* Linux 6.1.103
@ 2024-08-03 7:05 Greg Kroah-Hartman
2024-08-03 7:05 ` Greg Kroah-Hartman
0 siblings, 1 reply; 2+ messages in thread
From: Greg Kroah-Hartman @ 2024-08-03 7:05 UTC (permalink / raw)
To: linux-kernel, akpm, torvalds, stable; +Cc: lwn, jslaby, Greg Kroah-Hartman
I'm announcing the release of the 6.1.103 kernel.
All users of the 6.1 kernel series must upgrade.
The updated 6.1.y git tree can be found at:
git://git.kernel.org/pub/scm/linux/kernel/git/stable/linux-stable.git linux-6.1.y
and can be browsed at the normal kernel.org git web browser:
https://git.kernel.org/?p=linux/kernel/git/stable/linux-stable.git;a=summary
thanks,
greg k-h
------------
Documentation/devicetree/bindings/thermal/thermal-zones.yaml | 5
Makefile | 2
arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi | 23
arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi | 14
arch/arm/mach-pxa/spitz.c | 30
arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi | 4
arch/arm64/boot/dts/amlogic/meson-gxl.dtsi | 4
arch/arm64/boot/dts/amlogic/meson-sm1.dtsi | 4
arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts | 4
arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts | 4
arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi | 25
arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi | 2
arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi | 1
arch/arm64/boot/dts/qcom/msm8996.dtsi | 2
arch/arm64/boot/dts/qcom/msm8998.dtsi | 1
arch/arm64/boot/dts/qcom/sdm845.dtsi | 2
arch/arm64/boot/dts/qcom/sm6350.dtsi | 4
arch/arm64/boot/dts/qcom/sm8250.dtsi | 22
arch/arm64/boot/dts/qcom/sm8450.dtsi | 2
arch/arm64/boot/dts/renesas/r8a779a0.dtsi | 14
arch/arm64/boot/dts/renesas/r8a779f0.dtsi | 14
arch/arm64/boot/dts/renesas/r8a779g0.dtsi | 82 +
arch/arm64/boot/dts/renesas/r9a07g043u.dtsi | 11
arch/arm64/boot/dts/renesas/r9a07g044.dtsi | 11
arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi | 7
arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi | 7
arch/arm64/boot/dts/renesas/r9a07g054.dtsi | 11
arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi | 7
arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts | 71
arch/arm64/boot/dts/rockchip/rk3328.dtsi | 4
arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts | 2
arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts | 4
arch/arm64/boot/dts/rockchip/rk356x.dtsi | 1
arch/m68k/amiga/config.c | 9
arch/m68k/atari/ataints.c | 6
arch/m68k/include/asm/cmpxchg.h | 2
arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi | 21
arch/mips/include/asm/mach-loongson64/boot_param.h | 2
arch/mips/include/asm/mips-cm.h | 4
arch/mips/kernel/smp-cps.c | 5
arch/mips/loongson64/env.c | 8
arch/mips/loongson64/reset.c | 38
arch/mips/loongson64/smp.c | 23
arch/mips/sgi-ip30/ip30-console.c | 1
arch/parisc/Kconfig | 1
arch/powerpc/configs/85xx-hw.config | 2
arch/powerpc/include/asm/kexec.h | 4
arch/powerpc/include/asm/plpks.h | 163 ++
arch/powerpc/kernel/prom.c | 12
arch/powerpc/kexec/core_64.c | 112 +
arch/powerpc/kexec/file_load_64.c | 87 -
arch/powerpc/kvm/powerpc.c | 4
arch/powerpc/platforms/pseries/plpks.c | 171 ++
arch/powerpc/platforms/pseries/plpks.h | 96 -
arch/powerpc/xmon/ppc-dis.c | 33
arch/s390/kernel/uv.c | 58
arch/s390/pci/pci_irq.c | 110 -
arch/sparc/include/asm/oplib_64.h | 1
arch/sparc/prom/init_64.c | 3
arch/sparc/prom/p1275.c | 2
arch/um/drivers/ubd_kern.c | 50
arch/um/kernel/time.c | 4
arch/um/os-Linux/signal.c | 118 +
arch/x86/events/core.c | 3
arch/x86/events/intel/cstate.c | 7
arch/x86/events/intel/pt.c | 4
arch/x86/events/intel/pt.h | 4
arch/x86/events/intel/uncore_snbep.c | 6
arch/x86/include/asm/kvm_host.h | 2
arch/x86/kernel/devicetree.c | 2
arch/x86/kvm/vmx/nested.c | 2
arch/x86/kvm/vmx/vmx.c | 11
arch/x86/kvm/vmx/vmx.h | 1
arch/x86/kvm/x86.c | 4
arch/x86/pci/intel_mid_pci.c | 4
arch/x86/pci/xen.c | 4
arch/x86/platform/intel/iosf_mbi.c | 4
arch/x86/xen/p2m.c | 4
block/bio-integrity.c | 21
drivers/android/binder.c | 4
drivers/ata/libata-scsi.c | 7
drivers/auxdisplay/ht16k33.c | 1
drivers/base/devres.c | 11
drivers/block/rbd.c | 35
drivers/bluetooth/btusb.c | 4
drivers/char/hw_random/amd-rng.c | 4
drivers/char/tpm/eventlog/common.c | 2
drivers/clk/clk-en7523.c | 9
drivers/clk/davinci/da8xx-cfgchip.c | 4
drivers/clk/qcom/camcc-sc7280.c | 5
drivers/clk/qcom/clk-branch.h | 26
drivers/clk/qcom/clk-rcg2.c | 32
drivers/clk/qcom/gcc-sc7280.c | 3
drivers/clk/qcom/gpucc-sm8350.c | 5
drivers/cpufreq/ti-cpufreq.c | 2
drivers/crypto/qat/qat_common/adf_cfg.c | 6
drivers/dma/ti/k3-udma.c | 4
drivers/edac/Makefile | 10
drivers/edac/skx_common.c | 21
drivers/edac/skx_common.h | 4
drivers/firmware/efi/libstub/x86-stub.c | 25
drivers/firmware/turris-mox-rwtm.c | 23
drivers/gpu/drm/amd/amdgpu/amdgpu_device.c | 2
drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c | 1
drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c | 12
drivers/gpu/drm/amd/display/dc/core/dc_surface.c | 3
drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c | 4
drivers/gpu/drm/display/drm_dp_mst_topology.c | 4
drivers/gpu/drm/etnaviv/etnaviv_gem.c | 6
drivers/gpu/drm/etnaviv/etnaviv_sched.c | 9
drivers/gpu/drm/gma500/cdv_intel_lvds.c | 3
drivers/gpu/drm/gma500/psb_intel_lvds.c | 3
drivers/gpu/drm/i915/display/intel_dp.c | 2
drivers/gpu/drm/i915/gt/intel_execlists_submission.c | 6
drivers/gpu/drm/mediatek/mtk_drm_drv.c | 2
drivers/gpu/drm/mediatek/mtk_drm_plane.c | 2
drivers/gpu/drm/meson/meson_drv.c | 37
drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c | 3
drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c | 3
drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h | 3
drivers/gpu/drm/msm/dsi/dsi_host.c | 3
drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c | 8
drivers/gpu/drm/panfrost/panfrost_drv.c | 1
drivers/gpu/drm/qxl/qxl_display.c | 3
drivers/gpu/drm/rockchip/rockchip_drm_vop2.c | 2
drivers/hwmon/adt7475.c | 2
drivers/hwmon/max6697.c | 5
drivers/hwtracing/coresight/coresight-platform.c | 4
drivers/iio/frequency/adrf6780.c | 1
drivers/infiniband/core/cache.c | 14
drivers/infiniband/core/device.c | 6
drivers/infiniband/core/iwcm.c | 11
drivers/infiniband/hw/bnxt_re/ib_verbs.c | 8
drivers/infiniband/hw/bnxt_re/qplib_fp.h | 6
drivers/infiniband/hw/hns/hns_roce_device.h | 6
drivers/infiniband/hw/hns/hns_roce_hw_v2.c | 40
drivers/infiniband/hw/hns/hns_roce_mr.c | 5
drivers/infiniband/hw/hns/hns_roce_qp.c | 4
drivers/infiniband/hw/hns/hns_roce_srq.c | 2
drivers/infiniband/hw/mlx4/alias_GUID.c | 2
drivers/infiniband/hw/mlx4/mad.c | 2
drivers/infiniband/hw/mlx5/mlx5_ib.h | 13
drivers/infiniband/hw/mlx5/odp.c | 6
drivers/infiniband/sw/rxe/rxe_req.c | 7
drivers/input/keyboard/qt1050.c | 7
drivers/input/mouse/elan_i2c_core.c | 2
drivers/interconnect/qcom/qcm2290.c | 2
drivers/iommu/intel/iommu.c | 22
drivers/iommu/sprd-iommu.c | 2
drivers/irqchip/irq-imx-irqsteer.c | 24
drivers/isdn/hardware/mISDN/hfcmulti.c | 7
drivers/leds/flash/leds-mt6360.c | 5
drivers/leds/led-class.c | 1
drivers/leds/led-triggers.c | 2
drivers/leds/leds-ss4200.c | 7
drivers/macintosh/therm_windtunnel.c | 2
drivers/md/dm-verity-target.c | 16
drivers/md/md.c | 26
drivers/media/i2c/imx412.c | 9
drivers/media/pci/ivtv/ivtv-udma.c | 8
drivers/media/pci/ivtv/ivtv-yuv.c | 6
drivers/media/pci/ivtv/ivtvfb.c | 6
drivers/media/pci/saa7134/saa7134-dvb.c | 8
drivers/media/platform/qcom/venus/vdec.c | 3
drivers/media/platform/renesas/rcar-vin/rcar-csi2.c | 5
drivers/media/platform/renesas/rcar-vin/rcar-dma.c | 16
drivers/media/platform/renesas/vsp1/vsp1_histo.c | 20
drivers/media/platform/renesas/vsp1/vsp1_pipe.h | 2
drivers/media/platform/renesas/vsp1/vsp1_rpf.c | 8
drivers/media/rc/imon.c | 5
drivers/media/rc/lirc_dev.c | 4
drivers/media/usb/dvb-usb/dvb-usb-init.c | 35
drivers/media/usb/uvc/uvc_ctrl.c | 9
drivers/media/usb/uvc/uvc_video.c | 10
drivers/media/v4l2-core/v4l2-async.c | 3
drivers/memory/Kconfig | 2
drivers/mfd/Makefile | 6
drivers/mfd/omap-usb-tll.c | 3
drivers/mfd/rsmu_core.c | 2
drivers/mtd/nand/raw/Kconfig | 3
drivers/mtd/tests/Makefile | 34
drivers/mtd/tests/mtd_test.c | 9
drivers/mtd/ubi/eba.c | 3
drivers/net/bonding/bond_main.c | 7
drivers/net/dsa/b53/b53_common.c | 3
drivers/net/dsa/mv88e6xxx/chip.c | 3
drivers/net/ethernet/brocade/bna/bna_types.h | 2
drivers/net/ethernet/brocade/bna/bnad.c | 11
drivers/net/ethernet/freescale/fec_main.c | 52
drivers/net/ethernet/google/gve/gve_tx_dqo.c | 22
drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c | 2
drivers/net/ethernet/intel/ice/ice_fdir.h | 3
drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c | 16
drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h | 1
drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c | 18
drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c | 2
drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c | 13
drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h | 9
drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c | 2
drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c | 2
drivers/net/ethernet/stmicro/stmmac/hwif.h | 2
drivers/net/ethernet/stmicro/stmmac/stmmac_main.c | 4
drivers/net/netconsole.c | 2
drivers/net/wireless/ath/ath11k/dp_rx.c | 3
drivers/net/wireless/ath/ath11k/dp_rx.h | 3
drivers/net/wireless/ath/ath11k/mac.c | 15
drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c | 18
drivers/net/wireless/marvell/mwifiex/cfg80211.c | 2
drivers/net/wireless/realtek/rtw89/debug.c | 2
drivers/net/wireless/virt_wifi.c | 20
drivers/nvme/host/pci.c | 5
drivers/nvme/target/auth.c | 14
drivers/opp/ti-opp-supply.c | 6
drivers/parport/procfs.c | 24
drivers/pci/controller/dwc/pci-keystone.c | 156 +-
drivers/pci/controller/dwc/pcie-designware-ep.c | 13
drivers/pci/controller/dwc/pcie-dw-rockchip.c | 2
drivers/pci/controller/dwc/pcie-qcom-ep.c | 6
drivers/pci/controller/pci-hyperv.c | 4
drivers/pci/controller/pci-loongson.c | 13
drivers/pci/controller/pcie-rcar-host.c | 6
drivers/pci/controller/pcie-rockchip.c | 2
drivers/pci/endpoint/functions/pci-epf-vntb.c | 19
drivers/pci/pci.c | 6
drivers/pci/setup-bus.c | 6
drivers/phy/cadence/phy-cadence-torrent.c | 3
drivers/pinctrl/core.c | 12
drivers/pinctrl/freescale/pinctrl-mxs.c | 4
drivers/pinctrl/pinctrl-rockchip.c | 17
drivers/pinctrl/pinctrl-single.c | 7
drivers/pinctrl/renesas/pfc-r8a779g0.c | 712 ++++------
drivers/pinctrl/ti/pinctrl-ti-iodelay.c | 14
drivers/platform/chrome/cros_ec_debugfs.c | 1
drivers/platform/mips/cpu_hwmon.c | 3
drivers/pwm/pwm-atmel-tcb.c | 66
drivers/pwm/pwm-stm32.c | 5
drivers/remoteproc/imx_rproc.c | 10
drivers/remoteproc/stm32_rproc.c | 2
drivers/rtc/interface.c | 9
drivers/rtc/rtc-cmos.c | 10
drivers/rtc/rtc-isl1208.c | 11
drivers/s390/block/dasd_devmap.c | 10
drivers/scsi/qla2xxx/qla_bsg.c | 98 -
drivers/scsi/qla2xxx/qla_def.h | 3
drivers/scsi/qla2xxx/qla_gs.c | 35
drivers/scsi/qla2xxx/qla_init.c | 87 -
drivers/scsi/qla2xxx/qla_inline.h | 8
drivers/scsi/qla2xxx/qla_mid.c | 2
drivers/scsi/qla2xxx/qla_nvme.c | 5
drivers/scsi/qla2xxx/qla_os.c | 7
drivers/scsi/qla2xxx/qla_sup.c | 108 +
drivers/soc/qcom/pdr_interface.c | 8
drivers/soc/qcom/rpmh-rsc.c | 7
drivers/soc/qcom/rpmh.c | 1
drivers/soc/xilinx/xlnx_event_manager.c | 15
drivers/soc/xilinx/zynqmp_power.c | 4
drivers/spi/atmel-quadspi.c | 11
drivers/spi/spi-microchip-core.c | 188 +-
drivers/spi/spidev.c | 11
drivers/vhost/vsock.c | 4
drivers/watchdog/rzg2l_wdt.c | 22
fs/ceph/super.c | 3
fs/ext2/balloc.c | 11
fs/ext4/extents_status.c | 2
fs/ext4/fast_commit.c | 6
fs/ext4/namei.c | 73 -
fs/ext4/xattr.c | 6
fs/f2fs/checkpoint.c | 10
fs/f2fs/file.c | 2
fs/f2fs/inline.c | 6
fs/f2fs/inode.c | 3
fs/f2fs/segment.h | 3
fs/fuse/inode.c | 24
fs/hfs/inode.c | 3
fs/hfsplus/bfind.c | 15
fs/hfsplus/extents.c | 9
fs/hfsplus/hfsplus_fs.h | 21
fs/jbd2/commit.c | 2
fs/jbd2/journal.c | 5
fs/jfs/jfs_imap.c | 5
fs/kernfs/dir.c | 112 -
fs/kernfs/file.c | 18
fs/kernfs/inode.c | 8
fs/kernfs/kernfs-internal.h | 2
fs/kernfs/mount.c | 10
fs/kernfs/symlink.c | 2
fs/nfs/nfs4client.c | 6
fs/nfs/nfs4proc.c | 2
fs/nilfs2/btnode.c | 25
fs/nilfs2/btree.c | 4
fs/nilfs2/segment.c | 2
fs/ntfs3/attrib.c | 17
fs/ntfs3/bitmap.c | 2
fs/ntfs3/dir.c | 3
fs/ntfs3/file.c | 5
fs/ntfs3/frecord.c | 2
fs/ntfs3/fslog.c | 5
fs/ntfs3/fsntfs.c | 2
fs/ntfs3/index.c | 4
fs/ntfs3/inode.c | 3
fs/ntfs3/ntfs.h | 13
fs/ntfs3/ntfs_fs.h | 2
fs/proc/task_mmu.c | 2
fs/smb/client/cifsfs.c | 8
fs/smb/client/connect.c | 24
fs/super.c | 11
fs/udf/balloc.c | 15
fs/udf/super.c | 3
include/asm-generic/vmlinux.lds.h | 2
include/drm/drm_mipi_dsi.h | 21
include/linux/bpf_verifier.h | 2
include/linux/hugetlb.h | 1
include/linux/jbd2.h | 5
include/linux/jump_label.h | 21
include/linux/mlx5/qp.h | 9
include/linux/objagg.h | 1
include/linux/pci.h | 2
include/linux/perf_event.h | 1
include/linux/sbitmap.h | 5
include/linux/task_work.h | 3
include/linux/virtio_net.h | 11
include/net/ip_fib.h | 1
include/net/tcp.h | 1
include/trace/events/rpcgss.h | 2
include/uapi/linux/netfilter/nf_tables.h | 2
include/uapi/linux/zorro_ids.h | 3
io_uring/io-wq.c | 10
io_uring/io_uring.c | 5
io_uring/timeout.c | 2
kernel/bpf/btf.c | 10
kernel/bpf/dispatcher.c | 5
kernel/cgroup/cgroup-v1.c | 2
kernel/cgroup/cgroup.c | 4
kernel/cgroup/cpuset.c | 15
kernel/debug/kdb/kdb_io.c | 6
kernel/dma/mapping.c | 2
kernel/events/core.c | 79 -
kernel/events/internal.h | 2
kernel/events/ring_buffer.c | 4
kernel/irq/manage.c | 2
kernel/jump_label.c | 101 -
kernel/locking/rwsem.c | 6
kernel/rcu/tasks.h | 10
kernel/sched/core.c | 37
kernel/sched/fair.c | 9
kernel/sched/sched.h | 2
kernel/signal.c | 8
kernel/task_work.c | 34
kernel/time/tick-broadcast.c | 23
kernel/trace/pid_list.c | 4
kernel/watchdog_hld.c | 11
lib/decompress_bunzip2.c | 3
lib/kobject_uevent.c | 17
lib/objagg.c | 18
lib/sbitmap.c | 83 -
mm/hugetlb.c | 2
mm/mempolicy.c | 18
mm/mmap_lock.c | 175 --
mm/vmscan.c | 1
net/bridge/br_forward.c | 4
net/core/filter.c | 15
net/core/flow_dissector.c | 2
net/core/xdp.c | 4
net/ipv4/esp4.c | 3
net/ipv4/fib_semantics.c | 13
net/ipv4/fib_trie.c | 1
net/ipv4/nexthop.c | 7
net/ipv4/route.c | 18
net/ipv4/tcp.c | 13
net/ipv4/tcp_input.c | 34
net/ipv4/tcp_ipv4.c | 19
net/ipv4/tcp_output.c | 2
net/ipv4/tcp_timer.c | 10
net/ipv6/addrconf.c | 3
net/ipv6/esp6.c | 3
net/ipv6/tcp_ipv6.c | 19
net/mac80211/cfg.c | 23
net/mac80211/ieee80211_i.h | 2
net/mac80211/rate.c | 2
net/mac80211/sta_info.h | 6
net/mac80211/vht.c | 37
net/netfilter/ipvs/ip_vs_proto_sctp.c | 4
net/netfilter/nf_conntrack_netlink.c | 3
net/netfilter/nft_set_pipapo.c | 22
net/netfilter/nft_set_pipapo.h | 27
net/netfilter/nft_set_pipapo_avx2.c | 81 -
net/packet/af_packet.c | 86 +
net/smc/smc_core.c | 5
net/sunrpc/auth_gss/gss_krb5_keys.c | 2
net/sunrpc/clnt.c | 3
net/sunrpc/xprtrdma/frwr_ops.c | 3
net/sunrpc/xprtrdma/verbs.c | 16
net/tipc/udp_media.c | 5
net/unix/af_unix.c | 41
net/unix/unix_bpf.c | 3
net/wireless/util.c | 8
scripts/Makefile.lib | 6
scripts/gcc-x86_32-has-stack-protector.sh | 2
scripts/gcc-x86_64-has-stack-protector.sh | 2
security/apparmor/lsm.c | 7
security/apparmor/policy.c | 2
security/apparmor/policy_unpack.c | 1
security/keys/keyctl.c | 2
security/landlock/cred.c | 11
sound/soc/amd/acp-es8336.c | 4
sound/soc/amd/yc/acp6x-mach.c | 7
sound/soc/codecs/max98088.c | 10
sound/soc/intel/common/soc-intel-quirks.h | 2
sound/soc/qcom/lpass-cpu.c | 4
sound/soc/sof/imx/imx8m.c | 2
sound/usb/mixer.c | 7
sound/usb/quirks.c | 4
tools/bpf/bpftool/common.c | 2
tools/bpf/bpftool/prog.c | 4
tools/bpf/resolve_btfids/main.c | 2
tools/lib/bpf/btf_dump.c | 8
tools/lib/bpf/linker.c | 11
tools/memory-model/lock.cat | 20
tools/perf/arch/x86/util/intel-pt.c | 15
tools/perf/tests/shell/test_arm_callgraph_fp.sh | 64
tools/perf/tests/workloads/leafloop.c | 20
tools/perf/util/sort.c | 2
tools/testing/selftests/bpf/prog_tests/sk_lookup.c | 2
tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c | 2
tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c | 4
tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c | 4
tools/testing/selftests/bpf/test_sockmap.c | 9
tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh | 55
tools/testing/selftests/landlock/base_test.c | 74 +
tools/testing/selftests/landlock/config | 5
tools/testing/selftests/net/fib_tests.sh | 24
tools/testing/selftests/net/forwarding/devlink_lib.sh | 2
tools/testing/selftests/sigaltstack/current_stack_pointer.h | 2
433 files changed, 4242 insertions(+), 2567 deletions(-)
Abhinav Kumar (1):
drm/msm/dpu: drop validity checks for clear_pending_flush() ctl op
Adrian Hunter (7):
perf/x86/intel/pt: Fix pt_topa_entry_for_page() address calculation
perf: Fix perf_aux_size() for greater-than 32-bit size
perf: Prevent passing zero nr_pages to rb_alloc_aux()
perf: Fix default aux_watermark calculation
perf intel-pt: Fix aux_watermark calculation for 64-bit size
perf intel-pt: Fix exclude_guest setting
perf/x86/intel/pt: Fix a topa_entry base address calculation
Ahmed Zaki (1):
ice: Add a per-VF limit on number of FDIR filters
Al Viro (2):
powerpc: fix a file leak in kvm_vcpu_ioctl_enable_cap()
lirc: rc_dev_get_from_fd(): fix file leak
Alan Maguire (2):
bpf: annotate BTF show functions with __printf
bpf: Eliminate remaining "make W=1" warnings in kernel/bpf/btf.o
Alan Stern (1):
tools/memory-model: Fix bug in lock.cat
Aleksandr Burakov (1):
saa7134: Unchecked i2c_transfer function result fixed
Aleksandr Mishin (6):
wifi: rtw89: Fix array index mistake in rtw89_sta_info_get_iter()
PCI: keystone: Fix NULL pointer dereference in case of DT error in ks_pcie_setup_rc_app_regs()
ASoC: qcom: Adjust issues in case of DT error in asoc_qcom_lpass_cpu_platform_probe()
ASoC: amd: Adjust error handling in case of absent codec device
remoteproc: imx_rproc: Skip over memory region when node value is NULL
remoteproc: imx_rproc: Fix refcount mistake in imx_rproc_addr_init
Alex Deucher (1):
drm/amdgpu/sdma5.2: Update wptr registers as well as doorbell
Alexey Kodanev (1):
bna: adjust 'name' buf size of bna_tcb and bna_ccb structures
Amit Cohen (1):
selftests: forwarding: devlink_lib: Wait for udev events after reloading
Andreas Larsson (1):
sparc64: Fix incorrect function signature and add prototype for prom_cif_init
Andrei Lalaev (1):
Input: qt1050 - handle CHIP_ID reading error
Andrew Donnellan (1):
powerpc/pseries: Fix alignment of PLPKS structures and buffers
Andrii Nakryiko (1):
libbpf: Fix no-args func prototype BTF dumping syntax
Andy Yan (1):
drm/rockchip: vop2: Fix the port mux of VP2
Antoniu Miclaus (1):
iio: frequency: adrf6780: rm clk provider include
Ard Biesheuvel (2):
x86/efistub: Avoid returning EFI_SUCCESS on error
x86/efistub: Revert to heap allocated boot_params for PE entrypoint
Arnd Bergmann (4):
EDAC, i10nm: make skx_common.o a separate module
mfd: rsmu: Split core code into separate module
mtd: make mtd_test.c a separate module
kdb: address -Wformat-security warnings
Artem Chernyshev (1):
iommu: sprd: Avoid NULL deref in sprd_iommu_hw_en
Bailey Forrest (1):
gve: Fix an edge case for TSO skb validity check
Baochen Qiang (3):
wifi: ath11k: fix wrong handling of CCMP256 and GCMP ciphers
wifi: cfg80211: fix typo in cfg80211_calculate_bitrate_he()
wifi: cfg80211: handle 2x996 RU allocation in cfg80211_calculate_bitrate_he()
Baokun Li (2):
ext4: check dot and dotdot of dx_root before making dir indexed
ext4: make sure the first directory block is not a hole
Bart Van Assche (2):
RDMA/iwcm: Fix a use-after-free related to destroying CM IDs
nvme-pci: Fix the instructions for disabling power management
Bastien Curutchet (1):
clk: davinci: da8xx-cfgchip: Initialize clk_init_data before use
Benjamin Coddington (1):
SUNRPC: Fixup gss_status tracepoint error output
Breno Leitao (1):
net: netconsole: Disable target before netpoll cleanup
Bryan O'Donoghue (1):
media: i2c: Fix imx412 exposure control
Carlos Llamas (1):
binder: fix hang of unregistered readers
Carlos López (1):
s390/dasd: fix error checks in dasd_copy_pair_store()
Chao Yu (6):
hfsplus: fix to avoid false alarm of circular locking
hfs: fix to initialize fields of hfs_inode_info after hfs_alloc_inode()
f2fs: fix to force buffered IO on inline_data inode
f2fs: fix to don't dirty inode for readonly filesystem
f2fs: fix return value of f2fs_convert_inline_inode()
f2fs: fix to update user block counts in block_operations()
Chen Ni (4):
spi: atmel-quadspi: Add missing check for clk_prepare
x86/xen: Convert comma to semicolon
drm/qxl: Add check for drm_cvt_mode
ASoC: max98088: Check for clk_prepare_enable() error
Chen Ridong (1):
cgroup/cpuset: Prevent UAF in proc_cpuset_show()
Chen-Yu Tsai (2):
arm64: dts: mediatek: mt8183-kukui: Drop bogus output-enable property
arm64: dts: mediatek: mt8183-kukui-jacuzzi: Add ports node for anx7625
Chengchang Tang (4):
RDMA/hns: Fix missing pagesize and alignment check in FRMR
RDMA/hns: Fix shift-out-bounds when max_inline_data is 0
RDMA/hns: Fix undifined behavior caused by invalid max_sge
RDMA/hns: Fix insufficient extend DB for VFs.
