* Re: Linux 6.6.44
2024-08-03 7:06 Linux 6.6.44 Greg Kroah-Hartman
@ 2024-08-03 7:06 ` Greg Kroah-Hartman
0 siblings, 0 replies; 2+ messages in thread
From: Greg Kroah-Hartman @ 2024-08-03 7:06 UTC (permalink / raw)
To: linux-kernel, akpm, torvalds, stable; +Cc: lwn, jslaby, Greg Kroah-Hartman
diff --git a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
index 4f3acdc4dec0..98cdd98212c4 100644
--- a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
+++ b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
@@ -49,7 +49,10 @@ properties:
to take when the temperature crosses those thresholds.
patternProperties:
- "^[a-zA-Z][a-zA-Z0-9\\-]{1,12}-thermal$":
+ # Node name is limited in size due to Linux kernel requirements - 19
+ # characters in total (see THERMAL_NAME_LENGTH, including terminating NUL
+ # byte):
+ "^[a-zA-Z][a-zA-Z0-9\\-]{1,10}-thermal$":
type: object
description:
Each thermal zone node contains information about how frequently it
diff --git a/Makefile b/Makefile
index 37b5144449a9..2e5d92ce2774 100644
--- a/Makefile
+++ b/Makefile
@@ -1,7 +1,7 @@
# SPDX-License-Identifier: GPL-2.0
VERSION = 6
PATCHLEVEL = 6
-SUBLEVEL = 43
+SUBLEVEL = 44
EXTRAVERSION =
NAME = Hurr durr I'ma ninja sloth
diff --git a/arch/arm/boot/dts/allwinner/Makefile b/arch/arm/boot/dts/allwinner/Makefile
index eebb5a0c873a..296be33ec934 100644
--- a/arch/arm/boot/dts/allwinner/Makefile
+++ b/arch/arm/boot/dts/allwinner/Makefile
@@ -259,68 +259,6 @@ dtb-$(CONFIG_MACH_SUN8I) += \
sun8i-v3s-licheepi-zero.dtb \
sun8i-v3s-licheepi-zero-dock.dtb \
sun8i-v40-bananapi-m2-berry.dtb
-dtb-$(CONFIG_MACH_SUN8I) += \
- sun8i-a23-evb.dtb \
- sun8i-a23-gt90h-v4.dtb \
- sun8i-a23-inet86dz.dtb \
- sun8i-a23-ippo-q8h-v5.dtb \
- sun8i-a23-ippo-q8h-v1.2.dtb \
- sun8i-a23-polaroid-mid2407pxe03.dtb \
- sun8i-a23-polaroid-mid2809pxe04.dtb \
- sun8i-a23-q8-tablet.dtb \
- sun8i-a33-et-q8-v1.6.dtb \
- sun8i-a33-ga10h-v1.1.dtb \
- sun8i-a33-inet-d978-rev2.dtb \
- sun8i-a33-ippo-q8h-v1.2.dtb \
- sun8i-a33-olinuxino.dtb \
- sun8i-a33-q8-tablet.dtb \
- sun8i-a33-sinlinx-sina33.dtb \
- sun8i-a83t-allwinner-h8homlet-v2.dtb \
- sun8i-a83t-bananapi-m3.dtb \
- sun8i-a83t-cubietruck-plus.dtb \
- sun8i-a83t-tbs-a711.dtb \
- sun8i-h2-plus-bananapi-m2-zero.dtb \
- sun8i-h2-plus-libretech-all-h3-cc.dtb \
- sun8i-h2-plus-orangepi-r1.dtb \
- sun8i-h2-plus-orangepi-zero.dtb \
- sun8i-h3-bananapi-m2-plus.dtb \
- sun8i-h3-bananapi-m2-plus-v1.2.dtb \
- sun8i-h3-beelink-x2.dtb \
- sun8i-h3-libretech-all-h3-cc.dtb \
- sun8i-h3-mapleboard-mp130.dtb \
- sun8i-h3-nanopi-duo2.dtb \
- sun8i-h3-nanopi-m1.dtb\
- \
- sun8i-h3-nanopi-m1-plus.dtb \
- sun8i-h3-nanopi-neo.dtb \
- sun8i-h3-nanopi-neo-air.dtb \
- sun8i-h3-nanopi-r1.dtb \
- sun8i-h3-orangepi-2.dtb \
- sun8i-h3-orangepi-lite.dtb \
- sun8i-h3-orangepi-one.dtb \
- sun8i-h3-orangepi-pc.dtb \
- sun8i-h3-orangepi-pc-plus.dtb \
- sun8i-h3-orangepi-plus.dtb \
- sun8i-h3-orangepi-plus2e.dtb \
- sun8i-h3-orangepi-zero-plus2.dtb \
- sun8i-h3-rervision-dvk.dtb \
- sun8i-h3-zeropi.dtb \
- sun8i-h3-emlid-neutis-n5h3-devboard.dtb \
- sun8i-r16-bananapi-m2m.dtb \
- sun8i-r16-nintendo-nes-classic.dtb \
- sun8i-r16-nintendo-super-nes-classic.dtb \
- sun8i-r16-parrot.dtb \
- sun8i-r40-bananapi-m2-ultra.dtb \
- sun8i-r40-oka40i-c.dtb \
- sun8i-s3-elimo-initium.dtb \
- sun8i-s3-lichee-zero-plus.dtb \
- sun8i-s3-pinecube.dtb \
- sun8i-t113s-mangopi-mq-r-t113.dtb \
- sun8i-t3-cqa3t-bv3.dtb \
- sun8i-v3-sl631-imx179.dtb \
- sun8i-v3s-licheepi-zero.dtb \
- sun8i-v3s-licheepi-zero-dock.dtb \
- sun8i-v40-bananapi-m2-berry.dtb
dtb-$(CONFIG_MACH_SUN9I) += \
sun9i-a80-optimus.dtb \
sun9i-a80-cubieboard4.dtb
diff --git a/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi b/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi
index 4d6a0c3e8455..ff062f4fd726 100644
--- a/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/nxp/imx/imx6q-kontron-samx6i.dtsi
@@ -5,31 +5,8 @@
#include "imx6q.dtsi"
#include "imx6qdl-kontron-samx6i.dtsi"
-#include <dt-bindings/gpio/gpio.h>
/ {
model = "Kontron SMARC sAMX6i Quad/Dual";
compatible = "kontron,imx6q-samx6i", "fsl,imx6q";
};
-
-/* Quad/Dual SoMs have 3 chip-select signals */
-&ecspi4 {
- cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
- <&gpio3 29 GPIO_ACTIVE_LOW>,
- <&gpio3 25 GPIO_ACTIVE_LOW>;
-};
-
-&pinctrl_ecspi4 {
- fsl,pins = <
- MX6QDL_PAD_EIM_D21__ECSPI4_SCLK 0x100b1
- MX6QDL_PAD_EIM_D28__ECSPI4_MOSI 0x100b1
- MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
-
- /* SPI4_IMX_CS2# - connected to internal flash */
- MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
- /* SPI4_IMX_CS0# - connected to SMARC SPI0_CS0# */
- MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
- /* SPI4_CS3# - connected to SMARC SPI0_CS1# */
- MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
- >;
-};
diff --git a/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi b/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi
index 85aeebc9485d..668d33d1ff0c 100644
--- a/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/nxp/imx/imx6qdl-kontron-samx6i.dtsi
@@ -244,7 +244,8 @@ &ecspi4 {
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_ecspi4>;
cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
- <&gpio3 29 GPIO_ACTIVE_LOW>;
+ <&gpio3 29 GPIO_ACTIVE_LOW>,
+ <&gpio3 25 GPIO_ACTIVE_LOW>;
status = "okay";
/* default boot source: workaround #1 for errata ERR006282 */
@@ -259,7 +260,7 @@ smarc_flash: flash@0 {
&fec {
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_enet>;
- phy-mode = "rgmii";
+ phy-connection-type = "rgmii-id";
phy-handle = <ðphy>;
mdio {
@@ -269,7 +270,7 @@ mdio {
ethphy: ethernet-phy@1 {
compatible = "ethernet-phy-ieee802.3-c22";
reg = <1>;
- reset-gpios = <&gpio1 25 GPIO_ACTIVE_LOW>;
+ reset-gpios = <&gpio2 1 GPIO_ACTIVE_LOW>;
reset-assert-us = <1000>;
};
};
@@ -464,6 +465,8 @@ MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
/* SPI_IMX_CS0# - connected to SMARC SPI0_CS0# */
MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
+ /* SPI4_CS3# - connected to SMARC SPI0_CS1# */
+ MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
>;
};
@@ -516,7 +519,7 @@ MX6QDL_PAD_RGMII_RX_CTL__RGMII_RX_CTL 0x1b0b0
MX6QDL_PAD_ENET_MDIO__ENET_MDIO 0x1b0b0
MX6QDL_PAD_ENET_MDC__ENET_MDC 0x1b0b0
MX6QDL_PAD_ENET_REF_CLK__ENET_TX_CLK 0x1b0b0
- MX6QDL_PAD_ENET_CRS_DV__GPIO1_IO25 0x1b0b0 /* RST_GBE0_PHY# */
+ MX6QDL_PAD_NANDF_D1__GPIO2_IO01 0x1b0b0 /* RST_GBE0_PHY# */
>;
};
@@ -729,7 +732,7 @@ &pcie {
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_pcie>;
wake-up-gpio = <&gpio6 18 GPIO_ACTIVE_HIGH>;
- reset-gpio = <&gpio3 13 GPIO_ACTIVE_HIGH>;
+ reset-gpio = <&gpio3 13 GPIO_ACTIVE_LOW>;
};
/* LCD_BKLT_PWM */
@@ -817,5 +820,6 @@ &wdog1 {
/* CPLD is feeded by watchdog (hardwired) */
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_wdog1>;
+ fsl,ext-reset-output;
status = "okay";
};
diff --git a/arch/arm/boot/dts/st/stm32mp151.dtsi b/arch/arm/boot/dts/st/stm32mp151.dtsi
index 61508917521c..aec7fa5ab5d8 100644
--- a/arch/arm/boot/dts/st/stm32mp151.dtsi
+++ b/arch/arm/boot/dts/st/stm32mp151.dtsi
@@ -50,6 +50,7 @@ timer {
<GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
<GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
interrupt-parent = <&intc>;
+ arm,no-tick-in-suspend;
};
clocks {
diff --git a/arch/arm/mach-pxa/spitz.c b/arch/arm/mach-pxa/spitz.c
index cc691b199429..a42417de53f7 100644
--- a/arch/arm/mach-pxa/spitz.c
+++ b/arch/arm/mach-pxa/spitz.c
@@ -520,10 +520,8 @@ static struct gpiod_lookup_table spitz_ads7846_gpio_table = {
static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
.dev_id = "spi2.1",
.table = {
- GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_CONT,
- "BL_CONT", GPIO_ACTIVE_LOW),
- GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_ON,
- "BL_ON", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.1", 6, "BL_CONT", GPIO_ACTIVE_LOW),
+ GPIO_LOOKUP("sharp-scoop.1", 7, "BL_ON", GPIO_ACTIVE_HIGH),
{ },
},
};
@@ -531,10 +529,8 @@ static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
static struct gpiod_lookup_table akita_lcdcon_gpio_table = {
.dev_id = "spi2.1",
.table = {
- GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_CONT,
- "BL_CONT", GPIO_ACTIVE_LOW),
- GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_ON,
- "BL_ON", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("i2c-max7310", 3, "BL_ON", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("i2c-max7310", 4, "BL_CONT", GPIO_ACTIVE_LOW),
{ },
},
};
@@ -941,12 +937,9 @@ static inline void spitz_i2c_init(void) {}
static struct gpiod_lookup_table spitz_audio_gpio_table = {
.dev_id = "spitz-audio",
.table = {
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
- "mute-l", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
- "mute-r", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("sharp-scoop.1", SPITZ_GPIO_MIC_BIAS - SPITZ_SCP2_GPIO_BASE,
- "mic", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.1", 8, "mic", GPIO_ACTIVE_HIGH),
{ },
},
};
@@ -954,12 +947,9 @@ static struct gpiod_lookup_table spitz_audio_gpio_table = {
static struct gpiod_lookup_table akita_audio_gpio_table = {
.dev_id = "spitz-audio",
.table = {
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
- "mute-l", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
- "mute-r", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("i2c-max7310", AKITA_GPIO_MIC_BIAS - AKITA_IOEXP_GPIO_BASE,
- "mic", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("i2c-max7310", 2, "mic", GPIO_ACTIVE_HIGH),
{ },
},
};
diff --git a/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi b/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi
index ff68b911b729..0ff0d090548d 100644
--- a/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-g12-common.dtsi
@@ -215,6 +215,11 @@ hdmi_tx: hdmi-tx@0 {
#sound-dai-cells = <0>;
status = "disabled";
+ assigned-clocks = <&clkc CLKID_HDMI_SEL>,
+ <&clkc CLKID_HDMI>;
+ assigned-clock-parents = <&xtal>, <0>;
+ assigned-clock-rates = <0>, <24000000>;
+
/* VPU VENC Input */
hdmi_tx_venc_port: port@0 {
reg = <0>;
diff --git a/arch/arm64/boot/dts/amlogic/meson-g12.dtsi b/arch/arm64/boot/dts/amlogic/meson-g12.dtsi
index 6a1f4dcf6488..7b655e07e80c 100644
--- a/arch/arm64/boot/dts/amlogic/meson-g12.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-g12.dtsi
@@ -367,6 +367,10 @@ ðmac {
power-domains = <&pwrc PWRC_G12A_ETH_ID>;
};
+&hdmi_tx {
+ power-domains = <&pwrc PWRC_G12A_VPU_ID>;
+};
+
&vpu {
power-domains = <&pwrc PWRC_G12A_VPU_ID>;
};
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
index 12ef6e81c8bd..ed00e67e6923 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
@@ -311,10 +311,16 @@ &hdmi_tx {
<&reset RESET_HDMI_SYSTEM_RESET>,
<&reset RESET_HDMI_TX>;
reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
- clocks = <&clkc CLKID_HDMI_PCLK>,
- <&clkc CLKID_CLK81>,
+ clocks = <&clkc CLKID_HDMI>,
+ <&clkc CLKID_HDMI_PCLK>,
<&clkc CLKID_GCLK_VENCI_INT0>;
clock-names = "isfr", "iahb", "venci";
+ power-domains = <&pwrc PWRC_GXBB_VPU_ID>;
+
+ assigned-clocks = <&clkc CLKID_HDMI_SEL>,
+ <&clkc CLKID_HDMI>;
+ assigned-clock-parents = <&xtal>, <0>;
+ assigned-clock-rates = <0>, <24000000>;
};
&sysctrl {
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
index 17bcfa4702e1..f58d1790de1c 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
@@ -323,10 +323,16 @@ &hdmi_tx {
<&reset RESET_HDMI_SYSTEM_RESET>,
<&reset RESET_HDMI_TX>;
reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
- clocks = <&clkc CLKID_HDMI_PCLK>,
- <&clkc CLKID_CLK81>,
+ clocks = <&clkc CLKID_HDMI>,
+ <&clkc CLKID_HDMI_PCLK>,
<&clkc CLKID_GCLK_VENCI_INT0>;
clock-names = "isfr", "iahb", "venci";
+ power-domains = <&pwrc PWRC_GXBB_VPU_ID>;
+
+ assigned-clocks = <&clkc CLKID_HDMI_SEL>,
+ <&clkc CLKID_HDMI>;
+ assigned-clock-parents = <&xtal>, <0>;
+ assigned-clock-rates = <0>, <24000000>;
};
&sysctrl {
diff --git a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
index 643f94d9d08e..13e742ba00be 100644
--- a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
@@ -339,7 +339,7 @@ tdmin_lb: audio-controller@3c0 {
};
spdifin: audio-controller@400 {
- compatible = "amlogic,g12a-spdifin",
+ compatible = "amlogic,sm1-spdifin",
"amlogic,axg-spdifin";
reg = <0x0 0x400 0x0 0x30>;
#sound-dai-cells = <0>;
@@ -353,7 +353,7 @@ spdifin: audio-controller@400 {
};
spdifout_a: audio-controller@480 {
- compatible = "amlogic,g12a-spdifout",
+ compatible = "amlogic,sm1-spdifout",
"amlogic,axg-spdifout";
reg = <0x0 0x480 0x0 0x50>;
#sound-dai-cells = <0>;
@@ -518,6 +518,10 @@ &gpio_intc {
"amlogic,meson-gpio-intc";
};
+&hdmi_tx {
+ power-domains = <&pwrc PWRC_SM1_VPU_ID>;
+};
+
&pcie {
power-domains = <&pwrc PWRC_SM1_PCIE_ID>;
};
diff --git a/arch/arm64/boot/dts/freescale/imx8mp.dtsi b/arch/arm64/boot/dts/freescale/imx8mp.dtsi
index 4b50920ac204..d1488ebfef3f 100644
--- a/arch/arm64/boot/dts/freescale/imx8mp.dtsi
+++ b/arch/arm64/boot/dts/freescale/imx8mp.dtsi
@@ -785,6 +785,23 @@ pgc_usb2_phy: power-domain@3 {
reg = <IMX8MP_POWER_DOMAIN_USB2_PHY>;
};
+ pgc_mlmix: power-domain@4 {
+ #power-domain-cells = <0>;
+ reg = <IMX8MP_POWER_DOMAIN_MLMIX>;
+ clocks = <&clk IMX8MP_CLK_ML_AXI>,
+ <&clk IMX8MP_CLK_ML_AHB>,
+ <&clk IMX8MP_CLK_NPU_ROOT>;
+ assigned-clocks = <&clk IMX8MP_CLK_ML_CORE>,
+ <&clk IMX8MP_CLK_ML_AXI>,
+ <&clk IMX8MP_CLK_ML_AHB>;
+ assigned-clock-parents = <&clk IMX8MP_SYS_PLL1_800M>,
+ <&clk IMX8MP_SYS_PLL1_800M>,
+ <&clk IMX8MP_SYS_PLL1_800M>;
+ assigned-clock-rates = <800000000>,
+ <800000000>,
+ <300000000>;
+ };
+
pgc_audio: power-domain@5 {
#power-domain-cells = <0>;
reg = <IMX8MP_POWER_DOMAIN_AUDIOMIX>;
@@ -817,6 +834,12 @@ pgc_gpumix: power-domain@7 {
assigned-clock-rates = <800000000>, <400000000>;
};
+ pgc_vpumix: power-domain@8 {
+ #power-domain-cells = <0>;
+ reg = <IMX8MP_POWER_DOMAIN_VPUMIX>;
+ clocks = <&clk IMX8MP_CLK_VPU_ROOT>;
+ };
+
pgc_gpu3d: power-domain@9 {
#power-domain-cells = <0>;
reg = <IMX8MP_POWER_DOMAIN_GPU3D>;
@@ -832,60 +855,64 @@ pgc_mediamix: power-domain@10 {
<&clk IMX8MP_CLK_MEDIA_APB_ROOT>;
};
- pgc_mipi_phy2: power-domain@16 {
+ pgc_vpu_g1: power-domain@11 {
#power-domain-cells = <0>;
- reg = <IMX8MP_POWER_DOMAIN_MIPI_PHY2>;
+ power-domains = <&pgc_vpumix>;
+ reg = <IMX8MP_POWER_DOMAIN_VPU_G1>;
+ clocks = <&clk IMX8MP_CLK_VPU_G1_ROOT>;
};
- pgc_hsiomix: power-domain@17 {
+ pgc_vpu_g2: power-domain@12 {
#power-domain-cells = <0>;
- reg = <IMX8MP_POWER_DOMAIN_HSIOMIX>;
- clocks = <&clk IMX8MP_CLK_HSIO_AXI>,
- <&clk IMX8MP_CLK_HSIO_ROOT>;
- assigned-clocks = <&clk IMX8MP_CLK_HSIO_AXI>;
- assigned-clock-parents = <&clk IMX8MP_SYS_PLL2_500M>;
- assigned-clock-rates = <500000000>;
+ power-domains = <&pgc_vpumix>;
+ reg = <IMX8MP_POWER_DOMAIN_VPU_G2>;
+ clocks = <&clk IMX8MP_CLK_VPU_G2_ROOT>;
+
};
- pgc_ispdwp: power-domain@18 {
+ pgc_vpu_vc8000e: power-domain@13 {
#power-domain-cells = <0>;
- reg = <IMX8MP_POWER_DOMAIN_MEDIAMIX_ISPDWP>;
- clocks = <&clk IMX8MP_CLK_MEDIA_ISP_ROOT>;
+ power-domains = <&pgc_vpumix>;
+ reg = <IMX8MP_POWER_DOMAIN_VPU_VC8000E>;
+ clocks = <&clk IMX8MP_CLK_VPU_VC8KE_ROOT>;
};
- pgc_vpumix: power-domain@19 {
+ pgc_hdmimix: power-domain@14 {
#power-domain-cells = <0>;
- reg = <IMX8MP_POWER_DOMAIN_VPUMIX>;
- clocks = <&clk IMX8MP_CLK_VPU_ROOT>;
+ reg = <IMX8MP_POWER_DOMAIN_HDMIMIX>;
+ clocks = <&clk IMX8MP_CLK_HDMI_ROOT>,
+ <&clk IMX8MP_CLK_HDMI_APB>;
+ assigned-clocks = <&clk IMX8MP_CLK_HDMI_AXI>,
+ <&clk IMX8MP_CLK_HDMI_APB>;
+ assigned-clock-parents = <&clk IMX8MP_SYS_PLL2_500M>,
+ <&clk IMX8MP_SYS_PLL1_133M>;
+ assigned-clock-rates = <500000000>, <133000000>;
};
- pgc_vpu_g1: power-domain@20 {
+ pgc_hdmi_phy: power-domain@15 {
#power-domain-cells = <0>;
- power-domains = <&pgc_vpumix>;
- reg = <IMX8MP_POWER_DOMAIN_VPU_G1>;
- clocks = <&clk IMX8MP_CLK_VPU_G1_ROOT>;
+ reg = <IMX8MP_POWER_DOMAIN_HDMI_PHY>;
};
- pgc_vpu_g2: power-domain@21 {
+ pgc_mipi_phy2: power-domain@16 {
#power-domain-cells = <0>;
- power-domains = <&pgc_vpumix>;
- reg = <IMX8MP_POWER_DOMAIN_VPU_G2>;
- clocks = <&clk IMX8MP_CLK_VPU_G2_ROOT>;
+ reg = <IMX8MP_POWER_DOMAIN_MIPI_PHY2>;
};
- pgc_vpu_vc8000e: power-domain@22 {
+ pgc_hsiomix: power-domain@17 {
#power-domain-cells = <0>;
- power-domains = <&pgc_vpumix>;
- reg = <IMX8MP_POWER_DOMAIN_VPU_VC8000E>;
- clocks = <&clk IMX8MP_CLK_VPU_VC8KE_ROOT>;
+ reg = <IMX8MP_POWER_DOMAIN_HSIOMIX>;
+ clocks = <&clk IMX8MP_CLK_HSIO_AXI>,
+ <&clk IMX8MP_CLK_HSIO_ROOT>;
+ assigned-clocks = <&clk IMX8MP_CLK_HSIO_AXI>;
+ assigned-clock-parents = <&clk IMX8MP_SYS_PLL2_500M>;
+ assigned-clock-rates = <500000000>;
};
- pgc_mlmix: power-domain@24 {
+ pgc_ispdwp: power-domain@18 {
#power-domain-cells = <0>;
- reg = <IMX8MP_POWER_DOMAIN_MLMIX>;
- clocks = <&clk IMX8MP_CLK_ML_AXI>,
- <&clk IMX8MP_CLK_ML_AHB>,
- <&clk IMX8MP_CLK_NPU_ROOT>;
+ reg = <IMX8MP_POWER_DOMAIN_MEDIAMIX_ISPDWP>;
+ clocks = <&clk IMX8MP_CLK_MEDIA_ISP_ROOT>;
};
};
};
@@ -1831,6 +1858,27 @@ hsio_blk_ctrl: blk-ctrl@32f10000 {
#power-domain-cells = <1>;
#clock-cells = <0>;
};
+
+ hdmi_blk_ctrl: blk-ctrl@32fc0000 {
+ compatible = "fsl,imx8mp-hdmi-blk-ctrl", "syscon";
+ reg = <0x32fc0000 0x1000>;
+ clocks = <&clk IMX8MP_CLK_HDMI_APB>,
+ <&clk IMX8MP_CLK_HDMI_ROOT>,
+ <&clk IMX8MP_CLK_HDMI_REF_266M>,
+ <&clk IMX8MP_CLK_HDMI_24M>,
+ <&clk IMX8MP_CLK_HDMI_FDCC_TST>;
+ clock-names = "apb", "axi", "ref_266m", "ref_24m", "fdcc";
+ power-domains = <&pgc_hdmimix>, <&pgc_hdmimix>,
+ <&pgc_hdmimix>, <&pgc_hdmimix>,
+ <&pgc_hdmimix>, <&pgc_hdmimix>,
+ <&pgc_hdmimix>, <&pgc_hdmi_phy>,
+ <&pgc_hdmimix>, <&pgc_hdmimix>;
+ power-domain-names = "bus", "irqsteer", "lcdif",
+ "pai", "pvi", "trng",
+ "hdmi-tx", "hdmi-tx-phy",
+ "hdcp", "hrv";
+ #power-domain-cells = <1>;
+ };
};
pcie: pcie@33800000 {
@@ -1970,6 +2018,18 @@ vpumix_blk_ctrl: blk-ctrl@38330000 {
interconnect-names = "g1", "g2", "vc8000e";
};
+ npu: npu@38500000 {
+ compatible = "vivante,gc";
+ reg = <0x38500000 0x200000>;
+ interrupts = <GIC_SPI 13 IRQ_TYPE_LEVEL_HIGH>;
+ clocks = <&clk IMX8MP_CLK_NPU_ROOT>,
+ <&clk IMX8MP_CLK_NPU_ROOT>,
+ <&clk IMX8MP_CLK_ML_AXI>,
+ <&clk IMX8MP_CLK_ML_AHB>;
+ clock-names = "core", "shader", "bus", "reg";
+ power-domains = <&pgc_mlmix>;
+ };
+
gic: interrupt-controller@38800000 {
compatible = "arm,gic-v3";
reg = <0x38800000 0x10000>,
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
index 7ef517e9e374..15838c1ee8cc 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
@@ -318,8 +318,8 @@ asm_sel {
/* eMMC is shared pin with parallel NAND */
emmc_pins_default: emmc-pins-default {
mux {
- function = "emmc", "emmc_rst";
- groups = "emmc";
+ function = "emmc";
+ groups = "emmc", "emmc_rst";
};
/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
index a75dc63a1362..0a14ef1da60d 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
@@ -244,8 +244,8 @@ &pio {
/* eMMC is shared pin with parallel NAND */
emmc_pins_default: emmc-pins-default {
mux {
- function = "emmc", "emmc_rst";
- groups = "emmc";
+ function = "emmc";
+ groups = "emmc", "emmc_rst";
};
/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi
index 2c69e7658dba..b9a6fd4f86d4 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-audio-da7219.dtsi
@@ -28,7 +28,7 @@ da7219_aad {
dlg,btn-cfg = <50>;
dlg,mic-det-thr = <500>;
dlg,jack-ins-deb = <20>;
- dlg,jack-det-rate = "32ms_64ms";
+ dlg,jack-det-rate = "32_64";
dlg,jack-rem-deb = <1>;
dlg,a-d-btn-thr = <0xa>;
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
index 820260348de9..32f6899f885e 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
@@ -156,21 +156,24 @@ anx_bridge: anx7625@58 {
vdd18-supply = <&pp1800_mipibrdg>;
vdd33-supply = <&vddio_mipibrdg>;
- #address-cells = <1>;
- #size-cells = <0>;
- port@0 {
- reg = <0>;
+ ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
- anx7625_in: endpoint {
- remote-endpoint = <&dsi_out>;
+ port@0 {
+ reg = <0>;
+
+ anx7625_in: endpoint {
+ remote-endpoint = <&dsi_out>;
+ };
};
- };
- port@1 {
- reg = <1>;
+ port@1 {
+ reg = <1>;
- anx7625_out: endpoint {
- remote-endpoint = <&panel_in>;
+ anx7625_out: endpoint {
+ remote-endpoint = <&panel_in>;
+ };
};
};
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
index d846342c1d3b..2c6587f260f8 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
@@ -775,7 +775,6 @@ pins-tx {
};
pins-rts {
pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
- output-enable;
};
pins-cts {
pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
@@ -794,7 +793,6 @@ pins-tx {
};
pins-rts {
pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
- output-enable;
};
pins-cts {
pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
diff --git a/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi b/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi
index dc39ebd1bbfc..6b4b7a7cd35e 100644
--- a/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8192-asurada.dtsi
@@ -147,6 +147,7 @@ pp3300_mipibrdg: regulator-3v3-mipibrdg {
regulator-boot-on;
gpio = <&pio 127 GPIO_ACTIVE_HIGH>;
vin-supply = <&pp3300_g>;
+ off-on-delay-us = <500000>;
};
/* separately switched 3.3V power rail */
diff --git a/arch/arm64/boot/dts/mediatek/mt8195.dtsi b/arch/arm64/boot/dts/mediatek/mt8195.dtsi
index 2bb9d9aa65fe..20e6d90cc411 100644
--- a/arch/arm64/boot/dts/mediatek/mt8195.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8195.dtsi
@@ -3395,7 +3395,7 @@ vpu1_crit: trip-crit {
};
};
- gpu0-thermal {
+ gpu-thermal {
polling-delay = <1000>;
polling-delay-passive = <250>;
thermal-sensors = <&lvts_ap MT8195_AP_GPU0>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
index 06f8ff624181..d5b35ff0175c 100644
--- a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
@@ -405,7 +405,6 @@ &usb3_dwc3 {
&hsusb_phy1 {
status = "okay";
- extcon = <&typec>;
vdda-pll-supply = <&vreg_l12a_1p8>;
vdda-phy-dpdm-supply = <&vreg_l24a_3p075>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi
index dd407aa3abfb..1f7cbb35886d 100644
--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi
@@ -2090,7 +2090,7 @@ ufshc: ufshc@624000 {
<&gcc GCC_UFS_RX_SYMBOL_0_CLK>;
freq-table-hz =
<100000000 200000000>,
- <0 0>,
+ <100000000 200000000>,
<0 0>,
<0 0>,
<0 0>,
diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi
index f91c58c844af..9c072ce19735 100644
--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi
@@ -1588,7 +1588,6 @@ adreno_smmu: iommu@5040000 {
* SoC VDDMX RPM Power Domain in the Adreno driver.
*/
power-domains = <&gpucc GPU_GX_GDSC>;
- status = "disabled";
};
gpucc: clock-controller@5065000 {
diff --git a/arch/arm64/boot/dts/qcom/qdu1000.dtsi b/arch/arm64/boot/dts/qcom/qdu1000.dtsi
index 1c0e5d271e91..dbdc06be6260 100644
--- a/arch/arm64/boot/dts/qcom/qdu1000.dtsi
+++ b/arch/arm64/boot/dts/qcom/qdu1000.dtsi
@@ -1452,7 +1452,21 @@ system-cache-controller@19200000 {
"llcc_broadcast_base",
"multi_channel_register";
interrupts = <GIC_SPI 266 IRQ_TYPE_LEVEL_HIGH>;
- multi-ch-bit-off = <24 2>;
+
+ nvmem-cells = <&multi_chan_ddr>;
+ nvmem-cell-names = "multi-chan-ddr";
+ };
+
+ sec_qfprom: efuse@221c8000 {
+ compatible = "qcom,qdu1000-sec-qfprom", "qcom,sec-qfprom";
+ reg = <0 0x221c8000 0 0x1000>;
+ #address-cells = <1>;
+ #size-cells = <1>;
+
+ multi_chan_ddr: multi-chan-ddr@12b {
+ reg = <0x12b 0x1>;
+ bits = <0 2>;
+ };
};
};
diff --git a/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts b/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts
index c8e80bb405e7..5def8c1154ce 100644
--- a/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts
+++ b/arch/arm64/boot/dts/qcom/qrb4210-rb2.dts
@@ -364,6 +364,8 @@ vreg_l8a_0p664: l8 {
vreg_l9a_1p8: l9 {
regulator-min-microvolt = <1800000>;
regulator-max-microvolt = <2000000>;
+ regulator-always-on;
+ regulator-boot-on;
};
vreg_l10a_1p8: l10 {
diff --git a/arch/arm64/boot/dts/qcom/sa8775p.dtsi b/arch/arm64/boot/dts/qcom/sa8775p.dtsi
index 88ef3b5d374b..44bea063aedb 100644
--- a/arch/arm64/boot/dts/qcom/sa8775p.dtsi
+++ b/arch/arm64/boot/dts/qcom/sa8775p.dtsi
@@ -2350,6 +2350,7 @@ ethernet1: ethernet@23000000 {
phy-names = "serdes";
iommus = <&apps_smmu 0x140 0xf>;
+ dma-coherent;
snps,tso;
snps,pbl = <32>;
@@ -2383,6 +2384,7 @@ ethernet0: ethernet@23040000 {
phy-names = "serdes";
iommus = <&apps_smmu 0x120 0xf>;
+ dma-coherent;
snps,tso;
snps,pbl = <32>;
diff --git a/arch/arm64/boot/dts/qcom/sc8180x.dtsi b/arch/arm64/boot/dts/qcom/sc8180x.dtsi
index dd207eb81360..92b85de7706d 100644
--- a/arch/arm64/boot/dts/qcom/sc8180x.dtsi
+++ b/arch/arm64/boot/dts/qcom/sc8180x.dtsi
@@ -1853,7 +1853,7 @@ pcie3: pci@1c08000 {
power-domains = <&gcc PCIE_3_GDSC>;
interconnects = <&aggre2_noc MASTER_PCIE_3 0 &mc_virt SLAVE_EBI_CH0 0>,
- <&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_0 0>;
+ <&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_3 0>;
interconnect-names = "pcie-mem", "cpu-pcie";
phys = <&pcie3_phy>;
@@ -1952,7 +1952,7 @@ pcie1: pci@1c10000 {
power-domains = <&gcc PCIE_1_GDSC>;
interconnects = <&aggre2_noc MASTER_PCIE_1 0 &mc_virt SLAVE_EBI_CH0 0>,
- <&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_0 0>;
+ <&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_1 0>;
interconnect-names = "pcie-mem", "cpu-pcie";
phys = <&pcie1_phy>;
@@ -2051,7 +2051,7 @@ pcie2: pci@1c18000 {
power-domains = <&gcc PCIE_2_GDSC>;
interconnects = <&aggre2_noc MASTER_PCIE_2 0 &mc_virt SLAVE_EBI_CH0 0>,
- <&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_0 0>;
+ <&gem_noc MASTER_AMPSS_M0 0 &config_noc SLAVE_PCIE_2 0>;
interconnect-names = "pcie-mem", "cpu-pcie";
phys = <&pcie2_phy>;
@@ -2093,7 +2093,7 @@ ufs_mem_hc: ufshc@1d84000 {
"jedec,ufs-2.0";
reg = <0 0x01d84000 0 0x2500>;
interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>;
- phys = <&ufs_mem_phy_lanes>;
+ phys = <&ufs_mem_phy>;
phy-names = "ufsphy";
lanes-per-direction = <2>;
#reset-cells = <1>;
@@ -2132,10 +2132,8 @@ ufs_mem_hc: ufshc@1d84000 {
ufs_mem_phy: phy-wrapper@1d87000 {
compatible = "qcom,sc8180x-qmp-ufs-phy";
- reg = <0 0x01d87000 0 0x1c0>;
- #address-cells = <2>;
- #size-cells = <2>;
- ranges;
+ reg = <0 0x01d87000 0 0x1000>;
+
clocks = <&rpmhcc RPMH_CXO_CLK>,
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
clock-names = "ref",
@@ -2143,16 +2141,12 @@ ufs_mem_phy: phy-wrapper@1d87000 {
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
- status = "disabled";
- ufs_mem_phy_lanes: phy@1d87400 {
- reg = <0 0x01d87400 0 0x108>,
- <0 0x01d87600 0 0x1e0>,
- <0 0x01d87c00 0 0x1dc>,
- <0 0x01d87800 0 0x108>,
- <0 0x01d87a00 0 0x1e0>;
- #phy-cells = <0>;
- };
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
+ #phy-cells = <0>;
+
+ status = "disabled";
};
ipa_virt: interconnect@1e00000 {
diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi
index 5bf0d5af452a..9d9b378c07e1 100644
--- a/arch/arm64/boot/dts/qcom/sdm845.dtsi
+++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi
@@ -2634,6 +2634,8 @@ ufs_mem_phy: phy@1d87000 {
clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts b/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts
index 92a812b5f423..fe5c12da666e 100644
--- a/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts
+++ b/arch/arm64/boot/dts/qcom/sdm850-lenovo-yoga-c630.dts
@@ -488,6 +488,7 @@ ecsh: hid@5c {
&ipa {
qcom,gsi-loader = "self";
memory-region = <&ipa_fw_mem>;
+ firmware-name = "qcom/sdm850/LENOVO/81JL/ipa_fws.elf";
status = "okay";
};
diff --git a/arch/arm64/boot/dts/qcom/sm6115.dtsi b/arch/arm64/boot/dts/qcom/sm6115.dtsi
index 87cbc4e8b1ed..821db9b85185 100644
--- a/arch/arm64/boot/dts/qcom/sm6115.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm6115.dtsi
@@ -1043,6 +1043,8 @@ ufs_mem_phy: phy@4807000 {
clocks = <&gcc GCC_UFS_CLKREF_CLK>, <&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
clock-names = "ref", "ref_aux";
+ power-domains = <&gcc GCC_UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sm6350.dtsi b/arch/arm64/boot/dts/qcom/sm6350.dtsi
index 71ccda7389ee..2efceb49a321 100644
--- a/arch/arm64/boot/dts/qcom/sm6350.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm6350.dtsi
@@ -1197,6 +1197,8 @@ ufs_mem_phy: phy@1d87000 {
clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
@@ -1297,6 +1299,7 @@ fastrpc {
compatible = "qcom,fastrpc";
qcom,glink-channels = "fastrpcglink-apps-dsp";
label = "adsp";
+ qcom,non-secure-domain;
#address-cells = <1>;
#size-cells = <0>;
@@ -1557,6 +1560,7 @@ fastrpc {
compatible = "qcom,fastrpc";
qcom,glink-channels = "fastrpcglink-apps-dsp";
label = "cdsp";
+ qcom,non-secure-domain;
#address-cells = <1>;
#size-cells = <0>;
diff --git a/arch/arm64/boot/dts/qcom/sm8250.dtsi b/arch/arm64/boot/dts/qcom/sm8250.dtsi
index 64a656dcfa1f..b522d19f3a13 100644
--- a/arch/arm64/boot/dts/qcom/sm8250.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8250.dtsi
@@ -2169,7 +2169,7 @@ ufs_mem_hc: ufshc@1d84000 {
"jedec,ufs-2.0";
reg = <0 0x01d84000 0 0x3000>;
interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>;
- phys = <&ufs_mem_phy_lanes>;
+ phys = <&ufs_mem_phy>;
phy-names = "ufsphy";
lanes-per-direction = <2>;
#reset-cells = <1>;
@@ -2217,10 +2217,8 @@ ufs_mem_hc: ufshc@1d84000 {
ufs_mem_phy: phy@1d87000 {
compatible = "qcom,sm8250-qmp-ufs-phy";
- reg = <0 0x01d87000 0 0x1c0>;
- #address-cells = <2>;
- #size-cells = <2>;
- ranges;
+ reg = <0 0x01d87000 0 0x1000>;
+
clock-names = "ref",
"ref_aux";
clocks = <&rpmhcc RPMH_CXO_CLK>,
@@ -2228,16 +2226,12 @@ ufs_mem_phy: phy@1d87000 {
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
- status = "disabled";
- ufs_mem_phy_lanes: phy@1d87400 {
- reg = <0 0x01d87400 0 0x16c>,
- <0 0x01d87600 0 0x200>,
- <0 0x01d87c00 0 0x200>,
- <0 0x01d87800 0 0x16c>,
- <0 0x01d87a00 0 0x200>;
- #phy-cells = <0>;
- };
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
+ #phy-cells = <0>;
+
+ status = "disabled";
};
cryptobam: dma-controller@1dc4000 {
diff --git a/arch/arm64/boot/dts/qcom/sm8350.dtsi b/arch/arm64/boot/dts/qcom/sm8350.dtsi
index 5ed464c37422..d4f1b36c7aeb 100644
--- a/arch/arm64/boot/dts/qcom/sm8350.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8350.dtsi
@@ -1731,6 +1731,8 @@ ufs_mem_phy: phy@1d87000 {
clocks = <&rpmhcc RPMH_CXO_CLK>,
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sm8450.dtsi b/arch/arm64/boot/dts/qcom/sm8450.dtsi
index 0229bd706a2e..a34f460240a0 100644
--- a/arch/arm64/boot/dts/qcom/sm8450.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8450.dtsi
@@ -4200,6 +4200,8 @@ ufs_mem_phy: phy@1d87000 {
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>,
<&gcc GCC_UFS_0_CLKREF_EN>;
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
status = "disabled";
diff --git a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
index 504ac8c93faf..84e0eb48a1b8 100644
--- a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
@@ -2910,6 +2910,9 @@ timer {
interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
- <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
index ecdd5a523fa3..555fff9364e3 100644
--- a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
@@ -1181,7 +1181,10 @@ timer {
interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
- <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
ufs30_clk: ufs30-clk {
diff --git a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
index d7677595204d..87fbc5331690 100644
--- a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
@@ -2350,6 +2350,9 @@ timer {
interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
- <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
index b3f83d0ebcbb..4b72de43b71c 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
@@ -50,7 +50,10 @@ timer {
interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
- <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
index 081d8f49db87..a877738c3048 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
@@ -1288,6 +1288,9 @@ timer {
interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
- <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
index 0d327464d2ba..3f01b096cfb7 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
@@ -1295,6 +1295,9 @@ timer {
interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
<&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
- <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>;
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
index 4f6541262ab8..5ca0cc19f92c 100644
--- a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
@@ -17,6 +17,7 @@ aliases {
ethernet0 = &gmac;
mmc0 = &emmc;
mmc1 = &sdmmc;
+ mmc2 = &sdio;
};
chosen {
@@ -144,11 +145,25 @@ &emmc {
&gmac {
clock_in_out = "output";
+ phy-handle = <&rtl8201f>;
phy-supply = <&vcc_io>;
- snps,reset-gpio = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
- snps,reset-active-low;
- snps,reset-delays-us = <0 50000 50000>;
status = "okay";
+
+ mdio {
+ compatible = "snps,dwmac-mdio";
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+ rtl8201f: ethernet-phy@1 {
+ compatible = "ethernet-phy-ieee802.3-c22";
+ reg = <1>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&mac_rst>;
+ reset-assert-us = <20000>;
+ reset-deassert-us = <50000>;
+ reset-gpios = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
+ };
+ };
};
&i2c1 {
@@ -159,6 +174,26 @@ &pinctrl {
pinctrl-names = "default";
pinctrl-0 = <&rtc_32k>;
+ bluetooth {
+ bt_reg_on: bt-reg-on {
+ rockchip,pins = <4 RK_PB3 RK_FUNC_GPIO &pcfg_pull_none>;
+ };
+
+ bt_wake_host: bt-wake-host {
+ rockchip,pins = <4 RK_PB4 RK_FUNC_GPIO &pcfg_pull_down>;
+ };
+
+ host_wake_bt: host-wake-bt {
+ rockchip,pins = <4 RK_PB2 RK_FUNC_GPIO &pcfg_pull_none>;
+ };
+ };
+
+ gmac {
+ mac_rst: mac-rst {
+ rockchip,pins = <0 RK_PA7 RK_FUNC_GPIO &pcfg_pull_none>;
+ };
+ };
+
leds {
green_led: green-led {
rockchip,pins = <0 RK_PA6 RK_FUNC_GPIO &pcfg_pull_none>;
@@ -202,15 +237,31 @@ &sdio {
cap-sd-highspeed;
cap-sdio-irq;
keep-power-in-suspend;
- max-frequency = <1000000>;
+ max-frequency = <100000000>;
mmc-pwrseq = <&sdio_pwrseq>;
+ no-mmc;
+ no-sd;
non-removable;
- sd-uhs-sdr104;
+ sd-uhs-sdr50;
+ vmmc-supply = <&vcc_io>;
+ vqmmc-supply = <&vcc_1v8>;
status = "okay";
+
+ rtl8723ds: wifi@1 {
+ reg = <1>;
+ interrupt-parent = <&gpio0>;
+ interrupts = <RK_PA0 IRQ_TYPE_LEVEL_HIGH>;
+ interrupt-names = "host-wake";
+ pinctrl-names = "default";
+ pinctrl-0 = <&wifi_host_wake>;
+ };
};
&sdmmc {
+ cap-mmc-highspeed;
cap-sd-highspeed;
+ disable-wp;
+ vmmc-supply = <&vcc_io>;
status = "okay";
};
@@ -229,16 +280,22 @@ u2phy_otg: otg-port {
};
&uart0 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&uart0_xfer>;
status = "okay";
};
&uart4 {
+ uart-has-rtscts;
status = "okay";
bluetooth {
- compatible = "realtek,rtl8723bs-bt";
- device-wake-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
+ compatible = "realtek,rtl8723ds-bt";
+ device-wake-gpios = <&gpio4 RK_PB2 GPIO_ACTIVE_HIGH>;
+ enable-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
host-wake-gpios = <&gpio4 RK_PB4 GPIO_ACTIVE_HIGH>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&bt_reg_on &bt_wake_host &host_wake_bt>;
};
};
diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
index 3778fe5c42a4..126165ba1ea2 100644
--- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
@@ -822,8 +822,8 @@ cru: clock-controller@ff440000 {
<0>, <24000000>,
<24000000>, <24000000>,
<15000000>, <15000000>,
- <100000000>, <100000000>,
- <100000000>, <100000000>,
+ <300000000>, <100000000>,
+ <400000000>, <100000000>,
<50000000>, <100000000>,
<100000000>, <100000000>,
<50000000>, <50000000>,
diff --git a/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts b/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts
index 938092fce186..68a72ac24cd4 100644
--- a/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3566-roc-pc.dts
@@ -268,7 +268,7 @@ rk809: pmic@20 {
vcc9-supply = <&vcc3v3_sys>;
codec {
- mic-in-differential;
+ rockchip,mic-in-differential;
};
regulators {
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
index 19f8fc369b13..8c3ab07d3807 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
@@ -475,7 +475,7 @@ regulator-state-mem {
};
codec {
- mic-in-differential;
+ rockchip,mic-in-differential;
};
};
};
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts
index 58ab7e9971db..b5e67990dd0f 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dts
@@ -11,6 +11,10 @@ aliases {
};
};
+&pmu_io_domains {
+ vccio3-supply = <&vccio_sd>;
+};
+
&sdmmc0 {
bus-width = <4>;
cap-mmc-highspeed;
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi
index 89e84e3a9262..25c49bdbadbc 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r66s.dtsi
@@ -39,9 +39,9 @@ status_led: led-status {
};
};
- dc_12v: dc-12v-regulator {
+ vcc12v_dcin: vcc12v-dcin-regulator {
compatible = "regulator-fixed";
- regulator-name = "dc_12v";
+ regulator-name = "vcc12v_dcin";
regulator-always-on;
regulator-boot-on;
regulator-min-microvolt = <12000000>;
@@ -65,7 +65,7 @@ vcc3v3_sys: vcc3v3-sys-regulator {
regulator-boot-on;
regulator-min-microvolt = <3300000>;
regulator-max-microvolt = <3300000>;
- vin-supply = <&dc_12v>;
+ vin-supply = <&vcc12v_dcin>;
};
vcc5v0_sys: vcc5v0-sys-regulator {
@@ -75,16 +75,7 @@ vcc5v0_sys: vcc5v0-sys-regulator {
regulator-boot-on;
regulator-min-microvolt = <5000000>;
regulator-max-microvolt = <5000000>;
- vin-supply = <&dc_12v>;
- };
-
- vcc5v0_usb_host: vcc5v0-usb-host-regulator {
- compatible = "regulator-fixed";
- regulator-name = "vcc5v0_usb_host";
- regulator-always-on;
- regulator-boot-on;
- regulator-min-microvolt = <5000000>;
- regulator-max-microvolt = <5000000>;
+ vin-supply = <&vcc12v_dcin>;
};
vcc5v0_usb_otg: vcc5v0-usb-otg-regulator {
@@ -94,8 +85,9 @@ vcc5v0_usb_otg: vcc5v0-usb-otg-regulator {
pinctrl-names = "default";
pinctrl-0 = <&vcc5v0_usb_otg_en>;
regulator-name = "vcc5v0_usb_otg";
- regulator-always-on;
- regulator-boot-on;
+ regulator-min-microvolt = <5000000>;
+ regulator-max-microvolt = <5000000>;
+ vin-supply = <&vcc5v0_sys>;
};
};
@@ -123,6 +115,10 @@ &cpu3 {
cpu-supply = <&vdd_cpu>;
};
+&display_subsystem {
+ status = "disabled";
+};
+
&gpu {
mali-supply = <&vdd_gpu>;
status = "okay";
@@ -405,8 +401,8 @@ vcc5v0_usb_otg_en: vcc5v0-usb-otg-en {
&pmu_io_domains {
pmuio1-supply = <&vcc3v3_pmu>;
pmuio2-supply = <&vcc3v3_pmu>;
- vccio1-supply = <&vccio_acodec>;
- vccio3-supply = <&vccio_sd>;
+ vccio1-supply = <&vcc_3v3>;
+ vccio2-supply = <&vcc_1v8>;
vccio4-supply = <&vcc_1v8>;
vccio5-supply = <&vcc_3v3>;
vccio6-supply = <&vcc_1v8>;
@@ -429,28 +425,12 @@ &uart2 {
status = "okay";
};
-&usb_host0_ehci {
- status = "okay";
-};
-
-&usb_host0_ohci {
- status = "okay";
-};
-
&usb_host0_xhci {
dr_mode = "host";
extcon = <&usb2phy0>;
status = "okay";
};
-&usb_host1_ehci {
- status = "okay";
-};
-
-&usb_host1_ohci {
- status = "okay";
-};
-
&usb_host1_xhci {
status = "okay";
};
@@ -460,7 +440,7 @@ &usb2phy0 {
};
&usb2phy0_host {
- phy-supply = <&vcc5v0_usb_host>;
+ phy-supply = <&vcc5v0_sys>;
status = "okay";
};
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts
index e1fe5e442689..ce2a5e1ccefc 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-fastrhino-r68s.dts
@@ -39,7 +39,7 @@ &gmac0_tx_bus2
&gmac0_rx_bus2
&gmac0_rgmii_clk
&gmac0_rgmii_bus>;
- snps,reset-gpio = <&gpio0 RK_PB0 GPIO_ACTIVE_LOW>;
+ snps,reset-gpio = <&gpio1 RK_PB0 GPIO_ACTIVE_LOW>;
snps,reset-active-low;
/* Reset time is 15ms, 50ms for rtl8211f */
snps,reset-delays-us = <0 15000 50000>;
@@ -61,7 +61,7 @@ &gmac1m1_tx_bus2
&gmac1m1_rx_bus2
&gmac1m1_rgmii_clk
&gmac1m1_rgmii_bus>;
- snps,reset-gpio = <&gpio0 RK_PB1 GPIO_ACTIVE_LOW>;
+ snps,reset-gpio = <&gpio1 RK_PB1 GPIO_ACTIVE_LOW>;
snps,reset-active-low;
/* Reset time is 15ms, 50ms for rtl8211f */
snps,reset-delays-us = <0 15000 50000>;
@@ -71,18 +71,18 @@ &gmac1m1_rgmii_clk
};
&mdio0 {
- rgmii_phy0: ethernet-phy@0 {
+ rgmii_phy0: ethernet-phy@1 {
compatible = "ethernet-phy-ieee802.3-c22";
- reg = <0>;
+ reg = <0x1>;
pinctrl-0 = <ð_phy0_reset_pin>;
pinctrl-names = "default";
};
};
&mdio1 {
- rgmii_phy1: ethernet-phy@0 {
+ rgmii_phy1: ethernet-phy@1 {
compatible = "ethernet-phy-ieee802.3-c22";
- reg = <0>;
+ reg = <0x1>;
pinctrl-0 = <ð_phy1_reset_pin>;
pinctrl-names = "default";
};
@@ -102,6 +102,10 @@ eth_phy1_reset_pin: eth-phy1-reset-pin {
};
};
+&pmu_io_domains {
+ vccio3-supply = <&vcc_3v3>;
+};
+
&sdhci {
bus-width = <8>;
max-frequency = <200000000>;
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
index e05ab11981f5..17830e8c9a59 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
@@ -530,10 +530,6 @@ regulator-state-mem {
};
};
};
-
- codec {
- mic-in-differential;
- };
};
};
diff --git a/arch/arm64/boot/dts/rockchip/rk356x.dtsi b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
index 820c98dbccc0..2f885bc3665b 100644
--- a/arch/arm64/boot/dts/rockchip/rk356x.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
@@ -749,6 +749,7 @@ vop_mmu: iommu@fe043e00 {
clocks = <&cru ACLK_VOP>, <&cru HCLK_VOP>;
clock-names = "aclk", "iface";
#iommu-cells = <0>;
+ power-domains = <&power RK3568_PD_VO>;
status = "disabled";
};
diff --git a/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi b/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi
index d4f8776c9277..0a5634ca005d 100644
--- a/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi
+++ b/arch/arm64/boot/dts/ti/k3-am62-verdin.dtsi
@@ -1309,8 +1309,6 @@ &mcasp0 {
0 0 0 0
>;
tdm-slots = <2>;
- rx-num-evt = <32>;
- tx-num-evt = <32>;
#sound-dai-cells = <0>;
status = "disabled";
};
@@ -1327,8 +1325,6 @@ &mcasp1 {
0 0 0 0
>;
tdm-slots = <2>;
- rx-num-evt = <32>;
- tx-num-evt = <32>;
#sound-dai-cells = <0>;
status = "disabled";
};
diff --git a/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts b/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts
index 2de74428a8bd..3560349d6305 100644
--- a/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts
+++ b/arch/arm64/boot/dts/ti/k3-am625-beagleplay.dts
@@ -903,6 +903,4 @@ &mcasp1 {
0 0 0 0
0 0 0 0
>;
- tx-num-evt = <32>;
- rx-num-evt = <32>;
};
diff --git a/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi b/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi
index 677ff8de4b6e..0f8c0f6a0f57 100644
--- a/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi
+++ b/arch/arm64/boot/dts/ti/k3-am62x-sk-common.dtsi
@@ -481,8 +481,6 @@ &mcasp1 {
0 0 0 0
0 0 0 0
>;
- tx-num-evt = <32>;
- rx-num-evt = <32>;
};
&dss {
diff --git a/arch/loongarch/kernel/hw_breakpoint.c b/arch/loongarch/kernel/hw_breakpoint.c
index 621ad7634df7..a6e4b605bfa8 100644
--- a/arch/loongarch/kernel/hw_breakpoint.c
+++ b/arch/loongarch/kernel/hw_breakpoint.c
@@ -221,7 +221,7 @@ static int hw_breakpoint_control(struct perf_event *bp,
}
enable = csr_read64(LOONGARCH_CSR_CRMD);
csr_write64(CSR_CRMD_WE | enable, LOONGARCH_CSR_CRMD);
- if (bp->hw.target)
+ if (bp->hw.target && test_tsk_thread_flag(bp->hw.target, TIF_LOAD_WATCH))
regs->csr_prmd |= CSR_PRMD_PWE;
break;
case HW_BREAKPOINT_UNINSTALL:
diff --git a/arch/loongarch/kernel/ptrace.c b/arch/loongarch/kernel/ptrace.c
index 200109de1971..19dc6eff45cc 100644
--- a/arch/loongarch/kernel/ptrace.c
+++ b/arch/loongarch/kernel/ptrace.c
@@ -589,6 +589,7 @@ static int ptrace_hbp_set_ctrl(unsigned int note_type,
struct perf_event *bp;
struct perf_event_attr attr;
struct arch_hw_breakpoint_ctrl ctrl;
+ struct thread_info *ti = task_thread_info(tsk);
bp = ptrace_hbp_get_initialised_bp(note_type, tsk, idx);
if (IS_ERR(bp))
@@ -613,8 +614,10 @@ static int ptrace_hbp_set_ctrl(unsigned int note_type,
if (err)
return err;
attr.disabled = 0;
+ set_ti_thread_flag(ti, TIF_LOAD_WATCH);
} else {
attr.disabled = 1;
+ clear_ti_thread_flag(ti, TIF_LOAD_WATCH);
}
return modify_user_hw_breakpoint(bp, &attr);
diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c
index 3137b45750df..b7cb28f5ee29 100644
--- a/arch/m68k/amiga/config.c
+++ b/arch/m68k/amiga/config.c
@@ -180,6 +180,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record)
dev->slotsize = be16_to_cpu(cd->cd_SlotSize);
dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr);
dev->boardsize = be32_to_cpu(cd->cd_BoardSize);
+
+ /* CS-LAB Warp 1260 workaround */
+ if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) &&
+ dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) {
+
+ /* turn off all interrupts */
+ pr_info("Warp 1260 card detected: applying interrupt storm workaround\n");
+ *(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff;
+ }
} else
pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n");
#endif /* CONFIG_ZORRO */
diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c
index 56f02ea2c248..715d1e0d973e 100644
--- a/arch/m68k/atari/ataints.c
+++ b/arch/m68k/atari/ataints.c
@@ -302,11 +302,7 @@ void __init atari_init_IRQ(void)
if (ATARIHW_PRESENT(SCU)) {
/* init the SCU if present */
- tt_scu.sys_mask = 0x10; /* enable VBL (for the cursor) and
- * disable HSYNC interrupts (who
- * needs them?) MFP and SCC are
- * enabled in VME mask
- */
+ tt_scu.sys_mask = 0x0; /* disable all interrupts */
tt_scu.vme_mask = 0x60; /* enable MFP and SCC ints */
} else {
/* If no SCU and no Hades, the HSYNC interrupt needs to be
diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h
index d7f3de9c5d6f..4ba14f3535fc 100644
--- a/arch/m68k/include/asm/cmpxchg.h
+++ b/arch/m68k/include/asm/cmpxchg.h
@@ -32,7 +32,7 @@ static inline unsigned long __arch_xchg(unsigned long x, volatile void * ptr, in
x = tmp;
break;
default:
- tmp = __invalid_xchg_size(x, ptr, size);
+ x = __invalid_xchg_size(x, ptr, size);
break;
}
diff --git a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
index ee3e2153dd13..c0be84a6e81f 100644
--- a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
+++ b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
@@ -23,14 +23,6 @@ cpu0: cpu@0 {
};
};
- memory@200000 {
- compatible = "memory";
- device_type = "memory";
- reg = <0x00000000 0x00200000 0x00000000 0x0ee00000>, /* 238 MB at 2 MB */
- <0x00000000 0x20000000 0x00000000 0x1f000000>, /* 496 MB at 512 MB */
- <0x00000001 0x10000000 0x00000001 0xb0000000>; /* 6912 MB at 4352MB */
- };
-
cpu_clk: cpu_clk {
#clock-cells = <0>;
compatible = "fixed-clock";
@@ -52,6 +44,13 @@ package0: bus@10000000 {
0 0x40000000 0 0x40000000 0 0x40000000
0xfe 0x00000000 0xfe 0x00000000 0 0x40000000>;
+ isa@18000000 {
+ compatible = "isa";
+ #size-cells = <1>;
+ #address-cells = <2>;
+ ranges = <1 0x0 0x0 0x18000000 0x4000>;
+ };
+
pm: reset-controller@1fe07000 {
compatible = "loongson,ls2k-pm";
reg = <0 0x1fe07000 0 0x422>;
@@ -137,7 +136,8 @@ gmac@3,0 {
<13 IRQ_TYPE_LEVEL_LOW>;
interrupt-names = "macirq", "eth_lpi";
interrupt-parent = <&liointc0>;
- phy-mode = "rgmii";
+ phy-mode = "rgmii-id";
+ phy-handle = <&phy1>;
mdio {
#address-cells = <1>;
#size-cells = <0>;
@@ -160,7 +160,8 @@ gmac@3,1 {
<15 IRQ_TYPE_LEVEL_LOW>;
interrupt-names = "macirq", "eth_lpi";
interrupt-parent = <&liointc0>;
- phy-mode = "rgmii";
+ phy-mode = "rgmii-id";
+ phy-handle = <&phy1>;
mdio {
#address-cells = <1>;
#size-cells = <0>;
diff --git a/arch/mips/include/asm/mach-loongson64/boot_param.h b/arch/mips/include/asm/mach-loongson64/boot_param.h
index e007edd6b60a..9218b3ae3383 100644
--- a/arch/mips/include/asm/mach-loongson64/boot_param.h
+++ b/arch/mips/include/asm/mach-loongson64/boot_param.h
@@ -42,12 +42,14 @@ enum loongson_cpu_type {
Legacy_1B = 0x5,
Legacy_2G = 0x6,
Legacy_2H = 0x7,
+ Legacy_2K = 0x8,
Loongson_1A = 0x100,
Loongson_1B = 0x101,
Loongson_2E = 0x200,
Loongson_2F = 0x201,
Loongson_2G = 0x202,
Loongson_2H = 0x203,
+ Loongson_2K = 0x204,
Loongson_3A = 0x300,
Loongson_3B = 0x301
};
diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h
index 23c67c0871b1..696b40beb774 100644
--- a/arch/mips/include/asm/mips-cm.h
+++ b/arch/mips/include/asm/mips-cm.h
@@ -228,6 +228,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status)
GCR_ACCESSOR_RO(32, 0x0f0, cpc_status)
#define CM_GCR_CPC_STATUS_EX BIT(0)
+/* GCR_ACCESS - Controls core/IOCU access to GCRs */
+GCR_ACCESSOR_RW(32, 0x120, access_cm3)
+#define CM_GCR_ACCESS_ACCESSEN GENMASK(7, 0)
+
/* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */
GCR_ACCESSOR_RW(32, 0x130, l2_config)
#define CM_GCR_L2_CONFIG_BYPASS BIT(20)
diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c
index dd55d59b88db..d445f8e849ab 100644
--- a/arch/mips/kernel/smp-cps.c
+++ b/arch/mips/kernel/smp-cps.c
@@ -222,7 +222,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id)
write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB);
/* Ensure the core can access the GCRs */
- set_gcr_access(1 << core);
+ if (mips_cm_revision() < CM_REV_CM3)
+ set_gcr_access(1 << core);
+ else
+ set_gcr_access_cm3(1 << core);
if (mips_cpc_present()) {
/* Reset the core */
diff --git a/arch/mips/loongson64/env.c b/arch/mips/loongson64/env.c
index ef3750a6ffac..09ff05269861 100644
--- a/arch/mips/loongson64/env.c
+++ b/arch/mips/loongson64/env.c
@@ -88,6 +88,12 @@ void __init prom_lefi_init_env(void)
cpu_clock_freq = ecpu->cpu_clock_freq;
loongson_sysconf.cputype = ecpu->cputype;
switch (ecpu->cputype) {
+ case Legacy_2K:
+ case Loongson_2K:
+ smp_group[0] = 0x900000001fe11000;
+ loongson_sysconf.cores_per_node = 2;
+ loongson_sysconf.cores_per_package = 2;
+ break;
case Legacy_3A:
case Loongson_3A:
loongson_sysconf.cores_per_node = 4;
@@ -221,6 +227,8 @@ void __init prom_lefi_init_env(void)
default:
break;
}
+ } else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64R) {
+ loongson_fdt_blob = __dtb_loongson64_2core_2k1000_begin;
} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64G) {
if (loongson_sysconf.bridgetype == LS7A)
loongson_fdt_blob = __dtb_loongson64g_4core_ls7a_begin;
diff --git a/arch/mips/loongson64/reset.c b/arch/mips/loongson64/reset.c
index e420800043b0..2a8e4cd72605 100644
--- a/arch/mips/loongson64/reset.c
+++ b/arch/mips/loongson64/reset.c
@@ -11,6 +11,7 @@
#include <linux/init.h>
#include <linux/kexec.h>
#include <linux/pm.h>
+#include <linux/reboot.h>
#include <linux/slab.h>
#include <asm/bootinfo.h>
@@ -21,36 +22,21 @@
#include <loongson.h>
#include <boot_param.h>
-static void loongson_restart(char *command)
+static int firmware_restart(struct sys_off_data *unusedd)
{
void (*fw_restart)(void) = (void *)loongson_sysconf.restart_addr;
fw_restart();
- while (1) {
- if (cpu_wait)
- cpu_wait();
- }
+ return NOTIFY_DONE;
}
-static void loongson_poweroff(void)
+static int firmware_poweroff(struct sys_off_data *unused)
{
void (*fw_poweroff)(void) = (void *)loongson_sysconf.poweroff_addr;
fw_poweroff();
- while (1) {
- if (cpu_wait)
- cpu_wait();
- }
-}
-
-static void loongson_halt(void)
-{
- pr_notice("\n\n** You can safely turn off the power now **\n\n");
- while (1) {
- if (cpu_wait)
- cpu_wait();
- }
+ return NOTIFY_DONE;
}
#ifdef CONFIG_KEXEC
@@ -154,9 +140,17 @@ static void loongson_crash_shutdown(struct pt_regs *regs)
static int __init mips_reboot_setup(void)
{
- _machine_restart = loongson_restart;
- _machine_halt = loongson_halt;
- pm_power_off = loongson_poweroff;
+ if (loongson_sysconf.restart_addr) {
+ register_sys_off_handler(SYS_OFF_MODE_RESTART,
+ SYS_OFF_PRIO_FIRMWARE,
+ firmware_restart, NULL);
+ }
+
+ if (loongson_sysconf.poweroff_addr) {
+ register_sys_off_handler(SYS_OFF_MODE_POWER_OFF,
+ SYS_OFF_PRIO_FIRMWARE,
+ firmware_poweroff, NULL);
+ }
#ifdef CONFIG_KEXEC
kexec_argv = kmalloc(KEXEC_ARGV_SIZE, GFP_KERNEL);
diff --git a/arch/mips/loongson64/smp.c b/arch/mips/loongson64/smp.c
index e015a26a40f7..979993679d91 100644
--- a/arch/mips/loongson64/smp.c
+++ b/arch/mips/loongson64/smp.c
@@ -466,12 +466,25 @@ static void loongson3_smp_finish(void)
static void __init loongson3_smp_setup(void)
{
int i = 0, num = 0; /* i: physical id, num: logical id */
+ int max_cpus = 0;
init_cpu_possible(cpu_none_mask);
+ for (i = 0; i < ARRAY_SIZE(smp_group); i++) {
+ if (!smp_group[i])
+ break;
+ max_cpus += loongson_sysconf.cores_per_node;
+ }
+
+ if (max_cpus < loongson_sysconf.nr_cpus) {
+ pr_err("SMP Groups are less than the number of CPUs\n");
+ loongson_sysconf.nr_cpus = max_cpus ? max_cpus : 1;
+ }
+
/* For unified kernel, NR_CPUS is the maximum possible value,
* loongson_sysconf.nr_cpus is the really present value
*/
+ i = 0;
while (i < loongson_sysconf.nr_cpus) {
if (loongson_sysconf.reserved_cpus_mask & (1<<i)) {
/* Reserved physical CPU cores */
@@ -492,14 +505,14 @@ static void __init loongson3_smp_setup(void)
__cpu_logical_map[num] = -1;
num++;
}
-
csr_ipi_probe();
ipi_set0_regs_init();
ipi_clear0_regs_init();
ipi_status0_regs_init();
ipi_en0_regs_init();
ipi_mailbox_buf_init();
- ipi_write_enable(0);
+ if (smp_group[0])
+ ipi_write_enable(0);
cpu_set_core(&cpu_data[0],
cpu_logical_map(0) % loongson_sysconf.cores_per_package);
@@ -818,6 +831,9 @@ static int loongson3_disable_clock(unsigned int cpu)
uint64_t core_id = cpu_core(&cpu_data[cpu]);
uint64_t package_id = cpu_data[cpu].package;
+ if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+ return 0;
+
if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
LOONGSON_CHIPCFG(package_id) &= ~(1 << (12 + core_id));
} else {
@@ -832,6 +848,9 @@ static int loongson3_enable_clock(unsigned int cpu)
uint64_t core_id = cpu_core(&cpu_data[cpu]);
uint64_t package_id = cpu_data[cpu].package;
+ if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+ return 0;
+
if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
LOONGSON_CHIPCFG(package_id) |= 1 << (12 + core_id);
} else {
diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c
old mode 100755
new mode 100644
diff --git a/arch/mips/sgi-ip30/ip30-console.c b/arch/mips/sgi-ip30/ip30-console.c
index b91f8c4fdc78..a087b7ebe129 100644
--- a/arch/mips/sgi-ip30/ip30-console.c
+++ b/arch/mips/sgi-ip30/ip30-console.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: GPL-2.0
#include <linux/io.h>
+#include <linux/processor.h>
#include <asm/sn/ioc3.h>
diff --git a/arch/parisc/Kconfig b/arch/parisc/Kconfig
index 722e83edad28..2834a6406497 100644
--- a/arch/parisc/Kconfig
+++ b/arch/parisc/Kconfig
@@ -83,6 +83,7 @@ config PARISC
select HAVE_SOFTIRQ_ON_OWN_STACK if IRQSTACKS
select TRACE_IRQFLAGS_SUPPORT
select HAVE_FUNCTION_DESCRIPTORS if 64BIT
+ select PCI_MSI_ARCH_FALLBACKS if PCI_MSI
help
The PA-RISC microprocessor is designed by Hewlett-Packard and used
diff --git a/arch/powerpc/configs/85xx-hw.config b/arch/powerpc/configs/85xx-hw.config
index 524db76f47b7..8aff83217397 100644
--- a/arch/powerpc/configs/85xx-hw.config
+++ b/arch/powerpc/configs/85xx-hw.config
@@ -24,6 +24,7 @@ CONFIG_FS_ENET=y
CONFIG_FSL_CORENET_CF=y
CONFIG_FSL_DMA=y
CONFIG_FSL_HV_MANAGER=y
+CONFIG_FSL_IFC=y
CONFIG_FSL_PQ_MDIO=y
CONFIG_FSL_RIO=y
CONFIG_FSL_XGMAC_MDIO=y
@@ -58,6 +59,7 @@ CONFIG_INPUT_FF_MEMLESS=m
CONFIG_MARVELL_PHY=y
CONFIG_MDIO_BUS_MUX_GPIO=y
CONFIG_MDIO_BUS_MUX_MMIOREG=y
+CONFIG_MEMORY=y
CONFIG_MMC_SDHCI_OF_ESDHC=y
CONFIG_MMC_SDHCI_PLTFM=y
CONFIG_MMC_SDHCI=y
diff --git a/arch/powerpc/kernel/prom.c b/arch/powerpc/kernel/prom.c
index 77364729a1b6..bf6d8ad3819e 100644
--- a/arch/powerpc/kernel/prom.c
+++ b/arch/powerpc/kernel/prom.c
@@ -327,6 +327,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
void *data)
{
const char *type = of_get_flat_dt_prop(node, "device_type", NULL);
+ const __be32 *cpu_version = NULL;
const __be32 *prop;
const __be32 *intserv;
int i, nthreads;
@@ -410,7 +411,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
prop = of_get_flat_dt_prop(node, "cpu-version", NULL);
if (prop && (be32_to_cpup(prop) & 0xff000000) == 0x0f000000) {
identify_cpu(0, be32_to_cpup(prop));
- seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(prop));
+ cpu_version = prop;
}
check_cpu_feature_properties(node);
@@ -421,6 +422,12 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
}
identical_pvr_fixup(node);
+
+ // We can now add the CPU name & PVR to the hardware description
+ seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
+ if (cpu_version)
+ seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(cpu_version));
+
init_mmu_slb_size(node);
#ifdef CONFIG_PPC64
@@ -858,9 +865,6 @@ void __init early_init_devtree(void *params)
dt_cpu_ftrs_scan();
- // We can now add the CPU name & PVR to the hardware description
- seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
-
/* Retrieve CPU related informations from the flat tree
* (altivec support, boot CPU ID, ...)
*/
diff --git a/arch/powerpc/kvm/book3s_hv.c b/arch/powerpc/kvm/book3s_hv.c
index 0429488ba170..1bb00c721544 100644
--- a/arch/powerpc/kvm/book3s_hv.c
+++ b/arch/powerpc/kvm/book3s_hv.c
@@ -2249,7 +2249,7 @@ static int kvmppc_get_one_reg_hv(struct kvm_vcpu *vcpu, u64 id,
*val = get_reg_val(id, kvmppc_get_siar_hv(vcpu));
break;
case KVM_REG_PPC_SDAR:
- *val = get_reg_val(id, kvmppc_get_siar_hv(vcpu));
+ *val = get_reg_val(id, kvmppc_get_sdar_hv(vcpu));
break;
case KVM_REG_PPC_SIER:
*val = get_reg_val(id, kvmppc_get_sier_hv(vcpu, 0));
@@ -2484,7 +2484,7 @@ static int kvmppc_set_one_reg_hv(struct kvm_vcpu *vcpu, u64 id,
vcpu->arch.mmcrs = set_reg_val(id, *val);
break;
case KVM_REG_PPC_MMCR3:
- *val = get_reg_val(id, vcpu->arch.mmcr[3]);
+ kvmppc_set_mmcr_hv(vcpu, 3, set_reg_val(id, *val));
break;
case KVM_REG_PPC_PMC1 ... KVM_REG_PPC_PMC8:
i = id - KVM_REG_PPC_PMC1;
diff --git a/arch/powerpc/kvm/powerpc.c b/arch/powerpc/kvm/powerpc.c
index 7197c8256668..6cef200c2404 100644
--- a/arch/powerpc/kvm/powerpc.c
+++ b/arch/powerpc/kvm/powerpc.c
@@ -1990,8 +1990,10 @@ static int kvm_vcpu_ioctl_enable_cap(struct kvm_vcpu *vcpu,
break;
r = -ENXIO;
- if (!xive_enabled())
+ if (!xive_enabled()) {
+ fdput(f);
break;
+ }
r = -EPERM;
dev = kvm_device_from_filp(f.file);
diff --git a/arch/powerpc/mm/nohash/8xx.c b/arch/powerpc/mm/nohash/8xx.c
index a642a7929892..324501630278 100644
--- a/arch/powerpc/mm/nohash/8xx.c
+++ b/arch/powerpc/mm/nohash/8xx.c
@@ -92,7 +92,8 @@ static int __ref __early_map_kernel_hugepage(unsigned long va, phys_addr_t pa,
return -EINVAL;
set_huge_pte_at(&init_mm, va, ptep,
- pte_mkhuge(pfn_pte(pa >> PAGE_SHIFT, prot)), psize);
+ pte_mkhuge(pfn_pte(pa >> PAGE_SHIFT, prot)),
+ 1UL << mmu_psize_to_shift(psize));
return 0;
}
diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c
index 75fa98221d48..af105e1bc3fc 100644
--- a/arch/powerpc/xmon/ppc-dis.c
+++ b/arch/powerpc/xmon/ppc-dis.c
@@ -122,32 +122,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr)
bool insn_is_short;
ppc_cpu_t dialect;
- dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON
- | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC;
+ dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON;
- if (cpu_has_feature(CPU_FTRS_POWER5))
- dialect |= PPC_OPCODE_POWER5;
+ if (IS_ENABLED(CONFIG_PPC64))
+ dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL |
+ PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 |
+ PPC_OPCODE_POWER9;
- if (cpu_has_feature(CPU_FTRS_CELL))
- dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC);
+ if (cpu_has_feature(CPU_FTR_TM))
+ dialect |= PPC_OPCODE_HTM;
- if (cpu_has_feature(CPU_FTRS_POWER6))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC);
+ if (cpu_has_feature(CPU_FTR_ALTIVEC))
+ dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2;
- if (cpu_has_feature(CPU_FTRS_POWER7))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX);
-
- if (cpu_has_feature(CPU_FTRS_POWER8))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
- | PPC_OPCODE_POWER8 | PPC_OPCODE_HTM
- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX);
-
- if (cpu_has_feature(CPU_FTRS_POWER9))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
- | PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM
- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2
- | PPC_OPCODE_VSX | PPC_OPCODE_VSX3);
+ if (cpu_has_feature(CPU_FTR_VSX))
+ dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3;
/* Get the major opcode of the insn. */
opcode = NULL;
diff --git a/arch/s390/kernel/perf_cpum_cf.c b/arch/s390/kernel/perf_cpum_cf.c
index 850c11ea631a..5466e7bada03 100644
--- a/arch/s390/kernel/perf_cpum_cf.c
+++ b/arch/s390/kernel/perf_cpum_cf.c
@@ -556,25 +556,31 @@ static int cfdiag_diffctr(struct cpu_cf_events *cpuhw, unsigned long auth)
struct cf_trailer_entry *trailer_start, *trailer_stop;
struct cf_ctrset_entry *ctrstart, *ctrstop;
size_t offset = 0;
+ int i;
- auth &= (1 << CPUMF_LCCTL_ENABLE_SHIFT) - 1;
- do {
+ for (i = CPUMF_CTR_SET_BASIC; i < CPUMF_CTR_SET_MAX; ++i) {
ctrstart = (struct cf_ctrset_entry *)(cpuhw->start + offset);
ctrstop = (struct cf_ctrset_entry *)(cpuhw->stop + offset);
+ /* Counter set not authorized */
+ if (!(auth & cpumf_ctr_ctl[i]))
+ continue;
+ /* Counter set size zero was not saved */
+ if (!cpum_cf_read_setsize(i))
+ continue;
+
if (memcmp(ctrstop, ctrstart, sizeof(*ctrstop))) {
pr_err_once("cpum_cf_diag counter set compare error "
"in set %i\n", ctrstart->set);
return 0;
}
- auth &= ~cpumf_ctr_ctl[ctrstart->set];
if (ctrstart->def == CF_DIAG_CTRSET_DEF) {
cfdiag_diffctrset((u64 *)(ctrstart + 1),
(u64 *)(ctrstop + 1), ctrstart->ctr);
offset += ctrstart->ctr * sizeof(u64) +
sizeof(*ctrstart);
}
- } while (ctrstart->def && auth);
+ }
/* Save time_stamp from start of event in stop's trailer */
trailer_start = (struct cf_trailer_entry *)(cpuhw->start + offset);
diff --git a/arch/s390/kernel/uv.c b/arch/s390/kernel/uv.c
index fc07bc39e698..81fdee22a497 100644
--- a/arch/s390/kernel/uv.c
+++ b/arch/s390/kernel/uv.c
@@ -181,36 +181,36 @@ int uv_convert_owned_from_secure(unsigned long paddr)
}
/*
- * Calculate the expected ref_count for a page that would otherwise have no
+ * Calculate the expected ref_count for a folio that would otherwise have no
* further pins. This was cribbed from similar functions in other places in
* the kernel, but with some slight modifications. We know that a secure
- * page can not be a huge page for example.
+ * folio can not be a large folio, for example.
*/
-static int expected_page_refs(struct page *page)
+static int expected_folio_refs(struct folio *folio)
{
int res;
- res = page_mapcount(page);
- if (PageSwapCache(page)) {
+ res = folio_mapcount(folio);
+ if (folio_test_swapcache(folio)) {
res++;
- } else if (page_mapping(page)) {
+ } else if (folio_mapping(folio)) {
res++;
- if (page_has_private(page))
+ if (folio->private)
res++;
}
return res;
}
-static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
+static int make_folio_secure(struct folio *folio, struct uv_cb_header *uvcb)
{
int expected, cc = 0;
- if (PageWriteback(page))
+ if (folio_test_writeback(folio))
return -EAGAIN;
- expected = expected_page_refs(page);
- if (!page_ref_freeze(page, expected))
+ expected = expected_folio_refs(folio);
+ if (!folio_ref_freeze(folio, expected))
return -EBUSY;
- set_bit(PG_arch_1, &page->flags);
+ set_bit(PG_arch_1, &folio->flags);
/*
* If the UVC does not succeed or fail immediately, we don't want to
* loop for long, or we might get stall notifications.
@@ -220,9 +220,9 @@ static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
* -EAGAIN and we let the callers deal with it.
*/
cc = __uv_call(0, (u64)uvcb);
- page_ref_unfreeze(page, expected);
+ folio_ref_unfreeze(folio, expected);
/*
- * Return -ENXIO if the page was not mapped, -EINVAL for other errors.
+ * Return -ENXIO if the folio was not mapped, -EINVAL for other errors.
* If busy or partially completed, return -EAGAIN.
*/
if (cc == UVC_CC_OK)
@@ -277,7 +277,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
bool local_drain = false;
spinlock_t *ptelock;
unsigned long uaddr;
- struct page *page;
+ struct folio *folio;
pte_t *ptep;
int rc;
@@ -306,15 +306,26 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
if (!ptep)
goto out;
if (pte_present(*ptep) && !(pte_val(*ptep) & _PAGE_INVALID) && pte_write(*ptep)) {
- page = pte_page(*ptep);
+ folio = page_folio(pte_page(*ptep));
+ rc = -EINVAL;
+ if (folio_test_large(folio))
+ goto unlock;
rc = -EAGAIN;
- if (trylock_page(page)) {
+ if (folio_trylock(folio)) {
if (should_export_before_import(uvcb, gmap->mm))
- uv_convert_from_secure(page_to_phys(page));
- rc = make_page_secure(page, uvcb);
- unlock_page(page);
+ uv_convert_from_secure(PFN_PHYS(folio_pfn(folio)));
+ rc = make_folio_secure(folio, uvcb);
+ folio_unlock(folio);
}
+
+ /*
+ * Once we drop the PTL, the folio may get unmapped and
+ * freed immediately. We need a temporary reference.
+ */
+ if (rc == -EAGAIN)
+ folio_get(folio);
}
+unlock:
pte_unmap_unlock(ptep, ptelock);
out:
mmap_read_unlock(gmap->mm);
@@ -324,10 +335,11 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
* If we are here because the UVC returned busy or partial
* completion, this is just a useless check, but it is safe.
*/
- wait_on_page_writeback(page);
+ folio_wait_writeback(folio);
+ folio_put(folio);
} else if (rc == -EBUSY) {
/*
- * If we have tried a local drain and the page refcount
+ * If we have tried a local drain and the folio refcount
* still does not match our expected safe value, try with a
* system wide drain. This is needed if the pagevecs holding
* the page are on a different CPU.
@@ -338,7 +350,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
return -EAGAIN;
}
/*
- * We are here if the page refcount does not match the
+ * We are here if the folio refcount does not match the
* expected safe value. The main culprits are usually
* pagevecs. With lru_add_drain() we drain the pagevecs
* on the local CPU so that hopefully the refcount will
diff --git a/arch/s390/mm/fault.c b/arch/s390/mm/fault.c
index b678295931c3..1a231181a413 100644
--- a/arch/s390/mm/fault.c
+++ b/arch/s390/mm/fault.c
@@ -331,14 +331,16 @@ static noinline void do_fault_error(struct pt_regs *regs, vm_fault_t fault)
do_no_context(regs, fault);
else
do_sigsegv(regs, SEGV_MAPERR);
- } else if (fault & VM_FAULT_SIGBUS) {
+ } else if (fault & (VM_FAULT_SIGBUS | VM_FAULT_HWPOISON)) {
/* Kernel mode? Handle exceptions or die */
if (!user_mode(regs))
do_no_context(regs, fault);
else
do_sigbus(regs);
- } else
+ } else {
+ pr_emerg("Unexpected fault flags: %08x\n", fault);
BUG();
+ }
break;
}
}
diff --git a/arch/s390/pci/pci_irq.c b/arch/s390/pci/pci_irq.c
index 0ef83b6ac0db..84482a921332 100644
--- a/arch/s390/pci/pci_irq.c
+++ b/arch/s390/pci/pci_irq.c
@@ -268,33 +268,20 @@ static void zpci_floating_irq_handler(struct airq_struct *airq,
}
}
-int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+static int __alloc_airq(struct zpci_dev *zdev, int msi_vecs,
+ unsigned long *bit)
{
- struct zpci_dev *zdev = to_zpci(pdev);
- unsigned int hwirq, msi_vecs, cpu;
- unsigned long bit;
- struct msi_desc *msi;
- struct msi_msg msg;
- int cpu_addr;
- int rc, irq;
-
- zdev->aisb = -1UL;
- zdev->msi_first_bit = -1U;
- if (type == PCI_CAP_ID_MSI && nvec > 1)
- return 1;
- msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
-
if (irq_delivery == DIRECTED) {
/* Allocate cpu vector bits */
- bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
- if (bit == -1UL)
+ *bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
+ if (*bit == -1UL)
return -EIO;
} else {
/* Allocate adapter summary indicator bit */
- bit = airq_iv_alloc_bit(zpci_sbv);
- if (bit == -1UL)
+ *bit = airq_iv_alloc_bit(zpci_sbv);
+ if (*bit == -1UL)
return -EIO;
- zdev->aisb = bit;
+ zdev->aisb = *bit;
/* Create adapter interrupt vector */
zdev->aibv = airq_iv_create(msi_vecs, AIRQ_IV_DATA | AIRQ_IV_BITLOCK, NULL);
@@ -302,27 +289,66 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
return -ENOMEM;
/* Wire up shortcut pointer */
- zpci_ibv[bit] = zdev->aibv;
+ zpci_ibv[*bit] = zdev->aibv;
/* Each function has its own interrupt vector */
- bit = 0;
+ *bit = 0;
}
+ return 0;
+}
- /* Request MSI interrupts */
+int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+{
+ unsigned int hwirq, msi_vecs, irqs_per_msi, i, cpu;
+ struct zpci_dev *zdev = to_zpci(pdev);
+ struct msi_desc *msi;
+ struct msi_msg msg;
+ unsigned long bit;
+ int cpu_addr;
+ int rc, irq;
+
+ zdev->aisb = -1UL;
+ zdev->msi_first_bit = -1U;
+
+ msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
+ if (msi_vecs < nvec) {
+ pr_info("%s requested %d irqs, allocate system limit of %d",
+ pci_name(pdev), nvec, zdev->max_msi);
+ }
+
+ rc = __alloc_airq(zdev, msi_vecs, &bit);
+ if (rc < 0)
+ return rc;
+
+ /*
+ * Request MSI interrupts:
+ * When using MSI, nvec_used interrupt sources and their irq
+ * descriptors are controlled through one msi descriptor.
+ * Thus the outer loop over msi descriptors shall run only once,
+ * while two inner loops iterate over the interrupt vectors.
+ * When using MSI-X, each interrupt vector/irq descriptor
+ * is bound to exactly one msi descriptor (nvec_used is one).
+ * So the inner loops are executed once, while the outer iterates
+ * over the MSI-X descriptors.
+ */
hwirq = bit;
msi_for_each_desc(msi, &pdev->dev, MSI_DESC_NOTASSOCIATED) {
- rc = -EIO;
if (hwirq - bit >= msi_vecs)
break;
- irq = __irq_alloc_descs(-1, 0, 1, 0, THIS_MODULE,
- (irq_delivery == DIRECTED) ?
- msi->affinity : NULL);
+ irqs_per_msi = min_t(unsigned int, msi_vecs, msi->nvec_used);
+ irq = __irq_alloc_descs(-1, 0, irqs_per_msi, 0, THIS_MODULE,
+ (irq_delivery == DIRECTED) ?
+ msi->affinity : NULL);
if (irq < 0)
return -ENOMEM;
- rc = irq_set_msi_desc(irq, msi);
- if (rc)
- return rc;
- irq_set_chip_and_handler(irq, &zpci_irq_chip,
- handle_percpu_irq);
+
+ for (i = 0; i < irqs_per_msi; i++) {
+ rc = irq_set_msi_desc_off(irq, i, msi);
+ if (rc)
+ return rc;
+ irq_set_chip_and_handler(irq + i, &zpci_irq_chip,
+ handle_percpu_irq);
+ }
+
msg.data = hwirq - bit;
if (irq_delivery == DIRECTED) {
if (msi->affinity)
@@ -335,31 +361,35 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
msg.address_lo |= (cpu_addr << 8);
for_each_possible_cpu(cpu) {
- airq_iv_set_data(zpci_ibv[cpu], hwirq, irq);
+ for (i = 0; i < irqs_per_msi; i++)
+ airq_iv_set_data(zpci_ibv[cpu],
+ hwirq + i, irq + i);
}
} else {
msg.address_lo = zdev->msi_addr & 0xffffffff;
- airq_iv_set_data(zdev->aibv, hwirq, irq);
+ for (i = 0; i < irqs_per_msi; i++)
+ airq_iv_set_data(zdev->aibv, hwirq + i, irq + i);
}
msg.address_hi = zdev->msi_addr >> 32;
pci_write_msi_msg(irq, &msg);
- hwirq++;
+ hwirq += irqs_per_msi;
}
zdev->msi_first_bit = bit;
- zdev->msi_nr_irqs = msi_vecs;
+ zdev->msi_nr_irqs = hwirq - bit;
rc = zpci_set_irq(zdev);
if (rc)
return rc;
- return (msi_vecs == nvec) ? 0 : msi_vecs;
+ return (zdev->msi_nr_irqs == nvec) ? 0 : zdev->msi_nr_irqs;
}
void arch_teardown_msi_irqs(struct pci_dev *pdev)
{
struct zpci_dev *zdev = to_zpci(pdev);
struct msi_desc *msi;
+ unsigned int i;
int rc;
/* Disable interrupts */
@@ -369,8 +399,10 @@ void arch_teardown_msi_irqs(struct pci_dev *pdev)
/* Release MSI interrupts */
msi_for_each_desc(msi, &pdev->dev, MSI_DESC_ASSOCIATED) {
- irq_set_msi_desc(msi->irq, NULL);
- irq_free_desc(msi->irq);
+ for (i = 0; i < msi->nvec_used; i++) {
+ irq_set_msi_desc(msi->irq + i, NULL);
+ irq_free_desc(msi->irq + i);
+ }
msi->msg.address_lo = 0;
msi->msg.address_hi = 0;
msi->msg.data = 0;
diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h
index a67abebd4359..1b86d02a8455 100644
--- a/arch/sparc/include/asm/oplib_64.h
+++ b/arch/sparc/include/asm/oplib_64.h
@@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void);
int prom_ihandle2path(int handle, char *buffer, int bufsize);
/* Client interface level routines. */
+void prom_cif_init(void *cif_handler);
void p1275_cmd_direct(unsigned long *);
#endif /* !(__SPARC64_OPLIB_H) */
diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c
index 103aa9104318..f7b8a1a865b8 100644
--- a/arch/sparc/prom/init_64.c
+++ b/arch/sparc/prom/init_64.c
@@ -26,9 +26,6 @@ phandle prom_chosen_node;
* routines in the prom library.
* It gets passed the pointer to the PROM vector.
*/
-
-extern void prom_cif_init(void *);
-
void __init prom_init(void *cif_handler)
{
phandle node;
diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c
index 889aa602f8d8..51c3f984bbf7 100644
--- a/arch/sparc/prom/p1275.c
+++ b/arch/sparc/prom/p1275.c
@@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args)
local_irq_restore(flags);
}
-void prom_cif_init(void *cif_handler, void *cif_stack)
+void prom_cif_init(void *cif_handler)
{
p1275buf.prom_cif_handler = (void (*)(long *))cif_handler;
}
diff --git a/arch/um/drivers/ubd_kern.c b/arch/um/drivers/ubd_kern.c
index 81405aeab8bf..ef7b4b911a45 100644
--- a/arch/um/drivers/ubd_kern.c
+++ b/arch/um/drivers/ubd_kern.c
@@ -456,43 +456,31 @@ static int bulk_req_safe_read(
return n;
}
-/* Called without dev->lock held, and only in interrupt context. */
-static void ubd_handler(void)
+static void ubd_end_request(struct io_thread_req *io_req)
{
- int n;
- int count;
-
- while(1){
- n = bulk_req_safe_read(
- thread_fd,
- irq_req_buffer,
- &irq_remainder,
- &irq_remainder_size,
- UBD_REQ_BUFFER_SIZE
- );
- if (n < 0) {
- if(n == -EAGAIN)
- break;
- printk(KERN_ERR "spurious interrupt in ubd_handler, "
- "err = %d\n", -n);
- return;
- }
- for (count = 0; count < n/sizeof(struct io_thread_req *); count++) {
- struct io_thread_req *io_req = (*irq_req_buffer)[count];
-
- if ((io_req->error == BLK_STS_NOTSUPP) && (req_op(io_req->req) == REQ_OP_DISCARD)) {
- blk_queue_max_discard_sectors(io_req->req->q, 0);
- blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
- }
- blk_mq_end_request(io_req->req, io_req->error);
- kfree(io_req);
- }
+ if (io_req->error == BLK_STS_NOTSUPP) {
+ if (req_op(io_req->req) == REQ_OP_DISCARD)
+ blk_queue_max_discard_sectors(io_req->req->q, 0);
+ else if (req_op(io_req->req) == REQ_OP_WRITE_ZEROES)
+ blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
}
+ blk_mq_end_request(io_req->req, io_req->error);
+ kfree(io_req);
}
static irqreturn_t ubd_intr(int irq, void *dev)
{
- ubd_handler();
+ int len, i;
+
+ while ((len = bulk_req_safe_read(thread_fd, irq_req_buffer,
+ &irq_remainder, &irq_remainder_size,
+ UBD_REQ_BUFFER_SIZE)) >= 0) {
+ for (i = 0; i < len / sizeof(struct io_thread_req *); i++)
+ ubd_end_request((*irq_req_buffer)[i]);
+ }
+
+ if (len < 0 && len != -EAGAIN)
+ pr_err("spurious interrupt in %s, err = %d\n", __func__, len);
return IRQ_HANDLED;
}
diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c
index 3e270da6b6f6..c8c4ef94c753 100644
--- a/arch/um/kernel/time.c
+++ b/arch/um/kernel/time.c
@@ -874,9 +874,9 @@ int setup_time_travel_start(char *str)
return 1;
}
-__setup("time-travel-start", setup_time_travel_start);
+__setup("time-travel-start=", setup_time_travel_start);
__uml_help(setup_time_travel_start,
-"time-travel-start=<seconds>\n"
+"time-travel-start=<nanoseconds>\n"
"Configure the UML instance's wall clock to start at this value rather than\n"
"the host's wall clock at the time of UML boot.\n");
#endif
diff --git a/arch/um/os-Linux/signal.c b/arch/um/os-Linux/signal.c
index 24a403a70a02..850d21e6473e 100644
--- a/arch/um/os-Linux/signal.c
+++ b/arch/um/os-Linux/signal.c
@@ -8,6 +8,7 @@
#include <stdlib.h>
#include <stdarg.h>
+#include <stdbool.h>
#include <errno.h>
#include <signal.h>
#include <string.h>
@@ -65,9 +66,7 @@ static void sig_handler_common(int sig, struct siginfo *si, mcontext_t *mc)
int signals_enabled;
#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
-static int signals_blocked;
-#else
-#define signals_blocked 0
+static int signals_blocked, signals_blocked_pending;
#endif
static unsigned int signals_pending;
static unsigned int signals_active = 0;
@@ -76,14 +75,27 @@ void sig_handler(int sig, struct siginfo *si, mcontext_t *mc)
{
int enabled = signals_enabled;
- if ((signals_blocked || !enabled) && (sig == SIGIO)) {
+#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
+ if ((signals_blocked ||
+ __atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) &&
+ (sig == SIGIO)) {
+ /* increment so unblock will do another round */
+ __atomic_add_fetch(&signals_blocked_pending, 1,
+ __ATOMIC_SEQ_CST);
+ return;
+ }
+#endif
+
+ if (!enabled && (sig == SIGIO)) {
/*
* In TT_MODE_EXTERNAL, need to still call time-travel
- * handlers unless signals are also blocked for the
- * external time message processing. This will mark
- * signals_pending by itself (only if necessary.)
+ * handlers. This will mark signals_pending by itself
+ * (only if necessary.)
+ * Note we won't get here if signals are hard-blocked
+ * (which is handled above), in that case the hard-
+ * unblock will handle things.
*/
- if (!signals_blocked && time_travel_mode == TT_MODE_EXTERNAL)
+ if (time_travel_mode == TT_MODE_EXTERNAL)
sigio_run_timetravel_handlers();
else
signals_pending |= SIGIO_MASK;
@@ -380,33 +392,99 @@ int um_set_signals_trace(int enable)
#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
void mark_sigio_pending(void)
{
+ /*
+ * It would seem that this should be atomic so
+ * it isn't a read-modify-write with a signal
+ * that could happen in the middle, losing the
+ * value set by the signal.
+ *
+ * However, this function is only called when in
+ * time-travel=ext simulation mode, in which case
+ * the only signal ever pending is SIGIO, which
+ * is blocked while this can be called, and the
+ * timer signal (SIGALRM) cannot happen.
+ */
signals_pending |= SIGIO_MASK;
}
void block_signals_hard(void)
{
- if (signals_blocked)
- return;
- signals_blocked = 1;
+ signals_blocked++;
barrier();
}
void unblock_signals_hard(void)
{
+ static bool unblocking;
+
if (!signals_blocked)
+ panic("unblocking signals while not blocked");
+
+ if (--signals_blocked)
return;
- /* Must be set to 0 before we check the pending bits etc. */
- signals_blocked = 0;
+ /*
+ * Must be set to 0 before we check pending so the
+ * SIGIO handler will run as normal unless we're still
+ * going to process signals_blocked_pending.
+ */
barrier();
- if (signals_pending && signals_enabled) {
- /* this is a bit inefficient, but that's not really important */
- block_signals();
- unblock_signals();
- } else if (signals_pending & SIGIO_MASK) {
- /* we need to run time-travel handlers even if not enabled */
- sigio_run_timetravel_handlers();
+ /*
+ * Note that block_signals_hard()/unblock_signals_hard() can be called
+ * within the unblock_signals()/sigio_run_timetravel_handlers() below.
+ * This would still be prone to race conditions since it's actually a
+ * call _within_ e.g. vu_req_read_message(), where we observed this
+ * issue, which loops. Thus, if the inner call handles the recorded
+ * pending signals, we can get out of the inner call with the real
+ * signal hander no longer blocked, and still have a race. Thus don't
+ * handle unblocking in the inner call, if it happens, but only in
+ * the outermost call - 'unblocking' serves as an ownership for the
+ * signals_blocked_pending decrement.
+ */
+ if (unblocking)
+ return;
+ unblocking = true;
+
+ while (__atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) {
+ if (signals_enabled) {
+ /* signals are enabled so we can touch this */
+ signals_pending |= SIGIO_MASK;
+ /*
+ * this is a bit inefficient, but that's
+ * not really important
+ */
+ block_signals();
+ unblock_signals();
+ } else {
+ /*
+ * we need to run time-travel handlers even
+ * if not enabled
+ */
+ sigio_run_timetravel_handlers();
+ }
+
+ /*
+ * The decrement of signals_blocked_pending must be atomic so
+ * that the signal handler will either happen before or after
+ * the decrement, not during a read-modify-write:
+ * - If it happens before, it can increment it and we'll
+ * decrement it and do another round in the loop.
+ * - If it happens after it'll see 0 for both signals_blocked
+ * and signals_blocked_pending and thus run the handler as
+ * usual (subject to signals_enabled, but that's unrelated.)
+ *
+ * Note that a call to unblock_signals_hard() within the calls
+ * to unblock_signals() or sigio_run_timetravel_handlers() above
+ * will do nothing due to the 'unblocking' state, so this cannot
+ * underflow as the only one decrementing will be the outermost
+ * one.
+ */
+ if (__atomic_sub_fetch(&signals_blocked_pending, 1,
+ __ATOMIC_SEQ_CST) < 0)
+ panic("signals_blocked_pending underflow");
}
+
+ unblocking = false;
}
#endif
diff --git a/arch/x86/Kconfig.assembler b/arch/x86/Kconfig.assembler
index 8ad41da301e5..16d0b022d6ff 100644
--- a/arch/x86/Kconfig.assembler
+++ b/arch/x86/Kconfig.assembler
@@ -26,6 +26,6 @@ config AS_GFNI
Supported by binutils >= 2.30 and LLVM integrated assembler
config AS_WRUSS
- def_bool $(as-instr,wrussq %rax$(comma)(%rbx))
+ def_bool $(as-instr64,wrussq %rax$(comma)(%rbx))
help
Supported by binutils >= 2.31 and LLVM integrated assembler
diff --git a/arch/x86/events/core.c b/arch/x86/events/core.c
index c688cb22dcd6..8811fedc9776 100644
--- a/arch/x86/events/core.c
+++ b/arch/x86/events/core.c
@@ -2547,6 +2547,7 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
struct device_attribute *attr,
const char *buf, size_t count)
{
+ static DEFINE_MUTEX(rdpmc_mutex);
unsigned long val;
ssize_t ret;
@@ -2560,6 +2561,8 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
if (x86_pmu.attr_rdpmc_broken)
return -ENOTSUPP;
+ guard(mutex)(&rdpmc_mutex);
+
if (val != x86_pmu.attr_rdpmc) {
/*
* Changing into or out of never available or always available,
diff --git a/arch/x86/events/intel/cstate.c b/arch/x86/events/intel/cstate.c
index 96fffb2d521d..cc6609cbfc8d 100644
--- a/arch/x86/events/intel/cstate.c
+++ b/arch/x86/events/intel/cstate.c
@@ -80,7 +80,7 @@
* MSR_PKG_C7_RESIDENCY: Package C7 Residency Counter.
* perf code: 0x03
* Available model: NHM,WSM,SNB,IVB,HSW,BDW,SKL,CNL,
- * KBL,CML,ICL,TGL,RKL,ADL,RPL,MTL
+ * KBL,CML,ICL,TGL,RKL
* Scope: Package (physical package)
* MSR_PKG_C8_RESIDENCY: Package C8 Residency Counter.
* perf code: 0x04
@@ -89,8 +89,7 @@
* Scope: Package (physical package)
* MSR_PKG_C9_RESIDENCY: Package C9 Residency Counter.
* perf code: 0x05
- * Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL,
- * ADL,RPL,MTL
+ * Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL
* Scope: Package (physical package)
* MSR_PKG_C10_RESIDENCY: Package C10 Residency Counter.
* perf code: 0x06
@@ -582,9 +581,7 @@ static const struct cstate_model adl_cstates __initconst = {
.pkg_events = BIT(PERF_CSTATE_PKG_C2_RES) |
BIT(PERF_CSTATE_PKG_C3_RES) |
BIT(PERF_CSTATE_PKG_C6_RES) |
- BIT(PERF_CSTATE_PKG_C7_RES) |
BIT(PERF_CSTATE_PKG_C8_RES) |
- BIT(PERF_CSTATE_PKG_C9_RES) |
BIT(PERF_CSTATE_PKG_C10_RES),
};
diff --git a/arch/x86/events/intel/ds.c b/arch/x86/events/intel/ds.c
index 2b53f696c3c9..b592bed9ebcc 100644
--- a/arch/x86/events/intel/ds.c
+++ b/arch/x86/events/intel/ds.c
@@ -1830,8 +1830,12 @@ static void setup_pebs_adaptive_sample_data(struct perf_event *event,
set_linear_ip(regs, basic->ip);
regs->flags = PERF_EFLAGS_EXACT;
- if ((sample_type & PERF_SAMPLE_WEIGHT_STRUCT) && (x86_pmu.flags & PMU_FL_RETIRE_LATENCY))
- data->weight.var3_w = format_size >> PEBS_RETIRE_LATENCY_OFFSET & PEBS_LATENCY_MASK;
+ if (sample_type & PERF_SAMPLE_WEIGHT_STRUCT) {
+ if (x86_pmu.flags & PMU_FL_RETIRE_LATENCY)
+ data->weight.var3_w = format_size >> PEBS_RETIRE_LATENCY_OFFSET & PEBS_LATENCY_MASK;
+ else
+ data->weight.var3_w = 0;
+ }
/*
* The record for MEMINFO is in front of GP
diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c
index 42a55794004a..cc5c6a326496 100644
--- a/arch/x86/events/intel/pt.c
+++ b/arch/x86/events/intel/pt.c
@@ -877,7 +877,7 @@ static void pt_update_head(struct pt *pt)
*/
static void *pt_buffer_region(struct pt_buffer *buf)
{
- return phys_to_virt(TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
+ return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
}
/**
@@ -989,7 +989,7 @@ pt_topa_entry_for_page(struct pt_buffer *buf, unsigned int pg)
* order allocations, there shouldn't be many of these.
