 		  5120, /*  0.833333... */
 	};
 	u32 rates_160M[3] = { 960777777, 907400000, 816666666 };
-	u32 rates_969[3] =  { 480388888, 453700000, 408333333 };
+	u32 rates_996[3] =  { 480388888, 453700000, 408333333 };
 	u32 rates_484[3] =  { 229411111, 216666666, 195000000 };
 	u32 rates_242[3] =  { 114711111, 108333333,  97500000 };
 	u32 rates_106[3] =  {  40000000,  37777777,  34000000 };
@@ -1393,12 +1393,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
 	if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8))
 		return 0;
 
-	if (rate->bw == RATE_INFO_BW_160)
+	if (rate->bw == RATE_INFO_BW_160 ||
+	    (rate->bw == RATE_INFO_BW_HE_RU &&
+	     rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996))
 		result = rates_160M[rate->he_gi];
 	else if (rate->bw == RATE_INFO_BW_80 ||
 		 (rate->bw == RATE_INFO_BW_HE_RU &&
 		  rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996))
-		result = rates_969[rate->he_gi];
+		result = rates_996[rate->he_gi];
 	else if (rate->bw == RATE_INFO_BW_40 ||
 		 (rate->bw == RATE_INFO_BW_HE_RU &&
 		  rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484))
diff --git a/scripts/Makefile.lib b/scripts/Makefile.lib
index 3aa384cec76b..d236e5658f9b 100644
--- a/scripts/Makefile.lib
+++ b/scripts/Makefile.lib
@@ -382,8 +382,12 @@ cmd_dtc = $(HOSTCC) -E $(dtc_cpp_flags) -x assembler-with-cpp -o $(dtc-tmp) $< ;
 		-d $(depfile).dtc.tmp $(dtc-tmp) ; \
 	cat $(depfile).pre.tmp $(depfile).dtc.tmp > $(depfile)
 
+# NOTE:
+# Do not replace $(filter %.dtb %.dtbo, $^) with $(real-prereqs). When a single
+# DTB is turned into a multi-blob DTB, $^ will contain header file dependencies
+# recorded in the .*.cmd file.
 quiet_cmd_fdtoverlay = DTOVL   $@
-      cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(real-prereqs)
+      cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(filter %.dtb %.dtbo, $^)
 
 $(multi-dtb-y): FORCE
 	$(call if_changed,fdtoverlay)
diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh
index 825c75c5b715..9459ca4f0f11 100755
--- a/scripts/gcc-x86_32-has-stack-protector.sh
+++ b/scripts/gcc-x86_32-has-stack-protector.sh
@@ -5,4 +5,4 @@
 # -mstack-protector-guard-reg, added by
 # https://gcc.gnu.org/bugzilla/show_bug.cgi?id=81708
 
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh
index 75e4e22b986a..f680bb01aeeb 100755
--- a/scripts/gcc-x86_64-has-stack-protector.sh
+++ b/scripts/gcc-x86_64-has-stack-protector.sh
@@ -1,4 +1,4 @@
 #!/bin/sh
 # SPDX-License-Identifier: GPL-2.0
 
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
diff --git a/security/apparmor/lsm.c b/security/apparmor/lsm.c
index 1e2f40db15c5..97389b9c4129 100644
--- a/security/apparmor/lsm.c
+++ b/security/apparmor/lsm.c
@@ -1081,6 +1081,13 @@ static int apparmor_socket_sock_rcv_skb(struct sock *sk, struct sk_buff *skb)
 	if (!skb->secmark)
 		return 0;
 
+	/*
+	 * If reach here before socket_post_create hook is called, in which
+	 * case label is null, drop the packet.
+	 */
+	if (!ctx->label)
+		return -EACCES;
+
 	return apparmor_secmark_check(ctx->label, OP_RECVMSG, AA_MAY_RECEIVE,
 				      skb->secmark, sk);
 }
diff --git a/security/apparmor/policy.c b/security/apparmor/policy.c
index c7b84fb56841..4ee5a450d118 100644
--- a/security/apparmor/policy.c
+++ b/security/apparmor/policy.c
@@ -187,7 +187,7 @@ static void aa_free_data(void *ptr, void *arg)
 {
 	struct aa_data *data = ptr;
 
-	kfree_sensitive(data->data);
+	kvfree_sensitive(data->data, data->size);
 	kfree_sensitive(data->key);
 	kfree_sensitive(data);
 }
diff --git a/security/apparmor/policy_unpack.c b/security/apparmor/policy_unpack.c
index 633e778ec369..17601235ff98 100644
--- a/security/apparmor/policy_unpack.c
+++ b/security/apparmor/policy_unpack.c
@@ -898,6 +898,7 @@ static struct aa_profile *unpack_profile(struct aa_ext *e, char **ns_name)
 
 			if (rhashtable_insert_fast(profile->data, &data->head,
 						   profile->data->p)) {
+				kvfree_sensitive(data->data, data->size);
 				kfree_sensitive(data->key);
 				kfree_sensitive(data);
 				info = "failed to insert data to table";
diff --git a/security/keys/keyctl.c b/security/keys/keyctl.c
index 19be69fa4d05..aa1dc43b16dd 100644
--- a/security/keys/keyctl.c
+++ b/security/keys/keyctl.c
@@ -1694,7 +1694,7 @@ long keyctl_session_to_parent(void)
 		goto unlock;
 