Chengen Du (1):
af_packet: Handle outgoing VLAN packets without hardware offloading
ChiYuan Huang (1):
media: v4l: async: Fix NULL pointer dereference in adding ancillary links
Chiara Meiohas (1):
RDMA/mlx5: Set mkeys for dmabuf at PAGE_SIZE
Christoph Hellwig (3):
ubd: refactor the interrupt handler
ubd: untagle discard vs write zeroes not support handling
block: initialize integrity buffer to zero before writing it to media
Christophe Leroy (1):
vmlinux.lds.h: catch .bss..L* sections into BSS")
Chuck Lever (1):
xprtrdma: Fix rpcrdma_reqs_reset()
Claudiu Beznea (2):
watchdog: rzg2l_wdt: Use pm_runtime_resume_and_get()
watchdog: rzg2l_wdt: Check return status of pm_runtime_put()
Conor Dooley (1):
spi: spidev: add correct compatible for Rohm BH2228FV
Cristian Ciocaltea (3):
arm64: dts: rockchip: Drop invalid mic-in-differential on rk3568-rock-3a
arm64: dts: rockchip: Fix mic-in-differential usage on rk3568-evb1-v10
arm64: dts: rockchip: Add missing power-domains for rk356x vop_mmu
Csókás Bence (1):
net: fec: Refactor: #define magic constants
Csókás, Bence (2):
net: fec: Fix FEC_ECR_EN1588 being cleared on link-down
rtc: interface: Add RTC offset to alarm after fix-up
Dan Carpenter (3):
PCI: endpoint: Clean up error handling in vpci_scan_bus()
PCI: endpoint: Fix error handling in epf_ntb_epc_cleanup()
mISDN: Fix a use after free in hfcmulti_tx()
Daniel Baluta (1):
ASoC: SOF: imx8m: Fix DSP control regmap retrieval
Daniel Schaefer (1):
media: uvcvideo: Override default flags
David Hildenbrand (2):
s390/uv: Don't call folio_wait_writeback() without a folio reference
fs/proc/task_mmu: indicate PM_FILE for PMD-mapped file THP
Denis Arefev (1):
net: missing check virtio
Dikshita Agarwal (2):
media: venus: flush all buffers in output plane streamoff
media: venus: fix use after free in vdec_close
Dmitry Baryshkov (9):
arm64: dts: qcom: sdm845: add power-domain to UFS PHY
arm64: dts: qcom: sm6350: add power-domain to UFS PHY
arm64: dts: qcom: sm8250: switch UFS QMP PHY to new style of bindings
arm64: dts: qcom: sm8250: add power-domain to UFS PHY
arm64: dts: qcom: sm8450: add power-domain to UFS PHY
arm64: dts: qcom: msm8996-xiaomi-common: drop excton from the USB PHY
arm64: dts: qcom: msm8996: specify UFS core_clk frequencies
soc: qcom: pdr: protect locator_addr with the main mutex
soc: qcom: pdr: fix parsing of domains lists
Dmitry Safonov (1):
jump_label: Prevent key->enabled int overflow
Dmitry Torokhov (2):
ARM: spitz: fix GPIO assignment for backlight
Input: elan_i2c - do not leave interrupt disabled on suspend failure
Dmitry Yashin (1):
pinctrl: rockchip: update rk3308 iomux routes
Dominique Martinet (1):
MIPS: Octeron: remove source file executable bit
Donglin Peng (1):
libbpf: Checking the btf_type kind when fixing variable offsets
Douglas Anderson (4):
drm/mipi-dsi: Fix theoretical int overflow in mipi_dsi_dcs_write_seq()
drm/panel: boe-tv101wum-nl6: If prepare fails, disable GPIO before regulators
drm/panel: boe-tv101wum-nl6: Check for errors on the NOP in prepare()
kdb: Use the passed prompt in kdb_position_cursor()
Dragan Simic (1):
drm/panfrost: Mark simple_ondemand governor as softdep
Eero Tamminen (1):
m68k: atari: Fix TT bootup freeze / unexpected (SCU) interrupt messages
Elliot Ayrey (1):
net: bridge: mst: Check vlan state for egress decision
En-Wei Wu (1):
wifi: virt_wifi: avoid reporting connection success with wrong SSID
Eric Biggers (1):
dm-verity: fix dm_is_verity_target() when dm-verity is builtin
Eric Dumazet (5):
tcp: annotate lockless accesses to sk->sk_err_soft
tcp: annotate lockless access to sk->sk_err
tcp: add tcp_done_with_error() helper
tcp: fix race in tcp_write_err()
tcp: fix races in tcp_v[46]_err()
Eric Sandeen (1):
fuse: verify {g,u}id mount options correctly
Esben Haabendal (2):
powerpc/configs: Update defconfig with now user-visible CONFIG_FSL_IFC
memory: fsl_ifc: Make FSL_IFC config visible and selectable
Fedor Pchelkin (2):
apparmor: use kvfree_sensitive to free data->data
ubi: eba: properly rollback inside self_check_eba
Florian Westphal (3):
netfilter: nft_set_pipapo: constify lookup fn args where possible
netfilter: nf_set_pipapo: fix initial map fill
netfilter: nft_set_pipapo_avx2: disable softinterrupts
Frank Li (1):
PCI: dwc: Fix index 0 incorrectly being interpreted as a free ATU slot
Fred Li (1):
bpf: Fix a segment issue when downgrading gso_size
Frederic Weisbecker (5):
rcu/tasks: Fix stale task snaphot for Tasks Trace
task_work: s/task_work_cancel()/task_work_cancel_func()/
task_work: Introduce task_work_cancel() again
perf: Fix event leak upon exit
perf: Fix event leak upon exec and file release
Friedrich Vock (1):
drm/amdgpu: Check if NBIO funcs are NULL in amdgpu_device_baco_exit
Gaosheng Cui (2):
nvmet-auth: fix nvmet_auth hash error handling
gss_krb5: Fix the error handling path for crypto_sync_skcipher_setkey
Geert Uytterhoeven (16):
arm64: dts: renesas: r8a779g0: Add L3 cache controller
arm64: dts: renesas: r8a779g0: Add secondary CA76 CPU cores
arm64: dts: renesas: r8a779a0: Add missing hypervisor virtual timer IRQ
arm64: dts: renesas: r8a779f0: Add missing hypervisor virtual timer IRQ
arm64: dts: renesas: r8a779g0: Add missing hypervisor virtual timer IRQ
arm64: dts: renesas: r9a07g043u: Add missing hypervisor virtual timer IRQ
arm64: dts: renesas: r9a07g044: Add missing hypervisor virtual timer IRQ
arm64: dts: renesas: r9a07g054: Add missing hypervisor virtual timer IRQ
pinctrl: renesas: r8a779g0: Fix CANFD5 suffix
pinctrl: renesas: r8a779g0: Fix FXR_TXEN[AB] suffixes
pinctrl: renesas: r8a779g0: Fix (H)SCIF1 suffixes
pinctrl: renesas: r8a779g0: Fix (H)SCIF3 suffixes
pinctrl: renesas: r8a779g0: Fix IRQ suffixes
pinctrl: renesas: r8a779g0: FIX PWM suffixes
pinctrl: renesas: r8a779g0: Fix TCLK suffixes
pinctrl: renesas: r8a779g0: Fix TPU suffixes
Geliang Tang (4):
selftests/bpf: Fix prog numbers in test_sockmap
selftests/bpf: Check length of recv in test_sockmap
selftests/bpf: Close fd in error path in drop_on_reuseport
selftests/bpf: Close obj in error path in xdp_adjust_tail
Gerd Bayer (2):
s390/pci: Refactor arch_setup_msi_irqs()
s390/pci: Allow allocation of more than 1 MSI interrupt
Greg Kroah-Hartman (1):
Linux 6.1.103
Gregory CLEMENT (1):
MIPS: SMP-CPS: Fix address for GCR_ACCESS register for CM3 and later
Guangguan Wang (1):
net/smc: set rmb's SG_MAX_SINGLE_ALLOC limitation only when CONFIG_ARCH_NO_SG_CHAIN is defined
Guenter Roeck (2):
hwmon: (max6697) Fix underflow when writing limit attributes
hwmon: (max6697) Fix swapped temp{1,8} critical alarms
Gwenael Treuveur (1):
remoteproc: stm32_rproc: Fix mailbox interrupts queuing
Hagar Hemdan (1):
net: esp: cleanup esp_output_tail_tcp() in case of unsupported ESPINTCP
Hans de Goede (1):
leds: trigger: Unregister sysfs attributes before calling deactivate()
Hilda Wu (1):
Bluetooth: btusb: Add RTL8852BE device 0489:e125 to device tables
Honggang LI (1):
RDMA/rxe: Don't set BTH_ACK_MASK for UC or UD QPs
Hou Tao (1):
bpf, events: Use prog to emit ksymbol event for main program
Hsiao Chien Sung (2):
drm/mediatek: Add missing plane settings when async update
drm/mediatek: Add OVL compatible name for MT8195
Huacai Chen (2):
PCI: loongson: Enable MSI in LS7A Root Complex
fs/ntfs3: Update log->page_{mask,bits} if log->page_size changed
Ido Schimmel (6):
lib: objagg: Fix general protection fault
mlxsw: spectrum_acl_erp: Fix object nesting warning
mlxsw: spectrum_acl: Fix ACL scale regression and firmware errors
ipv4: Fix incorrect TOS in route get reply
ipv4: Fix incorrect TOS in fibmatch route get reply
ipv4: Fix incorrect source address in Record Route option
Igor Pylypiv (1):
ata: libata-scsi: Honor the D_SENSE bit for CK_COND=1 and no error
Ilpo Järvinen (7):
x86/of: Return consistent error type from x86_of_pci_irq_enable()
x86/pci/intel_mid_pci: Fix PCIBIOS_* return code handling
x86/pci/xen: Fix PCIBIOS_* return code handling
x86/platform/iosf_mbi: Convert PCIBIOS_* return codes to errnos
PCI: Fix resource double counting on remove & rescan
leds: ss4200: Convert PCIBIOS_* return codes to errnos
hwrng: amd - Convert PCIBIOS_* return codes to errnos
Ilya Dryomov (3):
rbd: don't assume rbd_is_lock_owner() for exclusive mappings
rbd: rename RBD_LOCK_STATE_RELEASING and releasing_wait
rbd: don't assume RBD_LOCK_STATE_LOCKED for exclusive mappings
Imre Deak (1):
drm/i915/dp: Reset intel_dp->link_trained before retraining the link
Ira Weiny (1):
PCI: Introduce cleanup helpers for device reference counts and locks
Ismael Luceno (1):
ipvs: Avoid unnecessary calls to skb_is_gso_sctp
Ivan Babrou (1):
bpftool: Un-const bpf_func_info to fix it for llvm 17 and newer
Jack Wang (1):
bnxt_re: Fix imm_data endianness
Jacopo Mondi (3):
media: rcar-vin: Fix YUYV8_1X16 handling for CSI-2
media: rcar-csi2: Disable runtime_pm in probe error
media: rcar-csi2: Cleanup subdevice in remove()
James Clark (3):
perf tests: Fix test_arm_callgraph_fp variable expansion
perf test: Make test_arm_callgraph_fp.sh more robust
coresight: Fix ref leak when of_coresight_parse_endpoint() fails
Jan Kara (4):
ext4: avoid writing unitialized memory to disk in EA inodes
ext2: Verify bitmap and itable block numbers before using them
udf: Avoid using corrupted block bitmap buffer
jbd2: make jbd2_journal_get_max_txn_bufs() internal
Jann Horn (1):
landlock: Don't lose track of restrictions on cred_transfer
Javier Carrasco (2):
mfd: omap-usb-tll: Use struct_size to allocate tll
leds: mt6360: Fix memory leak in mt6360_init_isnk_properties()
Javier Martinez Canillas (1):
drm/mipi-dsi: Fix mipi_dsi_dcs_write_seq() macro definition format
Jay Buddhabhatti (2):
soc: xilinx: rename cpu_number1 to dummy_cpu_number
drivers: soc: xilinx: check return status of get_api_version()
Jeongjun Park (1):
jfs: Fix array-index-out-of-bounds in diFree
Jerome Brunet (2):
arm64: dts: amlogic: sm1: fix spdif compatibles
arm64: dts: amlogic: gx: correct hdmi clocks
Jiaxun Yang (8):
platform: mips: cpu_hwmon: Disable driver on unsupported hardware
MIPS: dts: loongson: Add ISA node
MIPS: ip30: ip30-console: Add missing include
MIPS: dts: loongson: Fix GMAC phy node
MIPS: Loongson64: env: Hook up Loongsson-2K
MIPS: Loongson64: Remove memory node for builtin-dtb
MIPS: Loongson64: reset: Prioritise firmware service
MIPS: Loongson64: Test register availability before use
Jinyoung Choi (1):
block: cleanup bio_integrity_prep
Jiri Olsa (1):
bpf: Synchronize dispatcher update with bpf_dispatcher_xdp_func
Joe Hattori (1):
char: tpm: Fix possible memory leak in tpm_bios_measurements_open()
Johannes Berg (6):
wifi: virt_wifi: don't use strlen() in const context
wifi: mac80211: track capability/opmode NSS separately
wifi: mac80211: check basic rates validity
um: time-travel: fix time-travel-start option
um: time-travel: fix signal blocking race/hang
net: bonding: correctly annotate RCU in bond_should_notify_peers()
John David Anglin (1):
parisc: Fix warning at drivers/pci/msi/msi.h:121
John Stultz (1):
locking/rwsem: Add __always_inline annotation to __down_write_common() and inlined callers
Jon Pan-Doh (1):
iommu/vt-d: Fix identity map bounds in si_domain_init()
Jonas Karlman (5):
arm64: dts: rockchip: Add sdmmc related properties on rk3308-rock-pi-s
arm64: dts: rockchip: Add pinctrl for UART0 to rk3308-rock-pi-s
arm64: dts: rockchip: Add mdio and ethernet-phy nodes to rk3308-rock-pi-s
arm64: dts: rockchip: Update WIFi/BT related nodes on rk3308-rock-pi-s
arm64: dts: rockchip: Increase VOP clk rate on RK3328
Jonathan Marek (1):
drm/msm/dsi: set VIDEO_COMPRESSION_MODE_CTRL_WC
Joy Chakraborty (2):
rtc: cmos: Fix return value of nvmem callbacks
rtc: isl1208: Fix return value of nvmem callbacks
Junxian Huang (2):
RDMA/hns: Check atomic wr length
RDMA/hns: Fix unmatch exception handling when init eq table fails
Kan Liang (1):
perf/x86/intel/uncore: Fix the bits of the CHA extended umask for SPR
Kees Cook (1):
kernfs: Convert kernfs_path_from_node_locked() from strlcpy() to strscpy()
Kemeng Shi (2):
sbitmap: remove unnecessary calculation of alloc_hint in __sbitmap_get_shallow
sbitmap: rewrite sbitmap_find_bit_in_index to reduce repeat code
Konrad Dybcio (2):
clk: qcom: branch: Add helper functions for setting retain bits
interconnect: qcom: qcm2290: Fix mas_snoc_bimc RPM master ID
Konstantin Komarov (10):
fs/ntfs3: Use ALIGN kernel macro
fs/ntfs3: Merge synonym COMPRESSION_UNIT and NTFS_LZNT_CUNIT
fs/ntfs3: Fix transform resident to nonresident for compressed files
fs/ntfs3: Missed NI_FLAG_UPDATE_PARENT setting
fs/ntfs3: Fix getting file type
fs/ntfs3: Add missing .dirty_folio in address_space_operations
fs/ntfs3: Replace inode_trylock with inode_lock
fs/ntfs3: Fix field-spanning write in INDEX_HDR
fs/ntfs3: Missed error return
fs/ntfs3: Keep runs for $MFT::$ATTR_DATA and $MFT::$ATTR_BITMAP
Krzysztof Kozlowski (2):
dt-bindings: thermal: correct thermal zone node name limit
spi: spidev: order compatibles alphabetically
Lad Prabhakar (1):
arm64: dts: renesas: Drop specifying the GIC_CPU_MASK_SIMPLE() for GICv3 systems
Lance Richardson (1):
dma: fix call order in dmam_free_coherent
Laurent Pinchart (2):
media: renesas: vsp1: Fix _irqsave and _irq mix
media: renesas: vsp1: Store RPF partition configuration per RPF instance
Leon Romanovsky (5):
RDMA/cache: Release GID table even if leak is detected
RDMA/mlx4: Fix truncated output warning in mad.c
RDMA/mlx4: Fix truncated output warning in alias_GUID.c
RDMA/device: Return error earlier if port in not valid
nvme-pci: add missing condition check for existence of mapped data
Li Nan (1):
md: fix deadlock between mddev_suspend and flush bio
Lijo Lazar (1):
drm/amd/pm: Fix aldebaran pcie speed reporting
Liwei Song (1):
tools/resolve_btfids: Fix comparison of distinct pointer types warning in resolve_btfids
Lorenzo Bianconi (1):
clk: en7523: fix rate divider for slic and spi clocks
Luca Ceresoli (1):
Revert "leds: led-core: Fix refcount leak in of_led_get()"
Luca Weiss (1):
arm64: dts: qcom: sm6350: Add missing qcom,non-secure-domain property
Lucas Stach (2):
drm/etnaviv: fix DMA direction handling for cached RW buffers
drm/etnaviv: don't block scheduler when GPU is still active
Luis Henriques (SUSE) (2):
ext4: fix infinite loop when replaying fast_commit
ext4: don't track ranges in fast_commit if inode has inlined data
Lukas Wunner (1):
PCI/DPC: Fix use-after-free on concurrent DPC and hot-removal
Ma Ke (3):
drm/gma500: fix null pointer dereference in cdv_intel_lvds_get_modes
drm/gma500: fix null pointer dereference in psb_intel_lvds_get_modes
phy: cadence-torrent: Check return value on register read
Manish Rangankar (1):
scsi: qla2xxx: During vport delete send async logout explicitly
Manivannan Sadhasivam (2):
PCI: qcom-ep: Disable resources unconditionally during PERST# assert
PCI: rockchip: Use GPIOD_OUT_LOW flag while requesting ep_gpio
Marc Gonzalez (1):
arm64: dts: qcom: msm8998: enable adreno_smmu by default
Marco Cavenati (1):
perf/x86/intel/pt: Fix topa_entry base length
Marek Behún (3):
firmware: turris-mox-rwtm: Do not complete if there are no waiters
firmware: turris-mox-rwtm: Fix checking return value of wait_for_completion_timeout()
firmware: turris-mox-rwtm: Initialize completion before mailbox
Marek Vasut (1):
PCI: rcar: Demote WARN() to dev_warn_ratelimited() in rcar_pcie_wakeup()
Markus Elfring (1):
auxdisplay: ht16k33: Drop reference after LED registration
Martin Willi (2):
net: dsa: mv88e6xxx: Limit chip-wide frame size config to CPU ports
net: dsa: b53: Limit chip-wide jumbo frame config to CPU ports
Masahiro Yamada (1):
kbuild: avoid build error when single DTB is turned into composite DTB
Matthew Wilcox (Oracle) (2):
s390/mm: Convert make_page_secure to use a folio
s390/mm: Convert gmap_make_secure to use a folio
Miaohe Lin (1):
mm/hugetlb: fix possible recursive locking detected warning
Michael Ellerman (2):
powerpc/xmon: Fix disassembly CPU feature checks
selftests/sigaltstack: Fix ppc64 GCC build
Michael S. Tsirkin (1):
vhost/vsock: always initialize seqpacket_allow
Michael Walle (5):
ARM: dts: imx6qdl-kontron-samx6i: fix phy-mode
ARM: dts: imx6qdl-kontron-samx6i: fix PHY reset
ARM: dts: imx6qdl-kontron-samx6i: fix board reset
ARM: dts: imx6qdl-kontron-samx6i: fix SPI0 chip selects
ARM: dts: imx6qdl-kontron-samx6i: fix PCIe reset polarity
Michal Luczaj (1):
af_unix: Disable MSG_OOB handling for sockets in sockmap/sockhash
Mickaël Salaün (1):
selftests/landlock: Add cred_transfer test
Mikhail Kobuk (1):
media: pci: ivtv: Add check for DMA map result
Naga Sureshkumar Relli (1):
spi: microchip-core: fix the issues in the isr
Namhyung Kim (2):
perf test: Replace arm callgraph fp test workload with leafloop
perf report: Fix condition in sort__sym_cmp()
Nathan Chancellor (1):
kbuild: Fix '-S -c' in x86 stack protector scripts
Nathan Lynch (1):
powerpc/prom: Add CPU info to hardware description string later
Nayna Jain (1):
powerpc/pseries: Expose PLPKS config values, support additional fields
NeilBrown (1):
SUNRPC: avoid soft lockup when transmitting UDP to reachable server.