*/
list_for_each_entry(topa, &buf->tables, list) {
- if (topa->offset + topa->size > pg << PAGE_SHIFT)
+ if (topa->offset + topa->size > (unsigned long)pg << PAGE_SHIFT)
goto found;
}
diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h
index 96906a62aacd..f5e46c04c145 100644
--- a/arch/x86/events/intel/pt.h
+++ b/arch/x86/events/intel/pt.h
@@ -33,8 +33,8 @@ struct topa_entry {
u64 rsvd2 : 1;
u64 size : 4;
u64 rsvd3 : 2;
- u64 base : 36;
- u64 rsvd4 : 16;
+ u64 base : 40;
+ u64 rsvd4 : 12;
};
/* TSC to Core Crystal Clock Ratio */
diff --git a/arch/x86/events/intel/uncore_snbep.c b/arch/x86/events/intel/uncore_snbep.c
index 49bc27ab26ad..a8f11e60b987 100644
--- a/arch/x86/events/intel/uncore_snbep.c
+++ b/arch/x86/events/intel/uncore_snbep.c
@@ -461,6 +461,7 @@
#define SPR_UBOX_DID 0x3250
/* SPR CHA */
+#define SPR_CHA_EVENT_MASK_EXT 0xffffffff
#define SPR_CHA_PMON_CTL_TID_EN (1 << 16)
#define SPR_CHA_PMON_EVENT_MASK (SNBEP_PMON_RAW_EVENT_MASK | \
SPR_CHA_PMON_CTL_TID_EN)
@@ -477,6 +478,7 @@ DEFINE_UNCORE_FORMAT_ATTR(umask_ext, umask, "config:8-15,32-43,45-55");
DEFINE_UNCORE_FORMAT_ATTR(umask_ext2, umask, "config:8-15,32-57");
DEFINE_UNCORE_FORMAT_ATTR(umask_ext3, umask, "config:8-15,32-39");
DEFINE_UNCORE_FORMAT_ATTR(umask_ext4, umask, "config:8-15,32-55");
+DEFINE_UNCORE_FORMAT_ATTR(umask_ext5, umask, "config:8-15,32-63");
DEFINE_UNCORE_FORMAT_ATTR(qor, qor, "config:16");
DEFINE_UNCORE_FORMAT_ATTR(edge, edge, "config:18");
DEFINE_UNCORE_FORMAT_ATTR(tid_en, tid_en, "config:19");
@@ -5954,7 +5956,7 @@ static struct intel_uncore_ops spr_uncore_chabox_ops = {
static struct attribute *spr_uncore_cha_formats_attr[] = {
&format_attr_event.attr,
- &format_attr_umask_ext4.attr,
+ &format_attr_umask_ext5.attr,
&format_attr_tid_en2.attr,
&format_attr_edge.attr,
&format_attr_inv.attr,
@@ -5990,7 +5992,7 @@ ATTRIBUTE_GROUPS(uncore_alias);
static struct intel_uncore_type spr_uncore_chabox = {
.name = "cha",
.event_mask = SPR_CHA_PMON_EVENT_MASK,
- .event_mask_ext = SPR_RAW_EVENT_MASK_EXT,
+ .event_mask_ext = SPR_CHA_EVENT_MASK_EXT,
.num_shared_regs = 1,
.constraints = skx_uncore_chabox_constraints,
.ops = &spr_uncore_chabox_ops,
diff --git a/arch/x86/include/asm/kvm_host.h b/arch/x86/include/asm/kvm_host.h
index ccba66da7a5d..257bf2e71d06 100644
--- a/arch/x86/include/asm/kvm_host.h
+++ b/arch/x86/include/asm/kvm_host.h
@@ -1758,7 +1758,7 @@ struct kvm_x86_nested_ops {
bool (*is_exception_vmexit)(struct kvm_vcpu *vcpu, u8 vector,
u32 error_code);
int (*check_events)(struct kvm_vcpu *vcpu);
- bool (*has_events)(struct kvm_vcpu *vcpu);
+ bool (*has_events)(struct kvm_vcpu *vcpu, bool for_injection);
void (*triple_fault)(struct kvm_vcpu *vcpu);
int (*get_state)(struct kvm_vcpu *vcpu,
struct kvm_nested_state __user *user_kvm_nested_state,
diff --git a/arch/x86/include/asm/shstk.h b/arch/x86/include/asm/shstk.h
index 42fee8959df7..896909f306e3 100644
--- a/arch/x86/include/asm/shstk.h
+++ b/arch/x86/include/asm/shstk.h
@@ -21,6 +21,7 @@ unsigned long shstk_alloc_thread_stack(struct task_struct *p, unsigned long clon
void shstk_free(struct task_struct *p);
int setup_signal_shadow_stack(struct ksignal *ksig);
int restore_signal_shadow_stack(void);
+int shstk_update_last_frame(unsigned long val);
#else
static inline long shstk_prctl(struct task_struct *task, int option,
unsigned long arg2) { return -EINVAL; }
@@ -31,6 +32,7 @@ static inline unsigned long shstk_alloc_thread_stack(struct task_struct *p,
static inline void shstk_free(struct task_struct *p) {}
static inline int setup_signal_shadow_stack(struct ksignal *ksig) { return 0; }
static inline int restore_signal_shadow_stack(void) { return 0; }
+static inline int shstk_update_last_frame(unsigned long val) { return 0; }
#endif /* CONFIG_X86_USER_SHADOW_STACK */
#endif /* __ASSEMBLY__ */
diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c
index 87d38f17ff5c..c13c9cb40b9b 100644
--- a/arch/x86/kernel/devicetree.c
+++ b/arch/x86/kernel/devicetree.c
@@ -82,7 +82,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev)
ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin);
if (ret)
- return ret;
+ return pcibios_err_to_errno(ret);
if (!pin)
return 0;
diff --git a/arch/x86/kernel/shstk.c b/arch/x86/kernel/shstk.c
index 59e15dd8d0f8..19e4db582fb6 100644
--- a/arch/x86/kernel/shstk.c
+++ b/arch/x86/kernel/shstk.c
@@ -577,3 +577,14 @@ long shstk_prctl(struct task_struct *task, int option, unsigned long arg2)
return wrss_control(true);
return -EINVAL;
}
+
+int shstk_update_last_frame(unsigned long val)
+{
+ unsigned long ssp;
+
+ if (!features_enabled(ARCH_SHSTK_SHSTK))
+ return 0;
+
+ ssp = get_user_shstk_addr();
+ return write_user_shstk_64((u64 __user *)ssp, (u64)val);
+}
diff --git a/arch/x86/kernel/uprobes.c b/arch/x86/kernel/uprobes.c
index 6c07f6daaa22..6402fb3089d2 100644
--- a/arch/x86/kernel/uprobes.c
+++ b/arch/x86/kernel/uprobes.c
@@ -1076,8 +1076,13 @@ arch_uretprobe_hijack_return_addr(unsigned long trampoline_vaddr, struct pt_regs
return orig_ret_vaddr;
nleft = copy_to_user((void __user *)regs->sp, &trampoline_vaddr, rasize);
- if (likely(!nleft))
+ if (likely(!nleft)) {
+ if (shstk_update_last_frame(trampoline_vaddr)) {
+ force_sig(SIGSEGV);
+ return -1;
+ }
return orig_ret_vaddr;
+ }
if (nleft != rasize) {
pr_err("return address clobbered: pid=%d, %%sp=%#lx, %%ip=%#lx\n",
diff --git a/arch/x86/kvm/vmx/nested.c b/arch/x86/kvm/vmx/nested.c
index c5ec0ef51ff7..d1b4a85def0a 100644
--- a/arch/x86/kvm/vmx/nested.c
+++ b/arch/x86/kvm/vmx/nested.c
@@ -3962,7 +3962,7 @@ static bool nested_vmx_preemption_timer_pending(struct kvm_vcpu *vcpu)
to_vmx(vcpu)->nested.preemption_timer_expired;
}
-static bool vmx_has_nested_events(struct kvm_vcpu *vcpu)
+static bool vmx_has_nested_events(struct kvm_vcpu *vcpu, bool for_injection)
{
return nested_vmx_preemption_timer_pending(vcpu) ||
to_vmx(vcpu)->nested.mtf_pending;
diff --git a/arch/x86/kvm/vmx/vmx.c b/arch/x86/kvm/vmx/vmx.c
index dae499e2da84..f5f652a546bf 100644
--- a/arch/x86/kvm/vmx/vmx.c
+++ b/arch/x86/kvm/vmx/vmx.c
@@ -5048,14 +5048,19 @@ static int vmx_nmi_allowed(struct kvm_vcpu *vcpu, bool for_injection)
return !vmx_nmi_blocked(vcpu);
}
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
+{
+ return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
+ (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
+ (GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+}
+
bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
{
if (is_guest_mode(vcpu) && nested_exit_on_intr(vcpu))
return false;
- return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
- (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
- (GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+ return __vmx_interrupt_blocked(vcpu);
}
static int vmx_interrupt_allowed(struct kvm_vcpu *vcpu, bool for_injection)
diff --git a/arch/x86/kvm/vmx/vmx.h b/arch/x86/kvm/vmx/vmx.h
index c2130d2c8e24..912b0c469742 100644
--- a/arch/x86/kvm/vmx/vmx.h
+++ b/arch/x86/kvm/vmx/vmx.h
@@ -400,6 +400,7 @@ u64 construct_eptp(struct kvm_vcpu *vcpu, hpa_t root_hpa, int root_level);
bool vmx_guest_inject_ac(struct kvm_vcpu *vcpu);
void vmx_update_exception_bitmap(struct kvm_vcpu *vcpu);
bool vmx_nmi_blocked(struct kvm_vcpu *vcpu);
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
bool vmx_get_nmi_mask(struct kvm_vcpu *vcpu);
void vmx_set_nmi_mask(struct kvm_vcpu *vcpu, bool masked);
diff --git a/arch/x86/kvm/x86.c b/arch/x86/kvm/x86.c
index 9dd4624bdef2..c7e7ab1593d5 100644
--- a/arch/x86/kvm/x86.c
+++ b/arch/x86/kvm/x86.c
@@ -10254,7 +10254,7 @@ static int kvm_check_and_inject_events(struct kvm_vcpu *vcpu,
if (is_guest_mode(vcpu) &&
kvm_x86_ops.nested_ops->has_events &&
- kvm_x86_ops.nested_ops->has_events(vcpu))
+ kvm_x86_ops.nested_ops->has_events(vcpu, true))
*req_immediate_exit = true;
/*
@@ -12882,7 +12882,7 @@ static inline bool kvm_vcpu_has_events(struct kvm_vcpu *vcpu)
if (is_guest_mode(vcpu) &&
kvm_x86_ops.nested_ops->has_events &&
- kvm_x86_ops.nested_ops->has_events(vcpu))
+ kvm_x86_ops.nested_ops->has_events(vcpu, false))
return true;
if (kvm_xen_has_pending_events(vcpu))
diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c
index 8edd62206604..722a33be08a1 100644
--- a/arch/x86/pci/intel_mid_pci.c
+++ b/arch/x86/pci/intel_mid_pci.c
@@ -233,9 +233,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev)
return 0;
ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
- if (ret < 0) {
+ if (ret) {
dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret);
- return ret;
+ return pcibios_err_to_errno(ret);
}
id = x86_match_cpu(intel_mid_cpu_ids);
diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c
index 652cd53e77f6..0f2fe524f60d 100644
--- a/arch/x86/pci/xen.c
+++ b/arch/x86/pci/xen.c
@@ -38,10 +38,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev)
u8 gsi;
rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
- if (rc < 0) {
+ if (rc) {
dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n",
rc);
- return rc;
+ return pcibios_err_to_errno(rc);
}
/* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/
pirq = gsi;
diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c
index fdd49d70b437..c81cea208c2c 100644
--- a/arch/x86/platform/intel/iosf_mbi.c
+++ b/arch/x86/platform/intel/iosf_mbi.c
@@ -62,7 +62,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr)
fail_read:
dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
- return result;
+ return pcibios_err_to_errno(result);
}
static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
@@ -91,7 +91,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
fail_write:
dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
- return result;
+ return pcibios_err_to_errno(result);
}
int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr)
diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c
index 9bdc3b656b2c..4c2bf989edaf 100644
--- a/arch/x86/xen/p2m.c
+++ b/arch/x86/xen/p2m.c
@@ -731,7 +731,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
* immediate unmapping.
*/
map_ops[i].status = GNTST_general_error;
- unmap[0].host_addr = map_ops[i].host_addr,
+ unmap[0].host_addr = map_ops[i].host_addr;
unmap[0].handle = map_ops[i].handle;
map_ops[i].handle = INVALID_GRANT_HANDLE;
if (map_ops[i].flags & GNTMAP_device_map)
@@ -741,7 +741,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
if (kmap_ops) {
kmap_ops[i].status = GNTST_general_error;
- unmap[1].host_addr = kmap_ops[i].host_addr,
+ unmap[1].host_addr = kmap_ops[i].host_addr;
unmap[1].handle = kmap_ops[i].handle;
kmap_ops[i].handle = INVALID_GRANT_HANDLE;
if (kmap_ops[i].flags & GNTMAP_device_map)
diff --git a/block/bio-integrity.c b/block/bio-integrity.c
index ec8ac8cf6e1b..15e444b2fcc1 100644
--- a/block/bio-integrity.c
+++ b/block/bio-integrity.c
@@ -217,6 +217,7 @@ bool bio_integrity_prep(struct bio *bio)
unsigned long start, end;
unsigned int len, nr_pages;
unsigned int bytes, offset, i;
+ gfp_t gfp = GFP_NOIO;
if (!bi)
return true;
@@ -239,11 +240,19 @@ bool bio_integrity_prep(struct bio *bio)
if (!bi->profile->generate_fn ||
!(bi->flags & BLK_INTEGRITY_GENERATE))
return true;
+
+ /*
+ * Zero the memory allocated to not leak uninitialized kernel
+ * memory to disk. For PI this only affects the app tag, but
+ * for non-integrity metadata it affects the entire metadata
+ * buffer.
+ */
+ gfp |= __GFP_ZERO;
}
/* Allocate kernel buffer for protection data */
len = bio_integrity_bytes(bi, bio_sectors(bio));
- buf = kmalloc(len, GFP_NOIO);
+ buf = kmalloc(len, gfp);
if (unlikely(buf == NULL)) {
printk(KERN_ERR "could not allocate integrity buffer\n");
goto err_end_io;
diff --git a/block/blk-mq.c b/block/blk-mq.c
index 4c91889affa7..7cc315527a44 100644
--- a/block/blk-mq.c
+++ b/block/blk-mq.c
@@ -447,6 +447,10 @@ static struct request *__blk_mq_alloc_requests(struct blk_mq_alloc_data *data)
if (data->cmd_flags & REQ_NOWAIT)
data->flags |= BLK_MQ_REQ_NOWAIT;
+retry:
+ data->ctx = blk_mq_get_ctx(q);
+ data->hctx = blk_mq_map_queue(q, data->cmd_flags, data->ctx);
+
if (q->elevator) {
/*
* All requests use scheduler tags when an I/O scheduler is
@@ -468,13 +472,9 @@ static struct request *__blk_mq_alloc_requests(struct blk_mq_alloc_data *data)
if (ops->limit_depth)
ops->limit_depth(data->cmd_flags, data);
}
- }
-
-retry:
- data->ctx = blk_mq_get_ctx(q);
- data->hctx = blk_mq_map_queue(q, data->cmd_flags, data->ctx);
- if (!(data->rq_flags & RQF_SCHED_TAGS))
+ } else {
blk_mq_tag_busy(data->hctx);
+ }
if (data->flags & BLK_MQ_REQ_RESERVED)
data->rq_flags |= RQF_RESV;
diff --git a/block/genhd.c b/block/genhd.c
index 33b1ebf6ef82..203c880c3e1c 100644
--- a/block/genhd.c
+++ b/block/genhd.c
@@ -655,12 +655,12 @@ void del_gendisk(struct gendisk *disk)
*/
if (!test_bit(GD_DEAD, &disk->state))
blk_report_disk_dead(disk, false);
- __blk_mark_disk_dead(disk);
/*
* Drop all partitions now that the disk is marked dead.
*/
mutex_lock(&disk->open_mutex);
+ __blk_mark_disk_dead(disk);
xa_for_each_start(&disk->part_tbl, idx, part, 1)
drop_partition(part);
mutex_unlock(&disk->open_mutex);
diff --git a/block/mq-deadline.c b/block/mq-deadline.c
index 02a916ba62ee..78a8aa204c15 100644
--- a/block/mq-deadline.c
+++ b/block/mq-deadline.c
@@ -621,6 +621,20 @@ static struct request *dd_dispatch_request(struct blk_mq_hw_ctx *hctx)
return rq;
}
+/*
+ * 'depth' is a number in the range 1..INT_MAX representing a number of
+ * requests. Scale it with a factor (1 << bt->sb.shift) / q->nr_requests since
+ * 1..(1 << bt->sb.shift) is the range expected by sbitmap_get_shallow().
+ * Values larger than q->nr_requests have the same effect as q->nr_requests.
+ */
+static int dd_to_word_depth(struct blk_mq_hw_ctx *hctx, unsigned int qdepth)
+{
+ struct sbitmap_queue *bt = &hctx->sched_tags->bitmap_tags;
+ const unsigned int nrr = hctx->queue->nr_requests;
+
+ return ((qdepth << bt->sb.shift) + nrr - 1) / nrr;
+}
+
/*
* Called by __blk_mq_alloc_request(). The shallow_depth value set by this
* function is used by __blk_mq_get_tag().
@@ -637,7 +651,7 @@ static void dd_limit_depth(blk_opf_t opf, struct blk_mq_alloc_data *data)
* Throttle asynchronous requests and writes such that these requests
* do not block the allocation of synchronous requests.
*/
- data->shallow_depth = dd->async_depth;
+ data->shallow_depth = dd_to_word_depth(data->hctx, dd->async_depth);
}
/* Called by blk_mq_update_nr_requests(). */
@@ -647,9 +661,9 @@ static void dd_depth_updated(struct blk_mq_hw_ctx *hctx)
struct deadline_data *dd = q->elevator->elevator_data;
struct blk_mq_tags *tags = hctx->sched_tags;
- dd->async_depth = max(1UL, 3 * q->nr_requests / 4);
+ dd->async_depth = q->nr_requests;
- sbitmap_queue_min_shallow_depth(&tags->bitmap_tags, dd->async_depth);
+ sbitmap_queue_min_shallow_depth(&tags->bitmap_tags, 1);
}
/* Called by blk_mq_init_hctx() and blk_mq_init_sched(). */
diff --git a/drivers/android/binder.c b/drivers/android/binder.c
index e67a91120385..ccaceedbc2c0 100644
--- a/drivers/android/binder.c
+++ b/drivers/android/binder.c
@@ -570,9 +570,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work)
static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread)
{
return !thread->transaction_stack &&
- binder_worklist_empty_ilocked(&thread->todo) &&
- (thread->looper & (BINDER_LOOPER_STATE_ENTERED |
- BINDER_LOOPER_STATE_REGISTERED));
+ binder_worklist_empty_ilocked(&thread->todo);
}
static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc,
diff --git a/drivers/ata/libata-scsi.c b/drivers/ata/libata-scsi.c
index 0e078bf5aba0..77dbd516a054 100644
--- a/drivers/ata/libata-scsi.c
+++ b/drivers/ata/libata-scsi.c
@@ -230,6 +230,80 @@ void ata_scsi_set_sense_information(struct ata_device *dev,
SCSI_SENSE_BUFFERSIZE, information);
}
+/**
+ * ata_scsi_set_passthru_sense_fields - Set ATA fields in sense buffer
+ * @qc: ATA PASS-THROUGH command.
+ *
+ * Populates "ATA Status Return sense data descriptor" / "Fixed format
+ * sense data" with ATA taskfile fields.
+ *
+ * LOCKING:
+ * None.
+ */
+static void ata_scsi_set_passthru_sense_fields(struct ata_queued_cmd *qc)
+{
+ struct scsi_cmnd *cmd = qc->scsicmd;
+ struct ata_taskfile *tf = &qc->result_tf;
+ unsigned char *sb = cmd->sense_buffer;
+
+ if ((sb[0] & 0x7f) >= 0x72) {
+ unsigned char *desc;
+ u8 len;
+
+ /* descriptor format */
+ len = sb[7];
+ desc = (char *)scsi_sense_desc_find(sb, len + 8, 9);
+ if (!desc) {
+ if (SCSI_SENSE_BUFFERSIZE < len + 14)
+ return;
+ sb[7] = len + 14;
+ desc = sb + 8 + len;
+ }
+ desc[0] = 9;
+ desc[1] = 12;
+ /*
+ * Copy registers into sense buffer.
+ */
+ desc[2] = 0x00;
+ desc[3] = tf->error;
+ desc[5] = tf->nsect;
+ desc[7] = tf->lbal;
+ desc[9] = tf->lbam;
+ desc[11] = tf->lbah;
+ desc[12] = tf->device;
+ desc[13] = tf->status;
+
+ /*
+ * Fill in Extend bit, and the high order bytes
+ * if applicable.
+ */
+ if (tf->flags & ATA_TFLAG_LBA48) {
+ desc[2] |= 0x01;
+ desc[4] = tf->hob_nsect;
+ desc[6] = tf->hob_lbal;
+ desc[8] = tf->hob_lbam;
+ desc[10] = tf->hob_lbah;
+ }
+ } else {
+ /* Fixed sense format */
+ sb[0] |= 0x80;
+ sb[3] = tf->error;
+ sb[4] = tf->status;
+ sb[5] = tf->device;
+ sb[6] = tf->nsect;
+ if (tf->flags & ATA_TFLAG_LBA48) {
+ sb[8] |= 0x80;
+ if (tf->hob_nsect)
+ sb[8] |= 0x40;
+ if (tf->hob_lbal || tf->hob_lbam || tf->hob_lbah)
+ sb[8] |= 0x20;
+ }
+ sb[9] = tf->lbal;
+ sb[10] = tf->lbam;
+ sb[11] = tf->lbah;
+ }
+}
+
static void ata_scsi_set_invalid_field(struct ata_device *dev,
struct scsi_cmnd *cmd, u16 field, u8 bit)
{
@@ -837,10 +911,8 @@ static void ata_to_sense_error(unsigned id, u8 drv_stat, u8 drv_err, u8 *sk,
* ata_gen_passthru_sense - Generate check condition sense block.
* @qc: Command that completed.
*
- * This function is specific to the ATA descriptor format sense
- * block specified for the ATA pass through commands. Regardless
- * of whether the command errored or not, return a sense
- * block. Copy all controller registers into the sense
+ * This function is specific to the ATA pass through commands.
+ * Regardless of whether the command errored or not, return a sense
* block. If there was no error, we get the request from an ATA
* passthrough command, so we use the following sense data:
* sk = RECOVERED ERROR
@@ -855,7 +927,6 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc)
struct scsi_cmnd *cmd = qc->scsicmd;
struct ata_taskfile *tf = &qc->result_tf;
unsigned char *sb = cmd->sense_buffer;
- unsigned char *desc = sb + 8;
u8 sense_key, asc, ascq;
memset(sb, 0, SCSI_SENSE_BUFFERSIZE);
@@ -870,67 +941,8 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc)
&sense_key, &asc, &ascq);
ata_scsi_set_sense(qc->dev, cmd, sense_key, asc, ascq);
} else {
- /*
- * ATA PASS-THROUGH INFORMATION AVAILABLE
- * Always in descriptor format sense.
- */
- scsi_build_sense(cmd, 1, RECOVERED_ERROR, 0, 0x1D);
- }
-
- if ((cmd->sense_buffer[0] & 0x7f) >= 0x72) {
- u8 len;
-
- /* descriptor format */
- len = sb[7];
- desc = (char *)scsi_sense_desc_find(sb, len + 8, 9);
- if (!desc) {
- if (SCSI_SENSE_BUFFERSIZE < len + 14)
- return;
- sb[7] = len + 14;
- desc = sb + 8 + len;
- }
- desc[0] = 9;
- desc[1] = 12;
- /*
- * Copy registers into sense buffer.
- */
- desc[2] = 0x00;
- desc[3] = tf->error;
- desc[5] = tf->nsect;
- desc[7] = tf->lbal;
- desc[9] = tf->lbam;
- desc[11] = tf->lbah;
- desc[12] = tf->device;
- desc[13] = tf->status;
-
- /*
- * Fill in Extend bit, and the high order bytes
- * if applicable.
- */
- if (tf->flags & ATA_TFLAG_LBA48) {
- desc[2] |= 0x01;
- desc[4] = tf->hob_nsect;
- desc[6] = tf->hob_lbal;
- desc[8] = tf->hob_lbam;
- desc[10] = tf->hob_lbah;
- }
- } else {
- /* Fixed sense format */
- desc[0] = tf->error;
- desc[1] = tf->status;
- desc[2] = tf->device;
- desc[3] = tf->nsect;
- desc[7] = 0;
- if (tf->flags & ATA_TFLAG_LBA48) {
- desc[8] |= 0x80;
- if (tf->hob_nsect)
- desc[8] |= 0x40;
- if (tf->hob_lbal || tf->hob_lbam || tf->hob_lbah)
- desc[8] |= 0x20;
- }
- desc[9] = tf->lbal;
- desc[10] = tf->lbam;
- desc[11] = tf->lbah;
+ /* ATA PASS-THROUGH INFORMATION AVAILABLE */
+ ata_scsi_set_sense(qc->dev, cmd, RECOVERED_ERROR, 0, 0x1D);
}
}
@@ -1664,26 +1676,32 @@ static void ata_scsi_qc_complete(struct ata_queued_cmd *qc)
{
struct scsi_cmnd *cmd = qc->scsicmd;
u8 *cdb = cmd->cmnd;
- int need_sense = (qc->err_mask != 0) &&
- !(qc->flags & ATA_QCFLAG_SENSE_VALID);
+ bool have_sense = qc->flags & ATA_QCFLAG_SENSE_VALID;
+ bool is_ata_passthru = cdb[0] == ATA_16 || cdb[0] == ATA_12;
+ bool is_ck_cond_request = cdb[2] & 0x20;
+ bool is_error = qc->err_mask != 0;
/* For ATA pass thru (SAT) commands, generate a sense block if
* user mandated it or if there's an error. Note that if we
- * generate because the user forced us to [CK_COND =1], a check
+ * generate because the user forced us to [CK_COND=1], a check
* condition is generated and the ATA register values are returned
* whether the command completed successfully or not. If there
- * was no error, we use the following sense data:
+ * was no error, and CK_COND=1, we use the following sense data:
* sk = RECOVERED ERROR
* asc,ascq = ATA PASS-THROUGH INFORMATION AVAILABLE
*/
- if (((cdb[0] == ATA_16) || (cdb[0] == ATA_12)) &&
- ((cdb[2] & 0x20) || need_sense))
- ata_gen_passthru_sense(qc);
- else if (need_sense)
+ if (is_ata_passthru && (is_ck_cond_request || is_error || have_sense)) {
+ if (!have_sense)
+ ata_gen_passthru_sense(qc);
+ ata_scsi_set_passthru_sense_fields(qc);
+ if (is_ck_cond_request)
+ set_status_byte(qc->scsicmd, SAM_STAT_CHECK_CONDITION);
+ } else if (is_error && !have_sense) {
ata_gen_ata_sense(qc);
- else
+ } else {
/* Keep the SCSI ML and status byte, clear host byte. */
cmd->result &= 0x0000ffff;
+ }
ata_qc_done(qc);
}
@@ -2622,14 +2640,8 @@ static void atapi_qc_complete(struct ata_queued_cmd *qc)
/* handle completion from EH */
if (unlikely(err_mask || qc->flags & ATA_QCFLAG_SENSE_VALID)) {
- if (!(qc->flags & ATA_QCFLAG_SENSE_VALID)) {
- /* FIXME: not quite right; we don't want the
- * translation of taskfile registers into a
- * sense descriptors, since that's only
- * correct for ATA, not ATAPI
- */
+ if (!(qc->flags & ATA_QCFLAG_SENSE_VALID))
ata_gen_passthru_sense(qc);
- }
/* SCSI EH automatically locks door if sdev->locked is
* set. Sometimes door lock request continues to
diff --git a/drivers/auxdisplay/ht16k33.c b/drivers/auxdisplay/ht16k33.c
index 3a2d88387224..b360ddefc423 100644
--- a/drivers/auxdisplay/ht16k33.c
+++ b/drivers/auxdisplay/ht16k33.c
@@ -507,6 +507,7 @@ static int ht16k33_led_probe(struct device *dev, struct led_classdev *led,
led->max_brightness = MAX_BRIGHTNESS;
err = devm_led_classdev_register_ext(dev, led, &init_data);
+ fwnode_handle_put(init_data.fwnode);
if (err)
dev_err(dev, "Failed to register LED\n");
diff --git a/drivers/base/devres.c b/drivers/base/devres.c
index 3df0025d12aa..8d709dbd4e0c 100644
--- a/drivers/base/devres.c
+++ b/drivers/base/devres.c
@@ -896,9 +896,12 @@ void *devm_krealloc(struct device *dev, void *ptr, size_t new_size, gfp_t gfp)
/*
* Otherwise: allocate new, larger chunk. We need to allocate before
* taking the lock as most probably the caller uses GFP_KERNEL.
+ * alloc_dr() will call check_dr_size() to reserve extra memory
+ * for struct devres automatically, so size @new_size user request
+ * is delivered to it directly as devm_kmalloc() does.
*/
new_dr = alloc_dr(devm_kmalloc_release,
- total_new_size, gfp, dev_to_node(dev));
+ new_size, gfp, dev_to_node(dev));
if (!new_dr)
return NULL;
@@ -1222,7 +1225,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu);
*/
void devm_free_percpu(struct device *dev, void __percpu *pdata)
{
- WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match,
+ /*
+ * Use devres_release() to prevent memory leakage as
+ * devm_free_pages() does.
+ */
+ WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match,
(__force void *)pdata));
}
EXPORT_SYMBOL_GPL(devm_free_percpu);
diff --git a/drivers/block/rbd.c b/drivers/block/rbd.c
index 1e2596c5efd8..6fcd7f0fe4f0 100644
--- a/drivers/block/rbd.c
+++ b/drivers/block/rbd.c
@@ -362,7 +362,7 @@ enum rbd_watch_state {
enum rbd_lock_state {
RBD_LOCK_STATE_UNLOCKED,
RBD_LOCK_STATE_LOCKED,
- RBD_LOCK_STATE_RELEASING,
+ RBD_LOCK_STATE_QUIESCING,
};
/* WatchNotify::ClientId */
@@ -422,7 +422,7 @@ struct rbd_device {
struct list_head running_list;
struct completion acquire_wait;
int acquire_err;
- struct completion releasing_wait;
+ struct completion quiescing_wait;
spinlock_t object_map_lock;
u8 *object_map;
@@ -525,7 +525,7 @@ static bool __rbd_is_lock_owner(struct rbd_device *rbd_dev)
lockdep_assert_held(&rbd_dev->lock_rwsem);
return rbd_dev->lock_state == RBD_LOCK_STATE_LOCKED ||
- rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING;
+ rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING;
}
static bool rbd_is_lock_owner(struct rbd_device *rbd_dev)
@@ -3457,13 +3457,14 @@ static void rbd_lock_del_request(struct rbd_img_request *img_req)
lockdep_assert_held(&rbd_dev->lock_rwsem);
spin_lock(&rbd_dev->lock_lists_lock);
if (!list_empty(&img_req->lock_item)) {
+ rbd_assert(!list_empty(&rbd_dev->running_list));
list_del_init(&img_req->lock_item);
- need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING &&
+ need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING &&
list_empty(&rbd_dev->running_list));
}
spin_unlock(&rbd_dev->lock_lists_lock);
if (need_wakeup)
- complete(&rbd_dev->releasing_wait);
+ complete(&rbd_dev->quiescing_wait);
}
static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
@@ -3476,11 +3477,6 @@ static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
if (rbd_lock_add_request(img_req))
return 1;
- if (rbd_dev->opts->exclusive) {
- WARN_ON(1); /* lock got released? */
- return -EROFS;
- }
-
/*
* Note the use of mod_delayed_work() in rbd_acquire_lock()
* and cancel_delayed_work() in wake_lock_waiters().
@@ -4181,16 +4177,16 @@ static bool rbd_quiesce_lock(struct rbd_device *rbd_dev)
/*
* Ensure that all in-flight IO is flushed.
*/
- rbd_dev->lock_state = RBD_LOCK_STATE_RELEASING;
- rbd_assert(!completion_done(&rbd_dev->releasing_wait));
+ rbd_dev->lock_state = RBD_LOCK_STATE_QUIESCING;
+ rbd_assert(!completion_done(&rbd_dev->quiescing_wait));
if (list_empty(&rbd_dev->running_list))
return true;
up_write(&rbd_dev->lock_rwsem);
- wait_for_completion(&rbd_dev->releasing_wait);
+ wait_for_completion(&rbd_dev->quiescing_wait);
down_write(&rbd_dev->lock_rwsem);
- if (rbd_dev->lock_state != RBD_LOCK_STATE_RELEASING)
+ if (rbd_dev->lock_state != RBD_LOCK_STATE_QUIESCING)
return false;
rbd_assert(list_empty(&rbd_dev->running_list));
@@ -4601,6 +4597,10 @@ static void rbd_reacquire_lock(struct rbd_device *rbd_dev)
rbd_warn(rbd_dev, "failed to update lock cookie: %d",
ret);
+ if (rbd_dev->opts->exclusive)
+ rbd_warn(rbd_dev,
+ "temporarily releasing lock on exclusive mapping");
+
/*
* Lock cookie cannot be updated on older OSDs, so do
* a manual release and queue an acquire.
@@ -5382,7 +5382,7 @@ static struct rbd_device *__rbd_dev_create(struct rbd_spec *spec)
INIT_LIST_HEAD(&rbd_dev->acquiring_list);
INIT_LIST_HEAD(&rbd_dev->running_list);
init_completion(&rbd_dev->acquire_wait);
- init_completion(&rbd_dev->releasing_wait);
+ init_completion(&rbd_dev->quiescing_wait);
spin_lock_init(&rbd_dev->object_map_lock);
@@ -6588,11 +6588,6 @@ static int rbd_add_acquire_lock(struct rbd_device *rbd_dev)
if (ret)
return ret;
- /*
- * The lock may have been released by now, unless automatic lock
- * transitions are disabled.
- */
- rbd_assert(!rbd_dev->opts->exclusive || rbd_is_lock_owner(rbd_dev));
return 0;
}
diff --git a/drivers/bluetooth/btintel.c b/drivers/bluetooth/btintel.c
index ac1562d9ef26..3da3c266a66f 100644
--- a/drivers/bluetooth/btintel.c
+++ b/drivers/bluetooth/btintel.c
@@ -26,21 +26,11 @@
#define ECDSA_OFFSET 644
#define ECDSA_HEADER_LEN 320
-#define BTINTEL_PPAG_NAME "PPAG"
-
enum {
DSM_SET_WDISABLE2_DELAY = 1,
DSM_SET_RESET_METHOD = 3,
};
-/* structure to store the PPAG data read from ACPI table */
-struct btintel_ppag {
- u32 domain;
- u32 mode;
- acpi_status status;
- struct hci_dev *hdev;
-};
-
#define CMD_WRITE_BOOT_PARAMS 0xfc0e
struct cmd_write_boot_params {
__le32 boot_addr;
@@ -1312,65 +1302,6 @@ static int btintel_read_debug_features(struct hci_dev *hdev,
return 0;
}
-static acpi_status btintel_ppag_callback(acpi_handle handle, u32 lvl, void *data,
- void **ret)
-{
- acpi_status status;
- size_t len;
- struct btintel_ppag *ppag = data;
- union acpi_object *p, *elements;
- struct acpi_buffer string = {ACPI_ALLOCATE_BUFFER, NULL};
- struct acpi_buffer buffer = {ACPI_ALLOCATE_BUFFER, NULL};
- struct hci_dev *hdev = ppag->hdev;
-
- status = acpi_get_name(handle, ACPI_FULL_PATHNAME, &string);
- if (ACPI_FAILURE(status)) {
- bt_dev_warn(hdev, "PPAG-BT: ACPI Failure: %s", acpi_format_exception(status));
- return status;
- }
-
- len = strlen(string.pointer);
- if (len < strlen(BTINTEL_PPAG_NAME)) {
- kfree(string.pointer);
- return AE_OK;
- }
-
- if (strncmp((char *)string.pointer + len - 4, BTINTEL_PPAG_NAME, 4)) {
- kfree(string.pointer);
- return AE_OK;
- }
- kfree(string.pointer);
-
- status = acpi_evaluate_object(handle, NULL, NULL, &buffer);
- if (ACPI_FAILURE(status)) {
- ppag->status = status;
- bt_dev_warn(hdev, "PPAG-BT: ACPI Failure: %s", acpi_format_exception(status));
- return status;
- }
-
- p = buffer.pointer;
- ppag = (struct btintel_ppag *)data;
-
- if (p->type != ACPI_TYPE_PACKAGE || p->package.count != 2) {
- kfree(buffer.pointer);
- bt_dev_warn(hdev, "PPAG-BT: Invalid object type: %d or package count: %d",
- p->type, p->package.count);
- ppag->status = AE_ERROR;
- return AE_ERROR;
- }
-
- elements = p->package.elements;
-
- /* PPAG table is located at element[1] */
- p = &elements[1];
-
- ppag->domain = (u32)p->package.elements[0].integer.value;
- ppag->mode = (u32)p->package.elements[1].integer.value;
- ppag->status = AE_OK;
- kfree(buffer.pointer);
- return AE_CTRL_TERMINATE;
-}
-
static int btintel_set_debug_features(struct hci_dev *hdev,
const struct intel_debug_features *features)
{
@@ -2399,10 +2330,13 @@ static int btintel_configure_offload(struct hci_dev *hdev)
static void btintel_set_ppag(struct hci_dev *hdev, struct intel_version_tlv *ver)
{
- struct btintel_ppag ppag;
struct sk_buff *skb;
struct hci_ppag_enable_cmd ppag_cmd;
acpi_handle handle;
+ struct acpi_buffer buffer = {ACPI_ALLOCATE_BUFFER, NULL};
+ union acpi_object *p, *elements;
+ u32 domain, mode;
+ acpi_status status;
/* PPAG is not supported if CRF is HrP2, Jfp2, JfP1 */
switch (ver->cnvr_top & 0xFFF) {
@@ -2420,22 +2354,34 @@ static void btintel_set_ppag(struct hci_dev *hdev, struct intel_version_tlv *ver
return;
}
- memset(&ppag, 0, sizeof(ppag));
-
- ppag.hdev = hdev;
- ppag.status = AE_NOT_FOUND;
- acpi_walk_namespace(ACPI_TYPE_PACKAGE, handle, 1, NULL,
- btintel_ppag_callback, &ppag, NULL);
-
- if (ACPI_FAILURE(ppag.status)) {
- if (ppag.status == AE_NOT_FOUND) {
+ status = acpi_evaluate_object(handle, "PPAG", NULL, &buffer);
+ if (ACPI_FAILURE(status)) {
+ if (status == AE_NOT_FOUND) {
bt_dev_dbg(hdev, "PPAG-BT: ACPI entry not found");
return;
}
+ bt_dev_warn(hdev, "PPAG-BT: ACPI Failure: %s", acpi_format_exception(status));
+ return;
+ }
+
+ p = buffer.pointer;
+ if (p->type != ACPI_TYPE_PACKAGE || p->package.count != 2) {
+ bt_dev_warn(hdev, "PPAG-BT: Invalid object type: %d or package count: %d",
+ p->type, p->package.count);
+ kfree(buffer.pointer);
return;
}
- if (ppag.domain != 0x12) {
+ elements = p->package.elements;
+
+ /* PPAG table is located at element[1] */
+ p = &elements[1];
+
+ domain = (u32)p->package.elements[0].integer.value;
+ mode = (u32)p->package.elements[1].integer.value;
+ kfree(buffer.pointer);
+
+ if (domain != 0x12) {
bt_dev_dbg(hdev, "PPAG-BT: Bluetooth domain is disabled in ACPI firmware");
return;
}
@@ -2446,19 +2392,22 @@ static void btintel_set_ppag(struct hci_dev *hdev, struct intel_version_tlv *ver
* BIT 1 : 0 Disabled in China
* 1 Enabled in China
*/
- if ((ppag.mode & 0x01) != BIT(0) && (ppag.mode & 0x02) != BIT(1)) {
- bt_dev_dbg(hdev, "PPAG-BT: EU, China mode are disabled in CB/BIOS");
+ mode &= 0x03;
+
+ if (!mode) {
+ bt_dev_dbg(hdev, "PPAG-BT: EU, China mode are disabled in BIOS");
return;
}
- ppag_cmd.ppag_enable_flags = cpu_to_le32(ppag.mode);
+ ppag_cmd.ppag_enable_flags = cpu_to_le32(mode);
- skb = __hci_cmd_sync(hdev, INTEL_OP_PPAG_CMD, sizeof(ppag_cmd), &ppag_cmd, HCI_CMD_TIMEOUT);
+ skb = __hci_cmd_sync(hdev, INTEL_OP_PPAG_CMD, sizeof(ppag_cmd),
+ &ppag_cmd, HCI_CMD_TIMEOUT);
if (IS_ERR(skb)) {
bt_dev_warn(hdev, "Failed to send PPAG Enable (%ld)", PTR_ERR(skb));
return;
}
- bt_dev_info(hdev, "PPAG-BT: Enabled (Mode %d)", ppag.mode);
+ bt_dev_info(hdev, "PPAG-BT: Enabled (Mode %d)", mode);
kfree_skb(skb);
}
diff --git a/drivers/bluetooth/btnxpuart.c b/drivers/bluetooth/btnxpuart.c
index 5c5a5b752419..83e8e27a5ece 100644
--- a/drivers/bluetooth/btnxpuart.c
+++ b/drivers/bluetooth/btnxpuart.c
@@ -186,6 +186,11 @@ struct btnxpuart_dev {
#define NXP_NAK_V3 0x7b
#define NXP_CRC_ERROR_V3 0x7c
+/* Bootloader signature error codes */
+#define NXP_ACK_RX_TIMEOUT 0x0002 /* ACK not received from host */
+#define NXP_HDR_RX_TIMEOUT 0x0003 /* FW Header chunk not received */
+#define NXP_DATA_RX_TIMEOUT 0x0004 /* FW Data chunk not received */
+
#define HDR_LEN 16
#define NXP_RECV_CHIP_VER_V1 \
@@ -276,6 +281,17 @@ struct nxp_bootloader_cmd {
__be32 crc;
} __packed;
+struct nxp_v3_rx_timeout_nak {
+ u8 nak;
+ __le32 offset;
+ u8 crc;
+} __packed;
+
+union nxp_v3_rx_timeout_nak_u {
+ struct nxp_v3_rx_timeout_nak pkt;
+ u8 buf[6];
+};
+
static u8 crc8_table[CRC8_TABLE_SIZE];
/* Default configurations */
@@ -883,6 +899,32 @@ static int nxp_recv_chip_ver_v3(struct hci_dev *hdev, struct sk_buff *skb)
return 0;
}
+static void nxp_handle_fw_download_error(struct hci_dev *hdev, struct v3_data_req *req)
+{
+ struct btnxpuart_dev *nxpdev = hci_get_drvdata(hdev);
+ __u32 offset = __le32_to_cpu(req->offset);
+ __u16 err = __le16_to_cpu(req->error);
+ union nxp_v3_rx_timeout_nak_u nak_tx_buf;
+
+ switch (err) {
+ case NXP_ACK_RX_TIMEOUT:
+ case NXP_HDR_RX_TIMEOUT:
+ case NXP_DATA_RX_TIMEOUT:
+ nak_tx_buf.pkt.nak = NXP_NAK_V3;
+ nak_tx_buf.pkt.offset = __cpu_to_le32(offset);
+ nak_tx_buf.pkt.crc = crc8(crc8_table, nak_tx_buf.buf,
+ sizeof(nak_tx_buf) - 1, 0xff);
+ serdev_device_write_buf(nxpdev->serdev, nak_tx_buf.buf,
+ sizeof(nak_tx_buf));
+ break;
+ default:
+ bt_dev_dbg(hdev, "Unknown bootloader error code: %d", err);
+ break;
+
+ }
+
+}
+
static int nxp_recv_fw_req_v3(struct hci_dev *hdev, struct sk_buff *skb)
{
struct btnxpuart_dev *nxpdev = hci_get_drvdata(hdev);
@@ -897,7 +939,12 @@ static int nxp_recv_fw_req_v3(struct hci_dev *hdev, struct sk_buff *skb)
if (!req || !nxpdev->fw)
goto free_skb;
- nxp_send_ack(NXP_ACK_V3, hdev);
+ if (!req->error) {
+ nxp_send_ack(NXP_ACK_V3, hdev);
+ } else {
+ nxp_handle_fw_download_error(hdev, req);
+ goto free_skb;
+ }
len = __le16_to_cpu(req->len);
@@ -924,9 +971,6 @@ static int nxp_recv_fw_req_v3(struct hci_dev *hdev, struct sk_buff *skb)
wake_up_interruptible(&nxpdev->fw_dnld_done_wait_q);
goto free_skb;
}
- if (req->error)
- bt_dev_dbg(hdev, "FW Download received err 0x%02x from chip",
- req->error);
offset = __le32_to_cpu(req->offset);
if (offset < nxpdev->fw_v3_offset_correction) {
diff --git a/drivers/bluetooth/btusb.c b/drivers/bluetooth/btusb.c
index 7c271f55a9b4..c495fceda20a 100644
--- a/drivers/bluetooth/btusb.c
+++ b/drivers/bluetooth/btusb.c
@@ -551,6 +551,10 @@ static const struct usb_device_id quirks_table[] = {
BTUSB_WIDEBAND_SPEECH },
{ USB_DEVICE(0x13d3, 0x3571), .driver_info = BTUSB_REALTEK |
BTUSB_WIDEBAND_SPEECH },
+ { USB_DEVICE(0x13d3, 0x3591), .driver_info = BTUSB_REALTEK |
+ BTUSB_WIDEBAND_SPEECH },
+ { USB_DEVICE(0x0489, 0xe125), .driver_info = BTUSB_REALTEK |
+ BTUSB_WIDEBAND_SPEECH },
/* Realtek Bluetooth devices */
{ USB_VENDOR_AND_INTERFACE_INFO(0x0bda, 0xe0, 0x01, 0x01),
diff --git a/drivers/bluetooth/hci_bcm4377.c b/drivers/bluetooth/hci_bcm4377.c
index cf36cdac652d..0dc3ca3d4107 100644
--- a/drivers/bluetooth/hci_bcm4377.c
+++ b/drivers/bluetooth/hci_bcm4377.c
@@ -32,7 +32,7 @@ enum bcm4377_chip {
#define BCM4378_DEVICE_ID 0x5f69
#define BCM4387_DEVICE_ID 0x5f71
-#define BCM4377_TIMEOUT 1000
+#define BCM4377_TIMEOUT msecs_to_jiffies(1000)
/*
* These devices only support DMA transactions inside a 32bit window
diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c
index 86162a13681e..9a24d19236dc 100644
--- a/drivers/char/hw_random/amd-rng.c
+++ b/drivers/char/hw_random/amd-rng.c
@@ -143,8 +143,10 @@ static int __init amd_rng_mod_init(void)
found:
err = pci_read_config_dword(pdev, 0x58, &pmbase);
- if (err)
+ if (err) {
+ err = pcibios_err_to_errno(err);
goto put_dev;
+ }
pmbase &= 0x0000FF00;
if (pmbase == 0) {
diff --git a/drivers/char/hw_random/core.c b/drivers/char/hw_random/core.c
index a3bbdd6e60fc..a182fe794f98 100644
--- a/drivers/char/hw_random/core.c
+++ b/drivers/char/hw_random/core.c
@@ -174,7 +174,6 @@ static int hwrng_init(struct hwrng *rng)
reinit_completion(&rng->cleanup_done);
skip_init:
- rng->quality = min_t(u16, min_t(u16, default_quality, 1024), rng->quality ?: 1024);
current_quality = rng->quality; /* obsolete */
return 0;
@@ -563,6 +562,9 @@ int hwrng_register(struct hwrng *rng)
complete(&rng->cleanup_done);
init_completion(&rng->dying);
+ /* Adjust quality field to always have a proper value */
+ rng->quality = min_t(u16, min_t(u16, default_quality, 1024), rng->quality ?: 1024);
+
if (!current_rng ||
(!cur_rng_set_by_user && rng->quality > current_rng->quality)) {
/*
diff --git a/drivers/char/ipmi/ssif_bmc.c b/drivers/char/ipmi/ssif_bmc.c
index 56346fb32872..ab4e87a99f08 100644
--- a/drivers/char/ipmi/ssif_bmc.c
+++ b/drivers/char/ipmi/ssif_bmc.c
@@ -177,13 +177,15 @@ static ssize_t ssif_bmc_write(struct file *file, const char __user *buf, size_t
unsigned long flags;
ssize_t ret;
- if (count > sizeof(struct ipmi_ssif_msg))
+ if (count < sizeof(msg.len) ||
+ count > sizeof(struct ipmi_ssif_msg))
return -EINVAL;
if (copy_from_user(&msg, buf, count))
return -EFAULT;
- if (!msg.len || count < sizeof_field(struct ipmi_ssif_msg, len) + msg.len)
+ if (!msg.len || msg.len > IPMI_SSIF_PAYLOAD_MAX ||
+ count < sizeof_field(struct ipmi_ssif_msg, len) + msg.len)
return -EINVAL;
spin_lock_irqsave(&ssif_bmc->lock, flags);
diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c
index 639c3f395a5a..4c0bbba64ee5 100644
--- a/drivers/char/tpm/eventlog/common.c
+++ b/drivers/char/tpm/eventlog/common.c
@@ -47,6 +47,8 @@ static int tpm_bios_measurements_open(struct inode *inode,
if (!err) {
seq = file->private_data;
seq->private = chip;
+ } else {
+ put_device(&chip->dev);
}
return err;
diff --git a/drivers/clk/clk-en7523.c b/drivers/clk/clk-en7523.c
index 7cde328495e2..7914e60f3d6c 100644
--- a/drivers/clk/clk-en7523.c
+++ b/drivers/clk/clk-en7523.c
@@ -40,6 +40,7 @@ struct en_clk_desc {
u8 div_shift;
u16 div_val0;
u8 div_step;
+ u8 div_offset;
};
struct en_clk_gate {
@@ -67,6 +68,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_EMI,
.name = "emi",
@@ -80,6 +82,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_BUS,
.name = "bus",
@@ -93,6 +96,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_SLIC,
.name = "slic",
@@ -133,13 +137,14 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_CRYPTO,
.name = "crypto",
.base_reg = REG_CRYPTO_CLKSRC,
.base_bits = 1,
- .base_shift = 8,
+ .base_shift = 0,
.base_values = emi_base,
.n_base_values = ARRAY_SIZE(emi_base),
}
@@ -184,7 +189,7 @@ static u32 en7523_get_div(void __iomem *base, int i)
if (!val && desc->div_val0)
return desc->div_val0;
- return (val + 1) * desc->div_step;
+ return (val + desc->div_offset) * desc->div_step;
}
static int en7523_pci_is_enabled(struct clk_hw *hw)
diff --git a/drivers/clk/davinci/da8xx-cfgchip.c b/drivers/clk/davinci/da8xx-cfgchip.c
index e5b2cdfe88ce..dff7ca35536c 100644
--- a/drivers/clk/davinci/da8xx-cfgchip.c
+++ b/drivers/clk/davinci/da8xx-cfgchip.c
@@ -508,7 +508,7 @@ da8xx_cfgchip_register_usb0_clk48(struct device *dev,
const char * const parent_names[] = { "usb_refclkin", "pll0_auxclk" };
struct clk *fck_clk;
struct da8xx_usb0_clk48 *usb0;
- struct clk_init_data init;
+ struct clk_init_data init = {};
int ret;
fck_clk = devm_clk_get(dev, "fck");
@@ -583,7 +583,7 @@ da8xx_cfgchip_register_usb1_clk48(struct device *dev,
{
const char * const parent_names[] = { "usb0_clk48", "usb_refclkin" };
struct da8xx_usb1_clk48 *usb1;
- struct clk_init_data init;
+ struct clk_init_data init = {};
int ret;
usb1 = devm_kzalloc(dev, sizeof(*usb1), GFP_KERNEL);
diff --git a/drivers/clk/qcom/camcc-sc7280.c b/drivers/clk/qcom/camcc-sc7280.c
index 49f046ea857c..c1551de51d40 100644
--- a/drivers/clk/qcom/camcc-sc7280.c
+++ b/drivers/clk/qcom/camcc-sc7280.c
@@ -2260,6 +2260,7 @@ static struct gdsc cam_cc_bps_gdsc = {
.name = "cam_cc_bps_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = HW_CTRL | RETAIN_FF_ENABLE,
};
@@ -2269,6 +2270,7 @@ static struct gdsc cam_cc_ife_0_gdsc = {
.name = "cam_cc_ife_0_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = RETAIN_FF_ENABLE,
};
@@ -2278,6 +2280,7 @@ static struct gdsc cam_cc_ife_1_gdsc = {
.name = "cam_cc_ife_1_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = RETAIN_FF_ENABLE,
};
@@ -2287,6 +2290,7 @@ static struct gdsc cam_cc_ife_2_gdsc = {
.name = "cam_cc_ife_2_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = RETAIN_FF_ENABLE,
};
@@ -2296,6 +2300,7 @@ static struct gdsc cam_cc_ipe_0_gdsc = {
.name = "cam_cc_ipe_0_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = HW_CTRL | RETAIN_FF_ENABLE,
};
diff --git a/drivers/clk/qcom/clk-rcg2.c b/drivers/clk/qcom/clk-rcg2.c
index 5183c74b074f..b9f2a29be927 100644
--- a/drivers/clk/qcom/clk-rcg2.c
+++ b/drivers/clk/qcom/clk-rcg2.c
@@ -1138,7 +1138,39 @@ clk_rcg2_shared_recalc_rate(struct clk_hw *hw, unsigned long parent_rate)
return clk_rcg2_recalc_rate(hw, parent_rate);
}
+static int clk_rcg2_shared_init(struct clk_hw *hw)
+{
+ /*
+ * This does a few things:
+ *
+ * 1. Sets rcg->parked_cfg to reflect the value at probe so that the
+ * proper parent is reported from clk_rcg2_shared_get_parent().
+ *
+ * 2. Clears the force enable bit of the RCG because we rely on child
+ * clks (branches) to turn the RCG on/off with a hardware feedback
+ * mechanism and only set the force enable bit in the RCG when we
+ * want to make sure the clk stays on for parent switches or
+ * parking.
+ *
+ * 3. Parks shared RCGs on the safe source at registration because we
+ * can't be certain that the parent clk will stay on during boot,
+ * especially if the parent is shared. If this RCG is enabled at
+ * boot, and the parent is turned off, the RCG will get stuck on. A
+ * GDSC can wedge if is turned on and the RCG is stuck on because
+ * the GDSC's controller will hang waiting for the clk status to
+ * toggle on when it never does.
+ *
+ * The safest option here is to "park" the RCG at init so that the clk
+ * can never get stuck on or off. This ensures the GDSC can't get
+ * wedged.
+ */
+ clk_rcg2_shared_disable(hw);
+
+ return 0;
+}
+
const struct clk_ops clk_rcg2_shared_ops = {
+ .init = clk_rcg2_shared_init,
.enable = clk_rcg2_shared_enable,
.disable = clk_rcg2_shared_disable,
.get_parent = clk_rcg2_shared_get_parent,
diff --git a/drivers/clk/qcom/gcc-sa8775p.c b/drivers/clk/qcom/gcc-sa8775p.c
index 8171d23c96e6..a54438205698 100644
--- a/drivers/clk/qcom/gcc-sa8775p.c
+++ b/drivers/clk/qcom/gcc-sa8775p.c
@@ -4305,74 +4305,114 @@ static struct clk_branch gcc_video_axi1_clk = {
static struct gdsc pcie_0_gdsc = {
.gdscr = 0xa9004,
+ .collapse_ctrl = 0x4b104,
+ .collapse_mask = BIT(0),
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "pcie_0_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = VOTABLE | RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc pcie_1_gdsc = {
.gdscr = 0x77004,
+ .collapse_ctrl = 0x4b104,
+ .collapse_mask = BIT(1),
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "pcie_1_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = VOTABLE | RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc ufs_card_gdsc = {
.gdscr = 0x81004,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "ufs_card_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc ufs_phy_gdsc = {
.gdscr = 0x83004,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "ufs_phy_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc usb20_prim_gdsc = {
.gdscr = 0x1c004,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "usb20_prim_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc usb30_prim_gdsc = {
.gdscr = 0x1b004,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "usb30_prim_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc usb30_sec_gdsc = {
.gdscr = 0x2f004,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "usb30_sec_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc emac0_gdsc = {
.gdscr = 0xb6004,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "emac0_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct gdsc emac1_gdsc = {
.gdscr = 0xb4004,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "emac1_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .flags = RETAIN_FF_ENABLE | POLL_CFG_GDSCR,
};
static struct clk_regmap *gcc_sa8775p_clocks[] = {
diff --git a/drivers/clk/qcom/gcc-sc7280.c b/drivers/clk/qcom/gcc-sc7280.c
index 2b661df5de26..bc81026292fc 100644
--- a/drivers/clk/qcom/gcc-sc7280.c
+++ b/drivers/clk/qcom/gcc-sc7280.c
@@ -3467,6 +3467,9 @@ static int gcc_sc7280_probe(struct platform_device *pdev)
regmap_update_bits(regmap, 0x71004, BIT(0), BIT(0));
regmap_update_bits(regmap, 0x7100C, BIT(13), BIT(13));
+ /* FORCE_MEM_CORE_ON for ufs phy ice core clocks */
+ qcom_branch_set_force_mem_core(regmap, gcc_ufs_phy_ice_core_clk, true);
+
ret = qcom_cc_register_rcg_dfs(regmap, gcc_dfs_clocks,
ARRAY_SIZE(gcc_dfs_clocks));
if (ret)
diff --git a/drivers/clk/qcom/gpucc-sa8775p.c b/drivers/clk/qcom/gpucc-sa8775p.c
index 26ecfa63be19..0d9a8379efaa 100644
--- a/drivers/clk/qcom/gpucc-sa8775p.c
+++ b/drivers/clk/qcom/gpucc-sa8775p.c
@@ -1,6 +1,6 @@
// SPDX-License-Identifier: GPL-2.0-only
/*
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2022, 2024, Qualcomm Innovation Center, Inc. All rights reserved.
* Copyright (c) 2023, Linaro Limited
*/
@@ -161,7 +161,7 @@ static struct clk_rcg2 gpu_cc_ff_clk_src = {
.name = "gpu_cc_ff_clk_src",
.parent_data = gpu_cc_parent_data_0,
.num_parents = ARRAY_SIZE(gpu_cc_parent_data_0),
- .ops = &clk_rcg2_ops,
+ .ops = &clk_rcg2_shared_ops,
},
};
@@ -181,7 +181,7 @@ static struct clk_rcg2 gpu_cc_gmu_clk_src = {
.parent_data = gpu_cc_parent_data_1,
.num_parents = ARRAY_SIZE(gpu_cc_parent_data_1),
.flags = CLK_SET_RATE_PARENT,
- .ops = &clk_rcg2_ops,
+ .ops = &clk_rcg2_shared_ops,
},
};
@@ -200,7 +200,7 @@ static struct clk_rcg2 gpu_cc_hub_clk_src = {
.name = "gpu_cc_hub_clk_src",
.parent_data = gpu_cc_parent_data_2,
.num_parents = ARRAY_SIZE(gpu_cc_parent_data_2),
- .ops = &clk_rcg2_ops,
+ .ops = &clk_rcg2_shared_ops,
},
};
@@ -280,7 +280,7 @@ static struct clk_branch gpu_cc_ahb_clk = {
&gpu_cc_hub_ahb_div_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_ops,
},
},
@@ -294,8 +294,7 @@ static struct clk_branch gpu_cc_cb_clk = {
.enable_mask = BIT(0),
.hw.init = &(const struct clk_init_data){
.name = "gpu_cc_cb_clk",
- .flags = CLK_IS_CRITICAL,
- .ops = &clk_branch2_ops,
+ .ops = &clk_branch2_aon_ops,
},
},
};
@@ -312,7 +311,7 @@ static struct clk_branch gpu_cc_crc_ahb_clk = {
&gpu_cc_hub_ahb_div_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_ops,
},
},
@@ -330,7 +329,7 @@ static struct clk_branch gpu_cc_cx_ff_clk = {
&gpu_cc_ff_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_ops,
},
},
@@ -348,7 +347,7 @@ static struct clk_branch gpu_cc_cx_gmu_clk = {
&gpu_cc_gmu_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_aon_ops,
},
},
@@ -362,7 +361,6 @@ static struct clk_branch gpu_cc_cx_snoc_dvm_clk = {
.enable_mask = BIT(0),
.hw.init = &(const struct clk_init_data){
.name = "gpu_cc_cx_snoc_dvm_clk",
- .flags = CLK_IS_CRITICAL,
.ops = &clk_branch2_ops,
},
},
@@ -380,7 +378,7 @@ static struct clk_branch gpu_cc_cxo_aon_clk = {
&gpu_cc_xo_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_ops,
},
},
@@ -398,7 +396,7 @@ static struct clk_branch gpu_cc_cxo_clk = {
&gpu_cc_xo_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_ops,
},
},
@@ -416,7 +414,7 @@ static struct clk_branch gpu_cc_demet_clk = {
&gpu_cc_demet_div_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_aon_ops,
},
},
@@ -430,7 +428,6 @@ static struct clk_branch gpu_cc_hlos1_vote_gpu_smmu_clk = {
.enable_mask = BIT(0),
.hw.init = &(const struct clk_init_data){
.name = "gpu_cc_hlos1_vote_gpu_smmu_clk",
- .flags = CLK_IS_CRITICAL,
.ops = &clk_branch2_ops,
},
},
@@ -448,7 +445,7 @@ static struct clk_branch gpu_cc_hub_aon_clk = {
&gpu_cc_hub_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_aon_ops,
},
},
@@ -466,7 +463,7 @@ static struct clk_branch gpu_cc_hub_cx_int_clk = {
&gpu_cc_hub_cx_int_div_clk_src.clkr.hw,
},
.num_parents = 1,
- .flags = CLK_SET_RATE_PARENT | CLK_IS_CRITICAL,
+ .flags = CLK_SET_RATE_PARENT,
.ops = &clk_branch2_aon_ops,
},
},
@@ -480,7 +477,6 @@ static struct clk_branch gpu_cc_memnoc_gfx_clk = {
.enable_mask = BIT(0),
.hw.init = &(const struct clk_init_data){
.name = "gpu_cc_memnoc_gfx_clk",
- .flags = CLK_IS_CRITICAL,
.ops = &clk_branch2_ops,
},
},
@@ -494,7 +490,6 @@ static struct clk_branch gpu_cc_sleep_clk = {
.enable_mask = BIT(0),
.hw.init = &(const struct clk_init_data){
.name = "gpu_cc_sleep_clk",
- .flags = CLK_IS_CRITICAL,
.ops = &clk_branch2_ops,
},
},
@@ -528,16 +523,22 @@ static struct clk_regmap *gpu_cc_sa8775p_clocks[] = {
static struct gdsc cx_gdsc = {
.gdscr = 0x9108,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.gds_hw_ctrl = 0x953c,
.pd = {
.name = "cx_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
- .flags = VOTABLE | RETAIN_FF_ENABLE | ALWAYS_ON,
+ .flags = VOTABLE | RETAIN_FF_ENABLE,
};
static struct gdsc gx_gdsc = {
.gdscr = 0x905c,
+ .en_rest_wait_val = 0x2,
+ .en_few_wait_val = 0x2,
+ .clk_dis_wait_val = 0xf,
.pd = {
.name = "gx_gdsc",
.power_on = gdsc_gx_do_nothing_enable,
diff --git a/drivers/clk/qcom/gpucc-sm8350.c b/drivers/clk/qcom/gpucc-sm8350.c
index 8dc54dff983f..33c4fb8891ca 100644
--- a/drivers/clk/qcom/gpucc-sm8350.c
+++ b/drivers/clk/qcom/gpucc-sm8350.c
@@ -2,6 +2,7 @@
/*
* Copyright (c) 2019-2020, The Linux Foundation. All rights reserved.
* Copyright (c) 2022, Linaro Limited
+ * Copyright (c) 2024, Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/clk.h>
@@ -147,7 +148,7 @@ static struct clk_rcg2 gpu_cc_gmu_clk_src = {
.parent_data = gpu_cc_parent_data_0,
.num_parents = ARRAY_SIZE(gpu_cc_parent_data_0),
.flags = CLK_SET_RATE_PARENT,
- .ops = &clk_rcg2_ops,
+ .ops = &clk_rcg2_shared_ops,
},
};
@@ -169,7 +170,7 @@ static struct clk_rcg2 gpu_cc_hub_clk_src = {
.parent_data = gpu_cc_parent_data_1,
.num_parents = ARRAY_SIZE(gpu_cc_parent_data_1),
.flags = CLK_SET_RATE_PARENT,
- .ops = &clk_rcg2_ops,
+ .ops = &clk_rcg2_shared_ops,
},
};
diff --git a/drivers/clk/qcom/kpss-xcc.c b/drivers/clk/qcom/kpss-xcc.c
index 97358c98c6c9..d8c1f2b41eeb 100644
--- a/drivers/clk/qcom/kpss-xcc.c
+++ b/drivers/clk/qcom/kpss-xcc.c
@@ -63,9 +63,7 @@ static int kpss_xcc_driver_probe(struct platform_device *pdev)
if (IS_ERR(hw))
return PTR_ERR(hw);
- of_clk_add_hw_provider(dev->of_node, of_clk_hw_simple_get, hw);
-
- return 0;
+ return of_clk_add_hw_provider(dev->of_node, of_clk_hw_simple_get, hw);
}
static struct platform_driver kpss_xcc_driver = {
diff --git a/drivers/cpufreq/amd-pstate.c b/drivers/cpufreq/amd-pstate.c
index 3efc2aef31ce..23c74e9f04c4 100644
--- a/drivers/cpufreq/amd-pstate.c
+++ b/drivers/cpufreq/amd-pstate.c
@@ -175,6 +175,26 @@ static int amd_pstate_get_energy_pref_index(struct amd_cpudata *cpudata)
return index;
}
+static void pstate_update_perf(struct amd_cpudata *cpudata, u32 min_perf,
+ u32 des_perf, u32 max_perf, bool fast_switch)
+{
+ if (fast_switch)
+ wrmsrl(MSR_AMD_CPPC_REQ, READ_ONCE(cpudata->cppc_req_cached));
+ else
+ wrmsrl_on_cpu(cpudata->cpu, MSR_AMD_CPPC_REQ,
+ READ_ONCE(cpudata->cppc_req_cached));
+}
+
+DEFINE_STATIC_CALL(amd_pstate_update_perf, pstate_update_perf);
+
+static inline void amd_pstate_update_perf(struct amd_cpudata *cpudata,
+ u32 min_perf, u32 des_perf,
+ u32 max_perf, bool fast_switch)
+{
+ static_call(amd_pstate_update_perf)(cpudata, min_perf, des_perf,
+ max_perf, fast_switch);
+}
+
static int amd_pstate_set_epp(struct amd_cpudata *cpudata, u32 epp)
{
int ret;
@@ -191,6 +211,9 @@ static int amd_pstate_set_epp(struct amd_cpudata *cpudata, u32 epp)
if (!ret)
cpudata->epp_cached = epp;
} else {
+ amd_pstate_update_perf(cpudata, cpudata->min_limit_perf, 0U,
+ cpudata->max_limit_perf, false);
+
perf_ctrls.energy_perf = epp;
ret = cppc_set_epp_perf(cpudata->cpu, &perf_ctrls, 1);
if (ret) {
@@ -361,16 +384,6 @@ static inline int amd_pstate_init_perf(struct amd_cpudata *cpudata)
return static_call(amd_pstate_init_perf)(cpudata);
}
-static void pstate_update_perf(struct amd_cpudata *cpudata, u32 min_perf,
- u32 des_perf, u32 max_perf, bool fast_switch)
-{
- if (fast_switch)
- wrmsrl(MSR_AMD_CPPC_REQ, READ_ONCE(cpudata->cppc_req_cached));
- else
- wrmsrl_on_cpu(cpudata->cpu, MSR_AMD_CPPC_REQ,
- READ_ONCE(cpudata->cppc_req_cached));
-}
-
static void cppc_update_perf(struct amd_cpudata *cpudata,
u32 min_perf, u32 des_perf,
u32 max_perf, bool fast_switch)
@@ -384,16 +397,6 @@ static void cppc_update_perf(struct amd_cpudata *cpudata,
cppc_set_perf(cpudata->cpu, &perf_ctrls);
}
-DEFINE_STATIC_CALL(amd_pstate_update_perf, pstate_update_perf);
-
-static inline void amd_pstate_update_perf(struct amd_cpudata *cpudata,
- u32 min_perf, u32 des_perf,
- u32 max_perf, bool fast_switch)
-{
- static_call(amd_pstate_update_perf)(cpudata, min_perf, des_perf,
- max_perf, fast_switch);
-}
-
static inline bool amd_pstate_sample(struct amd_cpudata *cpudata)
{
u64 aperf, mperf, tsc;
diff --git a/drivers/cpufreq/ti-cpufreq.c b/drivers/cpufreq/ti-cpufreq.c
index 3c37d7899660..d88ee87b1cd6 100644
--- a/drivers/cpufreq/ti-cpufreq.c
+++ b/drivers/cpufreq/ti-cpufreq.c
@@ -418,7 +418,7 @@ static int ti_cpufreq_probe(struct platform_device *pdev)
ret = dev_pm_opp_set_config(opp_data->cpu_dev, &config);
if (ret < 0) {
- dev_err(opp_data->cpu_dev, "Failed to set OPP config\n");
+ dev_err_probe(opp_data->cpu_dev, ret, "Failed to set OPP config\n");
goto fail_put_node;
}
diff --git a/drivers/crypto/intel/qat/qat_common/adf_cfg.c b/drivers/crypto/intel/qat/qat_common/adf_cfg.c
index 8836f015c39c..2cf102ad4ca8 100644
--- a/drivers/crypto/intel/qat/qat_common/adf_cfg.c
+++ b/drivers/crypto/intel/qat/qat_common/adf_cfg.c
@@ -290,17 +290,19 @@ int adf_cfg_add_key_value_param(struct adf_accel_dev *accel_dev,
* 3. if the key exists with the same value, then return without doing
* anything (the newly created key_val is freed).
*/
+ down_write(&cfg->lock);
if (!adf_cfg_key_val_get(accel_dev, section_name, key, temp_val)) {
if (strncmp(temp_val, key_val->val, sizeof(temp_val))) {
adf_cfg_keyval_remove(key, section);
} else {
kfree(key_val);
- return 0;
+ goto out;
}
}
- down_write(&cfg->lock);
adf_cfg_keyval_add(key_val, section);
+
+out:
up_write(&cfg->lock);
return 0;
}
diff --git a/drivers/dma/ti/k3-udma.c b/drivers/dma/ti/k3-udma.c
index 037f1408e798..02a1ab04f498 100644
--- a/drivers/dma/ti/k3-udma.c
+++ b/drivers/dma/ti/k3-udma.c
@@ -4470,7 +4470,9 @@ static int udma_get_mmrs(struct platform_device *pdev, struct udma_dev *ud)
ud->rchan_cnt = UDMA_CAP2_RCHAN_CNT(cap2);
break;
case DMA_TYPE_BCDMA:
- ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2);
+ ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2) +
+ BCDMA_CAP3_HBCHAN_CNT(cap3) +
+ BCDMA_CAP3_UBCHAN_CNT(cap3);
ud->tchan_cnt = BCDMA_CAP2_TCHAN_CNT(cap2);
ud->rchan_cnt = BCDMA_CAP2_RCHAN_CNT(cap2);
ud->rflow_cnt = ud->rchan_cnt;
diff --git a/drivers/edac/Makefile b/drivers/edac/Makefile
index 61945d3113cc..446364264e2b 100644
--- a/drivers/edac/Makefile
+++ b/drivers/edac/Makefile
@@ -54,11 +54,13 @@ obj-$(CONFIG_EDAC_MPC85XX) += mpc85xx_edac_mod.o
layerscape_edac_mod-y := fsl_ddr_edac.o layerscape_edac.o
obj-$(CONFIG_EDAC_LAYERSCAPE) += layerscape_edac_mod.o
-skx_edac-y := skx_common.o skx_base.o
-obj-$(CONFIG_EDAC_SKX) += skx_edac.o
+skx_edac_common-y := skx_common.o
-i10nm_edac-y := skx_common.o i10nm_base.o
-obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o
+skx_edac-y := skx_base.o
+obj-$(CONFIG_EDAC_SKX) += skx_edac.o skx_edac_common.o
+
+i10nm_edac-y := i10nm_base.o
+obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o skx_edac_common.o
obj-$(CONFIG_EDAC_CELL) += cell_edac.o
obj-$(CONFIG_EDAC_PPC4XX) += ppc4xx_edac.o
diff --git a/drivers/edac/skx_common.c b/drivers/edac/skx_common.c
index ce3e0069e028..03d7a74ca22d 100644
--- a/drivers/edac/skx_common.c
+++ b/drivers/edac/skx_common.c
@@ -48,7 +48,7 @@ static u64 skx_tolm, skx_tohm;
static LIST_HEAD(dev_edac_list);
static bool skx_mem_cfg_2lm;
-int __init skx_adxl_get(void)
+int skx_adxl_get(void)
{
const char * const *names;
int i, j;
@@ -110,12 +110,14 @@ int __init skx_adxl_get(void)
return -ENODEV;
}
+EXPORT_SYMBOL_GPL(skx_adxl_get);
-void __exit skx_adxl_put(void)
+void skx_adxl_put(void)
{
kfree(adxl_values);
kfree(adxl_msg);
}
+EXPORT_SYMBOL_GPL(skx_adxl_put);
static bool skx_adxl_decode(struct decoded_addr *res, bool error_in_1st_level_mem)
{
@@ -187,12 +189,14 @@ void skx_set_mem_cfg(bool mem_cfg_2lm)
{
skx_mem_cfg_2lm = mem_cfg_2lm;
}
+EXPORT_SYMBOL_GPL(skx_set_mem_cfg);
void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log)
{
driver_decode = decode;
skx_show_retry_rd_err_log = show_retry_log;
}
+EXPORT_SYMBOL_GPL(skx_set_decode);
int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
{
@@ -206,6 +210,7 @@ int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
*id = GET_BITFIELD(reg, 12, 14);
return 0;
}
+EXPORT_SYMBOL_GPL(skx_get_src_id);
int skx_get_node_id(struct skx_dev *d, u8 *id)
{
@@ -219,6 +224,7 @@ int skx_get_node_id(struct skx_dev *d, u8 *id)
*id = GET_BITFIELD(reg, 0, 2);
return 0;
}
+EXPORT_SYMBOL_GPL(skx_get_node_id);
static int get_width(u32 mtr)
{
@@ -284,6 +290,7 @@ int skx_get_all_bus_mappings(struct res_config *cfg, struct list_head **list)
*list = &dev_edac_list;
return ndev;
}
+EXPORT_SYMBOL_GPL(skx_get_all_bus_mappings);
int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
{
@@ -323,6 +330,7 @@ int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
pci_dev_put(pdev);
return -ENODEV;
}
+EXPORT_SYMBOL_GPL(skx_get_hi_lo);
static int skx_get_dimm_attr(u32 reg, int lobit, int hibit, int add,
int minval, int maxval, const char *name)
@@ -394,6 +402,7 @@ int skx_get_dimm_info(u32 mtr, u32 mcmtr, u32 amap, struct dimm_info *dimm,
return 1;
}
+EXPORT_SYMBOL_GPL(skx_get_dimm_info);
int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
int chan, int dimmno, const char *mod_str)
@@ -442,6 +451,7 @@ int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
return (size == 0 || size == ~0ull) ? 0 : 1;
}
+EXPORT_SYMBOL_GPL(skx_get_nvdimm_info);
int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
const char *ctl_name, const char *mod_str,
@@ -512,6 +522,7 @@ int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
imc->mci = NULL;
return rc;
}
+EXPORT_SYMBOL_GPL(skx_register_mci);
static void skx_unregister_mci(struct skx_imc *imc)
{
@@ -684,6 +695,7 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val,
mce->kflags |= MCE_HANDLED_EDAC;
return NOTIFY_DONE;
}
+EXPORT_SYMBOL_GPL(skx_mce_check_error);
void skx_remove(void)
{
@@ -721,3 +733,8 @@ void skx_remove(void)
kfree(d);
}
}
+EXPORT_SYMBOL_GPL(skx_remove);
+
+MODULE_LICENSE("GPL v2");
+MODULE_AUTHOR("Tony Luck");
+MODULE_DESCRIPTION("MC Driver for Intel server processors");
diff --git a/drivers/edac/skx_common.h b/drivers/edac/skx_common.h
index b6d3607dffe2..11faf1db4fa4 100644
--- a/drivers/edac/skx_common.h
+++ b/drivers/edac/skx_common.h
@@ -231,8 +231,8 @@ typedef int (*get_dimm_config_f)(struct mem_ctl_info *mci,
typedef bool (*skx_decode_f)(struct decoded_addr *res);
typedef void (*skx_show_retry_log_f)(struct decoded_addr *res, char *msg, int len, bool scrub_err);
-int __init skx_adxl_get(void);
-void __exit skx_adxl_put(void);
+int skx_adxl_get(void);
+void skx_adxl_put(void);
void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log);
void skx_set_mem_cfg(bool mem_cfg_2lm);
diff --git a/drivers/firmware/efi/libstub/screen_info.c b/drivers/firmware/efi/libstub/screen_info.c
index a51ec201ca3c..5d3a1e32d177 100644
--- a/drivers/firmware/efi/libstub/screen_info.c
+++ b/drivers/firmware/efi/libstub/screen_info.c
@@ -32,6 +32,8 @@ struct screen_info *__alloc_screen_info(void)
if (status != EFI_SUCCESS)
return NULL;
+ memset(si, 0, sizeof(*si));
+
status = efi_bs_call(install_configuration_table,
&screen_info_guid, si);
if (status == EFI_SUCCESS)
diff --git a/drivers/firmware/efi/libstub/x86-stub.c b/drivers/firmware/efi/libstub/x86-stub.c
index 8e9f2ddfbe46..b2b06d18b7b4 100644
--- a/drivers/firmware/efi/libstub/x86-stub.c
+++ b/drivers/firmware/efi/libstub/x86-stub.c
@@ -469,11 +469,12 @@ void __noreturn efi_stub_entry(efi_handle_t handle,
efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
efi_system_table_t *sys_table_arg)
{
- static struct boot_params boot_params __page_aligned_bss;
- struct setup_header *hdr = &boot_params.hdr;
efi_guid_t proto = LOADED_IMAGE_PROTOCOL_GUID;
+ struct boot_params *boot_params;
+ struct setup_header *hdr;
int options_size = 0;
efi_status_t status;
+ unsigned long alloc;
char *cmdline_ptr;
if (efi_is_native())
@@ -491,6 +492,13 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
efi_exit(handle, status);
}
+ status = efi_allocate_pages(PARAM_SIZE, &alloc, ULONG_MAX);
+ if (status != EFI_SUCCESS)
+ efi_exit(handle, status);
+
+ boot_params = memset((void *)alloc, 0x0, PARAM_SIZE);
+ hdr = &boot_params->hdr;
+
/* Assign the setup_header fields that the kernel actually cares about */
hdr->root_flags = 1;
hdr->vid_mode = 0xffff;
@@ -500,17 +508,16 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
/* Convert unicode cmdline to ascii */
cmdline_ptr = efi_convert_cmdline(image, &options_size);
- if (!cmdline_ptr)
- goto fail;
+ if (!cmdline_ptr) {
+ efi_free(PARAM_SIZE, alloc);
+ efi_exit(handle, EFI_OUT_OF_RESOURCES);
+ }
efi_set_u64_split((unsigned long)cmdline_ptr, &hdr->cmd_line_ptr,
- &boot_params.ext_cmd_line_ptr);
+ &boot_params->ext_cmd_line_ptr);
- efi_stub_entry(handle, sys_table_arg, &boot_params);
+ efi_stub_entry(handle, sys_table_arg, boot_params);
/* not reached */
-
-fail:
- efi_exit(handle, status);
}
static void add_e820ext(struct boot_params *params,
diff --git a/drivers/firmware/turris-mox-rwtm.c b/drivers/firmware/turris-mox-rwtm.c
index 2de0fb139ce1..3d354ebd38c2 100644
--- a/drivers/firmware/turris-mox-rwtm.c
+++ b/drivers/firmware/turris-mox-rwtm.c
@@ -2,7 +2,7 @@
/*
* Turris Mox rWTM firmware driver
*
- * Copyright (C) 2019 Marek Behún <kabel@kernel.org>
+ * Copyright (C) 2019, 2024 Marek Behún <kabel@kernel.org>
*/
#include <linux/armada-37xx-rwtm-mailbox.h>
@@ -174,6 +174,9 @@ static void mox_rwtm_rx_callback(struct mbox_client *cl, void *data)
struct mox_rwtm *rwtm = dev_get_drvdata(cl->dev);
struct armada_37xx_rwtm_rx_msg *msg = data;
+ if (completion_done(&rwtm->cmd_done))
+ return;
+
rwtm->reply = *msg;
complete(&rwtm->cmd_done);
}
@@ -199,9 +202,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
if (ret < 0)
return ret;
- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
- if (ret < 0)
- return ret;
+ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+ return -ETIMEDOUT;
ret = mox_get_status(MBOX_CMD_BOARD_INFO, reply->retval);
if (ret == -ENODATA) {
@@ -235,9 +237,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
if (ret < 0)
return ret;
- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
- if (ret < 0)
- return ret;
+ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+ return -ETIMEDOUT;
ret = mox_get_status(MBOX_CMD_ECDSA_PUB_KEY, reply->retval);
if (ret == -ENODATA) {
@@ -274,9 +275,8 @@ static int check_get_random_support(struct mox_rwtm *rwtm)
if (ret < 0)
return ret;
- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
- if (ret < 0)
- return ret;
+ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+ return -ETIMEDOUT;
return mox_get_status(MBOX_CMD_GET_RANDOM, rwtm->reply.retval);
}
@@ -499,6 +499,7 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
platform_set_drvdata(pdev, rwtm);
mutex_init(&rwtm->busy);
+ init_completion(&rwtm->cmd_done);
rwtm->mbox_client.dev = dev;
rwtm->mbox_client.rx_callback = mox_rwtm_rx_callback;
@@ -512,8 +513,6 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
goto remove_files;
}
- init_completion(&rwtm->cmd_done);
-
ret = mox_get_board_info(rwtm);
if (ret < 0)
dev_warn(dev, "Cannot read board information: %i\n", ret);
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
index e1227b7c71b1..ea1bce13db94 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
@@ -5645,7 +5645,7 @@ int amdgpu_device_baco_exit(struct drm_device *dev)
adev->nbio.funcs->enable_doorbell_interrupt)
adev->nbio.funcs->enable_doorbell_interrupt(adev, true);
- if (amdgpu_passthrough(adev) &&
+ if (amdgpu_passthrough(adev) && adev->nbio.funcs &&
adev->nbio.funcs->clear_doorbell_interrupt)
adev->nbio.funcs->clear_doorbell_interrupt(adev);
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
index bc0eda1a729c..0b6a0e149f1c 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
@@ -650,7 +650,6 @@ void amdgpu_gmc_noretry_set(struct amdgpu_device *adev)
struct amdgpu_gmc *gmc = &adev->gmc;
uint32_t gc_ver = adev->ip_versions[GC_HWIP][0];
bool noretry_default = (gc_ver == IP_VERSION(9, 0, 1) ||
- gc_ver == IP_VERSION(9, 3, 0) ||
gc_ver == IP_VERSION(9, 4, 0) ||
gc_ver == IP_VERSION(9, 4, 1) ||
gc_ver == IP_VERSION(9, 4, 2) ||
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c
index f5e78b0c08f7..f02b6232680f 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_vm.c
@@ -418,7 +418,7 @@ uint64_t amdgpu_vm_generation(struct amdgpu_device *adev, struct amdgpu_vm *vm)
if (!vm)
return result;
- result += vm->generation;
+ result += lower_32_bits(vm->generation);
/* Add one if the page tables will be re-generated on next CS */
if (drm_sched_entity_error(&vm->delayed))
++result;
@@ -443,13 +443,14 @@ int amdgpu_vm_validate_pt_bos(struct amdgpu_device *adev, struct amdgpu_vm *vm,
int (*validate)(void *p, struct amdgpu_bo *bo),
void *param)
{
+ uint64_t new_vm_generation = amdgpu_vm_generation(adev, vm);
struct amdgpu_vm_bo_base *bo_base;
struct amdgpu_bo *shadow;
struct amdgpu_bo *bo;
int r;
- if (drm_sched_entity_error(&vm->delayed)) {
- ++vm->generation;
+ if (vm->generation != new_vm_generation) {
+ vm->generation = new_vm_generation;
amdgpu_vm_bo_reset_state_machine(vm);
amdgpu_vm_fini_entities(vm);
r = amdgpu_vm_init_entities(adev, vm);
@@ -2192,7 +2193,7 @@ int amdgpu_vm_init(struct amdgpu_device *adev, struct amdgpu_vm *vm,
vm->last_update = dma_fence_get_stub();
vm->last_unlocked = dma_fence_get_stub();
vm->last_tlb_flush = dma_fence_get_stub();
- vm->generation = 0;
+ vm->generation = amdgpu_vm_generation(adev, NULL);
mutex_init(&vm->eviction_lock);
vm->evicting = false;
diff --git a/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c b/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
index 8ace3f6210d3..6d2b9d260d92 100644
--- a/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
+++ b/drivers/gpu/drm/amd/amdgpu/gmc_v9_0.c
@@ -1949,7 +1949,7 @@ gmc_v9_0_init_sw_mem_ranges(struct amdgpu_device *adev,
break;
}
- size = adev->gmc.real_vram_size >> AMDGPU_GPU_PAGE_SHIFT;
+ size = (adev->gmc.real_vram_size + SZ_16M) >> AMDGPU_GPU_PAGE_SHIFT;
size /= adev->gmc.num_mem_partitions;
for (i = 0; i < adev->gmc.num_mem_partitions; ++i) {
diff --git a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
index 72b18156debb..47d4840c6275 100644
--- a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
+++ b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
@@ -188,6 +188,14 @@ static void sdma_v5_2_ring_set_wptr(struct amdgpu_ring *ring)
DRM_DEBUG("calling WDOORBELL64(0x%08x, 0x%016llx)\n",
ring->doorbell_index, ring->wptr << 2);
WDOORBELL64(ring->doorbell_index, ring->wptr << 2);
+ /* SDMA seems to miss doorbells sometimes when powergating kicks in.
+ * Updating the wptr directly will wake it. This is only safe because
+ * we disallow gfxoff in begin_use() and then allow it again in end_use().
+ */
+ WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR),
+ lower_32_bits(ring->wptr << 2));
+ WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR_HI),
+ upper_32_bits(ring->wptr << 2));
} else {
DRM_DEBUG("Not using doorbell -- "
"mmSDMA%i_GFX_RB_WPTR == 0x%08x "
@@ -1666,6 +1674,10 @@ static void sdma_v5_2_ring_begin_use(struct amdgpu_ring *ring)
* but it shouldn't hurt for other parts since
* this GFXOFF will be disallowed anyway when SDMA is
* active, this just makes it explicit.
+ * sdma_v5_2_ring_set_wptr() takes advantage of this
+ * to update the wptr because sometimes SDMA seems to miss
+ * doorbells when entering PG. If you remove this, update
+ * sdma_v5_2_ring_set_wptr() as well!
*/
amdgpu_gfx_off_ctrl(adev, false);
}
diff --git a/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c b/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c
index ae29620b1ea4..a7cef33a2a3d 100644
--- a/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c
+++ b/drivers/gpu/drm/amd/amdgpu/smu_v13_0_10.c
@@ -92,7 +92,7 @@ static int smu_v13_0_10_mode2_suspend_ip(struct amdgpu_device *adev)
adev->ip_blocks[i].status.hw = false;
}
- return r;
+ return 0;
}
static int
diff --git a/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c b/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c
index 42d881809dc7..1ac66c5337df 100644
--- a/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c
+++ b/drivers/gpu/drm/amd/amdkfd/kfd_mqd_manager_v9.c
@@ -686,7 +686,7 @@ static void update_mqd_v9_4_3(struct mqd_manager *mm, void *mqd,
m = get_mqd(mqd + size * xcc);
update_mqd(mm, m, q, minfo);
- update_cu_mask(mm, mqd, minfo, xcc);
+ update_cu_mask(mm, m, minfo, xcc);
if (q->format == KFD_QUEUE_FORMAT_AQL) {
switch (xcc) {
diff --git a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
index a80e45300783..f4f3ca7aad60 100644
--- a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
+++ b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
@@ -154,7 +154,8 @@ const struct dc_plane_status *dc_plane_get_status(
if (pipe_ctx->plane_state != plane_state)
continue;
- pipe_ctx->plane_state->status.is_flip_pending = false;
+ if (pipe_ctx->plane_state)
+ pipe_ctx->plane_state->status.is_flip_pending = false;
break;
}
diff --git a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
index c097aed4722b..c0adfa46ac78 100644
--- a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
+++ b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
@@ -79,8 +79,8 @@ MODULE_FIRMWARE("amdgpu/smu_13_0_10.bin");
#define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD_MASK 0x00000070L
#define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD__SHIFT 0x4
#define smnPCIE_LC_SPEED_CNTL 0x11140290
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xC000
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0xE
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xE0
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0x5
static const int link_width[] = {0, 1, 2, 4, 8, 12, 16};
diff --git a/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c b/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c
index 2c661f28410e..b645c5998230 100644
--- a/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c
+++ b/drivers/gpu/drm/arm/display/komeda/komeda_crtc.c
@@ -5,6 +5,7 @@
*
*/
#include <linux/clk.h>
+#include <linux/of.h>
#include <linux/pm_runtime.h>
#include <linux/spinlock.h>
@@ -610,12 +611,34 @@ get_crtc_primary(struct komeda_kms_dev *kms, struct komeda_crtc *crtc)
return NULL;
}
+static int komeda_attach_bridge(struct device *dev,
+ struct komeda_pipeline *pipe,
+ struct drm_encoder *encoder)
+{
+ struct drm_bridge *bridge;
+ int err;
+
+ bridge = devm_drm_of_get_bridge(dev, pipe->of_node,
+ KOMEDA_OF_PORT_OUTPUT, 0);
+ if (IS_ERR(bridge))
+ return dev_err_probe(dev, PTR_ERR(bridge), "remote bridge not found for pipe: %s\n",
+ of_node_full_name(pipe->of_node));
+
+ err = drm_bridge_attach(encoder, bridge, NULL, 0);
+ if (err)
+ dev_err(dev, "bridge_attach() failed for pipe: %s\n",
+ of_node_full_name(pipe->of_node));
+
+ return err;
+}
+
static int komeda_crtc_add(struct komeda_kms_dev *kms,
struct komeda_crtc *kcrtc)
{
struct drm_crtc *crtc = &kcrtc->base;
struct drm_device *base = &kms->base;
- struct drm_bridge *bridge;
+ struct komeda_pipeline *pipe = kcrtc->master;
+ struct drm_encoder *encoder = &kcrtc->encoder;
int err;
err = drm_crtc_init_with_planes(base, crtc,
@@ -626,27 +649,25 @@ static int komeda_crtc_add(struct komeda_kms_dev *kms,
drm_crtc_helper_add(crtc, &komeda_crtc_helper_funcs);
- crtc->port = kcrtc->master->of_output_port;
+ crtc->port = pipe->of_output_port;
/* Construct an encoder for each pipeline and attach it to the remote
* bridge
*/
kcrtc->encoder.possible_crtcs = drm_crtc_mask(crtc);
- err = drm_simple_encoder_init(base, &kcrtc->encoder,
- DRM_MODE_ENCODER_TMDS);
+ err = drm_simple_encoder_init(base, encoder, DRM_MODE_ENCODER_TMDS);
if (err)
return err;
- bridge = devm_drm_of_get_bridge(base->dev, kcrtc->master->of_node,
- KOMEDA_OF_PORT_OUTPUT, 0);
- if (IS_ERR(bridge))
- return PTR_ERR(bridge);
-
- err = drm_bridge_attach(&kcrtc->encoder, bridge, NULL, 0);
+ if (pipe->of_output_links[0]) {
+ err = komeda_attach_bridge(base->dev, pipe, encoder);
+ if (err)
+ return err;
+ }
drm_crtc_enable_color_mgmt(crtc, 0, true, KOMEDA_COLOR_LUT_SIZE);
- return err;
+ return 0;
}
int komeda_kms_add_crtcs(struct komeda_kms_dev *kms, struct komeda_dev *mdev)
diff --git a/drivers/gpu/drm/bridge/ite-it6505.c b/drivers/gpu/drm/bridge/ite-it6505.c
index 2f300f5ca051..4ad527fe04f2 100644
--- a/drivers/gpu/drm/bridge/ite-it6505.c
+++ b/drivers/gpu/drm/bridge/ite-it6505.c
@@ -1306,9 +1306,15 @@ static void it6505_video_reset(struct it6505 *it6505)
it6505_link_reset_step_train(it6505);
it6505_set_bits(it6505, REG_DATA_MUTE_CTRL, EN_VID_MUTE, EN_VID_MUTE);
it6505_set_bits(it6505, REG_INFOFRAME_CTRL, EN_VID_CTRL_PKT, 0x00);
- it6505_set_bits(it6505, REG_RESET_CTRL, VIDEO_RESET, VIDEO_RESET);
+
+ it6505_set_bits(it6505, REG_VID_BUS_CTRL1, TX_FIFO_RESET, TX_FIFO_RESET);
+ it6505_set_bits(it6505, REG_VID_BUS_CTRL1, TX_FIFO_RESET, 0x00);
+
it6505_set_bits(it6505, REG_501_FIFO_CTRL, RST_501_FIFO, RST_501_FIFO);
it6505_set_bits(it6505, REG_501_FIFO_CTRL, RST_501_FIFO, 0x00);
+
+ it6505_set_bits(it6505, REG_RESET_CTRL, VIDEO_RESET, VIDEO_RESET);
+ usleep_range(1000, 2000);
it6505_set_bits(it6505, REG_RESET_CTRL, VIDEO_RESET, 0x00);
}
@@ -2240,14 +2246,15 @@ static void it6505_link_training_work(struct work_struct *work)
ret = it6505_link_start_auto_train(it6505);
DRM_DEV_DEBUG_DRIVER(dev, "auto train %s, auto_train_retry: %d",
ret ? "pass" : "failed", it6505->auto_train_retry);
- it6505->auto_train_retry--;
if (ret) {
+ it6505->auto_train_retry = AUTO_TRAIN_RETRY;
it6505_link_train_ok(it6505);
- return;
+ } else {
+ it6505->auto_train_retry--;
+ it6505_dump(it6505);
}
- it6505_dump(it6505);
}
static void it6505_plugged_status_to_codec(struct it6505 *it6505)
@@ -2468,31 +2475,53 @@ static void it6505_irq_link_train_fail(struct it6505 *it6505)
schedule_work(&it6505->link_works);
}
-static void it6505_irq_video_fifo_error(struct it6505 *it6505)
+static bool it6505_test_bit(unsigned int bit, const unsigned int *addr)
{
- struct device *dev = it6505->dev;
-
- DRM_DEV_DEBUG_DRIVER(dev, "video fifo overflow interrupt");
- it6505->auto_train_retry = AUTO_TRAIN_RETRY;
- flush_work(&it6505->link_works);
- it6505_stop_hdcp(it6505);
- it6505_video_reset(it6505);
+ return 1 & (addr[bit / BITS_PER_BYTE] >> (bit % BITS_PER_BYTE));
}
-static void it6505_irq_io_latch_fifo_overflow(struct it6505 *it6505)
+static void it6505_irq_video_handler(struct it6505 *it6505, const int *int_status)
{
struct device *dev = it6505->dev;
+ int reg_0d, reg_int03;
- DRM_DEV_DEBUG_DRIVER(dev, "IO latch fifo overflow interrupt");
- it6505->auto_train_retry = AUTO_TRAIN_RETRY;
- flush_work(&it6505->link_works);
- it6505_stop_hdcp(it6505);
- it6505_video_reset(it6505);
-}
+ /*
+ * When video SCDT change with video not stable,
+ * Or video FIFO error, need video reset
+ */
-static bool it6505_test_bit(unsigned int bit, const unsigned int *addr)
-{
- return 1 & (addr[bit / BITS_PER_BYTE] >> (bit % BITS_PER_BYTE));
+ if ((!it6505_get_video_status(it6505) &&
+ (it6505_test_bit(INT_SCDT_CHANGE, (unsigned int *)int_status))) ||
+ (it6505_test_bit(BIT_INT_IO_FIFO_OVERFLOW,
+ (unsigned int *)int_status)) ||
+ (it6505_test_bit(BIT_INT_VID_FIFO_ERROR,
+ (unsigned int *)int_status))) {
+ it6505->auto_train_retry = AUTO_TRAIN_RETRY;
+ flush_work(&it6505->link_works);
+ it6505_stop_hdcp(it6505);
+ it6505_video_reset(it6505);
+
+ usleep_range(10000, 11000);
+
+ /*
+ * Clear FIFO error IRQ to prevent fifo error -> reset loop
+ * HW will trigger SCDT change IRQ again when video stable
+ */
+
+ reg_int03 = it6505_read(it6505, INT_STATUS_03);
+ reg_0d = it6505_read(it6505, REG_SYSTEM_STS);
+
+ reg_int03 &= (BIT(INT_VID_FIFO_ERROR) | BIT(INT_IO_LATCH_FIFO_OVERFLOW));
+ it6505_write(it6505, INT_STATUS_03, reg_int03);
+
+ DRM_DEV_DEBUG_DRIVER(dev, "reg08 = 0x%02x", reg_int03);
+ DRM_DEV_DEBUG_DRIVER(dev, "reg0D = 0x%02x", reg_0d);
+
+ return;
+ }
+
+ if (it6505_test_bit(INT_SCDT_CHANGE, (unsigned int *)int_status))
+ it6505_irq_scdt(it6505);
}
static irqreturn_t it6505_int_threaded_handler(int unused, void *data)
@@ -2505,15 +2534,12 @@ static irqreturn_t it6505_int_threaded_handler(int unused, void *data)
} irq_vec[] = {
{ BIT_INT_HPD, it6505_irq_hpd },
{ BIT_INT_HPD_IRQ, it6505_irq_hpd_irq },
- { BIT_INT_SCDT, it6505_irq_scdt },
{ BIT_INT_HDCP_FAIL, it6505_irq_hdcp_fail },
{ BIT_INT_HDCP_DONE, it6505_irq_hdcp_done },
{ BIT_INT_AUX_CMD_FAIL, it6505_irq_aux_cmd_fail },
{ BIT_INT_HDCP_KSV_CHECK, it6505_irq_hdcp_ksv_check },
{ BIT_INT_AUDIO_FIFO_ERROR, it6505_irq_audio_fifo_error },
{ BIT_INT_LINK_TRAIN_FAIL, it6505_irq_link_train_fail },
- { BIT_INT_VID_FIFO_ERROR, it6505_irq_video_fifo_error },
- { BIT_INT_IO_FIFO_OVERFLOW, it6505_irq_io_latch_fifo_overflow },
};
int int_status[3], i;
@@ -2543,6 +2569,7 @@ static irqreturn_t it6505_int_threaded_handler(int unused, void *data)
if (it6505_test_bit(irq_vec[i].bit, (unsigned int *)int_status))
irq_vec[i].handler(it6505);
}
+ it6505_irq_video_handler(it6505, (unsigned int *)int_status);
}
pm_runtime_put_sync(dev);
diff --git a/drivers/gpu/drm/display/drm_dp_mst_topology.c b/drivers/gpu/drm/display/drm_dp_mst_topology.c
index 6d169c83b062..9023c0216a8a 100644
--- a/drivers/gpu/drm/display/drm_dp_mst_topology.c
+++ b/drivers/gpu/drm/display/drm_dp_mst_topology.c
@@ -2923,7 +2923,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
/* FIXME: Actually do some real error handling here */
ret = drm_dp_mst_wait_tx_reply(mstb, txmsg);
- if (ret <= 0) {
+ if (ret < 0) {
drm_err(mgr->dev, "Sending link address failed with %d\n", ret);
goto out;
}
@@ -2975,7 +2975,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
mutex_unlock(&mgr->lock);
out:
- if (ret <= 0)
+ if (ret < 0)
mstb->link_address_sent = false;
kfree(txmsg);
return ret < 0 ? ret : changed;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
index b5f73502e3dd..69fccbcd92c6 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
@@ -356,9 +356,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj)
static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op)
{
- if (op & ETNA_PREP_READ)
+ op &= ETNA_PREP_READ | ETNA_PREP_WRITE;
+
+ if (op == ETNA_PREP_READ)
return DMA_FROM_DEVICE;
- else if (op & ETNA_PREP_WRITE)
+ else if (op == ETNA_PREP_WRITE)
return DMA_TO_DEVICE;
else
return DMA_BIDIRECTIONAL;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_sched.c b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
index 345fec6cb1a4..97e406d9ac06 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_sched.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
@@ -38,9 +38,6 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
u32 dma_addr;
int change;
- /* block scheduler */
- drm_sched_stop(&gpu->sched, sched_job);
-
/*
* If the GPU managed to complete this jobs fence, the timout is
* spurious. Bail out.
@@ -63,6 +60,9 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
goto out_no_timeout;
}
+ /* block scheduler */
+ drm_sched_stop(&gpu->sched, sched_job);
+
if(sched_job)
drm_sched_increase_karma(sched_job);
@@ -76,8 +76,7 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
return DRM_GPU_SCHED_STAT_NOMINAL;
out_no_timeout:
- /* restart scheduler after GPU is usable again */
- drm_sched_start(&gpu->sched, true);
+ list_add(&sched_job->list, &sched_job->sched->pending_list);
return DRM_GPU_SCHED_STAT_NOMINAL;
}
diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
index f08a6803dc18..3adc2c9ab72d 100644
--- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
@@ -311,6 +311,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector)
if (mode_dev->panel_fixed_mode != NULL) {
struct drm_display_mode *mode =
drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+ if (!mode)
+ return 0;
+
drm_mode_probed_add(connector, mode);
return 1;
}
diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c
index 8486de230ec9..8d1be94a443b 100644
--- a/drivers/gpu/drm/gma500/psb_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c
@@ -504,6 +504,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector)
if (mode_dev->panel_fixed_mode != NULL) {
struct drm_display_mode *mode =
drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+ if (!mode)
+ return 0;
+
drm_mode_probed_add(connector, mode);
return 1;
}
diff --git a/drivers/gpu/drm/i915/display/intel_dp.c b/drivers/gpu/drm/i915/display/intel_dp.c
index 2936a6c02d6a..c8b6d0f79c9b 100644
--- a/drivers/gpu/drm/i915/display/intel_dp.c
+++ b/drivers/gpu/drm/i915/display/intel_dp.c
@@ -4374,6 +4374,8 @@ int intel_dp_retrain_link(struct intel_encoder *encoder,
!intel_dp_mst_is_master_trans(crtc_state))
continue;
+ intel_dp->link_trained = false;
+
intel_dp_check_frl_training(intel_dp);
intel_dp_pcon_dsc_configure(intel_dp, crtc_state);
intel_dp_start_link_train(intel_dp, crtc_state);
diff --git a/drivers/gpu/drm/i915/display/intel_dp_link_training.c b/drivers/gpu/drm/i915/display/intel_dp_link_training.c
index a62bca622b0a..eb5559e1a200 100644
--- a/drivers/gpu/drm/i915/display/intel_dp_link_training.c
+++ b/drivers/gpu/drm/i915/display/intel_dp_link_training.c
@@ -114,10 +114,24 @@ intel_dp_set_lttpr_transparent_mode(struct intel_dp *intel_dp, bool enable)
return drm_dp_dpcd_write(&intel_dp->aux, DP_PHY_REPEATER_MODE, &val, 1) == 1;
}
-static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEIVER_CAP_SIZE])
+static bool intel_dp_lttpr_transparent_mode_enabled(struct intel_dp *intel_dp)
+{
+ return intel_dp->lttpr_common_caps[DP_PHY_REPEATER_MODE -
+ DP_LT_TUNABLE_PHY_REPEATER_FIELD_DATA_STRUCTURE_REV] ==
+ DP_PHY_REPEATER_MODE_TRANSPARENT;
+}
+
+/*
+ * Read the LTTPR common capabilities and switch the LTTPR PHYs to
+ * non-transparent mode if this is supported. Preserve the
+ * transparent/non-transparent mode on an active link.
+ *
+ * Return the number of detected LTTPRs in non-transparent mode or 0 if the
+ * LTTPRs are in transparent mode or the detection failed.
+ */
+static int intel_dp_init_lttpr_phys(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEIVER_CAP_SIZE])
{
int lttpr_count;
- int i;
if (!intel_dp_read_lttpr_common_caps(intel_dp, dpcd))
return 0;
@@ -131,6 +145,19 @@ static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEI
if (lttpr_count == 0)
return 0;
+ /*
+ * Don't change the mode on an active link, to prevent a loss of link
+ * synchronization. See DP Standard v2.0 3.6.7. about the LTTPR
+ * resetting its internal state when the mode is changed from
+ * non-transparent to transparent.
+ */
+ if (intel_dp->link_trained) {
+ if (lttpr_count < 0 || intel_dp_lttpr_transparent_mode_enabled(intel_dp))
+ goto out_reset_lttpr_count;
+
+ return lttpr_count;
+ }
+
/*
* See DP Standard v2.0 3.6.6.1. about the explicit disabling of
* non-transparent mode and the disable->enable non-transparent mode
@@ -151,11 +178,25 @@ static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEI
"Switching to LTTPR non-transparent LT mode failed, fall-back to transparent mode\n");
intel_dp_set_lttpr_transparent_mode(intel_dp, true);
- intel_dp_reset_lttpr_count(intel_dp);
- return 0;
+ goto out_reset_lttpr_count;
}
+ return lttpr_count;
+
+out_reset_lttpr_count:
+ intel_dp_reset_lttpr_count(intel_dp);
+
+ return 0;
+}
+
+static int intel_dp_init_lttpr(struct intel_dp *intel_dp, const u8 dpcd[DP_RECEIVER_CAP_SIZE])
+{
+ int lttpr_count;
+ int i;
+
+ lttpr_count = intel_dp_init_lttpr_phys(intel_dp, dpcd);
+
for (i = 0; i < lttpr_count; i++)
intel_dp_read_lttpr_phy_caps(intel_dp, dpcd, DP_PHY_LTTPR(i));
@@ -1353,10 +1394,10 @@ void intel_dp_start_link_train(struct intel_dp *intel_dp,
{
struct drm_i915_private *i915 = dp_to_i915(intel_dp);
bool passed;
-
/*
- * TODO: Reiniting LTTPRs here won't be needed once proper connector
- * HW state readout is added.
+ * Reinit the LTTPRs here to ensure that they are switched to
+ * non-transparent mode. During an earlier LTTPR detection this
+ * could've been prevented by an active link.
*/
int lttpr_count = intel_dp_init_lttpr_and_dprx_caps(intel_dp);
diff --git a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
index 42e09f158920..2065be5a196b 100644
--- a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
+++ b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
@@ -3315,11 +3315,7 @@ static void remove_from_engine(struct i915_request *rq)
static bool can_preempt(struct intel_engine_cs *engine)
{
- if (GRAPHICS_VER(engine->i915) > 8)
- return true;
-
- /* GPGPU on bdw requires extra w/a; not implemented */
- return engine->class != RENDER_CLASS;
+ return GRAPHICS_VER(engine->i915) > 8;
}
static void kick_execlists(const struct i915_request *rq, int prio)
diff --git a/drivers/gpu/drm/mediatek/mtk_disp_ovl.c b/drivers/gpu/drm/mediatek/mtk_disp_ovl.c
index 2bffe4245466..6f15069da8b0 100644
--- a/drivers/gpu/drm/mediatek/mtk_disp_ovl.c
+++ b/drivers/gpu/drm/mediatek/mtk_disp_ovl.c
@@ -38,6 +38,7 @@
#define DISP_REG_OVL_PITCH_MSB(n) (0x0040 + 0x20 * (n))
#define OVL_PITCH_MSB_2ND_SUBBUF BIT(16)
#define DISP_REG_OVL_PITCH(n) (0x0044 + 0x20 * (n))
+#define OVL_CONST_BLEND BIT(28)
#define DISP_REG_OVL_RDMA_CTRL(n) (0x00c0 + 0x20 * (n))
#define DISP_REG_OVL_RDMA_GMC(n) (0x00c8 + 0x20 * (n))
#define DISP_REG_OVL_ADDR_MT2701 0x0040
@@ -71,6 +72,8 @@
#define OVL_CON_VIRT_FLIP BIT(9)
#define OVL_CON_HORZ_FLIP BIT(10)
+#define OVL_COLOR_ALPHA GENMASK(31, 24)
+
static const u32 mt8173_formats[] = {
DRM_FORMAT_XRGB8888,
DRM_FORMAT_ARGB8888,
@@ -273,7 +276,13 @@ void mtk_ovl_config(struct device *dev, unsigned int w,
if (w != 0 && h != 0)
mtk_ddp_write_relaxed(cmdq_pkt, h << 16 | w, &ovl->cmdq_reg, ovl->regs,
DISP_REG_OVL_ROI_SIZE);
- mtk_ddp_write_relaxed(cmdq_pkt, 0x0, &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_ROI_BGCLR);
+
+ /*
+ * The background color must be opaque black (ARGB),
+ * otherwise the alpha blending will have no effect
+ */
+ mtk_ddp_write_relaxed(cmdq_pkt, OVL_COLOR_ALPHA, &ovl->cmdq_reg,
+ ovl->regs, DISP_REG_OVL_ROI_BGCLR);
mtk_ddp_write(cmdq_pkt, 0x1, &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_RST);
mtk_ddp_write(cmdq_pkt, 0x0, &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_RST);
@@ -407,6 +416,7 @@ void mtk_ovl_layer_config(struct device *dev, unsigned int idx,
unsigned int fmt = pending->format;
unsigned int offset = (pending->y << 16) | pending->x;
unsigned int src_size = (pending->height << 16) | pending->width;
+ unsigned int ignore_pixel_alpha = 0;
unsigned int con;
bool is_afbc = pending->modifier != DRM_FORMAT_MOD_LINEAR;
union overlay_pitch {
@@ -428,6 +438,14 @@ void mtk_ovl_layer_config(struct device *dev, unsigned int idx,
if (state->base.fb && state->base.fb->format->has_alpha)
con |= OVL_CON_AEN | OVL_CON_ALPHA;
+ /* CONST_BLD must be enabled for XRGB formats although the alpha channel
+ * can be ignored, or OVL will still read the value from memory.