 	/* cancel an already pending keyring replacement */
-	oldwork = task_work_cancel(parent, key_change_session_keyring);
+	oldwork = task_work_cancel_func(parent, key_change_session_keyring);
 
 	/* the replacement session keyring is applied just prior to userspace
 	 * restarting */
diff --git a/security/landlock/cred.c b/security/landlock/cred.c
index ec6c37f04a19..e215607fd46c 100644
--- a/security/landlock/cred.c
+++ b/security/landlock/cred.c
@@ -14,8 +14,8 @@
 #include "ruleset.h"
 #include "setup.h"
 
-static int hook_cred_prepare(struct cred *const new,
-			     const struct cred *const old, const gfp_t gfp)
+static void hook_cred_transfer(struct cred *const new,
+			       const struct cred *const old)
 {
 	struct landlock_ruleset *const old_dom = landlock_cred(old)->domain;
 
@@ -23,6 +23,12 @@ static int hook_cred_prepare(struct cred *const new,
 		landlock_get_ruleset(old_dom);
 		landlock_cred(new)->domain = old_dom;
 	}
+}
+
+static int hook_cred_prepare(struct cred *const new,
+			     const struct cred *const old, const gfp_t gfp)
+{
+	hook_cred_transfer(new, old);
 	return 0;
 }
 
@@ -36,6 +42,7 @@ static void hook_cred_free(struct cred *const cred)
 
 static struct security_hook_list landlock_hooks[] __lsm_ro_after_init = {
 	LSM_HOOK_INIT(cred_prepare, hook_cred_prepare),
+	LSM_HOOK_INIT(cred_transfer, hook_cred_transfer),
 	LSM_HOOK_INIT(cred_free, hook_cred_free),
 };
 
diff --git a/sound/soc/amd/acp-es8336.c b/sound/soc/amd/acp-es8336.c
index 89499542c803..f91a3c13ac23 100644
--- a/sound/soc/amd/acp-es8336.c
+++ b/sound/soc/amd/acp-es8336.c
@@ -203,8 +203,10 @@ static int st_es8336_late_probe(struct snd_soc_card *card)
 
 	codec_dev = acpi_get_first_physical_node(adev);
 	acpi_dev_put(adev);
-	if (!codec_dev)
+	if (!codec_dev) {
 		dev_err(card->dev, "can not find codec dev\n");
+		return -ENODEV;
+	}
 
 	ret = devm_acpi_dev_add_driver_gpios(codec_dev, acpi_es8336_gpios);
 	if (ret)
diff --git a/sound/soc/amd/yc/acp6x-mach.c b/sound/soc/amd/yc/acp6x-mach.c
index 8e3eccb4faa7..c438fccac8e9 100644
--- a/sound/soc/amd/yc/acp6x-mach.c
+++ b/sound/soc/amd/yc/acp6x-mach.c
@@ -220,6 +220,13 @@ static const struct dmi_system_id yc_acp_quirk_table[] = {
 			DMI_MATCH(DMI_PRODUCT_NAME, "21J6"),
 		}
 	},
+	{
+		.driver_data = &acp6x_card,
+		.matches = {
+			DMI_MATCH(DMI_BOARD_VENDOR, "LENOVO"),
+			DMI_MATCH(DMI_PRODUCT_NAME, "21M5"),
+		}
+	},
 	{
 		.driver_data = &acp6x_card,
 		.matches = {
diff --git a/sound/soc/codecs/max98088.c b/sound/soc/codecs/max98088.c
index 405ec16be2b6..eaabfe2cfd70 100644
--- a/sound/soc/codecs/max98088.c
+++ b/sound/soc/codecs/max98088.c
@@ -1318,6 +1318,7 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
                                   enum snd_soc_bias_level level)
 {
 	struct max98088_priv *max98088 = snd_soc_component_get_drvdata(component);
+	int ret;
 
 	switch (level) {
 	case SND_SOC_BIAS_ON:
@@ -1333,10 +1334,13 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
 		 */
 		if (!IS_ERR(max98088->mclk)) {
 			if (snd_soc_component_get_bias_level(component) ==
-			    SND_SOC_BIAS_ON)
+			    SND_SOC_BIAS_ON) {
 				clk_disable_unprepare(max98088->mclk);
-			else
-				clk_prepare_enable(max98088->mclk);
+			} else {
+				ret = clk_prepare_enable(max98088->mclk);
+				if (ret)
+					return ret;
+			}
 		}
 		break;
 
diff --git a/sound/soc/intel/common/soc-intel-quirks.h b/sound/soc/intel/common/soc-intel-quirks.h
index de4e550c5b34..42bd51456b94 100644
--- a/sound/soc/intel/common/soc-intel-quirks.h
+++ b/sound/soc/intel/common/soc-intel-quirks.h
@@ -11,7 +11,7 @@
 
 #include <linux/platform_data/x86/soc.h>
 
-#if IS_ENABLED(CONFIG_X86)
+#if IS_REACHABLE(CONFIG_IOSF_MBI)
 