Nick Bowler (1):
macintosh/therm_windtunnel: fix module unload.
Nicolas Dichtel (2):
ipv4: fix source address selection with route leak
ipv6: take care of scope when choosing the src addr
Niklas Cassel (1):
PCI: dw-rockchip: Fix initial PERST# GPIO value
Nilesh Javali (1):
scsi: qla2xxx: validate nvme_local_port correctly
Nitesh Shetty (1):
block: refactor to use helper
Nitin Gote (1):
drm/i915/gt: Do not consider preemption during execlists_dequeue for gen8
Nivas Varadharajan Mugunthakumar (1):
crypto: qat - extend scope of lock in adf_cfg_add_key_value_param()
Olga Kornievskaia (1):
NFSv4.1 another fix for EXCHGID4_FLAG_USE_PNFS_DS for DS server
Or Har-Toov (1):
RDMA/mlx5: Use sq timestamp as QP timestamp when RoCE is disabled
Pablo Neira Ayuso (3):
netfilter: nf_tables: rise cap on SELinux secmark context
netfilter: ctnetlink: use helper function to calculate expect ID
net: flow_dissector: use DEBUG_NET_WARN_ON_ONCE
Paolo Pisati (1):
m68k: amiga: Turn off Warp1260 interrupts during boot
Pavel Begunkov (4):
kernel: rerun task_work while freezing in get_signal()
io_uring: tighten task exit cancellations
io_uring/io-wq: limit retrying worker initialisation
io_uring: fix io_match_task must_hold
Peng Fan (1):
pinctrl: freescale: mxs: Fix refcount of child
Petr Machata (1):
net: nexthop: Initialize all fields in dumped nexthops
Pierre Gondois (1):
sched/fair: Use all little CPUs for CPU-bound workloads
Pierre-Louis Bossart (1):
ASoC: Intel: use soc_intel_is_byt_cr() only when IOSF_MBI is reachable
Prajna Rajendra Kumar (1):
spi: spi-microchip-core: Fix the number of chip selects supported
Primoz Fiser (2):
cpufreq: ti-cpufreq: Handle deferred probe with dev_err_probe()
OPP: ti: Fix ti_opp_supply_probe wrong return values
Quinn Tran (3):
scsi: qla2xxx: Unable to act on RSCN for port online
scsi: qla2xxx: Use QP lock to search for bsg
scsi: qla2xxx: Fix flash read failure
Rafael Beims (1):
wifi: mwifiex: Fix interface type change
Rafał Miłecki (1):
arm64: dts: mediatek: mt7622: fix "emmc" pinctrl mux
Rameshkumar Sundaram (1):
wifi: mac80211: Allow NSS change only up to capability
Randy Dunlap (1):
kernfs: fix all kernel-doc warnings and multiple typos
Ricardo Ribalda (2):
media: imon: Fix race getting ictx->lock
media: uvcvideo: Fix integer overflow calculating timestamp
Ross Lagerwall (1):
decompress_bunzip2: fix rare decompression failure
Russell Currey (3):
powerpc/pseries: Move plpks.h to include directory
powerpc/pseries: Add helper to get PLPKS password length
powerpc/pseries: Avoid hcall in plpks_is_available() on non-pseries
Ryusuke Konishi (2):
nilfs2: avoid undefined behavior in nilfs_cnt32_ge macro
nilfs2: handle inconsistent state in nilfs_btnode_create_block()
Samasth Norway Ananda (1):
wifi: brcmsmac: LCN PHY code is used for BCM4313 2G-only device
Saurav Kashyap (1):
scsi: qla2xxx: Return ENOBUFS if sg_cnt is more than one for ELS cmds
Sean Christopherson (2):
KVM: VMX: Split out the non-virtualization part of vmx_interrupt_blocked()
KVM: nVMX: Request immediate exit iff pending nested event needs injection
Seth Forshee (DigitalOcean) (1):
fs: don't allow non-init s_user_ns for filesystems without FS_USERNS_MOUNT
Sheng Yong (1):
f2fs: fix start segno of large section
Shenwei Wang (1):
irqchip/imx-irqsteer: Handle runtime power management correctly
Shigeru Yoshida (1):
tipc: Return non-zero value from tipc_udp_addr2str() on error
Shreyas Deodhar (3):
scsi: qla2xxx: Fix optrom version displayed in FDMI
scsi: qla2xxx: Fix for possible memory corruption
scsi: qla2xxx: Complete command early within lock
Siddharth Vadapalli (2):
PCI: keystone: Relocate ks_pcie_set/clear_dbi_mode()
PCI: keystone: Don't enable BAR 0 for AM654x
Simon Horman (1):
net: stmmac: Correct byte order of perfect_match
Sourabh Jain (2):
powerpc/kexec: make the update_cpus_node() function public
powerpc/kexec_file: fix cpus node update to FDT
Spoorthy S (1):
perf tests arm_callgraph_fp: Address shellcheck warnings about signal names and adding double quotes for expression
Stephen Boyd (2):
soc: qcom: rpmh-rsc: Ensure irqs aren't disabled by rpmh_rsc_send_data() callers
clk: qcom: Park shared RCGs upon registration
Steve French (3):
cifs: fix potential null pointer use in destroy_workqueue in init_cifs error path
cifs: fix reconnect with SMB1 UNIX Extensions
cifs: mount with "unix" mount option for SMB1 incorrectly handled
Steve Wilkins (2):
spi: microchip-core: only disable SPI controller when register value change requires it
spi: microchip-core: fix init function not setting the master and motorola modes
Sung Joon Kim (1):
drm/amd/display: Check for NULL pointer
Taehee Yoo (1):
xdp: fix invalid wait context of page_pool_destroy()
Takashi Iwai (2):
ALSA: usb-audio: Move HD Webcam quirk to the right place
ASoC: amd: yc: Support mic on Lenovo Thinkpad E16 Gen 2
Taniya Das (3):
clk: qcom: gcc-sc7280: Update force mem core bit for UFS ICE clock
clk: qcom: camcc-sc7280: Add parent dependency to all camera GDSCs
clk: qcom: gpucc-sm8350: Park RCG's clk source at XO during disable
Tao Chen (1):
bpftool: Mount bpffs when pinmaps path not under the bpffs
Tejun Heo (1):
sched/fair: set_load_weight() must also call reweight_task() for SCHED_IDLE tasks
Tengda Wu (1):
bpf: Fix null pointer dereference in resolve_prog_type() for BPF_PROG_TYPE_EXT
Tetsuo Handa (1):
mm: mmap_lock: replace get_memcg_path_buf() with on-stack buffer
Thomas Gleixner (3):
perf/x86: Serialize set_attr_rdpmc()
jump_label: Fix concurrency issues in static_key_slow_dec()
watchdog/perf: properly initialize the turbo mode timestamp and rearm counter
Thorsten Blum (1):
m68k: cmpxchg: Fix return value for default case in __arch_xchg()
Tim Van Patten (1):
drm/amdgpu: Remove GC HW IP 9.3.0 from noretry=1
Tvrtko Ursulin (1):
mm/numa_balancing: teach mpol_to_str about the balancing mode
Tzung-Bi Shih (1):
platform/chrome: cros_ec_debugfs: fix wrong EC message version
Uros Bizjak (1):
jump_label: Use atomic_try_cmpxchg() in static_key_slow_inc_cpuslocked()
Uwe Kleine-König (6):
pwm: stm32: Always do lazy disabling
pwm: atmel-tcb: Put per-channel data into driver data
pwm: atmel-tcb: Unroll atmel_tcb_pwm_set_polarity() into only caller
pwm: atmel-tcb: Don't track polarity in driver data
pwm: atmel-tcb: Fix race condition and convert to guards
pinctrl: ti: ti-iodelay: Drop if block with always false condition
Vignesh Raghavendra (1):
dmaengine: ti: k3-udma: Fix BCHAN count with UHC and HC channels
Vincent Tremblay (1):
spidev: Add Silicon Labs EM3581 device compatible
WangYuli (1):
Bluetooth: btusb: Add Realtek RTL8852BE support ID 0x13d3:0x3591
Wayne Lin (1):
drm/dp_mst: Fix all mstb marked as not probed after suspend/resume
Wayne Tung (1):
hwmon: (adt7475) Fix default duty on fan is disabled
Wei Liu (1):
PCI: hv: Return zero, not garbage, when reading PCI_INTERRUPT_PIN
Xiao Liang (1):
apparmor: Fix null pointer deref when receiving skb during sock creation
Yanfei Xu (1):
iommu/vt-d: Fix to convert mm pfn to dma pfn
Yang Yang (1):
sbitmap: fix io hung due to race on sbitmap_word::cleared
Yang Yingliang (4):
pinctrl: core: fix possible memory leak when pinctrl_enable() fails
pinctrl: single: fix possible memory leak when pinctrl_enable() fails
pinctrl: ti: ti-iodelay: fix possible memory leak when pinctrl_enable() fails
spi: microchip-core: switch to use modern name
Yao Zi (1):
drm/meson: fix canvas release in bind function
Yu Liao (1):
tick/broadcast: Make takeover of broadcast hrtimer reliable
Yu Zhao (1):
mm/mglru: fix div-by-zero in vmpressure_calc_level()
Zhang Rui (1):
perf/x86/intel/cstate: Fix Alderlake/Raptorlake/Meteorlake
Zheng Yejian (1):
media: dvb-usb: Fix unexpected infinite loop in dvb_usb_read_remote_control()
Zijun Hu (3):
kobject_uevent: Fix OOB access within zap_modalias_env()
devres: Fix devm_krealloc() wasting memory
devres: Fix memory leakage caused by driver API devm_free_percpu()
ethanwu (1):
ceph: fix incorrect kmalloc size of pagevec mempool
levi.yun (1):
trace/pid_list: Change gfp flags in pid_list_fill_irq()
linke li (1):
sbitmap: use READ_ONCE to access map->word
tuhaowen (1):
dev/parport: fix the array out-of-bounds risk
wangdicheng (2):
ALSA: usb-audio: Fix microphone sound on HD webcam.
ALSA: usb-audio: Add a quirk for Sonix HD USB Camera
^ permalink raw reply [flat|nested] 2+ messages in thread
* Re: Linux 6.1.103
2024-08-03 7:05 Linux 6.1.103 Greg Kroah-Hartman
@ 2024-08-03 7:05 ` Greg Kroah-Hartman
0 siblings, 0 replies; 2+ messages in thread
From: Greg Kroah-Hartman @ 2024-08-03 7:05 UTC (permalink / raw)
To: linux-kernel, akpm, torvalds, stable; +Cc: lwn, jslaby, Greg Kroah-Hartman
diff --git a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
index 8d2c6d74b605..bc9ccdfd3a27 100644
--- a/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
+++ b/Documentation/devicetree/bindings/thermal/thermal-zones.yaml
@@ -49,7 +49,10 @@ properties:
to take when the temperature crosses those thresholds.
patternProperties:
- "^[a-zA-Z][a-zA-Z0-9\\-]{1,12}-thermal$":
+ # Node name is limited in size due to Linux kernel requirements - 19
+ # characters in total (see THERMAL_NAME_LENGTH, including terminating NUL
+ # byte):
+ "^[a-zA-Z][a-zA-Z0-9\\-]{1,10}-thermal$":
type: object
description:
Each thermal zone node contains information about how frequently it
diff --git a/Makefile b/Makefile
index 00ec5357bc78..97149e46565a 100644
--- a/Makefile
+++ b/Makefile
@@ -1,7 +1,7 @@
# SPDX-License-Identifier: GPL-2.0
VERSION = 6
PATCHLEVEL = 1
-SUBLEVEL = 102
+SUBLEVEL = 103
EXTRAVERSION =
NAME = Curry Ramen
diff --git a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
index 4d6a0c3e8455..ff062f4fd726 100644
--- a/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/imx6q-kontron-samx6i.dtsi
@@ -5,31 +5,8 @@
#include "imx6q.dtsi"
#include "imx6qdl-kontron-samx6i.dtsi"
-#include <dt-bindings/gpio/gpio.h>
/ {
model = "Kontron SMARC sAMX6i Quad/Dual";
compatible = "kontron,imx6q-samx6i", "fsl,imx6q";
};
-
-/* Quad/Dual SoMs have 3 chip-select signals */
-&ecspi4 {
- cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
- <&gpio3 29 GPIO_ACTIVE_LOW>,
- <&gpio3 25 GPIO_ACTIVE_LOW>;
-};
-
-&pinctrl_ecspi4 {
- fsl,pins = <
- MX6QDL_PAD_EIM_D21__ECSPI4_SCLK 0x100b1
- MX6QDL_PAD_EIM_D28__ECSPI4_MOSI 0x100b1
- MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
-
- /* SPI4_IMX_CS2# - connected to internal flash */
- MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
- /* SPI4_IMX_CS0# - connected to SMARC SPI0_CS0# */
- MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
- /* SPI4_CS3# - connected to SMARC SPI0_CS1# */
- MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
- >;
-};
diff --git a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
index 85aeebc9485d..668d33d1ff0c 100644
--- a/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
+++ b/arch/arm/boot/dts/imx6qdl-kontron-samx6i.dtsi
@@ -244,7 +244,8 @@ &ecspi4 {
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_ecspi4>;
cs-gpios = <&gpio3 24 GPIO_ACTIVE_LOW>,
- <&gpio3 29 GPIO_ACTIVE_LOW>;
+ <&gpio3 29 GPIO_ACTIVE_LOW>,
+ <&gpio3 25 GPIO_ACTIVE_LOW>;
status = "okay";
/* default boot source: workaround #1 for errata ERR006282 */
@@ -259,7 +260,7 @@ smarc_flash: flash@0 {
&fec {
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_enet>;
- phy-mode = "rgmii";
+ phy-connection-type = "rgmii-id";
phy-handle = <ðphy>;
mdio {
@@ -269,7 +270,7 @@ mdio {
ethphy: ethernet-phy@1 {
compatible = "ethernet-phy-ieee802.3-c22";
reg = <1>;
- reset-gpios = <&gpio1 25 GPIO_ACTIVE_LOW>;
+ reset-gpios = <&gpio2 1 GPIO_ACTIVE_LOW>;
reset-assert-us = <1000>;
};
};
@@ -464,6 +465,8 @@ MX6QDL_PAD_EIM_D22__ECSPI4_MISO 0x100b1
MX6QDL_PAD_EIM_D24__GPIO3_IO24 0x1b0b0
/* SPI_IMX_CS0# - connected to SMARC SPI0_CS0# */
MX6QDL_PAD_EIM_D29__GPIO3_IO29 0x1b0b0
+ /* SPI4_CS3# - connected to SMARC SPI0_CS1# */
+ MX6QDL_PAD_EIM_D25__GPIO3_IO25 0x1b0b0
>;
};
@@ -516,7 +519,7 @@ MX6QDL_PAD_RGMII_RX_CTL__RGMII_RX_CTL 0x1b0b0
MX6QDL_PAD_ENET_MDIO__ENET_MDIO 0x1b0b0
MX6QDL_PAD_ENET_MDC__ENET_MDC 0x1b0b0
MX6QDL_PAD_ENET_REF_CLK__ENET_TX_CLK 0x1b0b0
- MX6QDL_PAD_ENET_CRS_DV__GPIO1_IO25 0x1b0b0 /* RST_GBE0_PHY# */
+ MX6QDL_PAD_NANDF_D1__GPIO2_IO01 0x1b0b0 /* RST_GBE0_PHY# */
>;
};
@@ -729,7 +732,7 @@ &pcie {
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_pcie>;
wake-up-gpio = <&gpio6 18 GPIO_ACTIVE_HIGH>;
- reset-gpio = <&gpio3 13 GPIO_ACTIVE_HIGH>;
+ reset-gpio = <&gpio3 13 GPIO_ACTIVE_LOW>;
};
/* LCD_BKLT_PWM */
@@ -817,5 +820,6 @@ &wdog1 {
/* CPLD is feeded by watchdog (hardwired) */
pinctrl-names = "default";
pinctrl-0 = <&pinctrl_wdog1>;
+ fsl,ext-reset-output;
status = "okay";
};
diff --git a/arch/arm/mach-pxa/spitz.c b/arch/arm/mach-pxa/spitz.c
index 937f56bbaf6c..effd28294da0 100644
--- a/arch/arm/mach-pxa/spitz.c
+++ b/arch/arm/mach-pxa/spitz.c
@@ -512,10 +512,8 @@ static struct ads7846_platform_data spitz_ads7846_info = {
static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
.dev_id = "spi2.1",
.table = {
- GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_CONT,
- "BL_CONT", GPIO_ACTIVE_LOW),
- GPIO_LOOKUP("gpio-pxa", SPITZ_GPIO_BACKLIGHT_ON,
- "BL_ON", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.1", 6, "BL_CONT", GPIO_ACTIVE_LOW),
+ GPIO_LOOKUP("sharp-scoop.1", 7, "BL_ON", GPIO_ACTIVE_HIGH),
{ },
},
};
@@ -523,10 +521,8 @@ static struct gpiod_lookup_table spitz_lcdcon_gpio_table = {
static struct gpiod_lookup_table akita_lcdcon_gpio_table = {
.dev_id = "spi2.1",
.table = {
- GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_CONT,
- "BL_CONT", GPIO_ACTIVE_LOW),
- GPIO_LOOKUP("gpio-pxa", AKITA_GPIO_BACKLIGHT_ON,
- "BL_ON", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("i2c-max7310", 3, "BL_ON", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("i2c-max7310", 4, "BL_CONT", GPIO_ACTIVE_LOW),
{ },
},
};
@@ -953,12 +949,9 @@ static inline void spitz_i2c_init(void) {}
static struct gpiod_lookup_table spitz_audio_gpio_table = {
.dev_id = "spitz-audio",
.table = {
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
- "mute-l", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
- "mute-r", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("sharp-scoop.1", SPITZ_GPIO_MIC_BIAS - SPITZ_SCP2_GPIO_BASE,
- "mic", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.1", 8, "mic", GPIO_ACTIVE_HIGH),
{ },
},
};
@@ -966,12 +959,9 @@ static struct gpiod_lookup_table spitz_audio_gpio_table = {
static struct gpiod_lookup_table akita_audio_gpio_table = {
.dev_id = "spitz-audio",
.table = {
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_L - SPITZ_SCP_GPIO_BASE,
- "mute-l", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("sharp-scoop.0", SPITZ_GPIO_MUTE_R - SPITZ_SCP_GPIO_BASE,
- "mute-r", GPIO_ACTIVE_HIGH),
- GPIO_LOOKUP("i2c-max7310", AKITA_GPIO_MIC_BIAS - AKITA_IOEXP_GPIO_BASE,
- "mic", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 3, "mute-l", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("sharp-scoop.0", 4, "mute-r", GPIO_ACTIVE_HIGH),
+ GPIO_LOOKUP("i2c-max7310", 2, "mic", GPIO_ACTIVE_HIGH),
{ },
},
};
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
index 7c029f552a23..256c46771db7 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxbb.dtsi
@@ -311,8 +311,8 @@ &hdmi_tx {
<&reset RESET_HDMI_SYSTEM_RESET>,
<&reset RESET_HDMI_TX>;
reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
- clocks = <&clkc CLKID_HDMI_PCLK>,
- <&clkc CLKID_CLK81>,
+ clocks = <&clkc CLKID_HDMI>,
+ <&clkc CLKID_HDMI_PCLK>,
<&clkc CLKID_GCLK_VENCI_INT0>;
clock-names = "isfr", "iahb", "venci";
};
diff --git a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
index 350022935052..a689bd14ece9 100644
--- a/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-gxl.dtsi
@@ -323,8 +323,8 @@ &hdmi_tx {
<&reset RESET_HDMI_SYSTEM_RESET>,
<&reset RESET_HDMI_TX>;
reset-names = "hdmitx_apb", "hdmitx", "hdmitx_phy";
- clocks = <&clkc CLKID_HDMI_PCLK>,
- <&clkc CLKID_CLK81>,
+ clocks = <&clkc CLKID_HDMI>,
+ <&clkc CLKID_HDMI_PCLK>,
<&clkc CLKID_GCLK_VENCI_INT0>;
clock-names = "isfr", "iahb", "venci";
};
diff --git a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
index 80737731af3f..8bc4ef9d8a61 100644
--- a/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
+++ b/arch/arm64/boot/dts/amlogic/meson-sm1.dtsi
@@ -337,7 +337,7 @@ tdmin_lb: audio-controller@3c0 {
};
spdifin: audio-controller@400 {
- compatible = "amlogic,g12a-spdifin",
+ compatible = "amlogic,sm1-spdifin",
"amlogic,axg-spdifin";
reg = <0x0 0x400 0x0 0x30>;
#sound-dai-cells = <0>;
@@ -351,7 +351,7 @@ spdifin: audio-controller@400 {
};
spdifout_a: audio-controller@480 {
- compatible = "amlogic,g12a-spdifout",
+ compatible = "amlogic,sm1-spdifout",
"amlogic,axg-spdifout";
reg = <0x0 0x480 0x0 0x50>;
#sound-dai-cells = <0>;
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
index b1ddc491d293..9c9431455f85 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-bananapi-bpi-r64.dts
@@ -286,8 +286,8 @@ asm_sel {
/* eMMC is shared pin with parallel NAND */
emmc_pins_default: emmc-pins-default {
mux {
- function = "emmc", "emmc_rst";
- groups = "emmc";
+ function = "emmc";
+ groups = "emmc", "emmc_rst";
};
/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
index 527dcb279ba5..f4bb9c6521c6 100644
--- a/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
+++ b/arch/arm64/boot/dts/mediatek/mt7622-rfb1.dts
@@ -244,8 +244,8 @@ &pio {
/* eMMC is shared pin with parallel NAND */
emmc_pins_default: emmc-pins-default {
mux {
- function = "emmc", "emmc_rst";
- groups = "emmc";
+ function = "emmc";
+ groups = "emmc", "emmc_rst";
};
/* "NDL0","NDL1","NDL2","NDL3","NDL4","NDL5","NDL6","NDL7",
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
index 3d95625f1b0b..d7fc924a9d0e 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui-jacuzzi.dtsi
@@ -168,21 +168,24 @@ anx_bridge: anx7625@58 {
vdd18-supply = <&pp1800_mipibrdg>;
vdd33-supply = <&vddio_mipibrdg>;
- #address-cells = <1>;
- #size-cells = <0>;
- port@0 {
- reg = <0>;
+ ports {
+ #address-cells = <1>;
+ #size-cells = <0>;
- anx7625_in: endpoint {
- remote-endpoint = <&dsi_out>;
+ port@0 {
+ reg = <0>;
+
+ anx7625_in: endpoint {
+ remote-endpoint = <&dsi_out>;
+ };
};
- };
- port@1 {
- reg = <1>;
+ port@1 {
+ reg = <1>;
- anx7625_out: endpoint {
- remote-endpoint = <&panel_in>;
+ anx7625_out: endpoint {
+ remote-endpoint = <&panel_in>;
+ };
};
};
};
diff --git a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
index 1db97d94658b..03ccdbb1c5ed 100644
--- a/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
+++ b/arch/arm64/boot/dts/mediatek/mt8183-kukui.dtsi
@@ -767,7 +767,6 @@ pins-tx {
};
pins-rts {
pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
- output-enable;
};
pins-cts {
pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
@@ -786,7 +785,6 @@ pins-tx {
};
pins-rts {
pinmux = <PINMUX_GPIO47__FUNC_URTS1>;
- output-enable;
};
pins-cts {
pinmux = <PINMUX_GPIO46__FUNC_UCTS1>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
index 77819186086a..de320bebe412 100644
--- a/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996-xiaomi-common.dtsi
@@ -368,7 +368,6 @@ &usb3_dwc3 {
&hsusb_phy1 {
status = "okay";
- extcon = <&typec>;
vdda-pll-supply = <&vreg_l12a_1p8>;
vdda-phy-dpdm-supply = <&vreg_l24a_3p075>;
diff --git a/arch/arm64/boot/dts/qcom/msm8996.dtsi b/arch/arm64/boot/dts/qcom/msm8996.dtsi
index 986a5b5c05e4..3b9a4bf89701 100644
--- a/arch/arm64/boot/dts/qcom/msm8996.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8996.dtsi
@@ -2016,7 +2016,7 @@ ufshc: ufshc@624000 {
<&gcc GCC_UFS_RX_SYMBOL_0_CLK>;
freq-table-hz =
<100000000 200000000>,
- <0 0>,
+ <100000000 200000000>,
<0 0>,
<0 0>,
<0 0>,
diff --git a/arch/arm64/boot/dts/qcom/msm8998.dtsi b/arch/arm64/boot/dts/qcom/msm8998.dtsi
index 7a41250539ff..3d4941dc31d7 100644
--- a/arch/arm64/boot/dts/qcom/msm8998.dtsi
+++ b/arch/arm64/boot/dts/qcom/msm8998.dtsi
@@ -1457,7 +1457,6 @@ adreno_smmu: iommu@5040000 {
* SoC VDDMX RPM Power Domain in the Adreno driver.