+ * For RGB888 related formats, whether CONST_BLD is enabled or not won't
+ * affect the result. Therefore we use !has_alpha as the condition.
+ */
+ if (state->base.fb && !state->base.fb->format->has_alpha)
+ ignore_pixel_alpha = OVL_CONST_BLEND;
+
if (pending->rotation & DRM_MODE_REFLECT_Y) {
con |= OVL_CON_VIRT_FLIP;
addr += (pending->height - 1) * pending->pitch;
@@ -443,8 +461,8 @@ void mtk_ovl_layer_config(struct device *dev, unsigned int idx,
mtk_ddp_write_relaxed(cmdq_pkt, con, &ovl->cmdq_reg, ovl->regs,
DISP_REG_OVL_CON(idx));
- mtk_ddp_write_relaxed(cmdq_pkt, overlay_pitch.split_pitch.lsb, &ovl->cmdq_reg, ovl->regs,
- DISP_REG_OVL_PITCH(idx));
+ mtk_ddp_write_relaxed(cmdq_pkt, overlay_pitch.split_pitch.lsb | ignore_pixel_alpha,
+ &ovl->cmdq_reg, ovl->regs, DISP_REG_OVL_PITCH(idx));
mtk_ddp_write_relaxed(cmdq_pkt, src_size, &ovl->cmdq_reg, ovl->regs,
DISP_REG_OVL_SRC_SIZE(idx));
mtk_ddp_write_relaxed(cmdq_pkt, offset, &ovl->cmdq_reg, ovl->regs,
diff --git a/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c b/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c
index 6bf6367853fb..8f0c47e86874 100644
--- a/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c
+++ b/drivers/gpu/drm/mediatek/mtk_disp_ovl_adaptor.c
@@ -111,7 +111,7 @@ void mtk_ovl_adaptor_layer_config(struct device *dev, unsigned int idx,
merge = ovl_adaptor->ovl_adaptor_comp[OVL_ADAPTOR_MERGE0 + idx];
ethdr = ovl_adaptor->ovl_adaptor_comp[OVL_ADAPTOR_ETHDR0];
- if (!pending->enable) {
+ if (!pending->enable || !pending->width || !pending->height) {
mtk_merge_stop_cmdq(merge, cmdq_pkt);
mtk_mdp_rdma_stop(rdma_l, cmdq_pkt);
mtk_mdp_rdma_stop(rdma_r, cmdq_pkt);
diff --git a/drivers/gpu/drm/mediatek/mtk_dp.c b/drivers/gpu/drm/mediatek/mtk_dp.c
index af03a22772fe..48a4defbc66c 100644
--- a/drivers/gpu/drm/mediatek/mtk_dp.c
+++ b/drivers/gpu/drm/mediatek/mtk_dp.c
@@ -2027,12 +2027,12 @@ static enum drm_connector_status mtk_dp_bdg_detect(struct drm_bridge *bridge)
return ret;
}
-static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
- struct drm_connector *connector)
+static const struct drm_edid *mtk_dp_edid_read(struct drm_bridge *bridge,
+ struct drm_connector *connector)
{
struct mtk_dp *mtk_dp = mtk_dp_from_bridge(bridge);
bool enabled = mtk_dp->enabled;
- struct edid *new_edid = NULL;
+ const struct drm_edid *drm_edid;
struct mtk_dp_audio_cfg *audio_caps = &mtk_dp->info.audio_cur_cfg;
if (!enabled) {
@@ -2040,7 +2040,7 @@ static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
mtk_dp_aux_panel_poweron(mtk_dp, true);
}
- new_edid = drm_get_edid(connector, &mtk_dp->aux.ddc);
+ drm_edid = drm_edid_read_ddc(connector, &mtk_dp->aux.ddc);
/*
* Parse capability here to let atomic_get_input_bus_fmts and
@@ -2048,17 +2048,32 @@ static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
*/
if (mtk_dp_parse_capabilities(mtk_dp)) {
drm_err(mtk_dp->drm_dev, "Can't parse capabilities\n");
- kfree(new_edid);
- new_edid = NULL;
+ drm_edid_free(drm_edid);
+ drm_edid = NULL;
}
- if (new_edid) {
+ if (drm_edid) {
+ /*
+ * FIXME: get rid of drm_edid_raw()
+ */
+ const struct edid *edid = drm_edid_raw(drm_edid);
struct cea_sad *sads;
+ int ret;
- audio_caps->sad_count = drm_edid_to_sad(new_edid, &sads);
- kfree(sads);
+ ret = drm_edid_to_sad(edid, &sads);
+ /* Ignore any errors */
+ if (ret < 0)
+ ret = 0;
+ if (ret)
+ kfree(sads);
+ audio_caps->sad_count = ret;
- audio_caps->detect_monitor = drm_detect_monitor_audio(new_edid);
+ /*
+ * FIXME: This should use connector->display_info.has_audio from
+ * a path that has read the EDID and called
+ * drm_edid_connector_update().
+ */
+ audio_caps->detect_monitor = drm_detect_monitor_audio(edid);
}
if (!enabled) {
@@ -2066,7 +2081,7 @@ static struct edid *mtk_dp_get_edid(struct drm_bridge *bridge,
drm_atomic_bridge_chain_post_disable(bridge, connector->state->state);
}
- return new_edid;
+ return drm_edid;
}
static ssize_t mtk_dp_aux_transfer(struct drm_dp_aux *mtk_aux,
@@ -2418,7 +2433,7 @@ static const struct drm_bridge_funcs mtk_dp_bridge_funcs = {
.atomic_enable = mtk_dp_bridge_atomic_enable,
.atomic_disable = mtk_dp_bridge_atomic_disable,
.mode_valid = mtk_dp_bridge_mode_valid,
- .get_edid = mtk_dp_get_edid,
+ .edid_read = mtk_dp_edid_read,
.detect = mtk_dp_bdg_detect,
};
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c b/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c
index 771f4e173353..66ccde966e3c 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_ddp_comp.c
@@ -553,7 +553,7 @@ int mtk_ddp_comp_init(struct device_node *node, struct mtk_ddp_comp *comp,
int ret;
#endif
- if (comp_id < 0 || comp_id >= DDP_COMPONENT_DRM_ID_MAX)
+ if (comp_id >= DDP_COMPONENT_DRM_ID_MAX)
return -EINVAL;
type = mtk_ddp_matches[comp_id].type;
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_drv.c b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
index 37d8113ba92f..ffe016d6cbcf 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_drv.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
@@ -719,6 +719,8 @@ static const struct of_device_id mtk_ddp_comp_dt_ids[] = {
.data = (void *)MTK_DISP_OVL },
{ .compatible = "mediatek,mt8192-disp-ovl",
.data = (void *)MTK_DISP_OVL },
+ { .compatible = "mediatek,mt8195-disp-ovl",
+ .data = (void *)MTK_DISP_OVL },
{ .compatible = "mediatek,mt8183-disp-ovl-2l",
.data = (void *)MTK_DISP_OVL_2L },
{ .compatible = "mediatek,mt8192-disp-ovl-2l",
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_plane.c b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
index ddc9355b06d5..f10d4cc6c223 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_plane.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
@@ -227,6 +227,8 @@ static void mtk_plane_atomic_async_update(struct drm_plane *plane,
plane->state->src_y = new_state->src_y;
plane->state->src_h = new_state->src_h;
plane->state->src_w = new_state->src_w;
+ plane->state->dst.x1 = new_state->dst.x1;
+ plane->state->dst.y1 = new_state->dst.y1;
mtk_plane_update_new_state(new_state, new_plane_state);
swap(plane->state->fb, new_state->fb);
diff --git a/drivers/gpu/drm/mediatek/mtk_ethdr.c b/drivers/gpu/drm/mediatek/mtk_ethdr.c
index db7ac666ec5e..0cf8c8899415 100644
--- a/drivers/gpu/drm/mediatek/mtk_ethdr.c
+++ b/drivers/gpu/drm/mediatek/mtk_ethdr.c
@@ -50,7 +50,6 @@
#define MIXER_INX_MODE_BYPASS 0
#define MIXER_INX_MODE_EVEN_EXTEND 1
-#define DEFAULT_9BIT_ALPHA 0x100
#define MIXER_ALPHA_AEN BIT(8)
#define MIXER_ALPHA 0xff
#define ETHDR_CLK_NUM 13
@@ -154,13 +153,19 @@ void mtk_ethdr_layer_config(struct device *dev, unsigned int idx,
unsigned int offset = (pending->x & 1) << 31 | pending->y << 16 | pending->x;
unsigned int align_width = ALIGN_DOWN(pending->width, 2);
unsigned int alpha_con = 0;
+ bool replace_src_a = false;
dev_dbg(dev, "%s+ idx:%d", __func__, idx);
if (idx >= 4)
return;
- if (!pending->enable) {
+ if (!pending->enable || !pending->width || !pending->height) {
+ /*
+ * instead of disabling layer with MIX_SRC_CON directly
+ * set the size to 0 to avoid screen shift due to mixer
+ * mode switch (hardware behavior)
+ */
mtk_ddp_write(cmdq_pkt, 0, &mixer->cmdq_base, mixer->regs, MIX_L_SRC_SIZE(idx));
return;
}
@@ -168,8 +173,16 @@ void mtk_ethdr_layer_config(struct device *dev, unsigned int idx,
if (state->base.fb && state->base.fb->format->has_alpha)
alpha_con = MIXER_ALPHA_AEN | MIXER_ALPHA;
- mtk_mmsys_mixer_in_config(priv->mmsys_dev, idx + 1, alpha_con ? false : true,
- DEFAULT_9BIT_ALPHA,
+ if (state->base.fb && !state->base.fb->format->has_alpha) {
+ /*
+ * Mixer doesn't support CONST_BLD mode,
+ * use a trick to make the output equivalent
+ */
+ replace_src_a = true;
+ }
+
+ mtk_mmsys_mixer_in_config(priv->mmsys_dev, idx + 1, replace_src_a,
+ MIXER_ALPHA,
pending->x & 1 ? MIXER_INX_MODE_EVEN_EXTEND :
MIXER_INX_MODE_BYPASS, align_width / 2 - 1, cmdq_pkt);
diff --git a/drivers/gpu/drm/meson/meson_drv.c b/drivers/gpu/drm/meson/meson_drv.c
index cb674966e9ac..095f634ff7c7 100644
--- a/drivers/gpu/drm/meson/meson_drv.c
+++ b/drivers/gpu/drm/meson/meson_drv.c
@@ -250,29 +250,20 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
if (ret)
goto free_drm;
ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_0);
- if (ret) {
- meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
- goto free_drm;
- }
+ if (ret)
+ goto free_canvas_osd1;
ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_1);
- if (ret) {
- meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
- goto free_drm;
- }
+ if (ret)
+ goto free_canvas_vd1_0;
ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_2);
- if (ret) {
- meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
- goto free_drm;
- }
+ if (ret)
+ goto free_canvas_vd1_1;
priv->vsync_irq = platform_get_irq(pdev, 0);
ret = drm_vblank_init(drm, 1);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
/* Assign limits per soc revision/package */
for (i = 0 ; i < ARRAY_SIZE(meson_drm_soc_attrs) ; ++i) {
@@ -288,11 +279,11 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
*/
ret = drm_aperture_remove_framebuffers(&meson_driver);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
ret = drmm_mode_config_init(drm);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
drm->mode_config.max_width = 3840;
drm->mode_config.max_height = 2160;
drm->mode_config.funcs = &meson_mode_config_funcs;
@@ -307,7 +298,7 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
if (priv->afbcd.ops) {
ret = priv->afbcd.ops->init(priv);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
}
/* Encoder Initialization */
@@ -371,6 +362,14 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
exit_afbcd:
if (priv->afbcd.ops)
priv->afbcd.ops->exit(priv);
+free_canvas_vd1_2:
+ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_2);
+free_canvas_vd1_1:
+ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
+free_canvas_vd1_0:
+ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
+free_canvas_osd1:
+ meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
free_drm:
drm_dev_put(drm);
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
index 5fb7e2e10801..e454b8090712 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
@@ -1672,8 +1672,7 @@ void dpu_encoder_trigger_kickoff_pending(struct drm_encoder *drm_enc)
phys = dpu_enc->phys_encs[i];
ctl = phys->hw_ctl;
- if (ctl->ops.clear_pending_flush)
- ctl->ops.clear_pending_flush(ctl);
+ ctl->ops.clear_pending_flush(ctl);
/* update only for command mode primary ctl */
if ((phys == dpu_enc->cur_master) &&
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
index 870a1f5060e3..a81a9ee71a86 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
@@ -528,8 +528,7 @@ static void dpu_encoder_phys_wb_disable(struct dpu_encoder_phys *phys_enc)
}
/* reset h/w before final flush */
- if (phys_enc->hw_ctl->ops.clear_pending_flush)
- phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
+ phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
/*
* New CTL reset sequence from 5.0 MDP onwards.
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
index 1c242298ff2e..dca87ea78e25 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
@@ -81,7 +81,8 @@ struct dpu_hw_ctl_ops {
/**
* Clear the value of the cached pending_flush_mask
- * No effect on hardware
+ * No effect on hardware.
+ * Required to be implemented.
* @ctx : ctl path ctx pointer
*/
void (*clear_pending_flush)(struct dpu_hw_ctl *ctx);
diff --git a/drivers/gpu/drm/msm/dsi/dsi_host.c b/drivers/gpu/drm/msm/dsi/dsi_host.c
index ab393bdaba6c..77b805eacb1b 100644
--- a/drivers/gpu/drm/msm/dsi/dsi_host.c
+++ b/drivers/gpu/drm/msm/dsi/dsi_host.c
@@ -832,6 +832,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
u32 slice_per_intf, total_bytes_per_intf;
u32 pkt_per_line;
u32 eol_byte_num;
+ u32 bytes_per_pkt;
/* first calculate dsc parameters and then program
* compress mode registers
@@ -839,6 +840,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
slice_per_intf = msm_dsc_get_slices_per_intf(dsc, hdisplay);
total_bytes_per_intf = dsc->slice_chunk_size * slice_per_intf;
+ bytes_per_pkt = dsc->slice_chunk_size; /* * slice_per_pkt; */
eol_byte_num = total_bytes_per_intf % 3;
@@ -876,6 +878,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL, reg_ctrl);
dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL2, reg_ctrl2);
} else {
+ reg |= DSI_VIDEO_COMPRESSION_MODE_CTRL_WC(bytes_per_pkt);
dsi_write(msm_host, REG_DSI_VIDEO_COMPRESSION_MODE_CTRL, reg);
}
}
diff --git a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
index 7990c519a56b..cfa5b54ed6fe 100644
--- a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
+++ b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
@@ -1847,7 +1847,11 @@ static int boe_panel_prepare(struct drm_panel *panel)
usleep_range(10000, 11000);
if (boe->desc->lp11_before_reset) {
- mipi_dsi_dcs_nop(boe->dsi);
+ ret = mipi_dsi_dcs_nop(boe->dsi);
+ if (ret < 0) {
+ dev_err(&boe->dsi->dev, "Failed to send NOP: %d\n", ret);
+ goto poweroff;
+ }
usleep_range(1000, 2000);
}
gpiod_set_value(boe->enable_gpio, 1);
@@ -1868,13 +1872,13 @@ static int boe_panel_prepare(struct drm_panel *panel)
return 0;
poweroff:
+ gpiod_set_value(boe->enable_gpio, 0);
regulator_disable(boe->avee);
poweroffavdd:
regulator_disable(boe->avdd);
poweroff1v8:
usleep_range(5000, 7000);
regulator_disable(boe->pp1800);
- gpiod_set_value(boe->enable_gpio, 0);
return ret;
}
diff --git a/drivers/gpu/drm/panel/panel-himax-hx8394.c b/drivers/gpu/drm/panel/panel-himax-hx8394.c
index c73243d85de7..631420d28be4 100644
--- a/drivers/gpu/drm/panel/panel-himax-hx8394.c
+++ b/drivers/gpu/drm/panel/panel-himax-hx8394.c
@@ -234,8 +234,7 @@ static int hx8394_enable(struct drm_panel *panel)
sleep_in:
/* This will probably fail, but let's try orderly power off anyway. */
- ret = mipi_dsi_dcs_enter_sleep_mode(dsi);
- if (!ret)
+ if (!mipi_dsi_dcs_enter_sleep_mode(dsi))
msleep(50);
return ret;
diff --git a/drivers/gpu/drm/panfrost/panfrost_drv.c b/drivers/gpu/drm/panfrost/panfrost_drv.c
index a2ab99698ca8..ddcc8259061b 100644
--- a/drivers/gpu/drm/panfrost/panfrost_drv.c
+++ b/drivers/gpu/drm/panfrost/panfrost_drv.c
@@ -731,3 +731,4 @@ module_platform_driver(panfrost_driver);
MODULE_AUTHOR("Panfrost Project Developers");
MODULE_DESCRIPTION("Panfrost DRM Driver");
MODULE_LICENSE("GPL v2");
+MODULE_SOFTDEP("pre: governor_simpleondemand");
diff --git a/drivers/gpu/drm/qxl/qxl_display.c b/drivers/gpu/drm/qxl/qxl_display.c
index 404b0483bb7c..8ee614be9adf 100644
--- a/drivers/gpu/drm/qxl/qxl_display.c
+++ b/drivers/gpu/drm/qxl/qxl_display.c
@@ -236,6 +236,9 @@ static int qxl_add_mode(struct drm_connector *connector,
return 0;
mode = drm_cvt_mode(dev, width, height, 60, false, false, false);
+ if (!mode)
+ return 0;
+
if (preferred)
mode->type |= DRM_MODE_TYPE_PREFERRED;
mode->hdisplay = width;
diff --git a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
index c5ec4169616d..f2a956f97361 100644
--- a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
+++ b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
@@ -1927,7 +1927,7 @@ static void vop2_setup_layer_mixer(struct vop2_video_port *vp)
port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX,
(vp2->nlayers + vp1->nlayers + vp0->nlayers - 1));
else
- port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT1_MUX, 8);
+ port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX, 8);
layer_sel = vop2_readl(vop2, RK3568_OVL_LAYER_SEL);
diff --git a/drivers/gpu/drm/udl/udl_modeset.c b/drivers/gpu/drm/udl/udl_modeset.c
index 40876bcdd79a..5a1539914ce8 100644
--- a/drivers/gpu/drm/udl/udl_modeset.c
+++ b/drivers/gpu/drm/udl/udl_modeset.c
@@ -512,8 +512,7 @@ struct drm_connector *udl_connector_init(struct drm_device *dev)
drm_connector_helper_add(connector, &udl_connector_helper_funcs);
- connector->polled = DRM_CONNECTOR_POLL_HPD |
- DRM_CONNECTOR_POLL_CONNECT |
+ connector->polled = DRM_CONNECTOR_POLL_CONNECT |
DRM_CONNECTOR_POLL_DISCONNECT;
return connector;
diff --git a/drivers/gpu/drm/xlnx/zynqmp_dpsub.c b/drivers/gpu/drm/xlnx/zynqmp_dpsub.c
index face8d6b2a6f..f5781939de9c 100644
--- a/drivers/gpu/drm/xlnx/zynqmp_dpsub.c
+++ b/drivers/gpu/drm/xlnx/zynqmp_dpsub.c
@@ -269,6 +269,7 @@ static int zynqmp_dpsub_probe(struct platform_device *pdev)
return 0;
err_disp:
+ drm_bridge_remove(dpsub->bridge);
zynqmp_disp_remove(dpsub);
err_dp:
zynqmp_dp_remove(dpsub);
diff --git a/drivers/gpu/drm/xlnx/zynqmp_kms.c b/drivers/gpu/drm/xlnx/zynqmp_kms.c
index a7f8611be6f4..44d4a510ad7d 100644
--- a/drivers/gpu/drm/xlnx/zynqmp_kms.c
+++ b/drivers/gpu/drm/xlnx/zynqmp_kms.c
@@ -434,23 +434,28 @@ static int zynqmp_dpsub_kms_init(struct zynqmp_dpsub *dpsub)
DRM_BRIDGE_ATTACH_NO_CONNECTOR);
if (ret) {
dev_err(dpsub->dev, "failed to attach bridge to encoder\n");
- return ret;
+ goto err_encoder;
}
/* Create the connector for the chain of bridges. */
connector = drm_bridge_connector_init(&dpsub->drm->dev, encoder);
if (IS_ERR(connector)) {
dev_err(dpsub->dev, "failed to created connector\n");
- return PTR_ERR(connector);
+ ret = PTR_ERR(connector);
+ goto err_encoder;
}
ret = drm_connector_attach_encoder(connector, encoder);
if (ret < 0) {
dev_err(dpsub->dev, "failed to attach connector to encoder\n");
- return ret;
+ goto err_encoder;
}
return 0;
+
+err_encoder:
+ drm_encoder_cleanup(encoder);
+ return ret;
}
static void zynqmp_dpsub_drm_release(struct drm_device *drm, void *res)
@@ -530,5 +535,6 @@ void zynqmp_dpsub_drm_cleanup(struct zynqmp_dpsub *dpsub)
drm_dev_unregister(drm);
drm_atomic_helper_shutdown(drm);
+ drm_encoder_cleanup(&dpsub->drm->encoder);
drm_kms_helper_poll_fini(drm);
}
diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c
index 03acadc3a6cb..14b2547adae8 100644
--- a/drivers/hwmon/adt7475.c
+++ b/drivers/hwmon/adt7475.c
@@ -1862,7 +1862,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index)
data->pwm[CONTROL][index] &= ~0xE0;
data->pwm[CONTROL][index] |= (7 << 5);
- i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
+ i2c_smbus_write_byte_data(client, PWM_REG(index),
data->pwm[INPUT][index]);
i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c
index 7d10dd434f2e..a338dd4e990d 100644
--- a/drivers/hwmon/max6697.c
+++ b/drivers/hwmon/max6697.c
@@ -311,6 +311,7 @@ static ssize_t temp_store(struct device *dev,
return ret;
mutex_lock(&data->update_lock);
+ temp = clamp_val(temp, -1000000, 1000000); /* prevent underflow */
temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset;
temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127);
data->temp[nr][index] = temp;
@@ -428,14 +429,14 @@ static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20);
static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21);
static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23);
-static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 14);
+static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15);
static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8);
static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9);
static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10);
static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11);
static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12);
static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13);
-static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 15);
+static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14);
static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1);
static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2);
diff --git a/drivers/hwtracing/coresight/coresight-platform.c b/drivers/hwtracing/coresight/coresight-platform.c
index 9d550f5697fa..57a009552cc5 100644
--- a/drivers/hwtracing/coresight/coresight-platform.c
+++ b/drivers/hwtracing/coresight/coresight-platform.c
@@ -297,8 +297,10 @@ static int of_get_coresight_platform_data(struct device *dev,
continue;
ret = of_coresight_parse_endpoint(dev, ep, pdata);
- if (ret)
+ if (ret) {
+ of_node_put(ep);
return ret;
+ }
}
return 0;
diff --git a/drivers/iio/frequency/adrf6780.c b/drivers/iio/frequency/adrf6780.c
index b4defb82f37e..3f46032c9275 100644
--- a/drivers/iio/frequency/adrf6780.c
+++ b/drivers/iio/frequency/adrf6780.c
@@ -9,7 +9,6 @@
#include <linux/bits.h>
#include <linux/clk.h>
#include <linux/clkdev.h>
-#include <linux/clk-provider.h>
#include <linux/delay.h>
#include <linux/device.h>
#include <linux/iio/iio.h>
diff --git a/drivers/iio/industrialio-gts-helper.c b/drivers/iio/industrialio-gts-helper.c
index b51eb6cb766f..59d7615c0f56 100644
--- a/drivers/iio/industrialio-gts-helper.c
+++ b/drivers/iio/industrialio-gts-helper.c
@@ -362,17 +362,20 @@ static int iio_gts_build_avail_time_table(struct iio_gts *gts)
for (i = gts->num_itime - 1; i >= 0; i--) {
int new = gts->itime_table[i].time_us;
- if (times[idx] < new) {
+ if (idx == 0 || times[idx - 1] < new) {
times[idx++] = new;
continue;
}
- for (j = 0; j <= idx; j++) {
+ for (j = 0; j < idx; j++) {
+ if (times[j] == new)
+ break;
if (times[j] > new) {
memmove(×[j + 1], ×[j],
(idx - j) * sizeof(int));
times[j] = new;
idx++;
+ break;
}
}
}
diff --git a/drivers/infiniband/core/cache.c b/drivers/infiniband/core/cache.c
index 7acc0f936dad..b7251ed7a8df 100644
--- a/drivers/infiniband/core/cache.c
+++ b/drivers/infiniband/core/cache.c
@@ -794,7 +794,6 @@ static struct ib_gid_table *alloc_gid_table(int sz)
static void release_gid_table(struct ib_device *device,
struct ib_gid_table *table)
{
- bool leak = false;
int i;
if (!table)
@@ -803,15 +802,12 @@ static void release_gid_table(struct ib_device *device,
for (i = 0; i < table->sz; i++) {
if (is_gid_entry_free(table->data_vec[i]))
continue;
- if (kref_read(&table->data_vec[i]->kref) > 1) {
- dev_err(&device->dev,
- "GID entry ref leak for index %d ref=%u\n", i,
- kref_read(&table->data_vec[i]->kref));
- leak = true;
- }
+
+ WARN_ONCE(true,
+ "GID entry ref leak for dev %s index %d ref=%u\n",
+ dev_name(&device->dev), i,
+ kref_read(&table->data_vec[i]->kref));
}
- if (leak)
- return;
mutex_destroy(&table->lock);
kfree(table->data_vec);
diff --git a/drivers/infiniband/core/device.c b/drivers/infiniband/core/device.c
index db0a58c82838..56dd030045a2 100644
--- a/drivers/infiniband/core/device.c
+++ b/drivers/infiniband/core/device.c
@@ -2146,6 +2146,9 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
unsigned long flags;
int ret;
+ if (!rdma_is_port_valid(ib_dev, port))
+ return -EINVAL;
+
/*
* Drivers wish to call this before ib_register_driver, so we have to
* setup the port data early.
@@ -2154,9 +2157,6 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
if (ret)
return ret;
- if (!rdma_is_port_valid(ib_dev, port))
- return -EINVAL;
-
pdata = &ib_dev->port_data[port];
spin_lock_irqsave(&pdata->netdev_lock, flags);
old_ndev = rcu_dereference_protected(
@@ -2166,17 +2166,12 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
return 0;
}
- if (old_ndev)
- netdev_tracker_free(ndev, &pdata->netdev_tracker);
- if (ndev)
- netdev_hold(ndev, &pdata->netdev_tracker, GFP_ATOMIC);
rcu_assign_pointer(pdata->netdev, ndev);
+ netdev_put(old_ndev, &pdata->netdev_tracker);
+ netdev_hold(ndev, &pdata->netdev_tracker, GFP_ATOMIC);
spin_unlock_irqrestore(&pdata->netdev_lock, flags);
add_ndev_hash(pdata);
- if (old_ndev)
- __dev_put(old_ndev);
-
return 0;
}
EXPORT_SYMBOL(ib_device_set_netdev);
@@ -2235,8 +2230,7 @@ struct net_device *ib_device_get_netdev(struct ib_device *ib_dev,
spin_lock(&pdata->netdev_lock);
res = rcu_dereference_protected(
pdata->netdev, lockdep_is_held(&pdata->netdev_lock));
- if (res)
- dev_hold(res);
+ dev_hold(res);
spin_unlock(&pdata->netdev_lock);
}
@@ -2311,9 +2305,7 @@ void ib_enum_roce_netdev(struct ib_device *ib_dev,
if (filter(ib_dev, port, idev, filter_cookie))
cb(ib_dev, port, idev, cookie);
-
- if (idev)
- dev_put(idev);
+ dev_put(idev);
}
}
diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c
index 2b47073c61a6..2d09d1be38f1 100644
--- a/drivers/infiniband/core/iwcm.c
+++ b/drivers/infiniband/core/iwcm.c
@@ -369,8 +369,10 @@ EXPORT_SYMBOL(iw_cm_disconnect);
*
* Clean up all resources associated with the connection and release
* the initial reference taken by iw_create_cm_id.
+ *
+ * Returns true if and only if the last cm_id_priv reference has been dropped.
*/
-static void destroy_cm_id(struct iw_cm_id *cm_id)
+static bool destroy_cm_id(struct iw_cm_id *cm_id)
{
struct iwcm_id_private *cm_id_priv;
struct ib_qp *qp;
@@ -440,7 +442,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM);
}
- (void)iwcm_deref_id(cm_id_priv);
+ return iwcm_deref_id(cm_id_priv);
}
/*
@@ -451,7 +453,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
*/
void iw_destroy_cm_id(struct iw_cm_id *cm_id)
{
- destroy_cm_id(cm_id);
+ if (!destroy_cm_id(cm_id))
+ flush_workqueue(iwcm_wq);
}
EXPORT_SYMBOL(iw_destroy_cm_id);
@@ -1035,7 +1038,7 @@ static void cm_work_handler(struct work_struct *_work)
if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) {
ret = process_event(cm_id_priv, &levent);
if (ret)
- destroy_cm_id(&cm_id_priv->id);
+ WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id));
} else
pr_debug("dropping event %d\n", levent.event);
if (iwcm_deref_id(cm_id_priv))
diff --git a/drivers/infiniband/core/lag.c b/drivers/infiniband/core/lag.c
index c77d7d2559a1..66c7e1e6600d 100644
--- a/drivers/infiniband/core/lag.c
+++ b/drivers/infiniband/core/lag.c
@@ -93,8 +93,7 @@ static struct net_device *rdma_get_xmit_slave_udp(struct ib_device *device,
slave = netdev_get_xmit_slave(master, skb,
!!(device->lag_flags &
RDMA_LAG_FLAGS_HASH_ALL_SLAVES));
- if (slave)
- dev_hold(slave);
+ dev_hold(slave);
rcu_read_unlock();
kfree_skb(skb);
return slave;
diff --git a/drivers/infiniband/core/roce_gid_mgmt.c b/drivers/infiniband/core/roce_gid_mgmt.c
index e958c43dd28f..d5131b3ba8ab 100644
--- a/drivers/infiniband/core/roce_gid_mgmt.c
+++ b/drivers/infiniband/core/roce_gid_mgmt.c
@@ -601,8 +601,7 @@ static void del_netdev_default_ips_join(struct ib_device *ib_dev, u32 port,
rcu_read_lock();
master_ndev = netdev_master_upper_dev_get_rcu(rdma_ndev);
- if (master_ndev)
- dev_hold(master_ndev);
+ dev_hold(master_ndev);
rcu_read_unlock();
if (master_ndev) {
diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
index fd69be982ce0..b4d3e7dfc939 100644
--- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c
+++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
@@ -2467,7 +2467,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp,
break;
case IB_WR_SEND_WITH_IMM:
wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM;
- wqe->send.imm_data = wr->ex.imm_data;
+ wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data);
break;
case IB_WR_SEND_WITH_INV:
wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV;
@@ -2497,7 +2497,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr,
break;
case IB_WR_RDMA_WRITE_WITH_IMM:
wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM;
- wqe->rdma.imm_data = wr->ex.imm_data;
+ wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data);
break;
case IB_WR_RDMA_READ:
wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ;
@@ -3545,7 +3545,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *gsi_sqp,
wc->byte_len = orig_cqe->length;
wc->qp = &gsi_qp->ib_qp;
- wc->ex.imm_data = orig_cqe->immdata;
+ wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata));
wc->src_qp = orig_cqe->src_qp;
memcpy(wc->smac, orig_cqe->smac, ETH_ALEN);
if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) {
@@ -3690,7 +3690,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc)
(unsigned long)(cqe->qp_handle),
struct bnxt_re_qp, qplib_qp);
wc->qp = &qp->ib_qp;
- wc->ex.imm_data = cqe->immdata;
+ wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata));
wc->src_qp = cqe->src_qp;
memcpy(wc->smac, cqe->smac, ETH_ALEN);
wc->port_num = 1;
diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
index 113be429f0aa..a6f38d8f12ef 100644
--- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h
+++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
@@ -164,7 +164,7 @@ struct bnxt_qplib_swqe {
/* Send, with imm, inval key */
struct {
union {
- __be32 imm_data;
+ u32 imm_data;
u32 inv_key;
};
u32 q_key;
@@ -182,7 +182,7 @@ struct bnxt_qplib_swqe {
/* RDMA write, with imm, read */
struct {
union {
- __be32 imm_data;
+ u32 imm_data;
u32 inv_key;
};
u64 remote_va;
@@ -389,7 +389,7 @@ struct bnxt_qplib_cqe {
u16 cfa_meta;
u64 wr_id;
union {
- __be32 immdata;
+ __le32 immdata;
u32 invrkey;
};
u64 qp_handle;
diff --git a/drivers/infiniband/hw/hns/hns_roce_device.h b/drivers/infiniband/hw/hns/hns_roce_device.h
index 82066859cc11..cd593d651e4c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_device.h
+++ b/drivers/infiniband/hw/hns/hns_roce_device.h
@@ -82,6 +82,7 @@
#define MR_TYPE_DMA 0x03
#define HNS_ROCE_FRMR_MAX_PA 512
+#define HNS_ROCE_FRMR_ALIGN_SIZE 128
#define PKEY_ID 0xffff
#define NODE_DESC_SIZE 64
@@ -90,6 +91,8 @@
/* Configure to HW for PAGE_SIZE larger than 4KB */
#define PG_SHIFT_OFFSET (PAGE_SHIFT - 12)
+#define ATOMIC_WR_LEN 8
+
#define HNS_ROCE_IDX_QUE_ENTRY_SZ 4
#define SRQ_DB_REG 0x230
@@ -181,6 +184,9 @@ enum {
#define HNS_HW_PAGE_SHIFT 12
#define HNS_HW_PAGE_SIZE (1 << HNS_HW_PAGE_SHIFT)
+#define HNS_HW_MAX_PAGE_SHIFT 27
+#define HNS_HW_MAX_PAGE_SIZE (1 << HNS_HW_MAX_PAGE_SHIFT)
+
struct hns_roce_uar {
u64 pfn;
unsigned long index;
diff --git a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
index 32fb2c00a8f2..a49280e2df8c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
+++ b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
@@ -595,11 +595,16 @@ static inline int set_rc_wqe(struct hns_roce_qp *qp,
(wr->send_flags & IB_SEND_SIGNALED) ? 1 : 0);
if (wr->opcode == IB_WR_ATOMIC_CMP_AND_SWP ||
- wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD)
+ wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD) {
+ if (msg_len != ATOMIC_WR_LEN)
+ return -EINVAL;
set_atomic_seg(wr, rc_sq_wqe, valid_num_sge);
- else if (wr->opcode != IB_WR_REG_MR)
+ } else if (wr->opcode != IB_WR_REG_MR) {
ret = set_rwqe_data_seg(&qp->ibqp, wr, rc_sq_wqe,
&curr_idx, valid_num_sge);
+ if (ret)
+ return ret;
+ }
/*
* The pipeline can sequentially post all valid WQEs into WQ buffer,
@@ -2443,14 +2448,16 @@ static int set_llm_cfg_to_hw(struct hns_roce_dev *hr_dev,
static struct hns_roce_link_table *
alloc_link_table_buf(struct hns_roce_dev *hr_dev)
{
+ u16 total_sl = hr_dev->caps.sl_num * hr_dev->func_num;
struct hns_roce_v2_priv *priv = hr_dev->priv;
struct hns_roce_link_table *link_tbl;
u32 pg_shift, size, min_size;
link_tbl = &priv->ext_llm;
pg_shift = hr_dev->caps.llm_buf_pg_sz + PAGE_SHIFT;
- size = hr_dev->caps.num_qps * HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
- min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(hr_dev->caps.sl_num) << pg_shift;
+ size = hr_dev->caps.num_qps * hr_dev->func_num *
+ HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
+ min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(total_sl) << pg_shift;
/* Alloc data table */
size = max(size, min_size);
@@ -6256,9 +6263,16 @@ static void hns_roce_v2_int_mask_enable(struct hns_roce_dev *hr_dev,
roce_write(hr_dev, ROCEE_VF_ABN_INT_CFG_REG, enable_flag);
}
-static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
+static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
+{
+ hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+}
+
+static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev,
+ struct hns_roce_eq *eq)
{
struct device *dev = hr_dev->dev;
+ int eqn = eq->eqn;
int ret;
u8 cmd;
@@ -6269,12 +6283,9 @@ static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
ret = hns_roce_destroy_hw_ctx(hr_dev, cmd, eqn & HNS_ROCE_V2_EQN_M);
if (ret)
- dev_err(dev, "[mailbox cmd] destroy eqc(%u) failed.\n", eqn);
-}
+ dev_err(dev, "[mailbox cmd] destroy eqc(%d) failed.\n", eqn);
-static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
-{
- hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+ free_eq_buf(hr_dev, eq);
}
static void init_eq_config(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
@@ -6580,7 +6591,7 @@ static int hns_roce_v2_init_eq_table(struct hns_roce_dev *hr_dev)
err_create_eq_fail:
for (i -= 1; i >= 0; i--)
- free_eq_buf(hr_dev, &eq_table->eq[i]);
+ hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
kfree(eq_table->eq);
return ret;
@@ -6600,11 +6611,8 @@ static void hns_roce_v2_cleanup_eq_table(struct hns_roce_dev *hr_dev)
__hns_roce_free_irq(hr_dev);
destroy_workqueue(hr_dev->irq_workq);
- for (i = 0; i < eq_num; i++) {
- hns_roce_v2_destroy_eqc(hr_dev, i);
-
- free_eq_buf(hr_dev, &eq_table->eq[i]);
- }
+ for (i = 0; i < eq_num; i++)
+ hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
kfree(eq_table->eq);
}
diff --git a/drivers/infiniband/hw/hns/hns_roce_mr.c b/drivers/infiniband/hw/hns/hns_roce_mr.c
index 190e62da98e4..980261969b0c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_mr.c
+++ b/drivers/infiniband/hw/hns/hns_roce_mr.c
@@ -423,6 +423,11 @@ int hns_roce_map_mr_sg(struct ib_mr *ibmr, struct scatterlist *sg, int sg_nents,
struct hns_roce_mtr *mtr = &mr->pbl_mtr;
int ret, sg_num = 0;
+ if (!IS_ALIGNED(*sg_offset, HNS_ROCE_FRMR_ALIGN_SIZE) ||
+ ibmr->page_size < HNS_HW_PAGE_SIZE ||
+ ibmr->page_size > HNS_HW_MAX_PAGE_SIZE)
+ return sg_num;
+
mr->npages = 0;
mr->page_list = kvcalloc(mr->pbl_mtr.hem_cfg.buf_pg_count,
sizeof(dma_addr_t), GFP_KERNEL);
diff --git a/drivers/infiniband/hw/hns/hns_roce_qp.c b/drivers/infiniband/hw/hns/hns_roce_qp.c
index 828b58534aa9..bff00b3af41f 100644
--- a/drivers/infiniband/hw/hns/hns_roce_qp.c
+++ b/drivers/infiniband/hw/hns/hns_roce_qp.c
@@ -531,13 +531,15 @@ static unsigned int get_sge_num_from_max_inl_data(bool is_ud_or_gsi,
{
unsigned int inline_sge;
- inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
+ if (!max_inline_data)
+ return 0;
/*
* if max_inline_data less than
* HNS_ROCE_SGE_IN_WQE * HNS_ROCE_SGE_SIZE,
* In addition to ud's mode, no need to extend sge.
*/
+ inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
if (!is_ud_or_gsi && inline_sge <= HNS_ROCE_SGE_IN_WQE)
inline_sge = 0;
diff --git a/drivers/infiniband/hw/hns/hns_roce_srq.c b/drivers/infiniband/hw/hns/hns_roce_srq.c
index 6a4923c21cbc..727f92650071 100644
--- a/drivers/infiniband/hw/hns/hns_roce_srq.c
+++ b/drivers/infiniband/hw/hns/hns_roce_srq.c
@@ -296,7 +296,7 @@ static int set_srq_basic_param(struct hns_roce_srq *srq,
max_sge = proc_srq_sge(hr_dev, srq, !!udata);
if (attr->max_wr > hr_dev->caps.max_srq_wrs ||
- attr->max_sge > max_sge) {
+ attr->max_sge > max_sge || !attr->max_sge) {
ibdev_err(&hr_dev->ib_dev,
"invalid SRQ attr, depth = %u, sge = %u.\n",
attr->max_wr, attr->max_sge);
diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c
index 111fa88a3be4..9a439569ffcf 100644
--- a/drivers/infiniband/hw/mlx4/alias_GUID.c
+++ b/drivers/infiniband/hw/mlx4/alias_GUID.c
@@ -829,7 +829,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev)
int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev)
{
- char alias_wq_name[15];
+ char alias_wq_name[22];
int ret = 0;
int i, j;
union ib_gid gid;
diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c
index a37cfac5e23f..dc9cf45d2d32 100644
--- a/drivers/infiniband/hw/mlx4/mad.c
+++ b/drivers/infiniband/hw/mlx4/mad.c
@@ -2158,7 +2158,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev,
struct mlx4_ib_demux_ctx *ctx,
int port)
{
- char name[12];
+ char name[21];
int ret = 0;
int i;
diff --git a/drivers/infiniband/hw/mlx5/mlx5_ib.h b/drivers/infiniband/hw/mlx5/mlx5_ib.h
index 6a57af8fa231..43a963e205eb 100644
--- a/drivers/infiniband/hw/mlx5/mlx5_ib.h
+++ b/drivers/infiniband/hw/mlx5/mlx5_ib.h
@@ -115,6 +115,19 @@ unsigned long __mlx5_umem_find_best_quantized_pgoff(
__mlx5_bit_sz(typ, page_offset_fld), 0, scale, \
page_offset_quantized)
+static inline unsigned long
+mlx5_umem_dmabuf_find_best_pgsz(struct ib_umem_dmabuf *umem_dmabuf)
+{
+ /*
+ * mkeys used for dmabuf are fixed at PAGE_SIZE because we must be able
+ * to hold any sgl after a move operation. Ideally the mkc page size
+ * could be changed at runtime to be optimal, but right now the driver
+ * cannot do that.
+ */
+ return ib_umem_find_best_pgsz(&umem_dmabuf->umem, PAGE_SIZE,
+ umem_dmabuf->umem.iova);
+}
+
enum {
MLX5_IB_MMAP_OFFSET_START = 9,
MLX5_IB_MMAP_OFFSET_END = 255,
diff --git a/drivers/infiniband/hw/mlx5/odp.c b/drivers/infiniband/hw/mlx5/odp.c
index 4a04cbc5b78a..a524181f34df 100644
--- a/drivers/infiniband/hw/mlx5/odp.c
+++ b/drivers/infiniband/hw/mlx5/odp.c
@@ -705,10 +705,8 @@ static int pagefault_dmabuf_mr(struct mlx5_ib_mr *mr, size_t bcnt,
return err;
}
- page_size = mlx5_umem_find_best_pgsz(&umem_dmabuf->umem, mkc,
- log_page_size, 0,
- umem_dmabuf->umem.iova);
- if (unlikely(page_size < PAGE_SIZE)) {
+ page_size = mlx5_umem_dmabuf_find_best_pgsz(umem_dmabuf);
+ if (!page_size) {
ib_umem_dmabuf_unmap_pages(umem_dmabuf);
err = -EINVAL;
} else {
diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c
index d8c41fd626a9..7a36080d2bae 100644
--- a/drivers/infiniband/sw/rxe/rxe_req.c
+++ b/drivers/infiniband/sw/rxe/rxe_req.c
@@ -424,7 +424,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
int paylen;
int solicited;
u32 qp_num;
- int ack_req;
+ int ack_req = 0;
/* length from start of bth to end of icrc */
paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE;
@@ -445,8 +445,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn :
qp->attr.dest_qp_num;
- ack_req = ((pkt->mask & RXE_END_MASK) ||
- (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
+ if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC)
+ ack_req = ((pkt->mask & RXE_END_MASK) ||
+ (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
if (ack_req)
qp->req.noack_pkts = 0;
diff --git a/drivers/input/keyboard/qt1050.c b/drivers/input/keyboard/qt1050.c
index 6953097db445..cd2f4216daf8 100644
--- a/drivers/input/keyboard/qt1050.c
+++ b/drivers/input/keyboard/qt1050.c
@@ -226,7 +226,12 @@ static bool qt1050_identify(struct qt1050_priv *ts)
int err;
/* Read Chip ID */
- regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+ err = regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+ if (err) {
+ dev_err(&ts->client->dev, "Failed to read chip ID: %d\n", err);
+ return false;
+ }
+
if (val != QT1050_CHIP_ID_VER) {
dev_err(&ts->client->dev, "ID %d not supported\n", val);
return false;
diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c
index 148a601396f9..dc80e407fb86 100644
--- a/drivers/input/mouse/elan_i2c_core.c
+++ b/drivers/input/mouse/elan_i2c_core.c
@@ -1356,6 +1356,8 @@ static int elan_suspend(struct device *dev)
}
err:
+ if (ret)
+ enable_irq(client->irq);
mutex_unlock(&data->sysfs_mutex);
return ret;
}
diff --git a/drivers/interconnect/qcom/qcm2290.c b/drivers/interconnect/qcom/qcm2290.c
index 52346f7319ac..69960a357a68 100644
--- a/drivers/interconnect/qcom/qcm2290.c
+++ b/drivers/interconnect/qcom/qcm2290.c
@@ -163,7 +163,7 @@ static struct qcom_icc_node mas_snoc_bimc = {
.qos.ap_owned = true,
.qos.qos_port = 6,
.qos.qos_mode = NOC_QOS_MODE_BYPASS,
- .mas_rpm_id = 164,
+ .mas_rpm_id = 3,
.slv_rpm_id = -1,
.num_links = ARRAY_SIZE(mas_snoc_bimc_links),
.links = mas_snoc_bimc_links,
diff --git a/drivers/iommu/intel/iommu.c b/drivers/iommu/intel/iommu.c
index 744e4e6b8d72..9918af222c51 100644
--- a/drivers/iommu/intel/iommu.c
+++ b/drivers/iommu/intel/iommu.c
@@ -2411,7 +2411,7 @@ static int __init si_domain_init(int hw)
for_each_mem_pfn_range(i, nid, &start_pfn, &end_pfn, NULL) {
ret = iommu_domain_identity_map(si_domain,
mm_to_dma_pfn_start(start_pfn),
- mm_to_dma_pfn_end(end_pfn));
+ mm_to_dma_pfn_end(end_pfn-1));
if (ret)
return ret;
}
diff --git a/drivers/iommu/sprd-iommu.c b/drivers/iommu/sprd-iommu.c
index 2fa9afebd4f5..c8e79a2d8b4c 100644
--- a/drivers/iommu/sprd-iommu.c
+++ b/drivers/iommu/sprd-iommu.c
@@ -236,8 +236,8 @@ static void sprd_iommu_cleanup(struct sprd_iommu_domain *dom)
pgt_size = sprd_iommu_pgt_size(&dom->domain);
dma_free_coherent(dom->sdev->dev, pgt_size, dom->pgt_va, dom->pgt_pa);
- dom->sdev = NULL;
sprd_iommu_hw_en(dom->sdev, false);
+ dom->sdev = NULL;
}
static void sprd_iommu_domain_free(struct iommu_domain *domain)
diff --git a/drivers/irqchip/irq-imx-irqsteer.c b/drivers/irqchip/irq-imx-irqsteer.c
index bd9543314539..7df53b4532b4 100644
--- a/drivers/irqchip/irq-imx-irqsteer.c
+++ b/drivers/irqchip/irq-imx-irqsteer.c
@@ -36,6 +36,7 @@ struct irqsteer_data {
int channel;
struct irq_domain *domain;
u32 *saved_reg;
+ struct device *dev;
};
static int imx_irqsteer_get_reg_index(struct irqsteer_data *data,
@@ -72,10 +73,26 @@ static void imx_irqsteer_irq_mask(struct irq_data *d)
raw_spin_unlock_irqrestore(&data->lock, flags);
}
+static void imx_irqsteer_irq_bus_lock(struct irq_data *d)
+{
+ struct irqsteer_data *data = d->chip_data;
+
+ pm_runtime_get_sync(data->dev);
+}
+
+static void imx_irqsteer_irq_bus_sync_unlock(struct irq_data *d)
+{
+ struct irqsteer_data *data = d->chip_data;
+
+ pm_runtime_put_autosuspend(data->dev);
+}
+
static const struct irq_chip imx_irqsteer_irq_chip = {
- .name = "irqsteer",
- .irq_mask = imx_irqsteer_irq_mask,
- .irq_unmask = imx_irqsteer_irq_unmask,
+ .name = "irqsteer",
+ .irq_mask = imx_irqsteer_irq_mask,
+ .irq_unmask = imx_irqsteer_irq_unmask,
+ .irq_bus_lock = imx_irqsteer_irq_bus_lock,
+ .irq_bus_sync_unlock = imx_irqsteer_irq_bus_sync_unlock,
};
static int imx_irqsteer_irq_map(struct irq_domain *h, unsigned int irq,
@@ -150,6 +167,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev)
if (!data)
return -ENOMEM;
+ data->dev = &pdev->dev;
data->regs = devm_platform_ioremap_resource(pdev, 0);
if (IS_ERR(data->regs)) {
dev_err(&pdev->dev, "failed to initialize reg\n");
diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c
index 2e5cb9dde3ec..44383cec1f47 100644
--- a/drivers/isdn/hardware/mISDN/hfcmulti.c
+++ b/drivers/isdn/hardware/mISDN/hfcmulti.c
@@ -1900,7 +1900,7 @@ hfcmulti_dtmf(struct hfc_multi *hc)
static void
hfcmulti_tx(struct hfc_multi *hc, int ch)
{
- int i, ii, temp, len = 0;
+ int i, ii, temp, tmp_len, len = 0;
int Zspace, z1, z2; /* must be int for calculation */
int Fspace, f1, f2;
u_char *d;
@@ -2121,14 +2121,15 @@ hfcmulti_tx(struct hfc_multi *hc, int ch)
HFC_wait_nodebug(hc);
}
+ tmp_len = (*sp)->len;
dev_kfree_skb(*sp);
/* check for next frame */
if (bch && get_next_bframe(bch)) {
- len = (*sp)->len;
+ len = tmp_len;
goto next_frame;
}
if (dch && get_next_dframe(dch)) {
- len = (*sp)->len;
+ len = tmp_len;
goto next_frame;
}
diff --git a/drivers/leds/flash/leds-mt6360.c b/drivers/leds/flash/leds-mt6360.c
index 1af6c5898343..fdf0812774ce 100644
--- a/drivers/leds/flash/leds-mt6360.c
+++ b/drivers/leds/flash/leds-mt6360.c
@@ -633,14 +633,17 @@ static int mt6360_init_isnk_properties(struct mt6360_led *led,
ret = fwnode_property_read_u32(child, "reg", ®);
if (ret || reg > MT6360_LED_ISNK3 ||
- priv->leds_active & BIT(reg))
+ priv->leds_active & BIT(reg)) {
+ fwnode_handle_put(child);
return -EINVAL;
+ }
ret = fwnode_property_read_u32(child, "color", &color);
if (ret) {
dev_err(priv->dev,
"led %d, no color specified\n",
led->led_no);
+ fwnode_handle_put(child);
return ret;
}
diff --git a/drivers/leds/flash/leds-qcom-flash.c b/drivers/leds/flash/leds-qcom-flash.c
index a73d3ea5c97a..17391aefeb94 100644
--- a/drivers/leds/flash/leds-qcom-flash.c
+++ b/drivers/leds/flash/leds-qcom-flash.c
@@ -505,6 +505,7 @@ qcom_flash_v4l2_init(struct device *dev, struct qcom_flash_led *led, struct fwno
struct qcom_flash_data *flash_data = led->flash_data;
struct v4l2_flash_config v4l2_cfg = { 0 };
struct led_flash_setting *intensity = &v4l2_cfg.intensity;
+ struct v4l2_flash *v4l2_flash;
if (!(led->flash.led_cdev.flags & LED_DEV_CAP_FLASH))
return 0;
@@ -523,9 +524,12 @@ qcom_flash_v4l2_init(struct device *dev, struct qcom_flash_led *led, struct fwno
LED_FAULT_OVER_TEMPERATURE |
LED_FAULT_TIMEOUT;
- flash_data->v4l2_flash[flash_data->leds_count] =
- v4l2_flash_init(dev, fwnode, &led->flash, &qcom_v4l2_flash_ops, &v4l2_cfg);
- return PTR_ERR_OR_ZERO(flash_data->v4l2_flash);
+ v4l2_flash = v4l2_flash_init(dev, fwnode, &led->flash, &qcom_v4l2_flash_ops, &v4l2_cfg);
+ if (IS_ERR(v4l2_flash))
+ return PTR_ERR(v4l2_flash);
+
+ flash_data->v4l2_flash[flash_data->leds_count] = v4l2_flash;
+ return 0;
}
# else
static int
diff --git a/drivers/leds/led-class.c b/drivers/leds/led-class.c
index ba1be15cfd8e..c66d1bead0a4 100644
--- a/drivers/leds/led-class.c
+++ b/drivers/leds/led-class.c
@@ -258,7 +258,6 @@ struct led_classdev *of_led_get(struct device_node *np, int index)
led_dev = class_find_device_by_of_node(&leds_class, led_node);
of_node_put(led_node);
- put_device(led_dev);
return led_module_get(led_dev);
}
diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c
index 6a5e1f41f9a4..4f5829b726a7 100644
--- a/drivers/leds/led-triggers.c
+++ b/drivers/leds/led-triggers.c
@@ -179,9 +179,9 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig)
cancel_work_sync(&led_cdev->set_brightness_work);
led_stop_software_blink(led_cdev);
+ device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
if (led_cdev->trigger->deactivate)
led_cdev->trigger->deactivate(led_cdev);
- device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
led_cdev->trigger = NULL;
led_cdev->trigger_data = NULL;
led_cdev->activated = false;
diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c
index fcaa34706b6c..2ef9fc7371bd 100644
--- a/drivers/leds/leds-ss4200.c
+++ b/drivers/leds/leds-ss4200.c
@@ -356,8 +356,10 @@ static int ich7_lpc_probe(struct pci_dev *dev,
nas_gpio_pci_dev = dev;
status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base);
- if (status)
+ if (status) {
+ status = pcibios_err_to_errno(status);
goto out;
+ }
g_pm_io_base &= 0x00000ff80;
status = pci_read_config_dword(dev, GPIO_CTRL, &gc);
@@ -369,8 +371,9 @@ static int ich7_lpc_probe(struct pci_dev *dev,
}
status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base);
- if (0 > status) {
+ if (status) {
dev_info(&dev->dev, "Unable to read GPIOBASE.\n");
+ status = pcibios_err_to_errno(status);
goto out;
}
dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base);
diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c
index 3c1b29476ce2..5c001105cdd9 100644
--- a/drivers/macintosh/therm_windtunnel.c
+++ b/drivers/macintosh/therm_windtunnel.c
@@ -551,7 +551,7 @@ g4fan_exit( void )
platform_driver_unregister( &therm_of_driver );
if( x.of_dev )
- of_device_unregister( x.of_dev );
+ of_platform_device_destroy(&x.of_dev->dev, NULL);
}
module_init(g4fan_init);
diff --git a/drivers/md/dm-verity-target.c b/drivers/md/dm-verity-target.c
index 49e4a35d7019..3636387ce565 100644
--- a/drivers/md/dm-verity-target.c
+++ b/drivers/md/dm-verity-target.c
@@ -1511,14 +1511,6 @@ static int verity_ctr(struct dm_target *ti, unsigned int argc, char **argv)
return r;
}
-/*
- * Check whether a DM target is a verity target.
- */
-bool dm_is_verity_target(struct dm_target *ti)
-{
- return ti->type->module == THIS_MODULE;
-}
-
/*
* Get the verity mode (error behavior) of a verity target.
*
@@ -1572,6 +1564,14 @@ static struct target_type verity_target = {
};
module_dm(verity);
+/*
+ * Check whether a DM target is a verity target.
+ */
+bool dm_is_verity_target(struct dm_target *ti)
+{
+ return ti->type == &verity_target;
+}
+
MODULE_AUTHOR("Mikulas Patocka <mpatocka@redhat.com>");
MODULE_AUTHOR("Mandeep Baines <msb@chromium.org>");
MODULE_AUTHOR("Will Drewry <wad@chromium.org>");
diff --git a/drivers/md/md-bitmap.c b/drivers/md/md-bitmap.c
index d9235ee7dcc4..be65472d8f8b 100644
--- a/drivers/md/md-bitmap.c
+++ b/drivers/md/md-bitmap.c
@@ -227,6 +227,8 @@ static int __write_sb_page(struct md_rdev *rdev, struct bitmap *bitmap,
struct block_device *bdev;
struct mddev *mddev = bitmap->mddev;
struct bitmap_storage *store = &bitmap->storage;
+ unsigned int bitmap_limit = (bitmap->storage.file_pages - pg_index) <<
+ PAGE_SHIFT;
loff_t sboff, offset = mddev->bitmap_info.offset;
sector_t ps = pg_index * PAGE_SIZE / SECTOR_SIZE;
unsigned int size = PAGE_SIZE;
@@ -269,11 +271,9 @@ static int __write_sb_page(struct md_rdev *rdev, struct bitmap *bitmap,
if (size == 0)
/* bitmap runs in to data */
return -EINVAL;
- } else {
- /* DATA METADATA BITMAP - no problems */
}
- md_super_write(mddev, rdev, sboff + ps, (int) size, page);
+ md_super_write(mddev, rdev, sboff + ps, (int)min(size, bitmap_limit), page);
return 0;
}
diff --git a/drivers/md/md.c b/drivers/md/md.c
index e4d3741234d9..b5dea664f946 100644
--- a/drivers/md/md.c
+++ b/drivers/md/md.c
@@ -493,13 +493,9 @@ static void md_end_flush(struct bio *bio)
rdev_dec_pending(rdev, mddev);
- if (atomic_dec_and_test(&mddev->flush_pending)) {
- /* The pair is percpu_ref_get() from md_flush_request() */
- percpu_ref_put(&mddev->active_io);
-
+ if (atomic_dec_and_test(&mddev->flush_pending))
/* The pre-request flush has finished */
queue_work(md_wq, &mddev->flush_work);
- }
}
static void md_submit_flush_data(struct work_struct *ws);
@@ -530,12 +526,8 @@ static void submit_flushes(struct work_struct *ws)
rcu_read_lock();
}
rcu_read_unlock();
- if (atomic_dec_and_test(&mddev->flush_pending)) {
- /* The pair is percpu_ref_get() from md_flush_request() */
- percpu_ref_put(&mddev->active_io);
-
+ if (atomic_dec_and_test(&mddev->flush_pending))
queue_work(md_wq, &mddev->flush_work);
- }
}
static void md_submit_flush_data(struct work_struct *ws)
@@ -560,8 +552,20 @@ static void md_submit_flush_data(struct work_struct *ws)
bio_endio(bio);
} else {
bio->bi_opf &= ~REQ_PREFLUSH;
- md_handle_request(mddev, bio);
+
+ /*
+ * make_requst() will never return error here, it only
+ * returns error in raid5_make_request() by dm-raid.
+ * Since dm always splits data and flush operation into
+ * two separate io, io size of flush submitted by dm
+ * always is 0, make_request() will not be called here.
+ */
+ if (WARN_ON_ONCE(!mddev->pers->make_request(mddev, bio)))
+ bio_io_error(bio);;
}
+
+ /* The pair is percpu_ref_get() from md_flush_request() */
+ percpu_ref_put(&mddev->active_io);
}
/*
@@ -7680,12 +7684,6 @@ static int md_ioctl(struct block_device *bdev, blk_mode_t mode,
}
- if (cmd == HOT_REMOVE_DISK)
- /* need to ensure recovery thread has run */
- wait_event_interruptible_timeout(mddev->sb_wait,
- !test_bit(MD_RECOVERY_NEEDED,
- &mddev->recovery),
- msecs_to_jiffies(5000));
if (cmd == STOP_ARRAY || cmd == STOP_ARRAY_RO) {
/* Need to flush page cache, and ensure no-one else opens
* and writes
diff --git a/drivers/media/i2c/imx219.c b/drivers/media/i2c/imx219.c
index 3afa3f79c8a2..a9a8cd148f4f 100644
--- a/drivers/media/i2c/imx219.c
+++ b/drivers/media/i2c/imx219.c
@@ -188,8 +188,8 @@ static const struct cci_reg_sequence imx219_common_regs[] = {
{ IMX219_REG_MODE_SELECT, 0x00 }, /* Mode Select */
/* To Access Addresses 3000-5fff, send the following commands */
- { CCI_REG8(0x30eb), 0x0c },
{ CCI_REG8(0x30eb), 0x05 },
+ { CCI_REG8(0x30eb), 0x0c },
{ CCI_REG8(0x300a), 0xff },
{ CCI_REG8(0x300b), 0xff },
{ CCI_REG8(0x30eb), 0x05 },
diff --git a/drivers/media/i2c/imx412.c b/drivers/media/i2c/imx412.c
index c7e862ae4040..8597f98a8dcf 100644
--- a/drivers/media/i2c/imx412.c
+++ b/drivers/media/i2c/imx412.c
@@ -544,14 +544,13 @@ static int imx412_update_controls(struct imx412 *imx412,
*/
static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
{
- u32 lpfr, shutter;
+ u32 lpfr;
int ret;
lpfr = imx412->vblank + imx412->cur_mode->height;
- shutter = lpfr - exposure;
- dev_dbg(imx412->dev, "Set exp %u, analog gain %u, shutter %u, lpfr %u",
- exposure, gain, shutter, lpfr);
+ dev_dbg(imx412->dev, "Set exp %u, analog gain %u, lpfr %u",
+ exposure, gain, lpfr);
ret = imx412_write_reg(imx412, IMX412_REG_HOLD, 1, 1);
if (ret)
@@ -561,7 +560,7 @@ static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
if (ret)
goto error_release_group_hold;
- ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, shutter);
+ ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, exposure);
if (ret)
goto error_release_group_hold;
diff --git a/drivers/media/pci/intel/ivsc/mei_csi.c b/drivers/media/pci/intel/ivsc/mei_csi.c
index 5132a7527feb..685b2ec96071 100644
--- a/drivers/media/pci/intel/ivsc/mei_csi.c
+++ b/drivers/media/pci/intel/ivsc/mei_csi.c
@@ -124,6 +124,8 @@ struct mei_csi {
struct v4l2_ctrl_handler ctrl_handler;
struct v4l2_ctrl *freq_ctrl;
struct v4l2_ctrl *privacy_ctrl;
+ /* lock for v4l2 controls */
+ struct mutex ctrl_lock;
unsigned int remote_pad;
/* start streaming or not */
int streaming;
@@ -189,7 +191,11 @@ static int mei_csi_send(struct mei_csi *csi, u8 *buf, size_t len)
/* command response status */
ret = csi->cmd_response.status;
- if (ret) {
+ if (ret == -1) {
+ /* notify privacy on instead of reporting error */
+ ret = 0;
+ v4l2_ctrl_s_ctrl(csi->privacy_ctrl, 1);
+ } else if (ret) {
ret = -EINVAL;
goto out;
}
@@ -609,11 +615,13 @@ static int mei_csi_init_controls(struct mei_csi *csi)
u32 max;
int ret;
+ mutex_init(&csi->ctrl_lock);
+
ret = v4l2_ctrl_handler_init(&csi->ctrl_handler, 2);
if (ret)
return ret;
- csi->ctrl_handler.lock = &csi->lock;
+ csi->ctrl_handler.lock = &csi->ctrl_lock;
max = ARRAY_SIZE(link_freq_menu_items) - 1;
csi->freq_ctrl = v4l2_ctrl_new_int_menu(&csi->ctrl_handler,
@@ -772,6 +780,7 @@ static int mei_csi_probe(struct mei_cl_device *cldev,
err_ctrl_handler:
v4l2_ctrl_handler_free(&csi->ctrl_handler);
+ mutex_destroy(&csi->ctrl_lock);
v4l2_async_nf_unregister(&csi->notifier);
v4l2_async_nf_cleanup(&csi->notifier);
@@ -791,6 +800,7 @@ static void mei_csi_remove(struct mei_cl_device *cldev)
v4l2_async_nf_unregister(&csi->notifier);
v4l2_async_nf_cleanup(&csi->notifier);
v4l2_ctrl_handler_free(&csi->ctrl_handler);
+ mutex_destroy(&csi->ctrl_lock);
v4l2_async_unregister_subdev(&csi->subdev);
v4l2_subdev_cleanup(&csi->subdev);
media_entity_cleanup(&csi->subdev.entity);
diff --git a/drivers/media/pci/ivtv/ivtv-udma.c b/drivers/media/pci/ivtv/ivtv-udma.c
index 99b9f55ca829..f467a00492f4 100644
--- a/drivers/media/pci/ivtv/ivtv-udma.c
+++ b/drivers/media/pci/ivtv/ivtv-udma.c
@@ -131,6 +131,8 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
/* Fill SG List with new values */
if (ivtv_udma_fill_sg_list(dma, &user_dma, 0) < 0) {
+ IVTV_DEBUG_WARN("%s: could not allocate bounce buffers for highmem userspace buffers\n",
+ __func__);
unpin_user_pages(dma->map, dma->page_count);
dma->page_count = 0;
return -ENOMEM;
@@ -139,6 +141,12 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
/* Map SG List */
dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
dma->page_count, DMA_TO_DEVICE);
+ if (!dma->SG_length) {
+ IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+ unpin_user_pages(dma->map, dma->page_count);
+ dma->page_count = 0;
+ return -EINVAL;
+ }
/* Fill SG Array with new values */
ivtv_udma_fill_sg_array (dma, ivtv_dest_addr, 0, -1);
diff --git a/drivers/media/pci/ivtv/ivtv-yuv.c b/drivers/media/pci/ivtv/ivtv-yuv.c
index 582146f8d70d..2d9274537725 100644
--- a/drivers/media/pci/ivtv/ivtv-yuv.c
+++ b/drivers/media/pci/ivtv/ivtv-yuv.c
@@ -114,6 +114,12 @@ static int ivtv_yuv_prep_user_dma(struct ivtv *itv, struct ivtv_user_dma *dma,
}
dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
dma->page_count, DMA_TO_DEVICE);
+ if (!dma->SG_length) {
+ IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+ unpin_user_pages(dma->map, dma->page_count);
+ dma->page_count = 0;
+ return -EINVAL;
+ }
/* Fill SG Array with new values */
ivtv_udma_fill_sg_array(dma, y_buffer_offset, uv_buffer_offset, y_size);
diff --git a/drivers/media/pci/ivtv/ivtvfb.c b/drivers/media/pci/ivtv/ivtvfb.c
index 23c8c094e791..9cdd14a3033c 100644
--- a/drivers/media/pci/ivtv/ivtvfb.c
+++ b/drivers/media/pci/ivtv/ivtvfb.c
@@ -281,10 +281,10 @@ static int ivtvfb_prep_dec_dma_to_device(struct ivtv *itv,
/* Map User DMA */
if (ivtv_udma_setup(itv, ivtv_dest_addr, userbuf, size_in_bytes) <= 0) {
mutex_unlock(&itv->udma.lock);
- IVTVFB_WARN("ivtvfb_prep_dec_dma_to_device, Error with pin_user_pages: %d bytes, %d pages returned\n",
- size_in_bytes, itv->udma.page_count);
+ IVTVFB_WARN("%s, Error in ivtv_udma_setup: %d bytes, %d pages returned\n",
+ __func__, size_in_bytes, itv->udma.page_count);
- /* pin_user_pages must have failed completely */
+ /* pin_user_pages or DMA must have failed completely */
return -EIO;
}
diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c
index 9c6cfef03331..a66df6adfaad 100644
--- a/drivers/media/pci/saa7134/saa7134-dvb.c
+++ b/drivers/media/pci/saa7134/saa7134-dvb.c
@@ -466,7 +466,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe)
/* switch the board to analog mode */
if (fe->ops.i2c_gate_ctrl)
fe->ops.i2c_gate_ctrl(fe, 1);
- i2c_transfer(&dev->i2c_adap, &analog_msg, 1);
+ if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1)
+ return -EIO;
+
return 0;
}
@@ -1018,7 +1020,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe,
else
wbuf[1] = rbuf & 0xef;
msg[0].len = 2;
- i2c_transfer(&dev->i2c_adap, msg, 1);
+ if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1)
+ return -EIO;
+
return 0;
}
diff --git a/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c b/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c
index da6be556727b..145958206e38 100644
--- a/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c
+++ b/drivers/media/platform/mediatek/vcodec/decoder/vdec_vpu_if.c
@@ -233,6 +233,12 @@ int vpu_dec_init(struct vdec_vpu_inst *vpu)
mtk_vdec_debug(vpu->ctx, "vdec_inst=%p", vpu);
err = vcodec_vpu_send_msg(vpu, (void *)&msg, sizeof(msg));
+
+ if (IS_ERR_OR_NULL(vpu->vsi)) {
+ mtk_vdec_err(vpu->ctx, "invalid vdec vsi, status=%d", err);
+ return -EINVAL;
+ }
+
mtk_vdec_debug(vpu->ctx, "- ret=%d", err);
return err;
}
diff --git a/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c b/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c
index 0c8b204535ff..2007152cd7a4 100644
--- a/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c
+++ b/drivers/media/platform/nxp/imx-jpeg/mxc-jpeg.c
@@ -1632,6 +1632,9 @@ static int mxc_jpeg_start_streaming(struct vb2_queue *q, unsigned int count)
dev_dbg(ctx->mxc_jpeg->dev, "Start streaming ctx=%p", ctx);
q_data->sequence = 0;
+ if (V4L2_TYPE_IS_CAPTURE(q->type))
+ ctx->need_initial_source_change_evt = false;
+
ret = pm_runtime_resume_and_get(ctx->mxc_jpeg->dev);
if (ret < 0) {
dev_err(ctx->mxc_jpeg->dev, "Failed to power up jpeg\n");
diff --git a/drivers/media/platform/nxp/imx-pxp.c b/drivers/media/platform/nxp/imx-pxp.c
index e62dc5c1a4ae..e4427e6487fb 100644
--- a/drivers/media/platform/nxp/imx-pxp.c
+++ b/drivers/media/platform/nxp/imx-pxp.c
@@ -1805,6 +1805,9 @@ static int pxp_probe(struct platform_device *pdev)
return PTR_ERR(mmio);
dev->regmap = devm_regmap_init_mmio(&pdev->dev, mmio,
&pxp_regmap_config);
+ if (IS_ERR(dev->regmap))
+ return dev_err_probe(&pdev->dev, PTR_ERR(dev->regmap),
+ "Failed to init regmap\n");
irq = platform_get_irq(pdev, 0);
if (irq < 0)
diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c
index dbf305cec120..884ee6e9d4bd 100644
--- a/drivers/media/platform/qcom/venus/vdec.c
+++ b/drivers/media/platform/qcom/venus/vdec.c
@@ -1255,7 +1255,7 @@ static int vdec_stop_output(struct venus_inst *inst)
break;
case VENUS_DEC_STATE_INIT:
case VENUS_DEC_STATE_CAPTURE_SETUP:
- ret = hfi_session_flush(inst, HFI_FLUSH_INPUT, true);
+ ret = hfi_session_flush(inst, HFI_FLUSH_ALL, true);
break;
default:
break;
@@ -1747,6 +1747,7 @@ static int vdec_close(struct file *file)
vdec_pm_get(inst);
+ cancel_work_sync(&inst->delayed_process_work);
v4l2_m2m_ctx_release(inst->m2m_ctx);
v4l2_m2m_release(inst->m2m_dev);
vdec_ctrl_deinit(inst);
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
index f6326df0b09b..109cca91f733 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
@@ -1914,12 +1914,14 @@ static int rcsi2_probe(struct platform_device *pdev)
ret = v4l2_async_register_subdev(&priv->subdev);
if (ret < 0)
- goto error_async;
+ goto error_pm_runtime;
dev_info(priv->dev, "%d lanes found\n", priv->lanes);
return 0;
+error_pm_runtime:
+ pm_runtime_disable(&pdev->dev);
error_async:
v4l2_async_nf_unregister(&priv->notifier);
v4l2_async_nf_cleanup(&priv->notifier);
@@ -1936,6 +1938,7 @@ static void rcsi2_remove(struct platform_device *pdev)
v4l2_async_nf_unregister(&priv->notifier);
v4l2_async_nf_cleanup(&priv->notifier);
v4l2_async_unregister_subdev(&priv->subdev);
+ v4l2_subdev_cleanup(&priv->subdev);
pm_runtime_disable(&pdev->dev);
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
index 2a77353f10b5..bb4774e2f335 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
@@ -742,12 +742,22 @@ static int rvin_setup(struct rvin_dev *vin)
*/
switch (vin->mbus_code) {
case MEDIA_BUS_FMT_YUYV8_1X16:
- /* BT.601/BT.1358 16bit YCbCr422 */
- vnmc |= VNMC_INF_YUV16;
+ if (vin->is_csi)
+ /* YCbCr422 8-bit */
+ vnmc |= VNMC_INF_YUV8_BT601;
+ else
+ /* BT.601/BT.1358 16bit YCbCr422 */
+ vnmc |= VNMC_INF_YUV16;
input_is_yuv = true;
break;
case MEDIA_BUS_FMT_UYVY8_1X16:
- vnmc |= VNMC_INF_YUV16 | VNMC_YCAL;
+ if (vin->is_csi)
+ /* YCbCr422 8-bit */
+ vnmc |= VNMC_INF_YUV8_BT601;
+ else
+ /* BT.601/BT.1358 16bit YCbCr422 */
+ vnmc |= VNMC_INF_YUV16;
+ vnmc |= VNMC_YCAL;
input_is_yuv = true;
break;
case MEDIA_BUS_FMT_UYVY8_2X8:
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_histo.c b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
index f22449dd654c..c0f1002f4ecf 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_histo.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
@@ -36,9 +36,8 @@ struct vsp1_histogram_buffer *
vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
{
struct vsp1_histogram_buffer *buf = NULL;
- unsigned long flags;
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock(&histo->irqlock);
if (list_empty(&histo->irqqueue))
goto done;
@@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
histo->readout = true;
done:
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock(&histo->irqlock);
return buf;
}
@@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
size_t size)
{
struct vsp1_pipeline *pipe = histo->entity.pipe;
- unsigned long flags;
/*
* The pipeline pointer is guaranteed to be valid as this function is
@@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size);
vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE);
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock(&histo->irqlock);
histo->readout = false;
wake_up(&histo->wait_queue);
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock(&histo->irqlock);
}
/* -----------------------------------------------------------------------------
@@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb)
struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb);
struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue);
struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf);
- unsigned long flags;
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock_irq(&histo->irqlock);
list_add_tail(&buf->queue, &histo->irqqueue);
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock_irq(&histo->irqlock);
}
static int histo_start_streaming(struct vb2_queue *vq, unsigned int count)
@@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq)
{
struct vsp1_histogram *histo = vb2_get_drv_priv(vq);
struct vsp1_histogram_buffer *buffer;
- unsigned long flags;
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock_irq(&histo->irqlock);
/* Remove all buffers from the IRQ queue. */
list_for_each_entry(buffer, &histo->irqqueue, queue)
@@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq)
/* Wait for the buffer being read out (if any) to complete. */
wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock);
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock_irq(&histo->irqlock);
}
static const struct vb2_ops histo_video_queue_qops = {
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
index 674b5748d929..85ecd53cda49 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
+++ b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
@@ -73,7 +73,7 @@ struct vsp1_partition_window {
* @wpf: The WPF partition window configuration
*/
struct vsp1_partition {
- struct vsp1_partition_window rpf;
+ struct vsp1_partition_window rpf[VSP1_MAX_RPF];
struct vsp1_partition_window uds_sink;
struct vsp1_partition_window uds_source;
struct vsp1_partition_window sru;
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
index ea12c3f12c92..78b6cefc5a01 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
@@ -315,8 +315,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity,
* 'width' need to be adjusted.
*/
if (pipe->partitions > 1) {
- crop.width = pipe->partition->rpf.width;
- crop.left += pipe->partition->rpf.left;
+ crop.width = pipe->partition->rpf[rpf->entity.index].width;
+ crop.left += pipe->partition->rpf[rpf->entity.index].left;
}
if (pipe->interlaced) {
@@ -371,7 +371,9 @@ static void rpf_partition(struct vsp1_entity *entity,
unsigned int partition_idx,
struct vsp1_partition_window *window)
{
- partition->rpf = *window;
+ struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev);
+
+ partition->rpf[rpf->entity.index] = *window;
}
static const struct vsp1_entity_operations rpf_entity_ops = {
diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c
index 5719dda6e0f0..e5590a708f1c 100644
--- a/drivers/media/rc/imon.c
+++ b/drivers/media/rc/imon.c
@@ -1148,10 +1148,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto)
memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet));
- if (!mutex_is_locked(&ictx->lock)) {
- unlock = true;
- mutex_lock(&ictx->lock);
- }
+ unlock = mutex_trylock(&ictx->lock);
retval = send_packet(ictx);
if (retval)
diff --git a/drivers/media/rc/lirc_dev.c b/drivers/media/rc/lirc_dev.c
index caad59f76793..f8901d6fbe9b 100644
--- a/drivers/media/rc/lirc_dev.c
+++ b/drivers/media/rc/lirc_dev.c
@@ -828,8 +828,10 @@ struct rc_dev *rc_dev_get_from_fd(int fd, bool write)
return ERR_PTR(-EINVAL);
}
- if (write && !(f.file->f_mode & FMODE_WRITE))
+ if (write && !(f.file->f_mode & FMODE_WRITE)) {
+ fdput(f);
return ERR_PTR(-EPERM);
+ }
fh = f.file->private_data;
dev = fh->rc;
diff --git a/drivers/media/usb/dvb-usb/dvb-usb-init.c b/drivers/media/usb/dvb-usb/dvb-usb-init.c
index fbf58012becd..22d83ac18eb7 100644
--- a/drivers/media/usb/dvb-usb/dvb-usb-init.c
+++ b/drivers/media/usb/dvb-usb/dvb-usb-init.c
@@ -23,11 +23,40 @@ static int dvb_usb_force_pid_filter_usage;
module_param_named(force_pid_filter_usage, dvb_usb_force_pid_filter_usage, int, 0444);
MODULE_PARM_DESC(force_pid_filter_usage, "force all dvb-usb-devices to use a PID filter, if any (default: 0).");
+static int dvb_usb_check_bulk_endpoint(struct dvb_usb_device *d, u8 endpoint)
+{
+ if (endpoint) {
+ int ret;
+
+ ret = usb_pipe_type_check(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+ if (ret)
+ return ret;
+ ret = usb_pipe_type_check(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+ if (ret)
+ return ret;
+ }
+ return 0;
+}
+
+static void dvb_usb_clear_halt(struct dvb_usb_device *d, u8 endpoint)
+{
+ if (endpoint) {
+ usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+ usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+ }
+}
+
static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
{
struct dvb_usb_adapter *adap;
int ret, n, o;
+ ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint);
+ if (ret)
+ return ret;
+ ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint_response);
+ if (ret)
+ return ret;
for (n = 0; n < d->props.num_adapters; n++) {
adap = &d->adapter[n];
adap->dev = d;
@@ -103,10 +132,8 @@ static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
* when reloading the driver w/o replugging the device
* sometimes a timeout occurs, this helps
*/
- if (d->props.generic_bulk_ctrl_endpoint != 0) {
- usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
- usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
- }
+ dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint);
+ dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint_response);
return 0;
diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c
index e59a463c2761..07158e9451fe 100644
--- a/drivers/media/usb/uvc/uvc_ctrl.c
+++ b/drivers/media/usb/uvc/uvc_ctrl.c
@@ -2029,7 +2029,13 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
else
ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id,
dev->intfnum, info->selector, data, 1);
- if (!ret)
+
+ if (!ret) {
+ info->flags &= ~(UVC_CTRL_FLAG_GET_CUR |
+ UVC_CTRL_FLAG_SET_CUR |
+ UVC_CTRL_FLAG_AUTO_UPDATE |
+ UVC_CTRL_FLAG_ASYNCHRONOUS);
+
info->flags |= (data[0] & UVC_CONTROL_CAP_GET ?
UVC_CTRL_FLAG_GET_CUR : 0)
| (data[0] & UVC_CONTROL_CAP_SET ?
@@ -2038,6 +2044,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
UVC_CTRL_FLAG_AUTO_UPDATE : 0)
| (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ?
UVC_CTRL_FLAG_ASYNCHRONOUS : 0);
+ }
kfree(data);
return ret;
diff --git a/drivers/media/usb/uvc/uvc_driver.c b/drivers/media/usb/uvc/uvc_driver.c
index 91a41aa3ced2..68bf41147a61 100644
--- a/drivers/media/usb/uvc/uvc_driver.c
+++ b/drivers/media/usb/uvc/uvc_driver.c
@@ -2236,8 +2236,11 @@ static int uvc_probe(struct usb_interface *intf,
if (dev->quirks & UVC_QUIRK_NO_RESET_RESUME)
udev->quirks &= ~USB_QUIRK_RESET_RESUME;
+ if (!(dev->quirks & UVC_QUIRK_DISABLE_AUTOSUSPEND))
+ usb_enable_autosuspend(udev);
+
uvc_dbg(dev, PROBE, "UVC device initialized\n");
- usb_enable_autosuspend(udev);
+
return 0;
error:
@@ -2577,7 +2580,17 @@ static const struct usb_device_id uvc_ids[] = {
.bInterfaceClass = USB_CLASS_VIDEO,
.bInterfaceSubClass = 1,
.bInterfaceProtocol = 0,
- .driver_info = UVC_INFO_QUIRK(UVC_QUIRK_RESTORE_CTRLS_ON_INIT) },
+ .driver_info = UVC_INFO_QUIRK(UVC_QUIRK_RESTORE_CTRLS_ON_INIT
+ | UVC_QUIRK_INVALID_DEVICE_SOF) },
+ /* Logitech HD Pro Webcam C922 */
+ { .match_flags = USB_DEVICE_ID_MATCH_DEVICE
+ | USB_DEVICE_ID_MATCH_INT_INFO,
+ .idVendor = 0x046d,
+ .idProduct = 0x085c,
+ .bInterfaceClass = USB_CLASS_VIDEO,
+ .bInterfaceSubClass = 1,
+ .bInterfaceProtocol = 0,
+ .driver_info = UVC_INFO_QUIRK(UVC_QUIRK_INVALID_DEVICE_SOF) },
/* Logitech Rally Bar Huddle */
{ .match_flags = USB_DEVICE_ID_MATCH_DEVICE
| USB_DEVICE_ID_MATCH_INT_INFO,
@@ -3043,6 +3056,15 @@ static const struct usb_device_id uvc_ids[] = {
.bInterfaceSubClass = 1,
.bInterfaceProtocol = UVC_PC_PROTOCOL_15,
.driver_info = (kernel_ulong_t)&uvc_ctrl_power_line_uvc11 },
+ /* Insta360 Link */
+ { .match_flags = USB_DEVICE_ID_MATCH_DEVICE
+ | USB_DEVICE_ID_MATCH_INT_INFO,
+ .idVendor = 0x2e1a,
+ .idProduct = 0x4c01,
+ .bInterfaceClass = USB_CLASS_VIDEO,
+ .bInterfaceSubClass = 1,
+ .bInterfaceProtocol = 0,
+ .driver_info = UVC_INFO_QUIRK(UVC_QUIRK_DISABLE_AUTOSUSPEND) },
/* Lenovo Integrated Camera */
{ .match_flags = USB_DEVICE_ID_MATCH_DEVICE
| USB_DEVICE_ID_MATCH_INT_INFO,
diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c
index 28dde08ec6c5..5eef560bc8cd 100644
--- a/drivers/media/usb/uvc/uvc_video.c
+++ b/drivers/media/usb/uvc/uvc_video.c
@@ -529,6 +529,17 @@ uvc_video_clock_decode(struct uvc_streaming *stream, struct uvc_buffer *buf,
stream->clock.last_sof = dev_sof;
host_sof = usb_get_current_frame_number(stream->dev->udev);
+
+ /*
+ * On some devices, like the Logitech C922, the device SOF does not run
+ * at a stable rate of 1kHz. For those devices use the host SOF instead.
+ * In the tests performed so far, this improves the timestamp precision.
+ * This is probably explained by a small packet handling jitter from the
+ * host, but the exact reason hasn't been fully determined.
+ */
+ if (stream->dev->quirks & UVC_QUIRK_INVALID_DEVICE_SOF)
+ dev_sof = host_sof;
+
time = uvc_video_get_time();
/*
@@ -709,11 +720,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
unsigned long flags;
u64 timestamp;
u32 delta_stc;
- u32 y1, y2;
+ u32 y1;
u32 x1, x2;
u32 mean;
u32 sof;
- u64 y;
+ u64 y, y2;
if (!uvc_hw_timestamps_param)
return;
@@ -753,7 +764,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
sof = y;
uvc_dbg(stream->dev, CLOCK,
- "%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n",
+ "%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n",
stream->dev->name, buf->pts,
y >> 16, div_u64((y & 0xffff) * 1000000, 65536),
sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
@@ -768,7 +779,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
goto done;
y1 = NSEC_PER_SEC;
- y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
+ y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
/*
* Interpolated and host SOF timestamps can wrap around at slightly
@@ -789,7 +800,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
timestamp = ktime_to_ns(first->host_time) + y - y1;
uvc_dbg(stream->dev, CLOCK,
- "%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n",
+ "%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n",
stream->dev->name,
sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
y, timestamp, vbuf->vb2_buf.timestamp,
diff --git a/drivers/media/usb/uvc/uvcvideo.h b/drivers/media/usb/uvc/uvcvideo.h
index 88218693f6f0..e5b12717016f 100644
--- a/drivers/media/usb/uvc/uvcvideo.h
+++ b/drivers/media/usb/uvc/uvcvideo.h
@@ -74,6 +74,8 @@
#define UVC_QUIRK_FORCE_BPP 0x00001000
#define UVC_QUIRK_WAKE_AUTOSUSPEND 0x00002000
#define UVC_QUIRK_NO_RESET_RESUME 0x00004000
+#define UVC_QUIRK_DISABLE_AUTOSUSPEND 0x00008000
+#define UVC_QUIRK_INVALID_DEVICE_SOF 0x00010000
/* Format flags */
#define UVC_FMT_FLAG_COMPRESSED 0x00000001
diff --git a/drivers/media/v4l2-core/v4l2-async.c b/drivers/media/v4l2-core/v4l2-async.c
index eaa15b8df76d..ac4d987bba25 100644
--- a/drivers/media/v4l2-core/v4l2-async.c
+++ b/drivers/media/v4l2-core/v4l2-async.c
@@ -324,6 +324,9 @@ static int v4l2_async_create_ancillary_links(struct v4l2_async_notifier *n,
sd->entity.function != MEDIA_ENT_F_FLASH)
return 0;
+ if (!n->sd)
+ return 0;
+
link = media_create_ancillary_link(&n->sd->entity, &sd->entity);
#endif
diff --git a/drivers/memory/Kconfig b/drivers/memory/Kconfig
index 8efdd1f97139..c82d8d8a16ea 100644
--- a/drivers/memory/Kconfig
+++ b/drivers/memory/Kconfig
@@ -167,7 +167,7 @@ config FSL_CORENET_CF
represents a coherency violation.
config FSL_IFC
- bool "Freescale IFC driver" if COMPILE_TEST
+ bool "Freescale IFC driver"
depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
depends on HAS_IOMEM
diff --git a/drivers/mfd/Makefile b/drivers/mfd/Makefile
index c66f07edcd0e..db1ba39de3b5 100644
--- a/drivers/mfd/Makefile
+++ b/drivers/mfd/Makefile
@@ -280,7 +280,5 @@ obj-$(CONFIG_MFD_INTEL_M10_BMC_PMCI) += intel-m10-bmc-pmci.o
obj-$(CONFIG_MFD_ATC260X) += atc260x-core.o
obj-$(CONFIG_MFD_ATC260X_I2C) += atc260x-i2c.o
-rsmu-i2c-objs := rsmu_core.o rsmu_i2c.o
-rsmu-spi-objs := rsmu_core.o rsmu_spi.o
-obj-$(CONFIG_MFD_RSMU_I2C) += rsmu-i2c.o
-obj-$(CONFIG_MFD_RSMU_SPI) += rsmu-spi.o
+obj-$(CONFIG_MFD_RSMU_I2C) += rsmu_i2c.o rsmu_core.o
+obj-$(CONFIG_MFD_RSMU_SPI) += rsmu_spi.o rsmu_core.o
diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c
index 906353735c78..5ba2b2352749 100644
--- a/drivers/mfd/omap-usb-tll.c
+++ b/drivers/mfd/omap-usb-tll.c
@@ -230,8 +230,7 @@ static int usbtll_omap_probe(struct platform_device *pdev)
break;
}
- tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]),
- GFP_KERNEL);
+ tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL);
if (!tll) {
pm_runtime_put_sync(dev);
pm_runtime_disable(dev);
diff --git a/drivers/mfd/rsmu_core.c b/drivers/mfd/rsmu_core.c
index 29437fd0bd5b..fd04a6e5dfa3 100644
--- a/drivers/mfd/rsmu_core.c
+++ b/drivers/mfd/rsmu_core.c
@@ -78,11 +78,13 @@ int rsmu_core_init(struct rsmu_ddata *rsmu)
return ret;
}
+EXPORT_SYMBOL_GPL(rsmu_core_init);
void rsmu_core_exit(struct rsmu_ddata *rsmu)
{
mutex_destroy(&rsmu->lock);
}
+EXPORT_SYMBOL_GPL(rsmu_core_exit);
MODULE_DESCRIPTION("Renesas SMU core driver");
MODULE_LICENSE("GPL");
diff --git a/drivers/mtd/nand/raw/Kconfig b/drivers/mtd/nand/raw/Kconfig
index cbf8ae85e1ae..614257308516 100644
--- a/drivers/mtd/nand/raw/Kconfig
+++ b/drivers/mtd/nand/raw/Kconfig
@@ -234,8 +234,7 @@ config MTD_NAND_FSL_IFC
tristate "Freescale IFC NAND controller"
depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
depends on HAS_IOMEM
- select FSL_IFC
- select MEMORY
+ depends on FSL_IFC
help
Various Freescale chips e.g P1010, include a NAND Flash machine
with built-in hardware ECC capabilities.
diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile
index 5de0378f90db..7dae831ee8b6 100644
--- a/drivers/mtd/tests/Makefile
+++ b/drivers/mtd/tests/Makefile
@@ -1,19 +1,19 @@
# SPDX-License-Identifier: GPL-2.0
-obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o
+obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o
-mtd_oobtest-objs := oobtest.o mtd_test.o
-mtd_pagetest-objs := pagetest.o mtd_test.o
-mtd_readtest-objs := readtest.o mtd_test.o
-mtd_speedtest-objs := speedtest.o mtd_test.o
-mtd_stresstest-objs := stresstest.o mtd_test.o
-mtd_subpagetest-objs := subpagetest.o mtd_test.o
-mtd_torturetest-objs := torturetest.o mtd_test.o
-mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o
+mtd_oobtest-objs := oobtest.o
+mtd_pagetest-objs := pagetest.o
+mtd_readtest-objs := readtest.o
+mtd_speedtest-objs := speedtest.o
+mtd_stresstest-objs := stresstest.o
+mtd_subpagetest-objs := subpagetest.o
+mtd_torturetest-objs := torturetest.o
+mtd_nandbiterrs-objs := nandbiterrs.o
diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c
index c84250beffdc..f391e0300cdc 100644
--- a/drivers/mtd/tests/mtd_test.c
+++ b/drivers/mtd/tests/mtd_test.c
@@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum)
return 0;
}
+EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock);
static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum)
{
@@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
return 0;
}
+EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks);
int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
unsigned int eb, int ebcnt)
@@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
return 0;
}
+EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks);
int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
{
@@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
return err;
}
+EXPORT_SYMBOL_GPL(mtdtest_read);
int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
const void *buf)
@@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
return err;
}
+EXPORT_SYMBOL_GPL(mtdtest_write);
+
+MODULE_LICENSE("GPL");
+MODULE_DESCRIPTION("MTD function test helpers");
+MODULE_AUTHOR("Akinobu Mita");
diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c
index 655ff41863e2..3b71924f4920 100644
--- a/drivers/mtd/ubi/eba.c
+++ b/drivers/mtd/ubi/eba.c
@@ -1560,6 +1560,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
GFP_KERNEL);
if (!fm_eba[i]) {
ret = -ENOMEM;
+ kfree(scan_eba[i]);
goto out_free;
}
@@ -1595,7 +1596,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
}
out_free:
- for (i = 0; i < num_volumes; i++) {
+ while (--i >= 0) {
if (!ubi->volumes[i])
continue;
diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c
index 34880b2db805..722ac5c4992c 100644
--- a/drivers/net/bonding/bond_main.c
+++ b/drivers/net/bonding/bond_main.c
@@ -1121,13 +1121,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond)
return bestslave;
}
+/* must be called in RCU critical section or with RTNL held */
static bool bond_should_notify_peers(struct bonding *bond)
{
- struct slave *slave;
-
- rcu_read_lock();
- slave = rcu_dereference(bond->curr_active_slave);
- rcu_read_unlock();
+ struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave);
if (!slave || !bond->send_peer_notif ||
bond->send_peer_notif %
diff --git a/drivers/net/dsa/b53/b53_common.c b/drivers/net/dsa/b53/b53_common.c
index 4e27dc913cf7..ae1c4dc35fe3 100644
--- a/drivers/net/dsa/b53/b53_common.c
+++ b/drivers/net/dsa/b53/b53_common.c
@@ -2265,6 +2265,9 @@ static int b53_change_mtu(struct dsa_switch *ds, int port, int mtu)
if (is5325(dev) || is5365(dev))
return -EOPNOTSUPP;
+ if (!dsa_is_cpu_port(ds, port))
+ return 0;
+
enable_jumbo = (mtu >= JMS_MIN_SIZE);
allow_10_100 = (dev->chip_id == BCM583XX_DEVICE_ID);
diff --git a/drivers/net/dsa/mv88e6xxx/chip.c b/drivers/net/dsa/mv88e6xxx/chip.c
index 354d4af13456..3877744193e2 100644
--- a/drivers/net/dsa/mv88e6xxx/chip.c
+++ b/drivers/net/dsa/mv88e6xxx/chip.c
@@ -3490,7 +3490,8 @@ static int mv88e6xxx_change_mtu(struct dsa_switch *ds, int port, int new_mtu)
mv88e6xxx_reg_lock(chip);
if (chip->info->ops->port_set_jumbo_size)
ret = chip->info->ops->port_set_jumbo_size(chip, port, new_mtu);
- else if (chip->info->ops->set_max_frame_size)
+ else if (chip->info->ops->set_max_frame_size &&
+ dsa_is_cpu_port(ds, port))
ret = chip->info->ops->set_max_frame_size(chip, new_mtu);
mv88e6xxx_reg_unlock(chip);
diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h
index a5ebd7110e07..986f43d27711 100644
--- a/drivers/net/ethernet/brocade/bna/bna_types.h
+++ b/drivers/net/ethernet/brocade/bna/bna_types.h
@@ -416,7 +416,7 @@ struct bna_ib {
/* Tx object */
/* Tx datapath control structure */
-#define BNA_Q_NAME_SIZE 16
+#define BNA_Q_NAME_SIZE (IFNAMSIZ + 6)
struct bna_tcb {
/* Fast path */
void **sw_qpt;
diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c
index 31191b520b58..6cf06a93bedf 100644
--- a/drivers/net/ethernet/brocade/bna/bnad.c
+++ b/drivers/net/ethernet/brocade/bna/bnad.c
@@ -1534,8 +1534,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info,
for (i = 0; i < num_txqs; i++) {
vector_num = tx_info->tcb[i]->intr_vector;
- sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name,
- tx_id + tx_info->tcb[i]->id);
+ snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d",
+ bnad->netdev->name,
+ tx_id + tx_info->tcb[i]->id);
err = request_irq(bnad->msix_table[vector_num].vector,
(irq_handler_t)bnad_msix_tx, 0,
tx_info->tcb[i]->name,
@@ -1585,9 +1586,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info,
for (i = 0; i < num_rxps; i++) {
vector_num = rx_info->rx_ctrl[i].ccb->intr_vector;
- sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d",
- bnad->netdev->name,
- rx_id + rx_info->rx_ctrl[i].ccb->id);
+ snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE,
+ "%s CQ %d", bnad->netdev->name,
+ rx_id + rx_info->rx_ctrl[i].ccb->id);
err = request_irq(bnad->msix_table[vector_num].vector,
(irq_handler_t)bnad_msix_rx, 0,
rx_info->rx_ctrl[i].ccb->name,
diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c
index d675f9d5f361..5604a47b35b2 100644
--- a/drivers/net/ethernet/freescale/fec_main.c
+++ b/drivers/net/ethernet/freescale/fec_main.c
@@ -283,8 +283,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
#define PKT_MINBUF_SIZE 64
/* FEC receive acceleration */
-#define FEC_RACC_IPDIS (1 << 1)
-#define FEC_RACC_PRODIS (1 << 2)
+#define FEC_RACC_IPDIS BIT(1)
+#define FEC_RACC_PRODIS BIT(2)
#define FEC_RACC_SHIFT16 BIT(7)
#define FEC_RACC_OPTIONS (FEC_RACC_IPDIS | FEC_RACC_PRODIS)
@@ -316,8 +316,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
#define FEC_MMFR_TA (2 << 16)
#define FEC_MMFR_DATA(v) (v & 0xffff)
/* FEC ECR bits definition */
-#define FEC_ECR_MAGICEN (1 << 2)
-#define FEC_ECR_SLEEP (1 << 3)
+#define FEC_ECR_RESET BIT(0)
+#define FEC_ECR_ETHEREN BIT(1)
+#define FEC_ECR_MAGICEN BIT(2)
+#define FEC_ECR_SLEEP BIT(3)
+#define FEC_ECR_EN1588 BIT(4)
+#define FEC_ECR_BYTESWP BIT(8)
+/* FEC RCR bits definition */
+#define FEC_RCR_LOOP BIT(0)
+#define FEC_RCR_HALFDPX BIT(1)
+#define FEC_RCR_MII BIT(2)
+#define FEC_RCR_PROMISC BIT(3)
+#define FEC_RCR_BC_REJ BIT(4)
+#define FEC_RCR_FLOWCTL BIT(5)
+#define FEC_RCR_RMII BIT(8)
+#define FEC_RCR_10BASET BIT(9)
+/* TX WMARK bits */
+#define FEC_TXWMRK_STRFWD BIT(8)
#define FEC_MII_TIMEOUT 30000 /* us */
@@ -1041,7 +1056,7 @@ fec_restart(struct net_device *ndev)
struct fec_enet_private *fep = netdev_priv(ndev);
u32 temp_mac[2];
u32 rcntl = OPT_FRAME_SIZE | 0x04;
- u32 ecntl = 0x2; /* ETHEREN */
+ u32 ecntl = FEC_ECR_ETHEREN;
/* Whack a reset. We should wait for this.
* For i.MX6SX SOC, enet use AXI bus, we use disable MAC
@@ -1116,18 +1131,18 @@ fec_restart(struct net_device *ndev)
fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID)
rcntl |= (1 << 6);
else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII)
- rcntl |= (1 << 8);
+ rcntl |= FEC_RCR_RMII;
else
- rcntl &= ~(1 << 8);
+ rcntl &= ~FEC_RCR_RMII;
/* 1G, 100M or 10M */
if (ndev->phydev) {
if (ndev->phydev->speed == SPEED_1000)
ecntl |= (1 << 5);
else if (ndev->phydev->speed == SPEED_100)
- rcntl &= ~(1 << 9);
+ rcntl &= ~FEC_RCR_10BASET;
else
- rcntl |= (1 << 9);
+ rcntl |= FEC_RCR_10BASET;
}
} else {
#ifdef FEC_MIIGSK_ENR
@@ -1186,13 +1201,13 @@ fec_restart(struct net_device *ndev)
if (fep->quirks & FEC_QUIRK_ENET_MAC) {
/* enable ENET endian swap */
- ecntl |= (1 << 8);
+ ecntl |= FEC_ECR_BYTESWP;
/* enable ENET store and forward mode */
- writel(1 << 8, fep->hwp + FEC_X_WMRK);
+ writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK);
}
if (fep->bufdesc_ex)
- ecntl |= (1 << 4);
+ ecntl |= FEC_ECR_EN1588;
if (fep->quirks & FEC_QUIRK_DELAYED_CLKS_SUPPORT &&
fep->rgmii_txc_dly)
@@ -1291,7 +1306,7 @@ static void
fec_stop(struct net_device *ndev)
{
struct fec_enet_private *fep = netdev_priv(ndev);
- u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8);
+ u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII;
u32 val;
/* We cannot expect a graceful transmit stop without link !!! */
@@ -1310,7 +1325,7 @@ fec_stop(struct net_device *ndev)
if (fep->quirks & FEC_QUIRK_HAS_MULTI_QUEUES) {
writel(0, fep->hwp + FEC_ECNTRL);
} else {
- writel(1, fep->hwp + FEC_ECNTRL);
+ writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL);
udelay(10);
}
} else {
@@ -1324,11 +1339,16 @@ fec_stop(struct net_device *ndev)
/* We have to keep ENET enabled to have MII interrupt stay working */
if (fep->quirks & FEC_QUIRK_ENET_MAC &&
!(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) {
- writel(2, fep->hwp + FEC_ECNTRL);
+ writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL);
writel(rmii_mode, fep->hwp + FEC_R_CNTRL);
}
-}
+ if (fep->bufdesc_ex) {
+ val = readl(fep->hwp + FEC_ECNTRL);
+ val |= FEC_ECR_EN1588;
+ writel(val, fep->hwp + FEC_ECNTRL);
+ }
+}
static void
fec_timeout(struct net_device *ndev, unsigned int txqueue)
diff --git a/drivers/net/ethernet/google/gve/gve_tx.c b/drivers/net/ethernet/google/gve/gve_tx.c
index 9f6ffc4a54f0..2ae891a62875 100644
--- a/drivers/net/ethernet/google/gve/gve_tx.c
+++ b/drivers/net/ethernet/google/gve/gve_tx.c
@@ -158,15 +158,16 @@ static int gve_clean_xdp_done(struct gve_priv *priv, struct gve_tx_ring *tx,
u32 to_do)
{
struct gve_tx_buffer_state *info;
- u32 clean_end = tx->done + to_do;
u64 pkts = 0, bytes = 0;
size_t space_freed = 0;
u32 xsk_complete = 0;
u32 idx;
+ int i;
- for (; tx->done < clean_end; tx->done++) {
+ for (i = 0; i < to_do; i++) {
idx = tx->done & tx->mask;
info = &tx->info[idx];
+ tx->done++;
if (unlikely(!info->xdp.size))
continue;
diff --git a/drivers/net/ethernet/google/gve/gve_tx_dqo.c b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
index 5a44354bbdfd..89b62b8d16e1 100644
--- a/drivers/net/ethernet/google/gve/gve_tx_dqo.c
+++ b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
@@ -812,22 +812,42 @@ static bool gve_can_send_tso(const struct sk_buff *skb)
const int header_len = skb_tcp_all_headers(skb);
const int gso_size = shinfo->gso_size;
int cur_seg_num_bufs;
+ int prev_frag_size;
int cur_seg_size;
int i;
cur_seg_size = skb_headlen(skb) - header_len;
+ prev_frag_size = skb_headlen(skb);
cur_seg_num_bufs = cur_seg_size > 0;
for (i = 0; i < shinfo->nr_frags; i++) {
if (cur_seg_size >= gso_size) {
cur_seg_size %= gso_size;
cur_seg_num_bufs = cur_seg_size > 0;
+
+ if (prev_frag_size > GVE_TX_MAX_BUF_SIZE_DQO) {
+ int prev_frag_remain = prev_frag_size %
+ GVE_TX_MAX_BUF_SIZE_DQO;
+
+ /* If the last descriptor of the previous frag
+ * is less than cur_seg_size, the segment will
+ * span two descriptors in the previous frag.
+ * Since max gso size (9728) is less than
+ * GVE_TX_MAX_BUF_SIZE_DQO, it is impossible
+ * for the segment to span more than two
+ * descriptors.