 #include <linux/dmi.h>
 #include <asm/iosf_mbi.h>
diff --git a/sound/soc/qcom/lpass-cpu.c b/sound/soc/qcom/lpass-cpu.c
index dbdaaa85ce48..4387cca893c5 100644
--- a/sound/soc/qcom/lpass-cpu.c
+++ b/sound/soc/qcom/lpass-cpu.c
@@ -1160,9 +1160,13 @@ int asoc_qcom_lpass_cpu_platform_probe(struct platform_device *pdev)
 		}
 
 		res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-rxtx-cdc-dma-lpm");
+		if (!res)
+			return -EINVAL;
 		drvdata->rxtx_cdc_dma_lpm_buf = res->start;
 
 		res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-va-cdc-dma-lpm");
+		if (!res)
+			return -EINVAL;
 		drvdata->va_cdc_dma_lpm_buf = res->start;
 	}
 
diff --git a/sound/soc/sof/imx/imx8m.c b/sound/soc/sof/imx/imx8m.c
index 1243f8a6141e..186ba4bbb5b2 100644
--- a/sound/soc/sof/imx/imx8m.c
+++ b/sound/soc/sof/imx/imx8m.c
@@ -243,7 +243,7 @@ static int imx8m_probe(struct snd_sof_dev *sdev)
 	/* set default mailbox offset for FW ready message */
 	sdev->dsp_box.offset = MBOX_OFFSET;
 
-	priv->regmap = syscon_regmap_lookup_by_compatible("fsl,dsp-ctrl");
+	priv->regmap = syscon_regmap_lookup_by_phandle(np, "fsl,dsp-ctrl");
 	if (IS_ERR(priv->regmap)) {
 		dev_err(sdev->dev, "cannot find dsp-ctrl registers");
 		ret = PTR_ERR(priv->regmap);
diff --git a/sound/usb/mixer.c b/sound/usb/mixer.c
index 783a2493707e..5699a62d1767 100644
--- a/sound/usb/mixer.c
+++ b/sound/usb/mixer.c
@@ -1211,6 +1211,13 @@ static void volume_control_quirks(struct usb_mixer_elem_info *cval,
 			cval->res = 16;
 		}
 		break;
+	case USB_ID(0x1bcf, 0x2281): /* HD Webcam */
+		if (!strcmp(kctl->id.name, "Mic Capture Volume")) {
+			usb_audio_info(chip,
+				"set resolution quirk: cval->res = 16\n");
+			cval->res = 16;
+		}
+		break;
 	}
 }
 
diff --git a/sound/usb/quirks.c b/sound/usb/quirks.c
index b8a474a2e4d5..733a25275fe9 100644
--- a/sound/usb/quirks.c
+++ b/sound/usb/quirks.c
@@ -2083,6 +2083,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
 		   QUIRK_FLAG_CTL_MSG_DELAY_1M),
 	DEVICE_FLG(0x0b0e, 0x0349, /* Jabra 550a */
 		   QUIRK_FLAG_CTL_MSG_DELAY_1M),
+	DEVICE_FLG(0x0c45, 0x6340, /* Sonix HD USB Camera */
+		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x0ecb, 0x205c, /* JBL Quantum610 Wireless */
 		   QUIRK_FLAG_FIXED_RATE),
 	DEVICE_FLG(0x0ecb, 0x2069, /* JBL Quantum810 Wireless */
@@ -2125,6 +2127,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x19f7, 0x0035, /* RODE NT-USB+ */
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
+	DEVICE_FLG(0x1bcf, 0x2281, /* HD Webcam */
+		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x1bcf, 0x2283, /* NexiGo N930AF FHD Webcam */
 		   QUIRK_FLAG_GET_SAMPLE_RATE),
 	DEVICE_FLG(0x2040, 0x7200, /* Hauppauge HVR-950Q */
diff --git a/tools/bpf/bpftool/common.c b/tools/bpf/bpftool/common.c
index e7a11cff7245..db02b000fbeb 100644
--- a/tools/bpf/bpftool/common.c
+++ b/tools/bpf/bpftool/common.c
@@ -333,7 +333,7 @@ void get_prog_full_name(const struct bpf_prog_info *prog_info, int prog_fd,
 {
 	const char *prog_name = prog_info->name;
 	const struct btf_type *func_type;
-	const struct bpf_func_info finfo = {};
+	struct bpf_func_info finfo = {};
 	struct bpf_prog_info info = {};
 	__u32 info_len = sizeof(info);
 	struct btf *prog_btf = NULL;
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 7e0b846e17ee..21817eb51039 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -1707,6 +1707,10 @@ static int load_with_options(int argc, char **argv, bool first_prog_only)
 	}
 
 	if (pinmaps) {
+		err = create_and_mount_bpffs_dir(pinmaps);
+		if (err)
+			goto err_unpin;
+
 		err = bpf_object__pin_maps(obj, pinmaps);
 		if (err) {
 			p_err("failed to pin all maps");
diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c
index 82bffa7cf865..7775040182e3 100644
--- a/tools/bpf/resolve_btfids/main.c
+++ b/tools/bpf/resolve_btfids/main.c
@@ -696,7 +696,7 @@ static int sets_patch(struct object *obj)
 			 * Make sure id is at the beginning of the pairs
 			 * struct, otherwise the below qsort would not work.
 			 */
-			BUILD_BUG_ON(set8->pairs != &set8->pairs[0].id);
+			BUILD_BUG_ON((u32 *)set8->pairs != &set8->pairs[0].id);
 			qsort(set8->pairs, set8->cnt, sizeof(set8->pairs[0]), cmp_id);
 