*/
power-domains = <&gpucc GPU_GX_GDSC>;
- status = "disabled";
};
gpucc: clock-controller@5065000 {
diff --git a/arch/arm64/boot/dts/qcom/sdm845.dtsi b/arch/arm64/boot/dts/qcom/sdm845.dtsi
index 95c515da9f2e..71644b9b8866 100644
--- a/arch/arm64/boot/dts/qcom/sdm845.dtsi
+++ b/arch/arm64/boot/dts/qcom/sdm845.dtsi
@@ -2537,6 +2537,8 @@ ufs_mem_phy: phy@1d87000 {
clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
status = "disabled";
diff --git a/arch/arm64/boot/dts/qcom/sm6350.dtsi b/arch/arm64/boot/dts/qcom/sm6350.dtsi
index 9da373090593..ba078099b805 100644
--- a/arch/arm64/boot/dts/qcom/sm6350.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm6350.dtsi
@@ -830,6 +830,8 @@ ufs_mem_phy: phy@1d87000 {
clocks = <&gcc GCC_UFS_MEM_CLKREF_CLK>,
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>;
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
@@ -893,6 +895,7 @@ fastrpc {
compatible = "qcom,fastrpc";
qcom,glink-channels = "fastrpcglink-apps-dsp";
label = "adsp";
+ qcom,non-secure-domain;
#address-cells = <1>;
#size-cells = <0>;
@@ -1000,6 +1003,7 @@ fastrpc {
compatible = "qcom,fastrpc";
qcom,glink-channels = "fastrpcglink-apps-dsp";
label = "cdsp";
+ qcom,non-secure-domain;
#address-cells = <1>;
#size-cells = <0>;
diff --git a/arch/arm64/boot/dts/qcom/sm8250.dtsi b/arch/arm64/boot/dts/qcom/sm8250.dtsi
index 3d02adbc0b62..6a2852584405 100644
--- a/arch/arm64/boot/dts/qcom/sm8250.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8250.dtsi
@@ -2125,7 +2125,7 @@ ufs_mem_hc: ufshc@1d84000 {
"jedec,ufs-2.0";
reg = <0 0x01d84000 0 0x3000>;
interrupts = <GIC_SPI 265 IRQ_TYPE_LEVEL_HIGH>;
- phys = <&ufs_mem_phy_lanes>;
+ phys = <&ufs_mem_phy>;
phy-names = "ufsphy";
lanes-per-direction = <2>;
#reset-cells = <1>;
@@ -2169,10 +2169,8 @@ ufs_mem_hc: ufshc@1d84000 {
ufs_mem_phy: phy@1d87000 {
compatible = "qcom,sm8250-qmp-ufs-phy";
- reg = <0 0x01d87000 0 0x1c0>;
- #address-cells = <2>;
- #size-cells = <2>;
- ranges;
+ reg = <0 0x01d87000 0 0x1000>;
+
clock-names = "ref",
"ref_aux";
clocks = <&rpmhcc RPMH_CXO_CLK>,
@@ -2180,16 +2178,12 @@ ufs_mem_phy: phy@1d87000 {
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
- status = "disabled";
- ufs_mem_phy_lanes: phy@1d87400 {
- reg = <0 0x01d87400 0 0x16c>,
- <0 0x01d87600 0 0x200>,
- <0 0x01d87c00 0 0x200>,
- <0 0x01d87800 0 0x16c>,
- <0 0x01d87a00 0 0x200>;
- #phy-cells = <0>;
- };
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
+ #phy-cells = <0>;
+
+ status = "disabled";
};
ipa_virt: interconnect@1e00000 {
diff --git a/arch/arm64/boot/dts/qcom/sm8450.dtsi b/arch/arm64/boot/dts/qcom/sm8450.dtsi
index 128542582b3d..aa0977af9411 100644
--- a/arch/arm64/boot/dts/qcom/sm8450.dtsi
+++ b/arch/arm64/boot/dts/qcom/sm8450.dtsi
@@ -3153,6 +3153,8 @@ ufs_mem_phy: phy@1d87000 {
<&gcc GCC_UFS_PHY_PHY_AUX_CLK>,
<&gcc GCC_UFS_0_CLKREF_EN>;
+ power-domains = <&gcc UFS_PHY_GDSC>;
+
resets = <&ufs_mem_hc 0>;
reset-names = "ufsphy";
status = "disabled";
diff --git a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
index b677ef6705d9..158c99b1a7b7 100644
--- a/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779a0.dtsi
@@ -2209,8 +2209,7 @@ gic: interrupt-controller@f1000000 {
interrupt-controller;
reg = <0x0 0xf1000000 0 0x20000>,
<0x0 0xf1060000 0 0x110000>;
- interrupts = <GIC_PPI 9
- (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_HIGH)>;
+ interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
};
fcpvd0: fcp@fea10000 {
@@ -2857,9 +2856,12 @@ sensor5_crit: sensor5-crit {
timer {
compatible = "arm,armv8-timer";
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+ interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
index 4092c0016035..140c4672ff5b 100644
--- a/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779f0.dtsi
@@ -935,8 +935,7 @@ gic: interrupt-controller@f1000000 {
interrupt-controller;
reg = <0x0 0xf1000000 0 0x20000>,
<0x0 0xf1060000 0 0x110000>;
- interrupts = <GIC_PPI 9
- (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_HIGH)>;
+ interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
};
prr: chipid@fff00044 {
@@ -991,10 +990,13 @@ sensor3_crit: sensor3-crit {
timer {
compatible = "arm,armv8-timer";
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(8) | IRQ_TYPE_LEVEL_LOW)>;
+ interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
ufs30_clk: ufs30-clk {
diff --git a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
index 868d1a3cbdf6..3de3ea0073c3 100644
--- a/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
+++ b/arch/arm64/boot/dts/renesas/r8a779g0.dtsi
@@ -18,12 +18,80 @@ cpus {
#address-cells = <1>;
#size-cells = <0>;
+ cpu-map {
+ cluster0 {
+ core0 {
+ cpu = <&a76_0>;
+ };
+ core1 {
+ cpu = <&a76_1>;
+ };
+ };
+
+ cluster1 {
+ core0 {
+ cpu = <&a76_2>;
+ };
+ core1 {
+ cpu = <&a76_3>;
+ };
+ };
+ };
+
a76_0: cpu@0 {
compatible = "arm,cortex-a76";
reg = <0>;
device_type = "cpu";
power-domains = <&sysc R8A779G0_PD_A1E0D0C0>;
+ next-level-cache = <&L3_CA76_0>;
+ enable-method = "psci";
+ };
+
+ a76_1: cpu@100 {
+ compatible = "arm,cortex-a76";
+ reg = <0x100>;
+ device_type = "cpu";
+ power-domains = <&sysc R8A779G0_PD_A1E0D0C1>;
+ next-level-cache = <&L3_CA76_0>;
+ enable-method = "psci";
+ };
+
+ a76_2: cpu@10000 {
+ compatible = "arm,cortex-a76";
+ reg = <0x10000>;
+ device_type = "cpu";
+ power-domains = <&sysc R8A779G0_PD_A1E0D1C0>;
+ next-level-cache = <&L3_CA76_1>;
+ enable-method = "psci";
};
+
+ a76_3: cpu@10100 {
+ compatible = "arm,cortex-a76";
+ reg = <0x10100>;
+ device_type = "cpu";
+ power-domains = <&sysc R8A779G0_PD_A1E0D1C1>;
+ next-level-cache = <&L3_CA76_1>;
+ enable-method = "psci";
+ };
+
+ L3_CA76_0: cache-controller-0 {
+ compatible = "cache";
+ power-domains = <&sysc R8A779G0_PD_A2E0D0>;
+ cache-unified;
+ cache-level = <3>;
+ };
+
+ L3_CA76_1: cache-controller-1 {
+ compatible = "cache";
+ power-domains = <&sysc R8A779G0_PD_A2E0D1>;
+ cache-unified;
+ cache-level = <3>;
+ };
+ };
+
+ psci {
+ compatible = "arm,psci-1.0", "arm,psci-0.2";
+ method = "smc";
};
extal_clk: extal {
@@ -482,8 +550,7 @@ gic: interrupt-controller@f1000000 {
interrupt-controller;
reg = <0x0 0xf1000000 0 0x20000>,
<0x0 0xf1060000 0 0x110000>;
- interrupts = <GIC_PPI 9
- (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_HIGH)>;
+ interrupts = <GIC_PPI 9 IRQ_TYPE_LEVEL_HIGH>;
};
prr: chipid@fff00044 {
@@ -494,9 +561,12 @@ prr: chipid@fff00044 {
timer {
compatible = "arm,armv8-timer";
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+ interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
index 011d4c88f4ed..2e7db48462e1 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g043u.dtsi
@@ -41,10 +41,13 @@ psci {
timer {
compatible = "arm,armv8-timer";
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
+ interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
index d26488b5a82d..4703fbc9a8e0 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044.dtsi
@@ -1091,9 +1091,12 @@ target: trip-point {
timer {
compatible = "arm,armv8-timer";
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>;
+ interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
index 1d57df706939..56a979e82c4f 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044c1.dtsi
@@ -15,13 +15,6 @@ cpus {
/delete-node/ cpu-map;
/delete-node/ cpu@100;
};
-
- timer {
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
- };
};
&soc {
diff --git a/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
index 9d89d4590358..9cf27ca9f1d2 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g044l1.dtsi
@@ -15,11 +15,4 @@ cpus {
/delete-node/ cpu-map;
/delete-node/ cpu@100;
};
-
- timer {
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
- };
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
index b3d37ca942ee..60a20a3ca12e 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054.dtsi
@@ -1097,9 +1097,12 @@ target: trip-point {
timer {
compatible = "arm,armv8-timer";
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(2) | IRQ_TYPE_LEVEL_LOW)>;
+ interrupts-extended = <&gic GIC_PPI 13 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 14 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 11 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 10 IRQ_TYPE_LEVEL_LOW>,
+ <&gic GIC_PPI 12 IRQ_TYPE_LEVEL_LOW>;
+ interrupt-names = "sec-phys", "phys", "virt", "hyp-phys",
+ "hyp-virt";
};
};
diff --git a/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi b/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
index c448cc6634c1..d85a6ac0f024 100644
--- a/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
+++ b/arch/arm64/boot/dts/renesas/r9a07g054l1.dtsi
@@ -15,11 +15,4 @@ cpus {
/delete-node/ cpu-map;
/delete-node/ cpu@100;
};
-
- timer {
- interrupts-extended = <&gic GIC_PPI 13 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 14 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 11 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>,
- <&gic GIC_PPI 10 (GIC_CPU_MASK_SIMPLE(1) | IRQ_TYPE_LEVEL_LOW)>;
- };
};
diff --git a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
index edc8d2e3980d..bc9e98fe0f01 100644
--- a/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3308-rock-pi-s.dts
@@ -17,6 +17,7 @@ aliases {
ethernet0 = &gmac;
mmc0 = &emmc;
mmc1 = &sdmmc;
+ mmc2 = &sdio;
};
chosen {
@@ -145,11 +146,25 @@ &emmc {
&gmac {
clock_in_out = "output";
+ phy-handle = <&rtl8201f>;
phy-supply = <&vcc_io>;
- snps,reset-gpio = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
- snps,reset-active-low;
- snps,reset-delays-us = <0 50000 50000>;
status = "okay";
+
+ mdio {
+ compatible = "snps,dwmac-mdio";
+ #address-cells = <1>;
+ #size-cells = <0>;
+
+ rtl8201f: ethernet-phy@1 {
+ compatible = "ethernet-phy-ieee802.3-c22";
+ reg = <1>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&mac_rst>;
+ reset-assert-us = <20000>;
+ reset-deassert-us = <50000>;
+ reset-gpios = <&gpio0 RK_PA7 GPIO_ACTIVE_LOW>;
+ };
+ };
};
&i2c1 {
@@ -160,6 +175,26 @@ &pinctrl {
pinctrl-names = "default";
pinctrl-0 = <&rtc_32k>;
+ bluetooth {
+ bt_reg_on: bt-reg-on {
+ rockchip,pins = <4 RK_PB3 RK_FUNC_GPIO &pcfg_pull_none>;
+ };
+
+ bt_wake_host: bt-wake-host {
+ rockchip,pins = <4 RK_PB4 RK_FUNC_GPIO &pcfg_pull_down>;
+ };
+
+ host_wake_bt: host-wake-bt {
+ rockchip,pins = <4 RK_PB2 RK_FUNC_GPIO &pcfg_pull_none>;
+ };
+ };
+
+ gmac {
+ mac_rst: mac-rst {
+ rockchip,pins = <0 RK_PA7 RK_FUNC_GPIO &pcfg_pull_none>;
+ };
+ };
+
leds {
green_led: green-led {
rockchip,pins = <0 RK_PA6 RK_FUNC_GPIO &pcfg_pull_none>;
@@ -203,15 +238,31 @@ &sdio {
cap-sd-highspeed;
cap-sdio-irq;
keep-power-in-suspend;
- max-frequency = <1000000>;
+ max-frequency = <100000000>;
mmc-pwrseq = <&sdio_pwrseq>;
+ no-mmc;
+ no-sd;
non-removable;
- sd-uhs-sdr104;
+ sd-uhs-sdr50;
+ vmmc-supply = <&vcc_io>;
+ vqmmc-supply = <&vcc_1v8>;
status = "okay";
+
+ rtl8723ds: wifi@1 {
+ reg = <1>;
+ interrupt-parent = <&gpio0>;
+ interrupts = <RK_PA0 IRQ_TYPE_LEVEL_HIGH>;
+ interrupt-names = "host-wake";
+ pinctrl-names = "default";
+ pinctrl-0 = <&wifi_host_wake>;
+ };
};
&sdmmc {
+ cap-mmc-highspeed;
cap-sd-highspeed;
+ disable-wp;
+ vmmc-supply = <&vcc_io>;
status = "okay";
};
@@ -230,16 +281,22 @@ u2phy_otg: otg-port {
};
&uart0 {
+ pinctrl-names = "default";
+ pinctrl-0 = <&uart0_xfer>;
status = "okay";
};
&uart4 {
+ uart-has-rtscts;
status = "okay";
bluetooth {
- compatible = "realtek,rtl8723bs-bt";
- device-wake-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
+ compatible = "realtek,rtl8723ds-bt";
+ device-wake-gpios = <&gpio4 RK_PB2 GPIO_ACTIVE_HIGH>;
+ enable-gpios = <&gpio4 RK_PB3 GPIO_ACTIVE_HIGH>;
host-wake-gpios = <&gpio4 RK_PB4 GPIO_ACTIVE_HIGH>;
+ pinctrl-names = "default";
+ pinctrl-0 = <&bt_reg_on &bt_wake_host &host_wake_bt>;
};
};
diff --git a/arch/arm64/boot/dts/rockchip/rk3328.dtsi b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
index d42846efff2f..5adb2fbc2aaf 100644
--- a/arch/arm64/boot/dts/rockchip/rk3328.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk3328.dtsi
@@ -820,8 +820,8 @@ cru: clock-controller@ff440000 {
<0>, <24000000>,
<24000000>, <24000000>,
<15000000>, <15000000>,
- <100000000>, <100000000>,
- <100000000>, <100000000>,
+ <300000000>, <100000000>,
+ <400000000>, <100000000>,
<50000000>, <100000000>,
<100000000>, <100000000>,
<50000000>, <50000000>,
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
index 674792567fa6..4fc8354e069a 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-evb1-v10.dts
@@ -478,7 +478,7 @@ regulator-state-mem {
};
codec {
- mic-in-differential;
+ rockchip,mic-in-differential;
};
};
};
diff --git a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
index bab46db2b18c..478620c78259 100644
--- a/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
+++ b/arch/arm64/boot/dts/rockchip/rk3568-rock-3a.dts
@@ -481,10 +481,6 @@ regulator-state-mem {
};
};
};
-
- codec {
- mic-in-differential;
- };
};
};
diff --git a/arch/arm64/boot/dts/rockchip/rk356x.dtsi b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
index 99ad6fc51b58..e5c88f000725 100644
--- a/arch/arm64/boot/dts/rockchip/rk356x.dtsi
+++ b/arch/arm64/boot/dts/rockchip/rk356x.dtsi
@@ -737,6 +737,7 @@ vop_mmu: iommu@fe043e00 {
clocks = <&cru ACLK_VOP>, <&cru HCLK_VOP>;
clock-names = "aclk", "iface";
#iommu-cells = <0>;
+ power-domains = <&power RK3568_PD_VO>;
status = "disabled";
};
diff --git a/arch/m68k/amiga/config.c b/arch/m68k/amiga/config.c
index 3137b45750df..b7cb28f5ee29 100644
--- a/arch/m68k/amiga/config.c
+++ b/arch/m68k/amiga/config.c
@@ -180,6 +180,15 @@ int __init amiga_parse_bootinfo(const struct bi_record *record)
dev->slotsize = be16_to_cpu(cd->cd_SlotSize);
dev->boardaddr = be32_to_cpu(cd->cd_BoardAddr);
dev->boardsize = be32_to_cpu(cd->cd_BoardSize);
+
+ /* CS-LAB Warp 1260 workaround */
+ if (be16_to_cpu(dev->rom.er_Manufacturer) == ZORRO_MANUF(ZORRO_PROD_CSLAB_WARP_1260) &&
+ dev->rom.er_Product == ZORRO_PROD(ZORRO_PROD_CSLAB_WARP_1260)) {
+
+ /* turn off all interrupts */
+ pr_info("Warp 1260 card detected: applying interrupt storm workaround\n");
+ *(uint32_t *)(dev->boardaddr + 0x1000) = 0xfff;
+ }
} else
pr_warn("amiga_parse_bootinfo: too many AutoConfig devices\n");
#endif /* CONFIG_ZORRO */
diff --git a/arch/m68k/atari/ataints.c b/arch/m68k/atari/ataints.c
index 56f02ea2c248..715d1e0d973e 100644
--- a/arch/m68k/atari/ataints.c
+++ b/arch/m68k/atari/ataints.c
@@ -302,11 +302,7 @@ void __init atari_init_IRQ(void)
if (ATARIHW_PRESENT(SCU)) {
/* init the SCU if present */
- tt_scu.sys_mask = 0x10; /* enable VBL (for the cursor) and
- * disable HSYNC interrupts (who
- * needs them?) MFP and SCC are
- * enabled in VME mask
- */
+ tt_scu.sys_mask = 0x0; /* disable all interrupts */
tt_scu.vme_mask = 0x60; /* enable MFP and SCC ints */
} else {
/* If no SCU and no Hades, the HSYNC interrupt needs to be
diff --git a/arch/m68k/include/asm/cmpxchg.h b/arch/m68k/include/asm/cmpxchg.h
index 6cf464cdab06..694a44a5c3b0 100644
--- a/arch/m68k/include/asm/cmpxchg.h
+++ b/arch/m68k/include/asm/cmpxchg.h
@@ -32,7 +32,7 @@ static inline unsigned long __xchg(unsigned long x, volatile void * ptr, int siz
x = tmp;
break;
default:
- tmp = __invalid_xchg_size(x, ptr, size);
+ x = __invalid_xchg_size(x, ptr, size);
break;
}
diff --git a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
index c16b521308cb..9089d1e4f3fe 100644
--- a/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
+++ b/arch/mips/boot/dts/loongson/loongson64-2k1000.dtsi
@@ -23,14 +23,6 @@ cpu0: cpu@0 {
};
};
- memory@200000 {