+ */
+ if (prev_frag_remain &&
+ cur_seg_size > prev_frag_remain)
+ cur_seg_num_bufs++;
+ }
}
if (unlikely(++cur_seg_num_bufs > max_bufs_per_seg))
return false;
- cur_seg_size += skb_frag_size(&shinfo->frags[i]);
+ prev_frag_size = skb_frag_size(&shinfo->frags[i]);
+ cur_seg_size += prev_frag_size;
}
return true;
diff --git a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
index 8c6e13f87b7d..1839a37139dc 100644
--- a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
@@ -531,7 +531,7 @@ ice_parse_rx_flow_user_data(struct ethtool_rx_flow_spec *fsp,
*
* Returns the number of available flow director filters to this VSI
*/
-static int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
{
u16 vsi_num = ice_get_hw_vsi_num(hw, vsi->idx);
u16 num_guar;
diff --git a/drivers/net/ethernet/intel/ice/ice_fdir.h b/drivers/net/ethernet/intel/ice/ice_fdir.h
index 1b9b84490689..b384d2a4ab19 100644
--- a/drivers/net/ethernet/intel/ice/ice_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_fdir.h
@@ -202,6 +202,8 @@ struct ice_fdir_base_pkt {
const u8 *tun_pkt;
};
+struct ice_vsi;
+
int ice_alloc_fd_res_cntr(struct ice_hw *hw, u16 *cntr_id);
int ice_free_fd_res_cntr(struct ice_hw *hw, u16 cntr_id);
int ice_alloc_fd_guar_item(struct ice_hw *hw, u16 *cntr_id, u16 num_fltr);
@@ -213,6 +215,7 @@ int
ice_fdir_get_gen_prgm_pkt(struct ice_hw *hw, struct ice_fdir_fltr *input,
u8 *pkt, bool frag, bool tun);
int ice_get_fdir_cnt_all(struct ice_hw *hw);
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi);
bool ice_fdir_is_dup_fltr(struct ice_hw *hw, struct ice_fdir_fltr *input);
bool ice_fdir_has_frag(enum ice_fltr_ptype flow);
struct ice_fdir_fltr *
diff --git a/drivers/net/ethernet/intel/ice/ice_switch.c b/drivers/net/ethernet/intel/ice/ice_switch.c
index d2a2388d4fa0..88ee2491312a 100644
--- a/drivers/net/ethernet/intel/ice/ice_switch.c
+++ b/drivers/net/ethernet/intel/ice/ice_switch.c
@@ -2271,10 +2271,10 @@ ice_get_recp_frm_fw(struct ice_hw *hw, struct ice_sw_recipe *recps, u8 rid,
/* Propagate some data to the recipe database */
recps[idx].is_root = !!is_root;
recps[idx].priority = root_bufs.content.act_ctrl_fwd_priority;
- recps[idx].need_pass_l2 = root_bufs.content.act_ctrl &
- ICE_AQ_RECIPE_ACT_NEED_PASS_L2;
- recps[idx].allow_pass_l2 = root_bufs.content.act_ctrl &
- ICE_AQ_RECIPE_ACT_ALLOW_PASS_L2;
+ recps[idx].need_pass_l2 = !!(root_bufs.content.act_ctrl &
+ ICE_AQ_RECIPE_ACT_NEED_PASS_L2);
+ recps[idx].allow_pass_l2 = !!(root_bufs.content.act_ctrl &
+ ICE_AQ_RECIPE_ACT_ALLOW_PASS_L2);
bitmap_zero(recps[idx].res_idxs, ICE_MAX_FV_WORDS);
if (root_bufs.content.result_indx & ICE_AQ_RECIPE_RESULT_EN) {
recps[idx].chain_idx = root_bufs.content.result_indx &
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
index 6fdbd73804d1..974c71490d97 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
@@ -551,6 +551,8 @@ static void ice_vc_fdir_reset_cnt_all(struct ice_vf_fdir *fdir)
fdir->fdir_fltr_cnt[flow][0] = 0;
fdir->fdir_fltr_cnt[flow][1] = 0;
}
+
+ fdir->fdir_fltr_cnt_total = 0;
}
/**
@@ -1567,6 +1569,7 @@ ice_vc_add_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
resp->status = status;
resp->flow_id = conf->flow_id;
vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]++;
+ vf->fdir.fdir_fltr_cnt_total++;
ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
(u8 *)resp, len);
@@ -1631,6 +1634,7 @@ ice_vc_del_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
resp->status = status;
ice_vc_fdir_remove_entry(vf, conf, conf->flow_id);
vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]--;
+ vf->fdir.fdir_fltr_cnt_total--;
ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
(u8 *)resp, len);
@@ -1797,6 +1801,7 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
struct virtchnl_fdir_add *stat = NULL;
struct virtchnl_fdir_fltr_conf *conf;
enum virtchnl_status_code v_ret;
+ struct ice_vsi *vf_vsi;
struct device *dev;
struct ice_pf *pf;
int is_tun = 0;
@@ -1805,6 +1810,17 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
pf = vf->pf;
dev = ice_pf_to_dev(pf);
+ vf_vsi = ice_get_vf_vsi(vf);
+
+#define ICE_VF_MAX_FDIR_FILTERS 128
+ if (!ice_fdir_num_avail_fltr(&pf->hw, vf_vsi) ||
+ vf->fdir.fdir_fltr_cnt_total >= ICE_VF_MAX_FDIR_FILTERS) {
+ v_ret = VIRTCHNL_STATUS_ERR_PARAM;
+ dev_err(dev, "Max number of FDIR filters for VF %d is reached\n",
+ vf->vf_id);
+ goto err_exit;
+ }
+
ret = ice_vc_fdir_param_check(vf, fltr->vsi_id);
if (ret) {
v_ret = VIRTCHNL_STATUS_ERR_PARAM;
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
index c5bcc8d7481c..ac6dcab454b4 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
@@ -29,6 +29,7 @@ struct ice_vf_fdir_ctx {
struct ice_vf_fdir {
u16 fdir_fltr_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
int prof_entry_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
+ u16 fdir_fltr_cnt_total;
struct ice_fd_hw_prof **fdir_prof;
struct idr fdir_rule_idr;
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
index 4b713832fdd5..f5c0a4214c4e 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
@@ -391,7 +391,8 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
if (err)
return err;
- lkey_id = aregion->ops->lkey_id_get(aregion, aentry->enc_key, erp_id);
+ lkey_id = aregion->ops->lkey_id_get(aregion, aentry->ht_key.enc_key,
+ erp_id);
if (IS_ERR(lkey_id))
return PTR_ERR(lkey_id);
aentry->lkey_id = lkey_id;
@@ -399,7 +400,7 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_WRITE,
priority, region->tcam_region_info,
- aentry->enc_key, erp_id,
+ aentry->ht_key.enc_key, erp_id,
aentry->delta_info.start,
aentry->delta_info.mask,
aentry->delta_info.value,
@@ -428,7 +429,7 @@ mlxsw_sp_acl_atcam_region_entry_remove(struct mlxsw_sp *mlxsw_sp,
mlxsw_reg_ptce3_pack(ptce3_pl, false, MLXSW_REG_PTCE3_OP_WRITE_WRITE, 0,
region->tcam_region_info,
- aentry->enc_key, erp_id,
+ aentry->ht_key.enc_key, erp_id,
aentry->delta_info.start,
aentry->delta_info.mask,
aentry->delta_info.value,
@@ -457,7 +458,7 @@ mlxsw_sp_acl_atcam_region_entry_action_replace(struct mlxsw_sp *mlxsw_sp,
kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_UPDATE,
priority, region->tcam_region_info,
- aentry->enc_key, erp_id,
+ aentry->ht_key.enc_key, erp_id,
aentry->delta_info.start,
aentry->delta_info.mask,
aentry->delta_info.value,
@@ -480,15 +481,13 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
int err;
mlxsw_afk_encode(afk, region->key_info, &rulei->values,
- aentry->ht_key.full_enc_key, mask);
+ aentry->ht_key.enc_key, mask);
erp_mask = mlxsw_sp_acl_erp_mask_get(aregion, mask, false);
if (IS_ERR(erp_mask))
return PTR_ERR(erp_mask);
aentry->erp_mask = erp_mask;
aentry->ht_key.erp_id = mlxsw_sp_acl_erp_mask_erp_id(erp_mask);
- memcpy(aentry->enc_key, aentry->ht_key.full_enc_key,
- sizeof(aentry->enc_key));
/* Compute all needed delta information and clear the delta bits
* from the encrypted key.
@@ -497,9 +496,8 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
aentry->delta_info.start = mlxsw_sp_acl_erp_delta_start(delta);
aentry->delta_info.mask = mlxsw_sp_acl_erp_delta_mask(delta);
aentry->delta_info.value =
- mlxsw_sp_acl_erp_delta_value(delta,
- aentry->ht_key.full_enc_key);
- mlxsw_sp_acl_erp_delta_clear(delta, aentry->enc_key);
+ mlxsw_sp_acl_erp_delta_value(delta, aentry->ht_key.enc_key);
+ mlxsw_sp_acl_erp_delta_clear(delta, aentry->ht_key.enc_key);
/* Add rule to the list of A-TCAM rules, assuming this
* rule is intended to A-TCAM. In case this rule does
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
index 95f63fcf4ba1..a54eedb69a3f 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
@@ -249,7 +249,7 @@ __mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion,
memcpy(chunk + pad_bytes, &erp_region_id,
sizeof(erp_region_id));
memcpy(chunk + key_offset,
- &aentry->enc_key[chunk_key_offsets[chunk_index]],
+ &aentry->ht_key.enc_key[chunk_key_offsets[chunk_index]],
chunk_key_len);
chunk += chunk_len;
}
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
index d231f4d2888b..9eee229303cc 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
@@ -1217,18 +1217,6 @@ static bool mlxsw_sp_acl_erp_delta_check(void *priv, const void *parent_obj,
return err ? false : true;
}
-static int mlxsw_sp_acl_erp_hints_obj_cmp(const void *obj1, const void *obj2)
-{
- const struct mlxsw_sp_acl_erp_key *key1 = obj1;
- const struct mlxsw_sp_acl_erp_key *key2 = obj2;
-
- /* For hints purposes, two objects are considered equal
- * in case the masks are the same. Does not matter what
- * the "ctcam" value is.
- */
- return memcmp(key1->mask, key2->mask, sizeof(key1->mask));
-}
-
static void *mlxsw_sp_acl_erp_delta_create(void *priv, void *parent_obj,
void *obj)
{
@@ -1308,7 +1296,6 @@ static void mlxsw_sp_acl_erp_root_destroy(void *priv, void *root_priv)
static const struct objagg_ops mlxsw_sp_acl_erp_objagg_ops = {
.obj_size = sizeof(struct mlxsw_sp_acl_erp_key),
.delta_check = mlxsw_sp_acl_erp_delta_check,
- .hints_obj_cmp = mlxsw_sp_acl_erp_hints_obj_cmp,
.delta_create = mlxsw_sp_acl_erp_delta_create,
.delta_destroy = mlxsw_sp_acl_erp_delta_destroy,
.root_create = mlxsw_sp_acl_erp_root_create,
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
index 79a1d8606512..010204f73ea4 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
@@ -167,9 +167,9 @@ struct mlxsw_sp_acl_atcam_region {
};
struct mlxsw_sp_acl_atcam_entry_ht_key {
- char full_enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded
- * key.
- */
+ char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key, minus
+ * delta bits.
+ */
u8 erp_id;
};
@@ -181,9 +181,6 @@ struct mlxsw_sp_acl_atcam_entry {
struct rhash_head ht_node;
struct list_head list; /* Member in entries_list */
struct mlxsw_sp_acl_atcam_entry_ht_key ht_key;
- char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key,
- * minus delta bits.
- */
struct {
u16 start;
u8 mask;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
index 4ead0ddf43a7..bf99495b51a9 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
@@ -982,7 +982,7 @@ static void dwmac4_set_mac_loopback(void __iomem *ioaddr, bool enable)
}
static void dwmac4_update_vlan_hash(struct mac_device_info *hw, u32 hash,
- __le16 perfect_match, bool is_double)
+ u16 perfect_match, bool is_double)
{
void __iomem *ioaddr = hw->pcsr;
u32 value;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
index 8bc317d2f7a6..052566f5b7f3 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
@@ -615,7 +615,7 @@ static int dwxgmac2_rss_configure(struct mac_device_info *hw,
}
static void dwxgmac2_update_vlan_hash(struct mac_device_info *hw, u32 hash,
- __le16 perfect_match, bool is_double)
+ u16 perfect_match, bool is_double)
{
void __iomem *ioaddr = hw->pcsr;
diff --git a/drivers/net/ethernet/stmicro/stmmac/hwif.h b/drivers/net/ethernet/stmicro/stmmac/hwif.h
index 68aa2d5ca6e5..47fb8e1646c2 100644
--- a/drivers/net/ethernet/stmicro/stmmac/hwif.h
+++ b/drivers/net/ethernet/stmicro/stmmac/hwif.h
@@ -386,7 +386,7 @@ struct stmmac_ops {
struct stmmac_rss *cfg, u32 num_rxq);
/* VLAN */
void (*update_vlan_hash)(struct mac_device_info *hw, u32 hash,
- __le16 perfect_match, bool is_double);
+ u16 perfect_match, bool is_double);
void (*enable_vlan)(struct mac_device_info *hw, u32 type);
int (*add_hw_vlan_rx_fltr)(struct net_device *dev,
struct mac_device_info *hw,
diff --git a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
index 19c58ad8df34..d6167a7b19f2 100644
--- a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
+++ b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
@@ -6473,7 +6473,7 @@ static u32 stmmac_vid_crc32_le(__le16 vid_le)
static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
{
u32 crc, hash = 0;
- __le16 pmatch = 0;
+ u16 pmatch = 0;
int count = 0;
u16 vid = 0;
@@ -6488,7 +6488,7 @@ static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
if (count > 2) /* VID = 0 always passes filter */
return -EOPNOTSUPP;
- pmatch = cpu_to_le16(vid);
+ pmatch = vid;
hash = 0;
}
diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c
index 3111e1648592..9c2e71b9c032 100644
--- a/drivers/net/netconsole.c
+++ b/drivers/net/netconsole.c
@@ -770,6 +770,7 @@ static int netconsole_netdev_event(struct notifier_block *this,
/* rtnl_lock already held
* we might sleep in __netpoll_cleanup()
*/
+ nt->enabled = false;
spin_unlock_irqrestore(&target_list_lock, flags);
__netpoll_cleanup(&nt->np);
@@ -777,7 +778,6 @@ static int netconsole_netdev_event(struct notifier_block *this,
spin_lock_irqsave(&target_list_lock, flags);
netdev_put(nt->np.dev, &nt->np.dev_tracker);
nt->np.dev = NULL;
- nt->enabled = false;
stopped = true;
netconsole_target_put(nt);
goto restart;
diff --git a/drivers/net/wireless/ath/ath11k/ce.c b/drivers/net/wireless/ath/ath11k/ce.c
index 289d47ae92af..e66e86bdec20 100644
--- a/drivers/net/wireless/ath/ath11k/ce.c
+++ b/drivers/net/wireless/ath/ath11k/ce.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include "dp_rx.h"
diff --git a/drivers/net/wireless/ath/ath11k/ce.h b/drivers/net/wireless/ath/ath11k/ce.h
index c0f6a0ba86df..bcde2fcf02cf 100644
--- a/drivers/net/wireless/ath/ath11k/ce.h
+++ b/drivers/net/wireless/ath/ath11k/ce.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022, 2024 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_CE_H
@@ -145,7 +146,7 @@ struct ath11k_ce_ring {
/* Host address space */
void *base_addr_owner_space_unaligned;
/* CE address space */
- u32 base_addr_ce_space_unaligned;
+ dma_addr_t base_addr_ce_space_unaligned;
/* Actual start of descriptors.
* Aligned to descriptor-size boundary.
@@ -155,7 +156,7 @@ struct ath11k_ce_ring {
void *base_addr_owner_space;
/* CE address space */
- u32 base_addr_ce_space;
+ dma_addr_t base_addr_ce_space;
/* HAL ring id */
u32 hal_ring_id;
diff --git a/drivers/net/wireless/ath/ath11k/dbring.c b/drivers/net/wireless/ath/ath11k/dbring.c
index 5536e8642331..fbb6e8d8a476 100644
--- a/drivers/net/wireless/ath/ath11k/dbring.c
+++ b/drivers/net/wireless/ath/ath11k/dbring.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/dbring.h b/drivers/net/wireless/ath/ath11k/dbring.h
index ef906c687b8c..2f93b78a50df 100644
--- a/drivers/net/wireless/ath/ath11k/dbring.h
+++ b/drivers/net/wireless/ath/ath11k/dbring.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_DBRING_H
diff --git a/drivers/net/wireless/ath/ath11k/debug.c b/drivers/net/wireless/ath/ath11k/debug.c
index f5c8a34c8802..2b8544355fc1 100644
--- a/drivers/net/wireless/ath/ath11k/debug.c
+++ b/drivers/net/wireless/ath/ath11k/debug.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debug.h b/drivers/net/wireless/ath/ath11k/debug.h
index 9c52804ef8ac..cc8934d15697 100644
--- a/drivers/net/wireless/ath/ath11k/debug.h
+++ b/drivers/net/wireless/ath/ath11k/debug.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef _ATH11K_DEBUG_H_
diff --git a/drivers/net/wireless/ath/ath11k/debugfs.c b/drivers/net/wireless/ath/ath11k/debugfs.c
index 5bb6fd17fdf6..8cda73b78ebf 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs.c
+++ b/drivers/net/wireless/ath/ath11k/debugfs.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debugfs.h b/drivers/net/wireless/ath/ath11k/debugfs.h
index 3af0169f6cf2..44d15845f39a 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs.h
+++ b/drivers/net/wireless/ath/ath11k/debugfs.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef _ATH11K_DEBUGFS_H_
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c
index 0207fc4910f3..870e86a31bf8 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c
+++ b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h
index 96219301f05b..476689bbd4da 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h
+++ b/drivers/net/wireless/ath/ath11k/debugfs_htt_stats.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef DEBUG_HTT_STATS_H
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_sta.c b/drivers/net/wireless/ath/ath11k/debugfs_sta.c
index 9cc4ef28e751..168879a380cb 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_sta.c
+++ b/drivers/net/wireless/ath/ath11k/debugfs_sta.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/vmalloc.h>
diff --git a/drivers/net/wireless/ath/ath11k/debugfs_sta.h b/drivers/net/wireless/ath/ath11k/debugfs_sta.h
index e6c11b3a40aa..ace877e19275 100644
--- a/drivers/net/wireless/ath/ath11k/debugfs_sta.h
+++ b/drivers/net/wireless/ath/ath11k/debugfs_sta.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef _ATH11K_DEBUGFS_STA_H_
diff --git a/drivers/net/wireless/ath/ath11k/dp.c b/drivers/net/wireless/ath/ath11k/dp.c
index d070bcb3fe24..be0beb6bae8f 100644
--- a/drivers/net/wireless/ath/ath11k/dp.c
+++ b/drivers/net/wireless/ath/ath11k/dp.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <crypto/hash.h>
diff --git a/drivers/net/wireless/ath/ath11k/dp.h b/drivers/net/wireless/ath/ath11k/dp.h
index 15815af453b2..2f6dd69d3be2 100644
--- a/drivers/net/wireless/ath/ath11k/dp.h
+++ b/drivers/net/wireless/ath/ath11k/dp.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_DP_H
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.c b/drivers/net/wireless/ath/ath11k/dp_rx.c
index a993e74bbae8..b3499f966a9d 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.c
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/ieee80211.h>
@@ -1879,8 +1880,7 @@ static void ath11k_dp_rx_h_csum_offload(struct ath11k *ar, struct sk_buff *msdu)
CHECKSUM_NONE : CHECKSUM_UNNECESSARY;
}
-static int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar,
- enum hal_encrypt_type enctype)
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype)
{
switch (enctype) {
case HAL_ENCRYPT_TYPE_OPEN:
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.h b/drivers/net/wireless/ath/ath11k/dp_rx.h
index 623da3bf9dc8..c322e30caa96 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.h
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2024 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_DP_RX_H
#define ATH11K_DP_RX_H
@@ -95,4 +96,6 @@ int ath11k_peer_rx_frag_setup(struct ath11k *ar, const u8 *peer_mac, int vdev_id
int ath11k_dp_rx_pktlog_start(struct ath11k_base *ab);
int ath11k_dp_rx_pktlog_stop(struct ath11k_base *ab, bool stop_timer);
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype);
+
#endif /* ATH11K_DP_RX_H */
diff --git a/drivers/net/wireless/ath/ath11k/dp_tx.c b/drivers/net/wireless/ath/ath11k/dp_tx.c
index 0dda76f7a4b5..7dd1ee589801 100644
--- a/drivers/net/wireless/ath/ath11k/dp_tx.c
+++ b/drivers/net/wireless/ath/ath11k/dp_tx.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/dp_tx.h b/drivers/net/wireless/ath/ath11k/dp_tx.h
index 68a21ea9b934..61be2265e09f 100644
--- a/drivers/net/wireless/ath/ath11k/dp_tx.h
+++ b/drivers/net/wireless/ath/ath11k/dp_tx.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021, 2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_DP_TX_H
diff --git a/drivers/net/wireless/ath/ath11k/hal.c b/drivers/net/wireless/ath/ath11k/hal.c
index 0a99aa7ddbf4..ae5f7e401e21 100644
--- a/drivers/net/wireless/ath/ath11k/hal.c
+++ b/drivers/net/wireless/ath/ath11k/hal.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/dma-mapping.h>
#include "hal_tx.h"
diff --git a/drivers/net/wireless/ath/ath11k/hal.h b/drivers/net/wireless/ath/ath11k/hal.h
index 1942d41d6de5..80447f488954 100644
--- a/drivers/net/wireless/ath/ath11k/hal.h
+++ b/drivers/net/wireless/ath/ath11k/hal.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_HAL_H
diff --git a/drivers/net/wireless/ath/ath11k/hal_desc.h b/drivers/net/wireless/ath/ath11k/hal_desc.h
index d895ea878d9f..b2fd180bd28e 100644
--- a/drivers/net/wireless/ath/ath11k/hal_desc.h
+++ b/drivers/net/wireless/ath/ath11k/hal_desc.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/hal_rx.c b/drivers/net/wireless/ath/ath11k/hal_rx.c
index e5ed5efb139e..363adac84a87 100644
--- a/drivers/net/wireless/ath/ath11k/hal_rx.c
+++ b/drivers/net/wireless/ath/ath11k/hal_rx.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include "debug.h"
diff --git a/drivers/net/wireless/ath/ath11k/hal_rx.h b/drivers/net/wireless/ath/ath11k/hal_rx.h
index 61bd8416c4fd..e05411005fc6 100644
--- a/drivers/net/wireless/ath/ath11k/hal_rx.h
+++ b/drivers/net/wireless/ath/ath11k/hal_rx.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_HAL_RX_H
diff --git a/drivers/net/wireless/ath/ath11k/hif.h b/drivers/net/wireless/ath/ath11k/hif.h
index 659b80d2abd4..e0952c062929 100644
--- a/drivers/net/wireless/ath/ath11k/hif.h
+++ b/drivers/net/wireless/ath/ath11k/hif.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef _HIF_H_
diff --git a/drivers/net/wireless/ath/ath11k/htc.c b/drivers/net/wireless/ath/ath11k/htc.c
index 2c2e425c8665..23054ab29a5e 100644
--- a/drivers/net/wireless/ath/ath11k/htc.c
+++ b/drivers/net/wireless/ath/ath11k/htc.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/skbuff.h>
#include <linux/ctype.h>
diff --git a/drivers/net/wireless/ath/ath11k/htc.h b/drivers/net/wireless/ath/ath11k/htc.h
index f429b37cfdf7..e9b123a50b5d 100644
--- a/drivers/net/wireless/ath/ath11k/htc.h
+++ b/drivers/net/wireless/ath/ath11k/htc.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_HTC_H
diff --git a/drivers/net/wireless/ath/ath11k/hw.c b/drivers/net/wireless/ath/ath11k/hw.c
index d7b5ec6e6904..77d8f9237680 100644
--- a/drivers/net/wireless/ath/ath11k/hw.c
+++ b/drivers/net/wireless/ath/ath11k/hw.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2020 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/types.h>
diff --git a/drivers/net/wireless/ath/ath11k/hw.h b/drivers/net/wireless/ath/ath11k/hw.h
index d51a99669dd6..1b070747a5db 100644
--- a/drivers/net/wireless/ath/ath11k/hw.h
+++ b/drivers/net/wireless/ath/ath11k/hw.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_HW_H
diff --git a/drivers/net/wireless/ath/ath11k/mac.c b/drivers/net/wireless/ath/ath11k/mac.c
index 445f59ad1fc0..33f2c189b4d8 100644
--- a/drivers/net/wireless/ath/ath11k/mac.c
+++ b/drivers/net/wireless/ath/ath11k/mac.c
@@ -4130,6 +4130,7 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
switch (key->cipher) {
case WLAN_CIPHER_SUITE_CCMP:
+ case WLAN_CIPHER_SUITE_CCMP_256:
arg.key_cipher = WMI_CIPHER_AES_CCM;
/* TODO: Re-check if flag is valid */
key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
@@ -4139,12 +4140,10 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
arg.key_txmic_len = 8;
arg.key_rxmic_len = 8;
break;
- case WLAN_CIPHER_SUITE_CCMP_256:
- arg.key_cipher = WMI_CIPHER_AES_CCM;
- break;
case WLAN_CIPHER_SUITE_GCMP:
case WLAN_CIPHER_SUITE_GCMP_256:
arg.key_cipher = WMI_CIPHER_AES_GCM;
+ key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
break;
default:
ath11k_warn(ar->ab, "cipher %d is not supported\n", key->cipher);
@@ -6023,7 +6022,10 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
{
struct ath11k_base *ab = ar->ab;
struct ieee80211_hdr *hdr = (struct ieee80211_hdr *)skb->data;
+ struct ath11k_skb_cb *skb_cb = ATH11K_SKB_CB(skb);
struct ieee80211_tx_info *info;
+ enum hal_encrypt_type enctype;
+ unsigned int mic_len;
dma_addr_t paddr;
int buf_id;
int ret;
@@ -6047,7 +6049,12 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
ieee80211_is_deauth(hdr->frame_control) ||
ieee80211_is_disassoc(hdr->frame_control)) &&
ieee80211_has_protected(hdr->frame_control)) {
- skb_put(skb, IEEE80211_CCMP_MIC_LEN);
+ if (!(skb_cb->flags & ATH11K_SKB_CIPHER_SET))
+ ath11k_warn(ab, "WMI management tx frame without ATH11K_SKB_CIPHER_SET");
+
+ enctype = ath11k_dp_tx_get_encrypt_type(skb_cb->cipher);
+ mic_len = ath11k_dp_rx_crypto_mic_len(ar, enctype);
+ skb_put(skb, mic_len);
}
}
diff --git a/drivers/net/wireless/ath/ath11k/mac.h b/drivers/net/wireless/ath/ath11k/mac.h
index 0231783ad754..0dfdeed5177b 100644
--- a/drivers/net/wireless/ath/ath11k/mac.h
+++ b/drivers/net/wireless/ath/ath11k/mac.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_MAC_H
diff --git a/drivers/net/wireless/ath/ath11k/mhi.c b/drivers/net/wireless/ath/ath11k/mhi.c
index 76de891d6c0f..48ae81efc269 100644
--- a/drivers/net/wireless/ath/ath11k/mhi.c
+++ b/drivers/net/wireless/ath/ath11k/mhi.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2020 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/msi.h>
diff --git a/drivers/net/wireless/ath/ath11k/mhi.h b/drivers/net/wireless/ath/ath11k/mhi.h
index 8d9f852da695..f81fba2644a4 100644
--- a/drivers/net/wireless/ath/ath11k/mhi.h
+++ b/drivers/net/wireless/ath/ath11k/mhi.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef _ATH11K_MHI_H
#define _ATH11K_MHI_H
diff --git a/drivers/net/wireless/ath/ath11k/pcic.c b/drivers/net/wireless/ath/ath11k/pcic.c
index 011cf5fb8023..803ee9dd7967 100644
--- a/drivers/net/wireless/ath/ath11k/pcic.c
+++ b/drivers/net/wireless/ath/ath11k/pcic.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2019-2021 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/peer.c b/drivers/net/wireless/ath/ath11k/peer.c
index 114aa3a9a339..ca719eb3f7f8 100644
--- a/drivers/net/wireless/ath/ath11k/peer.c
+++ b/drivers/net/wireless/ath/ath11k/peer.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include "core.h"
diff --git a/drivers/net/wireless/ath/ath11k/peer.h b/drivers/net/wireless/ath/ath11k/peer.h
index 9bd385d0a38c..3ad2f3355b14 100644
--- a/drivers/net/wireless/ath/ath11k/peer.h
+++ b/drivers/net/wireless/ath/ath11k/peer.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_PEER_H
diff --git a/drivers/net/wireless/ath/ath11k/qmi.c b/drivers/net/wireless/ath/ath11k/qmi.c
index 41fad03a3025..a831d9474e9e 100644
--- a/drivers/net/wireless/ath/ath11k/qmi.c
+++ b/drivers/net/wireless/ath/ath11k/qmi.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/elf.h>
diff --git a/drivers/net/wireless/ath/ath11k/qmi.h b/drivers/net/wireless/ath/ath11k/qmi.h
index d477e2be814b..7e06d100af57 100644
--- a/drivers/net/wireless/ath/ath11k/qmi.h
+++ b/drivers/net/wireless/ath/ath11k/qmi.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2022, Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_QMI_H
diff --git a/drivers/net/wireless/ath/ath11k/reg.c b/drivers/net/wireless/ath/ath11k/reg.c
index 7f9fb968dac6..c9e8bbc4896f 100644
--- a/drivers/net/wireless/ath/ath11k/reg.c
+++ b/drivers/net/wireless/ath/ath11k/reg.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/rtnetlink.h>
diff --git a/drivers/net/wireless/ath/ath11k/reg.h b/drivers/net/wireless/ath/ath11k/reg.h
index 2f284f26378d..d873b9cf7fc4 100644
--- a/drivers/net/wireless/ath/ath11k/reg.h
+++ b/drivers/net/wireless/ath/ath11k/reg.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_REG_H
diff --git a/drivers/net/wireless/ath/ath11k/rx_desc.h b/drivers/net/wireless/ath/ath11k/rx_desc.h
index 786d5f36f5e5..2da6da727278 100644
--- a/drivers/net/wireless/ath/ath11k/rx_desc.h
+++ b/drivers/net/wireless/ath/ath11k/rx_desc.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_RX_DESC_H
#define ATH11K_RX_DESC_H
diff --git a/drivers/net/wireless/ath/ath11k/spectral.c b/drivers/net/wireless/ath/ath11k/spectral.c
index 705868198df4..ae2abe8ae992 100644
--- a/drivers/net/wireless/ath/ath11k/spectral.c
+++ b/drivers/net/wireless/ath/ath11k/spectral.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/relay.h>
diff --git a/drivers/net/wireless/ath/ath11k/spectral.h b/drivers/net/wireless/ath/ath11k/spectral.h
index 96bfa16e18e9..789cff7c64a7 100644
--- a/drivers/net/wireless/ath/ath11k/spectral.h
+++ b/drivers/net/wireless/ath/ath11k/spectral.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2019-2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_SPECTRAL_H
diff --git a/drivers/net/wireless/ath/ath11k/thermal.c b/drivers/net/wireless/ath/ath11k/thermal.c
index 23ed01bd44f9..d39acc03be5b 100644
--- a/drivers/net/wireless/ath/ath11k/thermal.c
+++ b/drivers/net/wireless/ath/ath11k/thermal.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/device.h>
diff --git a/drivers/net/wireless/ath/ath11k/thermal.h b/drivers/net/wireless/ath/ath11k/thermal.h
index 3e39675ef7f5..40c1a9563e0c 100644
--- a/drivers/net/wireless/ath/ath11k/thermal.h
+++ b/drivers/net/wireless/ath/ath11k/thermal.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef _ATH11K_THERMAL_
diff --git a/drivers/net/wireless/ath/ath11k/trace.h b/drivers/net/wireless/ath/ath11k/trace.h
index 9535745fe026..235ab8ea715f 100644
--- a/drivers/net/wireless/ath/ath11k/trace.h
+++ b/drivers/net/wireless/ath/ath11k/trace.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#if !defined(_TRACE_H_) || defined(TRACE_HEADER_MULTI_READ)
diff --git a/drivers/net/wireless/ath/ath11k/wmi.c b/drivers/net/wireless/ath/ath11k/wmi.c
index 1c07f55c25e6..2cc13e60f422 100644
--- a/drivers/net/wireless/ath/ath11k/wmi.c
+++ b/drivers/net/wireless/ath/ath11k/wmi.c
@@ -1,7 +1,7 @@
// SPDX-License-Identifier: BSD-3-Clause-Clear
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021, 2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/skbuff.h>
#include <linux/ctype.h>
diff --git a/drivers/net/wireless/ath/ath11k/wmi.h b/drivers/net/wireless/ath/ath11k/wmi.h
index 100bb816b592..fa3b480b9d24 100644
--- a/drivers/net/wireless/ath/ath11k/wmi.h
+++ b/drivers/net/wireless/ath/ath11k/wmi.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
- * Copyright (c) 2023 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2023 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_WMI_H
diff --git a/drivers/net/wireless/ath/ath11k/wow.h b/drivers/net/wireless/ath/ath11k/wow.h
index 553ba850d910..c85811e3f42b 100644
--- a/drivers/net/wireless/ath/ath11k/wow.h
+++ b/drivers/net/wireless/ath/ath11k/wow.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2020 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2022 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef _WOW_H_
diff --git a/drivers/net/wireless/ath/ath12k/ce.h b/drivers/net/wireless/ath/ath12k/ce.h
index 79af3b6159f1..857bc5f9e946 100644
--- a/drivers/net/wireless/ath/ath12k/ce.h
+++ b/drivers/net/wireless/ath/ath12k/ce.h
@@ -1,7 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2021 The Linux Foundation. All rights reserved.
- * Copyright (c) 2021-2022 Qualcomm Innovation Center, Inc. All rights reserved.
+ * Copyright (c) 2021-2022, 2024 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH12K_CE_H
@@ -119,7 +119,7 @@ struct ath12k_ce_ring {
/* Host address space */
void *base_addr_owner_space_unaligned;
/* CE address space */
- u32 base_addr_ce_space_unaligned;
+ dma_addr_t base_addr_ce_space_unaligned;
/* Actual start of descriptors.
* Aligned to descriptor-size boundary.
@@ -129,7 +129,7 @@ struct ath12k_ce_ring {
void *base_addr_owner_space;
/* CE address space */
- u32 base_addr_ce_space;
+ dma_addr_t base_addr_ce_space;
/* HAL ring id */
u32 hal_ring_id;
diff --git a/drivers/net/wireless/ath/ath12k/dp.c b/drivers/net/wireless/ath/ath12k/dp.c
index 6893466f61f0..907655c45a4b 100644
--- a/drivers/net/wireless/ath/ath12k/dp.c
+++ b/drivers/net/wireless/ath/ath12k/dp.c
@@ -127,7 +127,9 @@ static int ath12k_dp_srng_find_ring_in_mask(int ring_num, const u8 *grp_mask)
static int ath12k_dp_srng_calculate_msi_group(struct ath12k_base *ab,
enum hal_ring_type type, int ring_num)
{
+ const struct ath12k_hal_tcl_to_wbm_rbm_map *map;
const u8 *grp_mask;
+ int i;
switch (type) {
case HAL_WBM2SW_RELEASE:
@@ -135,6 +137,14 @@ static int ath12k_dp_srng_calculate_msi_group(struct ath12k_base *ab,
grp_mask = &ab->hw_params->ring_mask->rx_wbm_rel[0];
ring_num = 0;
} else {
+ map = ab->hw_params->hal_ops->tcl_to_wbm_rbm_map;
+ for (i = 0; i < ab->hw_params->max_tx_ring; i++) {
+ if (ring_num == map[i].wbm_ring_num) {
+ ring_num = i;
+ break;
+ }
+ }
+
grp_mask = &ab->hw_params->ring_mask->tx[0];
}
break;
@@ -876,11 +886,9 @@ int ath12k_dp_service_srng(struct ath12k_base *ab,
enum dp_monitor_mode monitor_mode;
u8 ring_mask;
- while (i < ab->hw_params->max_tx_ring) {
- if (ab->hw_params->ring_mask->tx[grp_id] &
- BIT(ab->hw_params->hal_ops->tcl_to_wbm_rbm_map[i].wbm_ring_num))
- ath12k_dp_tx_completion_handler(ab, i);
- i++;
+ if (ab->hw_params->ring_mask->tx[grp_id]) {
+ i = fls(ab->hw_params->ring_mask->tx[grp_id]) - 1;
+ ath12k_dp_tx_completion_handler(ab, i);
}
if (ab->hw_params->ring_mask->rx_err[grp_id]) {
diff --git a/drivers/net/wireless/ath/ath12k/dp_rx.c b/drivers/net/wireless/ath/ath12k/dp_rx.c
index dbcbe7e0cd2a..2c17b1e7681a 100644
--- a/drivers/net/wireless/ath/ath12k/dp_rx.c
+++ b/drivers/net/wireless/ath/ath12k/dp_rx.c
@@ -2376,8 +2376,10 @@ void ath12k_dp_rx_h_ppdu(struct ath12k *ar, struct hal_rx_desc *rx_desc,
channel_num = meta_data;
center_freq = meta_data >> 16;
- if (center_freq >= 5935 && center_freq <= 7105) {
+ if (center_freq >= ATH12K_MIN_6G_FREQ &&
+ center_freq <= ATH12K_MAX_6G_FREQ) {
rx_status->band = NL80211_BAND_6GHZ;
+ rx_status->freq = center_freq;
} else if (channel_num >= 1 && channel_num <= 14) {
rx_status->band = NL80211_BAND_2GHZ;
} else if (channel_num >= 36 && channel_num <= 173) {
@@ -2395,8 +2397,9 @@ void ath12k_dp_rx_h_ppdu(struct ath12k *ar, struct hal_rx_desc *rx_desc,
rx_desc, sizeof(*rx_desc));
}
- rx_status->freq = ieee80211_channel_to_frequency(channel_num,
- rx_status->band);
+ if (rx_status->band != NL80211_BAND_6GHZ)
+ rx_status->freq = ieee80211_channel_to_frequency(channel_num,
+ rx_status->band);
ath12k_dp_rx_h_rate(ar, rx_desc, rx_status);
}
@@ -2985,7 +2988,7 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
struct hal_srng *srng;
dma_addr_t link_paddr, buf_paddr;
u32 desc_bank, msdu_info, msdu_ext_info, mpdu_info;
- u32 cookie, hal_rx_desc_sz, dest_ring_info0;
+ u32 cookie, hal_rx_desc_sz, dest_ring_info0, queue_addr_hi;
int ret;
struct ath12k_rx_desc_info *desc_info;
u8 dst_ind;
@@ -3021,7 +3024,7 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
buf_paddr = dma_map_single(ab->dev, defrag_skb->data,
defrag_skb->len + skb_tailroom(defrag_skb),
- DMA_FROM_DEVICE);
+ DMA_TO_DEVICE);
if (dma_mapping_error(ab->dev, buf_paddr))
return -ENOMEM;
@@ -3077,13 +3080,11 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
reo_ent_ring->rx_mpdu_info.peer_meta_data =
reo_dest_ring->rx_mpdu_info.peer_meta_data;
- /* Firmware expects physical address to be filled in queue_addr_lo in
- * the MLO scenario and in case of non MLO peer meta data needs to be
- * filled.
- * TODO: Need to handle for MLO scenario.
- */
- reo_ent_ring->queue_addr_lo = reo_dest_ring->rx_mpdu_info.peer_meta_data;
- reo_ent_ring->info0 = le32_encode_bits(dst_ind,
+ reo_ent_ring->queue_addr_lo = cpu_to_le32(lower_32_bits(rx_tid->paddr));
+ queue_addr_hi = upper_32_bits(rx_tid->paddr);
+ reo_ent_ring->info0 = le32_encode_bits(queue_addr_hi,
+ HAL_REO_ENTR_RING_INFO0_QUEUE_ADDR_HI) |
+ le32_encode_bits(dst_ind,
HAL_REO_ENTR_RING_INFO0_DEST_IND);
reo_ent_ring->info1 = le32_encode_bits(rx_tid->cur_sn,
@@ -3107,7 +3108,7 @@ static int ath12k_dp_rx_h_defrag_reo_reinject(struct ath12k *ar,
spin_unlock_bh(&dp->rx_desc_lock);
err_unmap_dma:
dma_unmap_single(ab->dev, buf_paddr, defrag_skb->len + skb_tailroom(defrag_skb),
- DMA_FROM_DEVICE);
+ DMA_TO_DEVICE);
return ret;
}
diff --git a/drivers/net/wireless/ath/ath12k/hw.c b/drivers/net/wireless/ath/ath12k/hw.c
index ba7720f760c5..dafd7c34d746 100644
--- a/drivers/net/wireless/ath/ath12k/hw.c
+++ b/drivers/net/wireless/ath/ath12k/hw.c
@@ -540,9 +540,6 @@ static const struct ath12k_hw_ring_mask ath12k_hw_ring_mask_qcn9274 = {
},
.rx_mon_dest = {
0, 0, 0,
- ATH12K_RX_MON_RING_MASK_0,
- ATH12K_RX_MON_RING_MASK_1,
- ATH12K_RX_MON_RING_MASK_2,
},
.rx = {
0, 0, 0, 0,
@@ -568,16 +565,15 @@ static const struct ath12k_hw_ring_mask ath12k_hw_ring_mask_qcn9274 = {
ATH12K_HOST2RXDMA_RING_MASK_0,
},
.tx_mon_dest = {
- ATH12K_TX_MON_RING_MASK_0,
- ATH12K_TX_MON_RING_MASK_1,
+ 0, 0, 0,
},
};
static const struct ath12k_hw_ring_mask ath12k_hw_ring_mask_wcn7850 = {
.tx = {
ATH12K_TX_RING_MASK_0,
+ ATH12K_TX_RING_MASK_1,
ATH12K_TX_RING_MASK_2,
- ATH12K_TX_RING_MASK_4,
},
.rx_mon_dest = {
},
diff --git a/drivers/net/wireless/ath/ath12k/wmi.c b/drivers/net/wireless/ath/ath12k/wmi.c
index cd89032fa25e..21399ad233c0 100644
--- a/drivers/net/wireless/ath/ath12k/wmi.c
+++ b/drivers/net/wireless/ath/ath12k/wmi.c
@@ -5772,8 +5772,10 @@ static void ath12k_mgmt_rx_event(struct ath12k_base *ab, struct sk_buff *skb)
if (rx_ev.status & WMI_RX_STATUS_ERR_MIC)
status->flag |= RX_FLAG_MMIC_ERROR;
- if (rx_ev.chan_freq >= ATH12K_MIN_6G_FREQ) {
+ if (rx_ev.chan_freq >= ATH12K_MIN_6G_FREQ &&
+ rx_ev.chan_freq <= ATH12K_MAX_6G_FREQ) {
status->band = NL80211_BAND_6GHZ;
+ status->freq = rx_ev.chan_freq;
} else if (rx_ev.channel >= 1 && rx_ev.channel <= 14) {
status->band = NL80211_BAND_2GHZ;
} else if (rx_ev.channel >= 36 && rx_ev.channel <= ATH12K_MAX_5G_CHAN) {
@@ -5794,8 +5796,10 @@ static void ath12k_mgmt_rx_event(struct ath12k_base *ab, struct sk_buff *skb)
sband = &ar->mac.sbands[status->band];
- status->freq = ieee80211_channel_to_frequency(rx_ev.channel,
- status->band);
+ if (status->band != NL80211_BAND_6GHZ)
+ status->freq = ieee80211_channel_to_frequency(rx_ev.channel,
+ status->band);
+
status->signal = rx_ev.snr + ATH12K_DEFAULT_NOISE_FLOOR;
status->rate_idx = ath12k_mac_bitrate_to_idx(sband, rx_ev.rate / 100);
diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
index 7717eb85a1db..47c0e8e429e5 100644
--- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
+++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
@@ -2567,7 +2567,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
struct lcnphy_txgains cal_gains, temp_gains;
u16 hash;
- u8 band_idx;
int j;
u16 ncorr_override[5];
u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000,
@@ -2599,6 +2598,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
u16 *values_to_save;
struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy;
+ if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec)))
+ return;
+
values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC);
if (NULL == values_to_save)
return;
@@ -2662,20 +2664,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
hash = (target_gains->gm_gain << 8) |
(target_gains->pga_gain << 4) | (target_gains->pad_gain);
- band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0);
-
cal_gains = *target_gains;
memset(ncorr_override, 0, sizeof(ncorr_override));
- for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) {
- if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) {
+ for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) {
+ if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) {
cal_gains.gm_gain =
- tbl_iqcal_gainparams_lcnphy[band_idx][j][1];
+ tbl_iqcal_gainparams_lcnphy[0][j][1];
cal_gains.pga_gain =
- tbl_iqcal_gainparams_lcnphy[band_idx][j][2];
+ tbl_iqcal_gainparams_lcnphy[0][j][2];
cal_gains.pad_gain =
- tbl_iqcal_gainparams_lcnphy[band_idx][j][3];
+ tbl_iqcal_gainparams_lcnphy[0][j][3];
memcpy(ncorr_override,
- &tbl_iqcal_gainparams_lcnphy[band_idx][j][3],
+ &tbl_iqcal_gainparams_lcnphy[0][j][3],
sizeof(ncorr_override));
break;
}
diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
index 4389cf3f889f..6f01b7573b23 100644
--- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c
+++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
@@ -926,6 +926,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv,
return -EOPNOTSUPP;
}
+ priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type);
+
spin_lock_irqsave(&adapter->main_proc_lock, flags);
adapter->main_locked = false;
spin_unlock_irqrestore(&adapter->main_proc_lock, flags);
diff --git a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c
index 1e1c8fa194cb..0466b8be5df0 100644
--- a/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c
+++ b/drivers/net/wireless/realtek/rtl8xxxu/rtl8xxxu_8188f.c
@@ -713,9 +713,14 @@ static void rtl8188fu_init_statistics(struct rtl8xxxu_priv *priv)
rtl8xxxu_write32(priv, REG_OFDM0_FA_RSTC, val32);
}
+#define TX_POWER_INDEX_MAX 0x3F
+#define TX_POWER_INDEX_DEFAULT_CCK 0x22
+#define TX_POWER_INDEX_DEFAULT_HT40 0x27
+
static int rtl8188fu_parse_efuse(struct rtl8xxxu_priv *priv)
{
struct rtl8188fu_efuse *efuse = &priv->efuse_wifi.efuse8188fu;
+ int i;
if (efuse->rtl_id != cpu_to_le16(0x8129))
return -EINVAL;
@@ -729,6 +734,16 @@ static int rtl8188fu_parse_efuse(struct rtl8xxxu_priv *priv)
efuse->tx_power_index_A.ht40_base,
sizeof(efuse->tx_power_index_A.ht40_base));
+ for (i = 0; i < ARRAY_SIZE(priv->cck_tx_power_index_A); i++) {
+ if (priv->cck_tx_power_index_A[i] > TX_POWER_INDEX_MAX)
+ priv->cck_tx_power_index_A[i] = TX_POWER_INDEX_DEFAULT_CCK;
+ }
+
+ for (i = 0; i < ARRAY_SIZE(priv->ht40_1s_tx_power_index_A); i++) {
+ if (priv->ht40_1s_tx_power_index_A[i] > TX_POWER_INDEX_MAX)
+ priv->ht40_1s_tx_power_index_A[i] = TX_POWER_INDEX_DEFAULT_HT40;
+ }
+
priv->ofdm_tx_power_diff[0].a = efuse->tx_power_index_A.ht20_ofdm_1s_diff.a;
priv->ht20_tx_power_diff[0].a = efuse->tx_power_index_A.ht20_ofdm_1s_diff.b;
diff --git a/drivers/net/wireless/realtek/rtw88/usb.c b/drivers/net/wireless/realtek/rtw88/usb.c
index a0188511099a..efd0c2915a05 100644
--- a/drivers/net/wireless/realtek/rtw88/usb.c
+++ b/drivers/net/wireless/realtek/rtw88/usb.c
@@ -273,6 +273,8 @@ static void rtw_usb_write_port_tx_complete(struct urb *urb)
info = IEEE80211_SKB_CB(skb);
tx_data = rtw_usb_get_tx_data(skb);
+ skb_pull(skb, rtwdev->chip->tx_pkt_desc_sz);
+
/* enqueue to wait for tx report */
if (info->flags & IEEE80211_TX_CTL_REQ_TX_STATUS) {
rtw_tx_report_enqueue(rtwdev, skb, tx_data->sn);
diff --git a/drivers/net/wireless/realtek/rtw89/debug.c b/drivers/net/wireless/realtek/rtw89/debug.c
index d162e64f6064..94fe921e9ff2 100644
--- a/drivers/net/wireless/realtek/rtw89/debug.c
+++ b/drivers/net/wireless/realtek/rtw89/debug.c
@@ -3292,7 +3292,7 @@ static void rtw89_sta_info_get_iter(void *data, struct ieee80211_sta *sta)
case RX_ENC_HE:
seq_printf(m, "HE %dSS MCS-%d GI:%s", status->nss, status->rate_idx,
status->he_gi <= NL80211_RATE_INFO_HE_GI_3_2 ?
- he_gi_str[rate->he_gi] : "N/A");
+ he_gi_str[status->he_gi] : "N/A");
break;
}
seq_printf(m, " BW:%u", rtw89_rate_info_bw_to_mhz(status->bw));
diff --git a/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c b/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c
index 259df67836a0..a2fa1d339bc2 100644
--- a/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c
+++ b/drivers/net/wireless/realtek/rtw89/rtw8852b_rfk.c
@@ -20,7 +20,7 @@
#define RTW8852B_RF_REL_VERSION 34
#define RTW8852B_DPK_VER 0x0d
#define RTW8852B_DPK_RF_PATH 2
-#define RTW8852B_DPK_KIP_REG_NUM 2
+#define RTW8852B_DPK_KIP_REG_NUM 3
#define _TSSI_DE_MASK GENMASK(21, 12)
#define ADDC_T_AVG 100
diff --git a/drivers/net/wireless/virtual/virt_wifi.c b/drivers/net/wireless/virtual/virt_wifi.c
index ba14d83353a4..fb4d95a027fe 100644
--- a/drivers/net/wireless/virtual/virt_wifi.c
+++ b/drivers/net/wireless/virtual/virt_wifi.c
@@ -136,6 +136,9 @@ static struct ieee80211_supported_band band_5ghz = {
/* Assigned at module init. Guaranteed locally-administered and unicast. */
static u8 fake_router_bssid[ETH_ALEN] __ro_after_init = {};
+#define VIRT_WIFI_SSID "VirtWifi"
+#define VIRT_WIFI_SSID_LEN 8
+
static void virt_wifi_inform_bss(struct wiphy *wiphy)
{
u64 tsf = div_u64(ktime_get_boottime_ns(), 1000);
@@ -146,8 +149,8 @@ static void virt_wifi_inform_bss(struct wiphy *wiphy)
u8 ssid[8];
} __packed ssid = {
.tag = WLAN_EID_SSID,
- .len = 8,
- .ssid = "VirtWifi",
+ .len = VIRT_WIFI_SSID_LEN,
+ .ssid = VIRT_WIFI_SSID,
};
informed_bss = cfg80211_inform_bss(wiphy, &channel_5ghz,
@@ -213,6 +216,8 @@ struct virt_wifi_netdev_priv {
struct net_device *upperdev;
u32 tx_packets;
u32 tx_failed;
+ u32 connect_requested_ssid_len;
+ u8 connect_requested_ssid[IEEE80211_MAX_SSID_LEN];
u8 connect_requested_bss[ETH_ALEN];
bool is_up;
bool is_connected;
@@ -229,6 +234,12 @@ static int virt_wifi_connect(struct wiphy *wiphy, struct net_device *netdev,
if (priv->being_deleted || !priv->is_up)
return -EBUSY;
+ if (!sme->ssid)
+ return -EINVAL;
+
+ priv->connect_requested_ssid_len = sme->ssid_len;
+ memcpy(priv->connect_requested_ssid, sme->ssid, sme->ssid_len);
+
could_schedule = schedule_delayed_work(&priv->connect, HZ * 2);
if (!could_schedule)
return -EBUSY;
@@ -252,12 +263,15 @@ static void virt_wifi_connect_complete(struct work_struct *work)
container_of(work, struct virt_wifi_netdev_priv, connect.work);
u8 *requested_bss = priv->connect_requested_bss;
bool right_addr = ether_addr_equal(requested_bss, fake_router_bssid);
+ bool right_ssid = priv->connect_requested_ssid_len == VIRT_WIFI_SSID_LEN &&
+ !memcmp(priv->connect_requested_ssid, VIRT_WIFI_SSID,
+ priv->connect_requested_ssid_len);
u16 status = WLAN_STATUS_SUCCESS;
if (is_zero_ether_addr(requested_bss))
requested_bss = NULL;
- if (!priv->is_up || (requested_bss && !right_addr))
+ if (!priv->is_up || (requested_bss && !right_addr) || !right_ssid)
status = WLAN_STATUS_UNSPECIFIED_FAILURE;
else
priv->is_connected = true;
diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c
index 710fd4d86252..796c2a00fea4 100644
--- a/drivers/nvme/host/pci.c
+++ b/drivers/nvme/host/pci.c
@@ -863,7 +863,8 @@ static blk_status_t nvme_prep_rq(struct nvme_dev *dev, struct request *req)
nvme_start_request(req);
return BLK_STS_OK;
out_unmap_data:
- nvme_unmap_data(dev, req);
+ if (blk_rq_nr_phys_segments(req))
+ nvme_unmap_data(dev, req);
out_free_cmd:
nvme_cleanup_cmd(req);
return ret;
@@ -1275,7 +1276,7 @@ static void nvme_warn_reset(struct nvme_dev *dev, u32 csts)
dev_warn(dev->ctrl.device,
"Does your device have a faulty power saving mode enabled?\n");
dev_warn(dev->ctrl.device,
- "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off\" and report a bug\n");
+ "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off pcie_port_pm=off\" and report a bug\n");
}
static enum blk_eh_timer_return nvme_timeout(struct request *req)
diff --git a/drivers/nvme/target/auth.c b/drivers/nvme/target/auth.c
index e900525b7866..aacc05ec00c2 100644
--- a/drivers/nvme/target/auth.c
+++ b/drivers/nvme/target/auth.c
@@ -314,7 +314,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
req->sq->dhchap_c1,
challenge, shash_len);
if (ret)
- goto out_free_response;
+ goto out_free_challenge;
}
pr_debug("ctrl %d qid %d host response seq %u transaction %d\n",
@@ -325,7 +325,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
GFP_KERNEL);
if (!shash) {
ret = -ENOMEM;
- goto out_free_response;
+ goto out_free_challenge;
}
shash->tfm = shash_tfm;
ret = crypto_shash_init(shash);
@@ -361,9 +361,10 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
goto out;
ret = crypto_shash_final(shash, response);
out:
+ kfree(shash);
+out_free_challenge:
if (challenge != req->sq->dhchap_c1)
kfree(challenge);
- kfree(shash);
out_free_response:
kfree_sensitive(host_response);
out_free_tfm:
@@ -426,14 +427,14 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
req->sq->dhchap_c2,
challenge, shash_len);
if (ret)
- goto out_free_response;
+ goto out_free_challenge;
}
shash = kzalloc(sizeof(*shash) + crypto_shash_descsize(shash_tfm),
GFP_KERNEL);
if (!shash) {
ret = -ENOMEM;
- goto out_free_response;
+ goto out_free_challenge;
}
shash->tfm = shash_tfm;
@@ -470,9 +471,10 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
goto out;
ret = crypto_shash_final(shash, response);
out:
+ kfree(shash);
+out_free_challenge:
if (challenge != req->sq->dhchap_c2)
kfree(challenge);
- kfree(shash);
out_free_response:
kfree_sensitive(ctrl_response);
out_free_tfm:
diff --git a/drivers/nvmem/rockchip-otp.c b/drivers/nvmem/rockchip-otp.c
index cb9aa5428350..7107d68a2f8c 100644
--- a/drivers/nvmem/rockchip-otp.c
+++ b/drivers/nvmem/rockchip-otp.c
@@ -255,6 +255,7 @@ static int rockchip_otp_read(void *context, unsigned int offset,
static struct nvmem_config otp_config = {
.name = "rockchip-otp",
.owner = THIS_MODULE,
+ .add_legacy_fixed_of_cells = true,
.read_only = true,
.stride = 1,
.word_size = 1,
diff --git a/drivers/opp/ti-opp-supply.c b/drivers/opp/ti-opp-supply.c
index 8f3f13fbbb25..a8a696d2e03a 100644
--- a/drivers/opp/ti-opp-supply.c
+++ b/drivers/opp/ti-opp-supply.c
@@ -400,10 +400,12 @@ static int ti_opp_supply_probe(struct platform_device *pdev)
}
ret = dev_pm_opp_set_config_regulators(cpu_dev, ti_opp_config_regulators);
- if (ret < 0)
+ if (ret < 0) {
_free_optimized_voltages(dev, &opp_data);
+ return ret;
+ }
- return ret;
+ return 0;
}
static struct platform_driver ti_opp_supply_driver = {
diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c
index 4e5b972c3e26..c334ef6e3b3f 100644
--- a/drivers/parport/procfs.c
+++ b/drivers/parport/procfs.c
@@ -58,12 +58,12 @@ static int do_active_device(struct ctl_table *table, int write,
for (dev = port->devices; dev ; dev = dev->next) {
if(dev == port->cad) {
- len += sprintf(buffer, "%s\n", dev->name);
+ len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name);
}
}
if(!len) {
- len += sprintf(buffer, "%s\n", "none");
+ len += snprintf(buffer, sizeof(buffer), "%s\n", "none");
}
if (len > *lenp)
@@ -94,19 +94,19 @@ static int do_autoprobe(struct ctl_table *table, int write,
}
if ((str = info->class_name) != NULL)
- len += sprintf (buffer + len, "CLASS:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str);
if ((str = info->model) != NULL)
- len += sprintf (buffer + len, "MODEL:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str);
if ((str = info->mfr) != NULL)
- len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str);
if ((str = info->description) != NULL)
- len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str);
if ((str = info->cmdset) != NULL)
- len += sprintf (buffer + len, "COMMAND SET:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str);
if (len > *lenp)
len = *lenp;
@@ -124,7 +124,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
void *result, size_t *lenp, loff_t *ppos)
{
struct parport *port = (struct parport *)table->extra1;
- char buffer[20];
+ char buffer[64];
int len = 0;
if (*ppos) {
@@ -135,7 +135,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
if (write) /* permissions prevent this anyway */
return -EACCES;
- len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi);
+ len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi);
if (len > *lenp)
len = *lenp;
@@ -162,7 +162,7 @@ static int do_hardware_irq(struct ctl_table *table, int write,
if (write) /* permissions prevent this anyway */
return -EACCES;
- len += sprintf (buffer, "%d\n", port->irq);
+ len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq);
if (len > *lenp)
len = *lenp;
@@ -189,7 +189,7 @@ static int do_hardware_dma(struct ctl_table *table, int write,
if (write) /* permissions prevent this anyway */
return -EACCES;
- len += sprintf (buffer, "%d\n", port->dma);
+ len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma);
if (len > *lenp)
len = *lenp;
@@ -220,7 +220,7 @@ static int do_hardware_modes(struct ctl_table *table, int write,
#define printmode(x) \
do { \
if (port->modes & PARPORT_MODE_##x) \
- len += sprintf(buffer + len, "%s%s", f++ ? "," : "", #x); \
+ len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \
} while (0)
int f = 0;
printmode(PCSPP);
diff --git a/drivers/pci/controller/dwc/pci-keystone.c b/drivers/pci/controller/dwc/pci-keystone.c
index cf3836561316..54a3c7f29f78 100644
--- a/drivers/pci/controller/dwc/pci-keystone.c
+++ b/drivers/pci/controller/dwc/pci-keystone.c
@@ -246,8 +246,68 @@ static struct irq_chip ks_pcie_msi_irq_chip = {
.irq_unmask = ks_pcie_msi_unmask,
};
+/**
+ * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ * PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+ u32 val;
+
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ val |= DBI_CS2;
+ ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+ do {
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ } while (!(val & DBI_CS2));
+}
+
+/**
+ * ks_pcie_clear_dbi_mode() - Disable DBI mode
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ * PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+ u32 val;
+
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ val &= ~DBI_CS2;
+ ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+ do {
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ } while (val & DBI_CS2);
+}
+
static int ks_pcie_msi_host_init(struct dw_pcie_rp *pp)
{
+ struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
+ struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
+
+ /* Configure and set up BAR0 */
+ ks_pcie_set_dbi_mode(ks_pcie);
+
+ /* Enable BAR0 */
+ dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
+ dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
+
+ ks_pcie_clear_dbi_mode(ks_pcie);
+
+ /*
+ * For BAR0, just setting bus address for inbound writes (MSI) should
+ * be sufficient. Use physical address to avoid any conflicts.
+ */
+ dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
+
pp->msi_irq_chip = &ks_pcie_msi_irq_chip;
return dw_pcie_allocate_domains(pp);
}
@@ -342,59 +402,22 @@ static const struct irq_domain_ops ks_pcie_legacy_irq_domain_ops = {
.xlate = irq_domain_xlate_onetwocell,
};
-/**
- * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- * PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
-{
- u32 val;
-
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- val |= DBI_CS2;
- ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
- do {
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- } while (!(val & DBI_CS2));
-}
-
-/**
- * ks_pcie_clear_dbi_mode() - Disable DBI mode
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- * PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
-{
- u32 val;
-
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- val &= ~DBI_CS2;
- ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
- do {
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- } while (val & DBI_CS2);
-}
-
-static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
+static int ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
{
u32 val;
u32 num_viewport = ks_pcie->num_viewport;
struct dw_pcie *pci = ks_pcie->pci;
struct dw_pcie_rp *pp = &pci->pp;
- u64 start, end;
+ struct resource_entry *entry;
struct resource *mem;
+ u64 start, end;
int i;
- mem = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM)->res;
+ entry = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM);
+ if (!entry)
+ return -ENODEV;
+
+ mem = entry->res;
start = mem->start;
end = mem->end;
@@ -405,7 +428,7 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
ks_pcie_clear_dbi_mode(ks_pcie);
if (ks_pcie->is_am6)
- return;
+ return 0;
val = ilog2(OB_WIN_SIZE);
ks_pcie_app_writel(ks_pcie, OB_SIZE, val);
@@ -422,6 +445,8 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
val |= OB_XLAT_EN_VAL;
ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+ return 0;
}
static void __iomem *ks_pcie_other_map_bus(struct pci_bus *bus,
@@ -447,44 +472,10 @@ static struct pci_ops ks_child_pcie_ops = {
.write = pci_generic_config_write,
};
-/**
- * ks_pcie_v3_65_add_bus() - keystone add_bus post initialization
- * @bus: A pointer to the PCI bus structure.
- *
- * This sets BAR0 to enable inbound access for MSI_IRQ register
- */
-static int ks_pcie_v3_65_add_bus(struct pci_bus *bus)
-{
- struct dw_pcie_rp *pp = bus->sysdata;
- struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
- struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
-
- if (!pci_is_root_bus(bus))
- return 0;
-
- /* Configure and set up BAR0 */
- ks_pcie_set_dbi_mode(ks_pcie);
-
- /* Enable BAR0 */
- dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
- dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
-
- ks_pcie_clear_dbi_mode(ks_pcie);
-
- /*
- * For BAR0, just setting bus address for inbound writes (MSI) should
- * be sufficient. Use physical address to avoid any conflicts.
- */
- dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
-
- return 0;
-}
-
static struct pci_ops ks_pcie_ops = {
.map_bus = dw_pcie_own_conf_map_bus,
.read = pci_generic_config_read,
.write = pci_generic_config_write,
- .add_bus = ks_pcie_v3_65_add_bus,
};
/**
@@ -817,7 +808,10 @@ static int __init ks_pcie_host_init(struct dw_pcie_rp *pp)
return ret;
ks_pcie_stop_link(pci);
- ks_pcie_setup_rc_app_regs(ks_pcie);
+ ret = ks_pcie_setup_rc_app_regs(ks_pcie);
+ if (ret)
+ return ret;
+
writew(PCI_IO_RANGE_TYPE_32 | (PCI_IO_RANGE_TYPE_32 << 8),
pci->dbi_base + PCI_IO_BASE);
diff --git a/drivers/pci/controller/dwc/pcie-designware-ep.c b/drivers/pci/controller/dwc/pcie-designware-ep.c
index ad6516a3ae6e..f2e5feba5526 100644
--- a/drivers/pci/controller/dwc/pcie-designware-ep.c
+++ b/drivers/pci/controller/dwc/pcie-designware-ep.c
@@ -163,7 +163,7 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
if (!ep->bar_to_atu[bar])
free_win = find_first_zero_bit(ep->ib_window_map, pci->num_ib_windows);
else
- free_win = ep->bar_to_atu[bar];
+ free_win = ep->bar_to_atu[bar] - 1;
if (free_win >= pci->num_ib_windows) {
dev_err(pci->dev, "No free inbound window\n");
@@ -177,7 +177,11 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
return ret;
}
- ep->bar_to_atu[bar] = free_win;
+ /*
+ * Always increment free_win before assignment, since value 0 is used to identify
+ * unallocated mapping.
+ */
+ ep->bar_to_atu[bar] = free_win + 1;
set_bit(free_win, ep->ib_window_map);
return 0;
@@ -214,7 +218,10 @@ static void dw_pcie_ep_clear_bar(struct pci_epc *epc, u8 func_no, u8 vfunc_no,
struct dw_pcie_ep *ep = epc_get_drvdata(epc);
struct dw_pcie *pci = to_dw_pcie_from_ep(ep);
enum pci_barno bar = epf_bar->barno;
- u32 atu_index = ep->bar_to_atu[bar];
+ u32 atu_index = ep->bar_to_atu[bar] - 1;
+
+ if (!ep->bar_to_atu[bar])
+ return;
__dw_pcie_ep_reset_bar(pci, func_no, bar, epf_bar->flags);
diff --git a/drivers/pci/controller/dwc/pcie-dw-rockchip.c b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
index 2fe42c70097f..9b1256da096c 100644
--- a/drivers/pci/controller/dwc/pcie-dw-rockchip.c
+++ b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
@@ -240,7 +240,7 @@ static int rockchip_pcie_resource_get(struct platform_device *pdev,
return PTR_ERR(rockchip->apb_base);
rockchip->rst_gpio = devm_gpiod_get_optional(&pdev->dev, "reset",
- GPIOD_OUT_HIGH);
+ GPIOD_OUT_LOW);
if (IS_ERR(rockchip->rst_gpio))
return PTR_ERR(rockchip->rst_gpio);
diff --git a/drivers/pci/controller/dwc/pcie-qcom-ep.c b/drivers/pci/controller/dwc/pcie-qcom-ep.c
index 9b62ee6992f0..66e080c99d5d 100644
--- a/drivers/pci/controller/dwc/pcie-qcom-ep.c
+++ b/drivers/pci/controller/dwc/pcie-qcom-ep.c
@@ -519,12 +519,6 @@ static int qcom_pcie_perst_deassert(struct dw_pcie *pci)
static void qcom_pcie_perst_assert(struct dw_pcie *pci)
{
struct qcom_pcie_ep *pcie_ep = to_pcie_ep(pci);
- struct device *dev = pci->dev;
-
- if (pcie_ep->link_status == QCOM_PCIE_EP_LINK_DISABLED) {
- dev_dbg(dev, "Link is already disabled\n");
- return;
- }
qcom_pcie_disable_resources(pcie_ep);
pcie_ep->link_status = QCOM_PCIE_EP_LINK_DISABLED;
diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c
index 5ab1a035c496..4c34909810d8 100644
--- a/drivers/pci/controller/pci-hyperv.c
+++ b/drivers/pci/controller/pci-hyperv.c
@@ -1137,8 +1137,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where,
PCI_CAPABILITY_LIST) {
/* ROM BARs are unimplemented */
*val = 0;
- } else if (where >= PCI_INTERRUPT_LINE && where + size <=
- PCI_INTERRUPT_PIN) {
+ } else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) ||
+ (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) {
/*
* Interrupt Line and Interrupt PIN are hard-wired to zero
* because this front-end only supports message-signaled
diff --git a/drivers/pci/controller/pci-loongson.c b/drivers/pci/controller/pci-loongson.c
index 8b34ccff073a..bc630ab8a283 100644
--- a/drivers/pci/controller/pci-loongson.c
+++ b/drivers/pci/controller/pci-loongson.c
@@ -163,6 +163,19 @@ DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
DEV_LS7A_HDMI, loongson_pci_pin_quirk);
+static void loongson_pci_msi_quirk(struct pci_dev *dev)
+{
+ u16 val, class = dev->class >> 8;
+
+ if (class != PCI_CLASS_BRIDGE_HOST)
+ return;
+
+ pci_read_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, &val);
+ val |= PCI_MSI_FLAGS_ENABLE;
+ pci_write_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, val);
+}
+DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON, DEV_LS7A_PCIE_PORT5, loongson_pci_msi_quirk);
+
static struct loongson_pci *pci_bus_to_loongson_pci(struct pci_bus *bus)
{
struct pci_config_window *cfg;
diff --git a/drivers/pci/controller/pcie-rcar-host.c b/drivers/pci/controller/pcie-rcar-host.c
index 88975e40ee2f..704ab5d723a9 100644
--- a/drivers/pci/controller/pcie-rcar-host.c
+++ b/drivers/pci/controller/pcie-rcar-host.c
@@ -77,7 +77,11 @@ static int rcar_pcie_wakeup(struct device *pcie_dev, void __iomem *pcie_base)
writel(L1IATN, pcie_base + PMCTLR);
ret = readl_poll_timeout_atomic(pcie_base + PMSR, val,
val & L1FAEG, 10, 1000);
- WARN(ret, "Timeout waiting for L1 link state, ret=%d\n", ret);
+ if (ret) {
+ dev_warn_ratelimited(pcie_dev,
+ "Timeout waiting for L1 link state, ret=%d\n",
+ ret);
+ }
writel(L1FAEG | PMEL1RX, pcie_base + PMSR);
}
diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c
index 0ef2e622d36e..c07d7129f1c7 100644
--- a/drivers/pci/controller/pcie-rockchip.c
+++ b/drivers/pci/controller/pcie-rockchip.c
@@ -121,7 +121,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip)
if (rockchip->is_rc) {
rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep",
- GPIOD_OUT_HIGH);
+ GPIOD_OUT_LOW);
if (IS_ERR(rockchip->ep_gpio))
return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio),
"failed to get ep GPIO\n");
diff --git a/drivers/pci/endpoint/functions/pci-epf-vntb.c b/drivers/pci/endpoint/functions/pci-epf-vntb.c
index 2b7bc5a731dd..3368f483f818 100644
--- a/drivers/pci/endpoint/functions/pci-epf-vntb.c
+++ b/drivers/pci/endpoint/functions/pci-epf-vntb.c
@@ -810,8 +810,9 @@ static int epf_ntb_epc_init(struct epf_ntb *ntb)
*/
static void epf_ntb_epc_cleanup(struct epf_ntb *ntb)
{
- epf_ntb_db_bar_clear(ntb);
epf_ntb_mw_bar_clear(ntb, ntb->num_mws);
+ epf_ntb_db_bar_clear(ntb);
+ epf_ntb_config_sspad_bar_clear(ntb);
}
#define EPF_NTB_R(_name) \
@@ -1029,8 +1030,10 @@ static int vpci_scan_bus(void *sysdata)
struct epf_ntb *ndev = sysdata;
vpci_bus = pci_scan_bus(ndev->vbus_number, &vpci_ops, sysdata);
- if (vpci_bus)
- pr_err("create pci bus\n");
+ if (!vpci_bus) {
+ pr_err("create pci bus failed\n");
+ return -EINVAL;
+ }
pci_bus_add_devices(vpci_bus);
@@ -1349,13 +1352,19 @@ static int epf_ntb_bind(struct pci_epf *epf)
ret = pci_register_driver(&vntb_pci_driver);
if (ret) {
dev_err(dev, "failure register vntb pci driver\n");
- goto err_bar_alloc;
+ goto err_epc_cleanup;
}
- vpci_scan_bus(ntb);
+ ret = vpci_scan_bus(ntb);
+ if (ret)
+ goto err_unregister;
return 0;
+err_unregister:
+ pci_unregister_driver(&vntb_pci_driver);
+err_epc_cleanup:
+ epf_ntb_epc_cleanup(ntb);
err_bar_alloc:
epf_ntb_config_spad_bar_free(ntb);
diff --git a/drivers/pci/pci.c b/drivers/pci/pci.c
index cd759e19cc18..a0f961a380fa 100644
--- a/drivers/pci/pci.c
+++ b/drivers/pci/pci.c
@@ -5123,7 +5123,7 @@ static int pci_bus_max_d3cold_delay(const struct pci_bus *bus)
*/
int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type)
{
- struct pci_dev *child;
+ struct pci_dev *child __free(pci_dev_put) = NULL;
int delay;
if (pci_dev_is_disconnected(dev))
@@ -5152,8 +5152,8 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type)
return 0;
}
- child = list_first_entry(&dev->subordinate->devices, struct pci_dev,
- bus_list);
+ child = pci_dev_get(list_first_entry(&dev->subordinate->devices,
+ struct pci_dev, bus_list));
up_read(&pci_bus_sem);
/*
diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c
index dae490f25641..5a143ad5fca2 100644
--- a/drivers/pci/setup-bus.c
+++ b/drivers/pci/setup-bus.c
@@ -820,11 +820,9 @@ static resource_size_t calculate_memsize(resource_size_t size,
size = min_size;
if (old_size == 1)
old_size = 0;
- if (size < old_size)
- size = old_size;
- size = ALIGN(max(size, add_size) + children_add_size, align);
- return size;
+ size = max(size, add_size) + children_add_size;
+ return ALIGN(max(size, old_size), align);
}
resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus,
diff --git a/drivers/phy/cadence/phy-cadence-torrent.c b/drivers/phy/cadence/phy-cadence-torrent.c
index a75c96385c57..a23d7f9b7d10 100644
--- a/drivers/phy/cadence/phy-cadence-torrent.c
+++ b/drivers/phy/cadence/phy-cadence-torrent.c
@@ -1154,6 +1154,9 @@ static int cdns_torrent_dp_set_power_state(struct cdns_torrent_phy *cdns_phy,
ret = regmap_read_poll_timeout(regmap, PHY_PMA_XCVR_POWER_STATE_ACK,
read_val, (read_val & mask) == value, 0,
POLL_TIMEOUT_US);
+ if (ret)
+ return ret;
+
cdns_torrent_dp_write(regmap, PHY_PMA_XCVR_POWER_STATE_REQ, 0x00000000);
ndelay(100);
diff --git a/drivers/phy/xilinx/phy-zynqmp.c b/drivers/phy/xilinx/phy-zynqmp.c
index 2559c6594cea..0cb5088e460b 100644
--- a/drivers/phy/xilinx/phy-zynqmp.c
+++ b/drivers/phy/xilinx/phy-zynqmp.c
@@ -80,7 +80,8 @@
/* Reference clock selection parameters */
#define L0_Ln_REF_CLK_SEL(n) (0x2860 + (n) * 4)
-#define L0_REF_CLK_SEL_MASK 0x8f
+#define L0_REF_CLK_LCL_SEL BIT(7)
+#define L0_REF_CLK_SEL_MASK 0x9f
/* Calibration digital logic parameters */
#define L3_TM_CALIB_DIG19 0xec4c
@@ -349,11 +350,12 @@ static void xpsgtr_configure_pll(struct xpsgtr_phy *gtr_phy)
PLL_FREQ_MASK, ssc->pll_ref_clk);
/* Enable lane clock sharing, if required */
- if (gtr_phy->refclk != gtr_phy->lane) {
- /* Lane3 Ref Clock Selection Register */
+ if (gtr_phy->refclk == gtr_phy->lane)
+ xpsgtr_clr_set(gtr_phy->dev, L0_Ln_REF_CLK_SEL(gtr_phy->lane),
+ L0_REF_CLK_SEL_MASK, L0_REF_CLK_LCL_SEL);
+ else
xpsgtr_clr_set(gtr_phy->dev, L0_Ln_REF_CLK_SEL(gtr_phy->lane),
L0_REF_CLK_SEL_MASK, 1 << gtr_phy->refclk);
- }
/* SSC step size [7:0] */
xpsgtr_clr_set_phy(gtr_phy, L0_PLL_SS_STEP_SIZE_0_LSB,
@@ -573,7 +575,7 @@ static int xpsgtr_phy_init(struct phy *phy)
mutex_lock(>r_dev->gtr_mutex);
/* Configure and enable the clock when peripheral phy_init call */
- if (clk_prepare_enable(gtr_dev->clk[gtr_phy->lane]))
+ if (clk_prepare_enable(gtr_dev->clk[gtr_phy->refclk]))
goto out;
/* Skip initialization if not required. */
@@ -625,7 +627,7 @@ static int xpsgtr_phy_exit(struct phy *phy)
gtr_phy->skip_phy_init = false;
/* Ensure that disable clock only, which configure for lane */
- clk_disable_unprepare(gtr_dev->clk[gtr_phy->lane]);
+ clk_disable_unprepare(gtr_dev->clk[gtr_phy->refclk]);
return 0;
}
diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c
index e19ee66e027b..88ee086e1376 100644
--- a/drivers/pinctrl/core.c
+++ b/drivers/pinctrl/core.c
@@ -2072,6 +2072,14 @@ pinctrl_init_controller(struct pinctrl_desc *pctldesc, struct device *dev,
return ERR_PTR(ret);
}
+static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc)
+{
+ pinctrl_free_pindescs(pctldev, pctldesc->pins,
+ pctldesc->npins);
+ mutex_destroy(&pctldev->mutex);
+ kfree(pctldev);
+}
+
static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev)
{
pctldev->p = create_pinctrl(pctldev->dev, pctldev);
@@ -2152,8 +2160,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc,
return pctldev;
error = pinctrl_enable(pctldev);
- if (error)
+ if (error) {
+ pinctrl_uninit_controller(pctldev, pctldesc);
return ERR_PTR(error);
+ }
return pctldev;
}
diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c
index cf3f4d2e0c16..a53287aaa653 100644
--- a/drivers/pinctrl/freescale/pinctrl-mxs.c
+++ b/drivers/pinctrl/freescale/pinctrl-mxs.c
@@ -408,8 +408,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev,
int ret;
u32 val;
- child = of_get_next_child(np, NULL);
- if (!child) {
+ val = of_get_child_count(np);
+ if (val == 0) {
dev_err(&pdev->dev, "no group is defined\n");
return -ENOENT;
}
diff --git a/drivers/pinctrl/pinctrl-rockchip.c b/drivers/pinctrl/pinctrl-rockchip.c
index caf8d0a98c32..b02eaba010d1 100644
--- a/drivers/pinctrl/pinctrl-rockchip.c
+++ b/drivers/pinctrl/pinctrl-rockchip.c
@@ -915,9 +915,8 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
RK_MUXROUTE_SAME(0, RK_PC3, 1, 0x314, BIT(16 + 0) | BIT(0)), /* rtc_clk */
RK_MUXROUTE_SAME(1, RK_PC6, 2, 0x314, BIT(16 + 2) | BIT(16 + 3)), /* uart2_rxm0 */
RK_MUXROUTE_SAME(4, RK_PD2, 2, 0x314, BIT(16 + 2) | BIT(16 + 3) | BIT(2)), /* uart2_rxm1 */
- RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x608, BIT(16 + 8) | BIT(16 + 9)), /* i2c3_sdam0 */
- RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(8)), /* i2c3_sdam1 */
- RK_MUXROUTE_SAME(2, RK_PA0, 3, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(9)), /* i2c3_sdam2 */
+ RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x314, BIT(16 + 4)), /* i2c3_sdam0 */
+ RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x314, BIT(16 + 4) | BIT(4)), /* i2c3_sdam1 */
RK_MUXROUTE_SAME(1, RK_PA3, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclktxm0 */
RK_MUXROUTE_SAME(1, RK_PA4, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclkrxm0 */
RK_MUXROUTE_SAME(1, RK_PB5, 2, 0x308, BIT(16 + 3) | BIT(3)), /* i2s-8ch-1-sclktxm1 */
@@ -926,18 +925,6 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
RK_MUXROUTE_SAME(1, RK_PB6, 4, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* pdm-clkm1 */
RK_MUXROUTE_SAME(2, RK_PA6, 2, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* pdm-clkm2 */
RK_MUXROUTE_SAME(2, RK_PA4, 3, 0x600, BIT(16 + 2) | BIT(2)), /* pdm-clkm-m2 */
- RK_MUXROUTE_SAME(3, RK_PB2, 3, 0x314, BIT(16 + 9)), /* spi1_miso */
- RK_MUXROUTE_SAME(2, RK_PA4, 2, 0x314, BIT(16 + 9) | BIT(9)), /* spi1_miso_m1 */
- RK_MUXROUTE_SAME(0, RK_PB3, 3, 0x314, BIT(16 + 10) | BIT(16 + 11)), /* owire_m0 */
- RK_MUXROUTE_SAME(1, RK_PC6, 7, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(10)), /* owire_m1 */
- RK_MUXROUTE_SAME(2, RK_PA2, 5, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(11)), /* owire_m2 */
- RK_MUXROUTE_SAME(0, RK_PB3, 2, 0x314, BIT(16 + 12) | BIT(16 + 13)), /* can_rxd_m0 */
- RK_MUXROUTE_SAME(1, RK_PC6, 5, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* can_rxd_m1 */
- RK_MUXROUTE_SAME(2, RK_PA2, 4, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* can_rxd_m2 */
- RK_MUXROUTE_SAME(1, RK_PC4, 3, 0x314, BIT(16 + 14)), /* mac_rxd0_m0 */
- RK_MUXROUTE_SAME(4, RK_PA2, 2, 0x314, BIT(16 + 14) | BIT(14)), /* mac_rxd0_m1 */
- RK_MUXROUTE_SAME(3, RK_PB4, 4, 0x314, BIT(16 + 15)), /* uart3_rx */
- RK_MUXROUTE_SAME(0, RK_PC1, 3, 0x314, BIT(16 + 15) | BIT(15)), /* uart3_rx_m1 */
};
static struct rockchip_mux_route_data rk3328_mux_route_data[] = {
diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c
index 461a7c02d4a3..17e08f21756c 100644
--- a/drivers/pinctrl/pinctrl-single.c
+++ b/drivers/pinctrl/pinctrl-single.c
@@ -1327,7 +1327,6 @@ static void pcs_irq_free(struct pcs_device *pcs)
static void pcs_free_resources(struct pcs_device *pcs)
{
pcs_irq_free(pcs);
- pinctrl_unregister(pcs->pctl);
#if IS_BUILTIN(CONFIG_PINCTRL_SINGLE)
if (pcs->missing_nr_pinctrl_cells)
@@ -1884,7 +1883,7 @@ static int pcs_probe(struct platform_device *pdev)
if (ret < 0)
goto free;
- ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl);
+ ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl);
if (ret) {
dev_err(pcs->dev, "could not register single pinctrl driver\n");
goto free;
@@ -1917,8 +1916,10 @@ static int pcs_probe(struct platform_device *pdev)
dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size);
- return pinctrl_enable(pcs->pctl);
+ if (pinctrl_enable(pcs->pctl))
+ goto free;
+ return 0;
free:
pcs_free_resources(pcs);
diff --git a/drivers/pinctrl/renesas/pfc-r8a779g0.c b/drivers/pinctrl/renesas/pfc-r8a779g0.c
index d2de526a3b58..bb843e333c88 100644
--- a/drivers/pinctrl/renesas/pfc-r8a779g0.c
+++ b/drivers/pinctrl/renesas/pfc-r8a779g0.c
@@ -68,20 +68,20 @@
#define GPSR0_9 F_(MSIOF5_SYNC, IP1SR0_7_4)
#define GPSR0_8 F_(MSIOF5_SS1, IP1SR0_3_0)
#define GPSR0_7 F_(MSIOF5_SS2, IP0SR0_31_28)
-#define GPSR0_6 F_(IRQ0, IP0SR0_27_24)
-#define GPSR0_5 F_(IRQ1, IP0SR0_23_20)
-#define GPSR0_4 F_(IRQ2, IP0SR0_19_16)
-#define GPSR0_3 F_(IRQ3, IP0SR0_15_12)
+#define GPSR0_6 F_(IRQ0_A, IP0SR0_27_24)
+#define GPSR0_5 F_(IRQ1_A, IP0SR0_23_20)
+#define GPSR0_4 F_(IRQ2_A, IP0SR0_19_16)
+#define GPSR0_3 F_(IRQ3_A, IP0SR0_15_12)
#define GPSR0_2 F_(GP0_02, IP0SR0_11_8)
#define GPSR0_1 F_(GP0_01, IP0SR0_7_4)
#define GPSR0_0 F_(GP0_00, IP0SR0_3_0)
/* GPSR1 */
-#define GPSR1_28 F_(HTX3, IP3SR1_19_16)
-#define GPSR1_27 F_(HCTS3_N, IP3SR1_15_12)
-#define GPSR1_26 F_(HRTS3_N, IP3SR1_11_8)
-#define GPSR1_25 F_(HSCK3, IP3SR1_7_4)
-#define GPSR1_24 F_(HRX3, IP3SR1_3_0)
+#define GPSR1_28 F_(HTX3_A, IP3SR1_19_16)
+#define GPSR1_27 F_(HCTS3_N_A, IP3SR1_15_12)
+#define GPSR1_26 F_(HRTS3_N_A, IP3SR1_11_8)
+#define GPSR1_25 F_(HSCK3_A, IP3SR1_7_4)
+#define GPSR1_24 F_(HRX3_A, IP3SR1_3_0)
#define GPSR1_23 F_(GP1_23, IP2SR1_31_28)
#define GPSR1_22 F_(AUDIO_CLKIN, IP2SR1_27_24)
#define GPSR1_21 F_(AUDIO_CLKOUT, IP2SR1_23_20)
@@ -119,14 +119,14 @@
#define GPSR2_11 F_(CANFD0_RX, IP1SR2_15_12)
#define GPSR2_10 F_(CANFD0_TX, IP1SR2_11_8)
#define GPSR2_9 F_(CAN_CLK, IP1SR2_7_4)
-#define GPSR2_8 F_(TPU0TO0, IP1SR2_3_0)
-#define GPSR2_7 F_(TPU0TO1, IP0SR2_31_28)
+#define GPSR2_8 F_(TPU0TO0_A, IP1SR2_3_0)
+#define GPSR2_7 F_(TPU0TO1_A, IP0SR2_31_28)
#define GPSR2_6 F_(FXR_TXDB, IP0SR2_27_24)
-#define GPSR2_5 F_(FXR_TXENB_N, IP0SR2_23_20)
+#define GPSR2_5 F_(FXR_TXENB_N_A, IP0SR2_23_20)
#define GPSR2_4 F_(RXDB_EXTFXR, IP0SR2_19_16)
#define GPSR2_3 F_(CLK_EXTFXR, IP0SR2_15_12)
#define GPSR2_2 F_(RXDA_EXTFXR, IP0SR2_11_8)
-#define GPSR2_1 F_(FXR_TXENA_N, IP0SR2_7_4)
+#define GPSR2_1 F_(FXR_TXENA_N_A, IP0SR2_7_4)
#define GPSR2_0 F_(FXR_TXDA, IP0SR2_3_0)
/* GPSR3 */
@@ -275,13 +275,13 @@
/* SR0 */
/* IP0SR0 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP0SR0_3_0 F_(0, 0) FM(ERROROUTC_N_B) FM(TCLK2_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_3_0 F_(0, 0) FM(ERROROUTC_N_B) FM(TCLK2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR0_7_4 F_(0, 0) FM(MSIOF3_SS1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR0_11_8 F_(0, 0) FM(MSIOF3_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_15_12 FM(IRQ3) FM(MSIOF3_SCK) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_19_16 FM(IRQ2) FM(MSIOF3_TXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_23_20 FM(IRQ1) FM(MSIOF3_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_27_24 FM(IRQ0) FM(MSIOF3_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_15_12 FM(IRQ3_A) FM(MSIOF3_SCK) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_19_16 FM(IRQ2_A) FM(MSIOF3_TXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_23_20 FM(IRQ1_A) FM(MSIOF3_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_27_24 FM(IRQ0_A) FM(MSIOF3_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR0_31_28 FM(MSIOF5_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP1SR0 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
@@ -290,72 +290,72 @@
#define IP1SR0_11_8 FM(MSIOF5_TXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR0_15_12 FM(MSIOF5_SCK) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR0_19_16 FM(MSIOF5_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_23_20 FM(MSIOF2_SS2) FM(TCLK1) FM(IRQ2_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_27_24 FM(MSIOF2_SS1) FM(HTX1) FM(TX1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_31_28 FM(MSIOF2_SYNC) FM(HRX1) FM(RX1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_23_20 FM(MSIOF2_SS2) FM(TCLK1_A) FM(IRQ2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_27_24 FM(MSIOF2_SS1) FM(HTX1_A) FM(TX1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_31_28 FM(MSIOF2_SYNC) FM(HRX1_A) FM(RX1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR0 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP2SR0_3_0 FM(MSIOF2_TXD) FM(HCTS1_N) FM(CTS1_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_7_4 FM(MSIOF2_SCK) FM(HRTS1_N) FM(RTS1_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_11_8 FM(MSIOF2_RXD) FM(HSCK1) FM(SCK1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_3_0 FM(MSIOF2_TXD) FM(HCTS1_N_A) FM(CTS1_N_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_7_4 FM(MSIOF2_SCK) FM(HRTS1_N_A) FM(RTS1_N_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_11_8 FM(MSIOF2_RXD) FM(HSCK1_A) FM(SCK1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* SR1 */
/* IP0SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP0SR1_3_0 FM(MSIOF1_SS2) FM(HTX3_A) FM(TX3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_7_4 FM(MSIOF1_SS1) FM(HCTS3_N_A) FM(RX3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_11_8 FM(MSIOF1_SYNC) FM(HRTS3_N_A) FM(RTS3_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_15_12 FM(MSIOF1_SCK) FM(HSCK3_A) FM(CTS3_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_19_16 FM(MSIOF1_TXD) FM(HRX3_A) FM(SCK3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_3_0 FM(MSIOF1_SS2) FM(HTX3_B) FM(TX3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_7_4 FM(MSIOF1_SS1) FM(HCTS3_N_B) FM(RX3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_11_8 FM(MSIOF1_SYNC) FM(HRTS3_N_B) FM(RTS3_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_15_12 FM(MSIOF1_SCK) FM(HSCK3_B) FM(CTS3_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_19_16 FM(MSIOF1_TXD) FM(HRX3_B) FM(SCK3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR1_23_20 FM(MSIOF1_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_27_24 FM(MSIOF0_SS2) FM(HTX1_X) FM(TX1_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_31_28 FM(MSIOF0_SS1) FM(HRX1_X) FM(RX1_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_27_24 FM(MSIOF0_SS2) FM(HTX1_B) FM(TX1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_31_28 FM(MSIOF0_SS1) FM(HRX1_B) FM(RX1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP1SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP1SR1_3_0 FM(MSIOF0_SYNC) FM(HCTS1_N_X) FM(CTS1_N_X) FM(CANFD5_TX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_7_4 FM(MSIOF0_TXD) FM(HRTS1_N_X) FM(RTS1_N_X) FM(CANFD5_RX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_11_8 FM(MSIOF0_SCK) FM(HSCK1_X) FM(SCK1_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_3_0 FM(MSIOF0_SYNC) FM(HCTS1_N_B) FM(CTS1_N_B) FM(CANFD5_TX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_7_4 FM(MSIOF0_TXD) FM(HRTS1_N_B) FM(RTS1_N_B) FM(CANFD5_RX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_11_8 FM(MSIOF0_SCK) FM(HSCK1_B) FM(SCK1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR1_15_12 FM(MSIOF0_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR1_19_16 FM(HTX0) FM(TX0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_23_20 FM(HCTS0_N) FM(CTS0_N) FM(PWM8_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_27_24 FM(HRTS0_N) FM(RTS0_N) FM(PWM9_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_31_28 FM(HSCK0) FM(SCK0) FM(PWM0_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_23_20 FM(HCTS0_N) FM(CTS0_N) FM(PWM8) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_27_24 FM(HRTS0_N) FM(RTS0_N) FM(PWM9) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_31_28 FM(HSCK0) FM(SCK0) FM(PWM0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
#define IP2SR1_3_0 FM(HRX0) FM(RX0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP2SR1_7_4 FM(SCIF_CLK) FM(IRQ4_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_11_8 FM(SSI_SCK) FM(TCLK3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_15_12 FM(SSI_WS) FM(TCLK4) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_19_16 FM(SSI_SD) FM(IRQ0_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_23_20 FM(AUDIO_CLKOUT) FM(IRQ1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_11_8 FM(SSI_SCK) FM(TCLK3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_15_12 FM(SSI_WS) FM(TCLK4_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_19_16 FM(SSI_SD) FM(IRQ0_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_23_20 FM(AUDIO_CLKOUT) FM(IRQ1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP2SR1_27_24 FM(AUDIO_CLKIN) FM(PWM3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_31_28 F_(0, 0) FM(TCLK2) FM(MSIOF4_SS1) FM(IRQ3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_31_28 F_(0, 0) FM(TCLK2_A) FM(MSIOF4_SS1) FM(IRQ3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP3SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP3SR1_3_0 FM(HRX3) FM(SCK3_A) FM(MSIOF4_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_7_4 FM(HSCK3) FM(CTS3_N_A) FM(MSIOF4_SCK) FM(TPU0TO0_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_11_8 FM(HRTS3_N) FM(RTS3_N_A) FM(MSIOF4_TXD) FM(TPU0TO1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_15_12 FM(HCTS3_N) FM(RX3_A) FM(MSIOF4_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_19_16 FM(HTX3) FM(TX3_A) FM(MSIOF4_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_3_0 FM(HRX3_A) FM(SCK3_A) FM(MSIOF4_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_7_4 FM(HSCK3_A) FM(CTS3_N_A) FM(MSIOF4_SCK) FM(TPU0TO0_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_11_8 FM(HRTS3_N_A) FM(RTS3_N_A) FM(MSIOF4_TXD) FM(TPU0TO1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_15_12 FM(HCTS3_N_A) FM(RX3_A) FM(MSIOF4_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_19_16 FM(HTX3_A) FM(TX3_A) FM(MSIOF4_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* SR2 */
/* IP0SR2 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP0SR2_3_0 FM(FXR_TXDA) FM(CANFD1_TX) FM(TPU0TO2_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_7_4 FM(FXR_TXENA_N) FM(CANFD1_RX) FM(TPU0TO3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_11_8 FM(RXDA_EXTFXR) FM(CANFD5_TX) FM(IRQ5) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_15_12 FM(CLK_EXTFXR) FM(CANFD5_RX) FM(IRQ4_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_3_0 FM(FXR_TXDA) FM(CANFD1_TX) FM(TPU0TO2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_7_4 FM(FXR_TXENA_N_A) FM(CANFD1_RX) FM(TPU0TO3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_11_8 FM(RXDA_EXTFXR) FM(CANFD5_TX_A) FM(IRQ5) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_15_12 FM(CLK_EXTFXR) FM(CANFD5_RX_A) FM(IRQ4_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR2_19_16 FM(RXDB_EXTFXR) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_23_20 FM(FXR_TXENB_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_23_20 FM(FXR_TXENB_N_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR2_27_24 FM(FXR_TXDB) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_31_28 FM(TPU0TO1) FM(CANFD6_TX) F_(0, 0) FM(TCLK2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_31_28 FM(TPU0TO1_A) FM(CANFD6_TX) F_(0, 0) FM(TCLK2_C) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP1SR2 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP1SR2_3_0 FM(TPU0TO0) FM(CANFD6_RX) F_(0, 0) FM(TCLK1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_7_4 FM(CAN_CLK) FM(FXR_TXENA_N_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_11_8 FM(CANFD0_TX) FM(FXR_TXENB_N_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_3_0 FM(TPU0TO0_A) FM(CANFD6_RX) F_(0, 0) FM(TCLK1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_7_4 FM(CAN_CLK) FM(FXR_TXENA_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_11_8 FM(CANFD0_TX) FM(FXR_TXENB_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR2_15_12 FM(CANFD0_RX) FM(STPWT_EXTFXR) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_19_16 FM(CANFD2_TX) FM(TPU0TO2) F_(0, 0) FM(TCLK3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_23_20 FM(CANFD2_RX) FM(TPU0TO3) FM(PWM1_B) FM(TCLK4_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_27_24 FM(CANFD3_TX) F_(0, 0) FM(PWM2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_19_16 FM(CANFD2_TX) FM(TPU0TO2_A) F_(0, 0) FM(TCLK3_C) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_23_20 FM(CANFD2_RX) FM(TPU0TO3_A) FM(PWM1_B) FM(TCLK4_C) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_27_24 FM(CANFD3_TX) F_(0, 0) FM(PWM2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR2_31_28 FM(CANFD3_RX) F_(0, 0) FM(PWM3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR2 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
@@ -381,8 +381,8 @@
#define IP1SR3_11_8 FM(MMC_SD_CMD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR3_15_12 FM(SD_CD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR3_19_16 FM(SD_WP) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_23_20 FM(IPC_CLKIN) FM(IPC_CLKEN_IN) FM(PWM1_A) FM(TCLK3_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_27_24 FM(IPC_CLKOUT) FM(IPC_CLKEN_OUT) FM(ERROROUTC_N_A) FM(TCLK4_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_23_20 FM(IPC_CLKIN) FM(IPC_CLKEN_IN) FM(PWM1_A) FM(TCLK3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_27_24 FM(IPC_CLKOUT) FM(IPC_CLKEN_OUT) FM(ERROROUTC_N_A) FM(TCLK4_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR3_31_28 FM(QSPI0_SSL) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR3 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
@@ -718,22 +718,22 @@ static const u16 pinmux_data[] = {
/* IP0SR0 */
PINMUX_IPSR_GPSR(IP0SR0_3_0, ERROROUTC_N_B),
- PINMUX_IPSR_GPSR(IP0SR0_3_0, TCLK2_A),
+ PINMUX_IPSR_GPSR(IP0SR0_3_0, TCLK2_B),
PINMUX_IPSR_GPSR(IP0SR0_7_4, MSIOF3_SS1),
PINMUX_IPSR_GPSR(IP0SR0_11_8, MSIOF3_SS2),
- PINMUX_IPSR_GPSR(IP0SR0_15_12, IRQ3),
+ PINMUX_IPSR_GPSR(IP0SR0_15_12, IRQ3_A),
PINMUX_IPSR_GPSR(IP0SR0_15_12, MSIOF3_SCK),
- PINMUX_IPSR_GPSR(IP0SR0_19_16, IRQ2),
+ PINMUX_IPSR_GPSR(IP0SR0_19_16, IRQ2_A),
PINMUX_IPSR_GPSR(IP0SR0_19_16, MSIOF3_TXD),
- PINMUX_IPSR_GPSR(IP0SR0_23_20, IRQ1),
+ PINMUX_IPSR_GPSR(IP0SR0_23_20, IRQ1_A),
PINMUX_IPSR_GPSR(IP0SR0_23_20, MSIOF3_RXD),
- PINMUX_IPSR_GPSR(IP0SR0_27_24, IRQ0),
+ PINMUX_IPSR_GPSR(IP0SR0_27_24, IRQ0_A),
PINMUX_IPSR_GPSR(IP0SR0_27_24, MSIOF3_SYNC),
PINMUX_IPSR_GPSR(IP0SR0_31_28, MSIOF5_SS2),
@@ -750,75 +750,75 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP1SR0_19_16, MSIOF5_RXD),
PINMUX_IPSR_GPSR(IP1SR0_23_20, MSIOF2_SS2),
- PINMUX_IPSR_GPSR(IP1SR0_23_20, TCLK1),
- PINMUX_IPSR_GPSR(IP1SR0_23_20, IRQ2_A),
+ PINMUX_IPSR_GPSR(IP1SR0_23_20, TCLK1_A),
+ PINMUX_IPSR_GPSR(IP1SR0_23_20, IRQ2_B),
PINMUX_IPSR_GPSR(IP1SR0_27_24, MSIOF2_SS1),
- PINMUX_IPSR_GPSR(IP1SR0_27_24, HTX1),
- PINMUX_IPSR_GPSR(IP1SR0_27_24, TX1),
+ PINMUX_IPSR_GPSR(IP1SR0_27_24, HTX1_A),
+ PINMUX_IPSR_GPSR(IP1SR0_27_24, TX1_A),
PINMUX_IPSR_GPSR(IP1SR0_31_28, MSIOF2_SYNC),
- PINMUX_IPSR_GPSR(IP1SR0_31_28, HRX1),
- PINMUX_IPSR_GPSR(IP1SR0_31_28, RX1),
+ PINMUX_IPSR_GPSR(IP1SR0_31_28, HRX1_A),
+ PINMUX_IPSR_GPSR(IP1SR0_31_28, RX1_A),
/* IP2SR0 */
PINMUX_IPSR_GPSR(IP2SR0_3_0, MSIOF2_TXD),
- PINMUX_IPSR_GPSR(IP2SR0_3_0, HCTS1_N),
- PINMUX_IPSR_GPSR(IP2SR0_3_0, CTS1_N),
+ PINMUX_IPSR_GPSR(IP2SR0_3_0, HCTS1_N_A),
+ PINMUX_IPSR_GPSR(IP2SR0_3_0, CTS1_N_A),
PINMUX_IPSR_GPSR(IP2SR0_7_4, MSIOF2_SCK),
- PINMUX_IPSR_GPSR(IP2SR0_7_4, HRTS1_N),
- PINMUX_IPSR_GPSR(IP2SR0_7_4, RTS1_N),
+ PINMUX_IPSR_GPSR(IP2SR0_7_4, HRTS1_N_A),
+ PINMUX_IPSR_GPSR(IP2SR0_7_4, RTS1_N_A),
PINMUX_IPSR_GPSR(IP2SR0_11_8, MSIOF2_RXD),
- PINMUX_IPSR_GPSR(IP2SR0_11_8, HSCK1),
- PINMUX_IPSR_GPSR(IP2SR0_11_8, SCK1),
+ PINMUX_IPSR_GPSR(IP2SR0_11_8, HSCK1_A),
+ PINMUX_IPSR_GPSR(IP2SR0_11_8, SCK1_A),
/* IP0SR1 */
PINMUX_IPSR_GPSR(IP0SR1_3_0, MSIOF1_SS2),
- PINMUX_IPSR_GPSR(IP0SR1_3_0, HTX3_A),
- PINMUX_IPSR_GPSR(IP0SR1_3_0, TX3),
+ PINMUX_IPSR_GPSR(IP0SR1_3_0, HTX3_B),
+ PINMUX_IPSR_GPSR(IP0SR1_3_0, TX3_B),
PINMUX_IPSR_GPSR(IP0SR1_7_4, MSIOF1_SS1),