 			/*
diff --git a/tools/lib/bpf/btf_dump.c b/tools/lib/bpf/btf_dump.c
index 713264899250..cfdee656789b 100644
--- a/tools/lib/bpf/btf_dump.c
+++ b/tools/lib/bpf/btf_dump.c
@@ -1521,10 +1521,12 @@ static void btf_dump_emit_type_chain(struct btf_dump *d,
 			 * Clang for BPF target generates func_proto with no
 			 * args as a func_proto with a single void arg (e.g.,
 			 * `int (*f)(void)` vs just `int (*f)()`). We are
-			 * going to pretend there are no args for such case.
+			 * going to emit valid empty args (void) syntax for
+			 * such case. Similarly and conveniently, valid
+			 * no args case can be special-cased here as well.
 			 */
-			if (vlen == 1 && p->type == 0) {
-				btf_dump_printf(d, ")");
+			if (vlen == 0 || (vlen == 1 && p->type == 0)) {
+				btf_dump_printf(d, "void)");
 				return;
 			}
 
diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c
index 4ac02c28e152..8a7cb830bff1 100644
--- a/tools/lib/bpf/linker.c
+++ b/tools/lib/bpf/linker.c
@@ -2189,10 +2189,17 @@ static int linker_fixup_btf(struct src_obj *obj)
 		vi = btf_var_secinfos(t);
 		for (j = 0, m = btf_vlen(t); j < m; j++, vi++) {
 			const struct btf_type *vt = btf__type_by_id(obj->btf, vi->type);
-			const char *var_name = btf__str_by_offset(obj->btf, vt->name_off);
-			int var_linkage = btf_var(vt)->linkage;
+			const char *var_name;
+			int var_linkage;
 			Elf64_Sym *sym;
 
+			/* could be a variable or function */
+			if (!btf_is_var(vt))
+				continue;
+
+			var_name = btf__str_by_offset(obj->btf, vt->name_off);
+			var_linkage = btf_var(vt)->linkage;
+
 			/* no need to patch up static or extern vars */
 			if (var_linkage != BTF_VAR_GLOBAL_ALLOCATED)
 				continue;
diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat
index 6b52f365d73a..9f3b5b38221b 100644
--- a/tools/memory-model/lock.cat
+++ b/tools/memory-model/lock.cat
@@ -102,19 +102,19 @@ let rf-lf = rfe-lf | rfi-lf
  * within one of the lock's critical sections returns False.
  *)
 
-(* rfi for RU events: an RU may read from the last po-previous UL *)
-let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc)
-
-(* rfe for RU events: an RU may read from an external UL or the initial write *)
-let all-possible-rfe-ru =
-	let possible-rfe-ru r =
+(*
+ * rf for RU events: an RU may read from an external UL or the initial write,
+ * or from the last po-previous UL
+ *)
+let all-possible-rf-ru =
+	let possible-rf-ru r =
 		let pair-to-relation p = p ++ 0
-		in map pair-to-relation (((UL | IW) * {r}) & loc & ext)
-	in map possible-rfe-ru RU
+		in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) |
+			(((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc)))
+	in map possible-rf-ru RU
 
 (* Generate all rf relations for RU events *)
-with rfe-ru from cross(all-possible-rfe-ru)
-let rf-ru = rfe-ru | rfi-ru
+with rf-ru from cross(all-possible-rf-ru)
 
 (* Final rf relation *)
 let rf = rf | rf-lf | rf-ru
diff --git a/tools/perf/arch/x86/util/intel-pt.c b/tools/perf/arch/x86/util/intel-pt.c
index af102f471e9f..9daec588103b 100644
--- a/tools/perf/arch/x86/util/intel-pt.c
+++ b/tools/perf/arch/x86/util/intel-pt.c
@@ -32,6 +32,7 @@
 #include "../../../util/tsc.h"
 #include <internal/lib.h> // page_size
 #include "../../../util/intel-pt.h"
+#include <api/fs/fs.h>
 
 #define KiB(x) ((x) * 1024)
 #define MiB(x) ((x) * 1024 * 1024)
@@ -440,6 +441,16 @@ static int intel_pt_track_switches(struct evlist *evlist)
 	return 0;
 }
 