- compatible = "memory";
- device_type = "memory";
- reg = <0x00000000 0x00200000 0x00000000 0x0ee00000>, /* 238 MB at 2 MB */
- <0x00000000 0x20000000 0x00000000 0x1f000000>, /* 496 MB at 512 MB */
- <0x00000001 0x10000000 0x00000001 0xb0000000>; /* 6912 MB at 4352MB */
- };
-
cpu_clk: cpu_clk {
#clock-cells = <0>;
compatible = "fixed-clock";
@@ -52,6 +44,13 @@ package0: bus@10000000 {
0 0x40000000 0 0x40000000 0 0x40000000
0xfe 0x00000000 0xfe 0x00000000 0 0x40000000>;
+ isa@18000000 {
+ compatible = "isa";
+ #size-cells = <1>;
+ #address-cells = <2>;
+ ranges = <1 0x0 0x0 0x18000000 0x4000>;
+ };
+
pm: reset-controller@1fe07000 {
compatible = "loongson,ls2k-pm";
reg = <0 0x1fe07000 0 0x422>;
@@ -130,7 +129,8 @@ gmac@3,0 {
<13 IRQ_TYPE_LEVEL_LOW>;
interrupt-names = "macirq", "eth_lpi";
interrupt-parent = <&liointc0>;
- phy-mode = "rgmii";
+ phy-mode = "rgmii-id";
+ phy-handle = <&phy1>;
mdio {
#address-cells = <1>;
#size-cells = <0>;
@@ -153,7 +153,8 @@ gmac@3,1 {
<15 IRQ_TYPE_LEVEL_LOW>;
interrupt-names = "macirq", "eth_lpi";
interrupt-parent = <&liointc0>;
- phy-mode = "rgmii";
+ phy-mode = "rgmii-id";
+ phy-handle = <&phy1>;
mdio {
#address-cells = <1>;
#size-cells = <0>;
diff --git a/arch/mips/include/asm/mach-loongson64/boot_param.h b/arch/mips/include/asm/mach-loongson64/boot_param.h
index e007edd6b60a..9218b3ae3383 100644
--- a/arch/mips/include/asm/mach-loongson64/boot_param.h
+++ b/arch/mips/include/asm/mach-loongson64/boot_param.h
@@ -42,12 +42,14 @@ enum loongson_cpu_type {
Legacy_1B = 0x5,
Legacy_2G = 0x6,
Legacy_2H = 0x7,
+ Legacy_2K = 0x8,
Loongson_1A = 0x100,
Loongson_1B = 0x101,
Loongson_2E = 0x200,
Loongson_2F = 0x201,
Loongson_2G = 0x202,
Loongson_2H = 0x203,
+ Loongson_2K = 0x204,
Loongson_3A = 0x300,
Loongson_3B = 0x301
};
diff --git a/arch/mips/include/asm/mips-cm.h b/arch/mips/include/asm/mips-cm.h
index 23c67c0871b1..696b40beb774 100644
--- a/arch/mips/include/asm/mips-cm.h
+++ b/arch/mips/include/asm/mips-cm.h
@@ -228,6 +228,10 @@ GCR_ACCESSOR_RO(32, 0x0d0, gic_status)
GCR_ACCESSOR_RO(32, 0x0f0, cpc_status)
#define CM_GCR_CPC_STATUS_EX BIT(0)
+/* GCR_ACCESS - Controls core/IOCU access to GCRs */
+GCR_ACCESSOR_RW(32, 0x120, access_cm3)
+#define CM_GCR_ACCESS_ACCESSEN GENMASK(7, 0)
+
/* GCR_L2_CONFIG - Indicates L2 cache configuration when Config5.L2C=1 */
GCR_ACCESSOR_RW(32, 0x130, l2_config)
#define CM_GCR_L2_CONFIG_BYPASS BIT(20)
diff --git a/arch/mips/kernel/smp-cps.c b/arch/mips/kernel/smp-cps.c
index bcd6a944b839..739997e6fd65 100644
--- a/arch/mips/kernel/smp-cps.c
+++ b/arch/mips/kernel/smp-cps.c
@@ -230,7 +230,10 @@ static void boot_core(unsigned int core, unsigned int vpe_id)
write_gcr_co_reset_ext_base(CM_GCR_Cx_RESET_EXT_BASE_UEB);
/* Ensure the core can access the GCRs */
- set_gcr_access(1 << core);
+ if (mips_cm_revision() < CM_REV_CM3)
+ set_gcr_access(1 << core);
+ else
+ set_gcr_access_cm3(1 << core);
if (mips_cpc_present()) {
/* Reset the core */
diff --git a/arch/mips/loongson64/env.c b/arch/mips/loongson64/env.c
index ef3750a6ffac..09ff05269861 100644
--- a/arch/mips/loongson64/env.c
+++ b/arch/mips/loongson64/env.c
@@ -88,6 +88,12 @@ void __init prom_lefi_init_env(void)
cpu_clock_freq = ecpu->cpu_clock_freq;
loongson_sysconf.cputype = ecpu->cputype;
switch (ecpu->cputype) {
+ case Legacy_2K:
+ case Loongson_2K:
+ smp_group[0] = 0x900000001fe11000;
+ loongson_sysconf.cores_per_node = 2;
+ loongson_sysconf.cores_per_package = 2;
+ break;
case Legacy_3A:
case Loongson_3A:
loongson_sysconf.cores_per_node = 4;
@@ -221,6 +227,8 @@ void __init prom_lefi_init_env(void)
default:
break;
}
+ } else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64R) {
+ loongson_fdt_blob = __dtb_loongson64_2core_2k1000_begin;
} else if ((read_c0_prid() & PRID_IMP_MASK) == PRID_IMP_LOONGSON_64G) {
if (loongson_sysconf.bridgetype == LS7A)
loongson_fdt_blob = __dtb_loongson64g_4core_ls7a_begin;
diff --git a/arch/mips/loongson64/reset.c b/arch/mips/loongson64/reset.c
index e420800043b0..2a8e4cd72605 100644
--- a/arch/mips/loongson64/reset.c
+++ b/arch/mips/loongson64/reset.c
@@ -11,6 +11,7 @@
#include <linux/init.h>
#include <linux/kexec.h>
#include <linux/pm.h>
+#include <linux/reboot.h>
#include <linux/slab.h>
#include <asm/bootinfo.h>
@@ -21,36 +22,21 @@
#include <loongson.h>
#include <boot_param.h>
-static void loongson_restart(char *command)
+static int firmware_restart(struct sys_off_data *unusedd)
{
void (*fw_restart)(void) = (void *)loongson_sysconf.restart_addr;
fw_restart();
- while (1) {
- if (cpu_wait)
- cpu_wait();
- }
+ return NOTIFY_DONE;
}
-static void loongson_poweroff(void)
+static int firmware_poweroff(struct sys_off_data *unused)
{
void (*fw_poweroff)(void) = (void *)loongson_sysconf.poweroff_addr;
fw_poweroff();
- while (1) {
- if (cpu_wait)
- cpu_wait();
- }
-}
-
-static void loongson_halt(void)
-{
- pr_notice("\n\n** You can safely turn off the power now **\n\n");
- while (1) {
- if (cpu_wait)
- cpu_wait();
- }
+ return NOTIFY_DONE;
}
#ifdef CONFIG_KEXEC
@@ -154,9 +140,17 @@ static void loongson_crash_shutdown(struct pt_regs *regs)
static int __init mips_reboot_setup(void)
{
- _machine_restart = loongson_restart;
- _machine_halt = loongson_halt;
- pm_power_off = loongson_poweroff;
+ if (loongson_sysconf.restart_addr) {
+ register_sys_off_handler(SYS_OFF_MODE_RESTART,
+ SYS_OFF_PRIO_FIRMWARE,
+ firmware_restart, NULL);
+ }
+
+ if (loongson_sysconf.poweroff_addr) {
+ register_sys_off_handler(SYS_OFF_MODE_POWER_OFF,
+ SYS_OFF_PRIO_FIRMWARE,
+ firmware_poweroff, NULL);
+ }
#ifdef CONFIG_KEXEC
kexec_argv = kmalloc(KEXEC_ARGV_SIZE, GFP_KERNEL);
diff --git a/arch/mips/loongson64/smp.c b/arch/mips/loongson64/smp.c
index 660e1de4412a..52dc95995783 100644
--- a/arch/mips/loongson64/smp.c
+++ b/arch/mips/loongson64/smp.c
@@ -479,12 +479,25 @@ static void loongson3_smp_finish(void)
static void __init loongson3_smp_setup(void)
{
int i = 0, num = 0; /* i: physical id, num: logical id */
+ int max_cpus = 0;
init_cpu_possible(cpu_none_mask);
+ for (i = 0; i < ARRAY_SIZE(smp_group); i++) {
+ if (!smp_group[i])
+ break;
+ max_cpus += loongson_sysconf.cores_per_node;
+ }
+
+ if (max_cpus < loongson_sysconf.nr_cpus) {
+ pr_err("SMP Groups are less than the number of CPUs\n");
+ loongson_sysconf.nr_cpus = max_cpus ? max_cpus : 1;
+ }
+
/* For unified kernel, NR_CPUS is the maximum possible value,
* loongson_sysconf.nr_cpus is the really present value
*/
+ i = 0;
while (i < loongson_sysconf.nr_cpus) {
if (loongson_sysconf.reserved_cpus_mask & (1<<i)) {
/* Reserved physical CPU cores */
@@ -505,14 +518,14 @@ static void __init loongson3_smp_setup(void)
__cpu_logical_map[num] = -1;
num++;
}
-
csr_ipi_probe();
ipi_set0_regs_init();
ipi_clear0_regs_init();
ipi_status0_regs_init();
ipi_en0_regs_init();
ipi_mailbox_buf_init();
- ipi_write_enable(0);
+ if (smp_group[0])
+ ipi_write_enable(0);
cpu_set_core(&cpu_data[0],
cpu_logical_map(0) % loongson_sysconf.cores_per_package);
@@ -829,6 +842,9 @@ static int loongson3_disable_clock(unsigned int cpu)
uint64_t core_id = cpu_core(&cpu_data[cpu]);
uint64_t package_id = cpu_data[cpu].package;
+ if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+ return 0;
+
if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
LOONGSON_CHIPCFG(package_id) &= ~(1 << (12 + core_id));
} else {
@@ -843,6 +859,9 @@ static int loongson3_enable_clock(unsigned int cpu)
uint64_t core_id = cpu_core(&cpu_data[cpu]);
uint64_t package_id = cpu_data[cpu].package;
+ if (!loongson_chipcfg[package_id] || !loongson_freqctrl[package_id])
+ return 0;
+
if ((read_c0_prid() & PRID_REV_MASK) == PRID_REV_LOONGSON3A_R1) {
LOONGSON_CHIPCFG(package_id) |= 1 << (12 + core_id);
} else {
diff --git a/arch/mips/pci/pcie-octeon.c b/arch/mips/pci/pcie-octeon.c
old mode 100755
new mode 100644
diff --git a/arch/mips/sgi-ip30/ip30-console.c b/arch/mips/sgi-ip30/ip30-console.c
index b91f8c4fdc78..a087b7ebe129 100644
--- a/arch/mips/sgi-ip30/ip30-console.c
+++ b/arch/mips/sgi-ip30/ip30-console.c
@@ -1,6 +1,7 @@
// SPDX-License-Identifier: GPL-2.0
#include <linux/io.h>
+#include <linux/processor.h>
#include <asm/sn/ioc3.h>
diff --git a/arch/parisc/Kconfig b/arch/parisc/Kconfig
index 5762633ea95e..3341d4a42199 100644
--- a/arch/parisc/Kconfig
+++ b/arch/parisc/Kconfig
@@ -75,6 +75,7 @@ config PARISC
select HAVE_SOFTIRQ_ON_OWN_STACK if IRQSTACKS
select TRACE_IRQFLAGS_SUPPORT
select HAVE_FUNCTION_DESCRIPTORS if 64BIT
+ select PCI_MSI_ARCH_FALLBACKS if PCI_MSI
help
The PA-RISC microprocessor is designed by Hewlett-Packard and used
diff --git a/arch/powerpc/configs/85xx-hw.config b/arch/powerpc/configs/85xx-hw.config
index 524db76f47b7..8aff83217397 100644
--- a/arch/powerpc/configs/85xx-hw.config
+++ b/arch/powerpc/configs/85xx-hw.config
@@ -24,6 +24,7 @@ CONFIG_FS_ENET=y
CONFIG_FSL_CORENET_CF=y
CONFIG_FSL_DMA=y
CONFIG_FSL_HV_MANAGER=y
+CONFIG_FSL_IFC=y
CONFIG_FSL_PQ_MDIO=y
CONFIG_FSL_RIO=y
CONFIG_FSL_XGMAC_MDIO=y
@@ -58,6 +59,7 @@ CONFIG_INPUT_FF_MEMLESS=m
CONFIG_MARVELL_PHY=y
CONFIG_MDIO_BUS_MUX_GPIO=y
CONFIG_MDIO_BUS_MUX_MMIOREG=y
+CONFIG_MEMORY=y
CONFIG_MMC_SDHCI_OF_ESDHC=y
CONFIG_MMC_SDHCI_PLTFM=y
CONFIG_MMC_SDHCI=y
diff --git a/arch/powerpc/include/asm/kexec.h b/arch/powerpc/include/asm/kexec.h
index a1ddba01e7d1..f2db1b443920 100644
--- a/arch/powerpc/include/asm/kexec.h
+++ b/arch/powerpc/include/asm/kexec.h
@@ -181,6 +181,10 @@ static inline void crash_send_ipi(void (*crash_ipi_callback)(struct pt_regs *))
#endif /* CONFIG_KEXEC_CORE */
+#if defined(CONFIG_KEXEC_FILE) || defined(CONFIG_CRASH_DUMP)
+int update_cpus_node(void *fdt);
+#endif
+
#ifdef CONFIG_PPC_BOOK3S_64
#include <asm/book3s/64/kexec.h>
#endif
diff --git a/arch/powerpc/include/asm/plpks.h b/arch/powerpc/include/asm/plpks.h
new file mode 100644
index 000000000000..9e2219b0202d
--- /dev/null
+++ b/arch/powerpc/include/asm/plpks.h
@@ -0,0 +1,163 @@
+/* SPDX-License-Identifier: GPL-2.0 */
+/*
+ * Copyright (C) 2022 IBM Corporation
+ * Author: Nayna Jain <nayna@linux.ibm.com>
+ *
+ * Platform keystore for pseries LPAR(PLPKS).
+ */
+
+#ifndef _ASM_POWERPC_PLPKS_H
+#define _ASM_POWERPC_PLPKS_H
+
+#ifdef CONFIG_PSERIES_PLPKS
+
+#include <linux/types.h>
+#include <linux/list.h>
+
+// Object policy flags from supported_policies
+#define PLPKS_OSSECBOOTAUDIT PPC_BIT32(1) // OS secure boot must be audit/enforce
+#define PLPKS_OSSECBOOTENFORCE PPC_BIT32(2) // OS secure boot must be enforce
+#define PLPKS_PWSET PPC_BIT32(3) // No access without password set
+#define PLPKS_WORLDREADABLE PPC_BIT32(4) // Readable without authentication
+#define PLPKS_IMMUTABLE PPC_BIT32(5) // Once written, object cannot be removed
+#define PLPKS_TRANSIENT PPC_BIT32(6) // Object does not persist through reboot
+#define PLPKS_SIGNEDUPDATE PPC_BIT32(7) // Object can only be modified by signed updates
+#define PLPKS_HVPROVISIONED PPC_BIT32(28) // Hypervisor has provisioned this object
+
+// Signature algorithm flags from signed_update_algorithms
+#define PLPKS_ALG_RSA2048 PPC_BIT(0)
+#define PLPKS_ALG_RSA4096 PPC_BIT(1)
+
+// Object label OS metadata flags
+#define PLPKS_VAR_LINUX 0x02
+#define PLPKS_VAR_COMMON 0x04
+
+// Flags for which consumer owns an object is owned by
+#define PLPKS_FW_OWNER 0x1
+#define PLPKS_BOOTLOADER_OWNER 0x2
+#define PLPKS_OS_OWNER 0x3
+
+// Flags for label metadata fields
+#define PLPKS_LABEL_VERSION 0
+#define PLPKS_MAX_LABEL_ATTR_SIZE 16
+#define PLPKS_MAX_NAME_SIZE 239
+#define PLPKS_MAX_DATA_SIZE 4000
+
+// Timeouts for PLPKS operations
+#define PLPKS_MAX_TIMEOUT (5 * USEC_PER_SEC)
+#define PLPKS_FLUSH_SLEEP 10000 // usec
+
+struct plpks_var {
+ char *component;
+ u8 *name;
+ u8 *data;
+ u32 policy;
+ u16 namelen;
+ u16 datalen;
+ u8 os;
+};
+
+struct plpks_var_name {
+ u8 *name;
+ u16 namelen;
+};
+
+struct plpks_var_name_list {
+ u32 varcount;
+ struct plpks_var_name varlist[];
+};
+
+/**
+ * Writes the specified var and its data to PKS.
+ * Any caller of PKS driver should present a valid component type for
+ * their variable.
+ */
+int plpks_write_var(struct plpks_var var);
+
+/**
+ * Removes the specified var and its data from PKS.
+ */
+int plpks_remove_var(char *component, u8 varos,
+ struct plpks_var_name vname);
+
+/**
+ * Returns the data for the specified os variable.
+ */
+int plpks_read_os_var(struct plpks_var *var);
+
+/**
+ * Returns the data for the specified firmware variable.
+ */
+int plpks_read_fw_var(struct plpks_var *var);
+
+/**
+ * Returns the data for the specified bootloader variable.
+ */
+int plpks_read_bootloader_var(struct plpks_var *var);
+
+/**
+ * Returns if PKS is available on this LPAR.
+ */
+bool plpks_is_available(void);
+
+/**
+ * Returns version of the Platform KeyStore.
+ */
+u8 plpks_get_version(void);
+
+/**
+ * Returns hypervisor storage overhead per object, not including the size of
+ * the object or label. Only valid for config version >= 2
+ */
+u16 plpks_get_objoverhead(void);
+
+/**
+ * Returns maximum password size. Must be >= 32 bytes
+ */
+u16 plpks_get_maxpwsize(void);
+
+/**
+ * Returns maximum object size supported by Platform KeyStore.
+ */
+u16 plpks_get_maxobjectsize(void);
+
+/**
+ * Returns maximum object label size supported by Platform KeyStore.
+ */
+u16 plpks_get_maxobjectlabelsize(void);
+
+/**
+ * Returns total size of the configured Platform KeyStore.
+ */
+u32 plpks_get_totalsize(void);
+
+/**
+ * Returns used space from the total size of the Platform KeyStore.
+ */
+u32 plpks_get_usedspace(void);
+
+/**
+ * Returns bitmask of policies supported by the hypervisor.
+ */
+u32 plpks_get_supportedpolicies(void);
+
+/**
+ * Returns maximum byte size of a single object supported by the hypervisor.
+ * Only valid for config version >= 3
+ */
+u32 plpks_get_maxlargeobjectsize(void);
+
+/**
+ * Returns bitmask of signature algorithms supported for signed updates.
+ * Only valid for config version >= 3
+ */
+u64 plpks_get_signedupdatealgorithms(void);
+
+/**
+ * Returns the length of the PLPKS password in bytes.
+ */
+u16 plpks_get_passwordlen(void);
+
+#endif // CONFIG_PSERIES_PLPKS
+
+#endif // _ASM_POWERPC_PLPKS_H
diff --git a/arch/powerpc/kernel/prom.c b/arch/powerpc/kernel/prom.c
index 9531ab90feb8..e5b90d67cd53 100644
--- a/arch/powerpc/kernel/prom.c
+++ b/arch/powerpc/kernel/prom.c
@@ -324,6 +324,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
void *data)
{
const char *type = of_get_flat_dt_prop(node, "device_type", NULL);
+ const __be32 *cpu_version = NULL;
const __be32 *prop;
const __be32 *intserv;
int i, nthreads;
@@ -404,7 +405,7 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
prop = of_get_flat_dt_prop(node, "cpu-version", NULL);
if (prop && (be32_to_cpup(prop) & 0xff000000) == 0x0f000000) {
identify_cpu(0, be32_to_cpup(prop));
- seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(prop));
+ cpu_version = prop;
}
check_cpu_feature_properties(node);
@@ -415,6 +416,12 @@ static int __init early_init_dt_scan_cpus(unsigned long node,
}
identical_pvr_fixup(node);
+
+ // We can now add the CPU name & PVR to the hardware description
+ seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
+ if (cpu_version)
+ seq_buf_printf(&ppc_hw_desc, "0x%04x ", be32_to_cpup(cpu_version));
+
init_mmu_slb_size(node);
#ifdef CONFIG_PPC64
@@ -852,9 +859,6 @@ void __init early_init_devtree(void *params)
dt_cpu_ftrs_scan();
- // We can now add the CPU name & PVR to the hardware description
- seq_buf_printf(&ppc_hw_desc, "%s 0x%04lx ", cur_cpu_spec->cpu_name, mfspr(SPRN_PVR));
-
/* Retrieve CPU related informations from the flat tree
* (altivec support, boot CPU ID, ...)