- PINMUX_IPSR_GPSR(IP0SR1_7_4, HCTS3_N_A),
- PINMUX_IPSR_GPSR(IP0SR1_7_4, RX3),
+ PINMUX_IPSR_GPSR(IP0SR1_7_4, HCTS3_N_B),
+ PINMUX_IPSR_GPSR(IP0SR1_7_4, RX3_B),
PINMUX_IPSR_GPSR(IP0SR1_11_8, MSIOF1_SYNC),
- PINMUX_IPSR_GPSR(IP0SR1_11_8, HRTS3_N_A),
- PINMUX_IPSR_GPSR(IP0SR1_11_8, RTS3_N),
+ PINMUX_IPSR_GPSR(IP0SR1_11_8, HRTS3_N_B),
+ PINMUX_IPSR_GPSR(IP0SR1_11_8, RTS3_N_B),
PINMUX_IPSR_GPSR(IP0SR1_15_12, MSIOF1_SCK),
- PINMUX_IPSR_GPSR(IP0SR1_15_12, HSCK3_A),
- PINMUX_IPSR_GPSR(IP0SR1_15_12, CTS3_N),
+ PINMUX_IPSR_GPSR(IP0SR1_15_12, HSCK3_B),
+ PINMUX_IPSR_GPSR(IP0SR1_15_12, CTS3_N_B),
PINMUX_IPSR_GPSR(IP0SR1_19_16, MSIOF1_TXD),
- PINMUX_IPSR_GPSR(IP0SR1_19_16, HRX3_A),
- PINMUX_IPSR_GPSR(IP0SR1_19_16, SCK3),
+ PINMUX_IPSR_GPSR(IP0SR1_19_16, HRX3_B),
+ PINMUX_IPSR_GPSR(IP0SR1_19_16, SCK3_B),
PINMUX_IPSR_GPSR(IP0SR1_23_20, MSIOF1_RXD),
PINMUX_IPSR_GPSR(IP0SR1_27_24, MSIOF0_SS2),
- PINMUX_IPSR_GPSR(IP0SR1_27_24, HTX1_X),
- PINMUX_IPSR_GPSR(IP0SR1_27_24, TX1_X),
+ PINMUX_IPSR_GPSR(IP0SR1_27_24, HTX1_B),
+ PINMUX_IPSR_GPSR(IP0SR1_27_24, TX1_B),
PINMUX_IPSR_GPSR(IP0SR1_31_28, MSIOF0_SS1),
- PINMUX_IPSR_GPSR(IP0SR1_31_28, HRX1_X),
- PINMUX_IPSR_GPSR(IP0SR1_31_28, RX1_X),
+ PINMUX_IPSR_GPSR(IP0SR1_31_28, HRX1_B),
+ PINMUX_IPSR_GPSR(IP0SR1_31_28, RX1_B),
/* IP1SR1 */
PINMUX_IPSR_GPSR(IP1SR1_3_0, MSIOF0_SYNC),
- PINMUX_IPSR_GPSR(IP1SR1_3_0, HCTS1_N_X),
- PINMUX_IPSR_GPSR(IP1SR1_3_0, CTS1_N_X),
+ PINMUX_IPSR_GPSR(IP1SR1_3_0, HCTS1_N_B),
+ PINMUX_IPSR_GPSR(IP1SR1_3_0, CTS1_N_B),
PINMUX_IPSR_GPSR(IP1SR1_3_0, CANFD5_TX_B),
PINMUX_IPSR_GPSR(IP1SR1_7_4, MSIOF0_TXD),
- PINMUX_IPSR_GPSR(IP1SR1_7_4, HRTS1_N_X),
- PINMUX_IPSR_GPSR(IP1SR1_7_4, RTS1_N_X),
+ PINMUX_IPSR_GPSR(IP1SR1_7_4, HRTS1_N_B),
+ PINMUX_IPSR_GPSR(IP1SR1_7_4, RTS1_N_B),
PINMUX_IPSR_GPSR(IP1SR1_7_4, CANFD5_RX_B),
PINMUX_IPSR_GPSR(IP1SR1_11_8, MSIOF0_SCK),
- PINMUX_IPSR_GPSR(IP1SR1_11_8, HSCK1_X),
- PINMUX_IPSR_GPSR(IP1SR1_11_8, SCK1_X),
+ PINMUX_IPSR_GPSR(IP1SR1_11_8, HSCK1_B),
+ PINMUX_IPSR_GPSR(IP1SR1_11_8, SCK1_B),
PINMUX_IPSR_GPSR(IP1SR1_15_12, MSIOF0_RXD),
@@ -827,15 +827,15 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP1SR1_23_20, HCTS0_N),
PINMUX_IPSR_GPSR(IP1SR1_23_20, CTS0_N),
- PINMUX_IPSR_GPSR(IP1SR1_23_20, PWM8_A),
+ PINMUX_IPSR_GPSR(IP1SR1_23_20, PWM8),
PINMUX_IPSR_GPSR(IP1SR1_27_24, HRTS0_N),
PINMUX_IPSR_GPSR(IP1SR1_27_24, RTS0_N),
- PINMUX_IPSR_GPSR(IP1SR1_27_24, PWM9_A),
+ PINMUX_IPSR_GPSR(IP1SR1_27_24, PWM9),
PINMUX_IPSR_GPSR(IP1SR1_31_28, HSCK0),
PINMUX_IPSR_GPSR(IP1SR1_31_28, SCK0),
- PINMUX_IPSR_GPSR(IP1SR1_31_28, PWM0_A),
+ PINMUX_IPSR_GPSR(IP1SR1_31_28, PWM0),
/* IP2SR1 */
PINMUX_IPSR_GPSR(IP2SR1_3_0, HRX0),
@@ -845,99 +845,99 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP2SR1_7_4, IRQ4_A),
PINMUX_IPSR_GPSR(IP2SR1_11_8, SSI_SCK),
- PINMUX_IPSR_GPSR(IP2SR1_11_8, TCLK3),
+ PINMUX_IPSR_GPSR(IP2SR1_11_8, TCLK3_B),
PINMUX_IPSR_GPSR(IP2SR1_15_12, SSI_WS),
- PINMUX_IPSR_GPSR(IP2SR1_15_12, TCLK4),
+ PINMUX_IPSR_GPSR(IP2SR1_15_12, TCLK4_B),
PINMUX_IPSR_GPSR(IP2SR1_19_16, SSI_SD),
- PINMUX_IPSR_GPSR(IP2SR1_19_16, IRQ0_A),
+ PINMUX_IPSR_GPSR(IP2SR1_19_16, IRQ0_B),
PINMUX_IPSR_GPSR(IP2SR1_23_20, AUDIO_CLKOUT),
- PINMUX_IPSR_GPSR(IP2SR1_23_20, IRQ1_A),
+ PINMUX_IPSR_GPSR(IP2SR1_23_20, IRQ1_B),
PINMUX_IPSR_GPSR(IP2SR1_27_24, AUDIO_CLKIN),
PINMUX_IPSR_GPSR(IP2SR1_27_24, PWM3_A),
- PINMUX_IPSR_GPSR(IP2SR1_31_28, TCLK2),
+ PINMUX_IPSR_GPSR(IP2SR1_31_28, TCLK2_A),
PINMUX_IPSR_GPSR(IP2SR1_31_28, MSIOF4_SS1),
PINMUX_IPSR_GPSR(IP2SR1_31_28, IRQ3_B),
/* IP3SR1 */
- PINMUX_IPSR_GPSR(IP3SR1_3_0, HRX3),
+ PINMUX_IPSR_GPSR(IP3SR1_3_0, HRX3_A),
PINMUX_IPSR_GPSR(IP3SR1_3_0, SCK3_A),
PINMUX_IPSR_GPSR(IP3SR1_3_0, MSIOF4_SS2),
- PINMUX_IPSR_GPSR(IP3SR1_7_4, HSCK3),
+ PINMUX_IPSR_GPSR(IP3SR1_7_4, HSCK3_A),
PINMUX_IPSR_GPSR(IP3SR1_7_4, CTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_7_4, MSIOF4_SCK),
- PINMUX_IPSR_GPSR(IP3SR1_7_4, TPU0TO0_A),
+ PINMUX_IPSR_GPSR(IP3SR1_7_4, TPU0TO0_B),
- PINMUX_IPSR_GPSR(IP3SR1_11_8, HRTS3_N),
+ PINMUX_IPSR_GPSR(IP3SR1_11_8, HRTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_11_8, RTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_11_8, MSIOF4_TXD),
- PINMUX_IPSR_GPSR(IP3SR1_11_8, TPU0TO1_A),
+ PINMUX_IPSR_GPSR(IP3SR1_11_8, TPU0TO1_B),
- PINMUX_IPSR_GPSR(IP3SR1_15_12, HCTS3_N),
+ PINMUX_IPSR_GPSR(IP3SR1_15_12, HCTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_15_12, RX3_A),
PINMUX_IPSR_GPSR(IP3SR1_15_12, MSIOF4_RXD),
- PINMUX_IPSR_GPSR(IP3SR1_19_16, HTX3),
+ PINMUX_IPSR_GPSR(IP3SR1_19_16, HTX3_A),
PINMUX_IPSR_GPSR(IP3SR1_19_16, TX3_A),
PINMUX_IPSR_GPSR(IP3SR1_19_16, MSIOF4_SYNC),
/* IP0SR2 */
PINMUX_IPSR_GPSR(IP0SR2_3_0, FXR_TXDA),
PINMUX_IPSR_GPSR(IP0SR2_3_0, CANFD1_TX),
- PINMUX_IPSR_GPSR(IP0SR2_3_0, TPU0TO2_A),
+ PINMUX_IPSR_GPSR(IP0SR2_3_0, TPU0TO2_B),
- PINMUX_IPSR_GPSR(IP0SR2_7_4, FXR_TXENA_N),
+ PINMUX_IPSR_GPSR(IP0SR2_7_4, FXR_TXENA_N_A),
PINMUX_IPSR_GPSR(IP0SR2_7_4, CANFD1_RX),
- PINMUX_IPSR_GPSR(IP0SR2_7_4, TPU0TO3_A),
+ PINMUX_IPSR_GPSR(IP0SR2_7_4, TPU0TO3_B),
PINMUX_IPSR_GPSR(IP0SR2_11_8, RXDA_EXTFXR),
- PINMUX_IPSR_GPSR(IP0SR2_11_8, CANFD5_TX),
+ PINMUX_IPSR_GPSR(IP0SR2_11_8, CANFD5_TX_A),
PINMUX_IPSR_GPSR(IP0SR2_11_8, IRQ5),
PINMUX_IPSR_GPSR(IP0SR2_15_12, CLK_EXTFXR),
- PINMUX_IPSR_GPSR(IP0SR2_15_12, CANFD5_RX),
+ PINMUX_IPSR_GPSR(IP0SR2_15_12, CANFD5_RX_A),
PINMUX_IPSR_GPSR(IP0SR2_15_12, IRQ4_B),
PINMUX_IPSR_GPSR(IP0SR2_19_16, RXDB_EXTFXR),
- PINMUX_IPSR_GPSR(IP0SR2_23_20, FXR_TXENB_N),
+ PINMUX_IPSR_GPSR(IP0SR2_23_20, FXR_TXENB_N_A),
PINMUX_IPSR_GPSR(IP0SR2_27_24, FXR_TXDB),
- PINMUX_IPSR_GPSR(IP0SR2_31_28, TPU0TO1),
+ PINMUX_IPSR_GPSR(IP0SR2_31_28, TPU0TO1_A),
PINMUX_IPSR_GPSR(IP0SR2_31_28, CANFD6_TX),
- PINMUX_IPSR_GPSR(IP0SR2_31_28, TCLK2_B),
+ PINMUX_IPSR_GPSR(IP0SR2_31_28, TCLK2_C),
/* IP1SR2 */
- PINMUX_IPSR_GPSR(IP1SR2_3_0, TPU0TO0),
+ PINMUX_IPSR_GPSR(IP1SR2_3_0, TPU0TO0_A),
PINMUX_IPSR_GPSR(IP1SR2_3_0, CANFD6_RX),
- PINMUX_IPSR_GPSR(IP1SR2_3_0, TCLK1_A),
+ PINMUX_IPSR_GPSR(IP1SR2_3_0, TCLK1_B),
PINMUX_IPSR_GPSR(IP1SR2_7_4, CAN_CLK),
- PINMUX_IPSR_GPSR(IP1SR2_7_4, FXR_TXENA_N_X),
+ PINMUX_IPSR_GPSR(IP1SR2_7_4, FXR_TXENA_N_B),
PINMUX_IPSR_GPSR(IP1SR2_11_8, CANFD0_TX),
- PINMUX_IPSR_GPSR(IP1SR2_11_8, FXR_TXENB_N_X),
+ PINMUX_IPSR_GPSR(IP1SR2_11_8, FXR_TXENB_N_B),
PINMUX_IPSR_GPSR(IP1SR2_15_12, CANFD0_RX),
PINMUX_IPSR_GPSR(IP1SR2_15_12, STPWT_EXTFXR),
PINMUX_IPSR_GPSR(IP1SR2_19_16, CANFD2_TX),
- PINMUX_IPSR_GPSR(IP1SR2_19_16, TPU0TO2),
- PINMUX_IPSR_GPSR(IP1SR2_19_16, TCLK3_A),
+ PINMUX_IPSR_GPSR(IP1SR2_19_16, TPU0TO2_A),
+ PINMUX_IPSR_GPSR(IP1SR2_19_16, TCLK3_C),
PINMUX_IPSR_GPSR(IP1SR2_23_20, CANFD2_RX),
- PINMUX_IPSR_GPSR(IP1SR2_23_20, TPU0TO3),
+ PINMUX_IPSR_GPSR(IP1SR2_23_20, TPU0TO3_A),
PINMUX_IPSR_GPSR(IP1SR2_23_20, PWM1_B),
- PINMUX_IPSR_GPSR(IP1SR2_23_20, TCLK4_A),
+ PINMUX_IPSR_GPSR(IP1SR2_23_20, TCLK4_C),
PINMUX_IPSR_GPSR(IP1SR2_27_24, CANFD3_TX),
- PINMUX_IPSR_GPSR(IP1SR2_27_24, PWM2_B),
+ PINMUX_IPSR_GPSR(IP1SR2_27_24, PWM2),
PINMUX_IPSR_GPSR(IP1SR2_31_28, CANFD3_RX),
PINMUX_IPSR_GPSR(IP1SR2_31_28, PWM3_B),
@@ -979,12 +979,12 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP1SR3_23_20, IPC_CLKIN),
PINMUX_IPSR_GPSR(IP1SR3_23_20, IPC_CLKEN_IN),
PINMUX_IPSR_GPSR(IP1SR3_23_20, PWM1_A),
- PINMUX_IPSR_GPSR(IP1SR3_23_20, TCLK3_X),
+ PINMUX_IPSR_GPSR(IP1SR3_23_20, TCLK3_A),
PINMUX_IPSR_GPSR(IP1SR3_27_24, IPC_CLKOUT),
PINMUX_IPSR_GPSR(IP1SR3_27_24, IPC_CLKEN_OUT),
PINMUX_IPSR_GPSR(IP1SR3_27_24, ERROROUTC_N_A),
- PINMUX_IPSR_GPSR(IP1SR3_27_24, TCLK4_X),
+ PINMUX_IPSR_GPSR(IP1SR3_27_24, TCLK4_A),
PINMUX_IPSR_GPSR(IP1SR3_31_28, QSPI0_SSL),
@@ -1531,15 +1531,14 @@ static const unsigned int canfd4_data_mux[] = {
};
/* - CANFD5 ----------------------------------------------------------------- */
-static const unsigned int canfd5_data_pins[] = {
- /* CANFD5_TX, CANFD5_RX */
+static const unsigned int canfd5_data_a_pins[] = {
+ /* CANFD5_TX_A, CANFD5_RX_A */
RCAR_GP_PIN(2, 2), RCAR_GP_PIN(2, 3),
};
-static const unsigned int canfd5_data_mux[] = {
- CANFD5_TX_MARK, CANFD5_RX_MARK,
+static const unsigned int canfd5_data_a_mux[] = {
+ CANFD5_TX_A_MARK, CANFD5_RX_A_MARK,
};
-/* - CANFD5_B ----------------------------------------------------------------- */
static const unsigned int canfd5_data_b_pins[] = {
/* CANFD5_TX_B, CANFD5_RX_B */
RCAR_GP_PIN(1, 8), RCAR_GP_PIN(1, 9),
@@ -1599,49 +1598,48 @@ static const unsigned int hscif0_ctrl_mux[] = {
};
/* - HSCIF1 ----------------------------------------------------------------- */
-static const unsigned int hscif1_data_pins[] = {
- /* HRX1, HTX1 */
+static const unsigned int hscif1_data_a_pins[] = {
+ /* HRX1_A, HTX1_A */
RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
};
-static const unsigned int hscif1_data_mux[] = {
- HRX1_MARK, HTX1_MARK,
+static const unsigned int hscif1_data_a_mux[] = {
+ HRX1_A_MARK, HTX1_A_MARK,
};
-static const unsigned int hscif1_clk_pins[] = {
- /* HSCK1 */
+static const unsigned int hscif1_clk_a_pins[] = {
+ /* HSCK1_A */
RCAR_GP_PIN(0, 18),
};
-static const unsigned int hscif1_clk_mux[] = {
- HSCK1_MARK,
+static const unsigned int hscif1_clk_a_mux[] = {
+ HSCK1_A_MARK,
};
-static const unsigned int hscif1_ctrl_pins[] = {
- /* HRTS1_N, HCTS1_N */
+static const unsigned int hscif1_ctrl_a_pins[] = {
+ /* HRTS1_N_A, HCTS1_N_A */
RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
};
-static const unsigned int hscif1_ctrl_mux[] = {
- HRTS1_N_MARK, HCTS1_N_MARK,
+static const unsigned int hscif1_ctrl_a_mux[] = {
+ HRTS1_N_A_MARK, HCTS1_N_A_MARK,
};
-/* - HSCIF1_X---------------------------------------------------------------- */
-static const unsigned int hscif1_data_x_pins[] = {
- /* HRX1_X, HTX1_X */
+static const unsigned int hscif1_data_b_pins[] = {
+ /* HRX1_B, HTX1_B */
RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
};
-static const unsigned int hscif1_data_x_mux[] = {
- HRX1_X_MARK, HTX1_X_MARK,
+static const unsigned int hscif1_data_b_mux[] = {
+ HRX1_B_MARK, HTX1_B_MARK,
};
-static const unsigned int hscif1_clk_x_pins[] = {
- /* HSCK1_X */
+static const unsigned int hscif1_clk_b_pins[] = {
+ /* HSCK1_B */
RCAR_GP_PIN(1, 10),
};
-static const unsigned int hscif1_clk_x_mux[] = {
- HSCK1_X_MARK,
+static const unsigned int hscif1_clk_b_mux[] = {
+ HSCK1_B_MARK,
};
-static const unsigned int hscif1_ctrl_x_pins[] = {
- /* HRTS1_N_X, HCTS1_N_X */
+static const unsigned int hscif1_ctrl_b_pins[] = {
+ /* HRTS1_N_B, HCTS1_N_B */
RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
};
-static const unsigned int hscif1_ctrl_x_mux[] = {
- HRTS1_N_X_MARK, HCTS1_N_X_MARK,
+static const unsigned int hscif1_ctrl_b_mux[] = {
+ HRTS1_N_B_MARK, HCTS1_N_B_MARK,
};
/* - HSCIF2 ----------------------------------------------------------------- */
@@ -1668,49 +1666,48 @@ static const unsigned int hscif2_ctrl_mux[] = {
};
/* - HSCIF3 ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_pins[] = {
- /* HRX3, HTX3 */
+static const unsigned int hscif3_data_a_pins[] = {
+ /* HRX3_A, HTX3_A */
RCAR_GP_PIN(1, 24), RCAR_GP_PIN(1, 28),
};
-static const unsigned int hscif3_data_mux[] = {
- HRX3_MARK, HTX3_MARK,
+static const unsigned int hscif3_data_a_mux[] = {
+ HRX3_A_MARK, HTX3_A_MARK,
};
-static const unsigned int hscif3_clk_pins[] = {
- /* HSCK3 */
+static const unsigned int hscif3_clk_a_pins[] = {
+ /* HSCK3_A */
RCAR_GP_PIN(1, 25),
};
-static const unsigned int hscif3_clk_mux[] = {
- HSCK3_MARK,
+static const unsigned int hscif3_clk_a_mux[] = {
+ HSCK3_A_MARK,
};
-static const unsigned int hscif3_ctrl_pins[] = {
- /* HRTS3_N, HCTS3_N */
+static const unsigned int hscif3_ctrl_a_pins[] = {
+ /* HRTS3_N_A, HCTS3_N_A */
RCAR_GP_PIN(1, 26), RCAR_GP_PIN(1, 27),
};
-static const unsigned int hscif3_ctrl_mux[] = {
- HRTS3_N_MARK, HCTS3_N_MARK,
+static const unsigned int hscif3_ctrl_a_mux[] = {
+ HRTS3_N_A_MARK, HCTS3_N_A_MARK,
};
-/* - HSCIF3_A ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_a_pins[] = {
- /* HRX3_A, HTX3_A */
+static const unsigned int hscif3_data_b_pins[] = {
+ /* HRX3_B, HTX3_B */
RCAR_GP_PIN(1, 4), RCAR_GP_PIN(1, 0),
};
-static const unsigned int hscif3_data_a_mux[] = {
- HRX3_A_MARK, HTX3_A_MARK,
+static const unsigned int hscif3_data_b_mux[] = {
+ HRX3_B_MARK, HTX3_B_MARK,
};
-static const unsigned int hscif3_clk_a_pins[] = {
- /* HSCK3_A */
+static const unsigned int hscif3_clk_b_pins[] = {
+ /* HSCK3_B */
RCAR_GP_PIN(1, 3),
};
-static const unsigned int hscif3_clk_a_mux[] = {
- HSCK3_A_MARK,
+static const unsigned int hscif3_clk_b_mux[] = {
+ HSCK3_B_MARK,
};
-static const unsigned int hscif3_ctrl_a_pins[] = {
- /* HRTS3_N_A, HCTS3_N_A */
+static const unsigned int hscif3_ctrl_b_pins[] = {
+ /* HRTS3_N_B, HCTS3_N_B */
RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 1),
};
-static const unsigned int hscif3_ctrl_a_mux[] = {
- HRTS3_N_A_MARK, HCTS3_N_A_MARK,
+static const unsigned int hscif3_ctrl_b_mux[] = {
+ HRTS3_N_B_MARK, HCTS3_N_B_MARK,
};
/* - I2C0 ------------------------------------------------------------------- */
@@ -2093,13 +2090,13 @@ static const unsigned int pcie1_clkreq_n_mux[] = {
PCIE1_CLKREQ_N_MARK,
};
-/* - PWM0_A ------------------------------------------------------------------- */
-static const unsigned int pwm0_a_pins[] = {
- /* PWM0_A */
+/* - PWM0 ------------------------------------------------------------------- */
+static const unsigned int pwm0_pins[] = {
+ /* PWM0 */
RCAR_GP_PIN(1, 15),
};
-static const unsigned int pwm0_a_mux[] = {
- PWM0_A_MARK,
+static const unsigned int pwm0_mux[] = {
+ PWM0_MARK,
};
/* - PWM1_A ------------------------------------------------------------------- */
@@ -2120,13 +2117,13 @@ static const unsigned int pwm1_b_mux[] = {
PWM1_B_MARK,
};
-/* - PWM2_B ------------------------------------------------------------------- */
-static const unsigned int pwm2_b_pins[] = {
- /* PWM2_B */
+/* - PWM2 ------------------------------------------------------------------- */
+static const unsigned int pwm2_pins[] = {
+ /* PWM2 */
RCAR_GP_PIN(2, 14),
};
-static const unsigned int pwm2_b_mux[] = {
- PWM2_B_MARK,
+static const unsigned int pwm2_mux[] = {
+ PWM2_MARK,
};
/* - PWM3_A ------------------------------------------------------------------- */
@@ -2183,22 +2180,22 @@ static const unsigned int pwm7_mux[] = {
PWM7_MARK,
};
-/* - PWM8_A ------------------------------------------------------------------- */
-static const unsigned int pwm8_a_pins[] = {
- /* PWM8_A */
+/* - PWM8 ------------------------------------------------------------------- */
+static const unsigned int pwm8_pins[] = {
+ /* PWM8 */
RCAR_GP_PIN(1, 13),
};
-static const unsigned int pwm8_a_mux[] = {
- PWM8_A_MARK,
+static const unsigned int pwm8_mux[] = {
+ PWM8_MARK,
};
-/* - PWM9_A ------------------------------------------------------------------- */
-static const unsigned int pwm9_a_pins[] = {
- /* PWM9_A */
+/* - PWM9 ------------------------------------------------------------------- */
+static const unsigned int pwm9_pins[] = {
+ /* PWM9 */
RCAR_GP_PIN(1, 14),
};
-static const unsigned int pwm9_a_mux[] = {
- PWM9_A_MARK,
+static const unsigned int pwm9_mux[] = {
+ PWM9_MARK,
};
/* - QSPI0 ------------------------------------------------------------------ */
@@ -2261,75 +2258,51 @@ static const unsigned int scif0_ctrl_mux[] = {
};
/* - SCIF1 ------------------------------------------------------------------ */
-static const unsigned int scif1_data_pins[] = {
- /* RX1, TX1 */
+static const unsigned int scif1_data_a_pins[] = {
+ /* RX1_A, TX1_A */
RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
};
-static const unsigned int scif1_data_mux[] = {
- RX1_MARK, TX1_MARK,
+static const unsigned int scif1_data_a_mux[] = {
+ RX1_A_MARK, TX1_A_MARK,
};
-static const unsigned int scif1_clk_pins[] = {
- /* SCK1 */
+static const unsigned int scif1_clk_a_pins[] = {
+ /* SCK1_A */
RCAR_GP_PIN(0, 18),
};
-static const unsigned int scif1_clk_mux[] = {
- SCK1_MARK,
+static const unsigned int scif1_clk_a_mux[] = {
+ SCK1_A_MARK,
};
-static const unsigned int scif1_ctrl_pins[] = {
- /* RTS1_N, CTS1_N */
+static const unsigned int scif1_ctrl_a_pins[] = {
+ /* RTS1_N_A, CTS1_N_A */
RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
};
-static const unsigned int scif1_ctrl_mux[] = {
- RTS1_N_MARK, CTS1_N_MARK,
+static const unsigned int scif1_ctrl_a_mux[] = {
+ RTS1_N_A_MARK, CTS1_N_A_MARK,
};
-/* - SCIF1_X ------------------------------------------------------------------ */
-static const unsigned int scif1_data_x_pins[] = {
- /* RX1_X, TX1_X */
+static const unsigned int scif1_data_b_pins[] = {
+ /* RX1_B, TX1_B */
RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
};
-static const unsigned int scif1_data_x_mux[] = {
- RX1_X_MARK, TX1_X_MARK,
+static const unsigned int scif1_data_b_mux[] = {
+ RX1_B_MARK, TX1_B_MARK,
};
-static const unsigned int scif1_clk_x_pins[] = {
- /* SCK1_X */
+static const unsigned int scif1_clk_b_pins[] = {
+ /* SCK1_B */
RCAR_GP_PIN(1, 10),
};
-static const unsigned int scif1_clk_x_mux[] = {
- SCK1_X_MARK,
+static const unsigned int scif1_clk_b_mux[] = {
+ SCK1_B_MARK,
};
-static const unsigned int scif1_ctrl_x_pins[] = {
- /* RTS1_N_X, CTS1_N_X */
+static const unsigned int scif1_ctrl_b_pins[] = {
+ /* RTS1_N_B, CTS1_N_B */
RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
};
-static const unsigned int scif1_ctrl_x_mux[] = {
- RTS1_N_X_MARK, CTS1_N_X_MARK,
+static const unsigned int scif1_ctrl_b_mux[] = {
+ RTS1_N_B_MARK, CTS1_N_B_MARK,
};
/* - SCIF3 ------------------------------------------------------------------ */
-static const unsigned int scif3_data_pins[] = {
- /* RX3, TX3 */
- RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
-};
-static const unsigned int scif3_data_mux[] = {
- RX3_MARK, TX3_MARK,
-};
-static const unsigned int scif3_clk_pins[] = {
- /* SCK3 */
- RCAR_GP_PIN(1, 4),
-};
-static const unsigned int scif3_clk_mux[] = {
- SCK3_MARK,
-};
-static const unsigned int scif3_ctrl_pins[] = {
- /* RTS3_N, CTS3_N */
- RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
-};
-static const unsigned int scif3_ctrl_mux[] = {
- RTS3_N_MARK, CTS3_N_MARK,
-};
-
-/* - SCIF3_A ------------------------------------------------------------------ */
static const unsigned int scif3_data_a_pins[] = {
/* RX3_A, TX3_A */
RCAR_GP_PIN(1, 27), RCAR_GP_PIN(1, 28),
@@ -2352,6 +2325,28 @@ static const unsigned int scif3_ctrl_a_mux[] = {
RTS3_N_A_MARK, CTS3_N_A_MARK,
};
+static const unsigned int scif3_data_b_pins[] = {
+ /* RX3_B, TX3_B */
+ RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
+};
+static const unsigned int scif3_data_b_mux[] = {
+ RX3_B_MARK, TX3_B_MARK,
+};
+static const unsigned int scif3_clk_b_pins[] = {
+ /* SCK3_B */
+ RCAR_GP_PIN(1, 4),
+};
+static const unsigned int scif3_clk_b_mux[] = {
+ SCK3_B_MARK,
+};
+static const unsigned int scif3_ctrl_b_pins[] = {
+ /* RTS3_N_B, CTS3_N_B */
+ RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
+};
+static const unsigned int scif3_ctrl_b_mux[] = {
+ RTS3_N_B_MARK, CTS3_N_B_MARK,
+};
+
/* - SCIF4 ------------------------------------------------------------------ */
static const unsigned int scif4_data_pins[] = {
/* RX4, TX4 */
@@ -2408,64 +2403,63 @@ static const unsigned int ssi_ctrl_mux[] = {
SSI_SCK_MARK, SSI_WS_MARK,
};
-/* - TPU ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_pins[] = {
- /* TPU0TO0 */
+/* - TPU -------------------------------------------------------------------- */
+static const unsigned int tpu_to0_a_pins[] = {
+ /* TPU0TO0_A */
RCAR_GP_PIN(2, 8),
};
-static const unsigned int tpu_to0_mux[] = {
- TPU0TO0_MARK,
+static const unsigned int tpu_to0_a_mux[] = {
+ TPU0TO0_A_MARK,
};
-static const unsigned int tpu_to1_pins[] = {
- /* TPU0TO1 */
+static const unsigned int tpu_to1_a_pins[] = {
+ /* TPU0TO1_A */
RCAR_GP_PIN(2, 7),
};
-static const unsigned int tpu_to1_mux[] = {
- TPU0TO1_MARK,
+static const unsigned int tpu_to1_a_mux[] = {
+ TPU0TO1_A_MARK,
};
-static const unsigned int tpu_to2_pins[] = {
- /* TPU0TO2 */
+static const unsigned int tpu_to2_a_pins[] = {
+ /* TPU0TO2_A */
RCAR_GP_PIN(2, 12),
};
-static const unsigned int tpu_to2_mux[] = {
- TPU0TO2_MARK,
+static const unsigned int tpu_to2_a_mux[] = {
+ TPU0TO2_A_MARK,
};
-static const unsigned int tpu_to3_pins[] = {
- /* TPU0TO3 */
+static const unsigned int tpu_to3_a_pins[] = {
+ /* TPU0TO3_A */
RCAR_GP_PIN(2, 13),
};
-static const unsigned int tpu_to3_mux[] = {
- TPU0TO3_MARK,
+static const unsigned int tpu_to3_a_mux[] = {
+ TPU0TO3_A_MARK,
};
-/* - TPU_A ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_a_pins[] = {
- /* TPU0TO0_A */
+static const unsigned int tpu_to0_b_pins[] = {
+ /* TPU0TO0_B */
RCAR_GP_PIN(1, 25),
};
-static const unsigned int tpu_to0_a_mux[] = {
- TPU0TO0_A_MARK,
+static const unsigned int tpu_to0_b_mux[] = {
+ TPU0TO0_B_MARK,
};
-static const unsigned int tpu_to1_a_pins[] = {
- /* TPU0TO1_A */
+static const unsigned int tpu_to1_b_pins[] = {
+ /* TPU0TO1_B */
RCAR_GP_PIN(1, 26),
};
-static const unsigned int tpu_to1_a_mux[] = {
- TPU0TO1_A_MARK,
+static const unsigned int tpu_to1_b_mux[] = {
+ TPU0TO1_B_MARK,
};
-static const unsigned int tpu_to2_a_pins[] = {
- /* TPU0TO2_A */
+static const unsigned int tpu_to2_b_pins[] = {
+ /* TPU0TO2_B */
RCAR_GP_PIN(2, 0),
};
-static const unsigned int tpu_to2_a_mux[] = {
- TPU0TO2_A_MARK,
+static const unsigned int tpu_to2_b_mux[] = {
+ TPU0TO2_B_MARK,
};
-static const unsigned int tpu_to3_a_pins[] = {
- /* TPU0TO3_A */
+static const unsigned int tpu_to3_b_pins[] = {
+ /* TPU0TO3_B */
RCAR_GP_PIN(2, 1),
};
-static const unsigned int tpu_to3_a_mux[] = {
- TPU0TO3_A_MARK,
+static const unsigned int tpu_to3_b_mux[] = {
+ TPU0TO3_B_MARK,
};
/* - TSN0 ------------------------------------------------ */
@@ -2578,8 +2572,8 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(canfd2_data),
SH_PFC_PIN_GROUP(canfd3_data),
SH_PFC_PIN_GROUP(canfd4_data),
- SH_PFC_PIN_GROUP(canfd5_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(canfd5_data_b), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(canfd5_data_a),
+ SH_PFC_PIN_GROUP(canfd5_data_b),
SH_PFC_PIN_GROUP(canfd6_data),
SH_PFC_PIN_GROUP(canfd7_data),
SH_PFC_PIN_GROUP(can_clk),
@@ -2587,21 +2581,21 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(hscif0_data),
SH_PFC_PIN_GROUP(hscif0_clk),
SH_PFC_PIN_GROUP(hscif0_ctrl),
- SH_PFC_PIN_GROUP(hscif1_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_data_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_clk_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_ctrl_x), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(hscif1_data_a),
+ SH_PFC_PIN_GROUP(hscif1_clk_a),
+ SH_PFC_PIN_GROUP(hscif1_ctrl_a),
+ SH_PFC_PIN_GROUP(hscif1_data_b),
+ SH_PFC_PIN_GROUP(hscif1_clk_b),
+ SH_PFC_PIN_GROUP(hscif1_ctrl_b),
SH_PFC_PIN_GROUP(hscif2_data),
SH_PFC_PIN_GROUP(hscif2_clk),
SH_PFC_PIN_GROUP(hscif2_ctrl),
- SH_PFC_PIN_GROUP(hscif3_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_data_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_clk_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_ctrl_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(hscif3_data_a),
+ SH_PFC_PIN_GROUP(hscif3_clk_a),
+ SH_PFC_PIN_GROUP(hscif3_ctrl_a),
+ SH_PFC_PIN_GROUP(hscif3_data_b),
+ SH_PFC_PIN_GROUP(hscif3_clk_b),
+ SH_PFC_PIN_GROUP(hscif3_ctrl_b),
SH_PFC_PIN_GROUP(i2c0),
SH_PFC_PIN_GROUP(i2c1),
@@ -2663,18 +2657,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(pcie0_clkreq_n),
SH_PFC_PIN_GROUP(pcie1_clkreq_n),
- SH_PFC_PIN_GROUP(pwm0_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(pwm0),
SH_PFC_PIN_GROUP(pwm1_a),
SH_PFC_PIN_GROUP(pwm1_b),
- SH_PFC_PIN_GROUP(pwm2_b), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(pwm2),
SH_PFC_PIN_GROUP(pwm3_a),
SH_PFC_PIN_GROUP(pwm3_b),
SH_PFC_PIN_GROUP(pwm4),
SH_PFC_PIN_GROUP(pwm5),
SH_PFC_PIN_GROUP(pwm6),
SH_PFC_PIN_GROUP(pwm7),
- SH_PFC_PIN_GROUP(pwm8_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(pwm9_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(pwm8),
+ SH_PFC_PIN_GROUP(pwm9),
SH_PFC_PIN_GROUP(qspi0_ctrl),
BUS_DATA_PIN_GROUP(qspi0_data, 2),
@@ -2686,18 +2680,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(scif0_data),
SH_PFC_PIN_GROUP(scif0_clk),
SH_PFC_PIN_GROUP(scif0_ctrl),
- SH_PFC_PIN_GROUP(scif1_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_data_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_clk_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_ctrl_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_data_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_clk_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_ctrl_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(scif1_data_a),
+ SH_PFC_PIN_GROUP(scif1_clk_a),
+ SH_PFC_PIN_GROUP(scif1_ctrl_a),
+ SH_PFC_PIN_GROUP(scif1_data_b),
+ SH_PFC_PIN_GROUP(scif1_clk_b),
+ SH_PFC_PIN_GROUP(scif1_ctrl_b),
+ SH_PFC_PIN_GROUP(scif3_data_a),
+ SH_PFC_PIN_GROUP(scif3_clk_a),
+ SH_PFC_PIN_GROUP(scif3_ctrl_a),
+ SH_PFC_PIN_GROUP(scif3_data_b),
+ SH_PFC_PIN_GROUP(scif3_clk_b),
+ SH_PFC_PIN_GROUP(scif3_ctrl_b),
SH_PFC_PIN_GROUP(scif4_data),
SH_PFC_PIN_GROUP(scif4_clk),
SH_PFC_PIN_GROUP(scif4_ctrl),
@@ -2707,14 +2701,14 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(ssi_data),
SH_PFC_PIN_GROUP(ssi_ctrl),
- SH_PFC_PIN_GROUP(tpu_to0), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to0_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to1), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to1_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to2), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to2_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to3), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to3_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(tpu_to0_a),
+ SH_PFC_PIN_GROUP(tpu_to0_b),
+ SH_PFC_PIN_GROUP(tpu_to1_a),
+ SH_PFC_PIN_GROUP(tpu_to1_b),
+ SH_PFC_PIN_GROUP(tpu_to2_a),
+ SH_PFC_PIN_GROUP(tpu_to2_b),
+ SH_PFC_PIN_GROUP(tpu_to3_a),
+ SH_PFC_PIN_GROUP(tpu_to3_b),
SH_PFC_PIN_GROUP(tsn0_link),
SH_PFC_PIN_GROUP(tsn0_phy_int),
@@ -2788,8 +2782,7 @@ static const char * const canfd4_groups[] = {
};
static const char * const canfd5_groups[] = {
- /* suffix might be updated */
- "canfd5_data",
+ "canfd5_data_a",
"canfd5_data_b",
};
@@ -2812,13 +2805,12 @@ static const char * const hscif0_groups[] = {
};
static const char * const hscif1_groups[] = {
- /* suffix might be updated */
- "hscif1_data",
- "hscif1_clk",
- "hscif1_ctrl",
- "hscif1_data_x",
- "hscif1_clk_x",
- "hscif1_ctrl_x",
+ "hscif1_data_a",
+ "hscif1_clk_a",
+ "hscif1_ctrl_a",
+ "hscif1_data_b",
+ "hscif1_clk_b",
+ "hscif1_ctrl_b",
};
static const char * const hscif2_groups[] = {
@@ -2828,13 +2820,12 @@ static const char * const hscif2_groups[] = {
};
static const char * const hscif3_groups[] = {
- /* suffix might be updated */
- "hscif3_data",
- "hscif3_clk",
- "hscif3_ctrl",
"hscif3_data_a",
"hscif3_clk_a",
"hscif3_ctrl_a",
+ "hscif3_data_b",
+ "hscif3_clk_b",
+ "hscif3_ctrl_b",
};
static const char * const i2c0_groups[] = {
@@ -2931,8 +2922,7 @@ static const char * const pcie_groups[] = {
};
static const char * const pwm0_groups[] = {
- /* suffix might be updated */
- "pwm0_a",
+ "pwm0",
};
static const char * const pwm1_groups[] = {
@@ -2941,8 +2931,7 @@ static const char * const pwm1_groups[] = {
};
static const char * const pwm2_groups[] = {
- /* suffix might be updated */
- "pwm2_b",
+ "pwm2",
};
static const char * const pwm3_groups[] = {
@@ -2967,13 +2956,11 @@ static const char * const pwm7_groups[] = {
};
static const char * const pwm8_groups[] = {
- /* suffix might be updated */
- "pwm8_a",
+ "pwm8",
};
static const char * const pwm9_groups[] = {
- /* suffix might be updated */
- "pwm9_a",
+ "pwm9",
};
static const char * const qspi0_groups[] = {
@@ -2995,23 +2982,21 @@ static const char * const scif0_groups[] = {
};
static const char * const scif1_groups[] = {
- /* suffix might be updated */
- "scif1_data",
- "scif1_clk",
- "scif1_ctrl",
- "scif1_data_x",
- "scif1_clk_x",
- "scif1_ctrl_x",
+ "scif1_data_a",
+ "scif1_clk_a",
+ "scif1_ctrl_a",
+ "scif1_data_b",
+ "scif1_clk_b",
+ "scif1_ctrl_b",
};
static const char * const scif3_groups[] = {
- /* suffix might be updated */
- "scif3_data",
- "scif3_clk",
- "scif3_ctrl",
"scif3_data_a",
"scif3_clk_a",
"scif3_ctrl_a",
+ "scif3_data_b",
+ "scif3_clk_b",
+ "scif3_ctrl_b",
};
static const char * const scif4_groups[] = {
@@ -3034,15 +3019,14 @@ static const char * const ssi_groups[] = {
};
static const char * const tpu_groups[] = {
- /* suffix might be updated */
- "tpu_to0",
"tpu_to0_a",
- "tpu_to1",
+ "tpu_to0_b",
"tpu_to1_a",
- "tpu_to2",
+ "tpu_to1_b",
"tpu_to2_a",
- "tpu_to3",
+ "tpu_to2_b",
"tpu_to3_a",
+ "tpu_to3_b",
};
static const char * const tsn0_groups[] = {
diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
index c1477f657839..5370bbdf2e1a 100644
--- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
+++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
@@ -878,7 +878,7 @@ static int ti_iodelay_probe(struct platform_device *pdev)
iod->desc.name = dev_name(dev);
iod->desc.owner = THIS_MODULE;
- ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl);
+ ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl);
if (ret) {
dev_err(dev, "Failed to register pinctrl\n");
goto exit_out;
@@ -886,7 +886,11 @@ static int ti_iodelay_probe(struct platform_device *pdev)
platform_set_drvdata(pdev, iod);
- return pinctrl_enable(iod->pctl);
+ ret = pinctrl_enable(iod->pctl);
+ if (ret)
+ goto exit_out;
+
+ return 0;
exit_out:
of_node_put(np);
@@ -903,12 +907,6 @@ static int ti_iodelay_remove(struct platform_device *pdev)
{
struct ti_iodelay_device *iod = platform_get_drvdata(pdev);
- if (!iod)
- return 0;
-
- if (iod->pctl)
- pinctrl_unregister(iod->pctl);
-
ti_iodelay_pinconf_deinit_dev(iod);
/* Expect other allocations to be freed by devm */
diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c
index c876120e0ebc..793c8c4bf35b 100644
--- a/drivers/platform/chrome/cros_ec_debugfs.c
+++ b/drivers/platform/chrome/cros_ec_debugfs.c
@@ -329,6 +329,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec)
if (!msg)
return 0;
+ msg->version = 1;
msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset;
msg->outsize = sizeof(*params);
msg->insize = sizeof(*response);
diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c
index d8c5f9195f85..2ac2f31090f9 100644
--- a/drivers/platform/mips/cpu_hwmon.c
+++ b/drivers/platform/mips/cpu_hwmon.c
@@ -139,6 +139,9 @@ static int __init loongson_hwmon_init(void)
csr_temp_enable = csr_readl(LOONGSON_CSR_FEATURES) &
LOONGSON_CSRF_TEMP;
+ if (!csr_temp_enable && !loongson_chiptemp[0])
+ return -ENODEV;
+
nr_packages = loongson_sysconf.nr_cpus /
loongson_sysconf.cores_per_package;
diff --git a/drivers/pwm/pwm-atmel-tcb.c b/drivers/pwm/pwm-atmel-tcb.c
index c00dd37c5fbd..06df8c612741 100644
--- a/drivers/pwm/pwm-atmel-tcb.c
+++ b/drivers/pwm/pwm-atmel-tcb.c
@@ -82,7 +82,8 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
tcbpwm->period = 0;
tcbpwm->div = 0;
- spin_lock(&tcbpwmc->lock);
+ guard(spinlock)(&tcbpwmc->lock);
+
regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
/*
* Get init config from Timer Counter registers if
@@ -108,7 +109,6 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
cmr |= ATMEL_TC_WAVE | ATMEL_TC_WAVESEL_UP_AUTO | ATMEL_TC_EEVT_XC0;
regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), cmr);
- spin_unlock(&tcbpwmc->lock);
return 0;
}
@@ -138,7 +138,6 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm,
if (tcbpwm->duty == 0)
polarity = !polarity;
- spin_lock(&tcbpwmc->lock);
regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
/* flush old setting and set the new one */
@@ -173,8 +172,6 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm,
ATMEL_TC_SWTRG);
tcbpwmc->bkup.enabled = 0;
}
-
- spin_unlock(&tcbpwmc->lock);
}
static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
@@ -195,7 +192,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
if (tcbpwm->duty == 0)
polarity = !polarity;
- spin_lock(&tcbpwmc->lock);
regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
/* flush old setting and set the new one */
@@ -257,7 +253,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CCR),
ATMEL_TC_SWTRG | ATMEL_TC_CLKEN);
tcbpwmc->bkup.enabled = 1;
- spin_unlock(&tcbpwmc->lock);
return 0;
}
@@ -342,9 +337,12 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
const struct pwm_state *state)
{
+ struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
int duty_cycle, period;
int ret;
+ guard(spinlock)(&tcbpwmc->lock);
+
if (!state->enabled) {
atmel_tcb_pwm_disable(chip, pwm, state->polarity);
return 0;
diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c
index 9bdab6c24fba..b91a14c895be 100644
--- a/drivers/pwm/pwm-stm32.c
+++ b/drivers/pwm/pwm-stm32.c
@@ -456,8 +456,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
enabled = pwm->state.enabled;
- if (enabled && !state->enabled) {
- stm32_pwm_disable(priv, pwm->hwpwm);
+ if (!state->enabled) {
+ if (enabled)
+ stm32_pwm_disable(priv, pwm->hwpwm);
return 0;
}
diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c
index 8bb293b9f327..cfee164dd645 100644
--- a/drivers/remoteproc/imx_rproc.c
+++ b/drivers/remoteproc/imx_rproc.c
@@ -729,31 +729,37 @@ static int imx_rproc_addr_init(struct imx_rproc *priv,
struct resource res;
node = of_parse_phandle(np, "memory-region", a);
+ if (!node)
+ continue;
/* Not map vdevbuffer, vdevring region */
if (!strncmp(node->name, "vdev", strlen("vdev"))) {
of_node_put(node);
continue;
}
err = of_address_to_resource(node, 0, &res);
- of_node_put(node);
if (err) {
dev_err(dev, "unable to resolve memory region\n");
+ of_node_put(node);
return err;
}
- if (b >= IMX_RPROC_MEM_MAX)
+ if (b >= IMX_RPROC_MEM_MAX) {
+ of_node_put(node);
break;
+ }
/* Not use resource version, because we might share region */
priv->mem[b].cpu_addr = devm_ioremap_wc(&pdev->dev, res.start, resource_size(&res));
if (!priv->mem[b].cpu_addr) {
dev_err(dev, "failed to remap %pr\n", &res);
+ of_node_put(node);
return -ENOMEM;
}
priv->mem[b].sys_addr = res.start;
priv->mem[b].size = resource_size(&res);
if (!strcmp(node->name, "rsc-table"))
priv->rsc_table = priv->mem[b].cpu_addr;
+ of_node_put(node);
b++;
}
diff --git a/drivers/remoteproc/stm32_rproc.c b/drivers/remoteproc/stm32_rproc.c
index 61794c9c080f..c786badf08fa 100644
--- a/drivers/remoteproc/stm32_rproc.c
+++ b/drivers/remoteproc/stm32_rproc.c
@@ -294,7 +294,7 @@ static void stm32_rproc_mb_vq_work(struct work_struct *work)
mutex_lock(&rproc->lock);
- if (rproc->state != RPROC_RUNNING)
+ if (rproc->state != RPROC_RUNNING && rproc->state != RPROC_ATTACHED)
goto unlock_mutex;
if (rproc_vq_interrupt(rproc, mb->vq_id) == IRQ_NONE)
diff --git a/drivers/rtc/interface.c b/drivers/rtc/interface.c
index 1b63111cdda2..0b23706d9fd3 100644
--- a/drivers/rtc/interface.c
+++ b/drivers/rtc/interface.c
@@ -274,10 +274,9 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
return err;
/* full-function RTCs won't have such missing fields */
- if (rtc_valid_tm(&alarm->time) == 0) {
- rtc_add_offset(rtc, &alarm->time);
- return 0;
- }
+ err = rtc_valid_tm(&alarm->time);
+ if (!err)
+ goto done;
/* get the "after" timestamp, to detect wrapped fields */
err = rtc_read_time(rtc, &now);
@@ -379,6 +378,8 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
if (err && alarm->enabled)
dev_warn(&rtc->dev, "invalid alarm value: %ptR\n",
&alarm->time);
+ else
+ rtc_add_offset(rtc, &alarm->time);
return err;
}
diff --git a/drivers/rtc/rtc-abx80x.c b/drivers/rtc/rtc-abx80x.c
index fde2b8054c2e..1298962402ff 100644
--- a/drivers/rtc/rtc-abx80x.c
+++ b/drivers/rtc/rtc-abx80x.c
@@ -705,14 +705,18 @@ static int abx80x_nvmem_xfer(struct abx80x_priv *priv, unsigned int offset,
if (ret)
return ret;
- if (write)
+ if (write) {
ret = i2c_smbus_write_i2c_block_data(priv->client, reg,
len, val);
- else
+ if (ret)
+ return ret;
+ } else {
ret = i2c_smbus_read_i2c_block_data(priv->client, reg,
len, val);
- if (ret)
- return ret;
+ if (ret <= 0)
+ return ret ? ret : -EIO;
+ len = ret;
+ }
offset += len;
val += len;
diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c
index 7d99cd2c37a0..35dca2accbb8 100644
--- a/drivers/rtc/rtc-cmos.c
+++ b/drivers/rtc/rtc-cmos.c
@@ -643,11 +643,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
size_t count)
{
unsigned char *buf = val;
- int retval;
off += NVRAM_OFFSET;
spin_lock_irq(&rtc_lock);
- for (retval = 0; count; count--, off++, retval++) {
+ for (; count; count--, off++) {
if (off < 128)
*buf++ = CMOS_READ(off);
else if (can_bank2)
@@ -657,7 +656,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
}
spin_unlock_irq(&rtc_lock);
- return retval;
+ return count ? -EIO : 0;
}
static int cmos_nvram_write(void *priv, unsigned int off, void *val,
@@ -665,7 +664,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
{
struct cmos_rtc *cmos = priv;
unsigned char *buf = val;
- int retval;
/* NOTE: on at least PCs and Ataris, the boot firmware uses a
* checksum on part of the NVRAM data. That's currently ignored
@@ -674,7 +672,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
*/
off += NVRAM_OFFSET;
spin_lock_irq(&rtc_lock);
- for (retval = 0; count; count--, off++, retval++) {
+ for (; count; count--, off++) {
/* don't trash RTC registers */
if (off == cmos->day_alrm
|| off == cmos->mon_alrm
@@ -689,7 +687,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
}
spin_unlock_irq(&rtc_lock);
- return retval;
+ return count ? -EIO : 0;
}
/*----------------------------------------------------------------*/
diff --git a/drivers/rtc/rtc-isl1208.c b/drivers/rtc/rtc-isl1208.c
index e50c23ee1646..206f96b90f58 100644
--- a/drivers/rtc/rtc-isl1208.c
+++ b/drivers/rtc/rtc-isl1208.c
@@ -775,14 +775,13 @@ static int isl1208_nvmem_read(void *priv, unsigned int off, void *buf,
{
struct isl1208_state *isl1208 = priv;
struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
- int ret;
/* nvmem sanitizes offset/count for us, but count==0 is possible */
if (!count)
return count;
- ret = isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
+
+ return isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
count);
- return ret == 0 ? count : ret;
}
static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
@@ -790,15 +789,13 @@ static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
{
struct isl1208_state *isl1208 = priv;
struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
- int ret;
/* nvmem sanitizes off/count for us, but count==0 is possible */
if (!count)
return count;
- ret = isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
- count);
- return ret == 0 ? count : ret;
+ return isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
+ count);
}
static const struct nvmem_config isl1208_nvmem_config = {
diff --git a/drivers/s390/block/dasd_devmap.c b/drivers/s390/block/dasd_devmap.c
index c4e36650c426..91522dba9fd9 100644
--- a/drivers/s390/block/dasd_devmap.c
+++ b/drivers/s390/block/dasd_devmap.c
@@ -2258,13 +2258,19 @@ static ssize_t dasd_copy_pair_store(struct device *dev,
/* allocate primary devmap if needed */
prim_devmap = dasd_find_busid(prim_busid);
- if (IS_ERR(prim_devmap))
+ if (IS_ERR(prim_devmap)) {
prim_devmap = dasd_add_busid(prim_busid, DASD_FEATURE_DEFAULT);
+ if (IS_ERR(prim_devmap))
+ return PTR_ERR(prim_devmap);
+ }
/* allocate secondary devmap if needed */
sec_devmap = dasd_find_busid(sec_busid);
- if (IS_ERR(sec_devmap))
+ if (IS_ERR(sec_devmap)) {
sec_devmap = dasd_add_busid(sec_busid, DASD_FEATURE_DEFAULT);
+ if (IS_ERR(sec_devmap))
+ return PTR_ERR(sec_devmap);
+ }
/* setting copy relation is only allowed for offline secondary */
if (sec_devmap->device)
diff --git a/drivers/scsi/lpfc/lpfc_attr.c b/drivers/scsi/lpfc/lpfc_attr.c
index 79b45ea5fdb5..8123062ec2fa 100644
--- a/drivers/scsi/lpfc/lpfc_attr.c
+++ b/drivers/scsi/lpfc/lpfc_attr.c
@@ -1904,6 +1904,11 @@ lpfc_xcvr_data_show(struct device *dev, struct device_attribute *attr,
/* Get transceiver information */
rdp_context = kmalloc(sizeof(*rdp_context), GFP_KERNEL);
+ if (!rdp_context) {
+ len = scnprintf(buf, PAGE_SIZE - len,
+ "SPF info NA: alloc failure\n");
+ return len;
+ }
rc = lpfc_get_sfp_info_wait(phba, rdp_context);
if (rc) {
diff --git a/drivers/scsi/lpfc/lpfc_hbadisc.c b/drivers/scsi/lpfc/lpfc_hbadisc.c
index 93703ab6ce03..0a01575ab06d 100644
--- a/drivers/scsi/lpfc/lpfc_hbadisc.c
+++ b/drivers/scsi/lpfc/lpfc_hbadisc.c
@@ -5782,7 +5782,7 @@ lpfc_setup_disc_node(struct lpfc_vport *vport, uint32_t did)
return NULL;
if (ndlp->nlp_state > NLP_STE_UNUSED_NODE &&
- ndlp->nlp_state < NLP_STE_PRLI_ISSUE) {
+ ndlp->nlp_state <= NLP_STE_PRLI_ISSUE) {
lpfc_disc_state_machine(vport, ndlp, NULL,
NLP_EVT_DEVICE_RECOVERY);
}
diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c
index 19bb64bdd88b..52dc9604f567 100644
--- a/drivers/scsi/qla2xxx/qla_bsg.c
+++ b/drivers/scsi/qla2xxx/qla_bsg.c
@@ -324,7 +324,7 @@ qla2x00_process_els(struct bsg_job *bsg_job)
"request_sg_cnt=%x reply_sg_cnt=%x.\n",
bsg_job->request_payload.sg_cnt,
bsg_job->reply_payload.sg_cnt);
- rval = -EPERM;
+ rval = -ENOBUFS;
goto done;
}
@@ -3059,17 +3059,61 @@ qla24xx_bsg_request(struct bsg_job *bsg_job)
return ret;
}
-int
-qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+static bool qla_bsg_found(struct qla_qpair *qpair, struct bsg_job *bsg_job)
{
+ bool found = false;
struct fc_bsg_reply *bsg_reply = bsg_job->reply;
scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
struct qla_hw_data *ha = vha->hw;
- srb_t *sp;
- int cnt, que;
+ srb_t *sp = NULL;
+ int cnt;
unsigned long flags;
struct req_que *req;
+ spin_lock_irqsave(qpair->qp_lock_ptr, flags);
+ req = qpair->req;
+
+ for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
+ sp = req->outstanding_cmds[cnt];
+ if (sp &&
+ (sp->type == SRB_CT_CMD ||
+ sp->type == SRB_ELS_CMD_HST ||
+ sp->type == SRB_ELS_CMD_HST_NOLOGIN) &&
+ sp->u.bsg_job == bsg_job) {
+ req->outstanding_cmds[cnt] = NULL;
+ spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+ if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
+ ql_log(ql_log_warn, vha, 0x7089,
+ "mbx abort_command failed.\n");
+ bsg_reply->result = -EIO;
+ } else {
+ ql_dbg(ql_dbg_user, vha, 0x708a,
+ "mbx abort_command success.\n");
+ bsg_reply->result = 0;
+ }
+ /* ref: INIT */
+ kref_put(&sp->cmd_kref, qla2x00_sp_release);
+
+ found = true;
+ goto done;
+ }
+ }
+ spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+done:
+ return found;
+}
+
+int
+qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+{
+ struct fc_bsg_reply *bsg_reply = bsg_job->reply;
+ scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
+ struct qla_hw_data *ha = vha->hw;
+ int i;
+ struct qla_qpair *qpair;
+
ql_log(ql_log_info, vha, 0x708b, "%s CMD timeout. bsg ptr %p.\n",
__func__, bsg_job);
@@ -3079,48 +3123,22 @@ qla24xx_bsg_timeout(struct bsg_job *bsg_job)
qla_pci_set_eeh_busy(vha);
}
+ if (qla_bsg_found(ha->base_qpair, bsg_job))
+ goto done;
+
/* find the bsg job from the active list of commands */
- spin_lock_irqsave(&ha->hardware_lock, flags);
- for (que = 0; que < ha->max_req_queues; que++) {
- req = ha->req_q_map[que];
- if (!req)
+ for (i = 0; i < ha->max_qpairs; i++) {
+ qpair = vha->hw->queue_pair_map[i];
+ if (!qpair)
continue;
-
- for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
- sp = req->outstanding_cmds[cnt];
- if (sp &&
- (sp->type == SRB_CT_CMD ||
- sp->type == SRB_ELS_CMD_HST ||
- sp->type == SRB_ELS_CMD_HST_NOLOGIN ||
- sp->type == SRB_FXIOCB_BCMD) &&
- sp->u.bsg_job == bsg_job) {
- req->outstanding_cmds[cnt] = NULL;
- spin_unlock_irqrestore(&ha->hardware_lock, flags);
-
- if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
- ql_log(ql_log_warn, vha, 0x7089,
- "mbx abort_command failed.\n");
- bsg_reply->result = -EIO;
- } else {
- ql_dbg(ql_dbg_user, vha, 0x708a,
- "mbx abort_command success.\n");
- bsg_reply->result = 0;
- }
- spin_lock_irqsave(&ha->hardware_lock, flags);
- goto done;
-
- }
- }
+ if (qla_bsg_found(qpair, bsg_job))
+ goto done;
}
- spin_unlock_irqrestore(&ha->hardware_lock, flags);
+
ql_log(ql_log_info, vha, 0x708b, "SRB not found to abort.\n");
bsg_reply->result = -ENXIO;
- return 0;
done:
- spin_unlock_irqrestore(&ha->hardware_lock, flags);
- /* ref: INIT */
- kref_put(&sp->cmd_kref, qla2x00_sp_release);
return 0;
}
diff --git a/drivers/scsi/qla2xxx/qla_def.h b/drivers/scsi/qla2xxx/qla_def.h
index 2f49baf131e2..7cf998e3cc68 100644
--- a/drivers/scsi/qla2xxx/qla_def.h
+++ b/drivers/scsi/qla2xxx/qla_def.h
@@ -3309,9 +3309,20 @@ struct fab_scan_rp {
u8 node_name[8];
};
+enum scan_step {
+ FAB_SCAN_START,
+ FAB_SCAN_GPNFT_FCP,
+ FAB_SCAN_GNNFT_FCP,
+ FAB_SCAN_GPNFT_NVME,
+ FAB_SCAN_GNNFT_NVME,
+};
+
struct fab_scan {
struct fab_scan_rp *l;
u32 size;
+ u32 rscn_gen_start;
+ u32 rscn_gen_end;
+ enum scan_step step;
u16 scan_retry;
#define MAX_SCAN_RETRIES 5
enum scan_flags_t scan_flags;
@@ -3537,9 +3548,8 @@ enum qla_work_type {
QLA_EVT_RELOGIN,
QLA_EVT_ASYNC_PRLO,
QLA_EVT_ASYNC_PRLO_DONE,
- QLA_EVT_GPNFT,
- QLA_EVT_GPNFT_DONE,
- QLA_EVT_GNNFT_DONE,
+ QLA_EVT_SCAN_CMD,
+ QLA_EVT_SCAN_FINISH,
QLA_EVT_GFPNID,
QLA_EVT_SP_RETRY,
QLA_EVT_IIDMA,
@@ -5030,6 +5040,7 @@ typedef struct scsi_qla_host {
/* Counter to detect races between ELS and RSCN events */
atomic_t generation_tick;
+ atomic_t rscn_gen;
/* Time when global fcport update has been scheduled */
int total_fcport_update_gen;
/* List of pending LOGOs, protected by tgt_mutex */
diff --git a/drivers/scsi/qla2xxx/qla_gbl.h b/drivers/scsi/qla2xxx/qla_gbl.h
index 7309310d2ab9..cededfda9d0e 100644
--- a/drivers/scsi/qla2xxx/qla_gbl.h
+++ b/drivers/scsi/qla2xxx/qla_gbl.h
@@ -728,9 +728,9 @@ int qla24xx_async_gpsc(scsi_qla_host_t *, fc_port_t *);
void qla24xx_handle_gpsc_event(scsi_qla_host_t *, struct event_arg *);
int qla2x00_mgmt_svr_login(scsi_qla_host_t *);
int qla24xx_async_gffid(scsi_qla_host_t *vha, fc_port_t *fcport, bool);
-int qla24xx_async_gpnft(scsi_qla_host_t *, u8, srb_t *);
-void qla24xx_async_gpnft_done(scsi_qla_host_t *, srb_t *);
-void qla24xx_async_gnnft_done(scsi_qla_host_t *, srb_t *);
+int qla_fab_async_scan(scsi_qla_host_t *, srb_t *);
+void qla_fab_scan_start(struct scsi_qla_host *);
+void qla_fab_scan_finish(scsi_qla_host_t *, srb_t *);
int qla24xx_post_gfpnid_work(struct scsi_qla_host *, fc_port_t *);
int qla24xx_async_gfpnid(scsi_qla_host_t *, fc_port_t *);
void qla24xx_handle_gfpnid_event(scsi_qla_host_t *, struct event_arg *);
diff --git a/drivers/scsi/qla2xxx/qla_gs.c b/drivers/scsi/qla2xxx/qla_gs.c
index 1cf9d200d563..d2bddca7045a 100644
--- a/drivers/scsi/qla2xxx/qla_gs.c
+++ b/drivers/scsi/qla2xxx/qla_gs.c
@@ -1710,7 +1710,7 @@ qla2x00_hba_attributes(scsi_qla_host_t *vha, void *entries,
eiter->type = cpu_to_be16(FDMI_HBA_OPTION_ROM_VERSION);
alen = scnprintf(
eiter->a.orom_version, sizeof(eiter->a.orom_version),
- "%d.%02d", ha->bios_revision[1], ha->bios_revision[0]);
+ "%d.%02d", ha->efi_revision[1], ha->efi_revision[0]);
alen += FDMI_ATTR_ALIGNMENT(alen);
alen += FDMI_ATTR_TYPELEN(eiter);
eiter->len = cpu_to_be16(alen);
@@ -3168,7 +3168,30 @@ static int qla2x00_is_a_vp(scsi_qla_host_t *vha, u64 wwn)
return rc;
}
-void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
+static bool qla_ok_to_clear_rscn(scsi_qla_host_t *vha, fc_port_t *fcport)
+{
+ u32 rscn_gen;
+
+ rscn_gen = atomic_read(&vha->rscn_gen);
+ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2017,
+ "%s %d %8phC rscn_gen %x start %x end %x current %x\n",
+ __func__, __LINE__, fcport->port_name, fcport->rscn_gen,
+ vha->scan.rscn_gen_start, vha->scan.rscn_gen_end, rscn_gen);
+
+ if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_start,
+ vha->scan.rscn_gen_end))
+ /* rscn came in before fabric scan */
+ return true;
+
+ if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_end, rscn_gen))
+ /* rscn came in after fabric scan */
+ return false;
+
+ /* rare: fcport's scan_needed + rscn_gen must be stale */
+ return true;
+}
+
+void qla_fab_scan_finish(scsi_qla_host_t *vha, srb_t *sp)
{
fc_port_t *fcport;
u32 i, rc;
@@ -3281,10 +3304,10 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
(fcport->scan_needed &&
fcport->port_type != FCT_INITIATOR &&
fcport->port_type != FCT_NVME_INITIATOR)) {
+ fcport->scan_needed = 0;
qlt_schedule_sess_for_deletion(fcport);
}
fcport->d_id.b24 = rp->id.b24;
- fcport->scan_needed = 0;
break;
}
@@ -3325,7 +3348,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
do_delete = true;
}
- fcport->scan_needed = 0;
+ if (qla_ok_to_clear_rscn(vha, fcport))
+ fcport->scan_needed = 0;
+
if (((qla_dual_mode_enabled(vha) ||
qla_ini_mode_enabled(vha)) &&
atomic_read(&fcport->state) == FCS_ONLINE) ||
@@ -3355,7 +3380,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
fcport->port_name, fcport->loop_id,
fcport->login_retry);
}
- fcport->scan_needed = 0;
+
+ if (qla_ok_to_clear_rscn(vha, fcport))
+ fcport->scan_needed = 0;
qla24xx_fcport_handle_login(vha, fcport);
}
}
@@ -3379,14 +3406,11 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
}
}
-static int qla2x00_post_gnnft_gpnft_done_work(struct scsi_qla_host *vha,
+static int qla2x00_post_next_scan_work(struct scsi_qla_host *vha,
srb_t *sp, int cmd)
{
struct qla_work_evt *e;
- if (cmd != QLA_EVT_GPNFT_DONE && cmd != QLA_EVT_GNNFT_DONE)
- return QLA_PARAMETER_ERROR;
-
e = qla2x00_alloc_work(vha, cmd);
if (!e)
return QLA_FUNCTION_FAILED;
@@ -3396,37 +3420,15 @@ static int qla2x00_post_gnnft_gpnft_done_work(struct scsi_qla_host *vha,
return qla2x00_post_work(vha, e);
}
-static int qla2x00_post_nvme_gpnft_work(struct scsi_qla_host *vha,
- srb_t *sp, int cmd)
-{
- struct qla_work_evt *e;
-
- if (cmd != QLA_EVT_GPNFT)
- return QLA_PARAMETER_ERROR;
-
- e = qla2x00_alloc_work(vha, cmd);
- if (!e)
- return QLA_FUNCTION_FAILED;
-
- e->u.gpnft.fc4_type = FC4_TYPE_NVME;
- e->u.gpnft.sp = sp;
-
- return qla2x00_post_work(vha, e);
-}
-
static void qla2x00_find_free_fcp_nvme_slot(struct scsi_qla_host *vha,
struct srb *sp)
{
struct qla_hw_data *ha = vha->hw;
int num_fibre_dev = ha->max_fibre_devices;
- struct ct_sns_req *ct_req =
- (struct ct_sns_req *)sp->u.iocb_cmd.u.ctarg.req;
struct ct_sns_gpnft_rsp *ct_rsp =
(struct ct_sns_gpnft_rsp *)sp->u.iocb_cmd.u.ctarg.rsp;
struct ct_sns_gpn_ft_data *d;
struct fab_scan_rp *rp;
- u16 cmd = be16_to_cpu(ct_req->command);
- u8 fc4_type = sp->gen2;
int i, j, k;
port_id_t id;
u8 found;
@@ -3445,85 +3447,83 @@ static void qla2x00_find_free_fcp_nvme_slot(struct scsi_qla_host *vha,
if (id.b24 == 0 || wwn == 0)
continue;
- if (fc4_type == FC4_TYPE_FCP_SCSI) {
- if (cmd == GPN_FT_CMD) {
- rp = &vha->scan.l[j];
- rp->id = id;
- memcpy(rp->port_name, d->port_name, 8);
- j++;
- rp->fc4type = FS_FC4TYPE_FCP;
- } else {
- for (k = 0; k < num_fibre_dev; k++) {
- rp = &vha->scan.l[k];
- if (id.b24 == rp->id.b24) {
- memcpy(rp->node_name,
- d->port_name, 8);
- break;
- }
+ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2025,
+ "%s %06x %8ph \n",
+ __func__, id.b24, d->port_name);
+
+ switch (vha->scan.step) {
+ case FAB_SCAN_GPNFT_FCP:
+ rp = &vha->scan.l[j];
+ rp->id = id;
+ memcpy(rp->port_name, d->port_name, 8);
+ j++;
+ rp->fc4type = FS_FC4TYPE_FCP;
+ break;
+ case FAB_SCAN_GNNFT_FCP:
+ for (k = 0; k < num_fibre_dev; k++) {
+ rp = &vha->scan.l[k];
+ if (id.b24 == rp->id.b24) {
+ memcpy(rp->node_name,
+ d->port_name, 8);
+ break;
}
}
- } else {
- /* Search if the fibre device supports FC4_TYPE_NVME */
- if (cmd == GPN_FT_CMD) {
- found = 0;
-
- for (k = 0; k < num_fibre_dev; k++) {
- rp = &vha->scan.l[k];
- if (!memcmp(rp->port_name,
- d->port_name, 8)) {
- /*
- * Supports FC-NVMe & FCP
- */
- rp->fc4type |= FS_FC4TYPE_NVME;
- found = 1;
- break;
- }
+ break;
+ case FAB_SCAN_GPNFT_NVME:
+ found = 0;
+
+ for (k = 0; k < num_fibre_dev; k++) {
+ rp = &vha->scan.l[k];
+ if (!memcmp(rp->port_name, d->port_name, 8)) {
+ /*
+ * Supports FC-NVMe & FCP
+ */
+ rp->fc4type |= FS_FC4TYPE_NVME;
+ found = 1;
+ break;
}
+ }
- /* We found new FC-NVMe only port */
- if (!found) {
- for (k = 0; k < num_fibre_dev; k++) {
- rp = &vha->scan.l[k];
- if (wwn_to_u64(rp->port_name)) {
- continue;
- } else {
- rp->id = id;
- memcpy(rp->port_name,
- d->port_name, 8);
- rp->fc4type =
- FS_FC4TYPE_NVME;
- break;
- }
- }
- }
- } else {
+ /* We found new FC-NVMe only port */
+ if (!found) {
for (k = 0; k < num_fibre_dev; k++) {
rp = &vha->scan.l[k];
- if (id.b24 == rp->id.b24) {
- memcpy(rp->node_name,
- d->port_name, 8);
+ if (wwn_to_u64(rp->port_name)) {
+ continue;
+ } else {
+ rp->id = id;
+ memcpy(rp->port_name, d->port_name, 8);
+ rp->fc4type = FS_FC4TYPE_NVME;
break;
}
}
}
+ break;
+ case FAB_SCAN_GNNFT_NVME:
+ for (k = 0; k < num_fibre_dev; k++) {
+ rp = &vha->scan.l[k];
+ if (id.b24 == rp->id.b24) {
+ memcpy(rp->node_name, d->port_name, 8);
+ break;
+ }
+ }
+ break;
+ default:
+ break;
}
}
}
-static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
+static void qla_async_scan_sp_done(srb_t *sp, int res)
{
struct scsi_qla_host *vha = sp->vha;
- struct ct_sns_req *ct_req =
- (struct ct_sns_req *)sp->u.iocb_cmd.u.ctarg.req;
- u16 cmd = be16_to_cpu(ct_req->command);
- u8 fc4_type = sp->gen2;
unsigned long flags;
int rc;
/* gen2 field is holding the fc4type */
- ql_dbg(ql_dbg_disc, vha, 0xffff,
- "Async done-%s res %x FC4Type %x\n",
- sp->name, res, sp->gen2);
+ ql_dbg(ql_dbg_disc, vha, 0x2026,
+ "Async done-%s res %x step %x\n",
+ sp->name, res, vha->scan.step);
sp->rc = res;
if (res) {
@@ -3547,8 +3547,7 @@ static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
* sp for GNNFT_DONE work. This will allow all
* the resource to get freed up.
*/
- rc = qla2x00_post_gnnft_gpnft_done_work(vha, sp,
- QLA_EVT_GNNFT_DONE);
+ rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_FINISH);
if (rc) {
/* Cleanup here to prevent memory leak */
qla24xx_sp_unmap(vha, sp);
@@ -3573,28 +3572,30 @@ static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
qla2x00_find_free_fcp_nvme_slot(vha, sp);
- if ((fc4_type == FC4_TYPE_FCP_SCSI) && vha->flags.nvme_enabled &&
- cmd == GNN_FT_CMD) {
- spin_lock_irqsave(&vha->work_lock, flags);
- vha->scan.scan_flags &= ~SF_SCANNING;
- spin_unlock_irqrestore(&vha->work_lock, flags);
+ spin_lock_irqsave(&vha->work_lock, flags);
+ vha->scan.scan_flags &= ~SF_SCANNING;
+ spin_unlock_irqrestore(&vha->work_lock, flags);
- sp->rc = res;
- rc = qla2x00_post_nvme_gpnft_work(vha, sp, QLA_EVT_GPNFT);
- if (rc) {
- qla24xx_sp_unmap(vha, sp);
- set_bit(LOCAL_LOOP_UPDATE, &vha->dpc_flags);
- set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
- }
- return;
- }
+ switch (vha->scan.step) {
+ case FAB_SCAN_GPNFT_FCP:
+ case FAB_SCAN_GPNFT_NVME:
+ rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_CMD);
+ break;
+ case FAB_SCAN_GNNFT_FCP:
+ if (vha->flags.nvme_enabled)
+ rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_CMD);
+ else
+ rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_FINISH);
- if (cmd == GPN_FT_CMD) {
- rc = qla2x00_post_gnnft_gpnft_done_work(vha, sp,
- QLA_EVT_GPNFT_DONE);
- } else {
- rc = qla2x00_post_gnnft_gpnft_done_work(vha, sp,
- QLA_EVT_GNNFT_DONE);
+ break;
+ case FAB_SCAN_GNNFT_NVME:
+ rc = qla2x00_post_next_scan_work(vha, sp, QLA_EVT_SCAN_FINISH);
+ break;
+ default:
+ /* should not be here */
+ WARN_ON(1);
+ rc = QLA_FUNCTION_FAILED;
+ break;
}
if (rc) {
@@ -3605,127 +3606,16 @@ static void qla2x00_async_gpnft_gnnft_sp_done(srb_t *sp, int res)
}
}
-/*
- * Get WWNN list for fc4_type
- *
- * It is assumed the same SRB is re-used from GPNFT to avoid
- * mem free & re-alloc
- */
-static int qla24xx_async_gnnft(scsi_qla_host_t *vha, struct srb *sp,
- u8 fc4_type)
-{
- int rval = QLA_FUNCTION_FAILED;
- struct ct_sns_req *ct_req;
- struct ct_sns_pkt *ct_sns;
- unsigned long flags;
-
- if (!vha->flags.online) {
- spin_lock_irqsave(&vha->work_lock, flags);
- vha->scan.scan_flags &= ~SF_SCANNING;
- spin_unlock_irqrestore(&vha->work_lock, flags);
- goto done_free_sp;
- }
-
- if (!sp->u.iocb_cmd.u.ctarg.req || !sp->u.iocb_cmd.u.ctarg.rsp) {
- ql_log(ql_log_warn, vha, 0xffff,
- "%s: req %p rsp %p are not setup\n",
- __func__, sp->u.iocb_cmd.u.ctarg.req,
- sp->u.iocb_cmd.u.ctarg.rsp);
- spin_lock_irqsave(&vha->work_lock, flags);
- vha->scan.scan_flags &= ~SF_SCANNING;
- spin_unlock_irqrestore(&vha->work_lock, flags);
- WARN_ON(1);
- set_bit(LOCAL_LOOP_UPDATE, &vha->dpc_flags);
- set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
- goto done_free_sp;
- }
-
- ql_dbg(ql_dbg_disc, vha, 0xfffff,
- "%s: FC4Type %x, CT-PASSTHRU %s command ctarg rsp size %d, ctarg req size %d\n",
- __func__, fc4_type, sp->name, sp->u.iocb_cmd.u.ctarg.rsp_size,
- sp->u.iocb_cmd.u.ctarg.req_size);
-
- sp->type = SRB_CT_PTHRU_CMD;
- sp->name = "gnnft";
- sp->gen1 = vha->hw->base_qpair->chip_reset;
- sp->gen2 = fc4_type;
- qla2x00_init_async_sp(sp, qla2x00_get_async_timeout(vha) + 2,
- qla2x00_async_gpnft_gnnft_sp_done);
-
- memset(sp->u.iocb_cmd.u.ctarg.rsp, 0, sp->u.iocb_cmd.u.ctarg.rsp_size);
- memset(sp->u.iocb_cmd.u.ctarg.req, 0, sp->u.iocb_cmd.u.ctarg.req_size);
-
- ct_sns = (struct ct_sns_pkt *)sp->u.iocb_cmd.u.ctarg.req;
- /* CT_IU preamble */
- ct_req = qla2x00_prep_ct_req(ct_sns, GNN_FT_CMD,
- sp->u.iocb_cmd.u.ctarg.rsp_size);
-
- /* GPN_FT req */
- ct_req->req.gpn_ft.port_type = fc4_type;
-
- sp->u.iocb_cmd.u.ctarg.req_size = GNN_FT_REQ_SIZE;
- sp->u.iocb_cmd.u.ctarg.nport_handle = NPH_SNS;
-
- ql_dbg(ql_dbg_disc, vha, 0xffff,
- "Async-%s hdl=%x FC4Type %x.\n", sp->name,
- sp->handle, ct_req->req.gpn_ft.port_type);
-
- rval = qla2x00_start_sp(sp);
- if (rval != QLA_SUCCESS) {
- goto done_free_sp;
- }
-
- return rval;
-
-done_free_sp:
- if (sp->u.iocb_cmd.u.ctarg.req) {
- dma_free_coherent(&vha->hw->pdev->dev,
- sp->u.iocb_cmd.u.ctarg.req_allocated_size,
- sp->u.iocb_cmd.u.ctarg.req,
- sp->u.iocb_cmd.u.ctarg.req_dma);
- sp->u.iocb_cmd.u.ctarg.req = NULL;
- }
- if (sp->u.iocb_cmd.u.ctarg.rsp) {
- dma_free_coherent(&vha->hw->pdev->dev,
- sp->u.iocb_cmd.u.ctarg.rsp_allocated_size,
- sp->u.iocb_cmd.u.ctarg.rsp,
- sp->u.iocb_cmd.u.ctarg.rsp_dma);
- sp->u.iocb_cmd.u.ctarg.rsp = NULL;
- }
- /* ref: INIT */
- kref_put(&sp->cmd_kref, qla2x00_sp_release);
-
- spin_lock_irqsave(&vha->work_lock, flags);
- vha->scan.scan_flags &= ~SF_SCANNING;
- if (vha->scan.scan_flags == 0) {
- ql_dbg(ql_dbg_disc, vha, 0xffff,
- "%s: schedule\n", __func__);
- vha->scan.scan_flags |= SF_QUEUED;
- schedule_delayed_work(&vha->scan.scan_work, 5);
- }
- spin_unlock_irqrestore(&vha->work_lock, flags);
-
-
- return rval;
-} /* GNNFT */
-
-void qla24xx_async_gpnft_done(scsi_qla_host_t *vha, srb_t *sp)
-{
- ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
- "%s enter\n", __func__);
- qla24xx_async_gnnft(vha, sp, sp->gen2);
-}
-
/* Get WWPN list for certain fc4_type */
-int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
+int qla_fab_async_scan(scsi_qla_host_t *vha, srb_t *sp)
{
int rval = QLA_FUNCTION_FAILED;
struct ct_sns_req *ct_req;
struct ct_sns_pkt *ct_sns;
- u32 rspsz;
+ u32 rspsz = 0;
unsigned long flags;
- ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x200c,
"%s enter\n", __func__);
if (!vha->flags.online)
@@ -3734,22 +3624,21 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
spin_lock_irqsave(&vha->work_lock, flags);
if (vha->scan.scan_flags & SF_SCANNING) {
spin_unlock_irqrestore(&vha->work_lock, flags);
- ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2012,
"%s: scan active\n", __func__);
return rval;
}
vha->scan.scan_flags |= SF_SCANNING;
+ if (!sp)
+ vha->scan.step = FAB_SCAN_START;
+
spin_unlock_irqrestore(&vha->work_lock, flags);
- if (fc4_type == FC4_TYPE_FCP_SCSI) {
- ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+ switch (vha->scan.step) {
+ case FAB_SCAN_START:
+ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2018,
"%s: Performing FCP Scan\n", __func__);
- if (sp) {
- /* ref: INIT */
- kref_put(&sp->cmd_kref, qla2x00_sp_release);
- }
-
/* ref: INIT */
sp = qla2x00_get_sp(vha, NULL, GFP_KERNEL);
if (!sp) {
@@ -3765,7 +3654,7 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
GFP_KERNEL);
sp->u.iocb_cmd.u.ctarg.req_allocated_size = sizeof(struct ct_sns_pkt);
if (!sp->u.iocb_cmd.u.ctarg.req) {
- ql_log(ql_log_warn, vha, 0xffff,
+ ql_log(ql_log_warn, vha, 0x201a,
"Failed to allocate ct_sns request.\n");
spin_lock_irqsave(&vha->work_lock, flags);
vha->scan.scan_flags &= ~SF_SCANNING;
@@ -3773,7 +3662,6 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
qla2x00_rel_sp(sp);
return rval;
}
- sp->u.iocb_cmd.u.ctarg.req_size = GPN_FT_REQ_SIZE;
rspsz = sizeof(struct ct_sns_gpnft_rsp) +
vha->hw->max_fibre_devices *
@@ -3785,7 +3673,7 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
GFP_KERNEL);
sp->u.iocb_cmd.u.ctarg.rsp_allocated_size = rspsz;
if (!sp->u.iocb_cmd.u.ctarg.rsp) {
- ql_log(ql_log_warn, vha, 0xffff,
+ ql_log(ql_log_warn, vha, 0x201b,
"Failed to allocate ct_sns request.\n");
spin_lock_irqsave(&vha->work_lock, flags);
vha->scan.scan_flags &= ~SF_SCANNING;
@@ -3805,35 +3693,95 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
"%s scan list size %d\n", __func__, vha->scan.size);
memset(vha->scan.l, 0, vha->scan.size);
- } else if (!sp) {
- ql_dbg(ql_dbg_disc, vha, 0xffff,
- "NVME scan did not provide SP\n");
+
+ vha->scan.step = FAB_SCAN_GPNFT_FCP;
+ break;
+ case FAB_SCAN_GPNFT_FCP:
+ vha->scan.step = FAB_SCAN_GNNFT_FCP;
+ break;
+ case FAB_SCAN_GNNFT_FCP:
+ vha->scan.step = FAB_SCAN_GPNFT_NVME;
+ break;
+ case FAB_SCAN_GPNFT_NVME:
+ vha->scan.step = FAB_SCAN_GNNFT_NVME;
+ break;
+ case FAB_SCAN_GNNFT_NVME:
+ default:
+ /* should not be here */
+ WARN_ON(1);
+ goto done_free_sp;
+ }
+
+ if (!sp) {
+ ql_dbg(ql_dbg_disc, vha, 0x201c,
+ "scan did not provide SP\n");
return rval;
}
+ if (!sp->u.iocb_cmd.u.ctarg.req || !sp->u.iocb_cmd.u.ctarg.rsp) {
+ ql_log(ql_log_warn, vha, 0x201d,
+ "%s: req %p rsp %p are not setup\n",
+ __func__, sp->u.iocb_cmd.u.ctarg.req,
+ sp->u.iocb_cmd.u.ctarg.rsp);
+ spin_lock_irqsave(&vha->work_lock, flags);
+ vha->scan.scan_flags &= ~SF_SCANNING;
+ spin_unlock_irqrestore(&vha->work_lock, flags);
+ WARN_ON(1);
+ set_bit(LOCAL_LOOP_UPDATE, &vha->dpc_flags);
+ set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
+ goto done_free_sp;
+ }
+
+ rspsz = sp->u.iocb_cmd.u.ctarg.rsp_size;
+ memset(sp->u.iocb_cmd.u.ctarg.req, 0, sp->u.iocb_cmd.u.ctarg.req_size);
+ memset(sp->u.iocb_cmd.u.ctarg.rsp, 0, sp->u.iocb_cmd.u.ctarg.rsp_size);
+
sp->type = SRB_CT_PTHRU_CMD;
- sp->name = "gpnft";
sp->gen1 = vha->hw->base_qpair->chip_reset;
- sp->gen2 = fc4_type;
qla2x00_init_async_sp(sp, qla2x00_get_async_timeout(vha) + 2,
- qla2x00_async_gpnft_gnnft_sp_done);
-
- rspsz = sp->u.iocb_cmd.u.ctarg.rsp_size;
- memset(sp->u.iocb_cmd.u.ctarg.rsp, 0, sp->u.iocb_cmd.u.ctarg.rsp_size);
- memset(sp->u.iocb_cmd.u.ctarg.req, 0, sp->u.iocb_cmd.u.ctarg.req_size);
+ qla_async_scan_sp_done);
ct_sns = (struct ct_sns_pkt *)sp->u.iocb_cmd.u.ctarg.req;
- /* CT_IU preamble */
- ct_req = qla2x00_prep_ct_req(ct_sns, GPN_FT_CMD, rspsz);
- /* GPN_FT req */
- ct_req->req.gpn_ft.port_type = fc4_type;
+ /* CT_IU preamble */
+ switch (vha->scan.step) {
+ case FAB_SCAN_GPNFT_FCP:
+ sp->name = "gpnft";
+ ct_req = qla2x00_prep_ct_req(ct_sns, GPN_FT_CMD, rspsz);
+ ct_req->req.gpn_ft.port_type = FC4_TYPE_FCP_SCSI;
+ sp->u.iocb_cmd.u.ctarg.req_size = GPN_FT_REQ_SIZE;
+ break;
+ case FAB_SCAN_GNNFT_FCP:
+ sp->name = "gnnft";
+ ct_req = qla2x00_prep_ct_req(ct_sns, GNN_FT_CMD, rspsz);
+ ct_req->req.gpn_ft.port_type = FC4_TYPE_FCP_SCSI;
+ sp->u.iocb_cmd.u.ctarg.req_size = GNN_FT_REQ_SIZE;
+ break;
+ case FAB_SCAN_GPNFT_NVME:
+ sp->name = "gpnft";
+ ct_req = qla2x00_prep_ct_req(ct_sns, GPN_FT_CMD, rspsz);
+ ct_req->req.gpn_ft.port_type = FC4_TYPE_NVME;
+ sp->u.iocb_cmd.u.ctarg.req_size = GPN_FT_REQ_SIZE;
+ break;
+ case FAB_SCAN_GNNFT_NVME:
+ sp->name = "gnnft";
+ ct_req = qla2x00_prep_ct_req(ct_sns, GNN_FT_CMD, rspsz);
+ ct_req->req.gpn_ft.port_type = FC4_TYPE_NVME;
+ sp->u.iocb_cmd.u.ctarg.req_size = GNN_FT_REQ_SIZE;
+ break;
+ default:
+ /* should not be here */
+ WARN_ON(1);
+ goto done_free_sp;
+ }
sp->u.iocb_cmd.u.ctarg.nport_handle = NPH_SNS;
- ql_dbg(ql_dbg_disc, vha, 0xffff,
- "Async-%s hdl=%x FC4Type %x.\n", sp->name,
- sp->handle, ct_req->req.gpn_ft.port_type);
+ ql_dbg(ql_dbg_disc, vha, 0x2003,
+ "%s: step %d, rsp size %d, req size %d hdl %x %s FC4TYPE %x \n",
+ __func__, vha->scan.step, sp->u.iocb_cmd.u.ctarg.rsp_size,
+ sp->u.iocb_cmd.u.ctarg.req_size, sp->handle, sp->name,
+ ct_req->req.gpn_ft.port_type);
rval = qla2x00_start_sp(sp);
if (rval != QLA_SUCCESS) {
@@ -3864,7 +3812,7 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
spin_lock_irqsave(&vha->work_lock, flags);
vha->scan.scan_flags &= ~SF_SCANNING;
if (vha->scan.scan_flags == 0) {
- ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0xffff,
+ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2007,
"%s: Scan scheduled.\n", __func__);
vha->scan.scan_flags |= SF_QUEUED;
schedule_delayed_work(&vha->scan.scan_work, 5);
@@ -3875,6 +3823,15 @@ int qla24xx_async_gpnft(scsi_qla_host_t *vha, u8 fc4_type, srb_t *sp)
return rval;
}
+void qla_fab_scan_start(struct scsi_qla_host *vha)
+{
+ int rval;
+
+ rval = qla_fab_async_scan(vha, NULL);
+ if (rval)
+ set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
+}
+
void qla_scan_work_fn(struct work_struct *work)
{
struct fab_scan *s = container_of(to_delayed_work(work),
diff --git a/drivers/scsi/qla2xxx/qla_init.c b/drivers/scsi/qla2xxx/qla_init.c
index 8377624d76c9..eda3bdab934d 100644
--- a/drivers/scsi/qla2xxx/qla_init.c
+++ b/drivers/scsi/qla2xxx/qla_init.c
@@ -1842,10 +1842,18 @@ int qla24xx_post_newsess_work(struct scsi_qla_host *vha, port_id_t *id,
return qla2x00_post_work(vha, e);
}
+static void qla_rscn_gen_tick(scsi_qla_host_t *vha, u32 *ret_rscn_gen)
+{
+ *ret_rscn_gen = atomic_inc_return(&vha->rscn_gen);
+ /* memory barrier */
+ wmb();
+}
+
void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
{
fc_port_t *fcport;
unsigned long flags;
+ u32 rscn_gen;
switch (ea->id.b.rsvd_1) {
case RSCN_PORT_ADDR:
@@ -1875,15 +1883,16 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
* Otherwise we're already in the middle of a relogin
*/
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ qla_rscn_gen_tick(vha, &fcport->rscn_gen);
}
} else {
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ qla_rscn_gen_tick(vha, &fcport->rscn_gen);
}
}
break;
case RSCN_AREA_ADDR:
+ qla_rscn_gen_tick(vha, &rscn_gen);
list_for_each_entry(fcport, &vha->vp_fcports, list) {
if (fcport->flags & FCF_FCP2_DEVICE &&
atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1891,11 +1900,12 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
if ((ea->id.b24 & 0xffff00) == (fcport->d_id.b24 & 0xffff00)) {
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ fcport->rscn_gen = rscn_gen;
}
}
break;
case RSCN_DOM_ADDR:
+ qla_rscn_gen_tick(vha, &rscn_gen);
list_for_each_entry(fcport, &vha->vp_fcports, list) {
if (fcport->flags & FCF_FCP2_DEVICE &&
atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1903,19 +1913,20 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
if ((ea->id.b24 & 0xff0000) == (fcport->d_id.b24 & 0xff0000)) {
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ fcport->rscn_gen = rscn_gen;
}
}
break;
case RSCN_FAB_ADDR:
default:
+ qla_rscn_gen_tick(vha, &rscn_gen);
list_for_each_entry(fcport, &vha->vp_fcports, list) {
if (fcport->flags & FCF_FCP2_DEVICE &&
atomic_read(&fcport->state) == FCS_ONLINE)
continue;
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ fcport->rscn_gen = rscn_gen;
}
break;
}
@@ -1924,6 +1935,7 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
if (vha->scan.scan_flags == 0) {
ql_dbg(ql_dbg_disc, vha, 0xffff, "%s: schedule\n", __func__);
vha->scan.scan_flags |= SF_QUEUED;
+ vha->scan.rscn_gen_start = atomic_read(&vha->rscn_gen);
schedule_delayed_work(&vha->scan.scan_work, 5);
}
spin_unlock_irqrestore(&vha->work_lock, flags);
@@ -6393,10 +6405,9 @@ qla2x00_configure_fabric(scsi_qla_host_t *vha)
qlt_do_generation_tick(vha, &discovery_gen);
if (USE_ASYNC_SCAN(ha)) {
- rval = qla24xx_async_gpnft(vha, FC4_TYPE_FCP_SCSI,
- NULL);
- if (rval)
- set_bit(LOOP_RESYNC_NEEDED, &vha->dpc_flags);
+ /* start of scan begins here */
+ vha->scan.rscn_gen_end = atomic_read(&vha->rscn_gen);
+ qla_fab_scan_start(vha);
} else {
list_for_each_entry(fcport, &vha->vp_fcports, list)
fcport->scan_state = QLA_FCPORT_SCAN;
@@ -8207,15 +8218,21 @@ qla28xx_get_aux_images(
struct qla27xx_image_status pri_aux_image_status, sec_aux_image_status;
bool valid_pri_image = false, valid_sec_image = false;
bool active_pri_image = false, active_sec_image = false;
+ int rc;
if (!ha->flt_region_aux_img_status_pri) {
ql_dbg(ql_dbg_init, vha, 0x018a, "Primary aux image not addressed\n");
goto check_sec_image;
}
- qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
+ rc = qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
ha->flt_region_aux_img_status_pri,
sizeof(pri_aux_image_status) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a1,
+ "Unable to read Primary aux image(%x).\n", rc);
+ goto check_sec_image;
+ }
qla27xx_print_image(vha, "Primary aux image", &pri_aux_image_status);
if (qla28xx_check_aux_image_status_signature(&pri_aux_image_status)) {
@@ -8246,9 +8263,15 @@ qla28xx_get_aux_images(
goto check_valid_image;
}
- qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
+ rc = qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
ha->flt_region_aux_img_status_sec,
sizeof(sec_aux_image_status) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a2,
+ "Unable to read Secondary aux image(%x).\n", rc);
+ goto check_valid_image;
+ }
+
qla27xx_print_image(vha, "Secondary aux image", &sec_aux_image_status);
if (qla28xx_check_aux_image_status_signature(&sec_aux_image_status)) {
@@ -8306,6 +8329,7 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
struct qla27xx_image_status pri_image_status, sec_image_status;
bool valid_pri_image = false, valid_sec_image = false;
bool active_pri_image = false, active_sec_image = false;
+ int rc;
if (!ha->flt_region_img_status_pri) {
ql_dbg(ql_dbg_init, vha, 0x018a, "Primary image not addressed\n");
@@ -8347,8 +8371,14 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
goto check_valid_image;
}
- qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
+ rc = qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
ha->flt_region_img_status_sec, sizeof(sec_image_status) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a3,
+ "Unable to read Secondary image status(%x).\n", rc);
+ goto check_valid_image;
+ }
+
qla27xx_print_image(vha, "Secondary image", &sec_image_status);
if (qla27xx_check_image_status_signature(&sec_image_status)) {
@@ -8420,11 +8450,10 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
"FW: Loading firmware from flash (%x).\n", faddr);
dcode = (uint32_t *)req->ring;
- qla24xx_read_flash_data(vha, dcode, faddr, 8);
- if (qla24xx_risc_firmware_invalid(dcode)) {
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+ if (rval || qla24xx_risc_firmware_invalid(dcode)) {
ql_log(ql_log_fatal, vha, 0x008c,
- "Unable to verify the integrity of flash firmware "
- "image.\n");
+ "Unable to verify the integrity of flash firmware image (rval %x).\n", rval);
ql_log(ql_log_fatal, vha, 0x008d,
"Firmware data: %08x %08x %08x %08x.\n",
dcode[0], dcode[1], dcode[2], dcode[3]);
@@ -8438,7 +8467,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
for (j = 0; j < segments; j++) {
ql_dbg(ql_dbg_init, vha, 0x008d,
"-> Loading segment %u...\n", j);
- qla24xx_read_flash_data(vha, dcode, faddr, 10);
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, 10);
+ if (rval) {
+ ql_log(ql_log_fatal, vha, 0x016a,
+ "-> Unable to read segment addr + size .\n");
+ return QLA_FUNCTION_FAILED;
+ }
risc_addr = be32_to_cpu((__force __be32)dcode[2]);
risc_size = be32_to_cpu((__force __be32)dcode[3]);
if (!*srisc_addr) {
@@ -8454,7 +8488,13 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
ql_dbg(ql_dbg_init, vha, 0x008e,
"-> Loading fragment %u: %#x <- %#x (%#lx dwords)...\n",
fragment, risc_addr, faddr, dlen);
- qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+ if (rval) {
+ ql_log(ql_log_fatal, vha, 0x016b,
+ "-> Unable to read fragment(faddr %#x dlen %#lx).\n",
+ faddr, dlen);
+ return QLA_FUNCTION_FAILED;
+ }
for (i = 0; i < dlen; i++)
dcode[i] = swab32(dcode[i]);
@@ -8483,7 +8523,14 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
fwdt->length = 0;
dcode = (uint32_t *)req->ring;
- qla24xx_read_flash_data(vha, dcode, faddr, 7);
+
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, 7);
+ if (rval) {
+ ql_log(ql_log_fatal, vha, 0x016c,
+ "-> Unable to read template size.\n");
+ goto failed;
+ }
+
risc_size = be32_to_cpu((__force __be32)dcode[2]);
ql_dbg(ql_dbg_init, vha, 0x0161,
"-> fwdt%u template array at %#x (%#x dwords)\n",
@@ -8509,11 +8556,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
}
dcode = fwdt->template;
- qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
- if (!qla27xx_fwdt_template_valid(dcode)) {
+ if (rval || !qla27xx_fwdt_template_valid(dcode)) {
ql_log(ql_log_warn, vha, 0x0165,
- "-> fwdt%u failed template validate\n", j);
+ "-> fwdt%u failed template validate (rval %x)\n",
+ j, rval);
goto failed;
}
diff --git a/drivers/scsi/qla2xxx/qla_inline.h b/drivers/scsi/qla2xxx/qla_inline.h
index a4a56ab0ba74..ef4b3cc1cd77 100644
--- a/drivers/scsi/qla2xxx/qla_inline.h
+++ b/drivers/scsi/qla2xxx/qla_inline.h
@@ -631,3 +631,11 @@ static inline int qla_mapq_alloc_qp_cpu_map(struct qla_hw_data *ha)
}
return 0;
}
+
+static inline bool val_is_in_range(u32 val, u32 start, u32 end)
+{
+ if (val >= start && val <= end)
+ return true;
+ else
+ return false;
+}
diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c
index b67416951a5f..76703f2706b8 100644
--- a/drivers/scsi/qla2xxx/qla_mid.c
+++ b/drivers/scsi/qla2xxx/qla_mid.c
@@ -180,7 +180,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha)
atomic_set(&vha->loop_state, LOOP_DOWN);
atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME);
list_for_each_entry(fcport, &vha->vp_fcports, list)
- fcport->logout_on_delete = 0;
+ fcport->logout_on_delete = 1;
if (!vha->hw->flags.edif_enabled)
qla2x00_wait_for_sess_deletion(vha);
diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c
index a8ddf356e662..8f4cc136a9c9 100644
--- a/drivers/scsi/qla2xxx/qla_nvme.c
+++ b/drivers/scsi/qla2xxx/qla_nvme.c
@@ -49,7 +49,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport)
return 0;
}
- if (!vha->nvme_local_port && qla_nvme_register_hba(vha))
+ if (qla_nvme_register_hba(vha))
+ return 0;
+
+ if (!vha->nvme_local_port)
return 0;
if (!(fcport->nvme_prli_service_param &
diff --git a/drivers/scsi/qla2xxx/qla_os.c b/drivers/scsi/qla2xxx/qla_os.c
index 63f45d50bf83..da8331dbb01c 100644
--- a/drivers/scsi/qla2xxx/qla_os.c
+++ b/drivers/scsi/qla2xxx/qla_os.c
@@ -1874,14 +1874,9 @@ __qla2x00_abort_all_cmds(struct qla_qpair *qp, int res)
for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
sp = req->outstanding_cmds[cnt];
if (sp) {
- /*
- * perform lockless completion during driver unload
- */
if (qla2x00_chip_is_down(vha)) {
req->outstanding_cmds[cnt] = NULL;
- spin_unlock_irqrestore(qp->qp_lock_ptr, flags);
sp->done(sp, res);
- spin_lock_irqsave(qp->qp_lock_ptr, flags);
continue;
}
@@ -4688,7 +4683,7 @@ static void
qla2x00_number_of_exch(scsi_qla_host_t *vha, u32 *ret_cnt, u16 max_cnt)
{
u32 temp;
- struct init_cb_81xx *icb = (struct init_cb_81xx *)&vha->hw->init_cb;
+ struct init_cb_81xx *icb = (struct init_cb_81xx *)vha->hw->init_cb;
*ret_cnt = FW_DEF_EXCHANGES_CNT;
if (max_cnt > vha->hw->max_exchg)
@@ -5562,15 +5557,11 @@ qla2x00_do_work(struct scsi_qla_host *vha)
qla2x00_async_prlo_done(vha, e->u.logio.fcport,
e->u.logio.data);
break;
- case QLA_EVT_GPNFT:
- qla24xx_async_gpnft(vha, e->u.gpnft.fc4_type,
- e->u.gpnft.sp);
- break;
- case QLA_EVT_GPNFT_DONE:
- qla24xx_async_gpnft_done(vha, e->u.iosb.sp);
+ case QLA_EVT_SCAN_CMD:
+ qla_fab_async_scan(vha, e->u.iosb.sp);
break;
- case QLA_EVT_GNNFT_DONE:
- qla24xx_async_gnnft_done(vha, e->u.iosb.sp);
+ case QLA_EVT_SCAN_FINISH:
+ qla_fab_scan_finish(vha, e->u.iosb.sp);
break;
case QLA_EVT_GFPNID:
qla24xx_async_gfpnid(vha, e->u.fcport.fcport);
diff --git a/drivers/scsi/qla2xxx/qla_sup.c b/drivers/scsi/qla2xxx/qla_sup.c
index c092a6b1ced4..6d16546e1729 100644
--- a/drivers/scsi/qla2xxx/qla_sup.c
+++ b/drivers/scsi/qla2xxx/qla_sup.c
@@ -555,6 +555,7 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
struct qla_flt_location *fltl = (void *)req->ring;
uint32_t *dcode = (uint32_t *)req->ring;
uint8_t *buf = (void *)req->ring, *bcode, last_image;
+ int rc;
/*
* FLT-location structure resides after the last PCI region.
@@ -584,14 +585,24 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
pcihdr = 0;
do {
/* Verify PCI expansion ROM header. */
- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x016d,
+ "Unable to read PCI Expansion Rom Header (%x).\n", rc);
+ return QLA_FUNCTION_FAILED;
+ }
bcode = buf + (pcihdr % 4);
if (bcode[0x0] != 0x55 || bcode[0x1] != 0xaa)
goto end;
/* Locate PCI data structure. */
pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
- qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ rc = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x0179,
+ "Unable to read PCI Data Structure (%x).\n", rc);
+ return QLA_FUNCTION_FAILED;
+ }
bcode = buf + (pcihdr % 4);
/* Validate signature of PCI data structure. */
@@ -606,7 +617,12 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
} while (!last_image);
/* Now verify FLT-location structure. */
- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+ rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x017a,
+ "Unable to read FLT (%x).\n", rc);
+ return QLA_FUNCTION_FAILED;
+ }
if (memcmp(fltl->sig, "QFLT", 4))
goto end;
@@ -2605,13 +2621,18 @@ qla24xx_read_optrom_data(struct scsi_qla_host *vha, void *buf,
uint32_t offset, uint32_t length)
{
struct qla_hw_data *ha = vha->hw;
+ int rc;
/* Suspend HBA. */
scsi_block_requests(vha->host);
set_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
/* Go with read. */
- qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+ rc = qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a0,
+ "Unable to perform optrom read(%x).\n", rc);
+ }
/* Resume HBA. */
clear_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
@@ -3412,7 +3433,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
struct active_regions active_regions = { };
if (IS_P3P_TYPE(ha))
- return ret;
+ return QLA_SUCCESS;
if (!mbuf)
return QLA_FUNCTION_FAILED;
@@ -3432,20 +3453,31 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
do {
/* Verify PCI expansion ROM header. */
- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ ret = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x017d,
+ "Unable to read PCI EXP Rom Header(%x).\n", ret);
+ return QLA_FUNCTION_FAILED;
+ }
+
bcode = mbuf + (pcihdr % 4);
if (memcmp(bcode, "\x55\xaa", 2)) {
/* No signature */
ql_log(ql_log_fatal, vha, 0x0059,
"No matching ROM signature.\n");
- ret = QLA_FUNCTION_FAILED;
- break;
+ return QLA_FUNCTION_FAILED;
}
/* Locate PCI data structure. */
pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
- qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ ret = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x018e,
+ "Unable to read PCI Data Structure (%x).\n", ret);
+ return QLA_FUNCTION_FAILED;
+ }
+
bcode = mbuf + (pcihdr % 4);
/* Validate signature of PCI data structure. */
@@ -3454,8 +3486,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
ql_log(ql_log_fatal, vha, 0x005a,
"PCI data struct not found pcir_adr=%x.\n", pcids);
ql_dump_buffer(ql_dbg_init, vha, 0x0059, dcode, 32);
- ret = QLA_FUNCTION_FAILED;
- break;
+ return QLA_FUNCTION_FAILED;
}
/* Read version */
@@ -3507,20 +3538,26 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
faddr = ha->flt_region_fw_sec;
}
- qla24xx_read_flash_data(vha, dcode, faddr, 8);
- if (qla24xx_risc_firmware_invalid(dcode)) {
- ql_log(ql_log_warn, vha, 0x005f,
- "Unrecognized fw revision at %x.\n",
- ha->flt_region_fw * 4);
- ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+ ret = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x019e,
+ "Unable to read FW version (%x).\n", ret);
+ return ret;
} else {
- for (i = 0; i < 4; i++)
- ha->fw_revision[i] =
+ if (qla24xx_risc_firmware_invalid(dcode)) {
+ ql_log(ql_log_warn, vha, 0x005f,
+ "Unrecognized fw revision at %x.\n",
+ ha->flt_region_fw * 4);
+ ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+ } else {
+ for (i = 0; i < 4; i++)
+ ha->fw_revision[i] =
be32_to_cpu((__force __be32)dcode[4+i]);
- ql_dbg(ql_dbg_init, vha, 0x0060,
- "Firmware revision (flash) %u.%u.%u (%x).\n",
- ha->fw_revision[0], ha->fw_revision[1],
- ha->fw_revision[2], ha->fw_revision[3]);
+ ql_dbg(ql_dbg_init, vha, 0x0060,
+ "Firmware revision (flash) %u.%u.%u (%x).\n",
+ ha->fw_revision[0], ha->fw_revision[1],
+ ha->fw_revision[2], ha->fw_revision[3]);
+ }
}
/* Check for golden firmware and get version if available */
@@ -3531,18 +3568,23 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
memset(ha->gold_fw_version, 0, sizeof(ha->gold_fw_version));
faddr = ha->flt_region_gold_fw;
- qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
- if (qla24xx_risc_firmware_invalid(dcode)) {
- ql_log(ql_log_warn, vha, 0x0056,
- "Unrecognized golden fw at %#x.\n", faddr);
- ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+ ret = qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x019f,
+ "Unable to read Gold FW version (%x).\n", ret);
return ret;
- }
-
- for (i = 0; i < 4; i++)
- ha->gold_fw_version[i] =
- be32_to_cpu((__force __be32)dcode[4+i]);
+ } else {
+ if (qla24xx_risc_firmware_invalid(dcode)) {
+ ql_log(ql_log_warn, vha, 0x0056,
+ "Unrecognized golden fw at %#x.\n", faddr);
+ ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+ return QLA_FUNCTION_FAILED;
+ }
+ for (i = 0; i < 4; i++)
+ ha->gold_fw_version[i] =
+ be32_to_cpu((__force __be32)dcode[4+i]);
+ }
return ret;
}
diff --git a/drivers/scsi/sr_ioctl.c b/drivers/scsi/sr_ioctl.c
index a0d2556a27bb..089653018d32 100644
--- a/drivers/scsi/sr_ioctl.c
+++ b/drivers/scsi/sr_ioctl.c
@@ -431,7 +431,7 @@ int sr_select_speed(struct cdrom_device_info *cdi, unsigned long speed)
struct packet_command cgc;
/* avoid exceeding the max speed or overflowing integer bounds */
- speed = clamp(0, speed, 0xffff / 177);
+ speed = clamp(speed, 0, 0xffff / 177);
if (speed == 0)
speed = 0xffff; /* set to max */
diff --git a/drivers/soc/qcom/icc-bwmon.c b/drivers/soc/qcom/icc-bwmon.c
index adf2d523f103..59ef8d739e93 100644
--- a/drivers/soc/qcom/icc-bwmon.c
+++ b/drivers/soc/qcom/icc-bwmon.c
@@ -565,7 +565,7 @@ static void bwmon_start(struct icc_bwmon *bwmon)
int window;
/* No need to check for errors, as this must have succeeded before. */
- dev_pm_opp_find_bw_ceil(bwmon->dev, &bw_low, 0);
+ dev_pm_opp_put(dev_pm_opp_find_bw_ceil(bwmon->dev, &bw_low, 0));
bwmon_clear_counters(bwmon, true);
@@ -772,11 +772,13 @@ static int bwmon_probe(struct platform_device *pdev)
opp = dev_pm_opp_find_bw_floor(dev, &bwmon->max_bw_kbps, 0);
if (IS_ERR(opp))
return dev_err_probe(dev, PTR_ERR(opp), "failed to find max peak bandwidth\n");
+ dev_pm_opp_put(opp);
bwmon->min_bw_kbps = 0;
opp = dev_pm_opp_find_bw_ceil(dev, &bwmon->min_bw_kbps, 0);
if (IS_ERR(opp))
return dev_err_probe(dev, PTR_ERR(opp), "failed to find min peak bandwidth\n");
+ dev_pm_opp_put(opp);
bwmon->dev = dev;
diff --git a/drivers/soc/qcom/pdr_interface.c b/drivers/soc/qcom/pdr_interface.c
index 0034af927b48..c7cd4daa10b0 100644
--- a/drivers/soc/qcom/pdr_interface.c
+++ b/drivers/soc/qcom/pdr_interface.c
@@ -76,12 +76,12 @@ static int pdr_locator_new_server(struct qmi_handle *qmi,
locator_hdl);
struct pdr_service *pds;
+ mutex_lock(&pdr->lock);
/* Create a local client port for QMI communication */
pdr->locator_addr.sq_family = AF_QIPCRTR;
pdr->locator_addr.sq_node = svc->node;
pdr->locator_addr.sq_port = svc->port;
- mutex_lock(&pdr->lock);
pdr->locator_init_complete = true;
mutex_unlock(&pdr->lock);
@@ -104,10 +104,10 @@ static void pdr_locator_del_server(struct qmi_handle *qmi,
mutex_lock(&pdr->lock);
pdr->locator_init_complete = false;
- mutex_unlock(&pdr->lock);
pdr->locator_addr.sq_node = 0;
pdr->locator_addr.sq_port = 0;
+ mutex_unlock(&pdr->lock);
}
static const struct qmi_ops pdr_locator_ops = {
@@ -365,12 +365,14 @@ static int pdr_get_domain_list(struct servreg_get_domain_list_req *req,
if (ret < 0)
return ret;
+ mutex_lock(&pdr->lock);
ret = qmi_send_request(&pdr->locator_hdl,
&pdr->locator_addr,
&txn, SERVREG_GET_DOMAIN_LIST_REQ,
SERVREG_GET_DOMAIN_LIST_REQ_MAX_LEN,
servreg_get_domain_list_req_ei,
req);
+ mutex_unlock(&pdr->lock);
if (ret < 0) {
qmi_txn_cancel(&txn);
return ret;
@@ -415,7 +417,7 @@ static int pdr_locate_service(struct pdr_handle *pdr, struct pdr_service *pds)
if (ret < 0)
goto out;
- for (i = domains_read; i < resp->domain_list_len; i++) {
+ for (i = 0; i < resp->domain_list_len; i++) {
entry = &resp->domain_list[i];
if (strnlen(entry->name, sizeof(entry->name)) == sizeof(entry->name))
diff --git a/drivers/soc/qcom/pmic_glink.c b/drivers/soc/qcom/pmic_glink.c
index 61a359938b6c..71d261ac8aa4 100644
--- a/drivers/soc/qcom/pmic_glink.c
+++ b/drivers/soc/qcom/pmic_glink.c
@@ -376,8 +376,17 @@ static struct platform_driver pmic_glink_driver = {
static int pmic_glink_init(void)
{
- platform_driver_register(&pmic_glink_driver);
- register_rpmsg_driver(&pmic_glink_rpmsg_driver);
+ int ret;
+
+ ret = platform_driver_register(&pmic_glink_driver);
+ if (ret < 0)
+ return ret;
+
+ ret = register_rpmsg_driver(&pmic_glink_rpmsg_driver);
+ if (ret < 0) {
+ platform_driver_unregister(&pmic_glink_driver);
+ return ret;
+ }
return 0;
};
diff --git a/drivers/soc/qcom/rpmh-rsc.c b/drivers/soc/qcom/rpmh-rsc.c
index daf64be966fe..dfc2d4e38fa9 100644
--- a/drivers/soc/qcom/rpmh-rsc.c
+++ b/drivers/soc/qcom/rpmh-rsc.c
@@ -646,13 +646,14 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
{
struct tcs_group *tcs;
int tcs_id;
- unsigned long flags;
+
+ might_sleep();
tcs = get_tcs_for_msg(drv, msg);
if (IS_ERR(tcs))
return PTR_ERR(tcs);
- spin_lock_irqsave(&drv->lock, flags);
+ spin_lock_irq(&drv->lock);
/* Wait forever for a free tcs. It better be there eventually! */
wait_event_lock_irq(drv->tcs_wait,
@@ -670,7 +671,7 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
write_tcs_reg_sync(drv, drv->regs[RSC_DRV_CMD_ENABLE], tcs_id, 0);
enable_tcs_irq(drv, tcs_id, true);
}
- spin_unlock_irqrestore(&drv->lock, flags);
+ spin_unlock_irq(&drv->lock);
/*
* These two can be done after the lock is released because:
diff --git a/drivers/soc/qcom/rpmh.c b/drivers/soc/qcom/rpmh.c
index 08e09642d7f5..62dfc7df9354 100644
--- a/drivers/soc/qcom/rpmh.c
+++ b/drivers/soc/qcom/rpmh.c
@@ -183,7 +183,6 @@ static int __rpmh_write(const struct device *dev, enum rpmh_state state,
}
if (state == RPMH_ACTIVE_ONLY_STATE) {
- WARN_ON(irqs_disabled());
ret = rpmh_rsc_send_data(ctrlr_to_drv(ctrlr), &rpm_msg->msg);
} else {
/* Clean up our call by spoofing tx_done */
diff --git a/drivers/soc/xilinx/xlnx_event_manager.c b/drivers/soc/xilinx/xlnx_event_manager.c
index 042553abe1bf..098a2ecfd5c6 100644
--- a/drivers/soc/xilinx/xlnx_event_manager.c
+++ b/drivers/soc/xilinx/xlnx_event_manager.c
@@ -3,6 +3,7 @@
* Xilinx Event Management Driver
*
* Copyright (C) 2021 Xilinx, Inc.