+static bool intel_pt_exclude_guest(void)
+{
+	int pt_mode;
+
+	if (sysfs__read_int("module/kvm_intel/parameters/pt_mode", &pt_mode))
+		pt_mode = 0;
+
+	return pt_mode == 1;
+}
+
 static void intel_pt_valid_str(char *str, size_t len, u64 valid)
 {
 	unsigned int val, last = 0, state = 1;
@@ -643,6 +654,7 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
 			}
 			evsel->core.attr.freq = 0;
 			evsel->core.attr.sample_period = 1;
+			evsel->core.attr.exclude_guest = intel_pt_exclude_guest();
 			evsel->no_aux_samples = true;
 			evsel->needs_auxtrace_mmap = true;
 			intel_pt_evsel = evsel;
@@ -780,7 +792,8 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
 	}
 
 	if (!opts->auxtrace_snapshot_mode && !opts->auxtrace_sample_mode) {
-		u32 aux_watermark = opts->auxtrace_mmap_pages * page_size / 4;
+		size_t aw = opts->auxtrace_mmap_pages * (size_t)page_size / 4;
+		u32 aux_watermark = aw > UINT_MAX ? UINT_MAX : aw;
 
 		intel_pt_evsel->core.attr.aux_watermark = aux_watermark;
 	}
diff --git a/tools/perf/tests/shell/test_arm_callgraph_fp.sh b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
index ec108d45d3c6..60cd35c73e47 100755
--- a/tools/perf/tests/shell/test_arm_callgraph_fp.sh
+++ b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
@@ -4,65 +4,31 @@
 
 lscpu | grep -q "aarch64" || exit 2
 
-if ! [ -x "$(command -v cc)" ]; then
-	echo "failed: no compiler, install gcc"
-	exit 2
-fi
-
 PERF_DATA=$(mktemp /tmp/__perf_test.perf.data.XXXXX)
-TEST_PROGRAM_SOURCE=$(mktemp /tmp/test_program.XXXXX.c)
-TEST_PROGRAM=$(mktemp /tmp/test_program.XXXXX)
+TEST_PROGRAM="perf test -w leafloop"
 
 cleanup_files()
 {
-	rm -f $PERF_DATA
-	rm -f $TEST_PROGRAM_SOURCE
-	rm -f $TEST_PROGRAM
-}
-
-trap cleanup_files exit term int
-
-cat << EOF > $TEST_PROGRAM_SOURCE
-int a = 0;
-void leaf(void) {
-  for (;;)
-    a += a;
+	rm -f "$PERF_DATA"
 }
-void parent(void) {
-  leaf();
-}
-int main(void) {
-  parent();
-  return 0;
-}
-EOF
-
-echo " + Compiling test program ($TEST_PROGRAM)..."
-
-CFLAGS="-g -O0 -fno-inline -fno-omit-frame-pointer"
-cc $CFLAGS $TEST_PROGRAM_SOURCE -o $TEST_PROGRAM || exit 1
 
-# Add a 1 second delay to skip samples that are not in the leaf() function
-perf record -o $PERF_DATA --call-graph fp -e cycles//u -D 1000 --user-callchains -- $TEST_PROGRAM 2> /dev/null &
-PID=$!
+trap cleanup_files EXIT TERM INT
 
-echo " + Recording (PID=$PID)..."
-sleep 2
-echo " + Stopping perf-record..."
+# shellcheck disable=SC2086
+perf record -o "$PERF_DATA" --call-graph fp -e cycles//u --user-callchains -- $TEST_PROGRAM
 
-kill $PID
-wait $PID
+# Try opening the file so any immediate errors are visible in the log
+perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4
 
-# expected perf-script output:
+# expected perf-script output if 'leaf' has been inserted correctly:
 #
-# program
+# perf
 # 	728 leaf
 # 	753 parent
-# 	76c main
-# ...
+# 	76c leafloop
+# ... remaining stack to main() ...
 
-perf script -i $PERF_DATA -F comm,ip,sym | head -n4
-perf script -i $PERF_DATA -F comm,ip,sym | head -n4 | \
-	awk '{ if ($2 != "") sym[i++] = $2 } END { if (sym[0] != "leaf" ||
-						       sym[1] != "parent" ||
-						       sym[2] != "main") exit 1 }'
+# Each frame is separated by a tab, some spaces and an address
+SEP="[[:space:]]+ [[:xdigit:]]+"
+perf script -i "$PERF_DATA" -F comm,ip,sym | tr '\n' ' ' | \
+	grep -E -q "perf $SEP leaf $SEP parent $SEP leafloop"
diff --git a/tools/perf/tests/workloads/leafloop.c b/tools/perf/tests/workloads/leafloop.c
index 1bf5cc97649b..f7561767e32c 100644
--- a/tools/perf/tests/workloads/leafloop.c
+++ b/tools/perf/tests/workloads/leafloop.c
@@ -1,6 +1,8 @@
 /* SPDX-License-Identifier: GPL-2.0 */
+#include <signal.h>
 #include <stdlib.h>
 #include <linux/compiler.h>
+#include <unistd.h>
 #include "../tests.h"
 
 /* We want to check these symbols in perf script */
@@ -8,10 +10,16 @@ noinline void leaf(volatile int b);
 noinline void parent(volatile int b);
 
 static volatile int a;
+static volatile sig_atomic_t done;
+
+static void sighandler(int sig __maybe_unused)
+{
+	done = 1;
+}
 
 noinline void leaf(volatile int b)
 {
-	for (;;)
+	while (!done)
 		a += b;
 }
 
@@ -22,12 +30,16 @@ noinline void parent(volatile int b)
 
 static int leafloop(int argc, const char **argv)
 {
-	int c = 1;
+	int sec = 1;
 
 	if (argc > 0)
-		c = atoi(argv[0]);
+		sec = atoi(argv[0]);
+
+	signal(SIGINT, sighandler);
+	signal(SIGALRM, sighandler);
+	alarm(sec);
 