*/
diff --git a/arch/powerpc/kexec/core_64.c b/arch/powerpc/kexec/core_64.c
index e465e4487737..653b3c8c6a53 100644
--- a/arch/powerpc/kexec/core_64.c
+++ b/arch/powerpc/kexec/core_64.c
@@ -17,6 +17,7 @@
#include <linux/cpu.h>
#include <linux/hardirq.h>
#include <linux/of.h>
+#include <linux/libfdt.h>
#include <asm/page.h>
#include <asm/current.h>
@@ -31,6 +32,7 @@
#include <asm/hw_breakpoint.h>
#include <asm/svm.h>
#include <asm/ultravisor.h>
+#include <asm/crashdump-ppc64.h>
int machine_kexec_prepare(struct kimage *image)
{
@@ -431,3 +433,113 @@ static int __init export_htab_values(void)
}
late_initcall(export_htab_values);
#endif /* CONFIG_PPC_64S_HASH_MMU */
+
+#if defined(CONFIG_KEXEC_FILE) || defined(CONFIG_CRASH_DUMP)
+/**
+ * add_node_props - Reads node properties from device node structure and add
+ * them to fdt.
+ * @fdt: Flattened device tree of the kernel
+ * @node_offset: offset of the node to add a property at
+ * @dn: device node pointer
+ *
+ * Returns 0 on success, negative errno on error.
+ */
+static int add_node_props(void *fdt, int node_offset, const struct device_node *dn)
+{
+ int ret = 0;
+ struct property *pp;
+
+ if (!dn)
+ return -EINVAL;
+
+ for_each_property_of_node(dn, pp) {
+ ret = fdt_setprop(fdt, node_offset, pp->name, pp->value, pp->length);
+ if (ret < 0) {
+ pr_err("Unable to add %s property: %s\n", pp->name, fdt_strerror(ret));
+ return ret;
+ }
+ }
+ return ret;
+}
+
+/**
+ * update_cpus_node - Update cpus node of flattened device tree using of_root
+ * device node.
+ * @fdt: Flattened device tree of the kernel.
+ *
+ * Returns 0 on success, negative errno on error.
+ *
+ * Note: expecting no subnodes under /cpus/<node> with device_type == "cpu".
+ * If this changes, update this function to include them.
+ */
+int update_cpus_node(void *fdt)
+{
+ int prev_node_offset;
+ const char *device_type;
+ const struct fdt_property *prop;
+ struct device_node *cpus_node, *dn;
+ int cpus_offset, cpus_subnode_offset, ret = 0;
+
+ cpus_offset = fdt_path_offset(fdt, "/cpus");
+ if (cpus_offset < 0 && cpus_offset != -FDT_ERR_NOTFOUND) {
+ pr_err("Malformed device tree: error reading /cpus node: %s\n",
+ fdt_strerror(cpus_offset));
+ return cpus_offset;
+ }
+
+ prev_node_offset = cpus_offset;
+ /* Delete sub-nodes of /cpus node with device_type == "cpu" */
+ for (cpus_subnode_offset = fdt_first_subnode(fdt, cpus_offset); cpus_subnode_offset >= 0;) {
+ /* Ignore nodes that do not have a device_type property or device_type != "cpu" */
+ prop = fdt_get_property(fdt, cpus_subnode_offset, "device_type", NULL);
+ if (!prop || strcmp(prop->data, "cpu")) {
+ prev_node_offset = cpus_subnode_offset;
+ goto next_node;
+ }
+
+ ret = fdt_del_node(fdt, cpus_subnode_offset);
+ if (ret < 0) {
+ pr_err("Failed to delete a cpus sub-node: %s\n", fdt_strerror(ret));
+ return ret;
+ }
+next_node:
+ if (prev_node_offset == cpus_offset)
+ cpus_subnode_offset = fdt_first_subnode(fdt, cpus_offset);
+ else
+ cpus_subnode_offset = fdt_next_subnode(fdt, prev_node_offset);
+ }
+
+ cpus_node = of_find_node_by_path("/cpus");
+ /* Fail here to avoid kexec/kdump kernel boot hung */
+ if (!cpus_node) {
+ pr_err("No /cpus node found\n");
+ return -EINVAL;
+ }
+
+ /* Add all /cpus sub-nodes of device_type == "cpu" to FDT */
+ for_each_child_of_node(cpus_node, dn) {
+ /* Ignore device nodes that do not have a device_type property
+ * or device_type != "cpu".
+ */
+ device_type = of_get_property(dn, "device_type", NULL);
+ if (!device_type || strcmp(device_type, "cpu"))
+ continue;
+
+ cpus_subnode_offset = fdt_add_subnode(fdt, cpus_offset, dn->full_name);
+ if (cpus_subnode_offset < 0) {
+ pr_err("Unable to add %s subnode: %s\n", dn->full_name,
+ fdt_strerror(cpus_subnode_offset));
+ ret = cpus_subnode_offset;
+ goto out;
+ }
+
+ ret = add_node_props(fdt, cpus_subnode_offset, dn);
+ if (ret < 0)
+ goto out;
+ }
+out:
+ of_node_put(cpus_node);
+ of_node_put(dn);
+ return ret;
+}
+#endif /* CONFIG_KEXEC_FILE || CONFIG_CRASH_DUMP */
diff --git a/arch/powerpc/kexec/file_load_64.c b/arch/powerpc/kexec/file_load_64.c
index 349a781cea0b..180c1dfe4aa7 100644
--- a/arch/powerpc/kexec/file_load_64.c
+++ b/arch/powerpc/kexec/file_load_64.c
@@ -952,93 +952,6 @@ unsigned int kexec_extra_fdt_size_ppc64(struct kimage *image)
return (unsigned int)(usm_entries * sizeof(u64));
}
-/**
- * add_node_props - Reads node properties from device node structure and add
- * them to fdt.
- * @fdt: Flattened device tree of the kernel
- * @node_offset: offset of the node to add a property at
- * @dn: device node pointer
- *
- * Returns 0 on success, negative errno on error.
- */
-static int add_node_props(void *fdt, int node_offset, const struct device_node *dn)
-{
- int ret = 0;
- struct property *pp;
-
- if (!dn)
- return -EINVAL;
-
- for_each_property_of_node(dn, pp) {
- ret = fdt_setprop(fdt, node_offset, pp->name, pp->value, pp->length);
- if (ret < 0) {
- pr_err("Unable to add %s property: %s\n", pp->name, fdt_strerror(ret));
- return ret;
- }
- }
- return ret;
-}
-
-/**
- * update_cpus_node - Update cpus node of flattened device tree using of_root
- * device node.
- * @fdt: Flattened device tree of the kernel.
- *
- * Returns 0 on success, negative errno on error.
- */
-static int update_cpus_node(void *fdt)
-{
- struct device_node *cpus_node, *dn;
- int cpus_offset, cpus_subnode_offset, ret = 0;
-
- cpus_offset = fdt_path_offset(fdt, "/cpus");
- if (cpus_offset < 0 && cpus_offset != -FDT_ERR_NOTFOUND) {
- pr_err("Malformed device tree: error reading /cpus node: %s\n",
- fdt_strerror(cpus_offset));
- return cpus_offset;
- }
-
- if (cpus_offset > 0) {
- ret = fdt_del_node(fdt, cpus_offset);
- if (ret < 0) {
- pr_err("Error deleting /cpus node: %s\n", fdt_strerror(ret));
- return -EINVAL;
- }
- }
-
- /* Add cpus node to fdt */
- cpus_offset = fdt_add_subnode(fdt, fdt_path_offset(fdt, "/"), "cpus");
- if (cpus_offset < 0) {
- pr_err("Error creating /cpus node: %s\n", fdt_strerror(cpus_offset));
- return -EINVAL;
- }
-
- /* Add cpus node properties */
- cpus_node = of_find_node_by_path("/cpus");
- ret = add_node_props(fdt, cpus_offset, cpus_node);
- of_node_put(cpus_node);
- if (ret < 0)
- return ret;
-
- /* Loop through all subnodes of cpus and add them to fdt */
- for_each_node_by_type(dn, "cpu") {
- cpus_subnode_offset = fdt_add_subnode(fdt, cpus_offset, dn->full_name);
- if (cpus_subnode_offset < 0) {
- pr_err("Unable to add %s subnode: %s\n", dn->full_name,
- fdt_strerror(cpus_subnode_offset));
- ret = cpus_subnode_offset;
- goto out;
- }
-
- ret = add_node_props(fdt, cpus_subnode_offset, dn);
- if (ret < 0)
- goto out;
- }
-out:
- of_node_put(dn);
- return ret;
-}
-
static int copy_property(void *fdt, int node_offset, const struct device_node *dn,
const char *propname)
{
diff --git a/arch/powerpc/kvm/powerpc.c b/arch/powerpc/kvm/powerpc.c
index b850b0efa201..98ac5d39ad9c 100644
--- a/arch/powerpc/kvm/powerpc.c
+++ b/arch/powerpc/kvm/powerpc.c
@@ -1998,8 +1998,10 @@ static int kvm_vcpu_ioctl_enable_cap(struct kvm_vcpu *vcpu,
break;
r = -ENXIO;
- if (!xive_enabled())
+ if (!xive_enabled()) {
+ fdput(f);
break;
+ }
r = -EPERM;
dev = kvm_device_from_filp(f.file);
diff --git a/arch/powerpc/platforms/pseries/plpks.c b/arch/powerpc/platforms/pseries/plpks.c
index 25f95440a773..d1eb6f0433fe 100644
--- a/arch/powerpc/platforms/pseries/plpks.c
+++ b/arch/powerpc/platforms/pseries/plpks.c
@@ -18,15 +18,23 @@
#include <linux/types.h>
#include <asm/hvcall.h>
#include <asm/machdep.h>
-
-#include "plpks.h"
+#include <asm/plpks.h>
+#include <asm/firmware.h>
static u8 *ospassword;
static u16 ospasswordlength;
// Retrieved with H_PKS_GET_CONFIG
+static u8 version;
+static u16 objoverhead;
static u16 maxpwsize;
static u16 maxobjsize;
+static s16 maxobjlabelsize;
+static u32 totalsize;
+static u32 usedspace;
+static u32 supportedpolicies;
+static u32 maxlargeobjectsize;
+static u64 signedupdatealgorithms;
struct plpks_auth {
u8 version;
@@ -113,7 +121,8 @@ static int plpks_gen_password(void)
u8 *password, consumer = PLPKS_OS_OWNER;
int rc;
- password = kzalloc(maxpwsize, GFP_KERNEL);
+ // The password must not cross a page boundary, so we align to the next power of 2
+ password = kzalloc(roundup_pow_of_two(maxpwsize), GFP_KERNEL);
if (!password)
return -ENOMEM;
@@ -149,7 +158,9 @@ static struct plpks_auth *construct_auth(u8 consumer)
if (consumer > PLPKS_OS_OWNER)
return ERR_PTR(-EINVAL);
- auth = kzalloc(struct_size(auth, password, maxpwsize), GFP_KERNEL);
+ // The auth structure must not cross a page boundary and must be
+ // 16 byte aligned. We align to the next largest power of 2
+ auth = kzalloc(roundup_pow_of_two(struct_size(auth, password, maxpwsize)), GFP_KERNEL);
if (!auth)
return ERR_PTR(-ENOMEM);
@@ -183,7 +194,8 @@ static struct label *construct_label(char *component, u8 varos, u8 *name,
if (component && slen > sizeof(label->attr.prefix))
return ERR_PTR(-EINVAL);
- label = kzalloc(sizeof(*label), GFP_KERNEL);
+ // The label structure must not cross a page boundary, so we align to the next power of 2
+ label = kzalloc(roundup_pow_of_two(sizeof(*label)), GFP_KERNEL);
if (!label)
return ERR_PTR(-ENOMEM);
@@ -203,32 +215,157 @@ static struct label *construct_label(char *component, u8 varos, u8 *name,
static int _plpks_get_config(void)
{
unsigned long retbuf[PLPAR_HCALL_BUFSIZE] = { 0 };
- struct {
+ struct config {
u8 version;
u8 flags;
- __be32 rsvd0;
+ __be16 rsvd0;
+ __be16 objoverhead;
__be16 maxpwsize;
__be16 maxobjlabelsize;
__be16 maxobjsize;
__be32 totalsize;
__be32 usedspace;
__be32 supportedpolicies;
- __be64 rsvd1;
- } __packed config;
+ __be32 maxlargeobjectsize;
+ __be64 signedupdatealgorithms;
+ u8 rsvd1[476];
+ } __packed * config;
size_t size;
- int rc;
+ int rc = 0;
+
+ size = sizeof(*config);
+
+ // Config struct must not cross a page boundary. So long as the struct
+ // size is a power of 2, this should be fine as alignment is guaranteed
+ config = kzalloc(size, GFP_KERNEL);
+ if (!config) {
+ rc = -ENOMEM;
+ goto err;
+ }
+
+ rc = plpar_hcall(H_PKS_GET_CONFIG, retbuf, virt_to_phys(config), size);
+
+ if (rc != H_SUCCESS) {
+ rc = pseries_status_to_err(rc);
+ goto err;
+ }
+
+ version = config->version;
+ objoverhead = be16_to_cpu(config->objoverhead);
+ maxpwsize = be16_to_cpu(config->maxpwsize);
+ maxobjsize = be16_to_cpu(config->maxobjsize);
+ maxobjlabelsize = be16_to_cpu(config->maxobjlabelsize);
+ totalsize = be32_to_cpu(config->totalsize);
+ usedspace = be32_to_cpu(config->usedspace);
+ supportedpolicies = be32_to_cpu(config->supportedpolicies);
+ maxlargeobjectsize = be32_to_cpu(config->maxlargeobjectsize);
+ signedupdatealgorithms = be64_to_cpu(config->signedupdatealgorithms);
+
+ // Validate that the numbers we get back match the requirements of the spec
+ if (maxpwsize < 32) {
+ pr_err("Invalid Max Password Size received from hypervisor (%d < 32)\n", maxpwsize);
+ rc = -EIO;
+ goto err;
+ }
+
+ if (maxobjlabelsize < 255) {
+ pr_err("Invalid Max Object Label Size received from hypervisor (%d < 255)\n",
+ maxobjlabelsize);
+ rc = -EIO;
+ goto err;
+ }
+
+ if (totalsize < 4096) {
+ pr_err("Invalid Total Size received from hypervisor (%d < 4096)\n", totalsize);
+ rc = -EIO;
+ goto err;
+ }
+
+ if (version >= 3 && maxlargeobjectsize >= 65536 && maxobjsize != 0xFFFF) {
+ pr_err("Invalid Max Object Size (0x%x != 0xFFFF)\n", maxobjsize);
+ rc = -EIO;
+ goto err;
+ }
+
+err:
+ kfree(config);
+ return rc;
+}
+
+u8 plpks_get_version(void)
+{
+ return version;
+}
+
+u16 plpks_get_objoverhead(void)
+{
+ return objoverhead;
+}
+
+u16 plpks_get_maxpwsize(void)
+{
+ return maxpwsize;
+}
+
+u16 plpks_get_maxobjectsize(void)
+{
+ return maxobjsize;
+}
+
+u16 plpks_get_maxobjectlabelsize(void)
+{
+ return maxobjlabelsize;
+}
+
+u32 plpks_get_totalsize(void)
+{
+ return totalsize;
+}
+
+u32 plpks_get_usedspace(void)
+{
+ // Unlike other config values, usedspace regularly changes as objects
+ // are updated, so we need to refresh.
+ int rc = _plpks_get_config();
+ if (rc) {
+ pr_err("Couldn't get config, rc: %d\n", rc);
+ return 0;
+ }
+ return usedspace;
+}
- size = sizeof(config);
+u32 plpks_get_supportedpolicies(void)
+{
+ return supportedpolicies;
+}
- rc = plpar_hcall(H_PKS_GET_CONFIG, retbuf, virt_to_phys(&config), size);
+u32 plpks_get_maxlargeobjectsize(void)
+{
+ return maxlargeobjectsize;
+}
- if (rc != H_SUCCESS)
- return pseries_status_to_err(rc);
+u64 plpks_get_signedupdatealgorithms(void)
+{
+ return signedupdatealgorithms;
+}
- maxpwsize = be16_to_cpu(config.maxpwsize);
- maxobjsize = be16_to_cpu(config.maxobjsize);
+u16 plpks_get_passwordlen(void)
+{
+ return ospasswordlength;
+}
+
+bool plpks_is_available(void)
+{
+ int rc;
+
+ if (!firmware_has_feature(FW_FEATURE_LPAR))
+ return false;
+
+ rc = _plpks_get_config();
+ if (rc)
+ return false;
- return 0;
+ return true;
}
static int plpks_confirm_object_flushed(struct label *label,
diff --git a/arch/powerpc/platforms/pseries/plpks.h b/arch/powerpc/platforms/pseries/plpks.h
deleted file mode 100644
index 07278a990c2d..000000000000
--- a/arch/powerpc/platforms/pseries/plpks.h
+++ /dev/null
@@ -1,96 +0,0 @@
-/* SPDX-License-Identifier: GPL-2.0 */
-/*
- * Copyright (C) 2022 IBM Corporation
- * Author: Nayna Jain <nayna@linux.ibm.com>
- *
- * Platform keystore for pseries LPAR(PLPKS).
- */
-
-#ifndef _PSERIES_PLPKS_H
-#define _PSERIES_PLPKS_H
-
-#include <linux/types.h>
-#include <linux/list.h>
-
-// Object policy flags from supported_policies
-#define PLPKS_OSSECBOOTAUDIT PPC_BIT32(1) // OS secure boot must be audit/enforce
-#define PLPKS_OSSECBOOTENFORCE PPC_BIT32(2) // OS secure boot must be enforce
-#define PLPKS_PWSET PPC_BIT32(3) // No access without password set
-#define PLPKS_WORLDREADABLE PPC_BIT32(4) // Readable without authentication
-#define PLPKS_IMMUTABLE PPC_BIT32(5) // Once written, object cannot be removed
-#define PLPKS_TRANSIENT PPC_BIT32(6) // Object does not persist through reboot
-#define PLPKS_SIGNEDUPDATE PPC_BIT32(7) // Object can only be modified by signed updates
-#define PLPKS_HVPROVISIONED PPC_BIT32(28) // Hypervisor has provisioned this object
-
-// Signature algorithm flags from signed_update_algorithms
-#define PLPKS_ALG_RSA2048 PPC_BIT(0)
-#define PLPKS_ALG_RSA4096 PPC_BIT(1)
-
-// Object label OS metadata flags
-#define PLPKS_VAR_LINUX 0x02
-#define PLPKS_VAR_COMMON 0x04
-
-// Flags for which consumer owns an object is owned by
-#define PLPKS_FW_OWNER 0x1
-#define PLPKS_BOOTLOADER_OWNER 0x2
-#define PLPKS_OS_OWNER 0x3
-
-// Flags for label metadata fields
-#define PLPKS_LABEL_VERSION 0
-#define PLPKS_MAX_LABEL_ATTR_SIZE 16
-#define PLPKS_MAX_NAME_SIZE 239
-#define PLPKS_MAX_DATA_SIZE 4000
-
-// Timeouts for PLPKS operations
-#define PLPKS_MAX_TIMEOUT (5 * USEC_PER_SEC)
-#define PLPKS_FLUSH_SLEEP 10000 // usec
-
-struct plpks_var {
- char *component;
- u8 *name;
- u8 *data;
- u32 policy;
- u16 namelen;
- u16 datalen;
- u8 os;
-};
-
-struct plpks_var_name {
- u8 *name;
- u16 namelen;
-};
-
-struct plpks_var_name_list {
- u32 varcount;
- struct plpks_var_name varlist[];
-};
-
-/**
- * Writes the specified var and its data to PKS.
- * Any caller of PKS driver should present a valid component type for
- * their variable.
- */
-int plpks_write_var(struct plpks_var var);
-
-/**
- * Removes the specified var and its data from PKS.
- */
-int plpks_remove_var(char *component, u8 varos,
- struct plpks_var_name vname);
-
-/**
- * Returns the data for the specified os variable.
- */
-int plpks_read_os_var(struct plpks_var *var);
-
-/**
- * Returns the data for the specified firmware variable.
- */
-int plpks_read_fw_var(struct plpks_var *var);
-
-/**
- * Returns the data for the specified bootloader variable.
- */
-int plpks_read_bootloader_var(struct plpks_var *var);
-
-#endif
diff --git a/arch/powerpc/xmon/ppc-dis.c b/arch/powerpc/xmon/ppc-dis.c
index 75fa98221d48..af105e1bc3fc 100644
--- a/arch/powerpc/xmon/ppc-dis.c
+++ b/arch/powerpc/xmon/ppc-dis.c
@@ -122,32 +122,21 @@ int print_insn_powerpc (unsigned long insn, unsigned long memaddr)
bool insn_is_short;
ppc_cpu_t dialect;
- dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON
- | PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_ALTIVEC;
+ dialect = PPC_OPCODE_PPC | PPC_OPCODE_COMMON;
- if (cpu_has_feature(CPU_FTRS_POWER5))
- dialect |= PPC_OPCODE_POWER5;
+ if (IS_ENABLED(CONFIG_PPC64))
+ dialect |= PPC_OPCODE_64 | PPC_OPCODE_POWER4 | PPC_OPCODE_CELL |
+ PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7 | PPC_OPCODE_POWER8 |
+ PPC_OPCODE_POWER9;
- if (cpu_has_feature(CPU_FTRS_CELL))
- dialect |= (PPC_OPCODE_CELL | PPC_OPCODE_ALTIVEC);
+ if (cpu_has_feature(CPU_FTR_TM))
+ dialect |= PPC_OPCODE_HTM;
- if (cpu_has_feature(CPU_FTRS_POWER6))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_ALTIVEC);
+ if (cpu_has_feature(CPU_FTR_ALTIVEC))
+ dialect |= PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2;
- if (cpu_has_feature(CPU_FTRS_POWER7))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_VSX);
-
- if (cpu_has_feature(CPU_FTRS_POWER8))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
- | PPC_OPCODE_POWER8 | PPC_OPCODE_HTM
- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2 | PPC_OPCODE_VSX);
-
- if (cpu_has_feature(CPU_FTRS_POWER9))
- dialect |= (PPC_OPCODE_POWER5 | PPC_OPCODE_POWER6 | PPC_OPCODE_POWER7
- | PPC_OPCODE_POWER8 | PPC_OPCODE_POWER9 | PPC_OPCODE_HTM
- | PPC_OPCODE_ALTIVEC | PPC_OPCODE_ALTIVEC2
- | PPC_OPCODE_VSX | PPC_OPCODE_VSX3);
+ if (cpu_has_feature(CPU_FTR_VSX))
+ dialect |= PPC_OPCODE_VSX | PPC_OPCODE_VSX3;
/* Get the major opcode of the insn. */
opcode = NULL;
diff --git a/arch/s390/kernel/uv.c b/arch/s390/kernel/uv.c
index 5caa0ed2b594..1ae7a0403804 100644
--- a/arch/s390/kernel/uv.c
+++ b/arch/s390/kernel/uv.c
@@ -172,36 +172,36 @@ int uv_convert_owned_from_secure(unsigned long paddr)
}
/*
- * Calculate the expected ref_count for a page that would otherwise have no
+ * Calculate the expected ref_count for a folio that would otherwise have no
* further pins. This was cribbed from similar functions in other places in
* the kernel, but with some slight modifications. We know that a secure
- * page can not be a huge page for example.