+ * Copyright (C) 2024 Advanced Micro Devices, Inc.
*
* Abhyuday Godhasara <abhyuday.godhasara@xilinx.com>
*/
@@ -19,7 +20,7 @@
#include <linux/platform_device.h>
#include <linux/slab.h>
-static DEFINE_PER_CPU_READ_MOSTLY(int, cpu_number1);
+static DEFINE_PER_CPU_READ_MOSTLY(int, dummy_cpu_number);
static int virq_sgi;
static int event_manager_availability = -EACCES;
@@ -555,7 +556,6 @@ static void xlnx_disable_percpu_irq(void *data)
static int xlnx_event_init_sgi(struct platform_device *pdev)
{
int ret = 0;
- int cpu;
/*
* IRQ related structures are used for the following:
* for each SGI interrupt ensure its mapped by GIC IRQ domain
@@ -592,11 +592,8 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
sgi_fwspec.param[0] = sgi_num;
virq_sgi = irq_create_fwspec_mapping(&sgi_fwspec);
- cpu = get_cpu();
- per_cpu(cpu_number1, cpu) = cpu;
ret = request_percpu_irq(virq_sgi, xlnx_event_handler, "xlnx_event_mgmt",
- &cpu_number1);
- put_cpu();
+ &dummy_cpu_number);
WARN_ON(ret);
if (ret) {
@@ -612,16 +609,12 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
static void xlnx_event_cleanup_sgi(struct platform_device *pdev)
{
- int cpu = smp_processor_id();
-
- per_cpu(cpu_number1, cpu) = cpu;
-
cpuhp_remove_state(CPUHP_AP_ONLINE_DYN);
on_each_cpu(xlnx_disable_percpu_irq, NULL, 1);
irq_clear_status_flags(virq_sgi, IRQ_PER_CPU);
- free_percpu_irq(virq_sgi, &cpu_number1);
+ free_percpu_irq(virq_sgi, &dummy_cpu_number);
irq_dispose_mapping(virq_sgi);
}
diff --git a/drivers/soc/xilinx/zynqmp_power.c b/drivers/soc/xilinx/zynqmp_power.c
index c2c819701eec..d7c784d77208 100644
--- a/drivers/soc/xilinx/zynqmp_power.c
+++ b/drivers/soc/xilinx/zynqmp_power.c
@@ -188,7 +188,9 @@ static int zynqmp_pm_probe(struct platform_device *pdev)
u32 pm_api_version;
struct mbox_client *client;
- zynqmp_pm_get_api_version(&pm_api_version);
+ ret = zynqmp_pm_get_api_version(&pm_api_version);
+ if (ret)
+ return ret;
/* Check PM API version number */
if (pm_api_version < ZYNQMP_PM_VERSION)
diff --git a/drivers/spi/atmel-quadspi.c b/drivers/spi/atmel-quadspi.c
index 3d1252566134..4cc4f32ca449 100644
--- a/drivers/spi/atmel-quadspi.c
+++ b/drivers/spi/atmel-quadspi.c
@@ -756,8 +756,15 @@ static int __maybe_unused atmel_qspi_resume(struct device *dev)
struct atmel_qspi *aq = spi_controller_get_devdata(ctrl);
int ret;
- clk_prepare(aq->pclk);
- clk_prepare(aq->qspick);
+ ret = clk_prepare(aq->pclk);
+ if (ret)
+ return ret;
+
+ ret = clk_prepare(aq->qspick);
+ if (ret) {
+ clk_unprepare(aq->pclk);
+ return ret;
+ }
ret = pm_runtime_force_resume(dev);
if (ret < 0)
diff --git a/drivers/spi/spi-microchip-core.c b/drivers/spi/spi-microchip-core.c
index b451cd4860ec..aa05127c8696 100644
--- a/drivers/spi/spi-microchip-core.c
+++ b/drivers/spi/spi-microchip-core.c
@@ -21,7 +21,7 @@
#include <linux/spi/spi.h>
#define MAX_LEN (0xffff)
-#define MAX_CS (8)
+#define MAX_CS (1)
#define DEFAULT_FRAMESIZE (8)
#define FIFO_DEPTH (32)
#define CLK_GEN_MODE1_MAX (255)
@@ -75,6 +75,7 @@
#define REG_CONTROL (0x00)
#define REG_FRAME_SIZE (0x04)
+#define FRAME_SIZE_MASK GENMASK(5, 0)
#define REG_STATUS (0x08)
#define REG_INT_CLEAR (0x0c)
#define REG_RX_DATA (0x10)
@@ -89,6 +90,9 @@
#define REG_RIS (0x24)
#define REG_CONTROL2 (0x28)
#define REG_COMMAND (0x2c)
+#define COMMAND_CLRFRAMECNT BIT(4)
+#define COMMAND_TXFIFORST BIT(3)
+#define COMMAND_RXFIFORST BIT(2)
#define REG_PKTSIZE (0x30)
#define REG_CMD_SIZE (0x34)
#define REG_HWSTATUS (0x38)
@@ -103,6 +107,7 @@ struct mchp_corespi {
u8 *rx_buf;
u32 clk_gen; /* divider for spi output clock generated by the controller */
u32 clk_mode;
+ u32 pending_slave_select;
int irq;
int tx_len;
int rx_len;
@@ -148,62 +153,59 @@ static inline void mchp_corespi_read_fifo(struct mchp_corespi *spi)
static void mchp_corespi_enable_ints(struct mchp_corespi *spi)
{
- u32 control, mask = INT_ENABLE_MASK;
-
- mchp_corespi_disable(spi);
-
- control = mchp_corespi_read(spi, REG_CONTROL);
-
- control |= mask;
- mchp_corespi_write(spi, REG_CONTROL, control);
+ u32 control = mchp_corespi_read(spi, REG_CONTROL);
- control |= CONTROL_ENABLE;
+ control |= INT_ENABLE_MASK;
mchp_corespi_write(spi, REG_CONTROL, control);
}
static void mchp_corespi_disable_ints(struct mchp_corespi *spi)
{
- u32 control, mask = INT_ENABLE_MASK;
-
- mchp_corespi_disable(spi);
-
- control = mchp_corespi_read(spi, REG_CONTROL);
- control &= ~mask;
- mchp_corespi_write(spi, REG_CONTROL, control);
+ u32 control = mchp_corespi_read(spi, REG_CONTROL);
- control |= CONTROL_ENABLE;
+ control &= ~INT_ENABLE_MASK;
mchp_corespi_write(spi, REG_CONTROL, control);
}
static inline void mchp_corespi_set_xfer_size(struct mchp_corespi *spi, int len)
{
u32 control;
- u16 lenpart;
+ u32 lenpart;
+ u32 frames = mchp_corespi_read(spi, REG_FRAMESUP);
/*
- * Disable the SPI controller. Writes to transfer length have
- * no effect when the controller is enabled.
+ * Writing to FRAMECNT in REG_CONTROL will reset the frame count, taking
+ * a shortcut requires an explicit clear.
*/
- mchp_corespi_disable(spi);
+ if (frames == len) {
+ mchp_corespi_write(spi, REG_COMMAND, COMMAND_CLRFRAMECNT);
+ return;
+ }
/*
* The lower 16 bits of the frame count are stored in the control reg
* for legacy reasons, but the upper 16 written to a different register:
* FRAMESUP. While both the upper and lower bits can be *READ* from the
- * FRAMESUP register, writing to the lower 16 bits is a NOP
+ * FRAMESUP register, writing to the lower 16 bits is (supposedly) a NOP.
+ *
+ * The driver used to disable the controller while modifying the frame
+ * count, and mask off the lower 16 bits of len while writing to
+ * FRAMES_UP. When the driver was changed to disable the controller as
+ * infrequently as possible, it was discovered that the logic of
+ * lenpart = len & 0xffff_0000
+ * write(REG_FRAMESUP, lenpart)
+ * would actually write zeros into the lower 16 bits on an mpfs250t-es,
+ * despite documentation stating these bits were read-only.
+ * Writing len unmasked into FRAMES_UP ensures those bits aren't zeroed
+ * on an mpfs250t-es and will be a NOP for the lower 16 bits on hardware
+ * that matches the documentation.
*/
lenpart = len & 0xffff;
-
control = mchp_corespi_read(spi, REG_CONTROL);
control &= ~CONTROL_FRAMECNT_MASK;
control |= lenpart << CONTROL_FRAMECNT_SHIFT;
mchp_corespi_write(spi, REG_CONTROL, control);
-
- lenpart = len & 0xffff0000;
- mchp_corespi_write(spi, REG_FRAMESUP, lenpart);
-
- control |= CONTROL_ENABLE;
- mchp_corespi_write(spi, REG_CONTROL, control);
+ mchp_corespi_write(spi, REG_FRAMESUP, len);
}
static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
@@ -226,17 +228,22 @@ static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
{
+ u32 frame_size = mchp_corespi_read(spi, REG_FRAME_SIZE);
u32 control;
+ if ((frame_size & FRAME_SIZE_MASK) == bt)
+ return;
+
/*
* Disable the SPI controller. Writes to the frame size have
* no effect when the controller is enabled.
*/
- mchp_corespi_disable(spi);
+ control = mchp_corespi_read(spi, REG_CONTROL);
+ control &= ~CONTROL_ENABLE;
+ mchp_corespi_write(spi, REG_CONTROL, control);
mchp_corespi_write(spi, REG_FRAME_SIZE, bt);
- control = mchp_corespi_read(spi, REG_CONTROL);
control |= CONTROL_ENABLE;
mchp_corespi_write(spi, REG_CONTROL, control);
}
@@ -244,49 +251,56 @@ static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
{
u32 reg;
- struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+ struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
reg = mchp_corespi_read(corespi, REG_SLAVE_SELECT);
reg &= ~BIT(spi_get_chipselect(spi, 0));
reg |= !disable << spi_get_chipselect(spi, 0);
+ corespi->pending_slave_select = reg;
- mchp_corespi_write(corespi, REG_SLAVE_SELECT, reg);
+ /*
+ * Only deassert chip select immediately. Writing to some registers
+ * requires the controller to be disabled, which results in the
+ * output pins being tristated and can cause the SCLK and MOSI lines
+ * to transition. Therefore asserting the chip select is deferred
+ * until just before writing to the TX FIFO, to ensure the device
+ * doesn't see any spurious clock transitions whilst CS is enabled.
+ */
+ if (((spi->mode & SPI_CS_HIGH) == 0) == disable)
+ mchp_corespi_write(corespi, REG_SLAVE_SELECT, reg);
}
static int mchp_corespi_setup(struct spi_device *spi)
{
- struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+ struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
u32 reg;
/*
- * Active high slaves need to be specifically set to their inactive
+ * Active high targets need to be specifically set to their inactive
* states during probe by adding them to the "control group" & thus
* driving their select line low.
*/
if (spi->mode & SPI_CS_HIGH) {
reg = mchp_corespi_read(corespi, REG_SLAVE_SELECT);
reg |= BIT(spi_get_chipselect(spi, 0));
+ corespi->pending_slave_select = reg;
mchp_corespi_write(corespi, REG_SLAVE_SELECT, reg);
}
return 0;
}
-static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *spi)
+static void mchp_corespi_init(struct spi_controller *host, struct mchp_corespi *spi)
{
unsigned long clk_hz;
u32 control = mchp_corespi_read(spi, REG_CONTROL);
- control |= CONTROL_MASTER;
+ control &= ~CONTROL_ENABLE;
+ mchp_corespi_write(spi, REG_CONTROL, control);
+ control |= CONTROL_MASTER;
control &= ~CONTROL_MODE_MASK;
control |= MOTOROLA_MODE;
- mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
-
- /* max. possible spi clock rate is the apb clock rate */
- clk_hz = clk_get_rate(spi->clk);
- master->max_speed_hz = clk_hz;
-
/*
* The controller must be configured so that it doesn't remove Chip
* Select until the entire message has been transferred, even if at
@@ -295,19 +309,25 @@ static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *sp
* BIGFIFO mode is also enabled, which sets the fifo depth to 32 frames
* for the 8 bit transfers that this driver uses.
*/
- control = mchp_corespi_read(spi, REG_CONTROL);
control |= CONTROL_SPS | CONTROL_BIGFIFO;
mchp_corespi_write(spi, REG_CONTROL, control);
+ mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
+
+ /* max. possible spi clock rate is the apb clock rate */
+ clk_hz = clk_get_rate(spi->clk);
+ host->max_speed_hz = clk_hz;
+
mchp_corespi_enable_ints(spi);
/*
* It is required to enable direct mode, otherwise control over the chip
* select is relinquished to the hardware. SSELOUT is enabled too so we
- * can deal with active high slaves.
+ * can deal with active high targets.
*/
- mchp_corespi_write(spi, REG_SLAVE_SELECT, SSELOUT | SSEL_DIRECT);
+ spi->pending_slave_select = SSELOUT | SSEL_DIRECT;
+ mchp_corespi_write(spi, REG_SLAVE_SELECT, spi->pending_slave_select);
control = mchp_corespi_read(spi, REG_CONTROL);
@@ -321,8 +341,6 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
{
u32 control;
- mchp_corespi_disable(spi);
-
control = mchp_corespi_read(spi, REG_CONTROL);
if (spi->clk_mode)
control |= CONTROL_CLKMODE;
@@ -331,12 +349,12 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
mchp_corespi_write(spi, REG_CLK_GEN, spi->clk_gen);
mchp_corespi_write(spi, REG_CONTROL, control);
- mchp_corespi_write(spi, REG_CONTROL, control | CONTROL_ENABLE);
}
static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int mode)
{
- u32 control, mode_val;
+ u32 mode_val;
+ u32 control = mchp_corespi_read(spi, REG_CONTROL);
switch (mode & SPI_MODE_X_MASK) {
case SPI_MODE_0:
@@ -354,12 +372,13 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
}
/*
- * Disable the SPI controller. Writes to the frame size have
+ * Disable the SPI controller. Writes to the frame protocol have
* no effect when the controller is enabled.
*/
- mchp_corespi_disable(spi);
- control = mchp_corespi_read(spi, REG_CONTROL);
+ control &= ~CONTROL_ENABLE;
+ mchp_corespi_write(spi, REG_CONTROL, control);
+
control &= ~(SPI_MODE_X_MASK << MODE_X_MASK_SHIFT);
control |= mode_val;
@@ -371,8 +390,8 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
{
- struct spi_master *master = dev_id;
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct spi_controller *host = dev_id;
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
u32 intfield = mchp_corespi_read(spi, REG_MIS) & 0xf;
bool finalise = false;
@@ -380,26 +399,23 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
if (intfield == 0)
return IRQ_NONE;
- if (intfield & INT_TXDONE) {
+ if (intfield & INT_TXDONE)
mchp_corespi_write(spi, REG_INT_CLEAR, INT_TXDONE);
+ if (intfield & INT_RXRDY) {
+ mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+
if (spi->rx_len)
mchp_corespi_read_fifo(spi);
-
- if (spi->tx_len)
- mchp_corespi_write_fifo(spi);
-
- if (!spi->rx_len)
- finalise = true;
}
- if (intfield & INT_RXRDY)
- mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+ if (!spi->rx_len && !spi->tx_len)
+ finalise = true;
if (intfield & INT_RX_CHANNEL_OVERFLOW) {
mchp_corespi_write(spi, REG_INT_CLEAR, INT_RX_CHANNEL_OVERFLOW);
finalise = true;
- dev_err(&master->dev,
+ dev_err(&host->dev,
"%s: RX OVERFLOW: rxlen: %d, txlen: %d\n", __func__,
spi->rx_len, spi->tx_len);
}
@@ -407,13 +423,13 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
if (intfield & INT_TX_CHANNEL_UNDERRUN) {
mchp_corespi_write(spi, REG_INT_CLEAR, INT_TX_CHANNEL_UNDERRUN);
finalise = true;
- dev_err(&master->dev,
+ dev_err(&host->dev,
"%s: TX UNDERFLOW: rxlen: %d, txlen: %d\n", __func__,
spi->rx_len, spi->tx_len);
}
if (finalise)
- spi_finalize_current_transfer(master);
+ spi_finalize_current_transfer(host);
return IRQ_HANDLED;
}
@@ -455,16 +471,16 @@ static int mchp_corespi_calculate_clkgen(struct mchp_corespi *spi,
return 0;
}
-static int mchp_corespi_transfer_one(struct spi_master *master,
+static int mchp_corespi_transfer_one(struct spi_controller *host,
struct spi_device *spi_dev,
struct spi_transfer *xfer)
{
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
int ret;
ret = mchp_corespi_calculate_clkgen(spi, (unsigned long)xfer->speed_hz);
if (ret) {
- dev_err(&master->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
+ dev_err(&host->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
return ret;
}
@@ -479,16 +495,21 @@ static int mchp_corespi_transfer_one(struct spi_master *master,
mchp_corespi_set_xfer_size(spi, (spi->tx_len > FIFO_DEPTH)
? FIFO_DEPTH : spi->tx_len);
- if (spi->tx_len)
+ mchp_corespi_write(spi, REG_COMMAND, COMMAND_RXFIFORST | COMMAND_TXFIFORST);
+
+ mchp_corespi_write(spi, REG_SLAVE_SELECT, spi->pending_slave_select);
+
+ while (spi->tx_len)
mchp_corespi_write_fifo(spi);
+
return 1;
}
-static int mchp_corespi_prepare_message(struct spi_master *master,
+static int mchp_corespi_prepare_message(struct spi_controller *host,
struct spi_message *msg)
{
struct spi_device *spi_dev = msg->spi;
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
mchp_corespi_set_mode(spi, spi_dev->mode);
@@ -498,32 +519,32 @@ static int mchp_corespi_prepare_message(struct spi_master *master,
static int mchp_corespi_probe(struct platform_device *pdev)
{
- struct spi_master *master;
+ struct spi_controller *host;
struct mchp_corespi *spi;
struct resource *res;
u32 num_cs;
int ret = 0;
- master = devm_spi_alloc_master(&pdev->dev, sizeof(*spi));
- if (!master)
+ host = devm_spi_alloc_host(&pdev->dev, sizeof(*spi));
+ if (!host)
return dev_err_probe(&pdev->dev, -ENOMEM,
- "unable to allocate master for SPI controller\n");
+ "unable to allocate host for SPI controller\n");
- platform_set_drvdata(pdev, master);
+ platform_set_drvdata(pdev, host);
if (of_property_read_u32(pdev->dev.of_node, "num-cs", &num_cs))
num_cs = MAX_CS;
- master->num_chipselect = num_cs;
- master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
- master->setup = mchp_corespi_setup;
- master->bits_per_word_mask = SPI_BPW_MASK(8);
- master->transfer_one = mchp_corespi_transfer_one;
- master->prepare_message = mchp_corespi_prepare_message;
- master->set_cs = mchp_corespi_set_cs;
- master->dev.of_node = pdev->dev.of_node;
+ host->num_chipselect = num_cs;
+ host->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
+ host->setup = mchp_corespi_setup;
+ host->bits_per_word_mask = SPI_BPW_MASK(8);
+ host->transfer_one = mchp_corespi_transfer_one;
+ host->prepare_message = mchp_corespi_prepare_message;
+ host->set_cs = mchp_corespi_set_cs;
+ host->dev.of_node = pdev->dev.of_node;
- spi = spi_master_get_devdata(master);
+ spi = spi_controller_get_devdata(host);
spi->regs = devm_platform_get_and_ioremap_resource(pdev, 0, &res);
if (IS_ERR(spi->regs))
@@ -534,7 +555,7 @@ static int mchp_corespi_probe(struct platform_device *pdev)
return spi->irq;
ret = devm_request_irq(&pdev->dev, spi->irq, mchp_corespi_interrupt,
- IRQF_SHARED, dev_name(&pdev->dev), master);
+ IRQF_SHARED, dev_name(&pdev->dev), host);
if (ret)
return dev_err_probe(&pdev->dev, ret,
"could not request irq\n");
@@ -549,25 +570,25 @@ static int mchp_corespi_probe(struct platform_device *pdev)
return dev_err_probe(&pdev->dev, ret,
"failed to enable clock\n");
- mchp_corespi_init(master, spi);
+ mchp_corespi_init(host, spi);
- ret = devm_spi_register_master(&pdev->dev, master);
+ ret = devm_spi_register_controller(&pdev->dev, host);
if (ret) {
mchp_corespi_disable(spi);
clk_disable_unprepare(spi->clk);
return dev_err_probe(&pdev->dev, ret,
- "unable to register master for SPI controller\n");
+ "unable to register host for SPI controller\n");
}
- dev_info(&pdev->dev, "Registered SPI controller %d\n", master->bus_num);
+ dev_info(&pdev->dev, "Registered SPI controller %d\n", host->bus_num);
return 0;
}
static void mchp_corespi_remove(struct platform_device *pdev)
{
- struct spi_master *master = platform_get_drvdata(pdev);
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct spi_controller *host = platform_get_drvdata(pdev);
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
mchp_corespi_disable_ints(spi);
clk_disable_unprepare(spi->clk);
diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c
index d13dc15cc191..1a8dd1001244 100644
--- a/drivers/spi/spidev.c
+++ b/drivers/spi/spidev.c
@@ -738,6 +738,7 @@ static const struct of_device_id spidev_dt_ids[] = {
{ .compatible = "lwn,bk4", .data = &spidev_of_check },
{ .compatible = "menlo,m53cpld", .data = &spidev_of_check },
{ .compatible = "micron,spi-authenta", .data = &spidev_of_check },
+ { .compatible = "rohm,bh2228fv", .data = &spidev_of_check },
{ .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
{ .compatible = "semtech,sx1301", .data = &spidev_of_check },
{ .compatible = "silabs,em3581", .data = &spidev_of_check },
diff --git a/drivers/ufs/core/ufs-mcq.c b/drivers/ufs/core/ufs-mcq.c
index a10fc7a69710..af5ce45315b3 100644
--- a/drivers/ufs/core/ufs-mcq.c
+++ b/drivers/ufs/core/ufs-mcq.c
@@ -230,8 +230,6 @@ int ufshcd_mcq_memory_alloc(struct ufs_hba *hba)
/* Operation and runtime registers configuration */
#define MCQ_CFG_n(r, i) ((r) + MCQ_QCFG_SIZE * (i))
-#define MCQ_OPR_OFFSET_n(p, i) \
- (hba->mcq_opr[(p)].offset + hba->mcq_opr[(p)].stride * (i))
static void __iomem *mcq_opr_base(struct ufs_hba *hba,
enum ufshcd_mcq_opr n, int i)
@@ -344,10 +342,10 @@ void ufshcd_mcq_make_queues_operational(struct ufs_hba *hba)
ufsmcq_writelx(hba, upper_32_bits(hwq->sqe_dma_addr),
MCQ_CFG_n(REG_SQUBA, i));
/* Submission Queue Doorbell Address Offset */
- ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_SQD, i),
+ ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_SQD, i),
MCQ_CFG_n(REG_SQDAO, i));
/* Submission Queue Interrupt Status Address Offset */
- ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_SQIS, i),
+ ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_SQIS, i),
MCQ_CFG_n(REG_SQISAO, i));
/* Completion Queue Lower Base Address */
@@ -357,10 +355,10 @@ void ufshcd_mcq_make_queues_operational(struct ufs_hba *hba)
ufsmcq_writelx(hba, upper_32_bits(hwq->cqe_dma_addr),
MCQ_CFG_n(REG_CQUBA, i));
/* Completion Queue Doorbell Address Offset */
- ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_CQD, i),
+ ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_CQD, i),
MCQ_CFG_n(REG_CQDAO, i));
/* Completion Queue Interrupt Status Address Offset */
- ufsmcq_writelx(hba, MCQ_OPR_OFFSET_n(OPR_CQIS, i),
+ ufsmcq_writelx(hba, ufshcd_mcq_opr_offset(hba, OPR_CQIS, i),
MCQ_CFG_n(REG_CQISAO, i));
/* Save the base addresses for quicker access */
diff --git a/drivers/usb/typec/mux/nb7vpq904m.c b/drivers/usb/typec/mux/nb7vpq904m.c
index cda206cf0c38..596639dad31d 100644
--- a/drivers/usb/typec/mux/nb7vpq904m.c
+++ b/drivers/usb/typec/mux/nb7vpq904m.c
@@ -453,7 +453,7 @@ static int nb7vpq904m_probe(struct i2c_client *client)
ret = nb7vpq904m_parse_data_lanes_mapping(nb7);
if (ret)
- return ret;
+ goto err_switch_put;
ret = regulator_enable(nb7->vcc_supply);
if (ret)
@@ -496,6 +496,9 @@ static int nb7vpq904m_probe(struct i2c_client *client)
gpiod_set_value(nb7->enable_gpio, 0);
regulator_disable(nb7->vcc_supply);
+err_switch_put:
+ typec_switch_put(nb7->typec_switch);
+
return ret;
}
@@ -509,6 +512,8 @@ static void nb7vpq904m_remove(struct i2c_client *client)
gpiod_set_value(nb7->enable_gpio, 0);
regulator_disable(nb7->vcc_supply);
+
+ typec_switch_put(nb7->typec_switch);
}
static const struct i2c_device_id nb7vpq904m_table[] = {
diff --git a/drivers/vhost/vsock.c b/drivers/vhost/vsock.c
index 61255855d490..d94a06008ff6 100644
--- a/drivers/vhost/vsock.c
+++ b/drivers/vhost/vsock.c
@@ -656,6 +656,7 @@ static int vhost_vsock_dev_open(struct inode *inode, struct file *file)
}
vsock->guest_cid = 0; /* no CID assigned yet */
+ vsock->seqpacket_allow = false;
atomic_set(&vsock->queued_replies, 0);
@@ -799,8 +800,7 @@ static int vhost_vsock_set_features(struct vhost_vsock *vsock, u64 features)
goto err;
}
- if (features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET))
- vsock->seqpacket_allow = true;
+ vsock->seqpacket_allow = features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET);
for (i = 0; i < ARRAY_SIZE(vsock->vqs); i++) {
vq = &vsock->vqs[i];
diff --git a/drivers/video/logo/pnmtologo.c b/drivers/video/logo/pnmtologo.c
index ada5ef6e51b7..87912cc35e92 100644
--- a/drivers/video/logo/pnmtologo.c
+++ b/drivers/video/logo/pnmtologo.c
@@ -235,8 +235,6 @@ static void write_header(void)
fputs("/*\n", out);
fputs(" * DO NOT EDIT THIS FILE!\n", out);
fputs(" *\n", out);
- fprintf(out, " * It was automatically generated from %s\n", filename);
- fputs(" *\n", out);
fprintf(out, " * Linux logo %s\n", logoname);
fputs(" */\n\n", out);
fputs("#include <linux/linux_logo.h>\n\n", out);
diff --git a/drivers/watchdog/rzg2l_wdt.c b/drivers/watchdog/rzg2l_wdt.c
index 1741f98ca67c..7bce093316c4 100644
--- a/drivers/watchdog/rzg2l_wdt.c
+++ b/drivers/watchdog/rzg2l_wdt.c
@@ -123,8 +123,11 @@ static void rzg2l_wdt_init_timeout(struct watchdog_device *wdev)
static int rzg2l_wdt_start(struct watchdog_device *wdev)
{
struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+ int ret;
- pm_runtime_get_sync(wdev->parent);
+ ret = pm_runtime_resume_and_get(wdev->parent);
+ if (ret)
+ return ret;
/* Initialize time out */
rzg2l_wdt_init_timeout(wdev);
@@ -141,15 +144,21 @@ static int rzg2l_wdt_start(struct watchdog_device *wdev)
static int rzg2l_wdt_stop(struct watchdog_device *wdev)
{
struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+ int ret;
rzg2l_wdt_reset(priv);
- pm_runtime_put(wdev->parent);
+
+ ret = pm_runtime_put(wdev->parent);
+ if (ret < 0)
+ return ret;
return 0;
}
static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int timeout)
{
+ int ret = 0;
+
wdev->timeout = timeout;
/*
@@ -158,11 +167,14 @@ static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int time
* to reset the module) so that it is updated with new timeout values.
*/
if (watchdog_active(wdev)) {
- rzg2l_wdt_stop(wdev);
- rzg2l_wdt_start(wdev);
+ ret = rzg2l_wdt_stop(wdev);
+ if (ret)
+ return ret;
+
+ ret = rzg2l_wdt_start(wdev);
}
- return 0;
+ return ret;
}
static int rzg2l_wdt_restart(struct watchdog_device *wdev,
diff --git a/fs/btrfs/compression.c b/fs/btrfs/compression.c
index 8818ed5c390f..a815ce9cfb51 100644
--- a/fs/btrfs/compression.c
+++ b/fs/btrfs/compression.c
@@ -420,6 +420,7 @@ static noinline int add_ra_bio_pages(struct inode *inode,
put_page(page);
break;
}
+ add_size = min(em->start + em->len, page_end + 1) - cur;
free_extent_map(em);
if (page->index == end_index) {
@@ -432,7 +433,6 @@ static noinline int add_ra_bio_pages(struct inode *inode,
}
}
- add_size = min(em->start + em->len, page_end + 1) - cur;
ret = bio_add_page(orig_bio, page, add_size, offset_in_page(cur));
if (ret != add_size) {
unlock_extent(tree, cur, page_end, NULL);
diff --git a/fs/ceph/super.c b/fs/ceph/super.c
index 52af90beab00..ec51e398562c 100644
--- a/fs/ceph/super.c
+++ b/fs/ceph/super.c
@@ -958,7 +958,8 @@ static int __init init_caches(void)
if (!ceph_mds_request_cachep)
goto bad_mds_req;
- ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10, CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT);
+ ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10,
+ (CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT) * sizeof(struct page *));
if (!ceph_wb_pagevec_pool)
goto bad_pagevec_pool;
diff --git a/fs/exfat/dir.c b/fs/exfat/dir.c
index e1586bba6d86..7a715016b96f 100644
--- a/fs/exfat/dir.c
+++ b/fs/exfat/dir.c
@@ -890,7 +890,7 @@ int exfat_get_dentry_set(struct exfat_entry_set_cache *es,
num_bh = EXFAT_B_TO_BLK_ROUND_UP(off + num_entries * DENTRY_SIZE, sb);
if (num_bh > ARRAY_SIZE(es->__bh)) {
- es->bh = kmalloc_array(num_bh, sizeof(*es->bh), GFP_KERNEL);
+ es->bh = kmalloc_array(num_bh, sizeof(*es->bh), GFP_NOFS);
if (!es->bh) {
brelse(bh);
return -ENOMEM;
diff --git a/fs/ext2/balloc.c b/fs/ext2/balloc.c
index e124f3d709b2..f2052723821a 100644
--- a/fs/ext2/balloc.c
+++ b/fs/ext2/balloc.c
@@ -77,26 +77,33 @@ static int ext2_valid_block_bitmap(struct super_block *sb,
ext2_grpblk_t next_zero_bit;
ext2_fsblk_t bitmap_blk;
ext2_fsblk_t group_first_block;
+ ext2_grpblk_t max_bit;
group_first_block = ext2_group_first_block_no(sb, block_group);
+ max_bit = ext2_group_last_block_no(sb, block_group) - group_first_block;
/* check whether block bitmap block number is set */
bitmap_blk = le32_to_cpu(desc->bg_block_bitmap);
offset = bitmap_blk - group_first_block;
- if (!ext2_test_bit(offset, bh->b_data))
+ if (offset < 0 || offset > max_bit ||
+ !ext2_test_bit(offset, bh->b_data))
/* bad block bitmap */
goto err_out;
/* check whether the inode bitmap block number is set */
bitmap_blk = le32_to_cpu(desc->bg_inode_bitmap);
offset = bitmap_blk - group_first_block;
- if (!ext2_test_bit(offset, bh->b_data))
+ if (offset < 0 || offset > max_bit ||
+ !ext2_test_bit(offset, bh->b_data))
/* bad block bitmap */
goto err_out;
/* check whether the inode table block number is set */
bitmap_blk = le32_to_cpu(desc->bg_inode_table);
offset = bitmap_blk - group_first_block;
+ if (offset < 0 || offset > max_bit ||
+ offset + EXT2_SB(sb)->s_itb_per_group - 1 > max_bit)
+ goto err_out;
next_zero_bit = ext2_find_next_zero_bit(bh->b_data,
offset + EXT2_SB(sb)->s_itb_per_group,
offset);
diff --git a/fs/ext4/extents_status.c b/fs/ext4/extents_status.c
index f4b50652f0cc..d9d5cfb9c951 100644
--- a/fs/ext4/extents_status.c
+++ b/fs/ext4/extents_status.c
@@ -310,6 +310,8 @@ void ext4_es_find_extent_range(struct inode *inode,
ext4_lblk_t lblk, ext4_lblk_t end,
struct extent_status *es)
{
+ es->es_lblk = es->es_len = es->es_pblk = 0;
+
if (EXT4_SB(inode->i_sb)->s_mount_state & EXT4_FC_REPLAY)
return;
diff --git a/fs/ext4/fast_commit.c b/fs/ext4/fast_commit.c
index b06de728b3b6..5d473e50598f 100644
--- a/fs/ext4/fast_commit.c
+++ b/fs/ext4/fast_commit.c
@@ -649,6 +649,12 @@ void ext4_fc_track_range(handle_t *handle, struct inode *inode, ext4_lblk_t star
if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE))
return;
+ if (ext4_has_inline_data(inode)) {
+ ext4_fc_mark_ineligible(inode->i_sb, EXT4_FC_REASON_XATTR,
+ handle);
+ return;
+ }
+
args.start = start;
args.end = end;
diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c
index a2ee882e5ebb..3bd2301cb48e 100644
--- a/fs/ext4/namei.c
+++ b/fs/ext4/namei.c
@@ -151,10 +151,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode,
return bh;
}
- if (!bh && (type == INDEX || type == DIRENT_HTREE)) {
+ /* The first directory block must not be a hole. */
+ if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) {
ext4_error_inode(inode, func, line, block,
- "Directory hole found for htree %s block",
- (type == INDEX) ? "index" : "leaf");
+ "Directory hole found for htree %s block %u",
+ (type == INDEX) ? "index" : "leaf", block);
return ERR_PTR(-EFSCORRUPTED);
}
if (!bh)
@@ -2218,6 +2219,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname,
return err ? err : err2;
}
+static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root)
+{
+ struct fake_dirent *fde;
+ const char *error_msg;
+ unsigned int rlen;
+ unsigned int blocksize = dir->i_sb->s_blocksize;
+ char *blockend = (char *)root + dir->i_sb->s_blocksize;
+
+ fde = &root->dot;
+ if (unlikely(fde->name_len != 1)) {
+ error_msg = "invalid name_len for '.'";
+ goto corrupted;
+ }
+ if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) {
+ error_msg = "invalid name for '.'";
+ goto corrupted;
+ }
+ rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+ if (unlikely((char *)fde + rlen >= blockend)) {
+ error_msg = "invalid rec_len for '.'";
+ goto corrupted;
+ }
+
+ fde = &root->dotdot;
+ if (unlikely(fde->name_len != 2)) {
+ error_msg = "invalid name_len for '..'";
+ goto corrupted;
+ }
+ if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) {
+ error_msg = "invalid name for '..'";
+ goto corrupted;
+ }
+ rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+ if (unlikely((char *)fde + rlen >= blockend)) {
+ error_msg = "invalid rec_len for '..'";
+ goto corrupted;
+ }
+
+ return true;
+
+corrupted:
+ EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended",
+ error_msg);
+ return false;
+}
+
/*
* This converts a one block unindexed directory to a 3 block indexed
* directory, and adds the dentry to the indexed directory.
@@ -2252,17 +2299,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname,
brelse(bh);
return retval;
}
+
root = (struct dx_root *) bh->b_data;
+ if (!ext4_check_dx_root(dir, root)) {
+ brelse(bh);
+ return -EFSCORRUPTED;
+ }
/* The 0th block becomes the root, move the dirents out */
fde = &root->dotdot;
de = (struct ext4_dir_entry_2 *)((char *)fde +
ext4_rec_len_from_disk(fde->rec_len, blocksize));
- if ((char *) de >= (((char *) root) + blocksize)) {
- EXT4_ERROR_INODE(dir, "invalid rec_len for '..'");
- brelse(bh);
- return -EFSCORRUPTED;
- }
len = ((char *) root) + (blocksize - csum_size) - (char *) de;
/* Allocate new block for the 0th block's dirents */
@@ -3087,10 +3134,7 @@ bool ext4_empty_dir(struct inode *inode)
EXT4_ERROR_INODE(inode, "invalid size");
return false;
}
- /* The first directory block must not be a hole,
- * so treat it as DIRENT_HTREE
- */
- bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+ bh = ext4_read_dirblock(inode, 0, EITHER);
if (IS_ERR(bh))
return false;
@@ -3535,10 +3579,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle,
struct ext4_dir_entry_2 *de;
unsigned int offset;
- /* The first directory block must not be a hole, so
- * treat it as DIRENT_HTREE
- */
- bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+ bh = ext4_read_dirblock(inode, 0, EITHER);
if (IS_ERR(bh)) {
*retval = PTR_ERR(bh);
return NULL;
diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c
index 41b4630b17d6..c58cbe9f7809 100644
--- a/fs/ext4/xattr.c
+++ b/fs/ext4/xattr.c
@@ -1433,6 +1433,12 @@ static int ext4_xattr_inode_write(handle_t *handle, struct inode *ea_inode,
goto out;
memcpy(bh->b_data, buf, csize);
+ /*
+ * Zero out block tail to avoid writing uninitialized memory
+ * to disk.
+ */
+ if (csize < blocksize)
+ memset(bh->b_data + csize, 0, blocksize - csize);
set_buffer_uptodate(bh);
ext4_handle_dirty_metadata(handle, ea_inode, bh);
diff --git a/fs/f2fs/checkpoint.c b/fs/f2fs/checkpoint.c
index 58ce751da92b..1a33a8c1623f 100644
--- a/fs/f2fs/checkpoint.c
+++ b/fs/f2fs/checkpoint.c
@@ -1170,6 +1170,11 @@ static void __prepare_cp_block(struct f2fs_sb_info *sbi)
ckpt->valid_node_count = cpu_to_le32(valid_node_count(sbi));
ckpt->valid_inode_count = cpu_to_le32(valid_inode_count(sbi));
ckpt->next_free_nid = cpu_to_le32(last_nid);
+
+ /* update user_block_counts */
+ sbi->last_valid_block_count = sbi->total_valid_block_count;
+ percpu_counter_set(&sbi->alloc_valid_block_count, 0);
+ percpu_counter_set(&sbi->rf_node_block_count, 0);
}
static bool __need_flush_quota(struct f2fs_sb_info *sbi)
@@ -1559,11 +1564,6 @@ static int do_checkpoint(struct f2fs_sb_info *sbi, struct cp_control *cpc)
start_blk += NR_CURSEG_NODE_TYPE;
}
- /* update user_block_counts */
- sbi->last_valid_block_count = sbi->total_valid_block_count;
- percpu_counter_set(&sbi->alloc_valid_block_count, 0);
- percpu_counter_set(&sbi->rf_node_block_count, 0);
-
/* Here, we have one bio having CP pack except cp pack 2 page */
f2fs_sync_meta_pages(sbi, META, LONG_MAX, FS_CP_META_IO);
/* Wait for all dirty meta pages to be submitted for IO */
diff --git a/fs/f2fs/data.c b/fs/f2fs/data.c
index 2c4cb801899e..84fc87018180 100644
--- a/fs/f2fs/data.c
+++ b/fs/f2fs/data.c
@@ -2586,7 +2586,7 @@ bool f2fs_should_update_outplace(struct inode *inode, struct f2fs_io_info *fio)
return true;
if (IS_NOQUOTA(inode))
return true;
- if (f2fs_is_atomic_file(inode))
+ if (f2fs_used_in_atomic_write(inode))
return true;
/* swap file is migrating in aligned write mode */
@@ -2672,7 +2672,7 @@ int f2fs_do_write_data_page(struct f2fs_io_info *fio)
}
/* wait for GCed page writeback via META_MAPPING */
- if (fio->post_read)
+ if (fio->meta_gc)
f2fs_wait_on_block_writeback(inode, fio->old_blkaddr);
/*
@@ -2768,7 +2768,7 @@ int f2fs_write_single_data_page(struct page *page, int *submitted,
.submitted = 0,
.compr_blocks = compr_blocks,
.need_lock = compr_blocks ? LOCK_DONE : LOCK_RETRY,
- .post_read = f2fs_post_read_required(inode) ? 1 : 0,
+ .meta_gc = f2fs_meta_inode_gc_required(inode) ? 1 : 0,
.io_type = io_type,
.io_wbc = wbc,
.bio = bio,
diff --git a/fs/f2fs/f2fs.h b/fs/f2fs/f2fs.h
index c7e717ab0900..19490dd83219 100644
--- a/fs/f2fs/f2fs.h
+++ b/fs/f2fs/f2fs.h
@@ -798,6 +798,7 @@ enum {
FI_COW_FILE, /* indicate COW file */
FI_ATOMIC_COMMITTED, /* indicate atomic commit completed except disk sync */
FI_ATOMIC_REPLACE, /* indicate atomic replace */
+ FI_OPENED_FILE, /* indicate file has been opened */
FI_MAX, /* max flag, never be used */
};
@@ -836,7 +837,11 @@ struct f2fs_inode_info {
struct task_struct *atomic_write_task; /* store atomic write task */
struct extent_tree *extent_tree[NR_EXTENT_CACHES];
/* cached extent_tree entry */
- struct inode *cow_inode; /* copy-on-write inode for atomic write */
+ union {
+ struct inode *cow_inode; /* copy-on-write inode for atomic write */
+ struct inode *atomic_inode;
+ /* point to atomic_inode, available only for cow_inode */
+ };
/* avoid racing between foreground op and gc */
struct f2fs_rwsem i_gc_rwsem[2];
@@ -1204,7 +1209,7 @@ struct f2fs_io_info {
unsigned int in_list:1; /* indicate fio is in io_list */
unsigned int is_por:1; /* indicate IO is from recovery or not */
unsigned int encrypted:1; /* indicate file is encrypted */
- unsigned int post_read:1; /* require post read */
+ unsigned int meta_gc:1; /* require meta inode GC */
enum iostat_type io_type; /* io type */
struct writeback_control *io_wbc; /* writeback control */
struct bio **bio; /* bio for ipu */
@@ -4255,6 +4260,16 @@ static inline bool f2fs_post_read_required(struct inode *inode)
f2fs_compressed_file(inode);
}
+static inline bool f2fs_used_in_atomic_write(struct inode *inode)
+{
+ return f2fs_is_atomic_file(inode) || f2fs_is_cow_file(inode);
+}
+
+static inline bool f2fs_meta_inode_gc_required(struct inode *inode)
+{
+ return f2fs_post_read_required(inode) || f2fs_used_in_atomic_write(inode);
+}
+
/*
* compress.c
*/
diff --git a/fs/f2fs/file.c b/fs/f2fs/file.c
index 154c55c1a0f4..523896200908 100644
--- a/fs/f2fs/file.c
+++ b/fs/f2fs/file.c
@@ -534,6 +534,42 @@ static int f2fs_file_mmap(struct file *file, struct vm_area_struct *vma)
return 0;
}
+static int finish_preallocate_blocks(struct inode *inode)
+{
+ int ret;
+
+ inode_lock(inode);
+ if (is_inode_flag_set(inode, FI_OPENED_FILE)) {
+ inode_unlock(inode);
+ return 0;
+ }
+
+ if (!file_should_truncate(inode)) {
+ set_inode_flag(inode, FI_OPENED_FILE);
+ inode_unlock(inode);
+ return 0;
+ }
+
+ f2fs_down_write(&F2FS_I(inode)->i_gc_rwsem[WRITE]);
+ filemap_invalidate_lock(inode->i_mapping);
+
+ truncate_setsize(inode, i_size_read(inode));
+ ret = f2fs_truncate(inode);
+
+ filemap_invalidate_unlock(inode->i_mapping);
+ f2fs_up_write(&F2FS_I(inode)->i_gc_rwsem[WRITE]);
+
+ if (!ret)
+ set_inode_flag(inode, FI_OPENED_FILE);
+
+ inode_unlock(inode);
+ if (ret)
+ return ret;
+
+ file_dont_truncate(inode);
+ return 0;
+}
+
static int f2fs_file_open(struct inode *inode, struct file *filp)
{
int err = fscrypt_file_open(inode, filp);
@@ -551,7 +587,11 @@ static int f2fs_file_open(struct inode *inode, struct file *filp)
filp->f_mode |= FMODE_NOWAIT | FMODE_BUF_RASYNC;
filp->f_mode |= FMODE_CAN_ODIRECT;
- return dquot_file_open(inode, filp);
+ err = dquot_file_open(inode, filp);
+ if (err)
+ return err;
+
+ return finish_preallocate_blocks(inode);
}
void f2fs_truncate_data_blocks_range(struct dnode_of_data *dn, int count)
@@ -803,6 +843,8 @@ static bool f2fs_force_buffered_io(struct inode *inode, int rw)
return true;
if (f2fs_compressed_file(inode))
return true;
+ if (f2fs_has_inline_data(inode))
+ return true;
/* disallow direct IO if any of devices has unaligned blksize */
if (f2fs_is_multi_device(sbi) && !sbi->aligned_blksize)
@@ -2117,6 +2159,9 @@ static int f2fs_ioc_start_atomic_write(struct file *filp, bool truncate)
set_inode_flag(fi->cow_inode, FI_COW_FILE);
clear_inode_flag(fi->cow_inode, FI_INLINE_DATA);
+
+ /* Set the COW inode's atomic_inode to the atomic inode */
+ F2FS_I(fi->cow_inode)->atomic_inode = inode;
} else {
/* Reuse the already created COW inode */
ret = f2fs_do_truncate_blocks(fi->cow_inode, 0, true);
diff --git a/fs/f2fs/gc.c b/fs/f2fs/gc.c
index 3f0632dd9d2e..afb7c88ba06b 100644
--- a/fs/f2fs/gc.c
+++ b/fs/f2fs/gc.c
@@ -1171,7 +1171,8 @@ static bool is_alive(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
static int ra_data_block(struct inode *inode, pgoff_t index)
{
struct f2fs_sb_info *sbi = F2FS_I_SB(inode);
- struct address_space *mapping = inode->i_mapping;
+ struct address_space *mapping = f2fs_is_cow_file(inode) ?
+ F2FS_I(inode)->atomic_inode->i_mapping : inode->i_mapping;
struct dnode_of_data dn;
struct page *page;
struct f2fs_io_info fio = {
@@ -1262,6 +1263,8 @@ static int ra_data_block(struct inode *inode, pgoff_t index)
static int move_data_block(struct inode *inode, block_t bidx,
int gc_type, unsigned int segno, int off)
{
+ struct address_space *mapping = f2fs_is_cow_file(inode) ?
+ F2FS_I(inode)->atomic_inode->i_mapping : inode->i_mapping;
struct f2fs_io_info fio = {
.sbi = F2FS_I_SB(inode),
.ino = inode->i_ino,
@@ -1284,7 +1287,7 @@ static int move_data_block(struct inode *inode, block_t bidx,
CURSEG_ALL_DATA_ATGC : CURSEG_COLD_DATA;
/* do not read out */
- page = f2fs_grab_cache_page(inode->i_mapping, bidx, false);
+ page = f2fs_grab_cache_page(mapping, bidx, false);
if (!page)
return -ENOMEM;
@@ -1576,7 +1579,7 @@ static int gc_data_segment(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
start_bidx = f2fs_start_bidx_of_node(nofs, inode) +
ofs_in_node;
- if (f2fs_post_read_required(inode)) {
+ if (f2fs_meta_inode_gc_required(inode)) {
int err = ra_data_block(inode, start_bidx);
f2fs_up_write(&F2FS_I(inode)->i_gc_rwsem[WRITE]);
@@ -1627,7 +1630,7 @@ static int gc_data_segment(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
start_bidx = f2fs_start_bidx_of_node(nofs, inode)
+ ofs_in_node;
- if (f2fs_post_read_required(inode))
+ if (f2fs_meta_inode_gc_required(inode))
err = move_data_block(inode, start_bidx,
gc_type, segno, off);
else
@@ -1635,7 +1638,7 @@ static int gc_data_segment(struct f2fs_sb_info *sbi, struct f2fs_summary *sum,
segno, off);
if (!err && (gc_type == FG_GC ||
- f2fs_post_read_required(inode)))
+ f2fs_meta_inode_gc_required(inode)))
submitted++;
if (locked) {
diff --git a/fs/f2fs/inline.c b/fs/f2fs/inline.c
index 2fe25619ccb5..2cbe557f971e 100644
--- a/fs/f2fs/inline.c
+++ b/fs/f2fs/inline.c
@@ -16,7 +16,7 @@
static bool support_inline_data(struct inode *inode)
{
- if (f2fs_is_atomic_file(inode))
+ if (f2fs_used_in_atomic_write(inode))
return false;
if (!S_ISREG(inode->i_mode) && !S_ISLNK(inode->i_mode))
return false;
@@ -203,8 +203,10 @@ int f2fs_convert_inline_inode(struct inode *inode)
struct page *ipage, *page;
int err = 0;
- if (!f2fs_has_inline_data(inode) ||
- f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+ if (f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+ return -EROFS;
+
+ if (!f2fs_has_inline_data(inode))
return 0;
err = f2fs_dquot_initialize(inode);
diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c
index ab2eecd986ec..0172f4e50306 100644
--- a/fs/f2fs/inode.c
+++ b/fs/f2fs/inode.c
@@ -29,6 +29,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync)
if (is_inode_flag_set(inode, FI_NEW_INODE))
return;
+ if (f2fs_readonly(F2FS_I_SB(inode)->sb))
+ return;
+
if (f2fs_inode_dirtied(inode, sync))
return;
@@ -610,14 +613,6 @@ struct inode *f2fs_iget(struct super_block *sb, unsigned long ino)
}
f2fs_set_inode_flags(inode);
- if (file_should_truncate(inode) &&
- !is_sbi_flag_set(sbi, SBI_POR_DOING)) {
- ret = f2fs_truncate(inode);
- if (ret)
- goto bad_inode;
- file_dont_truncate(inode);
- }
-
unlock_new_inode(inode);
trace_f2fs_iget(inode);
return inode;
@@ -813,8 +808,9 @@ void f2fs_evict_inode(struct inode *inode)
f2fs_abort_atomic_write(inode, true);
- if (fi->cow_inode) {
+ if (fi->cow_inode && f2fs_is_cow_file(fi->cow_inode)) {
clear_inode_flag(fi->cow_inode, FI_COW_FILE);
+ F2FS_I(fi->cow_inode)->atomic_inode = NULL;
iput(fi->cow_inode);
fi->cow_inode = NULL;
}
diff --git a/fs/f2fs/segment.c b/fs/f2fs/segment.c
index b578ce3757ef..22080606b876 100644
--- a/fs/f2fs/segment.c
+++ b/fs/f2fs/segment.c
@@ -3659,7 +3659,7 @@ int f2fs_inplace_write_data(struct f2fs_io_info *fio)
goto drop_bio;
}
- if (fio->post_read)
+ if (fio->meta_gc)
f2fs_truncate_meta_inode_pages(sbi, fio->new_blkaddr, 1);
stat_inc_inplace_blocks(fio->sbi);
@@ -3825,7 +3825,7 @@ void f2fs_wait_on_block_writeback(struct inode *inode, block_t blkaddr)
struct f2fs_sb_info *sbi = F2FS_I_SB(inode);
struct page *cpage;
- if (!f2fs_post_read_required(inode))
+ if (!f2fs_meta_inode_gc_required(inode))
return;
if (!__is_valid_data_blkaddr(blkaddr))
@@ -3844,7 +3844,7 @@ void f2fs_wait_on_block_writeback_range(struct inode *inode, block_t blkaddr,
struct f2fs_sb_info *sbi = F2FS_I_SB(inode);
block_t i;
- if (!f2fs_post_read_required(inode))
+ if (!f2fs_meta_inode_gc_required(inode))
return;
for (i = 0; i < len; i++)
diff --git a/fs/f2fs/segment.h b/fs/f2fs/segment.h
index 4595f1cc0382..952970166d5d 100644
--- a/fs/f2fs/segment.h
+++ b/fs/f2fs/segment.h
@@ -348,7 +348,8 @@ static inline unsigned int get_ckpt_valid_blocks(struct f2fs_sb_info *sbi,
unsigned int segno, bool use_section)
{
if (use_section && __is_large_section(sbi)) {
- unsigned int start_segno = START_SEGNO(segno);
+ unsigned int secno = GET_SEC_FROM_SEG(sbi, segno);
+ unsigned int start_segno = GET_SEG_FROM_SEC(sbi, secno);
unsigned int blocks = 0;
int i;
diff --git a/fs/fuse/inode.c b/fs/fuse/inode.c
index 23ab31b967a1..04c7ba3ea03a 100644
--- a/fs/fuse/inode.c
+++ b/fs/fuse/inode.c
@@ -751,6 +751,8 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
struct fs_parse_result result;
struct fuse_fs_context *ctx = fsc->fs_private;
int opt;
+ kuid_t kuid;
+ kgid_t kgid;
if (fsc->purpose == FS_CONTEXT_FOR_RECONFIGURE) {
/*
@@ -795,16 +797,30 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
break;
case OPT_USER_ID:
- ctx->user_id = make_kuid(fsc->user_ns, result.uint_32);
- if (!uid_valid(ctx->user_id))
+ kuid = make_kuid(fsc->user_ns, result.uint_32);
+ if (!uid_valid(kuid))
return invalfc(fsc, "Invalid user_id");
+ /*
+ * The requested uid must be representable in the
+ * filesystem's idmapping.
+ */
+ if (!kuid_has_mapping(fsc->user_ns, kuid))
+ return invalfc(fsc, "Invalid user_id");
+ ctx->user_id = kuid;
ctx->user_id_present = true;
break;
case OPT_GROUP_ID:
- ctx->group_id = make_kgid(fsc->user_ns, result.uint_32);
- if (!gid_valid(ctx->group_id))
+ kgid = make_kgid(fsc->user_ns, result.uint_32);;
+ if (!gid_valid(kgid))
+ return invalfc(fsc, "Invalid group_id");
+ /*
+ * The requested gid must be representable in the
+ * filesystem's idmapping.
+ */
+ if (!kgid_has_mapping(fsc->user_ns, kgid))
return invalfc(fsc, "Invalid group_id");
+ ctx->group_id = kgid;
ctx->group_id_present = true;
break;
diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c
index ee349b72cfb3..61ed76d10392 100644
--- a/fs/hfs/inode.c
+++ b/fs/hfs/inode.c
@@ -204,6 +204,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t
HFS_I(inode)->flags = 0;
HFS_I(inode)->rsrc_inode = NULL;
HFS_I(inode)->fs_blocks = 0;
+ HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60;
if (S_ISDIR(mode)) {
inode->i_size = 2;
HFS_SB(sb)->folder_count++;
@@ -279,6 +280,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext,
for (count = 0, i = 0; i < 3; i++)
count += be16_to_cpu(ext[i].count);
HFS_I(inode)->first_blocks = count;
+ HFS_I(inode)->cached_start = 0;
+ HFS_I(inode)->cached_blocks = 0;
inode->i_size = HFS_I(inode)->phys_size = log_size;
HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits;
diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c
index ca2ba8c9f82e..901e83d65d20 100644
--- a/fs/hfsplus/bfind.c
+++ b/fs/hfsplus/bfind.c
@@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd)
fd->key = ptr + tree->max_key_len + 2;
hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n",
tree->cnid, __builtin_return_address(0));
- switch (tree->cnid) {
- case HFSPLUS_CAT_CNID:
- mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX);
- break;
- case HFSPLUS_EXT_CNID:
- mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX);
- break;
- case HFSPLUS_ATTR_CNID:
- mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX);
- break;
- default:
- BUG();
- }
+ mutex_lock_nested(&tree->tree_lock,
+ hfsplus_btree_lock_class(tree));
return 0;
}
diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c
index 3c572e44f2ad..9c51867dddc5 100644
--- a/fs/hfsplus/extents.c
+++ b/fs/hfsplus/extents.c
@@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid,
hfsplus_free_extents(sb, ext_entry, total_blocks - start,
total_blocks);
total_blocks = start;
- mutex_lock(&fd.tree->tree_lock);
+ mutex_lock_nested(&fd.tree->tree_lock,
+ hfsplus_btree_lock_class(fd.tree));
} while (total_blocks > blocks);
hfs_find_exit(&fd);
@@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode)
alloc_cnt, alloc_cnt - blk_cnt);
hfsplus_dump_extent(hip->first_extents);
hip->first_blocks = blk_cnt;
- mutex_lock(&fd.tree->tree_lock);
+ mutex_lock_nested(&fd.tree->tree_lock,
+ hfsplus_btree_lock_class(fd.tree));
break;
}
res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt);
@@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode)
hfsplus_free_extents(sb, hip->cached_extents,
alloc_cnt - start, alloc_cnt - blk_cnt);
hfsplus_dump_extent(hip->cached_extents);
- mutex_lock(&fd.tree->tree_lock);
+ mutex_lock_nested(&fd.tree->tree_lock,
+ hfsplus_btree_lock_class(fd.tree));
if (blk_cnt > start) {
hip->extent_state |= HFSPLUS_EXT_DIRTY;
break;
diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h
index 7ededcb720c1..583c196ecd52 100644
--- a/fs/hfsplus/hfsplus_fs.h
+++ b/fs/hfsplus/hfsplus_fs.h
@@ -552,6 +552,27 @@ static inline __be32 __hfsp_ut2mt(time64_t ut)
return cpu_to_be32(lower_32_bits(ut) + HFSPLUS_UTC_OFFSET);
}
+static inline enum hfsplus_btree_mutex_classes
+hfsplus_btree_lock_class(struct hfs_btree *tree)
+{
+ enum hfsplus_btree_mutex_classes class;
+
+ switch (tree->cnid) {
+ case HFSPLUS_CAT_CNID:
+ class = CATALOG_BTREE_MUTEX;
+ break;
+ case HFSPLUS_EXT_CNID:
+ class = EXTENTS_BTREE_MUTEX;
+ break;
+ case HFSPLUS_ATTR_CNID:
+ class = ATTR_BTREE_MUTEX;
+ break;
+ default:
+ BUG();
+ }
+ return class;
+}
+
/* compatibility */
#define hfsp_mt2ut(t) (struct timespec64){ .tv_sec = __hfsp_mt2ut(t) }
#define hfsp_ut2mt(t) __hfsp_ut2mt((t).tv_sec)
diff --git a/fs/hostfs/hostfs.h b/fs/hostfs/hostfs.h
index 0239e3af3945..8b39c15c408c 100644
--- a/fs/hostfs/hostfs.h
+++ b/fs/hostfs/hostfs.h
@@ -63,9 +63,10 @@ struct hostfs_stat {
struct hostfs_timespec atime, mtime, ctime;
unsigned int blksize;
unsigned long long blocks;
- unsigned int maj;
- unsigned int min;
- dev_t dev;
+ struct {
+ unsigned int maj;
+ unsigned int min;
+ } rdev, dev;
};
extern int stat_file(const char *path, struct hostfs_stat *p, int fd);
diff --git a/fs/hostfs/hostfs_kern.c b/fs/hostfs/hostfs_kern.c
index dc5a5cea5fae..ff201753fd18 100644
--- a/fs/hostfs/hostfs_kern.c
+++ b/fs/hostfs/hostfs_kern.c
@@ -526,10 +526,11 @@ static int hostfs_inode_update(struct inode *ino, const struct hostfs_stat *st)
static int hostfs_inode_set(struct inode *ino, void *data)
{
struct hostfs_stat *st = data;
- dev_t rdev;
+ dev_t dev, rdev;
/* Reencode maj and min with the kernel encoding.*/
- rdev = MKDEV(st->maj, st->min);
+ rdev = MKDEV(st->rdev.maj, st->rdev.min);
+ dev = MKDEV(st->dev.maj, st->dev.min);
switch (st->mode & S_IFMT) {
case S_IFLNK:
@@ -555,7 +556,7 @@ static int hostfs_inode_set(struct inode *ino, void *data)
return -EIO;
}
- HOSTFS_I(ino)->dev = st->dev;
+ HOSTFS_I(ino)->dev = dev;
ino->i_ino = st->ino;
ino->i_mode = st->mode;
return hostfs_inode_update(ino, st);
@@ -564,8 +565,9 @@ static int hostfs_inode_set(struct inode *ino, void *data)
static int hostfs_inode_test(struct inode *inode, void *data)
{
const struct hostfs_stat *st = data;
+ dev_t dev = MKDEV(st->dev.maj, st->dev.min);
- return inode->i_ino == st->ino && HOSTFS_I(inode)->dev == st->dev;
+ return inode->i_ino == st->ino && HOSTFS_I(inode)->dev == dev;
}
static struct inode *hostfs_iget(struct super_block *sb, char *name)
diff --git a/fs/hostfs/hostfs_user.c b/fs/hostfs/hostfs_user.c
index 840619e39a1a..97e9c40a9448 100644
--- a/fs/hostfs/hostfs_user.c
+++ b/fs/hostfs/hostfs_user.c
@@ -34,9 +34,10 @@ static void stat64_to_hostfs(const struct stat64 *buf, struct hostfs_stat *p)
p->mtime.tv_nsec = 0;
p->blksize = buf->st_blksize;
p->blocks = buf->st_blocks;
- p->maj = os_major(buf->st_rdev);
- p->min = os_minor(buf->st_rdev);
- p->dev = buf->st_dev;
+ p->rdev.maj = os_major(buf->st_rdev);
+ p->rdev.min = os_minor(buf->st_rdev);
+ p->dev.maj = os_major(buf->st_dev);
+ p->dev.min = os_minor(buf->st_dev);
}
int stat_file(const char *path, struct hostfs_stat *p, int fd)
diff --git a/fs/jbd2/commit.c b/fs/jbd2/commit.c
index 5e122586e06e..0cd7439470fc 100644
--- a/fs/jbd2/commit.c
+++ b/fs/jbd2/commit.c
@@ -767,7 +767,7 @@ void jbd2_journal_commit_transaction(journal_t *journal)
if (first_block < journal->j_tail)
freed += journal->j_last - journal->j_first;
/* Update tail only if we free significant amount of space */
- if (freed < jbd2_journal_get_max_txn_bufs(journal))
+ if (freed < journal->j_max_transaction_buffers)
update_tail = 0;
}
J_ASSERT(commit_transaction->t_state == T_COMMIT);
diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c
index 19c69229ac6e..0168d2842707 100644
--- a/fs/jbd2/journal.c
+++ b/fs/jbd2/journal.c
@@ -1451,6 +1451,48 @@ static int journal_revoke_records_per_block(journal_t *journal)
return space / record_size;
}
+static int jbd2_journal_get_max_txn_bufs(journal_t *journal)
+{
+ return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
+}
+
+/*
+ * Base amount of descriptor blocks we reserve for each transaction.
+ */
+static int jbd2_descriptor_blocks_per_trans(journal_t *journal)
+{
+ int tag_space = journal->j_blocksize - sizeof(journal_header_t);
+ int tags_per_block;
+
+ /* Subtract UUID */
+ tag_space -= 16;
+ if (jbd2_journal_has_csum_v2or3(journal))
+ tag_space -= sizeof(struct jbd2_journal_block_tail);
+ /* Commit code leaves a slack space of 16 bytes at the end of block */
+ tags_per_block = (tag_space - 16) / journal_tag_bytes(journal);
+ /*
+ * Revoke descriptors are accounted separately so we need to reserve
+ * space for commit block and normal transaction descriptor blocks.
+ */
+ return 1 + DIV_ROUND_UP(jbd2_journal_get_max_txn_bufs(journal),
+ tags_per_block);
+}
+
+/*
+ * Initialize number of blocks each transaction reserves for its bookkeeping
+ * and maximum number of blocks a transaction can use. This needs to be called
+ * after the journal size and the fastcommit area size are initialized.
+ */
+static void jbd2_journal_init_transaction_limits(journal_t *journal)
+{
+ journal->j_revoke_records_per_block =
+ journal_revoke_records_per_block(journal);
+ journal->j_transaction_overhead_buffers =
+ jbd2_descriptor_blocks_per_trans(journal);
+ journal->j_max_transaction_buffers =
+ jbd2_journal_get_max_txn_bufs(journal);
+}
+
/*
* Load the on-disk journal superblock and read the key fields into the
* journal_t.
@@ -1492,8 +1534,8 @@ static int journal_load_superblock(journal_t *journal)
if (jbd2_journal_has_csum_v2or3(journal))
journal->j_csum_seed = jbd2_chksum(journal, ~0, sb->s_uuid,
sizeof(sb->s_uuid));
- journal->j_revoke_records_per_block =
- journal_revoke_records_per_block(journal);
+ /* After journal features are set, we can compute transaction limits */
+ jbd2_journal_init_transaction_limits(journal);
if (jbd2_has_feature_fast_commit(journal)) {
journal->j_fc_last = be32_to_cpu(sb->s_maxlen);
@@ -1735,8 +1777,6 @@ static int journal_reset(journal_t *journal)
journal->j_commit_sequence = journal->j_transaction_sequence - 1;
journal->j_commit_request = journal->j_commit_sequence;
- journal->j_max_transaction_buffers = jbd2_journal_get_max_txn_bufs(journal);
-
/*
* Now that journal recovery is done, turn fast commits off here. This
* way, if fast commit was enabled before the crash but if now FS has
@@ -2277,8 +2317,6 @@ jbd2_journal_initialize_fast_commit(journal_t *journal)
journal->j_fc_first = journal->j_last + 1;
journal->j_fc_off = 0;
journal->j_free = journal->j_last - journal->j_first;
- journal->j_max_transaction_buffers =
- jbd2_journal_get_max_txn_bufs(journal);
return 0;
}
@@ -2366,8 +2404,7 @@ int jbd2_journal_set_features(journal_t *journal, unsigned long compat,
sb->s_feature_ro_compat |= cpu_to_be32(ro);
sb->s_feature_incompat |= cpu_to_be32(incompat);
unlock_buffer(journal->j_sb_buffer);
- journal->j_revoke_records_per_block =
- journal_revoke_records_per_block(journal);
+ jbd2_journal_init_transaction_limits(journal);
return 1;
#undef COMPAT_FEATURE_ON
@@ -2398,8 +2435,7 @@ void jbd2_journal_clear_features(journal_t *journal, unsigned long compat,
sb->s_feature_compat &= ~cpu_to_be32(compat);
sb->s_feature_ro_compat &= ~cpu_to_be32(ro);
sb->s_feature_incompat &= ~cpu_to_be32(incompat);
- journal->j_revoke_records_per_block =
- journal_revoke_records_per_block(journal);
+ jbd2_journal_init_transaction_limits(journal);
}
EXPORT_SYMBOL(jbd2_journal_clear_features);
diff --git a/fs/jbd2/transaction.c b/fs/jbd2/transaction.c
index 5f08b5fd105a..76adab83cac3 100644
--- a/fs/jbd2/transaction.c
+++ b/fs/jbd2/transaction.c
@@ -62,28 +62,6 @@ void jbd2_journal_free_transaction(transaction_t *transaction)
kmem_cache_free(transaction_cache, transaction);
}
-/*
- * Base amount of descriptor blocks we reserve for each transaction.
- */
-static int jbd2_descriptor_blocks_per_trans(journal_t *journal)
-{
- int tag_space = journal->j_blocksize - sizeof(journal_header_t);
- int tags_per_block;
-
- /* Subtract UUID */
- tag_space -= 16;
- if (jbd2_journal_has_csum_v2or3(journal))
- tag_space -= sizeof(struct jbd2_journal_block_tail);
- /* Commit code leaves a slack space of 16 bytes at the end of block */
- tags_per_block = (tag_space - 16) / journal_tag_bytes(journal);
- /*
- * Revoke descriptors are accounted separately so we need to reserve
- * space for commit block and normal transaction descriptor blocks.
- */
- return 1 + DIV_ROUND_UP(journal->j_max_transaction_buffers,
- tags_per_block);
-}
-
/*
* jbd2_get_transaction: obtain a new transaction_t object.
*
@@ -109,7 +87,7 @@ static void jbd2_get_transaction(journal_t *journal,
transaction->t_expires = jiffies + journal->j_commit_interval;
atomic_set(&transaction->t_updates, 0);
atomic_set(&transaction->t_outstanding_credits,
- jbd2_descriptor_blocks_per_trans(journal) +
+ journal->j_transaction_overhead_buffers +
atomic_read(&journal->j_reserved_credits));
atomic_set(&transaction->t_outstanding_revokes, 0);
atomic_set(&transaction->t_handle_count, 0);
@@ -213,6 +191,13 @@ static void sub_reserved_credits(journal_t *journal, int blocks)
wake_up(&journal->j_wait_reserved);
}
+/* Maximum number of blocks for user transaction payload */
+static int jbd2_max_user_trans_buffers(journal_t *journal)
+{
+ return journal->j_max_transaction_buffers -
+ journal->j_transaction_overhead_buffers;
+}
+
/*
* Wait until we can add credits for handle to the running transaction. Called
* with j_state_lock held for reading. Returns 0 if handle joined the running
@@ -262,12 +247,12 @@ __must_hold(&journal->j_state_lock)
* big to fit this handle? Wait until reserved credits are freed.
*/
if (atomic_read(&journal->j_reserved_credits) + total >
- journal->j_max_transaction_buffers) {
+ jbd2_max_user_trans_buffers(journal)) {
read_unlock(&journal->j_state_lock);
jbd2_might_wait_for_commit(journal);
wait_event(journal->j_wait_reserved,
atomic_read(&journal->j_reserved_credits) + total <=
- journal->j_max_transaction_buffers);
+ jbd2_max_user_trans_buffers(journal));
__acquire(&journal->j_state_lock); /* fake out sparse */
return 1;
}
@@ -307,14 +292,14 @@ __must_hold(&journal->j_state_lock)
needed = atomic_add_return(rsv_blocks, &journal->j_reserved_credits);
/* We allow at most half of a transaction to be reserved */
- if (needed > journal->j_max_transaction_buffers / 2) {
+ if (needed > jbd2_max_user_trans_buffers(journal) / 2) {
sub_reserved_credits(journal, rsv_blocks);
atomic_sub(total, &t->t_outstanding_credits);
read_unlock(&journal->j_state_lock);
jbd2_might_wait_for_commit(journal);
wait_event(journal->j_wait_reserved,
atomic_read(&journal->j_reserved_credits) + rsv_blocks
- <= journal->j_max_transaction_buffers / 2);
+ <= jbd2_max_user_trans_buffers(journal) / 2);
__acquire(&journal->j_state_lock); /* fake out sparse */
return 1;
}
@@ -344,12 +329,12 @@ static int start_this_handle(journal_t *journal, handle_t *handle,
* size and limit the number of total credits to not exceed maximum
* transaction size per operation.
*/
- if ((rsv_blocks > journal->j_max_transaction_buffers / 2) ||
- (rsv_blocks + blocks > journal->j_max_transaction_buffers)) {
+ if (rsv_blocks > jbd2_max_user_trans_buffers(journal) / 2 ||
+ rsv_blocks + blocks > jbd2_max_user_trans_buffers(journal)) {
printk(KERN_ERR "JBD2: %s wants too many credits "
"credits:%d rsv_credits:%d max:%d\n",
current->comm, blocks, rsv_blocks,
- journal->j_max_transaction_buffers);
+ jbd2_max_user_trans_buffers(journal));
WARN_ON(1);
return -ENOSPC;
}
diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c
index eeedf606cf9d..4bc589c4dcca 100644
--- a/fs/jfs/jfs_imap.c
+++ b/fs/jfs/jfs_imap.c
@@ -290,7 +290,7 @@ int diSync(struct inode *ipimap)
int diRead(struct inode *ip)
{
struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb);
- int iagno, ino, extno, rc;
+ int iagno, ino, extno, rc, agno;
struct inode *ipimap;
struct dinode *dp;
struct iag *iagp;
@@ -339,8 +339,11 @@ int diRead(struct inode *ip)
/* get the ag for the iag */
agstart = le64_to_cpu(iagp->agstart);
+ agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb));
release_metapage(mp);
+ if (agno >= MAXAG || agno < 0)
+ return -EIO;
rel_inode = (ino & (INOSPERPAGE - 1));
pageno = blkno >> sbi->l2nbperpage;
diff --git a/fs/kernfs/dir.c b/fs/kernfs/dir.c
index 2405aeb39b9a..b068ed32d7b3 100644
--- a/fs/kernfs/dir.c
+++ b/fs/kernfs/dir.c
@@ -127,7 +127,7 @@ static struct kernfs_node *kernfs_common_ancestor(struct kernfs_node *a,
*
* [3] when @kn_to is %NULL result will be "(null)"
*
- * Return: the length of the full path. If the full length is equal to or
+ * Return: the length of the constructed path. If the path would have been
* greater than @buflen, @buf contains the truncated path with the trailing
* '\0'. On error, -errno is returned.
*/
@@ -138,16 +138,17 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
struct kernfs_node *kn, *common;
const char parent_str[] = "/..";
size_t depth_from, depth_to, len = 0;
+ ssize_t copied;
int i, j;
if (!kn_to)
- return strlcpy(buf, "(null)", buflen);
+ return strscpy(buf, "(null)", buflen);
if (!kn_from)
kn_from = kernfs_root(kn_to)->kn;
if (kn_from == kn_to)
- return strlcpy(buf, "/", buflen);
+ return strscpy(buf, "/", buflen);
common = kernfs_common_ancestor(kn_from, kn_to);
if (WARN_ON(!common))
@@ -158,18 +159,19 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
buf[0] = '\0';
- for (i = 0; i < depth_from; i++)
- len += strlcpy(buf + len, parent_str,
- len < buflen ? buflen - len : 0);
+ for (i = 0; i < depth_from; i++) {
+ copied = strscpy(buf + len, parent_str, buflen - len);
+ if (copied < 0)
+ return copied;
+ len += copied;
+ }
/* Calculate how many bytes we need for the rest */
for (i = depth_to - 1; i >= 0; i--) {
for (kn = kn_to, j = 0; j < i; j++)
kn = kn->parent;
- len += strlcpy(buf + len, "/",
- len < buflen ? buflen - len : 0);
- len += strlcpy(buf + len, kn->name,
- len < buflen ? buflen - len : 0);
+
+ len += scnprintf(buf + len, buflen - len, "/%s", kn->name);
}
return len;
@@ -214,7 +216,7 @@ int kernfs_name(struct kernfs_node *kn, char *buf, size_t buflen)
* path (which includes '..'s) as needed to reach from @from to @to is
* returned.
*
- * Return: the length of the full path. If the full length is equal to or
+ * Return: the length of the constructed path. If the path would have been
* greater than @buflen, @buf contains the truncated path with the trailing
* '\0'. On error, -errno is returned.
*/
@@ -265,12 +267,10 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
sz = kernfs_path_from_node(kn, NULL, kernfs_pr_cont_buf,
sizeof(kernfs_pr_cont_buf));
if (sz < 0) {
- pr_cont("(error)");
- goto out;
- }
-
- if (sz >= sizeof(kernfs_pr_cont_buf)) {
- pr_cont("(name too long)");
+ if (sz == -E2BIG)
+ pr_cont("(name too long)");
+ else
+ pr_cont("(error)");
goto out;
}
diff --git a/fs/nfs/nfs4client.c b/fs/nfs/nfs4client.c
index 11e3a285594c..ac80f87cb9d9 100644
--- a/fs/nfs/nfs4client.c
+++ b/fs/nfs/nfs4client.c
@@ -231,9 +231,8 @@ struct nfs_client *nfs4_alloc_client(const struct nfs_client_initdata *cl_init)
__set_bit(NFS_CS_INFINITE_SLOTS, &clp->cl_flags);
__set_bit(NFS_CS_DISCRTRY, &clp->cl_flags);
__set_bit(NFS_CS_NO_RETRANS_TIMEOUT, &clp->cl_flags);
-
- if (test_bit(NFS_CS_DS, &cl_init->init_flags))
- __set_bit(NFS_CS_DS, &clp->cl_flags);
+ if (test_bit(NFS_CS_PNFS, &cl_init->init_flags))
+ __set_bit(NFS_CS_PNFS, &clp->cl_flags);
/*
* Set up the connection to the server before we add add to the
* global list.
@@ -1011,7 +1010,6 @@ struct nfs_client *nfs4_set_ds_client(struct nfs_server *mds_srv,
if (mds_srv->flags & NFS_MOUNT_NORESVPORT)
__set_bit(NFS_CS_NORESVPORT, &cl_init.init_flags);
- __set_bit(NFS_CS_DS, &cl_init.init_flags);
__set_bit(NFS_CS_PNFS, &cl_init.init_flags);
cl_init.max_connect = NFS_MAX_TRANSPORTS;
/*
diff --git a/fs/nfs/nfs4proc.c b/fs/nfs/nfs4proc.c
index 05490d4784f1..e7ac249df1ad 100644
--- a/fs/nfs/nfs4proc.c
+++ b/fs/nfs/nfs4proc.c
@@ -8816,7 +8816,7 @@ nfs4_run_exchange_id(struct nfs_client *clp, const struct cred *cred,
#ifdef CONFIG_NFS_V4_1_MIGRATION
calldata->args.flags |= EXCHGID4_FLAG_SUPP_MOVED_MIGR;
#endif
- if (test_bit(NFS_CS_DS, &clp->cl_flags))
+ if (test_bit(NFS_CS_PNFS, &clp->cl_flags))
calldata->args.flags |= EXCHGID4_FLAG_USE_PNFS_DS;
msg.rpc_argp = &calldata->args;
msg.rpc_resp = &calldata->res;
diff --git a/fs/nfsd/nfs4proc.c b/fs/nfsd/nfs4proc.c
index 4199ede0583c..451026f9986b 100644
--- a/fs/nfsd/nfs4proc.c
+++ b/fs/nfsd/nfs4proc.c
@@ -2218,7 +2218,7 @@ nfsd4_layoutget(struct svc_rqst *rqstp,
const struct nfsd4_layout_ops *ops;
struct nfs4_layout_stateid *ls;
__be32 nfserr;
- int accmode = NFSD_MAY_READ_IF_EXEC;
+ int accmode = NFSD_MAY_READ_IF_EXEC | NFSD_MAY_OWNER_OVERRIDE;
switch (lgp->lg_seg.iomode) {
case IOMODE_READ:
@@ -2308,7 +2308,8 @@ nfsd4_layoutcommit(struct svc_rqst *rqstp,
struct nfs4_layout_stateid *ls;
__be32 nfserr;
- nfserr = fh_verify(rqstp, current_fh, 0, NFSD_MAY_WRITE);
+ nfserr = fh_verify(rqstp, current_fh, 0,
+ NFSD_MAY_WRITE | NFSD_MAY_OWNER_OVERRIDE);
if (nfserr)
goto out;
diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c
index 5710833ac1cc..8fe348bceabe 100644
--- a/fs/nilfs2/btnode.c
+++ b/fs/nilfs2/btnode.c
@@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node));
if (unlikely(!bh))
- return NULL;
+ return ERR_PTR(-ENOMEM);
if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) ||
buffer_dirty(bh))) {
- brelse(bh);
- BUG();
+ /*
+ * The block buffer at the specified new address was already
+ * in use. This can happen if it is a virtual block number
+ * and has been reallocated due to corruption of the bitmap
+ * used to manage its allocation state (if not, the buffer
+ * clearing of an abandoned b-tree node is missing somewhere).
+ */
+ nilfs_error(inode->i_sb,
+ "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)",
+ (unsigned long long)blocknr, inode->i_ino);
+ goto failed;
}
memset(bh->b_data, 0, i_blocksize(inode));
bh->b_bdev = inode->i_sb->s_bdev;
@@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
unlock_page(bh->b_page);
put_page(bh->b_page);
return bh;
+
+failed:
+ unlock_page(bh->b_page);
+ put_page(bh->b_page);
+ brelse(bh);
+ return ERR_PTR(-EIO);
}
int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr,
@@ -217,8 +232,8 @@ int nilfs_btnode_prepare_change_key(struct address_space *btnc,
}
nbh = nilfs_btnode_create_block(btnc, newkey);
- if (!nbh)
- return -ENOMEM;
+ if (IS_ERR(nbh))
+ return PTR_ERR(nbh);
BUG_ON(nbh == obh);
ctxt->newbh = nbh;
diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c
index 65659fa0372e..598f05867059 100644
--- a/fs/nilfs2/btree.c
+++ b/fs/nilfs2/btree.c
@@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree,
struct buffer_head *bh;
bh = nilfs_btnode_create_block(btnc, ptr);
- if (!bh)
- return -ENOMEM;
+ if (IS_ERR(bh))
+ return PTR_ERR(bh);
set_buffer_nilfs_volatile(bh);
*bhp = bh;
diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c
index 5783efafbabd..e10f8a777ab0 100644
--- a/fs/nilfs2/segment.c
+++ b/fs/nilfs2/segment.c
@@ -136,7 +136,7 @@ static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int);
#define nilfs_cnt32_ge(a, b) \
(typecheck(__u32, a) && typecheck(__u32, b) && \
- ((__s32)(a) - (__s32)(b) >= 0))
+ ((__s32)((a) - (b)) >= 0))
static int nilfs_prepare_segment_lock(struct super_block *sb,
struct nilfs_transaction_info *ti)
diff --git a/fs/ntfs3/attrib.c b/fs/ntfs3/attrib.c
index 7aadf5010999..fc6cea60044e 100644
--- a/fs/ntfs3/attrib.c
+++ b/fs/ntfs3/attrib.c
@@ -231,7 +231,7 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
struct ntfs_sb_info *sbi;
struct ATTRIB *attr_s;
struct MFT_REC *rec;
- u32 used, asize, rsize, aoff, align;
+ u32 used, asize, rsize, aoff;
bool is_data;
CLST len, alen;
char *next;
@@ -252,10 +252,13 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
rsize = le32_to_cpu(attr->res.data_size);
is_data = attr->type == ATTR_DATA && !attr->name_len;
- align = sbi->cluster_size;
- if (is_attr_compressed(attr))
- align <<= COMPRESSION_UNIT;
- len = (rsize + align - 1) >> sbi->cluster_bits;
+ /* len - how many clusters required to store 'rsize' bytes */
+ if (is_attr_compressed(attr)) {
+ u8 shift = sbi->cluster_bits + NTFS_LZNT_CUNIT;
+ len = ((rsize + (1u << shift) - 1) >> shift) << NTFS_LZNT_CUNIT;
+ } else {
+ len = bytes_to_cluster(sbi, rsize);
+ }
run_init(run);
@@ -670,7 +673,8 @@ int attr_set_size(struct ntfs_inode *ni, enum ATTR_TYPE type,
goto undo_2;
}
- if (!is_mft)
+ /* keep runs for $MFT::$ATTR_DATA and $MFT::$ATTR_BITMAP. */
+ if (ni->mi.rno != MFT_REC_MFT)
run_truncate_head(run, evcn + 1);
svcn = le64_to_cpu(attr->nres.svcn);
@@ -972,6 +976,19 @@ int attr_data_get_block(struct ntfs_inode *ni, CLST vcn, CLST clen, CLST *lcn,
if (err)
goto out;
+ /* Check for compressed frame. */
+ err = attr_is_frame_compressed(ni, attr, vcn >> NTFS_LZNT_CUNIT, &hint);
+ if (err)
+ goto out;
+
+ if (hint) {
+ /* if frame is compressed - don't touch it. */
+ *lcn = COMPRESSED_LCN;
+ *len = hint;
+ err = -EOPNOTSUPP;
+ goto out;
+ }
+
if (!*len) {
if (run_lookup_entry(run, vcn, lcn, len, NULL)) {
if (*lcn != SPARSE_LCN || !new)
@@ -1722,6 +1739,7 @@ int attr_allocate_frame(struct ntfs_inode *ni, CLST frame, size_t compr_size,
attr_b->nres.total_size = cpu_to_le64(total_size);
inode_set_bytes(&ni->vfs_inode, total_size);
+ ni->ni_flags |= NI_FLAG_UPDATE_PARENT;
mi_b->dirty = true;
mark_inode_dirty(&ni->vfs_inode);
diff --git a/fs/ntfs3/bitmap.c b/fs/ntfs3/bitmap.c
index 845f9b22deef..931a7744d186 100644
--- a/fs/ntfs3/bitmap.c
+++ b/fs/ntfs3/bitmap.c
@@ -1382,7 +1382,7 @@ int wnd_extend(struct wnd_bitmap *wnd, size_t new_bits)
err = ntfs_vbo_to_lbo(sbi, &wnd->run, vbo, &lbo, &bytes);
if (err)
- break;
+ return err;
bh = ntfs_bread(sb, lbo >> sb->s_blocksize_bits);
if (!bh)
diff --git a/fs/ntfs3/dir.c b/fs/ntfs3/dir.c
index ac8eb8657f1a..9d0a09f00b38 100644
--- a/fs/ntfs3/dir.c
+++ b/fs/ntfs3/dir.c
@@ -326,7 +326,8 @@ static inline int ntfs_filldir(struct ntfs_sb_info *sbi, struct ntfs_inode *ni,
* It does additional locks/reads just to get the type of name.
* Should we use additional mount option to enable branch below?
*/
- if ((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) &&
+ if (((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) ||
+ fname->dup.ea_size) &&
ino != ni->mi.rno) {
struct inode *inode = ntfs_iget5(sbi->sb, &e->ref, NULL);
if (!IS_ERR_OR_NULL(inode)) {
diff --git a/fs/ntfs3/file.c b/fs/ntfs3/file.c
index dfd5402a42e4..cd69cbd0aaae 100644
--- a/fs/ntfs3/file.c
+++ b/fs/ntfs3/file.c
@@ -299,10 +299,7 @@ static int ntfs_file_mmap(struct file *file, struct vm_area_struct *vma)
}
if (ni->i_valid < to) {
- if (!inode_trylock(inode)) {
- err = -EAGAIN;
- goto out;
- }
+ inode_lock(inode);
err = ntfs_extend_initialized_size(file, ni,
ni->i_valid, to);
inode_unlock(inode);
diff --git a/fs/ntfs3/frecord.c b/fs/ntfs3/frecord.c
index 22fe7f58ad63..424865dfca74 100644
--- a/fs/ntfs3/frecord.c
+++ b/fs/ntfs3/frecord.c
@@ -1501,7 +1501,7 @@ int ni_insert_nonresident(struct ntfs_inode *ni, enum ATTR_TYPE type,
if (is_ext) {
if (flags & ATTR_FLAG_COMPRESSED)
- attr->nres.c_unit = COMPRESSION_UNIT;
+ attr->nres.c_unit = NTFS_LZNT_CUNIT;
attr->nres.total_size = attr->nres.alloc_size;
}
diff --git a/fs/ntfs3/fslog.c b/fs/ntfs3/fslog.c
index c14ab9d5cfc7..231b012fb19d 100644
--- a/fs/ntfs3/fslog.c
+++ b/fs/ntfs3/fslog.c
@@ -2996,7 +2996,7 @@ static struct ATTRIB *attr_create_nonres_log(struct ntfs_sb_info *sbi,
if (is_ext) {
attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
if (is_attr_compressed(attr))
- attr->nres.c_unit = COMPRESSION_UNIT;
+ attr->nres.c_unit = NTFS_LZNT_CUNIT;
attr->nres.run_off =
cpu_to_le16(SIZEOF_NONRESIDENT_EX + name_size);
@@ -3922,6 +3922,9 @@ int log_replay(struct ntfs_inode *ni, bool *initialized)
goto out;
}
+ log->page_mask = log->page_size - 1;
+ log->page_bits = blksize_bits(log->page_size);
+
/* If the file size has shrunk then we won't mount it. */
if (log->l_size < le64_to_cpu(ra2->l_size)) {
err = -EINVAL;
diff --git a/fs/ntfs3/index.c b/fs/ntfs3/index.c
index 14284f0ed46a..0d8a96136b08 100644
--- a/fs/ntfs3/index.c
+++ b/fs/ntfs3/index.c
@@ -978,7 +978,7 @@ static struct indx_node *indx_new(struct ntfs_index *indx,
hdr->used =
cpu_to_le32(eo + sizeof(struct NTFS_DE) + sizeof(u64));
de_set_vbn_le(e, *sub_vbn);
- hdr->flags = 1;
+ hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
} else {
e->size = cpu_to_le16(sizeof(struct NTFS_DE));
hdr->used = cpu_to_le32(eo + sizeof(struct NTFS_DE));
@@ -1682,7 +1682,7 @@ static int indx_insert_into_root(struct ntfs_index *indx, struct ntfs_inode *ni,
e->size = cpu_to_le16(sizeof(struct NTFS_DE) + sizeof(u64));
e->flags = NTFS_IE_HAS_SUBNODES | NTFS_IE_LAST;
- hdr->flags = 1;
+ hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
hdr->used = hdr->total =
cpu_to_le32(new_root_size - offsetof(struct INDEX_ROOT, ihdr));
diff --git a/fs/ntfs3/inode.c b/fs/ntfs3/inode.c
index 6af705ccba65..1545262995da 100644
--- a/fs/ntfs3/inode.c
+++ b/fs/ntfs3/inode.c
@@ -1498,7 +1498,7 @@ struct inode *ntfs_create_inode(struct mnt_idmap *idmap, struct inode *dir,
attr->size = cpu_to_le32(SIZEOF_NONRESIDENT_EX + 8);
attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
attr->flags = ATTR_FLAG_COMPRESSED;
- attr->nres.c_unit = COMPRESSION_UNIT;
+ attr->nres.c_unit = NTFS_LZNT_CUNIT;
asize = SIZEOF_NONRESIDENT_EX + 8;
} else {
attr->size = cpu_to_le32(SIZEOF_NONRESIDENT + 8);
@@ -1652,7 +1652,9 @@ struct inode *ntfs_create_inode(struct mnt_idmap *idmap, struct inode *dir,
* The packed size of extended attribute is stored in direntry too.
* 'fname' here points to inside new_de.
*/
- ntfs_save_wsl_perm(inode, &fname->dup.ea_size);
+ err = ntfs_save_wsl_perm(inode, &fname->dup.ea_size);
+ if (err)
+ goto out6;
/*
* update ea_size in file_name attribute too.
@@ -1694,6 +1696,12 @@ struct inode *ntfs_create_inode(struct mnt_idmap *idmap, struct inode *dir,
goto out2;
out6:
+ attr = ni_find_attr(ni, NULL, NULL, ATTR_EA, NULL, 0, NULL, NULL);
+ if (attr && attr->non_res) {
+ /* Delete ATTR_EA, if non-resident. */
+ attr_set_size(ni, ATTR_EA, NULL, 0, NULL, 0, NULL, false, NULL);
+ }
+
if (rp_inserted)
ntfs_remove_reparse(sbi, IO_REPARSE_TAG_SYMLINK, &new_de->ref);
@@ -2117,5 +2125,6 @@ const struct address_space_operations ntfs_aops = {
const struct address_space_operations ntfs_aops_cmpr = {
.read_folio = ntfs_read_folio,
.readahead = ntfs_readahead,
+ .dirty_folio = block_dirty_folio,
};
// clang-format on
diff --git a/fs/ntfs3/ntfs.h b/fs/ntfs3/ntfs.h
index b70288cc5f6f..964e27c7b901 100644
--- a/fs/ntfs3/ntfs.h
+++ b/fs/ntfs3/ntfs.h
@@ -82,9 +82,6 @@ typedef u32 CLST;
#define RESIDENT_LCN ((CLST)-2)
#define COMPRESSED_LCN ((CLST)-3)
-#define COMPRESSION_UNIT 4
-#define COMPRESS_MAX_CLUSTER 0x1000
-
enum RECORD_NUM {
MFT_REC_MFT = 0,
MFT_REC_MIRR = 1,
@@ -696,14 +693,15 @@ static inline bool de_has_vcn_ex(const struct NTFS_DE *e)
offsetof(struct ATTR_FILE_NAME, name) + \
NTFS_NAME_LEN * sizeof(short), 8)
+#define NTFS_INDEX_HDR_HAS_SUBNODES cpu_to_le32(1)
+
struct INDEX_HDR {
__le32 de_off; // 0x00: The offset from the start of this structure
// to the first NTFS_DE.
__le32 used; // 0x04: The size of this structure plus all
// entries (quad-word aligned).
__le32 total; // 0x08: The allocated size of for this structure plus all entries.
- u8 flags; // 0x0C: 0x00 = Small directory, 0x01 = Large directory.
- u8 res[3];
+ __le32 flags; // 0x0C: 0x00 = Small directory, 0x01 = Large directory.
//
// de_off + used <= total
@@ -751,7 +749,7 @@ static inline struct NTFS_DE *hdr_next_de(const struct INDEX_HDR *hdr,
static inline bool hdr_has_subnode(const struct INDEX_HDR *hdr)
{
- return hdr->flags & 1;
+ return hdr->flags & NTFS_INDEX_HDR_HAS_SUBNODES;
}
struct INDEX_BUFFER {
@@ -771,7 +769,7 @@ static inline bool ib_is_empty(const struct INDEX_BUFFER *ib)
static inline bool ib_is_leaf(const struct INDEX_BUFFER *ib)
{
- return !(ib->ihdr.flags & 1);
+ return !(ib->ihdr.flags & NTFS_INDEX_HDR_HAS_SUBNODES);
}
/* Index root structure ( 0x90 ). */
diff --git a/fs/ntfs3/super.c b/fs/ntfs3/super.c
index 10659817f98c..d47cfa215a36 100644
--- a/fs/ntfs3/super.c
+++ b/fs/ntfs3/super.c
@@ -276,7 +276,7 @@ static const struct fs_parameter_spec ntfs_fs_parameters[] = {
fsparam_flag_no("acl", Opt_acl),
fsparam_string("iocharset", Opt_iocharset),
fsparam_flag_no("prealloc", Opt_prealloc),
- fsparam_flag_no("nocase", Opt_nocase),
+ fsparam_flag_no("case", Opt_nocase),
{}
};
// clang-format on
@@ -463,7 +463,7 @@ static int ntfs3_volinfo(struct seq_file *m, void *o)
struct super_block *sb = m->private;
struct ntfs_sb_info *sbi = sb->s_fs_info;
- seq_printf(m, "ntfs%d.%d\n%u\n%zu\n\%zu\n%zu\n%s\n%s\n",
+ seq_printf(m, "ntfs%d.%d\n%u\n%zu\n%zu\n%zu\n%s\n%s\n",
sbi->volume.major_ver, sbi->volume.minor_ver,
sbi->cluster_size, sbi->used.bitmap.nbits,
sbi->mft.bitmap.nbits,
diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c
index ac605f143762..59571737e167 100644
--- a/fs/proc/task_mmu.c
+++ b/fs/proc/task_mmu.c
@@ -1358,8 +1358,7 @@ static inline pagemap_entry_t make_pme(u64 frame, u64 flags)
return (pagemap_entry_t) { .pme = (frame & PM_PFRAME_MASK) | flags };
}
-static int add_to_pagemap(unsigned long addr, pagemap_entry_t *pme,
- struct pagemapread *pm)
+static int add_to_pagemap(pagemap_entry_t *pme, struct pagemapread *pm)
{
pm->buffer[pm->pos++] = *pme;
if (pm->pos >= pm->len)
@@ -1386,7 +1385,7 @@ static int pagemap_pte_hole(unsigned long start, unsigned long end,
hole_end = end;
for (; addr < hole_end; addr += PAGE_SIZE) {
- err = add_to_pagemap(addr, &pme, pm);
+ err = add_to_pagemap(&pme, pm);
if (err)
goto out;
}
@@ -1398,7 +1397,7 @@ static int pagemap_pte_hole(unsigned long start, unsigned long end,
if (vma->vm_flags & VM_SOFTDIRTY)
pme = make_pme(0, PM_SOFT_DIRTY);
for (; addr < min(end, vma->vm_end); addr += PAGE_SIZE) {
- err = add_to_pagemap(addr, &pme, pm);
+ err = add_to_pagemap(&pme, pm);
if (err)
goto out;
}
@@ -1412,7 +1411,6 @@ static pagemap_entry_t pte_to_pagemap_entry(struct pagemapread *pm,
{
u64 frame = 0, flags = 0;
struct page *page = NULL;
- bool migration = false;
if (pte_present(pte)) {
if (pm->show_pfn)
@@ -1444,7 +1442,6 @@ static pagemap_entry_t pte_to_pagemap_entry(struct pagemapread *pm,
(offset << MAX_SWAPFILES_SHIFT);
}
flags |= PM_SWAP;
- migration = is_migration_entry(entry);
if (is_pfn_swap_entry(entry))
page = pfn_swap_entry_to_page(entry);
if (pte_marker_entry_uffd_wp(entry))
@@ -1453,7 +1450,7 @@ static pagemap_entry_t pte_to_pagemap_entry(struct pagemapread *pm,
if (page && !PageAnon(page))
flags |= PM_FILE;
- if (page && !migration && page_mapcount(page) == 1)
+ if (page && (flags & PM_PRESENT) && page_mapcount(page) == 1)
flags |= PM_MMAP_EXCLUSIVE;
if (vma->vm_flags & VM_SOFTDIRTY)
flags |= PM_SOFT_DIRTY;
@@ -1470,10 +1467,10 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
pte_t *pte, *orig_pte;
int err = 0;
#ifdef CONFIG_TRANSPARENT_HUGEPAGE
- bool migration = false;
ptl = pmd_trans_huge_lock(pmdp, vma);
if (ptl) {
+ unsigned int idx = (addr & ~PMD_MASK) >> PAGE_SHIFT;
u64 flags = 0, frame = 0;
pmd_t pmd = *pmdp;
struct page *page = NULL;
@@ -1490,8 +1487,7 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
if (pmd_uffd_wp(pmd))
flags |= PM_UFFD_WP;
if (pm->show_pfn)
- frame = pmd_pfn(pmd) +
- ((addr & ~PMD_MASK) >> PAGE_SHIFT);
+ frame = pmd_pfn(pmd) + idx;
}
#ifdef CONFIG_ARCH_ENABLE_THP_MIGRATION
else if (is_swap_pmd(pmd)) {
@@ -1500,11 +1496,9 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
if (pm->show_pfn) {
if (is_pfn_swap_entry(entry))
- offset = swp_offset_pfn(entry);
+ offset = swp_offset_pfn(entry) + idx;
else
- offset = swp_offset(entry);
- offset = offset +
- ((addr & ~PMD_MASK) >> PAGE_SHIFT);
+ offset = swp_offset(entry) + idx;
frame = swp_type(entry) |
(offset << MAX_SWAPFILES_SHIFT);
}
@@ -1514,18 +1508,23 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
if (pmd_swp_uffd_wp(pmd))
flags |= PM_UFFD_WP;
VM_BUG_ON(!is_pmd_migration_entry(pmd));
- migration = is_migration_entry(entry);
page = pfn_swap_entry_to_page(entry);
}
#endif
- if (page && !migration && page_mapcount(page) == 1)
- flags |= PM_MMAP_EXCLUSIVE;
+ if (page && !PageAnon(page))
+ flags |= PM_FILE;
+
+ for (; addr != end; addr += PAGE_SIZE, idx++) {
+ unsigned long cur_flags = flags;
+ pagemap_entry_t pme;
- for (; addr != end; addr += PAGE_SIZE) {
- pagemap_entry_t pme = make_pme(frame, flags);
+ if (page && (flags & PM_PRESENT) &&
+ page_mapcount(page + idx) == 1)
+ cur_flags |= PM_MMAP_EXCLUSIVE;
- err = add_to_pagemap(addr, &pme, pm);
+ pme = make_pme(frame, cur_flags);
+ err = add_to_pagemap(&pme, pm);
if (err)
break;
if (pm->show_pfn) {
@@ -1553,7 +1552,7 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
pagemap_entry_t pme;
pme = pte_to_pagemap_entry(pm, vma, addr, ptep_get(pte));
- err = add_to_pagemap(addr, &pme, pm);
+ err = add_to_pagemap(&pme, pm);
if (err)
break;
}
@@ -1603,7 +1602,7 @@ static int pagemap_hugetlb_range(pte_t *ptep, unsigned long hmask,
for (; addr != end; addr += PAGE_SIZE) {
pagemap_entry_t pme = make_pme(frame, flags);
- err = add_to_pagemap(addr, &pme, pm);
+ err = add_to_pagemap(&pme, pm);
if (err)
return err;
if (pm->show_pfn && (flags & PM_PRESENT))
diff --git a/fs/smb/client/cifsfs.c b/fs/smb/client/cifsfs.c
index 19183b8f26b0..87caeff427a1 100644
--- a/fs/smb/client/cifsfs.c
+++ b/fs/smb/client/cifsfs.c
@@ -1885,12 +1885,12 @@ init_cifs(void)
WQ_FREEZABLE|WQ_MEM_RECLAIM, 0);
if (!serverclose_wq) {
rc = -ENOMEM;
- goto out_destroy_serverclose_wq;
+ goto out_destroy_deferredclose_wq;
}
rc = cifs_init_inodecache();
if (rc)
- goto out_destroy_deferredclose_wq;
+ goto out_destroy_serverclose_wq;
rc = init_mids();
if (rc)
@@ -1952,6 +1952,8 @@ init_cifs(void)
destroy_mids();
out_destroy_inodecache:
cifs_destroy_inodecache();
+out_destroy_serverclose_wq:
+ destroy_workqueue(serverclose_wq);
out_destroy_deferredclose_wq:
destroy_workqueue(deferredclose_wq);
out_destroy_cifsoplockd_wq:
@@ -1962,8 +1964,6 @@ init_cifs(void)
destroy_workqueue(decrypt_wq);
out_destroy_cifsiod_wq:
destroy_workqueue(cifsiod_wq);
-out_destroy_serverclose_wq:
- destroy_workqueue(serverclose_wq);
out_clean_proc:
cifs_proc_clean();
return rc;
diff --git a/fs/smb/client/connect.c b/fs/smb/client/connect.c
index 7a16e12f5da8..d2307162a2de 100644
--- a/fs/smb/client/connect.c
+++ b/fs/smb/client/connect.c
@@ -2614,6 +2614,13 @@ cifs_get_tcon(struct cifs_ses *ses, struct smb3_fs_context *ctx)
cifs_dbg(VFS, "Server does not support mounting with posix SMB3.11 extensions\n");
rc = -EOPNOTSUPP;
goto out_fail;
+ } else if (ses->server->vals->protocol_id == SMB10_PROT_ID)
+ if (cap_unix(ses))
+ cifs_dbg(FYI, "Unix Extensions requested on SMB1 mount\n");
+ else {
+ cifs_dbg(VFS, "SMB1 Unix Extensions not supported by server\n");
+ rc = -EOPNOTSUPP;
+ goto out_fail;
} else {
cifs_dbg(VFS,
"Check vers= mount option. SMB3.11 disabled but required for POSIX extensions\n");
@@ -3686,6 +3693,7 @@ int cifs_mount(struct cifs_sb_info *cifs_sb, struct smb3_fs_context *ctx)
}
#endif
+#ifdef CONFIG_CIFS_ALLOW_INSECURE_LEGACY
/*
* Issue a TREE_CONNECT request.
*/
@@ -3807,11 +3815,25 @@ CIFSTCon(const unsigned int xid, struct cifs_ses *ses,
else
tcon->Flags = 0;
cifs_dbg(FYI, "Tcon flags: 0x%x\n", tcon->Flags);
- }
+ /*
+ * reset_cifs_unix_caps calls QFSInfo which requires
+ * need_reconnect to be false, but we would not need to call
+ * reset_caps if this were not a reconnect case so must check
+ * need_reconnect flag here. The caller will also clear
+ * need_reconnect when tcon was successful but needed to be
+ * cleared earlier in the case of unix extensions reconnect
+ */
+ if (tcon->need_reconnect && tcon->unix_ext) {
+ cifs_dbg(FYI, "resetting caps for %s\n", tcon->tree_name);
+ tcon->need_reconnect = false;
+ reset_cifs_unix_caps(xid, tcon, NULL, NULL);
+ }
+ }
cifs_buf_release(smb_buffer);
return rc;
}
+#endif /* CONFIG_CIFS_ALLOW_INSECURE_LEGACY */
static void delayed_free(struct rcu_head *p)
{
diff --git a/fs/super.c b/fs/super.c
index 2d762ce67f6e..576abb1ff040 100644
--- a/fs/super.c
+++ b/fs/super.c
@@ -781,6 +781,17 @@ struct super_block *sget_fc(struct fs_context *fc,
struct user_namespace *user_ns = fc->global ? &init_user_ns : fc->user_ns;
int err;
+ /*
+ * Never allow s_user_ns != &init_user_ns when FS_USERNS_MOUNT is
+ * not set, as the filesystem is likely unprepared to handle it.
+ * This can happen when fsconfig() is called from init_user_ns with
+ * an fs_fd opened in another user namespace.
+ */
+ if (user_ns != &init_user_ns && !(fc->fs_type->fs_flags & FS_USERNS_MOUNT)) {
+ errorfc(fc, "VFS: Mounting from non-initial user namespace is not allowed");
+ return ERR_PTR(-EPERM);
+ }
+
retry:
spin_lock(&sb_lock);
if (test) {
diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c
index ab3ffc355949..558ad046972a 100644
--- a/fs/udf/balloc.c
+++ b/fs/udf/balloc.c
@@ -64,8 +64,12 @@ static int read_block_bitmap(struct super_block *sb,
}
for (i = 0; i < count; i++)
- if (udf_test_bit(i + off, bh->b_data))
+ if (udf_test_bit(i + off, bh->b_data)) {
+ bitmap->s_block_bitmap[bitmap_nr] =
+ ERR_PTR(-EFSCORRUPTED);
+ brelse(bh);
return -EFSCORRUPTED;
+ }
return 0;
}
@@ -81,8 +85,15 @@ static int __load_block_bitmap(struct super_block *sb,
block_group, nr_groups);
}
- if (bitmap->s_block_bitmap[block_group])
+ if (bitmap->s_block_bitmap[block_group]) {
+ /*
+ * The bitmap failed verification in the past. No point in
+ * trying again.