-	parent(c);
+	parent(sec);
 	return 0;
 }
 
diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c
index 6882b1714499..1821c81892df 100644
--- a/tools/perf/util/sort.c
+++ b/tools/perf/util/sort.c
@@ -275,7 +275,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right)
 	 * comparing symbol address alone is not enough since it's a
 	 * relative address within a dso.
 	 */
-	if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) {
+	if (!hists__has(left->hists, dso)) {
 		ret = sort__dso_cmp(left, right);
 		if (ret != 0)
 			return ret;
diff --git a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
index 597d0467a926..de2466547efe 100644
--- a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
+++ b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
@@ -994,7 +994,7 @@ static void drop_on_reuseport(const struct test *t)
 
 	err = update_lookup_map(t->sock_map, SERVER_A, server1);
 	if (err)
-		goto detach;
+		goto close_srv1;
 
 	/* second server on destination address we should never reach */
 	server2 = make_server(t->sotype, t->connect_to.ip, t->connect_to.port,
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
index 39973ea1ce43..89366913a251 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
@@ -217,7 +217,7 @@ static void test_xdp_adjust_frags_tail_grow(void)
 
 	prog = bpf_object__next_program(obj, NULL);
 	if (bpf_object__load(obj))
-		return;
+		goto out;
 
 	prog_fd = bpf_program__fd(prog);
 
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
index ba97165bdb28..a657651eba52 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
@@ -14,9 +14,9 @@ typedef int *ptr_arr_t[6];
 
 typedef int *ptr_multiarr_t[7][8][9][10];
 
-typedef int * (*fn_ptr_arr_t[11])();
+typedef int * (*fn_ptr_arr_t[11])(void);
 
-typedef int * (*fn_ptr_multiarr_t[12][13])();
+typedef int * (*fn_ptr_multiarr_t[12][13])(void);
 
 struct root_struct {
 	arr_t _1;
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
index 4ee4748133fe..9355e323d40c 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
@@ -67,7 +67,7 @@ typedef void (*printf_fn_t)(const char *, ...);
  *   `int -> char *` function and returns pointer to a char. Equivalent:
  *   typedef char * (*fn_input_t)(int);
  *   typedef char * (*fn_output_outer_t)(fn_input_t);
- *   typedef const fn_output_outer_t (* fn_output_inner_t)();
+ *   typedef const fn_output_outer_t (* fn_output_inner_t)(void);
  *   typedef const fn_output_inner_t fn_ptr_arr2_t[5];
  */
 /* ----- START-EXPECTED-OUTPUT ----- */
@@ -94,7 +94,7 @@ typedef void (* (*signal_t)(int, void (*)(int)))(int);
 
 typedef char * (*fn_ptr_arr1_t[10])(int **);
 
-typedef char * (* (* const fn_ptr_arr2_t[5])())(char * (*)(int));
+typedef char * (* (* const fn_ptr_arr2_t[5])(void))(char * (*)(int));
 
 struct struct_w_typedefs {
 	int_t a;
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index d56f521b8aaa..25da05cad8f6 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -63,7 +63,7 @@ int passed;
 int failed;
 int map_fd[9];
 struct bpf_map *maps[9];
-int prog_fd[11];
+int prog_fd[9];
 
 int txmsg_pass;
 int txmsg_redir;
@@ -680,7 +680,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt,
 				}
 			}
 
-			s->bytes_recvd += recv;
+			if (recv > 0)
+				s->bytes_recvd += recv;
 
 			if (opt->check_recved_len && s->bytes_recvd > total_bytes) {
 				errno = EMSGSIZE;
@@ -1775,8 +1776,6 @@ int prog_attach_type[] = {
 	BPF_SK_MSG_VERDICT,
 	BPF_SK_MSG_VERDICT,
 	BPF_SK_MSG_VERDICT,
-	BPF_SK_MSG_VERDICT,
-	BPF_SK_MSG_VERDICT,
 };
 
 int prog_type[] = {
@@ -1789,8 +1788,6 @@ int prog_type[] = {
 	BPF_PROG_TYPE_SK_MSG,
 	BPF_PROG_TYPE_SK_MSG,
 	BPF_PROG_TYPE_SK_MSG,
-	BPF_PROG_TYPE_SK_MSG,
-	BPF_PROG_TYPE_SK_MSG,
 };
 
 static int populate_progs(char *bpf_file)
diff --git a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
index 616d3581419c..21d0f419cc6d 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
@@ -11,7 +11,7 @@ ALL_TESTS="single_mask_test identical_filters_test two_masks_test \
 	multiple_masks_test ctcam_edge_cases_test delta_simple_test \
 	delta_two_masks_one_key_test delta_simple_rehash_test \
 	bloom_simple_test bloom_complex_test bloom_delta_test \
-	max_erp_entries_test max_group_size_test"
+	max_erp_entries_test max_group_size_test collision_test"
 NUM_NETIFS=2
 source $lib_dir/lib.sh
 source $lib_dir/tc_common.sh
@@ -457,7 +457,7 @@ delta_two_masks_one_key_test()
 {
 	# If 2 keys are the same and only differ in mask in a way that
 	# they belong under the same ERP (second is delta of the first),
-	# there should be no C-TCAM spill.
+	# there should be C-TCAM spill.
 