+ * folio can not be a large folio, for example.
*/
-static int expected_page_refs(struct page *page)
+static int expected_folio_refs(struct folio *folio)
{
int res;
- res = page_mapcount(page);
- if (PageSwapCache(page)) {
+ res = folio_mapcount(folio);
+ if (folio_test_swapcache(folio)) {
res++;
- } else if (page_mapping(page)) {
+ } else if (folio_mapping(folio)) {
res++;
- if (page_has_private(page))
+ if (folio->private)
res++;
}
return res;
}
-static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
+static int make_folio_secure(struct folio *folio, struct uv_cb_header *uvcb)
{
int expected, cc = 0;
- if (PageWriteback(page))
+ if (folio_test_writeback(folio))
return -EAGAIN;
- expected = expected_page_refs(page);
- if (!page_ref_freeze(page, expected))
+ expected = expected_folio_refs(folio);
+ if (!folio_ref_freeze(folio, expected))
return -EBUSY;
- set_bit(PG_arch_1, &page->flags);
+ set_bit(PG_arch_1, &folio->flags);
/*
* If the UVC does not succeed or fail immediately, we don't want to
* loop for long, or we might get stall notifications.
@@ -211,9 +211,9 @@ static int make_page_secure(struct page *page, struct uv_cb_header *uvcb)
* -EAGAIN and we let the callers deal with it.
*/
cc = __uv_call(0, (u64)uvcb);
- page_ref_unfreeze(page, expected);
+ folio_ref_unfreeze(folio, expected);
/*
- * Return -ENXIO if the page was not mapped, -EINVAL for other errors.
+ * Return -ENXIO if the folio was not mapped, -EINVAL for other errors.
* If busy or partially completed, return -EAGAIN.
*/
if (cc == UVC_CC_OK)
@@ -261,7 +261,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
bool local_drain = false;
spinlock_t *ptelock;
unsigned long uaddr;
- struct page *page;
+ struct folio *folio;
pte_t *ptep;
int rc;
@@ -288,15 +288,26 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
rc = -ENXIO;
ptep = get_locked_pte(gmap->mm, uaddr, &ptelock);
if (pte_present(*ptep) && !(pte_val(*ptep) & _PAGE_INVALID) && pte_write(*ptep)) {
- page = pte_page(*ptep);
+ folio = page_folio(pte_page(*ptep));
+ rc = -EINVAL;
+ if (folio_test_large(folio))
+ goto unlock;
rc = -EAGAIN;
- if (trylock_page(page)) {
+ if (folio_trylock(folio)) {
if (should_export_before_import(uvcb, gmap->mm))
- uv_convert_from_secure(page_to_phys(page));
- rc = make_page_secure(page, uvcb);
- unlock_page(page);
+ uv_convert_from_secure(PFN_PHYS(folio_pfn(folio)));
+ rc = make_folio_secure(folio, uvcb);
+ folio_unlock(folio);
}
+
+ /*
+ * Once we drop the PTL, the folio may get unmapped and
+ * freed immediately. We need a temporary reference.
+ */
+ if (rc == -EAGAIN)
+ folio_get(folio);
}
+unlock:
pte_unmap_unlock(ptep, ptelock);
out:
mmap_read_unlock(gmap->mm);
@@ -306,10 +317,11 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
* If we are here because the UVC returned busy or partial
* completion, this is just a useless check, but it is safe.
*/
- wait_on_page_writeback(page);
+ folio_wait_writeback(folio);
+ folio_put(folio);
} else if (rc == -EBUSY) {
/*
- * If we have tried a local drain and the page refcount
+ * If we have tried a local drain and the folio refcount
* still does not match our expected safe value, try with a
* system wide drain. This is needed if the pagevecs holding
* the page are on a different CPU.
@@ -320,7 +332,7 @@ int gmap_make_secure(struct gmap *gmap, unsigned long gaddr, void *uvcb)
return -EAGAIN;
}
/*
- * We are here if the page refcount does not match the
+ * We are here if the folio refcount does not match the
* expected safe value. The main culprits are usually
* pagevecs. With lru_add_drain() we drain the pagevecs
* on the local CPU so that hopefully the refcount will
diff --git a/arch/s390/pci/pci_irq.c b/arch/s390/pci/pci_irq.c
index 04c19ab93a32..393bcc2c3dc2 100644
--- a/arch/s390/pci/pci_irq.c
+++ b/arch/s390/pci/pci_irq.c
@@ -268,33 +268,20 @@ static void zpci_floating_irq_handler(struct airq_struct *airq,
}
}
-int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+static int __alloc_airq(struct zpci_dev *zdev, int msi_vecs,
+ unsigned long *bit)
{
- struct zpci_dev *zdev = to_zpci(pdev);
- unsigned int hwirq, msi_vecs, cpu;
- unsigned long bit;
- struct msi_desc *msi;
- struct msi_msg msg;
- int cpu_addr;
- int rc, irq;
-
- zdev->aisb = -1UL;
- zdev->msi_first_bit = -1U;
- if (type == PCI_CAP_ID_MSI && nvec > 1)
- return 1;
- msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
-
if (irq_delivery == DIRECTED) {
/* Allocate cpu vector bits */
- bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
- if (bit == -1UL)
+ *bit = airq_iv_alloc(zpci_ibv[0], msi_vecs);
+ if (*bit == -1UL)
return -EIO;
} else {
/* Allocate adapter summary indicator bit */
- bit = airq_iv_alloc_bit(zpci_sbv);
- if (bit == -1UL)
+ *bit = airq_iv_alloc_bit(zpci_sbv);
+ if (*bit == -1UL)
return -EIO;
- zdev->aisb = bit;
+ zdev->aisb = *bit;
/* Create adapter interrupt vector */
zdev->aibv = airq_iv_create(msi_vecs, AIRQ_IV_DATA | AIRQ_IV_BITLOCK, NULL);
@@ -302,27 +289,66 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
return -ENOMEM;
/* Wire up shortcut pointer */
- zpci_ibv[bit] = zdev->aibv;
+ zpci_ibv[*bit] = zdev->aibv;
/* Each function has its own interrupt vector */
- bit = 0;
+ *bit = 0;
}
+ return 0;
+}
- /* Request MSI interrupts */
+int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
+{
+ unsigned int hwirq, msi_vecs, irqs_per_msi, i, cpu;
+ struct zpci_dev *zdev = to_zpci(pdev);
+ struct msi_desc *msi;
+ struct msi_msg msg;
+ unsigned long bit;
+ int cpu_addr;
+ int rc, irq;
+
+ zdev->aisb = -1UL;
+ zdev->msi_first_bit = -1U;
+
+ msi_vecs = min_t(unsigned int, nvec, zdev->max_msi);
+ if (msi_vecs < nvec) {
+ pr_info("%s requested %d irqs, allocate system limit of %d",
+ pci_name(pdev), nvec, zdev->max_msi);
+ }
+
+ rc = __alloc_airq(zdev, msi_vecs, &bit);
+ if (rc < 0)
+ return rc;
+
+ /*
+ * Request MSI interrupts:
+ * When using MSI, nvec_used interrupt sources and their irq
+ * descriptors are controlled through one msi descriptor.
+ * Thus the outer loop over msi descriptors shall run only once,
+ * while two inner loops iterate over the interrupt vectors.
+ * When using MSI-X, each interrupt vector/irq descriptor
+ * is bound to exactly one msi descriptor (nvec_used is one).
+ * So the inner loops are executed once, while the outer iterates
+ * over the MSI-X descriptors.
+ */
hwirq = bit;
msi_for_each_desc(msi, &pdev->dev, MSI_DESC_NOTASSOCIATED) {
- rc = -EIO;
if (hwirq - bit >= msi_vecs)
break;
- irq = __irq_alloc_descs(-1, 0, 1, 0, THIS_MODULE,
- (irq_delivery == DIRECTED) ?
- msi->affinity : NULL);
+ irqs_per_msi = min_t(unsigned int, msi_vecs, msi->nvec_used);
+ irq = __irq_alloc_descs(-1, 0, irqs_per_msi, 0, THIS_MODULE,
+ (irq_delivery == DIRECTED) ?
+ msi->affinity : NULL);
if (irq < 0)
return -ENOMEM;
- rc = irq_set_msi_desc(irq, msi);
- if (rc)
- return rc;
- irq_set_chip_and_handler(irq, &zpci_irq_chip,
- handle_percpu_irq);
+
+ for (i = 0; i < irqs_per_msi; i++) {
+ rc = irq_set_msi_desc_off(irq, i, msi);
+ if (rc)
+ return rc;
+ irq_set_chip_and_handler(irq + i, &zpci_irq_chip,
+ handle_percpu_irq);
+ }
+
msg.data = hwirq - bit;
if (irq_delivery == DIRECTED) {
if (msi->affinity)
@@ -335,31 +361,35 @@ int arch_setup_msi_irqs(struct pci_dev *pdev, int nvec, int type)
msg.address_lo |= (cpu_addr << 8);
for_each_possible_cpu(cpu) {
- airq_iv_set_data(zpci_ibv[cpu], hwirq, irq);
+ for (i = 0; i < irqs_per_msi; i++)
+ airq_iv_set_data(zpci_ibv[cpu],
+ hwirq + i, irq + i);
}
} else {
msg.address_lo = zdev->msi_addr & 0xffffffff;
- airq_iv_set_data(zdev->aibv, hwirq, irq);
+ for (i = 0; i < irqs_per_msi; i++)
+ airq_iv_set_data(zdev->aibv, hwirq + i, irq + i);
}
msg.address_hi = zdev->msi_addr >> 32;
pci_write_msi_msg(irq, &msg);
- hwirq++;
+ hwirq += irqs_per_msi;
}
zdev->msi_first_bit = bit;
- zdev->msi_nr_irqs = msi_vecs;
+ zdev->msi_nr_irqs = hwirq - bit;
rc = zpci_set_irq(zdev);
if (rc)
return rc;
- return (msi_vecs == nvec) ? 0 : msi_vecs;
+ return (zdev->msi_nr_irqs == nvec) ? 0 : zdev->msi_nr_irqs;
}
void arch_teardown_msi_irqs(struct pci_dev *pdev)
{
struct zpci_dev *zdev = to_zpci(pdev);
struct msi_desc *msi;
+ unsigned int i;
int rc;
/* Disable interrupts */
@@ -369,8 +399,10 @@ void arch_teardown_msi_irqs(struct pci_dev *pdev)
/* Release MSI interrupts */
msi_for_each_desc(msi, &pdev->dev, MSI_DESC_ASSOCIATED) {
- irq_set_msi_desc(msi->irq, NULL);
- irq_free_desc(msi->irq);
+ for (i = 0; i < msi->nvec_used; i++) {
+ irq_set_msi_desc(msi->irq + i, NULL);
+ irq_free_desc(msi->irq + i);
+ }
msi->msg.address_lo = 0;
msi->msg.address_hi = 0;
msi->msg.data = 0;
diff --git a/arch/sparc/include/asm/oplib_64.h b/arch/sparc/include/asm/oplib_64.h
index a67abebd4359..1b86d02a8455 100644
--- a/arch/sparc/include/asm/oplib_64.h
+++ b/arch/sparc/include/asm/oplib_64.h
@@ -247,6 +247,7 @@ void prom_sun4v_guest_soft_state(void);
int prom_ihandle2path(int handle, char *buffer, int bufsize);
/* Client interface level routines. */
+void prom_cif_init(void *cif_handler);
void p1275_cmd_direct(unsigned long *);
#endif /* !(__SPARC64_OPLIB_H) */
diff --git a/arch/sparc/prom/init_64.c b/arch/sparc/prom/init_64.c
index 103aa9104318..f7b8a1a865b8 100644
--- a/arch/sparc/prom/init_64.c
+++ b/arch/sparc/prom/init_64.c
@@ -26,9 +26,6 @@ phandle prom_chosen_node;
* routines in the prom library.
* It gets passed the pointer to the PROM vector.
*/
-
-extern void prom_cif_init(void *);
-
void __init prom_init(void *cif_handler)
{
phandle node;
diff --git a/arch/sparc/prom/p1275.c b/arch/sparc/prom/p1275.c
index 889aa602f8d8..51c3f984bbf7 100644
--- a/arch/sparc/prom/p1275.c
+++ b/arch/sparc/prom/p1275.c
@@ -49,7 +49,7 @@ void p1275_cmd_direct(unsigned long *args)
local_irq_restore(flags);
}
-void prom_cif_init(void *cif_handler, void *cif_stack)
+void prom_cif_init(void *cif_handler)
{
p1275buf.prom_cif_handler = (void (*)(long *))cif_handler;
}
diff --git a/arch/um/drivers/ubd_kern.c b/arch/um/drivers/ubd_kern.c
index 13a22a461305..1203f5078cb5 100644
--- a/arch/um/drivers/ubd_kern.c
+++ b/arch/um/drivers/ubd_kern.c
@@ -456,43 +456,31 @@ static int bulk_req_safe_read(
return n;
}
-/* Called without dev->lock held, and only in interrupt context. */
-static void ubd_handler(void)
+static void ubd_end_request(struct io_thread_req *io_req)
{
- int n;
- int count;
-
- while(1){
- n = bulk_req_safe_read(
- thread_fd,
- irq_req_buffer,
- &irq_remainder,
- &irq_remainder_size,
- UBD_REQ_BUFFER_SIZE
- );
- if (n < 0) {
- if(n == -EAGAIN)
- break;
- printk(KERN_ERR "spurious interrupt in ubd_handler, "
- "err = %d\n", -n);
- return;
- }
- for (count = 0; count < n/sizeof(struct io_thread_req *); count++) {
- struct io_thread_req *io_req = (*irq_req_buffer)[count];
-
- if ((io_req->error == BLK_STS_NOTSUPP) && (req_op(io_req->req) == REQ_OP_DISCARD)) {
- blk_queue_max_discard_sectors(io_req->req->q, 0);
- blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
- }
- blk_mq_end_request(io_req->req, io_req->error);
- kfree(io_req);
- }
+ if (io_req->error == BLK_STS_NOTSUPP) {
+ if (req_op(io_req->req) == REQ_OP_DISCARD)
+ blk_queue_max_discard_sectors(io_req->req->q, 0);
+ else if (req_op(io_req->req) == REQ_OP_WRITE_ZEROES)
+ blk_queue_max_write_zeroes_sectors(io_req->req->q, 0);
}
+ blk_mq_end_request(io_req->req, io_req->error);
+ kfree(io_req);
}
static irqreturn_t ubd_intr(int irq, void *dev)
{
- ubd_handler();
+ int len, i;
+
+ while ((len = bulk_req_safe_read(thread_fd, irq_req_buffer,
+ &irq_remainder, &irq_remainder_size,
+ UBD_REQ_BUFFER_SIZE)) >= 0) {
+ for (i = 0; i < len / sizeof(struct io_thread_req *); i++)
+ ubd_end_request((*irq_req_buffer)[i]);
+ }
+
+ if (len < 0 && len != -EAGAIN)
+ pr_err("spurious interrupt in %s, err = %d\n", __func__, len);
return IRQ_HANDLED;
}
diff --git a/arch/um/kernel/time.c b/arch/um/kernel/time.c
index 3e270da6b6f6..c8c4ef94c753 100644
--- a/arch/um/kernel/time.c
+++ b/arch/um/kernel/time.c
@@ -874,9 +874,9 @@ int setup_time_travel_start(char *str)
return 1;
}
-__setup("time-travel-start", setup_time_travel_start);
+__setup("time-travel-start=", setup_time_travel_start);
__uml_help(setup_time_travel_start,
-"time-travel-start=<seconds>\n"
+"time-travel-start=<nanoseconds>\n"
"Configure the UML instance's wall clock to start at this value rather than\n"
"the host's wall clock at the time of UML boot.\n");
#endif
diff --git a/arch/um/os-Linux/signal.c b/arch/um/os-Linux/signal.c
index 24a403a70a02..850d21e6473e 100644
--- a/arch/um/os-Linux/signal.c
+++ b/arch/um/os-Linux/signal.c
@@ -8,6 +8,7 @@
#include <stdlib.h>
#include <stdarg.h>
+#include <stdbool.h>
#include <errno.h>
#include <signal.h>
#include <string.h>
@@ -65,9 +66,7 @@ static void sig_handler_common(int sig, struct siginfo *si, mcontext_t *mc)
int signals_enabled;
#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
-static int signals_blocked;
-#else
-#define signals_blocked 0
+static int signals_blocked, signals_blocked_pending;
#endif
static unsigned int signals_pending;
static unsigned int signals_active = 0;
@@ -76,14 +75,27 @@ void sig_handler(int sig, struct siginfo *si, mcontext_t *mc)
{
int enabled = signals_enabled;
- if ((signals_blocked || !enabled) && (sig == SIGIO)) {
+#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
+ if ((signals_blocked ||
+ __atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) &&
+ (sig == SIGIO)) {
+ /* increment so unblock will do another round */
+ __atomic_add_fetch(&signals_blocked_pending, 1,
+ __ATOMIC_SEQ_CST);
+ return;
+ }
+#endif
+
+ if (!enabled && (sig == SIGIO)) {
/*
* In TT_MODE_EXTERNAL, need to still call time-travel
- * handlers unless signals are also blocked for the
- * external time message processing. This will mark
- * signals_pending by itself (only if necessary.)
+ * handlers. This will mark signals_pending by itself
+ * (only if necessary.)
+ * Note we won't get here if signals are hard-blocked
+ * (which is handled above), in that case the hard-
+ * unblock will handle things.
*/
- if (!signals_blocked && time_travel_mode == TT_MODE_EXTERNAL)
+ if (time_travel_mode == TT_MODE_EXTERNAL)
sigio_run_timetravel_handlers();
else
signals_pending |= SIGIO_MASK;
@@ -380,33 +392,99 @@ int um_set_signals_trace(int enable)
#ifdef UML_CONFIG_UML_TIME_TRAVEL_SUPPORT
void mark_sigio_pending(void)
{
+ /*
+ * It would seem that this should be atomic so
+ * it isn't a read-modify-write with a signal
+ * that could happen in the middle, losing the
+ * value set by the signal.
+ *
+ * However, this function is only called when in
+ * time-travel=ext simulation mode, in which case
+ * the only signal ever pending is SIGIO, which
+ * is blocked while this can be called, and the
+ * timer signal (SIGALRM) cannot happen.
+ */
signals_pending |= SIGIO_MASK;
}
void block_signals_hard(void)
{
- if (signals_blocked)
- return;
- signals_blocked = 1;
+ signals_blocked++;
barrier();
}
void unblock_signals_hard(void)
{
+ static bool unblocking;
+
if (!signals_blocked)
+ panic("unblocking signals while not blocked");
+
+ if (--signals_blocked)
return;
- /* Must be set to 0 before we check the pending bits etc. */
- signals_blocked = 0;
+ /*
+ * Must be set to 0 before we check pending so the
+ * SIGIO handler will run as normal unless we're still
+ * going to process signals_blocked_pending.
+ */
barrier();
- if (signals_pending && signals_enabled) {
- /* this is a bit inefficient, but that's not really important */
- block_signals();
- unblock_signals();
- } else if (signals_pending & SIGIO_MASK) {
- /* we need to run time-travel handlers even if not enabled */
- sigio_run_timetravel_handlers();
+ /*
+ * Note that block_signals_hard()/unblock_signals_hard() can be called
+ * within the unblock_signals()/sigio_run_timetravel_handlers() below.
+ * This would still be prone to race conditions since it's actually a
+ * call _within_ e.g. vu_req_read_message(), where we observed this
+ * issue, which loops. Thus, if the inner call handles the recorded
+ * pending signals, we can get out of the inner call with the real
+ * signal hander no longer blocked, and still have a race. Thus don't
+ * handle unblocking in the inner call, if it happens, but only in
+ * the outermost call - 'unblocking' serves as an ownership for the
+ * signals_blocked_pending decrement.
+ */
+ if (unblocking)
+ return;
+ unblocking = true;
+
+ while (__atomic_load_n(&signals_blocked_pending, __ATOMIC_SEQ_CST)) {
+ if (signals_enabled) {
+ /* signals are enabled so we can touch this */
+ signals_pending |= SIGIO_MASK;
+ /*
+ * this is a bit inefficient, but that's
+ * not really important
+ */
+ block_signals();
+ unblock_signals();
+ } else {
+ /*
+ * we need to run time-travel handlers even
+ * if not enabled
+ */
+ sigio_run_timetravel_handlers();
+ }
+
+ /*
+ * The decrement of signals_blocked_pending must be atomic so
+ * that the signal handler will either happen before or after
+ * the decrement, not during a read-modify-write:
+ * - If it happens before, it can increment it and we'll
+ * decrement it and do another round in the loop.
+ * - If it happens after it'll see 0 for both signals_blocked
+ * and signals_blocked_pending and thus run the handler as
+ * usual (subject to signals_enabled, but that's unrelated.)
+ *
+ * Note that a call to unblock_signals_hard() within the calls
+ * to unblock_signals() or sigio_run_timetravel_handlers() above
+ * will do nothing due to the 'unblocking' state, so this cannot
+ * underflow as the only one decrementing will be the outermost
+ * one.