+ */
+ if (IS_ERR(bitmap->s_block_bitmap[block_group]))
+ return PTR_ERR(bitmap->s_block_bitmap[block_group]);
return block_group;
+ }
retval = read_block_bitmap(sb, bitmap, block_group, block_group);
if (retval < 0)
diff --git a/fs/udf/file.c b/fs/udf/file.c
index 0ceac4b5937c..94daaaf76f71 100644
--- a/fs/udf/file.c
+++ b/fs/udf/file.c
@@ -232,7 +232,9 @@ static int udf_setattr(struct mnt_idmap *idmap, struct dentry *dentry,
if ((attr->ia_valid & ATTR_SIZE) &&
attr->ia_size != i_size_read(inode)) {
+ filemap_invalidate_lock(inode->i_mapping);
error = udf_setsize(inode, attr->ia_size);
+ filemap_invalidate_unlock(inode->i_mapping);
if (error)
return error;
}
diff --git a/fs/udf/inode.c b/fs/udf/inode.c
index 1ff8c1f17f9e..8db07d1f56bc 100644
--- a/fs/udf/inode.c
+++ b/fs/udf/inode.c
@@ -1252,7 +1252,6 @@ int udf_setsize(struct inode *inode, loff_t newsize)
if (IS_APPEND(inode) || IS_IMMUTABLE(inode))
return -EPERM;
- filemap_invalidate_lock(inode->i_mapping);
iinfo = UDF_I(inode);
if (newsize > inode->i_size) {
if (iinfo->i_alloc_type == ICBTAG_FLAG_AD_IN_ICB) {
@@ -1265,11 +1264,11 @@ int udf_setsize(struct inode *inode, loff_t newsize)
}
err = udf_expand_file_adinicb(inode);
if (err)
- goto out_unlock;
+ return err;
}
err = udf_extend_file(inode, newsize);
if (err)
- goto out_unlock;
+ return err;
set_size:
truncate_setsize(inode, newsize);
} else {
@@ -1287,14 +1286,14 @@ int udf_setsize(struct inode *inode, loff_t newsize)
err = block_truncate_page(inode->i_mapping, newsize,
udf_get_block);
if (err)
- goto out_unlock;
+ return err;
truncate_setsize(inode, newsize);
down_write(&iinfo->i_data_sem);
udf_clear_extent_cache(inode);
err = udf_truncate_extents(inode);
up_write(&iinfo->i_data_sem);
if (err)
- goto out_unlock;
+ return err;
}
update_time:
inode->i_mtime = inode_set_ctime_current(inode);
@@ -1302,8 +1301,6 @@ int udf_setsize(struct inode *inode, loff_t newsize)
udf_sync_inode(inode);
else
mark_inode_dirty(inode);
-out_unlock:
- filemap_invalidate_unlock(inode->i_mapping);
return err;
}
diff --git a/fs/udf/namei.c b/fs/udf/namei.c
index ae55ab8859b6..605f182da42c 100644
--- a/fs/udf/namei.c
+++ b/fs/udf/namei.c
@@ -874,8 +874,6 @@ static int udf_rename(struct mnt_idmap *idmap, struct inode *old_dir,
if (has_diriter) {
diriter.fi.icb.extLocation =
cpu_to_lelb(UDF_I(new_dir)->i_location);
- udf_update_tag((char *)&diriter.fi,
- udf_dir_entry_len(&diriter.fi));
udf_fiiter_write_fi(&diriter, NULL);
udf_fiiter_release(&diriter);
diff --git a/fs/udf/super.c b/fs/udf/super.c
index 928a04d9d9e0..e0080fda2526 100644
--- a/fs/udf/super.c
+++ b/fs/udf/super.c
@@ -269,7 +269,8 @@ static void udf_sb_free_bitmap(struct udf_bitmap *bitmap)
int nr_groups = bitmap->s_nr_groups;
for (i = 0; i < nr_groups; i++)
- brelse(bitmap->s_block_bitmap[i]);
+ if (!IS_ERR_OR_NULL(bitmap->s_block_bitmap[i]))
+ brelse(bitmap->s_block_bitmap[i]);
kvfree(bitmap);
}
diff --git a/include/asm-generic/vmlinux.lds.h b/include/asm-generic/vmlinux.lds.h
index bae0fe4d499b..63029bc7c9dd 100644
--- a/include/asm-generic/vmlinux.lds.h
+++ b/include/asm-generic/vmlinux.lds.h
@@ -101,7 +101,7 @@
#define DATA_MAIN .data .data.[0-9a-zA-Z_]* .data..L* .data..compoundliteral* .data.$__unnamed_* .data.$L*
#define SDATA_MAIN .sdata .sdata.[0-9a-zA-Z_]*
#define RODATA_MAIN .rodata .rodata.[0-9a-zA-Z_]* .rodata..L*
-#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..compoundliteral*
+#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..L* .bss..compoundliteral*
#define SBSS_MAIN .sbss .sbss.[0-9a-zA-Z_]*
#else
#define TEXT_MAIN .text
diff --git a/include/drm/drm_mipi_dsi.h b/include/drm/drm_mipi_dsi.h
index 3011d33eccbd..900262f4c234 100644
--- a/include/drm/drm_mipi_dsi.h
+++ b/include/drm/drm_mipi_dsi.h
@@ -305,17 +305,17 @@ int mipi_dsi_dcs_get_display_brightness_large(struct mipi_dsi_device *dsi,
* @dsi: DSI peripheral device
* @seq: buffer containing the payload
*/
-#define mipi_dsi_generic_write_seq(dsi, seq...) \
- do { \
- static const u8 d[] = { seq }; \
- struct device *dev = &dsi->dev; \
- int ret; \
- ret = mipi_dsi_generic_write(dsi, d, ARRAY_SIZE(d)); \
- if (ret < 0) { \
- dev_err_ratelimited(dev, "transmit data failed: %d\n", \
- ret); \
- return ret; \
- } \
+#define mipi_dsi_generic_write_seq(dsi, seq...) \
+ do { \
+ static const u8 d[] = { seq }; \
+ struct device *dev = &dsi->dev; \
+ ssize_t ret; \
+ ret = mipi_dsi_generic_write(dsi, d, ARRAY_SIZE(d)); \
+ if (ret < 0) { \
+ dev_err_ratelimited(dev, "transmit data failed: %zd\n", \
+ ret); \
+ return ret; \
+ } \
} while (0)
/**
@@ -324,18 +324,18 @@ int mipi_dsi_dcs_get_display_brightness_large(struct mipi_dsi_device *dsi,
* @cmd: Command
* @seq: buffer containing data to be transmitted
*/
-#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...) \
- do { \
- static const u8 d[] = { cmd, seq }; \
- struct device *dev = &dsi->dev; \
- int ret; \
- ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d)); \
- if (ret < 0) { \
- dev_err_ratelimited( \
- dev, "sending command %#02x failed: %d\n", \
- cmd, ret); \
- return ret; \
- } \
+#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...) \
+ do { \
+ static const u8 d[] = { cmd, seq }; \
+ struct device *dev = &dsi->dev; \
+ ssize_t ret; \
+ ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d)); \
+ if (ret < 0) { \
+ dev_err_ratelimited( \
+ dev, "sending command %#02x failed: %zd\n", \
+ cmd, ret); \
+ return ret; \
+ } \
} while (0)
/**
diff --git a/include/linux/bpf_verifier.h b/include/linux/bpf_verifier.h
index 2d84d820a7ba..b62535fd8de5 100644
--- a/include/linux/bpf_verifier.h
+++ b/include/linux/bpf_verifier.h
@@ -760,7 +760,7 @@ static inline u32 type_flag(u32 type)
/* only use after check_attach_btf_id() */
static inline enum bpf_prog_type resolve_prog_type(const struct bpf_prog *prog)
{
- return prog->type == BPF_PROG_TYPE_EXT ?
+ return (prog->type == BPF_PROG_TYPE_EXT && prog->aux->dst_prog) ?
prog->aux->dst_prog->type : prog->type;
}
diff --git a/include/linux/hugetlb.h b/include/linux/hugetlb.h
index 31b2927ada73..0c50c4fceb95 100644
--- a/include/linux/hugetlb.h
+++ b/include/linux/hugetlb.h
@@ -713,6 +713,7 @@ HPAGEFLAG(RawHwpUnreliable, raw_hwp_unreliable)
/* Defines one hugetlb page size */
struct hstate {
struct mutex resize_lock;
+ struct lock_class_key resize_key;
int next_nid_to_alloc;
int next_nid_to_free;
unsigned int order;
diff --git a/include/linux/jbd2.h b/include/linux/jbd2.h
index 0fc6c1f51262..8553dc1d0e89 100644
--- a/include/linux/jbd2.h
+++ b/include/linux/jbd2.h
@@ -1083,6 +1083,13 @@ struct journal_s
*/
int j_revoke_records_per_block;
+ /**
+ * @j_transaction_overhead:
+ *
+ * Number of blocks each transaction needs for its own bookkeeping
+ */
+ int j_transaction_overhead_buffers;
+
/**
* @j_commit_interval:
*
@@ -1666,11 +1673,6 @@ int jbd2_wait_inode_data(journal_t *journal, struct jbd2_inode *jinode);
int jbd2_fc_wait_bufs(journal_t *journal, int num_blks);
int jbd2_fc_release_bufs(journal_t *journal);
-static inline int jbd2_journal_get_max_txn_bufs(journal_t *journal)
-{
- return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
-}
-
/*
* is_journal_abort
*
diff --git a/include/linux/mlx5/qp.h b/include/linux/mlx5/qp.h
index f0e55bf3ec8b..ad1ce650146c 100644
--- a/include/linux/mlx5/qp.h
+++ b/include/linux/mlx5/qp.h
@@ -576,9 +576,12 @@ static inline const char *mlx5_qp_state_str(int state)
static inline int mlx5_get_qp_default_ts(struct mlx5_core_dev *dev)
{
- return !MLX5_CAP_ROCE(dev, qp_ts_format) ?
- MLX5_TIMESTAMP_FORMAT_FREE_RUNNING :
- MLX5_TIMESTAMP_FORMAT_DEFAULT;
+ u8 supported_ts_cap = mlx5_get_roce_state(dev) ?
+ MLX5_CAP_ROCE(dev, qp_ts_format) :
+ MLX5_CAP_GEN(dev, sq_ts_format);
+
+ return supported_ts_cap ? MLX5_TIMESTAMP_FORMAT_DEFAULT :
+ MLX5_TIMESTAMP_FORMAT_FREE_RUNNING;
}
#endif /* MLX5_QP_H */
diff --git a/include/linux/objagg.h b/include/linux/objagg.h
index 78021777df46..6df5b887dc54 100644
--- a/include/linux/objagg.h
+++ b/include/linux/objagg.h
@@ -8,7 +8,6 @@ struct objagg_ops {
size_t obj_size;
bool (*delta_check)(void *priv, const void *parent_obj,
const void *obj);
- int (*hints_obj_cmp)(const void *obj1, const void *obj2);
void * (*delta_create)(void *priv, void *parent_obj, void *obj);
void (*delta_destroy)(void *priv, void *delta_priv);
void * (*root_create)(void *priv, void *obj, unsigned int root_id);
diff --git a/include/linux/pci.h b/include/linux/pci.h
index 512cb40150df..f14130011621 100644
--- a/include/linux/pci.h
+++ b/include/linux/pci.h
@@ -1146,6 +1146,7 @@ int pci_get_interrupt_pin(struct pci_dev *dev, struct pci_dev **bridge);
u8 pci_common_swizzle(struct pci_dev *dev, u8 *pinp);
struct pci_dev *pci_dev_get(struct pci_dev *dev);
void pci_dev_put(struct pci_dev *dev);
+DEFINE_FREE(pci_dev_put, struct pci_dev *, if (_T) pci_dev_put(_T))
void pci_remove_bus(struct pci_bus *b);
void pci_stop_and_remove_bus_device(struct pci_dev *dev);
void pci_stop_and_remove_bus_device_locked(struct pci_dev *dev);
@@ -1851,6 +1852,7 @@ void pci_cfg_access_unlock(struct pci_dev *dev);
void pci_dev_lock(struct pci_dev *dev);
int pci_dev_trylock(struct pci_dev *dev);
void pci_dev_unlock(struct pci_dev *dev);
+DEFINE_GUARD(pci_dev, struct pci_dev *, pci_dev_lock(_T), pci_dev_unlock(_T))
/*
* PCI domain support. Sometimes called PCI segment (eg by ACPI),
diff --git a/include/linux/perf_event.h b/include/linux/perf_event.h
index e846f87e2d09..95d4118ee4a9 100644
--- a/include/linux/perf_event.h
+++ b/include/linux/perf_event.h
@@ -786,6 +786,7 @@ struct perf_event {
struct irq_work pending_irq;
struct callback_head pending_task;
unsigned int pending_work;
+ struct rcuwait pending_work_wait;
atomic_t event_limit;
diff --git a/include/linux/sbitmap.h b/include/linux/sbitmap.h
index d662cf136021..c09cdcc99471 100644
--- a/include/linux/sbitmap.h
+++ b/include/linux/sbitmap.h
@@ -36,6 +36,11 @@ struct sbitmap_word {
* @cleared: word holding cleared bits
*/
unsigned long cleared ____cacheline_aligned_in_smp;
+
+ /**
+ * @swap_lock: serializes simultaneous updates of ->word and ->cleared
+ */
+ spinlock_t swap_lock;
} ____cacheline_aligned_in_smp;
/**
diff --git a/include/linux/task_work.h b/include/linux/task_work.h
index 795ef5a68429..26b8a47f41fc 100644
--- a/include/linux/task_work.h
+++ b/include/linux/task_work.h
@@ -30,7 +30,8 @@ int task_work_add(struct task_struct *task, struct callback_head *twork,
struct callback_head *task_work_cancel_match(struct task_struct *task,
bool (*match)(struct callback_head *, void *data), void *data);
-struct callback_head *task_work_cancel(struct task_struct *, task_work_func_t);
+struct callback_head *task_work_cancel_func(struct task_struct *, task_work_func_t);
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb);
void task_work_run(void);
static inline void exit_task_work(struct task_struct *task)
diff --git a/include/linux/virtio_net.h b/include/linux/virtio_net.h
index 4dfa9b69ca8d..d1d7825318c3 100644
--- a/include/linux/virtio_net.h
+++ b/include/linux/virtio_net.h
@@ -56,6 +56,7 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
unsigned int thlen = 0;
unsigned int p_off = 0;
unsigned int ip_proto;
+ u64 ret, remainder, gso_size;
if (hdr->gso_type != VIRTIO_NET_HDR_GSO_NONE) {
switch (hdr->gso_type & ~VIRTIO_NET_HDR_GSO_ECN) {
@@ -98,6 +99,16 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
u32 off = __virtio16_to_cpu(little_endian, hdr->csum_offset);
u32 needed = start + max_t(u32, thlen, off + sizeof(__sum16));
+ if (hdr->gso_size) {
+ gso_size = __virtio16_to_cpu(little_endian, hdr->gso_size);
+ ret = div64_u64_rem(skb->len, gso_size, &remainder);
+ if (!(ret && (hdr->gso_size > needed) &&
+ ((remainder > needed) || (remainder == 0)))) {
+ return -EINVAL;
+ }
+ skb_shinfo(skb)->tx_flags |= SKBFL_SHARED_FRAG;
+ }
+
if (!pskb_may_pull(skb, needed))
return -EINVAL;
diff --git a/include/net/ip_fib.h b/include/net/ip_fib.h
index 15de07d36540..ca1700c2a573 100644
--- a/include/net/ip_fib.h
+++ b/include/net/ip_fib.h
@@ -173,6 +173,7 @@ struct fib_result {
unsigned char type;
unsigned char scope;
u32 tclassid;
+ dscp_t dscp;
struct fib_nh_common *nhc;
struct fib_info *fi;
struct fib_table *table;
diff --git a/include/net/tcp.h b/include/net/tcp.h
index 690770321a6e..71af24410443 100644
--- a/include/net/tcp.h
+++ b/include/net/tcp.h
@@ -624,6 +624,7 @@ void tcp_skb_collapse_tstamp(struct sk_buff *skb,
/* tcp_input.c */
void tcp_rearm_rto(struct sock *sk);
void tcp_synack_rtt_meas(struct sock *sk, struct request_sock *req);
+void tcp_done_with_error(struct sock *sk, int err);
void tcp_reset(struct sock *sk, struct sk_buff *skb);
void tcp_fin(struct sock *sk);
void tcp_check_space(struct sock *sk);
diff --git a/include/net/xfrm.h b/include/net/xfrm.h
index a3fd2cfed5e3..b280e7c46011 100644
--- a/include/net/xfrm.h
+++ b/include/net/xfrm.h
@@ -176,7 +176,10 @@ struct xfrm_state {
struct hlist_node gclist;
struct hlist_node bydst;
};
- struct hlist_node bysrc;
+ union {
+ struct hlist_node dev_gclist;
+ struct hlist_node bysrc;
+ };
struct hlist_node byspi;
struct hlist_node byseq;
@@ -1584,7 +1587,7 @@ int xfrm_state_check_expire(struct xfrm_state *x);
static inline void xfrm_dev_state_update_curlft(struct xfrm_state *x)
{
struct xfrm_dev_offload *xdo = &x->xso;
- struct net_device *dev = xdo->dev;
+ struct net_device *dev = READ_ONCE(xdo->dev);
if (x->xso.type != XFRM_DEV_OFFLOAD_PACKET)
return;
@@ -1943,13 +1946,16 @@ int xfrm_dev_policy_add(struct net *net, struct xfrm_policy *xp,
struct xfrm_user_offload *xuo, u8 dir,
struct netlink_ext_ack *extack);
bool xfrm_dev_offload_ok(struct sk_buff *skb, struct xfrm_state *x);
+void xfrm_dev_state_delete(struct xfrm_state *x);
+void xfrm_dev_state_free(struct xfrm_state *x);
static inline void xfrm_dev_state_advance_esn(struct xfrm_state *x)
{
struct xfrm_dev_offload *xso = &x->xso;
+ struct net_device *dev = READ_ONCE(xso->dev);
- if (xso->dev && xso->dev->xfrmdev_ops->xdo_dev_state_advance_esn)
- xso->dev->xfrmdev_ops->xdo_dev_state_advance_esn(x);
+ if (dev && dev->xfrmdev_ops->xdo_dev_state_advance_esn)
+ dev->xfrmdev_ops->xdo_dev_state_advance_esn(x);
}
static inline bool xfrm_dst_offload_ok(struct dst_entry *dst)
@@ -1970,28 +1976,6 @@ static inline bool xfrm_dst_offload_ok(struct dst_entry *dst)
return false;
}
-static inline void xfrm_dev_state_delete(struct xfrm_state *x)
-{
- struct xfrm_dev_offload *xso = &x->xso;
-
- if (xso->dev)
- xso->dev->xfrmdev_ops->xdo_dev_state_delete(x);
-}
-
-static inline void xfrm_dev_state_free(struct xfrm_state *x)
-{
- struct xfrm_dev_offload *xso = &x->xso;
- struct net_device *dev = xso->dev;
-
- if (dev && dev->xfrmdev_ops) {
- if (dev->xfrmdev_ops->xdo_dev_state_free)
- dev->xfrmdev_ops->xdo_dev_state_free(x);
- xso->dev = NULL;
- xso->type = XFRM_DEV_OFFLOAD_UNSPECIFIED;
- netdev_put(dev, &xso->dev_tracker);
- }
-}
-
static inline void xfrm_dev_policy_delete(struct xfrm_policy *x)
{
struct xfrm_dev_offload *xdo = &x->xdo;
diff --git a/include/sound/tas2781-dsp.h b/include/sound/tas2781-dsp.h
index 4ef0f5c6fe6c..af3319dab230 100644
--- a/include/sound/tas2781-dsp.h
+++ b/include/sound/tas2781-dsp.h
@@ -112,10 +112,17 @@ struct tasdevice_fw {
struct device *dev;
};
-enum tasdevice_dsp_fw_state {
- TASDEVICE_DSP_FW_NONE = 0,
+enum tasdevice_fw_state {
+ /* Driver in startup mode, not load any firmware. */
TASDEVICE_DSP_FW_PENDING,
+ /* DSP firmware in the system, but parsing error. */
TASDEVICE_DSP_FW_FAIL,
+ /*
+ * Only RCA (Reconfigurable Architecture) firmware load
+ * successfully.
+ */
+ TASDEVICE_RCA_FW_OK,
+ /* Both RCA and DSP firmware load successfully. */
TASDEVICE_DSP_FW_ALL_OK,
};
diff --git a/include/trace/events/rpcgss.h b/include/trace/events/rpcgss.h
index f50fcafc69de..78704f1209d3 100644
--- a/include/trace/events/rpcgss.h
+++ b/include/trace/events/rpcgss.h
@@ -54,7 +54,7 @@ TRACE_DEFINE_ENUM(GSS_S_UNSEQ_TOKEN);
TRACE_DEFINE_ENUM(GSS_S_GAP_TOKEN);
#define show_gss_status(x) \
- __print_flags(x, "|", \
+ __print_symbolic(x, \
{ GSS_S_BAD_MECH, "GSS_S_BAD_MECH" }, \
{ GSS_S_BAD_NAME, "GSS_S_BAD_NAME" }, \
{ GSS_S_BAD_NAMETYPE, "GSS_S_BAD_NAMETYPE" }, \
diff --git a/include/uapi/linux/netfilter/nf_tables.h b/include/uapi/linux/netfilter/nf_tables.h
index 117c6a9b845b..621e3035145e 100644
--- a/include/uapi/linux/netfilter/nf_tables.h
+++ b/include/uapi/linux/netfilter/nf_tables.h
@@ -1372,7 +1372,7 @@ enum nft_secmark_attributes {
#define NFTA_SECMARK_MAX (__NFTA_SECMARK_MAX - 1)
/* Max security context length */
-#define NFT_SECMARK_CTX_MAXLEN 256
+#define NFT_SECMARK_CTX_MAXLEN 4096
/**
* enum nft_reject_types - nf_tables reject expression reject types
diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h
index 6e574d7b7d79..393f2ee9c042 100644
--- a/include/uapi/linux/zorro_ids.h
+++ b/include/uapi/linux/zorro_ids.h
@@ -449,6 +449,9 @@
#define ZORRO_PROD_VMC_ISDN_BLASTER_Z2 ZORRO_ID(VMC, 0x01, 0)
#define ZORRO_PROD_VMC_HYPERCOM_4 ZORRO_ID(VMC, 0x02, 0)
+#define ZORRO_MANUF_CSLAB 0x1400
+#define ZORRO_PROD_CSLAB_WARP_1260 ZORRO_ID(CSLAB, 0x65, 0)
+
#define ZORRO_MANUF_INFORMATION 0x157C
#define ZORRO_PROD_INFORMATION_ISDN_ENGINE_I ZORRO_ID(INFORMATION, 0x64, 0)
diff --git a/include/ufs/ufshcd.h b/include/ufs/ufshcd.h
index 7d07b256e906..e4da39736068 100644
--- a/include/ufs/ufshcd.h
+++ b/include/ufs/ufshcd.h
@@ -1117,6 +1117,12 @@ static inline bool is_mcq_enabled(struct ufs_hba *hba)
return hba->mcq_enabled;
}
+static inline unsigned int ufshcd_mcq_opr_offset(struct ufs_hba *hba,
+ enum ufshcd_mcq_opr opr, int idx)
+{
+ return hba->mcq_opr[opr].offset + hba->mcq_opr[opr].stride * idx;
+}
+
#ifdef CONFIG_SCSI_UFS_VARIABLE_SG_ENTRY_SIZE
static inline size_t ufshcd_sg_entry_size(const struct ufs_hba *hba)
{
diff --git a/io_uring/io-wq.c b/io_uring/io-wq.c
index 8a99aabcac2c..98c9cfb98306 100644
--- a/io_uring/io-wq.c
+++ b/io_uring/io-wq.c
@@ -23,6 +23,7 @@
#include "io_uring.h"
#define WORKER_IDLE_TIMEOUT (5 * HZ)
+#define WORKER_INIT_LIMIT 3
enum {
IO_WORKER_F_UP = 0, /* up and active */
@@ -59,6 +60,7 @@ struct io_worker {
unsigned long create_state;
struct callback_head create_work;
+ int init_retries;
union {
struct rcu_head rcu;
@@ -746,7 +748,7 @@ static bool io_wq_work_match_all(struct io_wq_work *work, void *data)
return true;
}
-static inline bool io_should_retry_thread(long err)
+static inline bool io_should_retry_thread(struct io_worker *worker, long err)
{
/*
* Prevent perpetual task_work retry, if the task (or its group) is
@@ -754,6 +756,8 @@ static inline bool io_should_retry_thread(long err)
*/
if (fatal_signal_pending(current))
return false;
+ if (worker->init_retries++ >= WORKER_INIT_LIMIT)
+ return false;
switch (err) {
case -EAGAIN:
@@ -780,7 +784,7 @@ static void create_worker_cont(struct callback_head *cb)
io_init_new_worker(wq, worker, tsk);
io_worker_release(worker);
return;
- } else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+ } else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
struct io_wq_acct *acct = io_wq_get_acct(worker);
atomic_dec(&acct->nr_running);
@@ -847,7 +851,7 @@ static bool create_io_worker(struct io_wq *wq, int index)
tsk = create_io_thread(io_wq_worker, worker, NUMA_NO_NODE);
if (!IS_ERR(tsk)) {
io_init_new_worker(wq, worker, tsk);
- } else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+ } else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
kfree(worker);
goto fail;
} else {
diff --git a/io_uring/io_uring.c b/io_uring/io_uring.c
index a5628d29b9b1..68504709f75c 100644
--- a/io_uring/io_uring.c
+++ b/io_uring/io_uring.c
@@ -3350,8 +3350,11 @@ __cold void io_uring_cancel_generic(bool cancel_all, struct io_sq_data *sqd)
bool loop = false;
io_uring_drop_tctx_refs(current);
+ if (!tctx_inflight(tctx, !cancel_all))
+ break;
+
/* read completions before cancelations */
- inflight = tctx_inflight(tctx, !cancel_all);
+ inflight = tctx_inflight(tctx, false);
if (!inflight)
break;
diff --git a/io_uring/timeout.c b/io_uring/timeout.c
index 7fd7dbb211d6..4f1f710197d6 100644
--- a/io_uring/timeout.c
+++ b/io_uring/timeout.c
@@ -644,7 +644,7 @@ void io_queue_linked_timeout(struct io_kiocb *req)
static bool io_match_task(struct io_kiocb *head, struct task_struct *task,
bool cancel_all)
- __must_hold(&req->ctx->timeout_lock)
+ __must_hold(&head->ctx->timeout_lock)
{
struct io_kiocb *req;
diff --git a/kernel/bpf/btf.c b/kernel/bpf/btf.c
index a31704a6bb61..fbf9721ba21b 100644
--- a/kernel/bpf/btf.c
+++ b/kernel/bpf/btf.c
@@ -405,7 +405,7 @@ const char *btf_type_str(const struct btf_type *t)
struct btf_show {
u64 flags;
void *target; /* target of show operation (seq file, buffer) */
- void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
+ __printf(2, 0) void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
const struct btf *btf;
/* below are used during iteration */
struct {
@@ -7070,8 +7070,8 @@ static void btf_type_show(const struct btf *btf, u32 type_id, void *obj,
btf_type_ops(t)->show(btf, t, type_id, obj, 0, show);
}
-static void btf_seq_show(struct btf_show *show, const char *fmt,
- va_list args)
+__printf(2, 0) static void btf_seq_show(struct btf_show *show, const char *fmt,
+ va_list args)
{
seq_vprintf((struct seq_file *)show->target, fmt, args);
}
@@ -7104,8 +7104,8 @@ struct btf_show_snprintf {
int len; /* length we would have written */
};
-static void btf_snprintf_show(struct btf_show *show, const char *fmt,
- va_list args)
+__printf(2, 0) static void btf_snprintf_show(struct btf_show *show, const char *fmt,
+ va_list args)
{
struct btf_show_snprintf *ssnprintf = (struct btf_show_snprintf *)show;
int len;
diff --git a/kernel/cgroup/cgroup-v1.c b/kernel/cgroup/cgroup-v1.c
index 76db6c67e39a..9cb00ebe9ac6 100644
--- a/kernel/cgroup/cgroup-v1.c
+++ b/kernel/cgroup/cgroup-v1.c
@@ -802,7 +802,7 @@ void cgroup1_release_agent(struct work_struct *work)
goto out_free;
ret = cgroup_path_ns(cgrp, pathbuf, PATH_MAX, &init_cgroup_ns);
- if (ret < 0 || ret >= PATH_MAX)
+ if (ret < 0)
goto out_free;
argv[0] = agentbuf;
diff --git a/kernel/cgroup/cgroup.c b/kernel/cgroup/cgroup.c
index 518725b57200..094f51331925 100644
--- a/kernel/cgroup/cgroup.c
+++ b/kernel/cgroup/cgroup.c
@@ -1887,7 +1887,7 @@ int cgroup_show_path(struct seq_file *sf, struct kernfs_node *kf_node,
len = kernfs_path_from_node(kf_node, ns_cgroup->kn, buf, PATH_MAX);
spin_unlock_irq(&css_set_lock);
- if (len >= PATH_MAX)
+ if (len == -E2BIG)
len = -ERANGE;
else if (len > 0) {
seq_escape(sf, buf, " \t\n\\");
@@ -6277,7 +6277,7 @@ int proc_cgroup_show(struct seq_file *m, struct pid_namespace *ns,
if (cgroup_on_dfl(cgrp) || !(tsk->flags & PF_EXITING)) {
retval = cgroup_path_ns_locked(cgrp, buf, PATH_MAX,
current->nsproxy->cgroup_ns);
- if (retval >= PATH_MAX)
+ if (retval == -E2BIG)
retval = -ENAMETOOLONG;
if (retval < 0)
goto out_unlock;
diff --git a/kernel/cgroup/cpuset.c b/kernel/cgroup/cpuset.c
index 679460ebccfb..3646426c69e2 100644
--- a/kernel/cgroup/cpuset.c
+++ b/kernel/cgroup/cpuset.c
@@ -21,6 +21,7 @@
* License. See the file COPYING in the main directory of the Linux
* distribution for more details.
*/
+#include "cgroup-internal.h"
#include <linux/cpu.h>
#include <linux/cpumask.h>
@@ -4293,11 +4294,15 @@ int proc_cpuset_show(struct seq_file *m, struct pid_namespace *ns,
if (!buf)
goto out;
- css = task_get_css(tsk, cpuset_cgrp_id);
- retval = cgroup_path_ns(css->cgroup, buf, PATH_MAX,
- current->nsproxy->cgroup_ns);
- css_put(css);
- if (retval >= PATH_MAX)
+ rcu_read_lock();
+ spin_lock_irq(&css_set_lock);
+ css = task_css(tsk, cpuset_cgrp_id);
+ retval = cgroup_path_ns_locked(css->cgroup, buf, PATH_MAX,
+ current->nsproxy->cgroup_ns);
+ spin_unlock_irq(&css_set_lock);
+ rcu_read_unlock();
+
+ if (retval == -E2BIG)
retval = -ENAMETOOLONG;
if (retval < 0)
goto out_free;
diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c
index 2aeaf9765b24..4799f6250bb2 100644
--- a/kernel/debug/kdb/kdb_io.c
+++ b/kernel/debug/kdb/kdb_io.c
@@ -206,7 +206,7 @@ char kdb_getchar(void)
*/
static void kdb_position_cursor(char *prompt, char *buffer, char *cp)
{
- kdb_printf("\r%s", kdb_prompt_str);
+ kdb_printf("\r%s", prompt);
if (cp > buffer)
kdb_printf("%.*s", (int)(cp - buffer), buffer);
}
@@ -371,7 +371,7 @@ static char *kdb_read(char *buffer, size_t bufsize)
if (i >= dtab_count)
kdb_printf("...");
kdb_printf("\n");
- kdb_printf(kdb_prompt_str);
+ kdb_printf("%s", kdb_prompt_str);
kdb_printf("%s", buffer);
if (cp != lastchar)
kdb_position_cursor(kdb_prompt_str, buffer, cp);
@@ -463,7 +463,7 @@ char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt)
{
if (prompt && kdb_prompt_str != prompt)
strscpy(kdb_prompt_str, prompt, CMD_BUFLEN);
- kdb_printf(kdb_prompt_str);
+ kdb_printf("%s", kdb_prompt_str);
kdb_nextline = 1; /* Prompt and input resets line number */
return kdb_read(buffer, bufsize);
}
diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c
index e323ca48f7f2..f1d9f01b283d 100644
--- a/kernel/dma/mapping.c
+++ b/kernel/dma/mapping.c
@@ -67,8 +67,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr,
{
struct dma_devres match_data = { size, vaddr, dma_handle };
- dma_free_coherent(dev, size, vaddr, dma_handle);
WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data));
+ dma_free_coherent(dev, size, vaddr, dma_handle);
}
EXPORT_SYMBOL(dmam_free_coherent);
diff --git a/kernel/events/core.c b/kernel/events/core.c
index 3e0db5b5a183..0f2b5610933d 100644
--- a/kernel/events/core.c
+++ b/kernel/events/core.c
@@ -2284,18 +2284,14 @@ event_sched_out(struct perf_event *event, struct perf_event_context *ctx)
}
if (event->pending_sigtrap) {
- bool dec = true;
-
event->pending_sigtrap = 0;
if (state != PERF_EVENT_STATE_OFF &&
- !event->pending_work) {
+ !event->pending_work &&
+ !task_work_add(current, &event->pending_task, TWA_RESUME)) {
event->pending_work = 1;
- dec = false;
- WARN_ON_ONCE(!atomic_long_inc_not_zero(&event->refcount));
- task_work_add(current, &event->pending_task, TWA_RESUME);
- }
- if (dec)
+ } else {
local_dec(&event->ctx->nr_pending);
+ }
}
perf_event_set_state(event, state);
@@ -5175,9 +5171,35 @@ static bool exclusive_event_installable(struct perf_event *event,
static void perf_addr_filters_splice(struct perf_event *event,
struct list_head *head);
+static void perf_pending_task_sync(struct perf_event *event)
+{
+ struct callback_head *head = &event->pending_task;
+
+ if (!event->pending_work)
+ return;
+ /*
+ * If the task is queued to the current task's queue, we
+ * obviously can't wait for it to complete. Simply cancel it.
+ */
+ if (task_work_cancel(current, head)) {
+ event->pending_work = 0;
+ local_dec(&event->ctx->nr_pending);
+ return;
+ }
+
+ /*
+ * All accesses related to the event are within the same
+ * non-preemptible section in perf_pending_task(). The RCU
+ * grace period before the event is freed will make sure all
+ * those accesses are complete by then.
+ */
+ rcuwait_wait_event(&event->pending_work_wait, !event->pending_work, TASK_UNINTERRUPTIBLE);
+}
+
static void _free_event(struct perf_event *event)
{
irq_work_sync(&event->pending_irq);
+ perf_pending_task_sync(event);
unaccount_event(event);
@@ -6478,6 +6500,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma)
return -EINVAL;
nr_pages = vma_size / PAGE_SIZE;
+ if (nr_pages > INT_MAX)
+ return -ENOMEM;
mutex_lock(&event->mmap_mutex);
ret = -EINVAL;
@@ -6808,24 +6832,28 @@ static void perf_pending_task(struct callback_head *head)
struct perf_event *event = container_of(head, struct perf_event, pending_task);
int rctx;
+ /*
+ * All accesses to the event must belong to the same implicit RCU read-side
+ * critical section as the ->pending_work reset. See comment in
+ * perf_pending_task_sync().
+ */
+ preempt_disable_notrace();
/*
* If we 'fail' here, that's OK, it means recursion is already disabled
* and we won't recurse 'further'.
*/
- preempt_disable_notrace();
rctx = perf_swevent_get_recursion_context();
if (event->pending_work) {
event->pending_work = 0;
perf_sigtrap(event);
local_dec(&event->ctx->nr_pending);
+ rcuwait_wake_up(&event->pending_work_wait);
}
if (rctx >= 0)
perf_swevent_put_recursion_context(rctx);
preempt_enable_notrace();
-
- put_event(event);
}
#ifdef CONFIG_GUEST_PERF_EVENTS
@@ -9271,21 +9299,19 @@ static void perf_event_bpf_emit_ksymbols(struct bpf_prog *prog,
bool unregister = type == PERF_BPF_EVENT_PROG_UNLOAD;
int i;
- if (prog->aux->func_cnt == 0) {
- perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
- (u64)(unsigned long)prog->bpf_func,
- prog->jited_len, unregister,
- prog->aux->ksym.name);
- } else {
- for (i = 0; i < prog->aux->func_cnt; i++) {
- struct bpf_prog *subprog = prog->aux->func[i];
-
- perf_event_ksymbol(
- PERF_RECORD_KSYMBOL_TYPE_BPF,
- (u64)(unsigned long)subprog->bpf_func,
- subprog->jited_len, unregister,
- subprog->aux->ksym.name);
- }
+ perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
+ (u64)(unsigned long)prog->bpf_func,
+ prog->jited_len, unregister,
+ prog->aux->ksym.name);
+
+ for (i = 1; i < prog->aux->func_cnt; i++) {
+ struct bpf_prog *subprog = prog->aux->func[i];
+
+ perf_event_ksymbol(
+ PERF_RECORD_KSYMBOL_TYPE_BPF,
+ (u64)(unsigned long)subprog->bpf_func,
+ subprog->jited_len, unregister,
+ subprog->aux->ksym.name);
}
}
@@ -11929,6 +11955,7 @@ perf_event_alloc(struct perf_event_attr *attr, int cpu,
init_waitqueue_head(&event->waitq);
init_irq_work(&event->pending_irq, perf_pending_irq);
init_task_work(&event->pending_task, perf_pending_task);
+ rcuwait_init(&event->pending_work_wait);
mutex_init(&event->mmap_mutex);
raw_spin_lock_init(&event->addr_filters.lock);
diff --git a/kernel/events/internal.h b/kernel/events/internal.h
index 5150d5f84c03..386d21c7edfa 100644
--- a/kernel/events/internal.h
+++ b/kernel/events/internal.h
@@ -128,7 +128,7 @@ static inline unsigned long perf_data_size(struct perf_buffer *rb)
static inline unsigned long perf_aux_size(struct perf_buffer *rb)
{
- return rb->aux_nr_pages << PAGE_SHIFT;
+ return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT;
}
#define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...) \
diff --git a/kernel/events/ring_buffer.c b/kernel/events/ring_buffer.c
index e8d82c2f07d0..f1f4a627f93d 100644
--- a/kernel/events/ring_buffer.c
+++ b/kernel/events/ring_buffer.c
@@ -684,7 +684,9 @@ int rb_alloc_aux(struct perf_buffer *rb, struct perf_event *event,
* max_order, to aid PMU drivers in double buffering.
*/
if (!watermark)
- watermark = nr_pages << (PAGE_SHIFT - 1);
+ watermark = min_t(unsigned long,
+ U32_MAX,
+ (unsigned long)nr_pages << (PAGE_SHIFT - 1));
/*
* Use aux_watermark as the basis for chunking to
diff --git a/kernel/irq/irqdomain.c b/kernel/irq/irqdomain.c
index 0bdef4fe925b..ddaaccdc09fa 100644
--- a/kernel/irq/irqdomain.c
+++ b/kernel/irq/irqdomain.c
@@ -154,7 +154,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
switch (fwid->type) {
case IRQCHIP_FWNODE_NAMED:
case IRQCHIP_FWNODE_NAMED_ID:
- domain->fwnode = fwnode;
domain->name = kstrdup(fwid->name, GFP_KERNEL);
if (!domain->name) {
kfree(domain);
@@ -163,7 +162,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED;
break;
default:
- domain->fwnode = fwnode;
domain->name = fwid->name;
break;
}
@@ -183,7 +181,6 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
}
domain->name = strreplace(name, '/', ':');
- domain->fwnode = fwnode;
domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED;
}
@@ -199,8 +196,8 @@ static struct irq_domain *__irq_domain_create(struct fwnode_handle *fwnode,
domain->flags |= IRQ_DOMAIN_NAME_ALLOCATED;
}
- fwnode_handle_get(fwnode);
- fwnode_dev_initialized(fwnode, true);
+ domain->fwnode = fwnode_handle_get(fwnode);
+ fwnode_dev_initialized(domain->fwnode, true);
/* Fill structure */
INIT_RADIX_TREE(&domain->revmap_tree, GFP_KERNEL);
diff --git a/kernel/irq/manage.c b/kernel/irq/manage.c
index 1782f90cd8c6..a054cd5ec08b 100644
--- a/kernel/irq/manage.c
+++ b/kernel/irq/manage.c
@@ -1332,7 +1332,7 @@ static int irq_thread(void *data)
* synchronize_hardirq(). So neither IRQTF_RUNTHREAD nor the
* oneshot mask bit can be set.
*/
- task_work_cancel(current, irq_thread_dtor);
+ task_work_cancel_func(current, irq_thread_dtor);
return 0;
}
diff --git a/kernel/jump_label.c b/kernel/jump_label.c
index d9c822bbffb8..eec802175ccc 100644
--- a/kernel/jump_label.c
+++ b/kernel/jump_label.c
@@ -131,7 +131,7 @@ bool static_key_fast_inc_not_disabled(struct static_key *key)
STATIC_KEY_CHECK_USE(key);
/*
* Negative key->enabled has a special meaning: it sends
- * static_key_slow_inc() down the slow path, and it is non-zero
+ * static_key_slow_inc/dec() down the slow path, and it is non-zero
* so it counts as "enabled" in jump_label_update(). Note that
* atomic_inc_unless_negative() checks >= 0, so roll our own.
*/
@@ -150,7 +150,7 @@ bool static_key_slow_inc_cpuslocked(struct static_key *key)
lockdep_assert_cpus_held();
/*
- * Careful if we get concurrent static_key_slow_inc() calls;
+ * Careful if we get concurrent static_key_slow_inc/dec() calls;
* later calls must wait for the first one to _finish_ the
* jump_label_update() process. At the same time, however,
* the jump_label_update() call below wants to see
@@ -247,20 +247,32 @@ EXPORT_SYMBOL_GPL(static_key_disable);
static bool static_key_slow_try_dec(struct static_key *key)
{
- int val;
-
- val = atomic_fetch_add_unless(&key->enabled, -1, 1);
- if (val == 1)
- return false;
+ int v;
/*
- * The negative count check is valid even when a negative
- * key->enabled is in use by static_key_slow_inc(); a
- * __static_key_slow_dec() before the first static_key_slow_inc()
- * returns is unbalanced, because all other static_key_slow_inc()
- * instances block while the update is in progress.
+ * Go into the slow path if key::enabled is less than or equal than
+ * one. One is valid to shut down the key, anything less than one
+ * is an imbalance, which is handled at the call site.
+ *
+ * That includes the special case of '-1' which is set in
+ * static_key_slow_inc_cpuslocked(), but that's harmless as it is
+ * fully serialized in the slow path below. By the time this task
+ * acquires the jump label lock the value is back to one and the
+ * retry under the lock must succeed.
*/
- WARN(val < 0, "jump label: negative count!\n");
+ v = atomic_read(&key->enabled);
+ do {
+ /*
+ * Warn about the '-1' case though; since that means a
+ * decrement is concurrent with a first (0->1) increment. IOW
+ * people are trying to disable something that wasn't yet fully
+ * enabled. This suggests an ordering problem on the user side.
+ */
+ WARN_ON_ONCE(v < 0);
+ if (v <= 1)
+ return false;
+ } while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v - 1)));
+
return true;
}
@@ -271,10 +283,11 @@ static void __static_key_slow_dec_cpuslocked(struct static_key *key)
if (static_key_slow_try_dec(key))
return;
- jump_label_lock();
- if (atomic_dec_and_test(&key->enabled))
+ guard(mutex)(&jump_label_mutex);
+ if (atomic_cmpxchg(&key->enabled, 1, 0))
jump_label_update(key);
- jump_label_unlock();
+ else
+ WARN_ON_ONCE(!static_key_slow_try_dec(key));
}
static void __static_key_slow_dec(struct static_key *key)
diff --git a/kernel/locking/rwsem.c b/kernel/locking/rwsem.c
index 9eabd585ce7a..11ed7ce6579e 100644
--- a/kernel/locking/rwsem.c
+++ b/kernel/locking/rwsem.c
@@ -1297,7 +1297,7 @@ static inline int __down_read_trylock(struct rw_semaphore *sem)
/*
* lock for writing
*/
-static inline int __down_write_common(struct rw_semaphore *sem, int state)
+static __always_inline int __down_write_common(struct rw_semaphore *sem, int state)
{
int ret = 0;
@@ -1310,12 +1310,12 @@ static inline int __down_write_common(struct rw_semaphore *sem, int state)
return ret;
}
-static inline void __down_write(struct rw_semaphore *sem)
+static __always_inline void __down_write(struct rw_semaphore *sem)
{
__down_write_common(sem, TASK_UNINTERRUPTIBLE);
}
-static inline int __down_write_killable(struct rw_semaphore *sem)
+static __always_inline int __down_write_killable(struct rw_semaphore *sem)
{
return __down_write_common(sem, TASK_KILLABLE);
}
diff --git a/kernel/rcu/tasks.h b/kernel/rcu/tasks.h
index 305e960c08ac..ff8d539ee22b 100644
--- a/kernel/rcu/tasks.h
+++ b/kernel/rcu/tasks.h
@@ -1675,6 +1675,16 @@ static void rcu_tasks_trace_pregp_step(struct list_head *hop)
// allow safe access to the hop list.
for_each_online_cpu(cpu) {
rcu_read_lock();
+ // Note that cpu_curr_snapshot() picks up the target
+ // CPU's current task while its runqueue is locked with
+ // an smp_mb__after_spinlock(). This ensures that either
+ // the grace-period kthread will see that task's read-side
+ // critical section or the task will see the updater's pre-GP
+ // accesses. The trailing smp_mb() in cpu_curr_snapshot()
+ // does not currently play a role other than simplify
+ // that function's ordering semantics. If these simplified
+ // ordering semantics continue to be redundant, that smp_mb()
+ // might be removed.
t = cpu_curr_snapshot(cpu);
if (rcu_tasks_trace_pertask_prep(t, true))
trc_add_holdout(t, hop);
diff --git a/kernel/sched/core.c b/kernel/sched/core.c
index 820880960513..92e4afeb71ad 100644
--- a/kernel/sched/core.c
+++ b/kernel/sched/core.c
@@ -1304,27 +1304,24 @@ int tg_nop(struct task_group *tg, void *data)
static void set_load_weight(struct task_struct *p, bool update_load)
{
int prio = p->static_prio - MAX_RT_PRIO;
- struct load_weight *load = &p->se.load;
+ struct load_weight lw;
- /*
- * SCHED_IDLE tasks get minimal weight:
- */
if (task_has_idle_policy(p)) {
- load->weight = scale_load(WEIGHT_IDLEPRIO);
- load->inv_weight = WMULT_IDLEPRIO;
- return;
+ lw.weight = scale_load(WEIGHT_IDLEPRIO);
+ lw.inv_weight = WMULT_IDLEPRIO;
+ } else {
+ lw.weight = scale_load(sched_prio_to_weight[prio]);
+ lw.inv_weight = sched_prio_to_wmult[prio];
}
/*
* SCHED_OTHER tasks have to update their load when changing their
* weight
*/
- if (update_load && p->sched_class == &fair_sched_class) {
- reweight_task(p, prio);
- } else {
- load->weight = scale_load(sched_prio_to_weight[prio]);
- load->inv_weight = sched_prio_to_wmult[prio];
- }
+ if (update_load && p->sched_class == &fair_sched_class)
+ reweight_task(p, &lw);
+ else
+ p->se.load = lw;
}
#ifdef CONFIG_UCLAMP_TASK
@@ -4438,12 +4435,7 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
* @cpu: The CPU on which to snapshot the task.
*
* Returns the task_struct pointer of the task "currently" running on
- * the specified CPU. If the same task is running on that CPU throughout,
- * the return value will be a pointer to that task's task_struct structure.
- * If the CPU did any context switches even vaguely concurrently with the
- * execution of this function, the return value will be a pointer to the
- * task_struct structure of a randomly chosen task that was running on
- * that CPU somewhere around the time that this function was executing.
+ * the specified CPU.
*
* If the specified CPU was offline, the return value is whatever it
* is, perhaps a pointer to the task_struct structure of that CPU's idle
@@ -4457,11 +4449,16 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
*/
struct task_struct *cpu_curr_snapshot(int cpu)
{
+ struct rq *rq = cpu_rq(cpu);
struct task_struct *t;
+ struct rq_flags rf;
- smp_mb(); /* Pairing determined by caller's synchronization design. */
+ rq_lock_irqsave(rq, &rf);
+ smp_mb__after_spinlock(); /* Pairing determined by caller's synchronization design. */
t = rcu_dereference(cpu_curr(cpu));
+ rq_unlock_irqrestore(rq, &rf);
smp_mb(); /* Pairing determined by caller's synchronization design. */
+
return t;
}
diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c
index d3d0a1c9336b..b2e1009e5706 100644
--- a/kernel/sched/fair.c
+++ b/kernel/sched/fair.c
@@ -3791,15 +3791,14 @@ static void reweight_entity(struct cfs_rq *cfs_rq, struct sched_entity *se,
}
}
-void reweight_task(struct task_struct *p, int prio)
+void reweight_task(struct task_struct *p, const struct load_weight *lw)
{
struct sched_entity *se = &p->se;
struct cfs_rq *cfs_rq = cfs_rq_of(se);
struct load_weight *load = &se->load;
- unsigned long weight = scale_load(sched_prio_to_weight[prio]);
- reweight_entity(cfs_rq, se, weight);
- load->inv_weight = sched_prio_to_wmult[prio];
+ reweight_entity(cfs_rq, se, lw->weight);
+ load->inv_weight = lw->inv_weight;
}
static inline int throttled_hierarchy(struct cfs_rq *cfs_rq);
diff --git a/kernel/sched/sched.h b/kernel/sched/sched.h
index 2e8f26a919ed..8cbbbea7fdbb 100644
--- a/kernel/sched/sched.h
+++ b/kernel/sched/sched.h
@@ -2435,7 +2435,7 @@ extern void init_sched_dl_class(void);
extern void init_sched_rt_class(void);
extern void init_sched_fair_class(void);
-extern void reweight_task(struct task_struct *p, int prio);
+extern void reweight_task(struct task_struct *p, const struct load_weight *lw);
extern void resched_curr(struct rq *rq);
extern void resched_cpu(int cpu);
diff --git a/kernel/signal.c b/kernel/signal.c
index 09019017d669..21903f524ef8 100644
--- a/kernel/signal.c
+++ b/kernel/signal.c
@@ -2587,6 +2587,14 @@ static void do_freezer_trap(void)
spin_unlock_irq(¤t->sighand->siglock);
cgroup_enter_frozen();
schedule();
+
+ /*
+ * We could've been woken by task_work, run it to clear
+ * TIF_NOTIFY_SIGNAL. The caller will retry if necessary.
+ */
+ clear_notify_signal();
+ if (unlikely(task_work_pending(current)))
+ task_work_run();
}
static int ptrace_signal(int signr, kernel_siginfo_t *info, enum pid_type type)
diff --git a/kernel/task_work.c b/kernel/task_work.c
index 95a7e1b7f1da..2134ac8057a9 100644
--- a/kernel/task_work.c
+++ b/kernel/task_work.c
@@ -120,9 +120,9 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
}
/**
- * task_work_cancel - cancel a pending work added by task_work_add()
- * @task: the task which should execute the work
- * @func: identifies the work to remove
+ * task_work_cancel_func - cancel a pending work matching a function added by task_work_add()
+ * @task: the task which should execute the func's work
+ * @func: identifies the func to match with a work to remove
*
* Find the last queued pending work with ->func == @func and remove
* it from queue.
@@ -131,11 +131,35 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
* The found work or NULL if not found.
*/
struct callback_head *
-task_work_cancel(struct task_struct *task, task_work_func_t func)
+task_work_cancel_func(struct task_struct *task, task_work_func_t func)
{
return task_work_cancel_match(task, task_work_func_match, func);
}
+static bool task_work_match(struct callback_head *cb, void *data)
+{
+ return cb == data;
+}
+
+/**
+ * task_work_cancel - cancel a pending work added by task_work_add()
+ * @task: the task which should execute the work
+ * @cb: the callback to remove if queued
+ *
+ * Remove a callback from a task's queue if queued.
+ *
+ * RETURNS:
+ * True if the callback was queued and got cancelled, false otherwise.
+ */
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb)
+{
+ struct callback_head *ret;
+
+ ret = task_work_cancel_match(task, task_work_match, cb);
+
+ return ret == cb;
+}
+
/**
* task_work_run - execute the works added by task_work_add()
*
@@ -168,7 +192,7 @@ void task_work_run(void)
if (!work)
break;
/*
- * Synchronize with task_work_cancel(). It can not remove
+ * Synchronize with task_work_cancel_match(). It can not remove
* the first entry == work, cmpxchg(task_works) must fail.
* But it can remove another entry from the ->next list.
*/
diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c
index 771d1e040303..b4843099a8da 100644
--- a/kernel/time/tick-broadcast.c
+++ b/kernel/time/tick-broadcast.c
@@ -1141,6 +1141,7 @@ void tick_broadcast_switch_to_oneshot(void)
#ifdef CONFIG_HOTPLUG_CPU
void hotplug_cpu__broadcast_tick_pull(int deadcpu)
{
+ struct tick_device *td = this_cpu_ptr(&tick_cpu_device);
struct clock_event_device *bc;
unsigned long flags;
@@ -1148,6 +1149,28 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu)
bc = tick_broadcast_device.evtdev;
if (bc && broadcast_needs_cpu(bc, deadcpu)) {
+ /*
+ * If the broadcast force bit of the current CPU is set,
+ * then the current CPU has not yet reprogrammed the local
+ * timer device to avoid a ping-pong race. See
+ * ___tick_broadcast_oneshot_control().
+ *
+ * If the broadcast device is hrtimer based then
+ * programming the broadcast event below does not have any
+ * effect because the local clockevent device is not
+ * running and not programmed because the broadcast event
+ * is not earlier than the pending event of the local clock
+ * event device. As a consequence all CPUs waiting for a
+ * broadcast event are stuck forever.
+ *
+ * Detect this condition and reprogram the cpu local timer
+ * device to avoid the starvation.
+ */
+ if (tick_check_broadcast_expired()) {
+ cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask);
+ tick_program_event(td->evtdev->next_event, 1);
+ }
+
/* This moves the broadcast assignment to this CPU: */
clockevents_program_event(bc, bc->next_event, 1);
}
diff --git a/kernel/trace/pid_list.c b/kernel/trace/pid_list.c
index 95106d02b32d..85de221c0b6f 100644
--- a/kernel/trace/pid_list.c
+++ b/kernel/trace/pid_list.c
@@ -354,7 +354,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
while (upper_count-- > 0) {
union upper_chunk *chunk;
- chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+ chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
if (!chunk)
break;
*upper_next = chunk;
@@ -365,7 +365,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
while (lower_count-- > 0) {
union lower_chunk *chunk;
- chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+ chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
if (!chunk)
break;
*lower_next = chunk;
diff --git a/kernel/watchdog_perf.c b/kernel/watchdog_perf.c
index 8ea00c4a24b2..0052afe18b7f 100644
--- a/kernel/watchdog_perf.c
+++ b/kernel/watchdog_perf.c
@@ -75,11 +75,15 @@ static bool watchdog_check_timestamp(void)
__this_cpu_write(last_timestamp, now);
return true;
}
-#else
-static inline bool watchdog_check_timestamp(void)
+
+static void watchdog_init_timestamp(void)
{
- return true;
+ __this_cpu_write(nmi_rearmed, 0);
+ __this_cpu_write(last_timestamp, ktime_get_mono_fast_ns());
}
+#else
+static inline bool watchdog_check_timestamp(void) { return true; }
+static inline void watchdog_init_timestamp(void) { }
#endif
static struct perf_event_attr wd_hw_attr = {
@@ -147,6 +151,7 @@ void watchdog_hardlockup_enable(unsigned int cpu)
if (!atomic_fetch_inc(&watchdog_cpus))
pr_info("Enabled. Permanently consumes one hw-PMU counter.\n");
+ watchdog_init_timestamp();
perf_event_enable(this_cpu_read(watchdog_ev));
}
diff --git a/lib/build_OID_registry b/lib/build_OID_registry
index d7fc32ea8ac2..56d8bafeb848 100755
--- a/lib/build_OID_registry
+++ b/lib/build_OID_registry
@@ -8,6 +8,7 @@
#
use strict;
+use Cwd qw(abs_path);
my @names = ();
my @oids = ();
@@ -17,6 +18,8 @@ if ($#ARGV != 1) {
exit(2);
}
+my $abs_srctree = abs_path($ENV{'srctree'});
+
#
# Open the file to read from
#
@@ -35,7 +38,7 @@ close IN_FILE || die;
#
open C_FILE, ">$ARGV[1]" or die;
print C_FILE "/*\n";
-print C_FILE " * Automatically generated by ", $0, ". Do not edit\n";
+print C_FILE " * Automatically generated by ", $0 =~ s#^\Q$abs_srctree/\E##r, ". Do not edit\n";
print C_FILE " */\n";
#
diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c
index 3518e7394eca..ca736166f100 100644
--- a/lib/decompress_bunzip2.c
+++ b/lib/decompress_bunzip2.c
@@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd)
RUNB) */
symCount = symTotal+2;
for (j = 0; j < groupCount; j++) {
- unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1];
+ unsigned char length[MAX_SYMBOLS];
+ unsigned short temp[MAX_HUFCODE_BITS+1];
int minLen, maxLen, pp;
/* Read Huffman code lengths for each symbol. They're
stored in a way similar to mtf; record a starting
diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c
index 7c44b7ae4c5c..d397b1ad5ccf 100644
--- a/lib/kobject_uevent.c
+++ b/lib/kobject_uevent.c
@@ -432,8 +432,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env)
len = strlen(env->envp[i]) + 1;
if (i != env->envp_idx - 1) {
+ /* @env->envp[] contains pointers to @env->buf[]
+ * with @env->buflen chars, and we are removing
+ * variable MODALIAS here pointed by @env->envp[i]
+ * with length @len as shown below:
+ *
+ * 0 @env->buf[] @env->buflen
+ * ---------------------------------------------
+ * ^ ^ ^ ^
+ * | |-> @len <-| target block |
+ * @env->envp[0] @env->envp[i] @env->envp[i + 1]
+ *
+ * so the "target block" indicated above is moved
+ * backward by @len, and its right size is
+ * @env->buflen - (@env->envp[i + 1] - @env->envp[0]).
+ */
memmove(env->envp[i], env->envp[i + 1],
- env->buflen - len);
+ env->buflen - (env->envp[i + 1] - env->envp[0]));
for (j = i; j < env->envp_idx - 1; j++)
env->envp[j] = env->envp[j + 1] - len;
diff --git a/lib/objagg.c b/lib/objagg.c
index 1e248629ed64..1608895b009c 100644
--- a/lib/objagg.c
+++ b/lib/objagg.c
@@ -167,6 +167,9 @@ static int objagg_obj_parent_assign(struct objagg *objagg,
{
void *delta_priv;
+ if (WARN_ON(!objagg_obj_is_root(parent)))
+ return -EINVAL;
+
delta_priv = objagg->ops->delta_create(objagg->priv, parent->obj,
objagg_obj->obj);
if (IS_ERR(delta_priv))
@@ -903,20 +906,6 @@ static const struct objagg_opt_algo *objagg_opt_algos[] = {
[OBJAGG_OPT_ALGO_SIMPLE_GREEDY] = &objagg_opt_simple_greedy,
};
-static int objagg_hints_obj_cmp(struct rhashtable_compare_arg *arg,
- const void *obj)
-{
- struct rhashtable *ht = arg->ht;
- struct objagg_hints *objagg_hints =
- container_of(ht, struct objagg_hints, node_ht);
- const struct objagg_ops *ops = objagg_hints->ops;
- const char *ptr = obj;
-
- ptr += ht->p.key_offset;
- return ops->hints_obj_cmp ? ops->hints_obj_cmp(ptr, arg->key) :
- memcmp(ptr, arg->key, ht->p.key_len);
-}
-
/**
* objagg_hints_get - obtains hints instance
* @objagg: objagg instance
@@ -955,7 +944,6 @@ struct objagg_hints *objagg_hints_get(struct objagg *objagg,
offsetof(struct objagg_hints_node, obj);
objagg_hints->ht_params.head_offset =
offsetof(struct objagg_hints_node, ht_node);
- objagg_hints->ht_params.obj_cmpfn = objagg_hints_obj_cmp;
err = rhashtable_init(&objagg_hints->node_ht, &objagg_hints->ht_params);
if (err)
diff --git a/lib/sbitmap.c b/lib/sbitmap.c
index d0a5081dfd12..9307bf17a817 100644
--- a/lib/sbitmap.c
+++ b/lib/sbitmap.c
@@ -60,12 +60,30 @@ static inline void update_alloc_hint_after_get(struct sbitmap *sb,
/*
* See if we have deferred clears that we can batch move
*/
-static inline bool sbitmap_deferred_clear(struct sbitmap_word *map)
+static inline bool sbitmap_deferred_clear(struct sbitmap_word *map,
+ unsigned int depth, unsigned int alloc_hint, bool wrap)
{
- unsigned long mask;
+ unsigned long mask, word_mask;
- if (!READ_ONCE(map->cleared))
- return false;
+ guard(spinlock_irqsave)(&map->swap_lock);
+
+ if (!map->cleared) {
+ if (depth == 0)
+ return false;
+
+ word_mask = (~0UL) >> (BITS_PER_LONG - depth);
+ /*
+ * The current behavior is to always retry after moving
+ * ->cleared to word, and we change it to retry in case
+ * of any free bits. To avoid an infinite loop, we need
+ * to take wrap & alloc_hint into account, otherwise a
+ * soft lockup may occur.
+ */
+ if (!wrap && alloc_hint)
+ word_mask &= ~((1UL << alloc_hint) - 1);
+
+ return (READ_ONCE(map->word) & word_mask) != word_mask;
+ }
/*
* First get a stable cleared mask, setting the old mask to 0.
@@ -85,6 +103,7 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
bool alloc_hint)
{
unsigned int bits_per_word;
+ int i;
if (shift < 0)
shift = sbitmap_calculate_shift(depth);
@@ -116,6 +135,9 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
return -ENOMEM;
}
+ for (i = 0; i < sb->map_nr; i++)
+ spin_lock_init(&sb->map[i].swap_lock);
+
return 0;
}
EXPORT_SYMBOL_GPL(sbitmap_init_node);
@@ -126,7 +148,7 @@ void sbitmap_resize(struct sbitmap *sb, unsigned int depth)
unsigned int i;
for (i = 0; i < sb->map_nr; i++)
- sbitmap_deferred_clear(&sb->map[i]);
+ sbitmap_deferred_clear(&sb->map[i], 0, 0, 0);
sb->depth = depth;
sb->map_nr = DIV_ROUND_UP(sb->depth, bits_per_word);
@@ -179,7 +201,7 @@ static int sbitmap_find_bit_in_word(struct sbitmap_word *map,
alloc_hint, wrap);
if (nr != -1)
break;
- if (!sbitmap_deferred_clear(map))
+ if (!sbitmap_deferred_clear(map, depth, alloc_hint, wrap))
break;
} while (1);
@@ -499,18 +521,18 @@ unsigned long __sbitmap_queue_get_batch(struct sbitmap_queue *sbq, int nr_tags,
struct sbitmap_word *map = &sb->map[index];
unsigned long get_mask;
unsigned int map_depth = __map_depth(sb, index);
+ unsigned long val;
- sbitmap_deferred_clear(map);
- if (map->word == (1UL << (map_depth - 1)) - 1)
+ sbitmap_deferred_clear(map, 0, 0, 0);
+ val = READ_ONCE(map->word);
+ if (val == (1UL << (map_depth - 1)) - 1)
goto next;
- nr = find_first_zero_bit(&map->word, map_depth);
+ nr = find_first_zero_bit(&val, map_depth);
if (nr + nr_tags <= map_depth) {
atomic_long_t *ptr = (atomic_long_t *) &map->word;
- unsigned long val;
get_mask = ((1UL << nr_tags) - 1) << nr;
- val = READ_ONCE(map->word);
while (!atomic_long_try_cmpxchg(ptr, &val,
get_mask | val))
;
diff --git a/mm/hugetlb.c b/mm/hugetlb.c
index 789decf5d11b..a480affd475b 100644
--- a/mm/hugetlb.c
+++ b/mm/hugetlb.c
@@ -2518,6 +2518,23 @@ struct folio *alloc_hugetlb_folio_vma(struct hstate *h, struct vm_area_struct *v
return folio;
}
+static nodemask_t *policy_mbind_nodemask(gfp_t gfp)
+{
+#ifdef CONFIG_NUMA
+ struct mempolicy *mpol = get_task_policy(current);
+
+ /*
+ * Only enforce MPOL_BIND policy which overlaps with cpuset policy
+ * (from policy_nodemask) specifically for hugetlb case
+ */
+ if (mpol->mode == MPOL_BIND &&
+ (apply_policy_zone(mpol, gfp_zone(gfp)) &&
+ cpuset_nodemask_valid_mems_allowed(&mpol->nodes)))
+ return &mpol->nodes;
+#endif
+ return NULL;
+}
+
/*
* Increase the hugetlb pool such that it can accommodate a reservation
* of size 'delta'.
@@ -2531,6 +2548,8 @@ static int gather_surplus_pages(struct hstate *h, long delta)
long i;
long needed, allocated;
bool alloc_ok = true;
+ int node;
+ nodemask_t *mbind_nodemask = policy_mbind_nodemask(htlb_alloc_mask(h));
lockdep_assert_held(&hugetlb_lock);
needed = (h->resv_huge_pages + delta) - h->free_huge_pages;
@@ -2545,8 +2564,15 @@ static int gather_surplus_pages(struct hstate *h, long delta)
retry:
spin_unlock_irq(&hugetlb_lock);
for (i = 0; i < needed; i++) {
- folio = alloc_surplus_hugetlb_folio(h, htlb_alloc_mask(h),
- NUMA_NO_NODE, NULL);
+ folio = NULL;
+ for_each_node_mask(node, cpuset_current_mems_allowed) {
+ if (!mbind_nodemask || node_isset(node, *mbind_nodemask)) {
+ folio = alloc_surplus_hugetlb_folio(h, htlb_alloc_mask(h),
+ node, NULL);
+ if (folio)
+ break;
+ }
+ }
if (!folio) {
alloc_ok = false;
break;
@@ -4308,7 +4334,7 @@ void __init hugetlb_add_hstate(unsigned int order)
BUG_ON(hugetlb_max_hstate >= HUGE_MAX_HSTATE);
BUG_ON(order == 0);
h = &hstates[hugetlb_max_hstate++];
- mutex_init(&h->resize_lock);
+ __mutex_init(&h->resize_lock, "resize mutex", &h->resize_key);
h->order = order;
h->mask = ~(huge_page_size(h) - 1);
for (i = 0; i < MAX_NUMNODES; ++i)
@@ -4531,23 +4557,6 @@ static int __init default_hugepagesz_setup(char *s)
}
__setup("default_hugepagesz=", default_hugepagesz_setup);
-static nodemask_t *policy_mbind_nodemask(gfp_t gfp)
-{
-#ifdef CONFIG_NUMA
- struct mempolicy *mpol = get_task_policy(current);
-
- /*
- * Only enforce MPOL_BIND policy which overlaps with cpuset policy
- * (from policy_nodemask) specifically for hugetlb case
- */
- if (mpol->mode == MPOL_BIND &&
- (apply_policy_zone(mpol, gfp_zone(gfp)) &&
- cpuset_nodemask_valid_mems_allowed(&mpol->nodes)))
- return &mpol->nodes;
-#endif
- return NULL;
-}
-
static unsigned int allowed_mems_nr(struct hstate *h)
{
int node;
diff --git a/mm/memory.c b/mm/memory.c
index e44d4d887cf6..58408bf96e0e 100644
--- a/mm/memory.c
+++ b/mm/memory.c
@@ -4353,7 +4353,7 @@ void set_pte_range(struct vm_fault *vmf, struct folio *folio,
struct vm_area_struct *vma = vmf->vma;
bool uffd_wp = vmf_orig_pte_uffd_wp(vmf);
bool write = vmf->flags & FAULT_FLAG_WRITE;
- bool prefault = in_range(vmf->address, addr, nr * PAGE_SIZE);
+ bool prefault = !in_range(vmf->address, addr, nr * PAGE_SIZE);
pte_t entry;
flush_icache_pages(vma, page, nr);
diff --git a/mm/mempolicy.c b/mm/mempolicy.c
index e52e3a0b8f2e..4cae854c0f28 100644
--- a/mm/mempolicy.c
+++ b/mm/mempolicy.c
@@ -3134,8 +3134,9 @@ int mpol_parse_str(char *str, struct mempolicy **mpol)
* @pol: pointer to mempolicy to be formatted
*
* Convert @pol into a string. If @buffer is too short, truncate the string.
- * Recommend a @maxlen of at least 32 for the longest mode, "interleave", the
- * longest flag, "relative", and to display at least a few node ids.
+ * Recommend a @maxlen of at least 51 for the longest mode, "weighted
+ * interleave", plus the longest flag flags, "relative|balancing", and to
+ * display at least a few node ids.
*/
void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
{
@@ -3144,7 +3145,10 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
unsigned short mode = MPOL_DEFAULT;
unsigned short flags = 0;
- if (pol && pol != &default_policy && !(pol->flags & MPOL_F_MORON)) {
+ if (pol &&
+ pol != &default_policy &&
+ !(pol >= &preferred_node_policy[0] &&
+ pol <= &preferred_node_policy[ARRAY_SIZE(preferred_node_policy) - 1])) {
mode = pol->mode;
flags = pol->flags;
}
@@ -3171,12 +3175,18 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
p += snprintf(p, buffer + maxlen - p, "=");
/*
- * Currently, the only defined flags are mutually exclusive
+ * Static and relative are mutually exclusive.
*/
if (flags & MPOL_F_STATIC_NODES)
p += snprintf(p, buffer + maxlen - p, "static");
else if (flags & MPOL_F_RELATIVE_NODES)
p += snprintf(p, buffer + maxlen - p, "relative");
+
+ if (flags & MPOL_F_NUMA_BALANCING) {
+ if (!is_power_of_2(flags & MPOL_MODE_FLAGS))
+ p += snprintf(p, buffer + maxlen - p, "|");
+ p += snprintf(p, buffer + maxlen - p, "balancing");
+ }
}
if (!nodes_empty(nodes))
diff --git a/mm/mmap_lock.c b/mm/mmap_lock.c
index 1854850b4b89..368b840e7508 100644
--- a/mm/mmap_lock.c
+++ b/mm/mmap_lock.c
@@ -19,14 +19,7 @@ EXPORT_TRACEPOINT_SYMBOL(mmap_lock_released);
#ifdef CONFIG_MEMCG
-/*
- * Our various events all share the same buffer (because we don't want or need
- * to allocate a set of buffers *per event type*), so we need to protect against
- * concurrent _reg() and _unreg() calls, and count how many _reg() calls have
- * been made.
- */
-static DEFINE_MUTEX(reg_lock);
-static int reg_refcount; /* Protected by reg_lock. */
+static atomic_t reg_refcount;
/*
* Size of the buffer for memcg path names. Ignoring stack trace support,
@@ -34,136 +27,22 @@ static int reg_refcount; /* Protected by reg_lock. */
*/
#define MEMCG_PATH_BUF_SIZE MAX_FILTER_STR_VAL
-/*
- * How many contexts our trace events might be called in: normal, softirq, irq,
- * and NMI.
- */
-#define CONTEXT_COUNT 4
-
-struct memcg_path {
- local_lock_t lock;
- char __rcu *buf;
- local_t buf_idx;
-};
-static DEFINE_PER_CPU(struct memcg_path, memcg_paths) = {
- .lock = INIT_LOCAL_LOCK(lock),
- .buf_idx = LOCAL_INIT(0),
-};
-
-static char **tmp_bufs;
-
-/* Called with reg_lock held. */
-static void free_memcg_path_bufs(void)
-{
- struct memcg_path *memcg_path;
- int cpu;
- char **old = tmp_bufs;
-
- for_each_possible_cpu(cpu) {
- memcg_path = per_cpu_ptr(&memcg_paths, cpu);
- *(old++) = rcu_dereference_protected(memcg_path->buf,
- lockdep_is_held(®_lock));
- rcu_assign_pointer(memcg_path->buf, NULL);
- }
-
- /* Wait for inflight memcg_path_buf users to finish. */
- synchronize_rcu();
-
- old = tmp_bufs;
- for_each_possible_cpu(cpu) {
- kfree(*(old++));
- }
-
- kfree(tmp_bufs);
- tmp_bufs = NULL;
-}
-
int trace_mmap_lock_reg(void)
{
- int cpu;
- char *new;
-
- mutex_lock(®_lock);
-
- /* If the refcount is going 0->1, proceed with allocating buffers. */
- if (reg_refcount++)
- goto out;
-
- tmp_bufs = kmalloc_array(num_possible_cpus(), sizeof(*tmp_bufs),
- GFP_KERNEL);
- if (tmp_bufs == NULL)
- goto out_fail;
-
- for_each_possible_cpu(cpu) {
- new = kmalloc(MEMCG_PATH_BUF_SIZE * CONTEXT_COUNT, GFP_KERNEL);
- if (new == NULL)
- goto out_fail_free;
- rcu_assign_pointer(per_cpu_ptr(&memcg_paths, cpu)->buf, new);
- /* Don't need to wait for inflights, they'd have gotten NULL. */
- }
-
-out:
- mutex_unlock(®_lock);
+ atomic_inc(®_refcount);
return 0;
-
-out_fail_free:
- free_memcg_path_bufs();
-out_fail:
- /* Since we failed, undo the earlier ref increment. */
- --reg_refcount;
-
- mutex_unlock(®_lock);
- return -ENOMEM;
}
void trace_mmap_lock_unreg(void)
{
- mutex_lock(®_lock);
-
- /* If the refcount is going 1->0, proceed with freeing buffers. */
- if (--reg_refcount)
- goto out;
-
- free_memcg_path_bufs();
-
-out:
- mutex_unlock(®_lock);
-}
-
-static inline char *get_memcg_path_buf(void)
-{
- struct memcg_path *memcg_path = this_cpu_ptr(&memcg_paths);
- char *buf;
- int idx;
-
- rcu_read_lock();
- buf = rcu_dereference(memcg_path->buf);
- if (buf == NULL) {
- rcu_read_unlock();
- return NULL;
- }
- idx = local_add_return(MEMCG_PATH_BUF_SIZE, &memcg_path->buf_idx) -
- MEMCG_PATH_BUF_SIZE;
- return &buf[idx];
+ atomic_dec(®_refcount);
}
-static inline void put_memcg_path_buf(void)
-{
- local_sub(MEMCG_PATH_BUF_SIZE, &this_cpu_ptr(&memcg_paths)->buf_idx);
- rcu_read_unlock();
-}
-
-#define TRACE_MMAP_LOCK_EVENT(type, mm, ...) \
- do { \
- const char *memcg_path; \
- local_lock(&memcg_paths.lock); \
- memcg_path = get_mm_memcg_path(mm); \
- trace_mmap_lock_##type(mm, \
- memcg_path != NULL ? memcg_path : "", \
- ##__VA_ARGS__); \
- if (likely(memcg_path != NULL)) \
- put_memcg_path_buf(); \
- local_unlock(&memcg_paths.lock); \
+#define TRACE_MMAP_LOCK_EVENT(type, mm, ...) \
+ do { \
+ char buf[MEMCG_PATH_BUF_SIZE]; \
+ get_mm_memcg_path(mm, buf, sizeof(buf)); \
+ trace_mmap_lock_##type(mm, buf, ##__VA_ARGS__); \
} while (0)
#else /* !CONFIG_MEMCG */
@@ -185,37 +64,23 @@ void trace_mmap_lock_unreg(void)
#ifdef CONFIG_TRACING
#ifdef CONFIG_MEMCG
/*
- * Write the given mm_struct's memcg path to a percpu buffer, and return a
- * pointer to it. If the path cannot be determined, or no buffer was available
- * (because the trace event is being unregistered), NULL is returned.
- *
- * Note: buffers are allocated per-cpu to avoid locking, so preemption must be
- * disabled by the caller before calling us, and re-enabled only after the
- * caller is done with the pointer.
- *
- * The caller must call put_memcg_path_buf() once the buffer is no longer
- * needed. This must be done while preemption is still disabled.
+ * Write the given mm_struct's memcg path to a buffer. If the path cannot be
+ * determined or the trace event is being unregistered, empty string is written.
*/
-static const char *get_mm_memcg_path(struct mm_struct *mm)
+static void get_mm_memcg_path(struct mm_struct *mm, char *buf, size_t buflen)
{
- char *buf = NULL;
- struct mem_cgroup *memcg = get_mem_cgroup_from_mm(mm);
+ struct mem_cgroup *memcg;
+ buf[0] = '\0';
+ /* No need to get path if no trace event is registered. */
+ if (!atomic_read(®_refcount))
+ return;
+ memcg = get_mem_cgroup_from_mm(mm);
if (memcg == NULL)
- goto out;
- if (unlikely(memcg->css.cgroup == NULL))
- goto out_put;
-
- buf = get_memcg_path_buf();
- if (buf == NULL)
- goto out_put;
-
- cgroup_path(memcg->css.cgroup, buf, MEMCG_PATH_BUF_SIZE);
-
-out_put:
+ return;
+ if (memcg->css.cgroup)
+ cgroup_path(memcg->css.cgroup, buf, buflen);
css_put(&memcg->css);
-out:
- return buf;
}
#endif /* CONFIG_MEMCG */
diff --git a/mm/vmscan.c b/mm/vmscan.c
index e9d4c1f6d7bb..83fa8e924f8a 100644
--- a/mm/vmscan.c
+++ b/mm/vmscan.c
@@ -4546,6 +4546,32 @@ static bool try_to_inc_max_seq(struct lruvec *lruvec, unsigned long max_seq,
* working set protection
******************************************************************************/
+static void set_initial_priority(struct pglist_data *pgdat, struct scan_control *sc)
+{
+ int priority;
+ unsigned long reclaimable;
+
+ if (sc->priority != DEF_PRIORITY || sc->nr_to_reclaim < MIN_LRU_BATCH)
+ return;
+ /*
+ * Determine the initial priority based on
+ * (total >> priority) * reclaimed_to_scanned_ratio = nr_to_reclaim,
+ * where reclaimed_to_scanned_ratio = inactive / total.
+ */
+ reclaimable = node_page_state(pgdat, NR_INACTIVE_FILE);
+ if (can_reclaim_anon_pages(NULL, pgdat->node_id, sc))
+ reclaimable += node_page_state(pgdat, NR_INACTIVE_ANON);
+
+ /* round down reclaimable and round up sc->nr_to_reclaim */
+ priority = fls_long(reclaimable) - 1 - fls_long(sc->nr_to_reclaim - 1);
+
+ /*
+ * The estimation is based on LRU pages only, so cap it to prevent
+ * overshoots of shrinker objects by large margins.
+ */
+ sc->priority = clamp(priority, DEF_PRIORITY / 2, DEF_PRIORITY);
+}
+
static bool lruvec_is_sizable(struct lruvec *lruvec, struct scan_control *sc)
{
int gen, type, zone;
@@ -4579,19 +4605,17 @@ static bool lruvec_is_reclaimable(struct lruvec *lruvec, struct scan_control *sc
struct mem_cgroup *memcg = lruvec_memcg(lruvec);
DEFINE_MIN_SEQ(lruvec);
- /* see the comment on lru_gen_folio */
- gen = lru_gen_from_seq(min_seq[LRU_GEN_FILE]);
- birth = READ_ONCE(lruvec->lrugen.timestamps[gen]);
-
- if (time_is_after_jiffies(birth + min_ttl))
+ if (mem_cgroup_below_min(NULL, memcg))
return false;
if (!lruvec_is_sizable(lruvec, sc))
return false;
- mem_cgroup_calculate_protection(NULL, memcg);
+ /* see the comment on lru_gen_folio */
+ gen = lru_gen_from_seq(min_seq[LRU_GEN_FILE]);
+ birth = READ_ONCE(lruvec->lrugen.timestamps[gen]);
- return !mem_cgroup_below_min(NULL, memcg);
+ return time_is_before_jiffies(birth + min_ttl);
}
/* to protect the working set of the last N jiffies */
@@ -4601,23 +4625,20 @@ static void lru_gen_age_node(struct pglist_data *pgdat, struct scan_control *sc)
{
struct mem_cgroup *memcg;
unsigned long min_ttl = READ_ONCE(lru_gen_min_ttl);
+ bool reclaimable = !min_ttl;
VM_WARN_ON_ONCE(!current_is_kswapd());
- /* check the order to exclude compaction-induced reclaim */
- if (!min_ttl || sc->order || sc->priority == DEF_PRIORITY)
- return;
+ set_initial_priority(pgdat, sc);
memcg = mem_cgroup_iter(NULL, NULL, NULL);
do {
struct lruvec *lruvec = mem_cgroup_lruvec(memcg, pgdat);
- if (lruvec_is_reclaimable(lruvec, sc, min_ttl)) {
- mem_cgroup_iter_break(NULL, memcg);
- return;
- }
+ mem_cgroup_calculate_protection(NULL, memcg);
- cond_resched();
+ if (!reclaimable)
+ reclaimable = lruvec_is_reclaimable(lruvec, sc, min_ttl);
} while ((memcg = mem_cgroup_iter(NULL, memcg, NULL)));
/*
@@ -4625,7 +4646,7 @@ static void lru_gen_age_node(struct pglist_data *pgdat, struct scan_control *sc)
* younger than min_ttl. However, another possibility is all memcgs are
* either too small or below min.
*/
- if (mutex_trylock(&oom_lock)) {
+ if (!reclaimable && mutex_trylock(&oom_lock)) {
struct oom_control oc = {
.gfp_mask = sc->gfp_mask,
};
@@ -5226,7 +5247,6 @@ static int evict_folios(struct lruvec *lruvec, struct scan_control *sc, int swap
/* retry folios that may have missed folio_rotate_reclaimable() */
list_move(&folio->lru, &clean);
- sc->nr_scanned -= folio_nr_pages(folio);
}
spin_lock_irq(&lruvec->lru_lock);
@@ -5425,8 +5445,7 @@ static int shrink_one(struct lruvec *lruvec, struct scan_control *sc)
struct mem_cgroup *memcg = lruvec_memcg(lruvec);
struct pglist_data *pgdat = lruvec_pgdat(lruvec);
- mem_cgroup_calculate_protection(NULL, memcg);
-
+ /* lru_gen_age_node() called mem_cgroup_calculate_protection() */
if (mem_cgroup_below_min(NULL, memcg))
return MEMCG_LRU_YOUNG;
@@ -5566,29 +5585,6 @@ static void lru_gen_shrink_lruvec(struct lruvec *lruvec, struct scan_control *sc
#endif
-static void set_initial_priority(struct pglist_data *pgdat, struct scan_control *sc)
-{
- int priority;
- unsigned long reclaimable;
- struct lruvec *lruvec = mem_cgroup_lruvec(NULL, pgdat);
-
- if (sc->priority != DEF_PRIORITY || sc->nr_to_reclaim < MIN_LRU_BATCH)
- return;
- /*
- * Determine the initial priority based on
- * (total >> priority) * reclaimed_to_scanned_ratio = nr_to_reclaim,
- * where reclaimed_to_scanned_ratio = inactive / total.
- */
- reclaimable = node_page_state(pgdat, NR_INACTIVE_FILE);
- if (get_swappiness(lruvec, sc))
- reclaimable += node_page_state(pgdat, NR_INACTIVE_ANON);
-
- /* round down reclaimable and round up sc->nr_to_reclaim */
- priority = fls_long(reclaimable) - 1 - fls_long(sc->nr_to_reclaim - 1);
-
- sc->priority = clamp(priority, 0, DEF_PRIORITY);
-}
-
static void lru_gen_shrink_node(struct pglist_data *pgdat, struct scan_control *sc)
{
struct blk_plug plug;
@@ -7351,6 +7347,7 @@ static bool kswapd_shrink_node(pg_data_t *pgdat,
{
struct zone *zone;
int z;
+ unsigned long nr_reclaimed = sc->nr_reclaimed;
/* Reclaim a number of pages proportional to the number of zones */
sc->nr_to_reclaim = 0;
@@ -7378,7 +7375,8 @@ static bool kswapd_shrink_node(pg_data_t *pgdat,
if (sc->order && sc->nr_reclaimed >= compact_gap(sc->order))
sc->order = 0;
- return sc->nr_scanned >= sc->nr_to_reclaim;
+ /* account for progress from mm_account_reclaimed_pages() */
+ return max(sc->nr_scanned, sc->nr_reclaimed - nr_reclaimed) >= sc->nr_to_reclaim;
}
/* Page allocator PCP high watermark is lowered if reclaim is active. */
diff --git a/net/bridge/br_forward.c b/net/bridge/br_forward.c
index d97064d460dc..e19b583ff2c6 100644
--- a/net/bridge/br_forward.c
+++ b/net/bridge/br_forward.c
@@ -25,8 +25,8 @@ static inline int should_deliver(const struct net_bridge_port *p,
vg = nbp_vlan_group_rcu(p);
return ((p->flags & BR_HAIRPIN_MODE) || skb->dev != p->dev) &&
- p->state == BR_STATE_FORWARDING && br_allowed_egress(vg, skb) &&
- nbp_switchdev_allowed_egress(p, skb) &&
+ (br_mst_is_enabled(p->br) || p->state == BR_STATE_FORWARDING) &&
+ br_allowed_egress(vg, skb) && nbp_switchdev_allowed_egress(p, skb) &&
!br_skb_isolated(p, skb);
}
diff --git a/net/core/filter.c b/net/core/filter.c
index afe38b8dee02..8cb44cd29967 100644
--- a/net/core/filter.c
+++ b/net/core/filter.c
@@ -3530,13 +3530,20 @@ static int bpf_skb_net_grow(struct sk_buff *skb, u32 off, u32 len_diff,
if (skb_is_gso(skb)) {
struct skb_shared_info *shinfo = skb_shinfo(skb);
- /* Due to header grow, MSS needs to be downgraded. */
- if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO))
- skb_decrease_gso_size(shinfo, len_diff);
-
/* Header must be checked, and gso_segs recomputed. */
shinfo->gso_type |= gso_type;
shinfo->gso_segs = 0;
+
+ /* Due to header growth, MSS needs to be downgraded.
+ * There is a BUG_ON() when segmenting the frag_list with
+ * head_frag true, so linearize the skb after downgrading
+ * the MSS.
+ */
+ if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) {
+ skb_decrease_gso_size(shinfo, len_diff);
+ if (shinfo->frag_list)
+ return skb_linearize(skb);
+ }
}
return 0;
diff --git a/net/core/flow_dissector.c b/net/core/flow_dissector.c
index 272f09251343..b22d20cc417b 100644
--- a/net/core/flow_dissector.c
+++ b/net/core/flow_dissector.c
@@ -1093,7 +1093,7 @@ bool __skb_flow_dissect(const struct net *net,
}
}
- WARN_ON_ONCE(!net);
+ DEBUG_NET_WARN_ON_ONCE(!net);
if (net) {
enum netns_bpf_attach_type type = NETNS_BPF_FLOW_DISSECTOR;
struct bpf_prog_array *run_array;
diff --git a/net/core/xdp.c b/net/core/xdp.c
index 5fe4c099f30a..5ee3f8f165e5 100644
--- a/net/core/xdp.c
+++ b/net/core/xdp.c
@@ -126,10 +126,8 @@ void xdp_unreg_mem_model(struct xdp_mem_info *mem)
return;
if (type == MEM_TYPE_PAGE_POOL) {
- rcu_read_lock();
- xa = rhashtable_lookup(mem_id_ht, &id, mem_id_rht_params);
+ xa = rhashtable_lookup_fast(mem_id_ht, &id, mem_id_rht_params);
page_pool_destroy(xa->page_pool);
- rcu_read_unlock();
}
}
EXPORT_SYMBOL_GPL(xdp_unreg_mem_model);
diff --git a/net/ipv4/esp4.c b/net/ipv4/esp4.c
index fe501d2186bc..eeace9b509ce 100644
--- a/net/ipv4/esp4.c
+++ b/net/ipv4/esp4.c
@@ -238,8 +238,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
#else
static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
{
- kfree_skb(skb);
-
+ WARN_ON(1);
return -EOPNOTSUPP;
}
#endif
diff --git a/net/ipv4/fib_semantics.c b/net/ipv4/fib_semantics.c
index 5eb1b8d302bb..e3268615a65a 100644
--- a/net/ipv4/fib_semantics.c
+++ b/net/ipv4/fib_semantics.c
@@ -2270,6 +2270,15 @@ void fib_select_path(struct net *net, struct fib_result *res,
fib_select_default(fl4, res);
check_saddr:
- if (!fl4->saddr)
- fl4->saddr = fib_result_prefsrc(net, res);
+ if (!fl4->saddr) {
+ struct net_device *l3mdev;
+
+ l3mdev = dev_get_by_index_rcu(net, fl4->flowi4_l3mdev);
+
+ if (!l3mdev ||
+ l3mdev_master_dev_rcu(FIB_RES_DEV(*res)) == l3mdev)
+ fl4->saddr = fib_result_prefsrc(net, res);
+ else
+ fl4->saddr = inet_select_addr(l3mdev, 0, RT_SCOPE_LINK);
+ }
}
diff --git a/net/ipv4/fib_trie.c b/net/ipv4/fib_trie.c
index 9bdfdab906fe..77b97c48da5e 100644
--- a/net/ipv4/fib_trie.c
+++ b/net/ipv4/fib_trie.c
@@ -1628,6 +1628,7 @@ int fib_table_lookup(struct fib_table *tb, const struct flowi4 *flp,
res->nhc = nhc;
res->type = fa->fa_type;
res->scope = fi->fib_scope;
+ res->dscp = fa->fa_dscp;
res->fi = fi;
res->table = tb;
res->fa_head = &n->leaf;
diff --git a/net/ipv4/nexthop.c b/net/ipv4/nexthop.c
index bbff68b5b5d4..8d41b0394219 100644
--- a/net/ipv4/nexthop.c
+++ b/net/ipv4/nexthop.c
@@ -676,9 +676,10 @@ static int nla_put_nh_group(struct sk_buff *skb, struct nh_group *nhg)
p = nla_data(nla);
for (i = 0; i < nhg->num_nh; ++i) {
- p->id = nhg->nh_entries[i].nh->id;
- p->weight = nhg->nh_entries[i].weight - 1;
- p += 1;
+ *p++ = (struct nexthop_grp) {
+ .id = nhg->nh_entries[i].nh->id,
+ .weight = nhg->nh_entries[i].weight - 1,
+ };
}
if (nhg->resilient && nla_put_nh_group_res(skb, nhg))
diff --git a/net/ipv4/route.c b/net/ipv4/route.c
index 40b9c579c917..285482060082 100644
--- a/net/ipv4/route.c
+++ b/net/ipv4/route.c
@@ -1275,7 +1275,7 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt)
struct flowi4 fl4 = {
.daddr = iph->daddr,
.saddr = iph->saddr,
- .flowi4_tos = RT_TOS(iph->tos),
+ .flowi4_tos = iph->tos & IPTOS_RT_MASK,
.flowi4_oif = rt->dst.dev->ifindex,
.flowi4_iif = skb->dev->ifindex,
.flowi4_mark = skb->mark,
@@ -2930,9 +2930,9 @@ EXPORT_SYMBOL_GPL(ip_route_output_tunnel);
/* called with rcu_read_lock held */
static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
- struct rtable *rt, u32 table_id, struct flowi4 *fl4,
- struct sk_buff *skb, u32 portid, u32 seq,
- unsigned int flags)
+ struct rtable *rt, u32 table_id, dscp_t dscp,
+ struct flowi4 *fl4, struct sk_buff *skb, u32 portid,
+ u32 seq, unsigned int flags)
{
struct rtmsg *r;
struct nlmsghdr *nlh;
@@ -2948,7 +2948,7 @@ static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
r->rtm_family = AF_INET;
r->rtm_dst_len = 32;
r->rtm_src_len = 0;
- r->rtm_tos = fl4 ? fl4->flowi4_tos : 0;
+ r->rtm_tos = inet_dscp_to_dsfield(dscp);
r->rtm_table = table_id < 256 ? table_id : RT_TABLE_COMPAT;
if (nla_put_u32(skb, RTA_TABLE, table_id))
goto nla_put_failure;
@@ -3098,7 +3098,7 @@ static int fnhe_dump_bucket(struct net *net, struct sk_buff *skb,
goto next;
err = rt_fill_info(net, fnhe->fnhe_daddr, 0, rt,
- table_id, NULL, skb,
+ table_id, 0, NULL, skb,
NETLINK_CB(cb->skb).portid,
cb->nlh->nlmsg_seq, flags);
if (err)
@@ -3394,7 +3394,7 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
fri.tb_id = table_id;
fri.dst = res.prefix;
fri.dst_len = res.prefixlen;
- fri.dscp = inet_dsfield_to_dscp(fl4.flowi4_tos);
+ fri.dscp = res.dscp;
fri.type = rt->rt_type;
fri.offload = 0;
fri.trap = 0;
@@ -3421,8 +3421,8 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
err = fib_dump_info(skb, NETLINK_CB(in_skb).portid,
nlh->nlmsg_seq, RTM_NEWROUTE, &fri, 0);
} else {
- err = rt_fill_info(net, dst, src, rt, table_id, &fl4, skb,
- NETLINK_CB(in_skb).portid,
+ err = rt_fill_info(net, dst, src, rt, table_id, res.dscp, &fl4,
+ skb, NETLINK_CB(in_skb).portid,
nlh->nlmsg_seq, 0);
}
if (err < 0)
diff --git a/net/ipv4/tcp.c b/net/ipv4/tcp.c
index 2df05ea2e00f..91c3d8264059 100644
--- a/net/ipv4/tcp.c
+++ b/net/ipv4/tcp.c
@@ -591,7 +591,7 @@ __poll_t tcp_poll(struct file *file, struct socket *sock, poll_table *wait)
*/
mask |= EPOLLOUT | EPOLLWRNORM;
}
- /* This barrier is coupled with smp_wmb() in tcp_reset() */
+ /* This barrier is coupled with smp_wmb() in tcp_done_with_error() */
smp_rmb();
if (READ_ONCE(sk->sk_err) ||
!skb_queue_empty_lockless(&sk->sk_error_queue))
diff --git a/net/ipv4/tcp_input.c b/net/ipv4/tcp_input.c
index b9133c0972d3..c2e4dac42453 100644
--- a/net/ipv4/tcp_input.c
+++ b/net/ipv4/tcp_input.c
@@ -4367,9 +4367,26 @@ static enum skb_drop_reason tcp_sequence(const struct tcp_sock *tp,
return SKB_NOT_DROPPED_YET;
}
+
+void tcp_done_with_error(struct sock *sk, int err)
+{
+ /* This barrier is coupled with smp_rmb() in tcp_poll() */
+ WRITE_ONCE(sk->sk_err, err);
+ smp_wmb();
+
+ tcp_write_queue_purge(sk);
+ tcp_done(sk);
+
+ if (!sock_flag(sk, SOCK_DEAD))
+ sk_error_report(sk);
+}
+EXPORT_SYMBOL(tcp_done_with_error);
+
/* When we get a reset we do this. */
void tcp_reset(struct sock *sk, struct sk_buff *skb)
{
+ int err;
+
trace_tcp_receive_reset(sk);
/* mptcp can't tell us to ignore reset pkts,
@@ -4381,24 +4398,17 @@ void tcp_reset(struct sock *sk, struct sk_buff *skb)
/* We want the right error as BSD sees it (and indeed as we do). */
switch (sk->sk_state) {
case TCP_SYN_SENT:
- WRITE_ONCE(sk->sk_err, ECONNREFUSED);
+ err = ECONNREFUSED;
break;
case TCP_CLOSE_WAIT:
- WRITE_ONCE(sk->sk_err, EPIPE);
+ err = EPIPE;
break;
case TCP_CLOSE:
return;
default:
- WRITE_ONCE(sk->sk_err, ECONNRESET);
+ err = ECONNRESET;
}
- /* This barrier is coupled with smp_rmb() in tcp_poll() */
- smp_wmb();
-
- tcp_write_queue_purge(sk);
- tcp_done(sk);
-
- if (!sock_flag(sk, SOCK_DEAD))
- sk_error_report(sk);
+ tcp_done_with_error(sk, err);
}
/*
diff --git a/net/ipv4/tcp_ipv4.c b/net/ipv4/tcp_ipv4.c
index 7c2ca4df0daa..48ec2c1777d4 100644
--- a/net/ipv4/tcp_ipv4.c
+++ b/net/ipv4/tcp_ipv4.c
@@ -602,15 +602,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
ip_icmp_error(sk, skb, err, th->dest, info, (u8 *)th);
- if (!sock_owned_by_user(sk)) {
- WRITE_ONCE(sk->sk_err, err);
-
- sk_error_report(sk);
-
- tcp_done(sk);
- } else {
+ if (!sock_owned_by_user(sk))
+ tcp_done_with_error(sk, err);
+ else
WRITE_ONCE(sk->sk_err_soft, err);
- }
goto out;
}
diff --git a/net/ipv4/tcp_timer.c b/net/ipv4/tcp_timer.c
index 87ebe958a642..64bcf384e9dd 100644
--- a/net/ipv4/tcp_timer.c
+++ b/net/ipv4/tcp_timer.c
@@ -69,11 +69,7 @@ u32 tcp_clamp_probe0_to_user_timeout(const struct sock *sk, u32 when)
static void tcp_write_err(struct sock *sk)
{
- WRITE_ONCE(sk->sk_err, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT);
- sk_error_report(sk);
-
- tcp_write_queue_purge(sk);
- tcp_done(sk);
+ tcp_done_with_error(sk, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT);
__NET_INC_STATS(sock_net(sk), LINUX_MIB_TCPABORTONTIMEOUT);
}
diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c
index 9dfbda164e8c..a9358c796a81 100644
--- a/net/ipv6/addrconf.c
+++ b/net/ipv6/addrconf.c
@@ -1839,7 +1839,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev,
master, &dst,
scores, hiscore_idx);
- if (scores[hiscore_idx].ifa)
+ if (scores[hiscore_idx].ifa &&
+ scores[hiscore_idx].scopedist >= 0)
goto out;
}
diff --git a/net/ipv6/esp6.c b/net/ipv6/esp6.c
index a3fa3eda388a..62bb9651133c 100644
--- a/net/ipv6/esp6.c
+++ b/net/ipv6/esp6.c
@@ -255,8 +255,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
#else
static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
{
- kfree_skb(skb);
-
+ WARN_ON(1);
return -EOPNOTSUPP;
}
#endif
diff --git a/net/ipv6/tcp_ipv6.c b/net/ipv6/tcp_ipv6.c
index 07bcb690932e..d0034916d386 100644
--- a/net/ipv6/tcp_ipv6.c
+++ b/net/ipv6/tcp_ipv6.c
@@ -488,14 +488,10 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
ipv6_icmp_error(sk, skb, err, th->dest, ntohl(info), (u8 *)th);
- if (!sock_owned_by_user(sk)) {
- WRITE_ONCE(sk->sk_err, err);
- sk_error_report(sk); /* Wake people up to see the error (see connect in sock.c) */
-
- tcp_done(sk);
- } else {
+ if (!sock_owned_by_user(sk))
+ tcp_done_with_error(sk, err);
+ else
WRITE_ONCE(sk->sk_err_soft, err);
- }
goto out;
case TCP_LISTEN:
break;
diff --git a/net/mac80211/cfg.c b/net/mac80211/cfg.c
index f3fc0be9d8ea..ca5b111f20e5 100644
--- a/net/mac80211/cfg.c
+++ b/net/mac80211/cfg.c
@@ -1887,7 +1887,7 @@ static int sta_link_apply_parameters(struct ieee80211_local *local,
sband->band);
}
- ieee80211_sta_set_rx_nss(link_sta);
+ ieee80211_sta_init_nss(link_sta);
return ret;
}
diff --git a/net/mac80211/ieee80211_i.h b/net/mac80211/ieee80211_i.h
index fb55014c0e89..daea061d0fc1 100644
--- a/net/mac80211/ieee80211_i.h
+++ b/net/mac80211/ieee80211_i.h
@@ -2150,7 +2150,7 @@ enum ieee80211_sta_rx_bandwidth
ieee80211_sta_cap_rx_bw(struct link_sta_info *link_sta);
enum ieee80211_sta_rx_bandwidth
ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta);
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta);
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta);
enum ieee80211_sta_rx_bandwidth
ieee80211_chan_width_to_rx_bw(enum nl80211_chan_width width);
enum nl80211_chan_width
diff --git a/net/mac80211/rate.c b/net/mac80211/rate.c
index a2bc9c5d92b8..3cf252418bd3 100644
--- a/net/mac80211/rate.c
+++ b/net/mac80211/rate.c
@@ -37,7 +37,7 @@ void rate_control_rate_init(struct sta_info *sta)
struct ieee80211_supported_band *sband;
struct ieee80211_chanctx_conf *chanctx_conf;
- ieee80211_sta_set_rx_nss(&sta->deflink);
+ ieee80211_sta_init_nss(&sta->deflink);
if (!ref)
return;
diff --git a/net/mac80211/sta_info.h b/net/mac80211/sta_info.h
index 195b563132d6..f4af851f45ce 100644
--- a/net/mac80211/sta_info.h
+++ b/net/mac80211/sta_info.h
@@ -3,7 +3,7 @@
* Copyright 2002-2005, Devicescape Software, Inc.
* Copyright 2013-2014 Intel Mobile Communications GmbH
* Copyright(c) 2015-2017 Intel Deutschland GmbH
- * Copyright(c) 2020-2022 Intel Corporation
+ * Copyright(c) 2020-2024 Intel Corporation
*/
#ifndef STA_INFO_H
@@ -485,6 +485,8 @@ struct ieee80211_fragment_cache {
* same for non-MLD STA. This is used as key for searching link STA
* @link_id: Link ID uniquely identifying the link STA. This is 0 for non-MLD
* and set to the corresponding vif LinkId for MLD STA
+ * @op_mode_nss: NSS limit as set by operating mode notification, or 0
+ * @capa_nss: NSS limit as determined by local and peer capabilities
* @link_hash_node: hash node for rhashtable
* @sta: Points to the STA info
* @gtk: group keys negotiated with this station, if any
@@ -521,6 +523,8 @@ struct link_sta_info {
u8 addr[ETH_ALEN];
u8 link_id;
+ u8 op_mode_nss, capa_nss;
+
struct rhlist_head link_hash_node;
struct sta_info *sta;
diff --git a/net/mac80211/vht.c b/net/mac80211/vht.c
index b3a5c3e96a72..bc13b1419981 100644
--- a/net/mac80211/vht.c
+++ b/net/mac80211/vht.c
@@ -4,7 +4,7 @@
*
* Portions of this file
* Copyright(c) 2015 - 2016 Intel Deutschland GmbH
- * Copyright (C) 2018 - 2023 Intel Corporation
+ * Copyright (C) 2018 - 2024 Intel Corporation
*/
#include <linux/ieee80211.h>
@@ -541,15 +541,11 @@ ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta)
return bw;
}
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta)
{
u8 ht_rx_nss = 0, vht_rx_nss = 0, he_rx_nss = 0, eht_rx_nss = 0, rx_nss;
bool support_160;
- /* if we received a notification already don't overwrite it */
- if (link_sta->pub->rx_nss)
- return;
-
if (link_sta->pub->eht_cap.has_eht) {
int i;
const u8 *rx_nss_mcs = (void *)&link_sta->pub->eht_cap.eht_mcs_nss_supp;
@@ -627,7 +623,15 @@ void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
rx_nss = max(vht_rx_nss, ht_rx_nss);
rx_nss = max(he_rx_nss, rx_nss);
rx_nss = max(eht_rx_nss, rx_nss);
- link_sta->pub->rx_nss = max_t(u8, 1, rx_nss);
+ rx_nss = max_t(u8, 1, rx_nss);
+ link_sta->capa_nss = rx_nss;
+
+ /* that shouldn't be set yet, but we can handle it anyway */
+ if (link_sta->op_mode_nss)
+ link_sta->pub->rx_nss =
+ min_t(u8, rx_nss, link_sta->op_mode_nss);
+ else
+ link_sta->pub->rx_nss = rx_nss;
}
u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
@@ -637,7 +641,7 @@ u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
enum ieee80211_sta_rx_bandwidth new_bw;
struct sta_opmode_info sta_opmode = {};
u32 changed = 0;
- u8 nss, cur_nss;
+ u8 nss;
/* ignore - no support for BF yet */
if (opmode & IEEE80211_OPMODE_NOTIF_RX_NSS_TYPE_BF)
@@ -647,23 +651,17 @@ u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
nss >>= IEEE80211_OPMODE_NOTIF_RX_NSS_SHIFT;
nss += 1;
- if (link_sta->pub->rx_nss != nss) {
- cur_nss = link_sta->pub->rx_nss;
- /* Reset rx_nss and call ieee80211_sta_set_rx_nss() which
- * will set the same to max nss value calculated based on capability.
- */
- link_sta->pub->rx_nss = 0;
- ieee80211_sta_set_rx_nss(link_sta);
- /* Do not allow an nss change to rx_nss greater than max_nss
- * negotiated and capped to APs capability during association.
- */
- if (nss <= link_sta->pub->rx_nss) {
- link_sta->pub->rx_nss = nss;
- sta_opmode.rx_nss = nss;
- changed |= IEEE80211_RC_NSS_CHANGED;
- sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+ if (link_sta->op_mode_nss != nss) {
+ if (nss <= link_sta->capa_nss) {
+ link_sta->op_mode_nss = nss;
+
+ if (nss != link_sta->pub->rx_nss) {
+ link_sta->pub->rx_nss = nss;
+ changed |= IEEE80211_RC_NSS_CHANGED;
+ sta_opmode.rx_nss = link_sta->pub->rx_nss;
+ sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+ }
} else {
- link_sta->pub->rx_nss = cur_nss;
pr_warn_ratelimited("Ignoring NSS change in VHT Operating Mode Notification from %pM with invalid nss %d",
link_sta->pub->addr, nss);
}
diff --git a/net/netfilter/ipvs/ip_vs_ctl.c b/net/netfilter/ipvs/ip_vs_ctl.c
index 143a341bbc0a..dec5309d9f1f 100644
--- a/net/netfilter/ipvs/ip_vs_ctl.c
+++ b/net/netfilter/ipvs/ip_vs_ctl.c
@@ -1459,18 +1459,18 @@ ip_vs_add_service(struct netns_ipvs *ipvs, struct ip_vs_service_user_kern *u,
if (ret < 0)
goto out_err;
- /* Bind the ct retriever */
- RCU_INIT_POINTER(svc->pe, pe);
- pe = NULL;
-
/* Update the virtual service counters */
if (svc->port == FTPPORT)
atomic_inc(&ipvs->ftpsvc_counter);
else if (svc->port == 0)
atomic_inc(&ipvs->nullsvc_counter);
- if (svc->pe && svc->pe->conn_out)
+ if (pe && pe->conn_out)
atomic_inc(&ipvs->conn_out_counter);
+ /* Bind the ct retriever */
+ RCU_INIT_POINTER(svc->pe, pe);
+ pe = NULL;
+
/* Count only IPv4 services for old get/setsockopt interface */
if (svc->af == AF_INET)
ipvs->num_services++;
diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c
index 1e689c714127..83e452916403 100644
--- a/net/netfilter/ipvs/ip_vs_proto_sctp.c
+++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c
@@ -126,7 +126,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
if (sctph->source != cp->vport || payload_csum ||
skb->ip_summed == CHECKSUM_PARTIAL) {
sctph->source = cp->vport;
- if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+ if (!skb_is_gso(skb))
sctp_nat_csum(skb, sctph, sctphoff);
} else {
skb->ip_summed = CHECKSUM_UNNECESSARY;
@@ -175,7 +175,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
(skb->ip_summed == CHECKSUM_PARTIAL &&
!(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) {
sctph->dest = cp->dport;
- if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+ if (!skb_is_gso(skb))
sctp_nat_csum(skb, sctph, sctphoff);
} else if (skb->ip_summed != CHECKSUM_PARTIAL) {
skb->ip_summed = CHECKSUM_UNNECESSARY;
diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c
index 334db22199c1..4dab45039f34 100644
--- a/net/netfilter/nf_conntrack_netlink.c
+++ b/net/netfilter/nf_conntrack_netlink.c
@@ -3411,7 +3411,8 @@ static int ctnetlink_del_expect(struct sk_buff *skb,
if (cda[CTA_EXPECT_ID]) {
__be32 id = nla_get_be32(cda[CTA_EXPECT_ID]);
- if (ntohl(id) != (u32)(unsigned long)exp) {
+
+ if (id != nf_expect_get_id(exp)) {
nf_ct_expect_put(exp);
return -ENOENT;
}
diff --git a/net/netfilter/nft_set_pipapo.c b/net/netfilter/nft_set_pipapo.c
index 69b02a3f1ff0..e4dd73093048 100644
--- a/net/netfilter/nft_set_pipapo.c
+++ b/net/netfilter/nft_set_pipapo.c
@@ -360,7 +360,7 @@
* Return: -1 on no match, bit position on 'match_only', 0 otherwise.