 	RET=0
 
@@ -474,8 +474,8 @@ delta_two_masks_one_key_test()
 	tp_record "mlxsw:*" "tc filter add dev $h2 ingress protocol ip \
 		   pref 2 handle 102 flower $tcflags dst_ip 192.0.2.2 \
 		   action drop"
-	tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 0
-	check_err $? "incorrect C-TCAM spill while inserting the second rule"
+	tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 1
+	check_err $? "C-TCAM spill did not happen while inserting the second rule"
 
 	$MZ $h1 -c 1 -p 64 -a $h1mac -b $h2mac -A 192.0.2.1 -B 192.0.2.2 \
 		-t ip -q
@@ -1087,6 +1087,53 @@ max_group_size_test()
 	log_test "max ACL group size test ($tcflags). max size $max_size"
 }
 
+collision_test()
+{
+	# Filters cannot share an eRP if in the common unmasked part (i.e.,
+	# without the delta bits) they have the same values. If the driver does
+	# not prevent such configuration (by spilling into the C-TCAM), then
+	# multiple entries will be present in the device with the same key,
+	# leading to collisions and a reduced scale.
+	#
+	# Create such a scenario and make sure all the filters are successfully
+	# added.
+
+	RET=0
+
+	local ret
+
+	if [[ "$tcflags" != "skip_sw" ]]; then
+		return 0;
+	fi
+
+	# Add a single dst_ip/24 filter and multiple dst_ip/32 filters that all
+	# have the same values in the common unmasked part (dst_ip/24).
+
+	tc filter add dev $h2 ingress pref 1 proto ipv4 handle 101 \
+		flower $tcflags dst_ip 198.51.100.0/24 \
+		action drop
+
+	for i in {0..255}; do
+		tc filter add dev $h2 ingress pref 2 proto ipv4 \
+			handle $((102 + i)) \
+			flower $tcflags dst_ip 198.51.100.${i}/32 \
+			action drop
+		ret=$?
+		[[ $ret -ne 0 ]] && break
+	done
+
+	check_err $ret "failed to add all the filters"
+
+	for i in {255..0}; do
+		tc filter del dev $h2 ingress pref 2 proto ipv4 \
+			handle $((102 + i)) flower
+	done
+
+	tc filter del dev $h2 ingress pref 1 proto ipv4 handle 101 flower
+
+	log_test "collision test ($tcflags)"
+}
+
 setup_prepare()
 {
 	h1=${NETIFS[p1]}
diff --git a/tools/testing/selftests/landlock/base_test.c b/tools/testing/selftests/landlock/base_test.c
index da9290817866..e43831746146 100644
--- a/tools/testing/selftests/landlock/base_test.c
+++ b/tools/testing/selftests/landlock/base_test.c
@@ -9,6 +9,7 @@
 #define _GNU_SOURCE
 #include <errno.h>
 #include <fcntl.h>
+#include <linux/keyctl.h>
 #include <linux/landlock.h>
 #include <string.h>
 #include <sys/prctl.h>
@@ -356,4 +357,77 @@ TEST(ruleset_fd_transfer)
 	ASSERT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
 }
 