*/
int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
- union nft_pipapo_map_bucket *mt, bool match_only)
+ const union nft_pipapo_map_bucket *mt, bool match_only)
{
unsigned long bitset;
int k, ret = -1;
@@ -412,9 +412,9 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
struct nft_pipapo_scratch *scratch;
unsigned long *res_map, *fill_map;
u8 genmask = nft_genmask_cur(net);
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
const u8 *rp = (const u8 *)key;
- struct nft_pipapo_match *m;
- struct nft_pipapo_field *f;
bool map_index;
int i;
@@ -432,7 +432,7 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
res_map = scratch->map + (map_index ? m->bsize_max : 0);
fill_map = scratch->map + (map_index ? 0 : m->bsize_max);
- memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+ pipapo_resmap_init(m, res_map);
nft_pipapo_for_each_field(f, i, m) {
bool last = i == m->field_count - 1;
@@ -517,11 +517,13 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
{
struct nft_pipapo_elem *ret = ERR_PTR(-ENOENT);
struct nft_pipapo *priv = nft_set_priv(set);
- struct nft_pipapo_match *m = priv->clone;
unsigned long *res_map, *fill_map = NULL;
- struct nft_pipapo_field *f;
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
int i;
+ m = priv->clone;
+
res_map = kmalloc_array(m->bsize_max, sizeof(*res_map), GFP_ATOMIC);
if (!res_map) {
ret = ERR_PTR(-ENOMEM);
@@ -534,7 +536,7 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
goto out;
}
- memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+ pipapo_resmap_init(m, res_map);
nft_pipapo_for_each_field(f, i, m) {
bool last = i == m->field_count - 1;
@@ -1590,7 +1592,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m)
while ((rules_f0 = pipapo_rules_same_key(m->f, first_rule))) {
union nft_pipapo_map_bucket rulemap[NFT_PIPAPO_MAX_FIELDS];
- struct nft_pipapo_field *f;
+ const struct nft_pipapo_field *f;
int i, start, rules_fx;
start = first_rule;
@@ -2036,8 +2038,8 @@ static void nft_pipapo_walk(const struct nft_ctx *ctx, struct nft_set *set,
{
struct nft_pipapo *priv = nft_set_priv(set);
struct net *net = read_pnet(&set->net);
- struct nft_pipapo_match *m;
- struct nft_pipapo_field *f;
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
int i, r;
rcu_read_lock();
diff --git a/net/netfilter/nft_set_pipapo.h b/net/netfilter/nft_set_pipapo.h
index a4a58812c108..aad9130cc763 100644
--- a/net/netfilter/nft_set_pipapo.h
+++ b/net/netfilter/nft_set_pipapo.h
@@ -185,7 +185,7 @@ struct nft_pipapo_elem {
};
int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
- union nft_pipapo_map_bucket *mt, bool match_only);
+ const union nft_pipapo_map_bucket *mt, bool match_only);
/**
* pipapo_and_field_buckets_4bit() - Intersect 4-bit buckets
@@ -193,7 +193,7 @@ int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
* @dst: Area to store result
* @data: Input data selecting table buckets
*/
-static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_4bit(const struct nft_pipapo_field *f,
unsigned long *dst,
const u8 *data)
{
@@ -221,7 +221,7 @@ static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
* @dst: Area to store result
* @data: Input data selecting table buckets
*/
-static inline void pipapo_and_field_buckets_8bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_8bit(const struct nft_pipapo_field *f,
unsigned long *dst,
const u8 *data)
{
@@ -285,4 +285,25 @@ static u64 pipapo_estimate_size(const struct nft_set_desc *desc)
return size;
}
+/**
+ * pipapo_resmap_init() - Initialise result map before first use
+ * @m: Matching data, including mapping table
+ * @res_map: Result map
+ *
+ * Initialize all bits covered by the first field to one, so that after
+ * the first step, only the matching bits of the first bit group remain.
+ *
+ * If other fields have a large bitmap, set remainder of res_map to 0.
+ */
+static inline void pipapo_resmap_init(const struct nft_pipapo_match *m, unsigned long *res_map)
+{
+ const struct nft_pipapo_field *f = m->f;
+ int i;
+
+ for (i = 0; i < f->bsize; i++)
+ res_map[i] = ULONG_MAX;
+
+ for (i = f->bsize; i < m->bsize_max; i++)
+ res_map[i] = 0ul;
+}
#endif /* _NFT_SET_PIPAPO_H */
diff --git a/net/netfilter/nft_set_pipapo_avx2.c b/net/netfilter/nft_set_pipapo_avx2.c
index a3a8ddca9918..b8d3c3213efe 100644
--- a/net/netfilter/nft_set_pipapo_avx2.c
+++ b/net/netfilter/nft_set_pipapo_avx2.c
@@ -212,8 +212,9 @@ static int nft_pipapo_avx2_refill(int offset, unsigned long *map,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
u8 pg[2] = { pkt[0] >> 4, pkt[0] & 0xf };
@@ -274,8 +275,9 @@ static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
u8 pg[4] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf };
@@ -350,8 +352,9 @@ static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
u8 pg[8] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf,
pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf,
@@ -445,8 +448,9 @@ static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
u8 pg[12] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf,
pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf,
@@ -534,8 +538,9 @@ static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
u8 pg[32] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf,
pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf,
@@ -669,8 +674,9 @@ static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -726,8 +732,9 @@ static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -790,8 +797,9 @@ static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -865,8 +873,9 @@ static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -950,8 +959,9 @@ static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -1026,6 +1036,7 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
/**
* nft_pipapo_avx2_lookup_slow() - Fallback function for uncommon field sizes
+ * @mdata: Matching data, including mapping table
* @map: Previous match result, used as initial bitmap
* @fill: Destination bitmap to be filled with current match result
* @f: Field, containing lookup and mapping tables
@@ -1041,15 +1052,17 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
* Return: -1 on no match, rule index of match if @last, otherwise first long
* word index to be checked next (i.e. first filled word).
*/
-static int nft_pipapo_avx2_lookup_slow(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+static int nft_pipapo_avx2_lookup_slow(const struct nft_pipapo_match *mdata,
+ unsigned long *map, unsigned long *fill,
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
unsigned long bsize = f->bsize;
int i, ret = -1, b;
if (first)
- memset(map, 0xff, bsize * sizeof(*map));
+ pipapo_resmap_init(mdata, map);
for (i = offset; i < bsize; i++) {
if (f->bb == 8)
@@ -1119,15 +1132,21 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
struct nft_pipapo *priv = nft_set_priv(set);
struct nft_pipapo_scratch *scratch;
u8 genmask = nft_genmask_cur(net);
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
const u8 *rp = (const u8 *)key;
- struct nft_pipapo_match *m;
- struct nft_pipapo_field *f;
unsigned long *res, *fill;
bool map_index;
int i, ret = 0;
- if (unlikely(!irq_fpu_usable()))
- return nft_pipapo_lookup(net, set, key, ext);
+ local_bh_disable();
+
+ if (unlikely(!irq_fpu_usable())) {
+ bool fallback_res = nft_pipapo_lookup(net, set, key, ext);
+
+ local_bh_enable();
+ return fallback_res;
+ }
m = rcu_dereference(priv->match);
@@ -1142,6 +1161,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
scratch = *raw_cpu_ptr(m->scratch);
if (unlikely(!scratch)) {
kernel_fpu_end();
+ local_bh_enable();
return false;
}
@@ -1175,7 +1195,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
} else if (f->groups == 16) {
NFT_SET_PIPAPO_AVX2_LOOKUP(8, 16);
} else {
- ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+ ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
ret, rp,
first, last);
}
@@ -1191,7 +1211,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
} else if (f->groups == 32) {
NFT_SET_PIPAPO_AVX2_LOOKUP(4, 32);
} else {
- ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+ ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
ret, rp,
first, last);
}
@@ -1222,6 +1242,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
if (i % 2)
scratch->map_index = !map_index;
kernel_fpu_end();
+ local_bh_enable();
return ret >= 0;
}
diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c
index 10a6ec43efb9..3e5703537e4e 100644
--- a/net/packet/af_packet.c
+++ b/net/packet/af_packet.c
@@ -538,6 +538,61 @@ static void *packet_current_frame(struct packet_sock *po,
return packet_lookup_frame(po, rb, rb->head, status);
}
+static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev)
+{
+ u8 *skb_orig_data = skb->data;
+ int skb_orig_len = skb->len;
+ struct vlan_hdr vhdr, *vh;
+ unsigned int header_len;
+
+ if (!dev)
+ return 0;
+
+ /* In the SOCK_DGRAM scenario, skb data starts at the network
+ * protocol, which is after the VLAN headers. The outer VLAN
+ * header is at the hard_header_len offset in non-variable
+ * length link layer headers. If it's a VLAN device, the
+ * min_header_len should be used to exclude the VLAN header
+ * size.
+ */
+ if (dev->min_header_len == dev->hard_header_len)
+ header_len = dev->hard_header_len;
+ else if (is_vlan_dev(dev))
+ header_len = dev->min_header_len;
+ else
+ return 0;
+
+ skb_push(skb, skb->data - skb_mac_header(skb));
+ vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr);
+ if (skb_orig_data != skb->data) {
+ skb->data = skb_orig_data;
+ skb->len = skb_orig_len;
+ }
+ if (unlikely(!vh))
+ return 0;
+
+ return ntohs(vh->h_vlan_TCI);
+}
+
+static __be16 vlan_get_protocol_dgram(struct sk_buff *skb)
+{
+ __be16 proto = skb->protocol;
+
+ if (unlikely(eth_type_vlan(proto))) {
+ u8 *skb_orig_data = skb->data;
+ int skb_orig_len = skb->len;
+
+ skb_push(skb, skb->data - skb_mac_header(skb));
+ proto = __vlan_get_protocol(skb, proto, NULL);
+ if (skb_orig_data != skb->data) {
+ skb->data = skb_orig_data;
+ skb->len = skb_orig_len;
+ }
+ }
+
+ return proto;
+}
+
static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc)
{
del_timer_sync(&pkc->retire_blk_timer);
@@ -1007,10 +1062,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc,
static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc,
struct tpacket3_hdr *ppd)
{
+ struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc);
+
if (skb_vlan_tag_present(pkc->skb)) {
ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb);
ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto);
ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) {
+ ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev);
+ ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol);
+ ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
} else {
ppd->hv1.tp_vlan_tci = 0;
ppd->hv1.tp_vlan_tpid = 0;
@@ -2431,6 +2492,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
h.h2->tp_vlan_tci = skb_vlan_tag_get(skb);
h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto);
status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+ h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev);
+ h.h2->tp_vlan_tpid = ntohs(skb->protocol);
+ status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
} else {
h.h2->tp_vlan_tci = 0;
h.h2->tp_vlan_tpid = 0;
@@ -2460,7 +2525,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
sll->sll_halen = dev_parse_header(skb, sll->sll_addr);
sll->sll_family = AF_PACKET;
sll->sll_hatype = dev->type;
- sll->sll_protocol = skb->protocol;
+ sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ?
+ vlan_get_protocol_dgram(skb) : skb->protocol;
sll->sll_pkttype = skb->pkt_type;
if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV)))
sll->sll_ifindex = orig_dev->ifindex;
@@ -3488,7 +3554,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
/* Original length was stored in sockaddr_ll fields */
origlen = PACKET_SKB_CB(skb)->sa.origlen;
sll->sll_family = AF_PACKET;
- sll->sll_protocol = skb->protocol;
+ sll->sll_protocol = (sock->type == SOCK_DGRAM) ?
+ vlan_get_protocol_dgram(skb) : skb->protocol;
}
sock_recv_cmsgs(msg, sk, skb);
@@ -3545,6 +3612,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
aux.tp_vlan_tci = skb_vlan_tag_get(skb);
aux.tp_vlan_tpid = ntohs(skb->vlan_proto);
aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+ struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll;
+ struct net_device *dev;
+
+ rcu_read_lock();
+ dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex);
+ if (dev) {
+ aux.tp_vlan_tci = vlan_get_tci(skb, dev);
+ aux.tp_vlan_tpid = ntohs(skb->protocol);
+ aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else {
+ aux.tp_vlan_tci = 0;
+ aux.tp_vlan_tpid = 0;
+ }
+ rcu_read_unlock();
} else {
aux.tp_vlan_tci = 0;
aux.tp_vlan_tpid = 0;
diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c
index d520ee62c8ec..f99bb9d0adcc 100644
--- a/net/smc/smc_core.c
+++ b/net/smc/smc_core.c
@@ -1974,7 +1974,6 @@ int smc_conn_create(struct smc_sock *smc, struct smc_init_info *ini)
*/
static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
{
- const unsigned int max_scat = SG_MAX_SINGLE_ALLOC * PAGE_SIZE;
u8 compressed;
if (size <= SMC_BUF_MIN_SIZE)
@@ -1984,9 +1983,11 @@ static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
compressed = min_t(u8, ilog2(size) + 1,
is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES);
+#ifdef CONFIG_ARCH_NO_SG_CHAIN
if (!is_smcd && is_rmb)
/* RMBs are backed by & limited to max size of scatterlists */
- compressed = min_t(u8, compressed, ilog2(max_scat >> 14));
+ compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14));
+#endif
return compressed;
}
diff --git a/net/sunrpc/auth_gss/gss_krb5_keys.c b/net/sunrpc/auth_gss/gss_krb5_keys.c
index 06d8ee0db000..4eb19c3a54c7 100644
--- a/net/sunrpc/auth_gss/gss_krb5_keys.c
+++ b/net/sunrpc/auth_gss/gss_krb5_keys.c
@@ -168,7 +168,7 @@ static int krb5_DK(const struct gss_krb5_enctype *gk5e,
goto err_return;
blocksize = crypto_sync_skcipher_blocksize(cipher);
if (crypto_sync_skcipher_setkey(cipher, inkey->data, inkey->len))
- goto err_return;
+ goto err_free_cipher;
ret = -ENOMEM;
inblockdata = kmalloc(blocksize, gfp_mask);
diff --git a/net/sunrpc/clnt.c b/net/sunrpc/clnt.c
index d3c917c0c8d5..142ee6554848 100644
--- a/net/sunrpc/clnt.c
+++ b/net/sunrpc/clnt.c
@@ -2310,12 +2310,13 @@ call_transmit_status(struct rpc_task *task)
task->tk_action = call_transmit;
task->tk_status = 0;
break;
- case -ECONNREFUSED:
case -EHOSTDOWN:
case -ENETDOWN:
case -EHOSTUNREACH:
case -ENETUNREACH:
case -EPERM:
+ break;
+ case -ECONNREFUSED:
if (RPC_IS_SOFTCONN(task)) {
if (!task->tk_msg.rpc_proc->p_proc)
trace_xprt_ping(task->tk_xprt,
diff --git a/net/sunrpc/xprtrdma/frwr_ops.c b/net/sunrpc/xprtrdma/frwr_ops.c
index ffbf99894970..47f33bb7bff8 100644
--- a/net/sunrpc/xprtrdma/frwr_ops.c
+++ b/net/sunrpc/xprtrdma/frwr_ops.c
@@ -92,7 +92,8 @@ static void frwr_mr_put(struct rpcrdma_mr *mr)
rpcrdma_mr_push(mr, &mr->mr_req->rl_free_mrs);
}
-/* frwr_reset - Place MRs back on the free list
+/**
+ * frwr_reset - Place MRs back on @req's free list
* @req: request to reset
*
* Used after a failed marshal. For FRWR, this means the MRs
diff --git a/net/sunrpc/xprtrdma/verbs.c b/net/sunrpc/xprtrdma/verbs.c
index 4f71627ba39c..cb909329a503 100644
--- a/net/sunrpc/xprtrdma/verbs.c
+++ b/net/sunrpc/xprtrdma/verbs.c
@@ -897,6 +897,8 @@ static int rpcrdma_reqs_setup(struct rpcrdma_xprt *r_xprt)
static void rpcrdma_req_reset(struct rpcrdma_req *req)
{
+ struct rpcrdma_mr *mr;
+
/* Credits are valid for only one connection */
req->rl_slot.rq_cong = 0;
@@ -906,7 +908,19 @@ static void rpcrdma_req_reset(struct rpcrdma_req *req)
rpcrdma_regbuf_dma_unmap(req->rl_sendbuf);
rpcrdma_regbuf_dma_unmap(req->rl_recvbuf);
- frwr_reset(req);
+ /* The verbs consumer can't know the state of an MR on the
+ * req->rl_registered list unless a successful completion
+ * has occurred, so they cannot be re-used.
+ */
+ while ((mr = rpcrdma_mr_pop(&req->rl_registered))) {
+ struct rpcrdma_buffer *buf = &mr->mr_xprt->rx_buf;
+
+ spin_lock(&buf->rb_lock);
+ list_del(&mr->mr_all);
+ spin_unlock(&buf->rb_lock);
+
+ frwr_mr_release(mr);
+ }
}
/* ASSUMPTION: the rb_allreqs list is stable for the duration,
diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c
index f892b0903dba..cdc8378261ec 100644
--- a/net/tipc/udp_media.c
+++ b/net/tipc/udp_media.c
@@ -135,8 +135,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size)
snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port));
else if (ntohs(ua->proto) == ETH_P_IPV6)
snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port));
- else
+ else {
pr_err("Invalid UDP media address\n");
+ return 1;
+ }
+
return 0;
}
diff --git a/net/unix/af_unix.c b/net/unix/af_unix.c
index 5a26e785ce70..a551be47cb6c 100644
--- a/net/unix/af_unix.c
+++ b/net/unix/af_unix.c
@@ -2624,10 +2624,49 @@ static struct sk_buff *manage_oob(struct sk_buff *skb, struct sock *sk,
static int unix_stream_read_skb(struct sock *sk, skb_read_actor_t recv_actor)
{
+ struct unix_sock *u = unix_sk(sk);
+ struct sk_buff *skb;
+ int err;
+
if (unlikely(READ_ONCE(sk->sk_state) != TCP_ESTABLISHED))
return -ENOTCONN;
- return unix_read_skb(sk, recv_actor);
+ mutex_lock(&u->iolock);
+ skb = skb_recv_datagram(sk, MSG_DONTWAIT, &err);
+ mutex_unlock(&u->iolock);
+ if (!skb)
+ return err;
+
+#if IS_ENABLED(CONFIG_AF_UNIX_OOB)
+ if (unlikely(skb == READ_ONCE(u->oob_skb))) {
+ bool drop = false;
+
+ unix_state_lock(sk);
+
+ if (sock_flag(sk, SOCK_DEAD)) {
+ unix_state_unlock(sk);
+ kfree_skb(skb);
+ return -ECONNRESET;
+ }
+
+ spin_lock(&sk->sk_receive_queue.lock);
+ if (likely(skb == u->oob_skb)) {
+ WRITE_ONCE(u->oob_skb, NULL);
+ drop = true;
+ }
+ spin_unlock(&sk->sk_receive_queue.lock);
+
+ unix_state_unlock(sk);
+
+ if (drop) {
+ WARN_ON_ONCE(skb_unref(skb));
+ kfree_skb(skb);
+ return -EAGAIN;
+ }
+ }
+#endif
+
+ return recv_actor(sk, skb);
}
static int unix_stream_read_generic(struct unix_stream_read_state *state,
diff --git a/net/unix/unix_bpf.c b/net/unix/unix_bpf.c
index bd84785bf8d6..bca2d86ba97d 100644
--- a/net/unix/unix_bpf.c
+++ b/net/unix/unix_bpf.c
@@ -54,6 +54,9 @@ static int unix_bpf_recvmsg(struct sock *sk, struct msghdr *msg,
struct sk_psock *psock;
int copied;
+ if (flags & MSG_OOB)
+ return -EOPNOTSUPP;
+
if (!len)
return 0;
diff --git a/net/wireless/util.c b/net/wireless/util.c
index 57ea6d5b092d..7acd8d0db61a 100644
--- a/net/wireless/util.c
+++ b/net/wireless/util.c
@@ -1460,7 +1460,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
5120, /* 0.833333... */
};
u32 rates_160M[3] = { 960777777, 907400000, 816666666 };
- u32 rates_969[3] = { 480388888, 453700000, 408333333 };
+ u32 rates_996[3] = { 480388888, 453700000, 408333333 };
u32 rates_484[3] = { 229411111, 216666666, 195000000 };
u32 rates_242[3] = { 114711111, 108333333, 97500000 };
u32 rates_106[3] = { 40000000, 37777777, 34000000 };
@@ -1480,12 +1480,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8))
return 0;
- if (rate->bw == RATE_INFO_BW_160)
+ if (rate->bw == RATE_INFO_BW_160 ||
+ (rate->bw == RATE_INFO_BW_HE_RU &&
+ rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996))
result = rates_160M[rate->he_gi];
else if (rate->bw == RATE_INFO_BW_80 ||
(rate->bw == RATE_INFO_BW_HE_RU &&
rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996))
- result = rates_969[rate->he_gi];
+ result = rates_996[rate->he_gi];
else if (rate->bw == RATE_INFO_BW_40 ||
(rate->bw == RATE_INFO_BW_HE_RU &&
rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484))
diff --git a/net/xfrm/xfrm_policy.c b/net/xfrm/xfrm_policy.c
index 0dde08e02887..b699cc2ec35a 100644
--- a/net/xfrm/xfrm_policy.c
+++ b/net/xfrm/xfrm_policy.c
@@ -436,6 +436,8 @@ EXPORT_SYMBOL(xfrm_policy_destroy);
static void xfrm_policy_kill(struct xfrm_policy *policy)
{
+ xfrm_dev_policy_delete(policy);
+
write_lock_bh(&policy->lock);
policy->walk.dead = 1;
write_unlock_bh(&policy->lock);
@@ -1834,7 +1836,6 @@ int xfrm_policy_flush(struct net *net, u8 type, bool task_valid)
__xfrm_policy_unlink(pol, dir);
spin_unlock_bh(&net->xfrm.xfrm_policy_lock);
- xfrm_dev_policy_delete(pol);
cnt++;
xfrm_audit_policy_delete(pol, 1, task_valid);
xfrm_policy_kill(pol);
@@ -1875,7 +1876,6 @@ int xfrm_dev_policy_flush(struct net *net, struct net_device *dev,
__xfrm_policy_unlink(pol, dir);
spin_unlock_bh(&net->xfrm.xfrm_policy_lock);
- xfrm_dev_policy_delete(pol);
cnt++;
xfrm_audit_policy_delete(pol, 1, task_valid);
xfrm_policy_kill(pol);
@@ -2326,7 +2326,6 @@ int xfrm_policy_delete(struct xfrm_policy *pol, int dir)
pol = __xfrm_policy_unlink(pol, dir);
spin_unlock_bh(&net->xfrm.xfrm_policy_lock);
if (pol) {
- xfrm_dev_policy_delete(pol);
xfrm_policy_kill(pol);
return 0;
}
diff --git a/net/xfrm/xfrm_state.c b/net/xfrm/xfrm_state.c
index bda5327bf34d..8a6e8656d014 100644
--- a/net/xfrm/xfrm_state.c
+++ b/net/xfrm/xfrm_state.c
@@ -49,6 +49,7 @@ static struct kmem_cache *xfrm_state_cache __ro_after_init;
static DECLARE_WORK(xfrm_state_gc_work, xfrm_state_gc_task);
static HLIST_HEAD(xfrm_state_gc_list);
+static HLIST_HEAD(xfrm_state_dev_gc_list);
static inline bool xfrm_state_hold_rcu(struct xfrm_state __rcu *x)
{
@@ -214,6 +215,7 @@ static DEFINE_SPINLOCK(xfrm_state_afinfo_lock);
static struct xfrm_state_afinfo __rcu *xfrm_state_afinfo[NPROTO];
static DEFINE_SPINLOCK(xfrm_state_gc_lock);
+static DEFINE_SPINLOCK(xfrm_state_dev_gc_lock);
int __xfrm_state_delete(struct xfrm_state *x);
@@ -683,6 +685,41 @@ struct xfrm_state *xfrm_state_alloc(struct net *net)
}
EXPORT_SYMBOL(xfrm_state_alloc);
+#ifdef CONFIG_XFRM_OFFLOAD
+void xfrm_dev_state_delete(struct xfrm_state *x)
+{
+ struct xfrm_dev_offload *xso = &x->xso;
+ struct net_device *dev = READ_ONCE(xso->dev);
+
+ if (dev) {
+ dev->xfrmdev_ops->xdo_dev_state_delete(x);
+ spin_lock_bh(&xfrm_state_dev_gc_lock);
+ hlist_add_head(&x->dev_gclist, &xfrm_state_dev_gc_list);
+ spin_unlock_bh(&xfrm_state_dev_gc_lock);
+ }
+}
+EXPORT_SYMBOL_GPL(xfrm_dev_state_delete);
+
+void xfrm_dev_state_free(struct xfrm_state *x)
+{
+ struct xfrm_dev_offload *xso = &x->xso;
+ struct net_device *dev = READ_ONCE(xso->dev);
+
+ if (dev && dev->xfrmdev_ops) {
+ spin_lock_bh(&xfrm_state_dev_gc_lock);
+ if (!hlist_unhashed(&x->dev_gclist))
+ hlist_del(&x->dev_gclist);
+ spin_unlock_bh(&xfrm_state_dev_gc_lock);
+
+ if (dev->xfrmdev_ops->xdo_dev_state_free)
+ dev->xfrmdev_ops->xdo_dev_state_free(x);
+ WRITE_ONCE(xso->dev, NULL);
+ xso->type = XFRM_DEV_OFFLOAD_UNSPECIFIED;
+ netdev_put(dev, &xso->dev_tracker);
+ }
+}
+#endif
+
void __xfrm_state_destroy(struct xfrm_state *x, bool sync)
{
WARN_ON(x->km.state != XFRM_STATE_DEAD);
@@ -848,6 +885,9 @@ EXPORT_SYMBOL(xfrm_state_flush);
int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_valid)
{
+ struct xfrm_state *x;
+ struct hlist_node *tmp;
+ struct xfrm_dev_offload *xso;
int i, err = 0, cnt = 0;
spin_lock_bh(&net->xfrm.xfrm_state_lock);
@@ -857,8 +897,6 @@ int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_vali
err = -ESRCH;
for (i = 0; i <= net->xfrm.state_hmask; i++) {
- struct xfrm_state *x;
- struct xfrm_dev_offload *xso;
restart:
hlist_for_each_entry(x, net->xfrm.state_bydst+i, bydst) {
xso = &x->xso;
@@ -868,6 +906,8 @@ int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_vali
spin_unlock_bh(&net->xfrm.xfrm_state_lock);
err = xfrm_state_delete(x);
+ xfrm_dev_state_free(x);
+
xfrm_audit_state_delete(x, err ? 0 : 1,
task_valid);
xfrm_state_put(x);
@@ -884,6 +924,24 @@ int xfrm_dev_state_flush(struct net *net, struct net_device *dev, bool task_vali
out:
spin_unlock_bh(&net->xfrm.xfrm_state_lock);
+
+ spin_lock_bh(&xfrm_state_dev_gc_lock);
+restart_gc:
+ hlist_for_each_entry_safe(x, tmp, &xfrm_state_dev_gc_list, dev_gclist) {
+ xso = &x->xso;
+
+ if (xso->dev == dev) {
+ spin_unlock_bh(&xfrm_state_dev_gc_lock);
+ xfrm_dev_state_free(x);
+ spin_lock_bh(&xfrm_state_dev_gc_lock);
+ goto restart_gc;
+ }
+
+ }
+ spin_unlock_bh(&xfrm_state_dev_gc_lock);
+
+ xfrm_flush_gc();
+
return err;
}
EXPORT_SYMBOL(xfrm_dev_state_flush);
@@ -1273,8 +1331,7 @@ xfrm_state_find(const xfrm_address_t *daddr, const xfrm_address_t *saddr,
xso->dev = xdo->dev;
xso->real_dev = xdo->real_dev;
xso->flags = XFRM_DEV_OFFLOAD_FLAG_ACQ;
- netdev_tracker_alloc(xso->dev, &xso->dev_tracker,
- GFP_ATOMIC);
+ netdev_hold(xso->dev, &xso->dev_tracker, GFP_ATOMIC);
error = xso->dev->xfrmdev_ops->xdo_dev_state_add(x, NULL);
if (error) {
xso->dir = 0;
diff --git a/net/xfrm/xfrm_user.c b/net/xfrm/xfrm_user.c
index 444e58bc3f44..979f23cded40 100644
--- a/net/xfrm/xfrm_user.c
+++ b/net/xfrm/xfrm_user.c
@@ -2348,7 +2348,6 @@ static int xfrm_get_policy(struct sk_buff *skb, struct nlmsghdr *nlh,
NETLINK_CB(skb).portid);
}
} else {
- xfrm_dev_policy_delete(xp);
xfrm_audit_policy_delete(xp, err ? 0 : 1, true);
if (err != 0)
diff --git a/scripts/Kconfig.include b/scripts/Kconfig.include
index 3ee8ecfb8c04..3500a3d62f0d 100644
--- a/scripts/Kconfig.include
+++ b/scripts/Kconfig.include
@@ -33,7 +33,8 @@ ld-option = $(success,$(LD) -v $(1))
# $(as-instr,<instr>)
# Return y if the assembler supports <instr>, n otherwise
-as-instr = $(success,printf "%b\n" "$(1)" | $(CC) $(CLANG_FLAGS) -Wa$(comma)--fatal-warnings -c -x assembler-with-cpp -o /dev/null -)
+as-instr = $(success,printf "%b\n" "$(1)" | $(CC) $(CLANG_FLAGS) $(2) -Wa$(comma)--fatal-warnings -c -x assembler-with-cpp -o /dev/null -)
+as-instr64 = $(as-instr,$(1),$(m64-flag))
# check if $(CC) and $(LD) exist
$(error-if,$(failure,command -v $(CC)),C compiler '$(CC)' not found)
diff --git a/scripts/Makefile.lib b/scripts/Makefile.lib
index 68d0134bdbf9..e702552fb131 100644
--- a/scripts/Makefile.lib
+++ b/scripts/Makefile.lib
@@ -395,8 +395,12 @@ cmd_dtc = $(HOSTCC) -E $(dtc_cpp_flags) -x assembler-with-cpp -o $(dtc-tmp) $< ;
-d $(depfile).dtc.tmp $(dtc-tmp) ; \
cat $(depfile).pre.tmp $(depfile).dtc.tmp > $(depfile)
+# NOTE:
+# Do not replace $(filter %.dtb %.dtbo, $^) with $(real-prereqs). When a single
+# DTB is turned into a multi-blob DTB, $^ will contain header file dependencies
+# recorded in the .*.cmd file.
quiet_cmd_fdtoverlay = DTOVL $@
- cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(real-prereqs)
+ cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(filter %.dtb %.dtbo, $^)
$(multi-dtb-y): FORCE
$(call if_changed,fdtoverlay)
diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh
index 825c75c5b715..9459ca4f0f11 100755
--- a/scripts/gcc-x86_32-has-stack-protector.sh
+++ b/scripts/gcc-x86_32-has-stack-protector.sh
@@ -5,4 +5,4 @@
# -mstack-protector-guard-reg, added by
# https://gcc.gnu.org/bugzilla/show_bug.cgi?id=81708
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh
index 75e4e22b986a..f680bb01aeeb 100755
--- a/scripts/gcc-x86_64-has-stack-protector.sh
+++ b/scripts/gcc-x86_64-has-stack-protector.sh
@@ -1,4 +1,4 @@
#!/bin/sh
# SPDX-License-Identifier: GPL-2.0
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
diff --git a/security/apparmor/lsm.c b/security/apparmor/lsm.c
index 366cdfd6a7ba..5303a51eff9c 100644
--- a/security/apparmor/lsm.c
+++ b/security/apparmor/lsm.c
@@ -1130,6 +1130,13 @@ static int apparmor_socket_sock_rcv_skb(struct sock *sk, struct sk_buff *skb)
if (!skb->secmark)
return 0;
+ /*
+ * If reach here before socket_post_create hook is called, in which
+ * case label is null, drop the packet.
+ */
+ if (!ctx->label)
+ return -EACCES;
+
return apparmor_secmark_check(ctx->label, OP_RECVMSG, AA_MAY_RECEIVE,
skb->secmark, sk);
}
diff --git a/security/apparmor/policy.c b/security/apparmor/policy.c
index 8a07793ce103..d9d3b3d776e1 100644
--- a/security/apparmor/policy.c
+++ b/security/apparmor/policy.c
@@ -188,7 +188,7 @@ static void aa_free_data(void *ptr, void *arg)
{
struct aa_data *data = ptr;
- kfree_sensitive(data->data);
+ kvfree_sensitive(data->data, data->size);
kfree_sensitive(data->key);
kfree_sensitive(data);
}
diff --git a/security/apparmor/policy_unpack.c b/security/apparmor/policy_unpack.c
index d92788da6704..d752bfa9b3f3 100644
--- a/security/apparmor/policy_unpack.c
+++ b/security/apparmor/policy_unpack.c
@@ -1081,6 +1081,7 @@ static struct aa_profile *unpack_profile(struct aa_ext *e, char **ns_name)
if (rhashtable_insert_fast(profile->data, &data->head,
profile->data->p)) {
+ kvfree_sensitive(data->data, data->size);
kfree_sensitive(data->key);
kfree_sensitive(data);
info = "failed to insert data to table";
diff --git a/security/keys/keyctl.c b/security/keys/keyctl.c
index 19be69fa4d05..aa1dc43b16dd 100644
--- a/security/keys/keyctl.c
+++ b/security/keys/keyctl.c
@@ -1694,7 +1694,7 @@ long keyctl_session_to_parent(void)
goto unlock;
/* cancel an already pending keyring replacement */
- oldwork = task_work_cancel(parent, key_change_session_keyring);
+ oldwork = task_work_cancel_func(parent, key_change_session_keyring);
/* the replacement session keyring is applied just prior to userspace
* restarting */
diff --git a/security/landlock/cred.c b/security/landlock/cred.c
index 13dff2a31545..94f0d03bfd64 100644
--- a/security/landlock/cred.c
+++ b/security/landlock/cred.c
@@ -14,8 +14,8 @@
#include "ruleset.h"
#include "setup.h"
-static int hook_cred_prepare(struct cred *const new,
- const struct cred *const old, const gfp_t gfp)
+static void hook_cred_transfer(struct cred *const new,
+ const struct cred *const old)
{
struct landlock_ruleset *const old_dom = landlock_cred(old)->domain;
@@ -23,6 +23,12 @@ static int hook_cred_prepare(struct cred *const new,
landlock_get_ruleset(old_dom);
landlock_cred(new)->domain = old_dom;
}
+}
+
+static int hook_cred_prepare(struct cred *const new,
+ const struct cred *const old, const gfp_t gfp)
+{
+ hook_cred_transfer(new, old);
return 0;
}
@@ -36,6 +42,7 @@ static void hook_cred_free(struct cred *const cred)
static struct security_hook_list landlock_hooks[] __ro_after_init = {
LSM_HOOK_INIT(cred_prepare, hook_cred_prepare),
+ LSM_HOOK_INIT(cred_transfer, hook_cred_transfer),
LSM_HOOK_INIT(cred_free, hook_cred_free),
};
diff --git a/sound/core/ump.c b/sound/core/ump.c
index d68d3bda97e4..8a7ecec74b5d 100644
--- a/sound/core/ump.c
+++ b/sound/core/ump.c
@@ -733,6 +733,12 @@ static void fill_fb_info(struct snd_ump_endpoint *ump,
info->block_id, info->direction, info->active,
info->first_group, info->num_groups, info->midi_ci_version,
info->sysex8_streams, info->flags);
+
+ if ((info->flags & SNDRV_UMP_BLOCK_IS_MIDI1) && info->num_groups != 1) {
+ info->num_groups = 1;
+ ump_dbg(ump, "FB %d: corrected groups to 1 for MIDI1\n",
+ info->block_id);
+ }
}
/* check whether the FB info gets updated by the current message */
@@ -806,6 +812,13 @@ static int ump_handle_fb_name_msg(struct snd_ump_endpoint *ump,
if (!fb)
return -ENODEV;
+ if (ump->parsed &&
+ (ump->info.flags & SNDRV_UMP_EP_INFO_STATIC_BLOCKS)) {
+ ump_dbg(ump, "Skipping static FB name update (blk#%d)\n",
+ fb->info.block_id);
+ return 0;
+ }
+
ret = ump_append_string(ump, fb->info.name, sizeof(fb->info.name),
buf->raw, 3);
/* notify the FB name update to sequencer, too */
diff --git a/sound/soc/amd/acp-es8336.c b/sound/soc/amd/acp-es8336.c
index 5e56d3a53be7..49bffc567e68 100644
--- a/sound/soc/amd/acp-es8336.c
+++ b/sound/soc/amd/acp-es8336.c
@@ -203,8 +203,10 @@ static int st_es8336_late_probe(struct snd_soc_card *card)
codec_dev = acpi_get_first_physical_node(adev);
acpi_dev_put(adev);
- if (!codec_dev)
+ if (!codec_dev) {
dev_err(card->dev, "can not find codec dev\n");
+ return -ENODEV;
+ }
ret = devm_acpi_dev_add_driver_gpios(codec_dev, acpi_es8336_gpios);
if (ret)
diff --git a/sound/soc/amd/yc/acp6x-mach.c b/sound/soc/amd/yc/acp6x-mach.c
index 4e3a8ce690a4..36dddf230c2c 100644
--- a/sound/soc/amd/yc/acp6x-mach.c
+++ b/sound/soc/amd/yc/acp6x-mach.c
@@ -220,6 +220,13 @@ static const struct dmi_system_id yc_acp_quirk_table[] = {
DMI_MATCH(DMI_PRODUCT_NAME, "21J6"),
}
},
+ {
+ .driver_data = &acp6x_card,
+ .matches = {
+ DMI_MATCH(DMI_BOARD_VENDOR, "LENOVO"),
+ DMI_MATCH(DMI_PRODUCT_NAME, "21M5"),
+ }
+ },
{
.driver_data = &acp6x_card,
.matches = {
diff --git a/sound/soc/codecs/cs35l56-shared.c b/sound/soc/codecs/cs35l56-shared.c
index 12291242362b..69c951e30584 100644
--- a/sound/soc/codecs/cs35l56-shared.c
+++ b/sound/soc/codecs/cs35l56-shared.c
@@ -354,7 +354,7 @@ int cs35l56_irq_request(struct cs35l56_base *cs35l56_base, int irq)
{
int ret;
- if (!irq)
+ if (irq < 1)
return 0;
ret = devm_request_threaded_irq(cs35l56_base->dev, irq, NULL, cs35l56_irq,
diff --git a/sound/soc/codecs/max98088.c b/sound/soc/codecs/max98088.c
index 8b56ee550c09..8b0645c63462 100644
--- a/sound/soc/codecs/max98088.c
+++ b/sound/soc/codecs/max98088.c
@@ -1318,6 +1318,7 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
enum snd_soc_bias_level level)
{
struct max98088_priv *max98088 = snd_soc_component_get_drvdata(component);
+ int ret;
switch (level) {
case SND_SOC_BIAS_ON:
@@ -1333,10 +1334,13 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
*/
if (!IS_ERR(max98088->mclk)) {
if (snd_soc_component_get_bias_level(component) ==
- SND_SOC_BIAS_ON)
+ SND_SOC_BIAS_ON) {
clk_disable_unprepare(max98088->mclk);
- else
- clk_prepare_enable(max98088->mclk);
+ } else {
+ ret = clk_prepare_enable(max98088->mclk);
+ if (ret)
+ return ret;
+ }
}
break;
diff --git a/sound/soc/codecs/tas2781-fmwlib.c b/sound/soc/codecs/tas2781-fmwlib.c
index c6c47297a4fe..41ad82a42916 100644
--- a/sound/soc/codecs/tas2781-fmwlib.c
+++ b/sound/soc/codecs/tas2781-fmwlib.c
@@ -2193,7 +2193,7 @@ static void tasdev_load_calibrated_data(struct tasdevice_priv *priv, int i)
return;
cal = cal_fmw->calibrations;
- if (cal)
+ if (!cal)
return;
load_calib_data(priv, &cal->dev_data);
@@ -2354,14 +2354,21 @@ void tasdevice_tuning_switch(void *context, int state)
struct tasdevice_fw *tas_fmw = tas_priv->fmw;
int profile_cfg_id = tas_priv->rcabin.profile_cfg_id;
- if (tas_priv->fw_state == TASDEVICE_DSP_FW_FAIL) {
- dev_err(tas_priv->dev, "DSP bin file not loaded\n");
+ /*
+ * Only RCA-based Playback can still work with no dsp program running
+ * inside the chip.
+ */
+ switch (tas_priv->fw_state) {
+ case TASDEVICE_RCA_FW_OK:
+ case TASDEVICE_DSP_FW_ALL_OK:
+ break;
+ default:
return;
}
if (state == 0) {
- if (tas_priv->cur_prog < tas_fmw->nr_programs) {
- /*dsp mode or tuning mode*/
+ if (tas_fmw && tas_priv->cur_prog < tas_fmw->nr_programs) {
+ /* dsp mode or tuning mode */
profile_cfg_id = tas_priv->rcabin.profile_cfg_id;
tasdevice_select_tuningprm_cfg(tas_priv,
tas_priv->cur_prog, tas_priv->cur_conf,
@@ -2370,9 +2377,10 @@ void tasdevice_tuning_switch(void *context, int state)
tasdevice_select_cfg_blk(tas_priv, profile_cfg_id,
TASDEVICE_BIN_BLK_PRE_POWER_UP);
- } else
+ } else {
tasdevice_select_cfg_blk(tas_priv, profile_cfg_id,
TASDEVICE_BIN_BLK_PRE_SHUTDOWN);
+ }
}
EXPORT_SYMBOL_NS_GPL(tasdevice_tuning_switch,
SND_SOC_TAS2781_FMWLIB);
diff --git a/sound/soc/codecs/tas2781-i2c.c b/sound/soc/codecs/tas2781-i2c.c
index 7327e9dcc8c0..a9d179e30773 100644
--- a/sound/soc/codecs/tas2781-i2c.c
+++ b/sound/soc/codecs/tas2781-i2c.c
@@ -378,23 +378,37 @@ static void tasdevice_fw_ready(const struct firmware *fmw,
mutex_lock(&tas_priv->codec_lock);
ret = tasdevice_rca_parser(tas_priv, fmw);
- if (ret)
+ if (ret) {
+ tasdevice_config_info_remove(tas_priv);
goto out;
+ }
tasdevice_create_control(tas_priv);
tasdevice_dsp_remove(tas_priv);
tasdevice_calbin_remove(tas_priv);
- tas_priv->fw_state = TASDEVICE_DSP_FW_PENDING;
+ /*
+ * The baseline is the RCA-only case, and then the code attempts to
+ * load DSP firmware but in case of failures just keep going, i.e.
+ * failing to load DSP firmware is NOT an error.
+ */
+ tas_priv->fw_state = TASDEVICE_RCA_FW_OK;
scnprintf(tas_priv->coef_binaryname, 64, "%s_coef.bin",
tas_priv->dev_name);
ret = tasdevice_dsp_parser(tas_priv);
if (ret) {
dev_err(tas_priv->dev, "dspfw load %s error\n",
tas_priv->coef_binaryname);
- tas_priv->fw_state = TASDEVICE_DSP_FW_FAIL;
goto out;
}
- tasdevice_dsp_create_ctrls(tas_priv);
+
+ /*
+ * If no dsp-related kcontrol created, the dsp resource will be freed.
+ */
+ ret = tasdevice_dsp_create_ctrls(tas_priv);
+ if (ret) {
+ dev_err(tas_priv->dev, "dsp controls error\n");
+ goto out;
+ }
tas_priv->fw_state = TASDEVICE_DSP_FW_ALL_OK;
@@ -415,9 +429,8 @@ static void tasdevice_fw_ready(const struct firmware *fmw,
tasdevice_prmg_load(tas_priv, 0);
tas_priv->cur_prog = 0;
out:
- if (tas_priv->fw_state == TASDEVICE_DSP_FW_FAIL) {
- /*If DSP FW fail, kcontrol won't be created */
- tasdevice_config_info_remove(tas_priv);
+ if (tas_priv->fw_state == TASDEVICE_RCA_FW_OK) {
+ /* If DSP FW fail, DSP kcontrol won't be created. */
tasdevice_dsp_remove(tas_priv);
}
mutex_unlock(&tas_priv->codec_lock);
@@ -464,14 +477,14 @@ static int tasdevice_startup(struct snd_pcm_substream *substream,
{
struct snd_soc_component *codec = dai->component;
struct tasdevice_priv *tas_priv = snd_soc_component_get_drvdata(codec);
- int ret = 0;
- if (tas_priv->fw_state != TASDEVICE_DSP_FW_ALL_OK) {
- dev_err(tas_priv->dev, "DSP bin file not loaded\n");
- ret = -EINVAL;
+ switch (tas_priv->fw_state) {
+ case TASDEVICE_RCA_FW_OK:
+ case TASDEVICE_DSP_FW_ALL_OK:
+ return 0;
+ default:
+ return -EINVAL;
}
-
- return ret;
}
static int tasdevice_hw_params(struct snd_pcm_substream *substream,
diff --git a/sound/soc/fsl/fsl_qmc_audio.c b/sound/soc/fsl/fsl_qmc_audio.c
index 56d6b0b039a2..df8188159a58 100644
--- a/sound/soc/fsl/fsl_qmc_audio.c
+++ b/sound/soc/fsl/fsl_qmc_audio.c
@@ -604,6 +604,8 @@ static int qmc_audio_dai_parse(struct qmc_audio *qmc_audio, struct device_node *
qmc_dai->name = devm_kasprintf(qmc_audio->dev, GFP_KERNEL, "%s.%d",
np->parent->name, qmc_dai->id);
+ if (!qmc_dai->name)
+ return -ENOMEM;
qmc_dai->qmc_chan = devm_qmc_chan_get_byphandle(qmc_audio->dev, np,
"fsl,qmc-chan");
diff --git a/sound/soc/intel/common/soc-intel-quirks.h b/sound/soc/intel/common/soc-intel-quirks.h
index de4e550c5b34..42bd51456b94 100644
--- a/sound/soc/intel/common/soc-intel-quirks.h
+++ b/sound/soc/intel/common/soc-intel-quirks.h
@@ -11,7 +11,7 @@
#include <linux/platform_data/x86/soc.h>
-#if IS_ENABLED(CONFIG_X86)
+#if IS_REACHABLE(CONFIG_IOSF_MBI)
#include <linux/dmi.h>
#include <asm/iosf_mbi.h>
diff --git a/sound/soc/qcom/lpass-cpu.c b/sound/soc/qcom/lpass-cpu.c
index 39571fed4001..73b42d9ee244 100644
--- a/sound/soc/qcom/lpass-cpu.c
+++ b/sound/soc/qcom/lpass-cpu.c
@@ -1170,9 +1170,13 @@ int asoc_qcom_lpass_cpu_platform_probe(struct platform_device *pdev)
}
res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-rxtx-cdc-dma-lpm");
+ if (!res)
+ return -EINVAL;
drvdata->rxtx_cdc_dma_lpm_buf = res->start;
res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-va-cdc-dma-lpm");
+ if (!res)
+ return -EINVAL;
drvdata->va_cdc_dma_lpm_buf = res->start;
}
diff --git a/sound/soc/sof/amd/pci-vangogh.c b/sound/soc/sof/amd/pci-vangogh.c
index d8be42fbcb6d..b035e31fadab 100644
--- a/sound/soc/sof/amd/pci-vangogh.c
+++ b/sound/soc/sof/amd/pci-vangogh.c
@@ -34,7 +34,6 @@ static const struct sof_amd_acp_desc vangogh_chip_info = {
.dsp_intr_base = ACP5X_DSP_SW_INTR_BASE,
.sram_pte_offset = ACP5X_SRAM_PTE_OFFSET,
.hw_semaphore_offset = ACP5X_AXI2DAGB_SEM_0,
- .acp_clkmux_sel = ACP5X_CLKMUX_SEL,
.probe_reg_offset = ACP5X_FUTURE_REG_ACLK_0,
};
diff --git a/sound/soc/sof/imx/imx8m.c b/sound/soc/sof/imx/imx8m.c
index 1243f8a6141e..186ba4bbb5b2 100644
--- a/sound/soc/sof/imx/imx8m.c
+++ b/sound/soc/sof/imx/imx8m.c
@@ -243,7 +243,7 @@ static int imx8m_probe(struct snd_sof_dev *sdev)
/* set default mailbox offset for FW ready message */
sdev->dsp_box.offset = MBOX_OFFSET;
- priv->regmap = syscon_regmap_lookup_by_compatible("fsl,dsp-ctrl");
+ priv->regmap = syscon_regmap_lookup_by_phandle(np, "fsl,dsp-ctrl");
if (IS_ERR(priv->regmap)) {
dev_err(sdev->dev, "cannot find dsp-ctrl registers");
ret = PTR_ERR(priv->regmap);
diff --git a/sound/soc/sof/ipc4-topology.c b/sound/soc/sof/ipc4-topology.c
index 78ff129be772..284efad30f1a 100644
--- a/sound/soc/sof/ipc4-topology.c
+++ b/sound/soc/sof/ipc4-topology.c
@@ -1254,7 +1254,13 @@ static void sof_ipc4_unprepare_copier_module(struct snd_sof_widget *swidget)
ipc4_copier = dai->private;
if (pipeline->use_chain_dma) {
- pipeline->msg.primary = 0;
+ /*
+ * Preserve the DMA Link ID and clear other bits since
+ * the DMA Link ID is only configured once during
+ * dai_config, other fields are expected to be 0 for
+ * re-configuration
+ */
+ pipeline->msg.primary &= SOF_IPC4_GLB_CHAIN_DMA_LINK_ID_MASK;
pipeline->msg.extension = 0;
}
diff --git a/sound/usb/mixer.c b/sound/usb/mixer.c
index 409fc1164694..d1bdb0b93bda 100644
--- a/sound/usb/mixer.c
+++ b/sound/usb/mixer.c
@@ -1211,6 +1211,13 @@ static void volume_control_quirks(struct usb_mixer_elem_info *cval,
cval->res = 16;
}
break;
+ case USB_ID(0x1bcf, 0x2281): /* HD Webcam */
+ if (!strcmp(kctl->id.name, "Mic Capture Volume")) {
+ usb_audio_info(chip,
+ "set resolution quirk: cval->res = 16\n");
+ cval->res = 16;
+ }
+ break;
}
}
diff --git a/sound/usb/quirks.c b/sound/usb/quirks.c
index 09712e61c606..b437b14d838a 100644
--- a/sound/usb/quirks.c
+++ b/sound/usb/quirks.c
@@ -2085,6 +2085,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
QUIRK_FLAG_CTL_MSG_DELAY_1M),
DEVICE_FLG(0x0b0e, 0x0349, /* Jabra 550a */
QUIRK_FLAG_CTL_MSG_DELAY_1M),
+ DEVICE_FLG(0x0c45, 0x6340, /* Sonix HD USB Camera */
+ QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x0ecb, 0x205c, /* JBL Quantum610 Wireless */
QUIRK_FLAG_FIXED_RATE),
DEVICE_FLG(0x0ecb, 0x2069, /* JBL Quantum810 Wireless */
@@ -2127,6 +2129,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x19f7, 0x0035, /* RODE NT-USB+ */
QUIRK_FLAG_GET_SAMPLE_RATE),
+ DEVICE_FLG(0x1bcf, 0x2281, /* HD Webcam */
+ QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x1bcf, 0x2283, /* NexiGo N930AF FHD Webcam */
QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x2040, 0x7200, /* Hauppauge HVR-950Q */
diff --git a/tools/bpf/bpftool/common.c b/tools/bpf/bpftool/common.c
index 958e92acca8e..9b75639434b8 100644
--- a/tools/bpf/bpftool/common.c
+++ b/tools/bpf/bpftool/common.c
@@ -410,7 +410,7 @@ void get_prog_full_name(const struct bpf_prog_info *prog_info, int prog_fd,
{
const char *prog_name = prog_info->name;
const struct btf_type *func_type;
- const struct bpf_func_info finfo = {};
+ struct bpf_func_info finfo = {};
struct bpf_prog_info info = {};
__u32 info_len = sizeof(info);
struct btf *prog_btf = NULL;
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 086b93939ce9..e5e0fe3854a3 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -1809,6 +1809,10 @@ static int load_with_options(int argc, char **argv, bool first_prog_only)
}
if (pinmaps) {
+ err = create_and_mount_bpffs_dir(pinmaps);
+ if (err)
+ goto err_unpin;
+
err = bpf_object__pin_maps(obj, pinmaps);
if (err) {
p_err("failed to pin all maps");
diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c
index af393c7dee1f..b3edc239fe56 100644
--- a/tools/bpf/resolve_btfids/main.c
+++ b/tools/bpf/resolve_btfids/main.c
@@ -696,7 +696,7 @@ static int sets_patch(struct object *obj)
* Make sure id is at the beginning of the pairs
* struct, otherwise the below qsort would not work.
*/
- BUILD_BUG_ON(set8->pairs != &set8->pairs[0].id);
+ BUILD_BUG_ON((u32 *)set8->pairs != &set8->pairs[0].id);
qsort(set8->pairs, set8->cnt, sizeof(set8->pairs[0]), cmp_id);
/*
diff --git a/tools/lib/bpf/btf_dump.c b/tools/lib/bpf/btf_dump.c
index 4d9f30bf7f01..ebf56d21d08e 100644
--- a/tools/lib/bpf/btf_dump.c
+++ b/tools/lib/bpf/btf_dump.c
@@ -1559,10 +1559,12 @@ static void btf_dump_emit_type_chain(struct btf_dump *d,
* Clang for BPF target generates func_proto with no
* args as a func_proto with a single void arg (e.g.,
* `int (*f)(void)` vs just `int (*f)()`). We are
- * going to pretend there are no args for such case.
+ * going to emit valid empty args (void) syntax for
+ * such case. Similarly and conveniently, valid
+ * no args case can be special-cased here as well.
*/
- if (vlen == 1 && p->type == 0) {
- btf_dump_printf(d, ")");
+ if (vlen == 0 || (vlen == 1 && p->type == 0)) {
+ btf_dump_printf(d, "void)");
return;
}
diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c
index 5ced96d99f8c..b311bb91f672 100644
--- a/tools/lib/bpf/linker.c
+++ b/tools/lib/bpf/linker.c
@@ -2194,10 +2194,17 @@ static int linker_fixup_btf(struct src_obj *obj)
vi = btf_var_secinfos(t);
for (j = 0, m = btf_vlen(t); j < m; j++, vi++) {
const struct btf_type *vt = btf__type_by_id(obj->btf, vi->type);
- const char *var_name = btf__str_by_offset(obj->btf, vt->name_off);
- int var_linkage = btf_var(vt)->linkage;
+ const char *var_name;
+ int var_linkage;
Elf64_Sym *sym;
+ /* could be a variable or function */
+ if (!btf_is_var(vt))
+ continue;
+
+ var_name = btf__str_by_offset(obj->btf, vt->name_off);
+ var_linkage = btf_var(vt)->linkage;
+
/* no need to patch up static or extern vars */
if (var_linkage != BTF_VAR_GLOBAL_ALLOCATED)
continue;
diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat
index 53b5a492739d..21ba65086938 100644
--- a/tools/memory-model/lock.cat
+++ b/tools/memory-model/lock.cat
@@ -102,19 +102,19 @@ let rf-lf = rfe-lf | rfi-lf
* within one of the lock's critical sections returns False.
*)
-(* rfi for RU events: an RU may read from the last po-previous UL *)
-let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc)
-
-(* rfe for RU events: an RU may read from an external UL or the initial write *)
-let all-possible-rfe-ru =
- let possible-rfe-ru r =
+(*
+ * rf for RU events: an RU may read from an external UL or the initial write,
+ * or from the last po-previous UL
+ *)
+let all-possible-rf-ru =
+ let possible-rf-ru r =
let pair-to-relation p = p ++ 0
- in map pair-to-relation (((UL | IW) * {r}) & loc & ext)
- in map possible-rfe-ru RU
+ in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) |
+ (((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc)))
+ in map possible-rf-ru RU
(* Generate all rf relations for RU events *)
-with rfe-ru from cross(all-possible-rfe-ru)
-let rf-ru = rfe-ru | rfi-ru
+with rf-ru from cross(all-possible-rf-ru)
(* Final rf relation *)
let rf = rf | rf-lf | rf-ru
diff --git a/tools/perf/arch/x86/util/intel-pt.c b/tools/perf/arch/x86/util/intel-pt.c
index 31807791589e..aaa2c641e787 100644
--- a/tools/perf/arch/x86/util/intel-pt.c
+++ b/tools/perf/arch/x86/util/intel-pt.c
@@ -32,6 +32,7 @@
#include "../../../util/tsc.h"
#include <internal/lib.h> // page_size
#include "../../../util/intel-pt.h"
+#include <api/fs/fs.h>
#define KiB(x) ((x) * 1024)
#define MiB(x) ((x) * 1024 * 1024)
@@ -436,6 +437,16 @@ static int intel_pt_track_switches(struct evlist *evlist)
}
#endif
+static bool intel_pt_exclude_guest(void)
+{
+ int pt_mode;
+
+ if (sysfs__read_int("module/kvm_intel/parameters/pt_mode", &pt_mode))
+ pt_mode = 0;
+
+ return pt_mode == 1;
+}
+
static void intel_pt_valid_str(char *str, size_t len, u64 valid)
{
unsigned int val, last = 0, state = 1;
@@ -628,6 +639,7 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
}
evsel->core.attr.freq = 0;
evsel->core.attr.sample_period = 1;
+ evsel->core.attr.exclude_guest = intel_pt_exclude_guest();
evsel->no_aux_samples = true;
evsel->needs_auxtrace_mmap = true;
intel_pt_evsel = evsel;
@@ -766,7 +778,8 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
}
if (!opts->auxtrace_snapshot_mode && !opts->auxtrace_sample_mode) {
- u32 aux_watermark = opts->auxtrace_mmap_pages * page_size / 4;
+ size_t aw = opts->auxtrace_mmap_pages * (size_t)page_size / 4;
+ u32 aux_watermark = aw > UINT_MAX ? UINT_MAX : aw;
intel_pt_evsel->core.attr.aux_watermark = aux_watermark;
}
diff --git a/tools/perf/tests/shell/test_arm_callgraph_fp.sh b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
index 66dfdfdad553..60cd35c73e47 100755
--- a/tools/perf/tests/shell/test_arm_callgraph_fp.sh
+++ b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
@@ -14,28 +14,21 @@ cleanup_files()
trap cleanup_files EXIT TERM INT
-# Add a 1 second delay to skip samples that are not in the leaf() function
# shellcheck disable=SC2086
-perf record -o "$PERF_DATA" --call-graph fp -e cycles//u -D 1000 --user-callchains -- $TEST_PROGRAM 2> /dev/null &
-PID=$!
+perf record -o "$PERF_DATA" --call-graph fp -e cycles//u --user-callchains -- $TEST_PROGRAM
-echo " + Recording (PID=$PID)..."
-sleep 2
-echo " + Stopping perf-record..."
-
-kill $PID
-wait $PID
+# Try opening the file so any immediate errors are visible in the log
+perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4
-# expected perf-script output:
+# expected perf-script output if 'leaf' has been inserted correctly:
#
-# program
+# perf
# 728 leaf
# 753 parent
# 76c leafloop
-# ...
+# ... remaining stack to main() ...
-perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4
-perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4 | \
- awk '{ if ($2 != "") sym[i++] = $2 } END { if (sym[0] != "leaf" ||
- sym[1] != "parent" ||
- sym[2] != "leafloop") exit 1 }'
+# Each frame is separated by a tab, some spaces and an address
+SEP="[[:space:]]+ [[:xdigit:]]+"
+perf script -i "$PERF_DATA" -F comm,ip,sym | tr '\n' ' ' | \
+ grep -E -q "perf $SEP leaf $SEP parent $SEP leafloop"
diff --git a/tools/perf/tests/workloads/leafloop.c b/tools/perf/tests/workloads/leafloop.c
index 1bf5cc97649b..f7561767e32c 100644
--- a/tools/perf/tests/workloads/leafloop.c
+++ b/tools/perf/tests/workloads/leafloop.c
@@ -1,6 +1,8 @@
/* SPDX-License-Identifier: GPL-2.0 */
+#include <signal.h>
#include <stdlib.h>
#include <linux/compiler.h>
+#include <unistd.h>
#include "../tests.h"
/* We want to check these symbols in perf script */
@@ -8,10 +10,16 @@ noinline void leaf(volatile int b);
noinline void parent(volatile int b);
static volatile int a;
+static volatile sig_atomic_t done;
+
+static void sighandler(int sig __maybe_unused)
+{
+ done = 1;
+}
noinline void leaf(volatile int b)
{
- for (;;)
+ while (!done)
a += b;
}
@@ -22,12 +30,16 @@ noinline void parent(volatile int b)
static int leafloop(int argc, const char **argv)
{
- int c = 1;
+ int sec = 1;
if (argc > 0)
- c = atoi(argv[0]);
+ sec = atoi(argv[0]);
+
+ signal(SIGINT, sighandler);
+ signal(SIGALRM, sighandler);
+ alarm(sec);
- parent(c);
+ parent(sec);
return 0;
}
diff --git a/tools/perf/util/pmus.c b/tools/perf/util/pmus.c
index cec869cbe163..54a237b2b853 100644
--- a/tools/perf/util/pmus.c
+++ b/tools/perf/util/pmus.c
@@ -470,8 +470,8 @@ void perf_pmus__print_pmu_events(const struct print_callbacks *print_cb, void *p
qsort(aliases, len, sizeof(struct sevent), cmp_sevent);
for (int j = 0; j < len; j++) {
/* Skip duplicates */
- if (j > 0 && pmu_alias_is_duplicate(&aliases[j], &aliases[j - 1]))
- continue;
+ if (j < len - 1 && pmu_alias_is_duplicate(&aliases[j], &aliases[j + 1]))
+ goto free;
print_cb->print_event(print_state,
aliases[j].pmu_name,
@@ -484,6 +484,7 @@ void perf_pmus__print_pmu_events(const struct print_callbacks *print_cb, void *p
aliases[j].desc,
aliases[j].long_desc,
aliases[j].encoding_desc);
+free:
zfree(&aliases[j].name);
zfree(&aliases[j].alias);
zfree(&aliases[j].scale_unit);
diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c
index 6aa1c7f2b444..6ab8147a3f87 100644
--- a/tools/perf/util/sort.c
+++ b/tools/perf/util/sort.c
@@ -332,7 +332,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right)
* comparing symbol address alone is not enough since it's a
* relative address within a dso.
*/
- if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) {
+ if (!hists__has(left->hists, dso)) {
ret = sort__dso_cmp(left, right);
if (ret != 0)
return ret;
diff --git a/tools/perf/util/stat-shadow.c b/tools/perf/util/stat-shadow.c
index cf573ff3fa84..2affa4d45aa2 100644
--- a/tools/perf/util/stat-shadow.c
+++ b/tools/perf/util/stat-shadow.c
@@ -176,6 +176,13 @@ static double find_stat(const struct evsel *evsel, int aggr_idx, enum stat_type
if (type != evsel__stat_type(cur))
continue;
+ /*
+ * Except the SW CLOCK events,
+ * ignore if not the PMU we're looking for.
+ */
+ if ((type != STAT_NSECS) && (evsel->pmu != cur->pmu))
+ continue;
+
aggr = &cur->stats->aggr[aggr_idx];
if (type == STAT_NSECS)
return aggr->counts.val;
diff --git a/tools/testing/selftests/bpf/DENYLIST.aarch64 b/tools/testing/selftests/bpf/DENYLIST.aarch64
index 3babaf3eee5c..ec6aa58fb181 100644
--- a/tools/testing/selftests/bpf/DENYLIST.aarch64
+++ b/tools/testing/selftests/bpf/DENYLIST.aarch64
@@ -1,6 +1,5 @@
bpf_cookie/multi_kprobe_attach_api # kprobe_multi_link_api_subtest:FAIL:fentry_raw_skel_load unexpected error: -3
bpf_cookie/multi_kprobe_link_api # kprobe_multi_link_api_subtest:FAIL:fentry_raw_skel_load unexpected error: -3
-fexit_sleep # The test never returns. The remaining tests cannot start.
kprobe_multi_bench_attach # needs CONFIG_FPROBE
kprobe_multi_test # needs CONFIG_FPROBE
module_attach # prog 'kprobe_multi': failed to auto-attach: -95
diff --git a/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c b/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
index 4aabeaa525d4..d0d9a0241545 100644
--- a/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
+++ b/tools/testing/selftests/bpf/prog_tests/bpf_tcp_ca.c
@@ -396,7 +396,8 @@ static void test_update_ca(void)
return;
link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
- ASSERT_OK_PTR(link, "attach_struct_ops");
+ if (!ASSERT_OK_PTR(link, "attach_struct_ops"))
+ goto out;
do_test("tcp_ca_update", NULL);
saved_ca1_cnt = skel->bss->ca1_cnt;
@@ -410,6 +411,7 @@ static void test_update_ca(void)
ASSERT_GT(skel->bss->ca2_cnt, 0, "ca2_ca2_cnt");
bpf_link__destroy(link);
+out:
tcp_ca_update__destroy(skel);
}
@@ -425,7 +427,8 @@ static void test_update_wrong(void)
return;
link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
- ASSERT_OK_PTR(link, "attach_struct_ops");
+ if (!ASSERT_OK_PTR(link, "attach_struct_ops"))
+ goto out;
do_test("tcp_ca_update", NULL);
saved_ca1_cnt = skel->bss->ca1_cnt;
@@ -438,6 +441,7 @@ static void test_update_wrong(void)
ASSERT_GT(skel->bss->ca1_cnt, saved_ca1_cnt, "ca2_ca1_cnt");
bpf_link__destroy(link);
+out:
tcp_ca_update__destroy(skel);
}
@@ -452,7 +456,8 @@ static void test_mixed_links(void)
return;
link_nl = bpf_map__attach_struct_ops(skel->maps.ca_no_link);
- ASSERT_OK_PTR(link_nl, "attach_struct_ops_nl");
+ if (!ASSERT_OK_PTR(link_nl, "attach_struct_ops_nl"))
+ goto out;
link = bpf_map__attach_struct_ops(skel->maps.ca_update_1);
ASSERT_OK_PTR(link, "attach_struct_ops");
@@ -465,6 +470,7 @@ static void test_mixed_links(void)
bpf_link__destroy(link);
bpf_link__destroy(link_nl);
+out:
tcp_ca_update__destroy(skel);
}
@@ -507,7 +513,8 @@ static void test_link_replace(void)
bpf_link__destroy(link);
link = bpf_map__attach_struct_ops(skel->maps.ca_update_2);
- ASSERT_OK_PTR(link, "attach_struct_ops_2nd");
+ if (!ASSERT_OK_PTR(link, "attach_struct_ops_2nd"))
+ goto out;
/* BPF_F_REPLACE with a wrong old map Fd. It should fail!
*
@@ -530,6 +537,7 @@ static void test_link_replace(void)
bpf_link__destroy(link);
+out:
tcp_ca_update__destroy(skel);
}
diff --git a/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c b/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c
index f949647dbbc2..552a0875ca6d 100644
--- a/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c
+++ b/tools/testing/selftests/bpf/prog_tests/fexit_sleep.c
@@ -21,13 +21,13 @@ static int do_sleep(void *skel)
}
#define STACK_SIZE (1024 * 1024)
-static char child_stack[STACK_SIZE];
void test_fexit_sleep(void)
{
struct fexit_sleep_lskel *fexit_skel = NULL;
int wstatus, duration = 0;
pid_t cpid;
+ char *child_stack = NULL;
int err, fexit_cnt;
fexit_skel = fexit_sleep_lskel__open_and_load();
@@ -38,6 +38,11 @@ void test_fexit_sleep(void)
if (CHECK(err, "fexit_attach", "fexit attach failed: %d\n", err))
goto cleanup;
+ child_stack = mmap(NULL, STACK_SIZE, PROT_READ | PROT_WRITE, MAP_PRIVATE |
+ MAP_ANONYMOUS | MAP_STACK, -1, 0);
+ if (!ASSERT_NEQ(child_stack, MAP_FAILED, "mmap"))
+ goto cleanup;
+
cpid = clone(do_sleep, child_stack + STACK_SIZE, CLONE_FILES | SIGCHLD, fexit_skel);
if (CHECK(cpid == -1, "clone", "%s\n", strerror(errno)))
goto cleanup;
@@ -78,5 +83,6 @@ void test_fexit_sleep(void)
goto cleanup;
cleanup:
+ munmap(child_stack, STACK_SIZE);
fexit_sleep_lskel__destroy(fexit_skel);
}
diff --git a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
index 597d0467a926..de2466547efe 100644
--- a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
+++ b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
@@ -994,7 +994,7 @@ static void drop_on_reuseport(const struct test *t)
err = update_lookup_map(t->sock_map, SERVER_A, server1);
if (err)
- goto detach;
+ goto close_srv1;
/* second server on destination address we should never reach */
server2 = make_server(t->sotype, t->connect_to.ip, t->connect_to.port,
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
index f09505f8b038..53d6ad8c2257 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
@@ -222,7 +222,7 @@ static void test_xdp_adjust_frags_tail_grow(void)
prog = bpf_object__next_program(obj, NULL);
if (bpf_object__load(obj))
- return;
+ goto out;
prog_fd = bpf_program__fd(prog);
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
index ba97165bdb28..a657651eba52 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
@@ -14,9 +14,9 @@ typedef int *ptr_arr_t[6];
typedef int *ptr_multiarr_t[7][8][9][10];
-typedef int * (*fn_ptr_arr_t[11])();
+typedef int * (*fn_ptr_arr_t[11])(void);
-typedef int * (*fn_ptr_multiarr_t[12][13])();
+typedef int * (*fn_ptr_multiarr_t[12][13])(void);
struct root_struct {
arr_t _1;
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
index ad21ee8c7e23..29d01fff32bd 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
@@ -100,7 +100,7 @@ typedef void (*printf_fn_t)(const char *, ...);
* `int -> char *` function and returns pointer to a char. Equivalent:
* typedef char * (*fn_input_t)(int);
* typedef char * (*fn_output_outer_t)(fn_input_t);
- * typedef const fn_output_outer_t (* fn_output_inner_t)();
+ * typedef const fn_output_outer_t (* fn_output_inner_t)(void);
* typedef const fn_output_inner_t fn_ptr_arr2_t[5];
*/
/* ----- START-EXPECTED-OUTPUT ----- */
@@ -127,7 +127,7 @@ typedef void (* (*signal_t)(int, void (*)(int)))(int);
typedef char * (*fn_ptr_arr1_t[10])(int **);
-typedef char * (* (* const fn_ptr_arr2_t[5])())(char * (*)(int));
+typedef char * (* (* const fn_ptr_arr2_t[5])(void))(char * (*)(int));
struct struct_w_typedefs {
int_t a;
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index 43612de44fbf..a181c0ccf98b 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -63,7 +63,7 @@ int passed;
int failed;
int map_fd[9];
struct bpf_map *maps[9];
-int prog_fd[11];
+int prog_fd[9];
int txmsg_pass;
int txmsg_redir;
@@ -680,7 +680,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt,
}
}
- s->bytes_recvd += recv;
+ if (recv > 0)
+ s->bytes_recvd += recv;
if (opt->check_recved_len && s->bytes_recvd > total_bytes) {
errno = EMSGSIZE;
@@ -1793,8 +1794,6 @@ int prog_attach_type[] = {
BPF_SK_MSG_VERDICT,
BPF_SK_MSG_VERDICT,
BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
};
int prog_type[] = {
@@ -1807,8 +1806,6 @@ int prog_type[] = {
BPF_PROG_TYPE_SK_MSG,
BPF_PROG_TYPE_SK_MSG,
BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
};
static int populate_progs(char *bpf_file)
diff --git a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
index 616d3581419c..21d0f419cc6d 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
@@ -11,7 +11,7 @@ ALL_TESTS="single_mask_test identical_filters_test two_masks_test \
multiple_masks_test ctcam_edge_cases_test delta_simple_test \
delta_two_masks_one_key_test delta_simple_rehash_test \
bloom_simple_test bloom_complex_test bloom_delta_test \
- max_erp_entries_test max_group_size_test"
+ max_erp_entries_test max_group_size_test collision_test"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/tc_common.sh
@@ -457,7 +457,7 @@ delta_two_masks_one_key_test()
{
# If 2 keys are the same and only differ in mask in a way that
# they belong under the same ERP (second is delta of the first),
- # there should be no C-TCAM spill.
+ # there should be C-TCAM spill.
RET=0
@@ -474,8 +474,8 @@ delta_two_masks_one_key_test()
tp_record "mlxsw:*" "tc filter add dev $h2 ingress protocol ip \
pref 2 handle 102 flower $tcflags dst_ip 192.0.2.2 \
action drop"
- tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 0
- check_err $? "incorrect C-TCAM spill while inserting the second rule"
+ tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 1
+ check_err $? "C-TCAM spill did not happen while inserting the second rule"
$MZ $h1 -c 1 -p 64 -a $h1mac -b $h2mac -A 192.0.2.1 -B 192.0.2.2 \
-t ip -q
@@ -1087,6 +1087,53 @@ max_group_size_test()
log_test "max ACL group size test ($tcflags). max size $max_size"
}
+collision_test()
+{
+ # Filters cannot share an eRP if in the common unmasked part (i.e.,
+ # without the delta bits) they have the same values. If the driver does
+ # not prevent such configuration (by spilling into the C-TCAM), then
+ # multiple entries will be present in the device with the same key,
+ # leading to collisions and a reduced scale.
+ #
+ # Create such a scenario and make sure all the filters are successfully
+ # added.
+
+ RET=0
+
+ local ret
+
+ if [[ "$tcflags" != "skip_sw" ]]; then
+ return 0;
+ fi
+
+ # Add a single dst_ip/24 filter and multiple dst_ip/32 filters that all
+ # have the same values in the common unmasked part (dst_ip/24).
+
+ tc filter add dev $h2 ingress pref 1 proto ipv4 handle 101 \
+ flower $tcflags dst_ip 198.51.100.0/24 \
+ action drop
+
+ for i in {0..255}; do
+ tc filter add dev $h2 ingress pref 2 proto ipv4 \
+ handle $((102 + i)) \
+ flower $tcflags dst_ip 198.51.100.${i}/32 \
+ action drop
+ ret=$?
+ [[ $ret -ne 0 ]] && break
+ done
+
+ check_err $ret "failed to add all the filters"
+
+ for i in {255..0}; do
+ tc filter del dev $h2 ingress pref 2 proto ipv4 \
+ handle $((102 + i)) flower
+ done
+
+ tc filter del dev $h2 ingress pref 1 proto ipv4 handle 101 flower
+
+ log_test "collision test ($tcflags)"
+}
+
setup_prepare()
{
h1=${NETIFS[p1]}
diff --git a/tools/testing/selftests/landlock/base_test.c b/tools/testing/selftests/landlock/base_test.c
index 792c3f0a59b4..5aa7d2feab10 100644
--- a/tools/testing/selftests/landlock/base_test.c
+++ b/tools/testing/selftests/landlock/base_test.c
@@ -9,6 +9,7 @@
#define _GNU_SOURCE
#include <errno.h>
#include <fcntl.h>
+#include <linux/keyctl.h>
#include <linux/landlock.h>
#include <string.h>
#include <sys/prctl.h>
@@ -326,4 +327,77 @@ TEST(ruleset_fd_transfer)
ASSERT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
}
+TEST(cred_transfer)
+{
+ struct landlock_ruleset_attr ruleset_attr = {
+ .handled_access_fs = LANDLOCK_ACCESS_FS_READ_DIR,
+ };
+ int ruleset_fd, dir_fd;
+ pid_t child;
+ int status;
+
+ drop_caps(_metadata);
+
+ dir_fd = open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC);
+ EXPECT_LE(0, dir_fd);
+ EXPECT_EQ(0, close(dir_fd));
+
+ /* Denies opening directories. */
+ ruleset_fd =
+ landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+ ASSERT_LE(0, ruleset_fd);
+ EXPECT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0));
+ ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0));
+ EXPECT_EQ(0, close(ruleset_fd));
+
+ /* Checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+
+ /* Needed for KEYCTL_SESSION_TO_PARENT permission checks */
+ EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING, NULL, 0,
+ 0, 0))
+ {
+ TH_LOG("Failed to join session keyring: %s", strerror(errno));
+ }
+
+ child = fork();
+ ASSERT_LE(0, child);
+ if (child == 0) {
+ /* Checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+
+ /*
+ * KEYCTL_SESSION_TO_PARENT is a no-op unless we have a
+ * different session keyring in the child, so make that happen.
+ */
+ EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING,
+ NULL, 0, 0, 0));
+
+ /*
+ * KEYCTL_SESSION_TO_PARENT installs credentials on the parent
+ * that never go through the cred_prepare hook, this path uses
+ * cred_transfer instead.
+ */
+ EXPECT_EQ(0, syscall(__NR_keyctl, KEYCTL_SESSION_TO_PARENT, 0,
+ 0, 0, 0));
+
+ /* Re-checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+
+ _exit(_metadata->passed ? EXIT_SUCCESS : EXIT_FAILURE);
+ return;
+ }
+
+ EXPECT_EQ(child, waitpid(child, &status, 0));
+ EXPECT_EQ(1, WIFEXITED(status));
+ EXPECT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
+
+ /* Re-checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+}
+
TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/landlock/config b/tools/testing/selftests/landlock/config
index 3dc9e438eab1..efca1c733367 100644
--- a/tools/testing/selftests/landlock/config
+++ b/tools/testing/selftests/landlock/config
@@ -1,5 +1,6 @@
CONFIG_CGROUPS=y
CONFIG_CGROUP_SCHED=y
+CONFIG_KEYS=y
CONFIG_OVERLAY_FS=y
CONFIG_PROC_FS=y
CONFIG_SECURITY=y
diff --git a/tools/testing/selftests/net/fib_tests.sh b/tools/testing/selftests/net/fib_tests.sh
index 66d0db7a2614..ede2c0ec2a9d 100755
--- a/tools/testing/selftests/net/fib_tests.sh
+++ b/tools/testing/selftests/net/fib_tests.sh
@@ -1643,53 +1643,53 @@ ipv4_rt_dsfield()
# DSCP 0x10 should match the specific route, no matter the ECN bits
$IP route get fibmatch 172.16.102.1 dsfield 0x10 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:Not-ECT"
$IP route get fibmatch 172.16.102.1 dsfield 0x11 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:ECT(1)"
$IP route get fibmatch 172.16.102.1 dsfield 0x12 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:ECT(0)"
$IP route get fibmatch 172.16.102.1 dsfield 0x13 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:CE"
# Unknown DSCP should match the generic route, no matter the ECN bits
$IP route get fibmatch 172.16.102.1 dsfield 0x14 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:Not-ECT"
$IP route get fibmatch 172.16.102.1 dsfield 0x15 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(1)"
$IP route get fibmatch 172.16.102.1 dsfield 0x16 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(0)"
$IP route get fibmatch 172.16.102.1 dsfield 0x17 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:CE"
# Null DSCP should match the generic route, no matter the ECN bits
$IP route get fibmatch 172.16.102.1 dsfield 0x00 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:Not-ECT"
$IP route get fibmatch 172.16.102.1 dsfield 0x01 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(1)"
$IP route get fibmatch 172.16.102.1 dsfield 0x02 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(0)"
$IP route get fibmatch 172.16.102.1 dsfield 0x03 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:CE"
}
diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh
index f1de525cfa55..62a05bca1e82 100644
--- a/tools/testing/selftests/net/forwarding/devlink_lib.sh
+++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh
@@ -122,6 +122,8 @@ devlink_reload()
still_pending=$(devlink resource show "$DEVLINK_DEV" | \
grep -c "size_new")
check_err $still_pending "Failed reload - There are still unset sizes"
+
+ udevadm settle
}
declare -A DEVLINK_ORIG
diff --git a/tools/testing/selftests/resctrl/cache.c b/tools/testing/selftests/resctrl/cache.c
index a0318bd3a63d..601ab78dbf42 100644
--- a/tools/testing/selftests/resctrl/cache.c
+++ b/tools/testing/selftests/resctrl/cache.c
@@ -40,7 +40,7 @@ static int perf_event_open_llc_miss(pid_t pid, int cpu_no)
fd_lm = perf_event_open(&pea_llc_miss, pid, cpu_no, -1,
PERF_FLAG_FD_CLOEXEC);
if (fd_lm == -1) {
- perror("Error opening leader");
+ ksft_perror("Error opening leader");
ctrlc_handler(0, NULL, NULL);
return -1;
}
@@ -95,7 +95,7 @@ static int get_llc_perf(unsigned long *llc_perf_miss)
ret = read(fd_lm, &rf_cqm, sizeof(struct read_format));
if (ret == -1) {
- perror("Could not get llc misses through perf");
+ ksft_perror("Could not get llc misses through perf");
return -1;
}
@@ -124,12 +124,12 @@ static int get_llc_occu_resctrl(unsigned long *llc_occupancy)
fp = fopen(llc_occup_path, "r");
if (!fp) {
- perror("Failed to open results file");
+ ksft_perror("Failed to open results file");
return errno;
}
if (fscanf(fp, "%lu", llc_occupancy) <= 0) {
- perror("Could not get llc occupancy");
+ ksft_perror("Could not get llc occupancy");
fclose(fp);
return -1;
@@ -159,7 +159,7 @@ static int print_results_cache(char *filename, int bm_pid,
} else {
fp = fopen(filename, "a");
if (!fp) {
- perror("Cannot open results file");
+ ksft_perror("Cannot open results file");
return errno;
}
diff --git a/tools/testing/selftests/resctrl/cat_test.c b/tools/testing/selftests/resctrl/cat_test.c
index 224ba8544d8a..9bb8ba93f433 100644
--- a/tools/testing/selftests/resctrl/cat_test.c
+++ b/tools/testing/selftests/resctrl/cat_test.c
@@ -51,7 +51,7 @@ static int check_results(struct resctrl_val_param *param, size_t span)
ksft_print_msg("Checking for pass/fail\n");
fp = fopen(param->filename, "r");
if (!fp) {
- perror("# Cannot open file");
+ ksft_perror("Cannot open file");
return errno;
}
@@ -149,7 +149,7 @@ int cat_perf_miss_val(int cpu_no, int n, char *cache_type)
param.num_of_runs = 0;
if (pipe(pipefd)) {
- perror("# Unable to create pipe");
+ ksft_perror("Unable to create pipe");
return errno;
}
@@ -185,7 +185,7 @@ int cat_perf_miss_val(int cpu_no, int n, char *cache_type)
* Just print the error message.
* Let while(1) run and wait for itself to be killed.
*/
- perror("# failed signaling parent process");
+ ksft_perror("Failed signaling parent process");
close(pipefd[1]);
while (1)
@@ -197,7 +197,7 @@ int cat_perf_miss_val(int cpu_no, int n, char *cache_type)
while (pipe_message != 1) {
if (read(pipefd[0], &pipe_message,
sizeof(pipe_message)) < sizeof(pipe_message)) {
- perror("# failed reading from child process");
+ ksft_perror("Failed reading from child process");
break;
}
}
diff --git a/tools/testing/selftests/resctrl/cmt_test.c b/tools/testing/selftests/resctrl/cmt_test.c
index 50bdbce9fba9..16fc0488e0a5 100644
--- a/tools/testing/selftests/resctrl/cmt_test.c
+++ b/tools/testing/selftests/resctrl/cmt_test.c
@@ -37,7 +37,7 @@ static int check_results(struct resctrl_val_param *param, size_t span, int no_of
ksft_print_msg("Checking for pass/fail\n");
fp = fopen(param->filename, "r");
if (!fp) {
- perror("# Error in opening file\n");
+ ksft_perror("Error in opening file");
return errno;
}
diff --git a/tools/testing/selftests/resctrl/fill_buf.c b/tools/testing/selftests/resctrl/fill_buf.c
index 0d425f26583a..0f6cca61ec94 100644
--- a/tools/testing/selftests/resctrl/fill_buf.c
+++ b/tools/testing/selftests/resctrl/fill_buf.c
@@ -115,7 +115,7 @@ static int fill_cache_read(unsigned char *buf, size_t buf_size, bool once)
/* Consume read result so that reading memory is not optimized out. */
fp = fopen("/dev/null", "w");
if (!fp) {
- perror("Unable to write to /dev/null");
+ ksft_perror("Unable to write to /dev/null");
return -1;
}
fprintf(fp, "Sum: %d ", ret);
diff --git a/tools/testing/selftests/resctrl/mba_test.c b/tools/testing/selftests/resctrl/mba_test.c
index d3bf4368341e..4988b93add6a 100644
--- a/tools/testing/selftests/resctrl/mba_test.c
+++ b/tools/testing/selftests/resctrl/mba_test.c
@@ -109,7 +109,7 @@ static int check_results(void)
fp = fopen(output, "r");
if (!fp) {
- perror(output);
+ ksft_perror(output);
return errno;
}
diff --git a/tools/testing/selftests/resctrl/mbm_test.c b/tools/testing/selftests/resctrl/mbm_test.c
index d3c0d30c676a..eb488aabb9ae 100644
--- a/tools/testing/selftests/resctrl/mbm_test.c
+++ b/tools/testing/selftests/resctrl/mbm_test.c
@@ -59,7 +59,7 @@ static int check_results(size_t span)
fp = fopen(output, "r");
if (!fp) {
- perror(output);
+ ksft_perror(output);
return errno;
}
diff --git a/tools/testing/selftests/resctrl/resctrl.h b/tools/testing/selftests/resctrl/resctrl.h
index 8578a8b4e145..dd3546655657 100644
--- a/tools/testing/selftests/resctrl/resctrl.h
+++ b/tools/testing/selftests/resctrl/resctrl.h
@@ -37,9 +37,8 @@
#define DEFAULT_SPAN (250 * MB)
-#define PARENT_EXIT(err_msg) \
+#define PARENT_EXIT() \
do { \
- perror(err_msg); \
kill(ppid, SIGKILL); \
umount_resctrlfs(); \
exit(EXIT_FAILURE); \
@@ -86,7 +85,6 @@ int validate_bw_report_request(char *bw_report);
bool validate_resctrl_feature_request(const char *resource, const char *feature);
char *fgrep(FILE *inf, const char *str);
int taskset_benchmark(pid_t bm_pid, int cpu_no);
-void run_benchmark(int signum, siginfo_t *info, void *ucontext);
int write_schemata(char *ctrlgrp, char *schemata, int cpu_no,
char *resctrl_val);
int write_bm_pid_to_resctrl(pid_t bm_pid, char *ctrlgrp, char *mongrp,
diff --git a/tools/testing/selftests/resctrl/resctrl_val.c b/tools/testing/selftests/resctrl/resctrl_val.c
index b8ca6fa40b3b..45439e726e79 100644
--- a/tools/testing/selftests/resctrl/resctrl_val.c
+++ b/tools/testing/selftests/resctrl/resctrl_val.c
@@ -156,12 +156,12 @@ static int read_from_imc_dir(char *imc_dir, int count)
sprintf(imc_counter_type, "%s%s", imc_dir, "type");
fp = fopen(imc_counter_type, "r");
if (!fp) {
- perror("Failed to open imc counter type file");
+ ksft_perror("Failed to open iMC counter type file");
return -1;
}
if (fscanf(fp, "%u", &imc_counters_config[count][READ].type) <= 0) {
- perror("Could not get imc type");
+ ksft_perror("Could not get iMC type");
fclose(fp);
return -1;
@@ -175,12 +175,12 @@ static int read_from_imc_dir(char *imc_dir, int count)
sprintf(imc_counter_cfg, "%s%s", imc_dir, READ_FILE_NAME);
fp = fopen(imc_counter_cfg, "r");
if (!fp) {
- perror("Failed to open imc config file");
+ ksft_perror("Failed to open iMC config file");
return -1;
}
if (fscanf(fp, "%s", cas_count_cfg) <= 0) {
- perror("Could not get imc cas count read");
+ ksft_perror("Could not get iMC cas count read");
fclose(fp);
return -1;
@@ -193,12 +193,12 @@ static int read_from_imc_dir(char *imc_dir, int count)
sprintf(imc_counter_cfg, "%s%s", imc_dir, WRITE_FILE_NAME);
fp = fopen(imc_counter_cfg, "r");
if (!fp) {
- perror("Failed to open imc config file");
+ ksft_perror("Failed to open iMC config file");
return -1;
}
if (fscanf(fp, "%s", cas_count_cfg) <= 0) {
- perror("Could not get imc cas count write");
+ ksft_perror("Could not get iMC cas count write");
fclose(fp);
return -1;
@@ -262,12 +262,12 @@ static int num_of_imcs(void)
}
closedir(dp);
if (count == 0) {
- perror("Unable find iMC counters!\n");
+ ksft_print_msg("Unable to find iMC counters\n");
return -1;
}
} else {
- perror("Unable to open PMU directory!\n");
+ ksft_perror("Unable to open PMU directory");
return -1;
}
@@ -292,6 +292,18 @@ static int initialize_mem_bw_imc(void)
return 0;
}
+static void perf_close_imc_mem_bw(void)
+{
+ int mc;
+
+ for (mc = 0; mc < imcs; mc++) {
+ if (imc_counters_config[mc][READ].fd != -1)
+ close(imc_counters_config[mc][READ].fd);
+ if (imc_counters_config[mc][WRITE].fd != -1)
+ close(imc_counters_config[mc][WRITE].fd);
+ }
+}
+
/*
* get_mem_bw_imc: Memory band width as reported by iMC counters
* @cpu_no: CPU number that the benchmark PID is binded to
@@ -305,26 +317,33 @@ static int initialize_mem_bw_imc(void)
static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
{
float reads, writes, of_mul_read, of_mul_write;
- int imc, j, ret;
+ int imc, ret;
+
+ for (imc = 0; imc < imcs; imc++) {
+ imc_counters_config[imc][READ].fd = -1;
+ imc_counters_config[imc][WRITE].fd = -1;
+ }
/* Start all iMC counters to log values (both read and write) */
reads = 0, writes = 0, of_mul_read = 1, of_mul_write = 1;
for (imc = 0; imc < imcs; imc++) {
- for (j = 0; j < 2; j++) {
- ret = open_perf_event(imc, cpu_no, j);
- if (ret)
- return -1;
- }
- for (j = 0; j < 2; j++)
- membw_ioctl_perf_event_ioc_reset_enable(imc, j);
+ ret = open_perf_event(imc, cpu_no, READ);
+ if (ret)
+ goto close_fds;
+ ret = open_perf_event(imc, cpu_no, WRITE);
+ if (ret)
+ goto close_fds;
+
+ membw_ioctl_perf_event_ioc_reset_enable(imc, READ);
+ membw_ioctl_perf_event_ioc_reset_enable(imc, WRITE);
}
sleep(1);
/* Stop counters after a second to get results (both read and write) */
for (imc = 0; imc < imcs; imc++) {
- for (j = 0; j < 2; j++)
- membw_ioctl_perf_event_ioc_disable(imc, j);
+ membw_ioctl_perf_event_ioc_disable(imc, READ);
+ membw_ioctl_perf_event_ioc_disable(imc, WRITE);
}
/*
@@ -339,16 +358,14 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
if (read(r->fd, &r->return_value,
sizeof(struct membw_read_format)) == -1) {
- perror("Couldn't get read b/w through iMC");
-
- return -1;
+ ksft_perror("Couldn't get read b/w through iMC");
+ goto close_fds;
}
if (read(w->fd, &w->return_value,
sizeof(struct membw_read_format)) == -1) {
- perror("Couldn't get write bw through iMC");
-
- return -1;
+ ksft_perror("Couldn't get write bw through iMC");
+ goto close_fds;
}
__u64 r_time_enabled = r->return_value.time_enabled;
@@ -368,10 +385,7 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
writes += w->return_value.value * of_mul_write * SCALE;
}
- for (imc = 0; imc < imcs; imc++) {
- close(imc_counters_config[imc][READ].fd);
- close(imc_counters_config[imc][WRITE].fd);
- }
+ perf_close_imc_mem_bw();
if (strcmp(bw_report, "reads") == 0) {
*bw_imc = reads;
@@ -385,6 +399,10 @@ static int get_mem_bw_imc(int cpu_no, char *bw_report, float *bw_imc)
*bw_imc = reads + writes;
return 0;
+
+close_fds:
+ perf_close_imc_mem_bw();
+ return -1;
}
void set_mbm_path(const char *ctrlgrp, const char *mongrp, int resource_id)
@@ -416,7 +434,7 @@ static void initialize_mem_bw_resctrl(const char *ctrlgrp, const char *mongrp,
int resource_id;
if (get_resource_id(cpu_no, &resource_id) < 0) {
- perror("Could not get resource_id");
+ ksft_print_msg("Could not get resource_id\n");
return;
}
@@ -449,12 +467,12 @@ static int get_mem_bw_resctrl(unsigned long *mbm_total)
fp = fopen(mbm_total_path, "r");
if (!fp) {
- perror("Failed to open total bw file");
+ ksft_perror("Failed to open total bw file");
return -1;
}
if (fscanf(fp, "%lu", mbm_total) <= 0) {
- perror("Could not get mbm local bytes");
+ ksft_perror("Could not get mbm local bytes");
fclose(fp);
return -1;
@@ -495,7 +513,7 @@ int signal_handler_register(void)
if (sigaction(SIGINT, &sigact, NULL) ||
sigaction(SIGTERM, &sigact, NULL) ||
sigaction(SIGHUP, &sigact, NULL)) {
- perror("# sigaction");
+ ksft_perror("sigaction");
ret = -1;
}
return ret;
@@ -515,7 +533,7 @@ void signal_handler_unregister(void)
if (sigaction(SIGINT, &sigact, NULL) ||
sigaction(SIGTERM, &sigact, NULL) ||
sigaction(SIGHUP, &sigact, NULL)) {
- perror("# sigaction");
+ ksft_perror("sigaction");
}
}
@@ -540,14 +558,14 @@ static int print_results_bw(char *filename, int bm_pid, float bw_imc,
} else {
fp = fopen(filename, "a");
if (!fp) {
- perror("Cannot open results file");
+ ksft_perror("Cannot open results file");
return errno;
}
if (fprintf(fp, "Pid: %d \t Mem_BW_iMC: %f \t Mem_BW_resc: %lu \t Difference: %lu\n",
bm_pid, bw_imc, bw_resc, diff) <= 0) {
+ ksft_print_msg("Could not log results\n");
fclose(fp);
- perror("Could not log results.");
return errno;
}
@@ -585,7 +603,7 @@ static void initialize_llc_occu_resctrl(const char *ctrlgrp, const char *mongrp,
int resource_id;
if (get_resource_id(cpu_no, &resource_id) < 0) {
- perror("# Unable to resource_id");
+ ksft_print_msg("Could not get resource_id\n");
return;
}
@@ -625,6 +643,61 @@ measure_vals(struct resctrl_val_param *param, unsigned long *bw_resc_start)
return 0;
}
+/*
+ * run_benchmark - Run a specified benchmark or fill_buf (default benchmark)
+ * in specified signal. Direct benchmark stdio to /dev/null.
+ * @signum: signal number
+ * @info: signal info
+ * @ucontext: user context in signal handling
+ */
+static void run_benchmark(int signum, siginfo_t *info, void *ucontext)
+{
+ int operation, ret, memflush;
+ char **benchmark_cmd;
+ size_t span;
+ bool once;
+ FILE *fp;
+
+ benchmark_cmd = info->si_ptr;
+
+ /*
+ * Direct stdio of child to /dev/null, so that only parent writes to
+ * stdio (console)
+ */
+ fp = freopen("/dev/null", "w", stdout);
+ if (!fp) {
+ ksft_perror("Unable to direct benchmark status to /dev/null");
+ PARENT_EXIT();
+ }
+
+ if (strcmp(benchmark_cmd[0], "fill_buf") == 0) {
+ /* Execute default fill_buf benchmark */
+ span = strtoul(benchmark_cmd[1], NULL, 10);
+ memflush = atoi(benchmark_cmd[2]);
+ operation = atoi(benchmark_cmd[3]);
+ if (!strcmp(benchmark_cmd[4], "true")) {
+ once = true;
+ } else if (!strcmp(benchmark_cmd[4], "false")) {
+ once = false;
+ } else {
+ ksft_print_msg("Invalid once parameter\n");
+ PARENT_EXIT();
+ }
+
+ if (run_fill_buf(span, memflush, operation, once))
+ fprintf(stderr, "Error in running fill buffer\n");
+ } else {
+ /* Execute specified benchmark */
+ ret = execvp(benchmark_cmd[0], benchmark_cmd);
+ if (ret)
+ ksft_perror("execvp");
+ }
+
+ fclose(stdout);
+ ksft_print_msg("Unable to run specified benchmark\n");
+ PARENT_EXIT();
+}
+
/*
* resctrl_val: execute benchmark and measure memory bandwidth on
* the benchmark
@@ -659,7 +732,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
ppid = getpid();
if (pipe(pipefd)) {
- perror("# Unable to create pipe");
+ ksft_perror("Unable to create pipe");
return -1;
}
@@ -671,7 +744,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
fflush(stdout);
bm_pid = fork();
if (bm_pid == -1) {
- perror("# Unable to fork");
+ ksft_perror("Unable to fork");
return -1;
}
@@ -688,15 +761,17 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
sigact.sa_flags = SA_SIGINFO;
/* Register for "SIGUSR1" signal from parent */
- if (sigaction(SIGUSR1, &sigact, NULL))
- PARENT_EXIT("Can't register child for signal");
+ if (sigaction(SIGUSR1, &sigact, NULL)) {
+ ksft_perror("Can't register child for signal");
+ PARENT_EXIT();
+ }
/* Tell parent that child is ready */
close(pipefd[0]);
pipe_message = 1;
if (write(pipefd[1], &pipe_message, sizeof(pipe_message)) <
sizeof(pipe_message)) {
- perror("# failed signaling parent process");
+ ksft_perror("Failed signaling parent process");
close(pipefd[1]);
return -1;
}
@@ -705,7 +780,8 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
/* Suspend child until delivery of "SIGUSR1" from parent */
sigsuspend(&sigact.sa_mask);
- PARENT_EXIT("Child is done");
+ ksft_perror("Child is done");
+ PARENT_EXIT();
}
ksft_print_msg("Benchmark PID: %d\n", bm_pid);
@@ -746,7 +822,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
while (pipe_message != 1) {
if (read(pipefd[0], &pipe_message, sizeof(pipe_message)) <
sizeof(pipe_message)) {
- perror("# failed reading message from child process");
+ ksft_perror("Failed reading message from child process");
close(pipefd[0]);
goto out;
}
@@ -755,7 +831,7 @@ int resctrl_val(const char * const *benchmark_cmd, struct resctrl_val_param *par
/* Signal child to start benchmark */
if (sigqueue(bm_pid, SIGUSR1, value) == -1) {
- perror("# sigqueue SIGUSR1 to child");
+ ksft_perror("sigqueue SIGUSR1 to child");
ret = errno;
goto out;
}
diff --git a/tools/testing/selftests/resctrl/resctrlfs.c b/tools/testing/selftests/resctrl/resctrlfs.c
index 3a8111362d26..71ad2b335b83 100644
--- a/tools/testing/selftests/resctrl/resctrlfs.c
+++ b/tools/testing/selftests/resctrl/resctrlfs.c
@@ -19,7 +19,7 @@ static int find_resctrl_mount(char *buffer)
mounts = fopen("/proc/mounts", "r");
if (!mounts) {
- perror("/proc/mounts");
+ ksft_perror("/proc/mounts");
return -ENXIO;
}
while (!feof(mounts)) {
@@ -68,7 +68,7 @@ int mount_resctrlfs(void)
ksft_print_msg("Mounting resctrl to \"%s\"\n", RESCTRL_PATH);
ret = mount("resctrl", RESCTRL_PATH, "resctrl", 0, NULL);
if (ret)
- perror("# mount");
+ ksft_perror("mount");
return ret;
}
@@ -85,7 +85,7 @@ int umount_resctrlfs(void)
return ret;
if (umount(mountpoint)) {
- perror("# Unable to umount resctrl");
+ ksft_perror("Unable to umount resctrl");
return errno;
}
@@ -114,12 +114,12 @@ int get_resource_id(int cpu_no, int *resource_id)
fp = fopen(phys_pkg_path, "r");
if (!fp) {
- perror("Failed to open physical_package_id");
+ ksft_perror("Failed to open physical_package_id");
return -1;
}
if (fscanf(fp, "%d", resource_id) <= 0) {
- perror("Could not get socket number or l3 id");
+ ksft_perror("Could not get socket number or l3 id");
fclose(fp);
return -1;
@@ -148,7 +148,7 @@ int get_cache_size(int cpu_no, char *cache_type, unsigned long *cache_size)
} else if (!strcmp(cache_type, "L2")) {
cache_num = 2;
} else {
- perror("Invalid cache level");
+ ksft_print_msg("Invalid cache level\n");
return -1;
}
@@ -156,12 +156,12 @@ int get_cache_size(int cpu_no, char *cache_type, unsigned long *cache_size)
cpu_no, cache_num);
fp = fopen(cache_path, "r");
if (!fp) {
- perror("Failed to open cache size");
+ ksft_perror("Failed to open cache size");
return -1;
}
if (fscanf(fp, "%s", cache_str) <= 0) {
- perror("Could not get cache_size");
+ ksft_perror("Could not get cache_size");
fclose(fp);
return -1;
@@ -213,12 +213,12 @@ int get_cbm_mask(char *cache_type, char *cbm_mask)
fp = fopen(cbm_mask_path, "r");
if (!fp) {
- perror("Failed to open cache level");
+ ksft_perror("Failed to open cache level");
return -1;
}
if (fscanf(fp, "%s", cbm_mask) <= 0) {
- perror("Could not get max cbm_mask");
+ ksft_perror("Could not get max cbm_mask");
fclose(fp);
return -1;
@@ -245,12 +245,12 @@ int get_core_sibling(int cpu_no)
fp = fopen(core_siblings_path, "r");
if (!fp) {
- perror("Failed to open core siblings path");
+ ksft_perror("Failed to open core siblings path");
return -1;
}
if (fscanf(fp, "%s", cpu_list_str) <= 0) {
- perror("Could not get core_siblings list");
+ ksft_perror("Could not get core_siblings list");
fclose(fp);
return -1;
@@ -285,7 +285,7 @@ int taskset_benchmark(pid_t bm_pid, int cpu_no)
CPU_SET(cpu_no, &my_set);
if (sched_setaffinity(bm_pid, sizeof(cpu_set_t), &my_set)) {
- perror("Unable to taskset benchmark");
+ ksft_perror("Unable to taskset benchmark");
return -1;
}
@@ -293,58 +293,6 @@ int taskset_benchmark(pid_t bm_pid, int cpu_no)
return 0;
}
-/*
- * run_benchmark - Run a specified benchmark or fill_buf (default benchmark)
- * in specified signal. Direct benchmark stdio to /dev/null.
- * @signum: signal number
- * @info: signal info
- * @ucontext: user context in signal handling
- *
- * Return: void
- */
-void run_benchmark(int signum, siginfo_t *info, void *ucontext)
-{
- int operation, ret, memflush;
- char **benchmark_cmd;
- size_t span;
- bool once;
- FILE *fp;
-
- benchmark_cmd = info->si_ptr;
-
- /*
- * Direct stdio of child to /dev/null, so that only parent writes to
- * stdio (console)
- */
- fp = freopen("/dev/null", "w", stdout);
- if (!fp)
- PARENT_EXIT("Unable to direct benchmark status to /dev/null");
-
- if (strcmp(benchmark_cmd[0], "fill_buf") == 0) {
- /* Execute default fill_buf benchmark */
- span = strtoul(benchmark_cmd[1], NULL, 10);
- memflush = atoi(benchmark_cmd[2]);
- operation = atoi(benchmark_cmd[3]);
- if (!strcmp(benchmark_cmd[4], "true"))
- once = true;
- else if (!strcmp(benchmark_cmd[4], "false"))
- once = false;
- else
- PARENT_EXIT("Invalid once parameter");
-
- if (run_fill_buf(span, memflush, operation, once))
- fprintf(stderr, "Error in running fill buffer\n");
- } else {
- /* Execute specified benchmark */
- ret = execvp(benchmark_cmd[0], benchmark_cmd);
- if (ret)
- perror("wrong\n");
- }
-
- fclose(stdout);
- PARENT_EXIT("Unable to run specified benchmark");
-}
-
/*
* create_grp - Create a group only if one doesn't exist
* @grp_name: Name of the group
@@ -376,7 +324,7 @@ static int create_grp(const char *grp_name, char *grp, const char *parent_grp)
}
closedir(dp);
} else {
- perror("Unable to open resctrl for group");
+ ksft_perror("Unable to open resctrl for group");
return -1;
}
@@ -384,7 +332,7 @@ static int create_grp(const char *grp_name, char *grp, const char *parent_grp)
/* Requested grp doesn't exist, hence create it */
if (found_grp == 0) {
if (mkdir(grp, 0) == -1) {
- perror("Unable to create group");
+ ksft_perror("Unable to create group");
return -1;
}
@@ -399,12 +347,12 @@ static int write_pid_to_tasks(char *tasks, pid_t pid)
fp = fopen(tasks, "w");
if (!fp) {
- perror("Failed to open tasks file");
+ ksft_perror("Failed to open tasks file");
return -1;
}
if (fprintf(fp, "%d\n", pid) < 0) {
- perror("Failed to wr pid to tasks file");
+ ksft_print_msg("Failed to write pid to tasks file\n");
fclose(fp);
return -1;
@@ -471,7 +419,7 @@ int write_bm_pid_to_resctrl(pid_t bm_pid, char *ctrlgrp, char *mongrp,
out:
ksft_print_msg("Writing benchmark parameters to resctrl FS\n");
if (ret)
- perror("# writing to resctrlfs");
+ ksft_print_msg("Failed writing to resctrlfs\n");
return ret;
}
@@ -658,7 +606,7 @@ int filter_dmesg(void)
ret = pipe(pipefds);
if (ret) {
- perror("pipe");
+ ksft_perror("pipe");
return ret;
}
fflush(stdout);
@@ -667,13 +615,13 @@ int filter_dmesg(void)
close(pipefds[0]);
dup2(pipefds[1], STDOUT_FILENO);
execlp("dmesg", "dmesg", NULL);
- perror("executing dmesg");
+ ksft_perror("Executing dmesg");
exit(1);
}
close(pipefds[1]);
fp = fdopen(pipefds[0], "r");
if (!fp) {
- perror("fdopen(pipe)");
+ ksft_perror("fdopen(pipe)");
kill(pid, SIGTERM);
return -1;
diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
index ea9bdf3a90b1..09da8f1011ce 100644
--- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h
+++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
@@ -8,7 +8,7 @@ register unsigned long sp asm("sp");
register unsigned long sp asm("esp");
#elif __loongarch64
register unsigned long sp asm("$sp");
-#elif __ppc__
+#elif __powerpc__
register unsigned long sp asm("r1");
#elif __s390x__
register unsigned long sp asm("%15");
^ permalink raw reply related [flat|nested] 2+ messages in thread