+TEST(cred_transfer)
+{
+	struct landlock_ruleset_attr ruleset_attr = {
+		.handled_access_fs = LANDLOCK_ACCESS_FS_READ_DIR,
+	};
+	int ruleset_fd, dir_fd;
+	pid_t child;
+	int status;
+
+	drop_caps(_metadata);
+
+	dir_fd = open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC);
+	EXPECT_LE(0, dir_fd);
+	EXPECT_EQ(0, close(dir_fd));
+
+	/* Denies opening directories. */
+	ruleset_fd =
+		landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+	ASSERT_LE(0, ruleset_fd);
+	EXPECT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0));
+	ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0));
+	EXPECT_EQ(0, close(ruleset_fd));
+
+	/* Checks ruleset enforcement. */
+	EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+	EXPECT_EQ(EACCES, errno);
+
+	/* Needed for KEYCTL_SESSION_TO_PARENT permission checks */
+	EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING, NULL, 0,
+			      0, 0))
+	{
+		TH_LOG("Failed to join session keyring: %s", strerror(errno));
+	}
+
+	child = fork();
+	ASSERT_LE(0, child);
+	if (child == 0) {
+		/* Checks ruleset enforcement. */
+		EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+		EXPECT_EQ(EACCES, errno);
+
+		/*
+		 * KEYCTL_SESSION_TO_PARENT is a no-op unless we have a
+		 * different session keyring in the child, so make that happen.
+		 */
+		EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING,
+				      NULL, 0, 0, 0));
+
+		/*
+		 * KEYCTL_SESSION_TO_PARENT installs credentials on the parent
+		 * that never go through the cred_prepare hook, this path uses
+		 * cred_transfer instead.
+		 */
+		EXPECT_EQ(0, syscall(__NR_keyctl, KEYCTL_SESSION_TO_PARENT, 0,
+				     0, 0, 0));
+
+		/* Re-checks ruleset enforcement. */
+		EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+		EXPECT_EQ(EACCES, errno);
+
+		_exit(_metadata->passed ? EXIT_SUCCESS : EXIT_FAILURE);
+		return;
+	}
+
+	EXPECT_EQ(child, waitpid(child, &status, 0));
+	EXPECT_EQ(1, WIFEXITED(status));
+	EXPECT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
+
+	/* Re-checks ruleset enforcement. */
+	EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+	EXPECT_EQ(EACCES, errno);
+}
+
 TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/landlock/config b/tools/testing/selftests/landlock/config
index 0f0a65287bac..177f4878bdf3 100644
--- a/tools/testing/selftests/landlock/config
+++ b/tools/testing/selftests/landlock/config
@@ -1,7 +1,8 @@
+CONFIG_KEYS=y
 CONFIG_OVERLAY_FS=y
+CONFIG_SECURITY=y
 CONFIG_SECURITY_LANDLOCK=y
 CONFIG_SECURITY_PATH=y
-CONFIG_SECURITY=y
 CONFIG_SHMEM=y
-CONFIG_TMPFS_XATTR=y
 CONFIG_TMPFS=y
+CONFIG_TMPFS_XATTR=y
diff --git a/tools/testing/selftests/net/fib_tests.sh b/tools/testing/selftests/net/fib_tests.sh
index e5db2a2a67df..26f30c6fa0f2 100755
--- a/tools/testing/selftests/net/fib_tests.sh
+++ b/tools/testing/selftests/net/fib_tests.sh
@@ -1485,53 +1485,53 @@ ipv4_rt_dsfield()
 
 	# DSCP 0x10 should match the specific route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x10 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x11 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x12 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x13 | \
-		grep -q "via 172.16.103.2"
+		grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
 	log_test $? 0 "IPv4 route with DSCP and ECN:CE"
 
 	# Unknown DSCP should match the generic route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x14 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x15 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x16 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x17 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with unknown DSCP and ECN:CE"
 
 	# Null DSCP should match the generic route, no matter the ECN bits
 	$IP route get fibmatch 172.16.102.1 dsfield 0x00 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:Not-ECT"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x01 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(1)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x02 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(0)"
 
 	$IP route get fibmatch 172.16.102.1 dsfield 0x03 | \
-		grep -q "via 172.16.101.2"
+		grep -q "172.16.102.0/24 via 172.16.101.2"
 	log_test $? 0 "IPv4 route with no DSCP and ECN:CE"
 }
 
diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh
index 601990c6881b..4c555fab9e75 100644
--- a/tools/testing/selftests/net/forwarding/devlink_lib.sh
+++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh
@@ -122,6 +122,8 @@ devlink_reload()
 	still_pending=$(devlink resource show "$DEVLINK_DEV" | \
 			grep -c "size_new")
 	check_err $still_pending "Failed reload - There are still unset sizes"
+
+	udevadm settle
 }
 
 declare -A DEVLINK_ORIG
diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
index ea9bdf3a90b1..09da8f1011ce 100644
--- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h
+++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
@@ -8,7 +8,7 @@ register unsigned long sp asm("sp");
 register unsigned long sp asm("esp");
 #elif __loongarch64
 register unsigned long sp asm("$sp");
-#elif __ppc__
+#elif __powerpc__
 register unsigned long sp asm("r1");
 #elif __s390x__
 register unsigned long sp asm("%15");

      reply	other threads:[~2024-08-03  7:06 UTC|newest]

Thread overview: 2+ messages / expand[flat|nested]  mbox.gz  Atom feed  top
2024-08-03  7:05 Linux 6.1.103 Greg Kroah-Hartman
2024-08-03  7:05 ` Greg Kroah-Hartman [this message]

Reply instructions:

You may reply publicly to this message via plain-text email
using any one of the following methods:

* Save the following mbox file, import it into your mail client,
  and reply-to-all from there: mbox

  Avoid top-posting and favor interleaved quoting:
  https://en.wikipedia.org/wiki/Posting_style#Interleaved_style

* Reply using the --to, --cc, and --in-reply-to
  switches of git-send-email(1):

  git send-email \
    --in-reply-to=2024080352-appliance-oppressor-ff53@gregkh \
    --to=gregkh@linuxfoundation.org \
    --cc=akpm@linux-foundation.org \
    --cc=jslaby@suse.cz \
    --cc=linux-kernel@vger.kernel.org \
    --cc=lwn@lwn.net \
    --cc=stable@vger.kernel.org \
    --cc=torvalds@linux-foundation.org \
    /path/to/YOUR_REPLY

  https://kernel.org/pub/software/scm/git/docs/git-send-email.html

* If your mail client supports setting the In-Reply-To header
  via mailto: links, try the mailto: link
Be sure your reply has a Subject: header at the top and a blank line before the message body.
This is an external index of several public inboxes,
see mirroring instructions on how to clone and mirror
all data and code used by this external index.