+ */
+ if (__atomic_sub_fetch(&signals_blocked_pending, 1,
+ __ATOMIC_SEQ_CST) < 0)
+ panic("signals_blocked_pending underflow");
}
+
+ unblocking = false;
}
#endif
diff --git a/arch/x86/events/core.c b/arch/x86/events/core.c
index 1394312b732a..2b2c9fd74ef9 100644
--- a/arch/x86/events/core.c
+++ b/arch/x86/events/core.c
@@ -2573,6 +2573,7 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
struct device_attribute *attr,
const char *buf, size_t count)
{
+ static DEFINE_MUTEX(rdpmc_mutex);
unsigned long val;
ssize_t ret;
@@ -2586,6 +2587,8 @@ static ssize_t set_attr_rdpmc(struct device *cdev,
if (x86_pmu.attr_rdpmc_broken)
return -ENOTSUPP;
+ guard(mutex)(&rdpmc_mutex);
+
if (val != x86_pmu.attr_rdpmc) {
/*
* Changing into or out of never available or always available,
diff --git a/arch/x86/events/intel/cstate.c b/arch/x86/events/intel/cstate.c
index 551741e79e03..8175bff77efa 100644
--- a/arch/x86/events/intel/cstate.c
+++ b/arch/x86/events/intel/cstate.c
@@ -80,7 +80,7 @@
* MSR_PKG_C7_RESIDENCY: Package C7 Residency Counter.
* perf code: 0x03
* Available model: NHM,WSM,SNB,IVB,HSW,BDW,SKL,CNL,
- * KBL,CML,ICL,TGL,RKL,ADL,RPL,MTL
+ * KBL,CML,ICL,TGL,RKL
* Scope: Package (physical package)
* MSR_PKG_C8_RESIDENCY: Package C8 Residency Counter.
* perf code: 0x04
@@ -89,8 +89,7 @@
* Scope: Package (physical package)
* MSR_PKG_C9_RESIDENCY: Package C9 Residency Counter.
* perf code: 0x05
- * Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL,
- * ADL,RPL,MTL
+ * Available model: HSW ULT,KBL,CNL,CML,ICL,TGL,RKL
* Scope: Package (physical package)
* MSR_PKG_C10_RESIDENCY: Package C10 Residency Counter.
* perf code: 0x06
@@ -584,9 +583,7 @@ static const struct cstate_model adl_cstates __initconst = {
.pkg_events = BIT(PERF_CSTATE_PKG_C2_RES) |
BIT(PERF_CSTATE_PKG_C3_RES) |
BIT(PERF_CSTATE_PKG_C6_RES) |
- BIT(PERF_CSTATE_PKG_C7_RES) |
BIT(PERF_CSTATE_PKG_C8_RES) |
- BIT(PERF_CSTATE_PKG_C9_RES) |
BIT(PERF_CSTATE_PKG_C10_RES),
};
diff --git a/arch/x86/events/intel/pt.c b/arch/x86/events/intel/pt.c
index 42a55794004a..cc5c6a326496 100644
--- a/arch/x86/events/intel/pt.c
+++ b/arch/x86/events/intel/pt.c
@@ -877,7 +877,7 @@ static void pt_update_head(struct pt *pt)
*/
static void *pt_buffer_region(struct pt_buffer *buf)
{
- return phys_to_virt(TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
+ return phys_to_virt((phys_addr_t)TOPA_ENTRY(buf->cur, buf->cur_idx)->base << TOPA_SHIFT);
}
/**
@@ -989,7 +989,7 @@ pt_topa_entry_for_page(struct pt_buffer *buf, unsigned int pg)
* order allocations, there shouldn't be many of these.
*/
list_for_each_entry(topa, &buf->tables, list) {
- if (topa->offset + topa->size > pg << PAGE_SHIFT)
+ if (topa->offset + topa->size > (unsigned long)pg << PAGE_SHIFT)
goto found;
}
diff --git a/arch/x86/events/intel/pt.h b/arch/x86/events/intel/pt.h
index 96906a62aacd..f5e46c04c145 100644
--- a/arch/x86/events/intel/pt.h
+++ b/arch/x86/events/intel/pt.h
@@ -33,8 +33,8 @@ struct topa_entry {
u64 rsvd2 : 1;
u64 size : 4;
u64 rsvd3 : 2;
- u64 base : 36;
- u64 rsvd4 : 16;
+ u64 base : 40;
+ u64 rsvd4 : 12;
};
/* TSC to Core Crystal Clock Ratio */
diff --git a/arch/x86/events/intel/uncore_snbep.c b/arch/x86/events/intel/uncore_snbep.c
index 9b5859812f4f..d081eb89ba12 100644
--- a/arch/x86/events/intel/uncore_snbep.c
+++ b/arch/x86/events/intel/uncore_snbep.c
@@ -459,6 +459,7 @@
#define SPR_RAW_EVENT_MASK_EXT 0xffffff
/* SPR CHA */
+#define SPR_CHA_EVENT_MASK_EXT 0xffffffff
#define SPR_CHA_PMON_CTL_TID_EN (1 << 16)
#define SPR_CHA_PMON_EVENT_MASK (SNBEP_PMON_RAW_EVENT_MASK | \
SPR_CHA_PMON_CTL_TID_EN)
@@ -475,6 +476,7 @@ DEFINE_UNCORE_FORMAT_ATTR(umask_ext, umask, "config:8-15,32-43,45-55");
DEFINE_UNCORE_FORMAT_ATTR(umask_ext2, umask, "config:8-15,32-57");
DEFINE_UNCORE_FORMAT_ATTR(umask_ext3, umask, "config:8-15,32-39");
DEFINE_UNCORE_FORMAT_ATTR(umask_ext4, umask, "config:8-15,32-55");
+DEFINE_UNCORE_FORMAT_ATTR(umask_ext5, umask, "config:8-15,32-63");
DEFINE_UNCORE_FORMAT_ATTR(qor, qor, "config:16");
DEFINE_UNCORE_FORMAT_ATTR(edge, edge, "config:18");
DEFINE_UNCORE_FORMAT_ATTR(tid_en, tid_en, "config:19");
@@ -5648,7 +5650,7 @@ static struct intel_uncore_ops spr_uncore_chabox_ops = {
static struct attribute *spr_uncore_cha_formats_attr[] = {
&format_attr_event.attr,
- &format_attr_umask_ext4.attr,
+ &format_attr_umask_ext5.attr,
&format_attr_tid_en2.attr,
&format_attr_edge.attr,
&format_attr_inv.attr,
@@ -5684,7 +5686,7 @@ ATTRIBUTE_GROUPS(uncore_alias);
static struct intel_uncore_type spr_uncore_chabox = {
.name = "cha",
.event_mask = SPR_CHA_PMON_EVENT_MASK,
- .event_mask_ext = SPR_RAW_EVENT_MASK_EXT,
+ .event_mask_ext = SPR_CHA_EVENT_MASK_EXT,
.num_shared_regs = 1,
.constraints = skx_uncore_chabox_constraints,
.ops = &spr_uncore_chabox_ops,
diff --git a/arch/x86/include/asm/kvm_host.h b/arch/x86/include/asm/kvm_host.h
index 887a171488ea..9de3db4a32f8 100644
--- a/arch/x86/include/asm/kvm_host.h
+++ b/arch/x86/include/asm/kvm_host.h
@@ -1651,7 +1651,7 @@ struct kvm_x86_nested_ops {
bool (*is_exception_vmexit)(struct kvm_vcpu *vcpu, u8 vector,
u32 error_code);
int (*check_events)(struct kvm_vcpu *vcpu);
- bool (*has_events)(struct kvm_vcpu *vcpu);
+ bool (*has_events)(struct kvm_vcpu *vcpu, bool for_injection);
void (*triple_fault)(struct kvm_vcpu *vcpu);
int (*get_state)(struct kvm_vcpu *vcpu,
struct kvm_nested_state __user *user_kvm_nested_state,
diff --git a/arch/x86/kernel/devicetree.c b/arch/x86/kernel/devicetree.c
index 5cd51f25f446..c77297fa2dad 100644
--- a/arch/x86/kernel/devicetree.c
+++ b/arch/x86/kernel/devicetree.c
@@ -87,7 +87,7 @@ static int x86_of_pci_irq_enable(struct pci_dev *dev)
ret = pci_read_config_byte(dev, PCI_INTERRUPT_PIN, &pin);
if (ret)
- return ret;
+ return pcibios_err_to_errno(ret);
if (!pin)
return 0;
diff --git a/arch/x86/kvm/vmx/nested.c b/arch/x86/kvm/vmx/nested.c
index 9d683b6067c7..2283f485a81f 100644
--- a/arch/x86/kvm/vmx/nested.c
+++ b/arch/x86/kvm/vmx/nested.c
@@ -3934,7 +3934,7 @@ static bool nested_vmx_preemption_timer_pending(struct kvm_vcpu *vcpu)
to_vmx(vcpu)->nested.preemption_timer_expired;
}
-static bool vmx_has_nested_events(struct kvm_vcpu *vcpu)
+static bool vmx_has_nested_events(struct kvm_vcpu *vcpu, bool for_injection)
{
return nested_vmx_preemption_timer_pending(vcpu) ||
to_vmx(vcpu)->nested.mtf_pending;
diff --git a/arch/x86/kvm/vmx/vmx.c b/arch/x86/kvm/vmx/vmx.c
index 10aff2c9a4e4..87abf4eebf8a 100644
--- a/arch/x86/kvm/vmx/vmx.c
+++ b/arch/x86/kvm/vmx/vmx.c
@@ -4980,14 +4980,19 @@ static int vmx_nmi_allowed(struct kvm_vcpu *vcpu, bool for_injection)
return !vmx_nmi_blocked(vcpu);
}
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
+{
+ return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
+ (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
+ (GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+}
+
bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu)
{
if (is_guest_mode(vcpu) && nested_exit_on_intr(vcpu))
return false;
- return !(vmx_get_rflags(vcpu) & X86_EFLAGS_IF) ||
- (vmcs_read32(GUEST_INTERRUPTIBILITY_INFO) &
- (GUEST_INTR_STATE_STI | GUEST_INTR_STATE_MOV_SS));
+ return __vmx_interrupt_blocked(vcpu);
}
static int vmx_interrupt_allowed(struct kvm_vcpu *vcpu, bool for_injection)
diff --git a/arch/x86/kvm/vmx/vmx.h b/arch/x86/kvm/vmx/vmx.h
index e2b04f4c0fef..9e0bb98b116d 100644
--- a/arch/x86/kvm/vmx/vmx.h
+++ b/arch/x86/kvm/vmx/vmx.h
@@ -413,6 +413,7 @@ u64 construct_eptp(struct kvm_vcpu *vcpu, hpa_t root_hpa, int root_level);
bool vmx_guest_inject_ac(struct kvm_vcpu *vcpu);
void vmx_update_exception_bitmap(struct kvm_vcpu *vcpu);
bool vmx_nmi_blocked(struct kvm_vcpu *vcpu);
+bool __vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
bool vmx_interrupt_blocked(struct kvm_vcpu *vcpu);
bool vmx_get_nmi_mask(struct kvm_vcpu *vcpu);
void vmx_set_nmi_mask(struct kvm_vcpu *vcpu, bool masked);
diff --git a/arch/x86/kvm/x86.c b/arch/x86/kvm/x86.c
index 53d83b37db8c..658a88483d8b 100644
--- a/arch/x86/kvm/x86.c
+++ b/arch/x86/kvm/x86.c
@@ -10131,7 +10131,7 @@ static int kvm_check_and_inject_events(struct kvm_vcpu *vcpu,
if (is_guest_mode(vcpu) &&
kvm_x86_ops.nested_ops->has_events &&
- kvm_x86_ops.nested_ops->has_events(vcpu))
+ kvm_x86_ops.nested_ops->has_events(vcpu, true))
*req_immediate_exit = true;
/*
@@ -13013,7 +13013,7 @@ static inline bool kvm_vcpu_has_events(struct kvm_vcpu *vcpu)
if (is_guest_mode(vcpu) &&
kvm_x86_ops.nested_ops->has_events &&
- kvm_x86_ops.nested_ops->has_events(vcpu))
+ kvm_x86_ops.nested_ops->has_events(vcpu, false))
return true;
if (kvm_xen_has_pending_events(vcpu))
diff --git a/arch/x86/pci/intel_mid_pci.c b/arch/x86/pci/intel_mid_pci.c
index 8edd62206604..722a33be08a1 100644
--- a/arch/x86/pci/intel_mid_pci.c
+++ b/arch/x86/pci/intel_mid_pci.c
@@ -233,9 +233,9 @@ static int intel_mid_pci_irq_enable(struct pci_dev *dev)
return 0;
ret = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
- if (ret < 0) {
+ if (ret) {
dev_warn(&dev->dev, "Failed to read interrupt line: %d\n", ret);
- return ret;
+ return pcibios_err_to_errno(ret);
}
id = x86_match_cpu(intel_mid_cpu_ids);
diff --git a/arch/x86/pci/xen.c b/arch/x86/pci/xen.c
index 5a4ecf0c2ac4..b4621cc95e1f 100644
--- a/arch/x86/pci/xen.c
+++ b/arch/x86/pci/xen.c
@@ -38,10 +38,10 @@ static int xen_pcifront_enable_irq(struct pci_dev *dev)
u8 gsi;
rc = pci_read_config_byte(dev, PCI_INTERRUPT_LINE, &gsi);
- if (rc < 0) {
+ if (rc) {
dev_warn(&dev->dev, "Xen PCI: failed to read interrupt line: %d\n",
rc);
- return rc;
+ return pcibios_err_to_errno(rc);
}
/* In PV DomU the Xen PCI backend puts the PIRQ in the interrupt line.*/
pirq = gsi;
diff --git a/arch/x86/platform/intel/iosf_mbi.c b/arch/x86/platform/intel/iosf_mbi.c
index fdd49d70b437..c81cea208c2c 100644
--- a/arch/x86/platform/intel/iosf_mbi.c
+++ b/arch/x86/platform/intel/iosf_mbi.c
@@ -62,7 +62,7 @@ static int iosf_mbi_pci_read_mdr(u32 mcrx, u32 mcr, u32 *mdr)
fail_read:
dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
- return result;
+ return pcibios_err_to_errno(result);
}
static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
@@ -91,7 +91,7 @@ static int iosf_mbi_pci_write_mdr(u32 mcrx, u32 mcr, u32 mdr)
fail_write:
dev_err(&mbi_pdev->dev, "PCI config access failed with %d\n", result);
- return result;
+ return pcibios_err_to_errno(result);
}
int iosf_mbi_read(u8 port, u8 opcode, u32 offset, u32 *mdr)
diff --git a/arch/x86/xen/p2m.c b/arch/x86/xen/p2m.c
index 58db86f7b384..a02cc5433889 100644
--- a/arch/x86/xen/p2m.c
+++ b/arch/x86/xen/p2m.c
@@ -736,7 +736,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
* immediate unmapping.
*/
map_ops[i].status = GNTST_general_error;
- unmap[0].host_addr = map_ops[i].host_addr,
+ unmap[0].host_addr = map_ops[i].host_addr;
unmap[0].handle = map_ops[i].handle;
map_ops[i].handle = INVALID_GRANT_HANDLE;
if (map_ops[i].flags & GNTMAP_device_map)
@@ -746,7 +746,7 @@ int set_foreign_p2m_mapping(struct gnttab_map_grant_ref *map_ops,
if (kmap_ops) {
kmap_ops[i].status = GNTST_general_error;
- unmap[1].host_addr = kmap_ops[i].host_addr,
+ unmap[1].host_addr = kmap_ops[i].host_addr;
unmap[1].handle = kmap_ops[i].handle;
kmap_ops[i].handle = INVALID_GRANT_HANDLE;
if (kmap_ops[i].flags & GNTMAP_device_map)
diff --git a/block/bio-integrity.c b/block/bio-integrity.c
index 4533eb491661..adbc00449a9c 100644
--- a/block/bio-integrity.c
+++ b/block/bio-integrity.c
@@ -199,8 +199,7 @@ bool bio_integrity_prep(struct bio *bio)
unsigned long start, end;
unsigned int len, nr_pages;
unsigned int bytes, offset, i;
- unsigned int intervals;
- blk_status_t status;
+ gfp_t gfp = GFP_NOIO;
if (!bi)
return true;
@@ -223,13 +222,19 @@ bool bio_integrity_prep(struct bio *bio)
if (!bi->profile->generate_fn ||
!(bi->flags & BLK_INTEGRITY_GENERATE))
return true;
+
+ /*
+ * Zero the memory allocated to not leak uninitialized kernel
+ * memory to disk. For PI this only affects the app tag, but
+ * for non-integrity metadata it affects the entire metadata
+ * buffer.
+ */
+ gfp |= __GFP_ZERO;
}
- intervals = bio_integrity_intervals(bi, bio_sectors(bio));
/* Allocate kernel buffer for protection data */
- len = intervals * bi->tuple_size;
- buf = kmalloc(len, GFP_NOIO);
- status = BLK_STS_RESOURCE;
+ len = bio_integrity_bytes(bi, bio_sectors(bio));
+ buf = kmalloc(len, gfp);
if (unlikely(buf == NULL)) {
printk(KERN_ERR "could not allocate integrity buffer\n");
goto err_end_io;
@@ -244,7 +249,6 @@ bool bio_integrity_prep(struct bio *bio)
if (IS_ERR(bip)) {
printk(KERN_ERR "could not allocate data integrity bioset\n");
kfree(buf);
- status = BLK_STS_RESOURCE;
goto err_end_io;
}
@@ -272,7 +276,6 @@ bool bio_integrity_prep(struct bio *bio)
if (ret == 0) {
printk(KERN_ERR "could not attach integrity payload\n");
- status = BLK_STS_RESOURCE;
goto err_end_io;
}
@@ -294,7 +297,7 @@ bool bio_integrity_prep(struct bio *bio)
return true;
err_end_io:
- bio->bi_status = status;
+ bio->bi_status = BLK_STS_RESOURCE;
bio_endio(bio);
return false;
diff --git a/drivers/android/binder.c b/drivers/android/binder.c
index 46111f8c12e6..e0ef648df265 100644
--- a/drivers/android/binder.c
+++ b/drivers/android/binder.c
@@ -569,9 +569,7 @@ static bool binder_has_work(struct binder_thread *thread, bool do_proc_work)
static bool binder_available_for_proc_work_ilocked(struct binder_thread *thread)
{
return !thread->transaction_stack &&
- binder_worklist_empty_ilocked(&thread->todo) &&
- (thread->looper & (BINDER_LOOPER_STATE_ENTERED |
- BINDER_LOOPER_STATE_REGISTERED));
+ binder_worklist_empty_ilocked(&thread->todo);
}
static void binder_wakeup_poll_threads_ilocked(struct binder_proc *proc,
diff --git a/drivers/ata/libata-scsi.c b/drivers/ata/libata-scsi.c
index 65fde5717928..c8970453b4d9 100644
--- a/drivers/ata/libata-scsi.c
+++ b/drivers/ata/libata-scsi.c
@@ -900,11 +900,8 @@ static void ata_gen_passthru_sense(struct ata_queued_cmd *qc)
&sense_key, &asc, &ascq, verbose);
ata_scsi_set_sense(qc->dev, cmd, sense_key, asc, ascq);
} else {
- /*
- * ATA PASS-THROUGH INFORMATION AVAILABLE
- * Always in descriptor format sense.
- */
- scsi_build_sense(cmd, 1, RECOVERED_ERROR, 0, 0x1D);
+ /* ATA PASS-THROUGH INFORMATION AVAILABLE */
+ ata_scsi_set_sense(qc->dev, cmd, RECOVERED_ERROR, 0, 0x1D);
}
if ((cmd->sense_buffer[0] & 0x7f) >= 0x72) {
diff --git a/drivers/auxdisplay/ht16k33.c b/drivers/auxdisplay/ht16k33.c
index 02425991c159..57b4efff344e 100644
--- a/drivers/auxdisplay/ht16k33.c
+++ b/drivers/auxdisplay/ht16k33.c
@@ -507,6 +507,7 @@ static int ht16k33_led_probe(struct device *dev, struct led_classdev *led,
led->max_brightness = MAX_BRIGHTNESS;
err = devm_led_classdev_register_ext(dev, led, &init_data);
+ fwnode_handle_put(init_data.fwnode);
if (err)
dev_err(dev, "Failed to register LED\n");
diff --git a/drivers/base/devres.c b/drivers/base/devres.c
index 4ab2b50ee38f..f9add2ecdc55 100644
--- a/drivers/base/devres.c
+++ b/drivers/base/devres.c
@@ -892,9 +892,12 @@ void *devm_krealloc(struct device *dev, void *ptr, size_t new_size, gfp_t gfp)
/*
* Otherwise: allocate new, larger chunk. We need to allocate before
* taking the lock as most probably the caller uses GFP_KERNEL.
+ * alloc_dr() will call check_dr_size() to reserve extra memory
+ * for struct devres automatically, so size @new_size user request
+ * is delivered to it directly as devm_kmalloc() does.
*/
new_dr = alloc_dr(devm_kmalloc_release,
- total_new_size, gfp, dev_to_node(dev));
+ new_size, gfp, dev_to_node(dev));
if (!new_dr)
return NULL;
@@ -1218,7 +1221,11 @@ EXPORT_SYMBOL_GPL(__devm_alloc_percpu);
*/
void devm_free_percpu(struct device *dev, void __percpu *pdata)
{
- WARN_ON(devres_destroy(dev, devm_percpu_release, devm_percpu_match,
+ /*
+ * Use devres_release() to prevent memory leakage as
+ * devm_free_pages() does.
+ */
+ WARN_ON(devres_release(dev, devm_percpu_release, devm_percpu_match,
(__force void *)pdata));
}
EXPORT_SYMBOL_GPL(devm_free_percpu);
diff --git a/drivers/block/rbd.c b/drivers/block/rbd.c
index f58ca9ce3503..4f8efc829a59 100644
--- a/drivers/block/rbd.c
+++ b/drivers/block/rbd.c
@@ -362,7 +362,7 @@ enum rbd_watch_state {
enum rbd_lock_state {
RBD_LOCK_STATE_UNLOCKED,
RBD_LOCK_STATE_LOCKED,
- RBD_LOCK_STATE_RELEASING,
+ RBD_LOCK_STATE_QUIESCING,
};
/* WatchNotify::ClientId */
@@ -422,7 +422,7 @@ struct rbd_device {
struct list_head running_list;
struct completion acquire_wait;
int acquire_err;
- struct completion releasing_wait;
+ struct completion quiescing_wait;
spinlock_t object_map_lock;
u8 *object_map;
@@ -525,7 +525,7 @@ static bool __rbd_is_lock_owner(struct rbd_device *rbd_dev)
lockdep_assert_held(&rbd_dev->lock_rwsem);
return rbd_dev->lock_state == RBD_LOCK_STATE_LOCKED ||
- rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING;
+ rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING;
}
static bool rbd_is_lock_owner(struct rbd_device *rbd_dev)
@@ -3458,13 +3458,14 @@ static void rbd_lock_del_request(struct rbd_img_request *img_req)
lockdep_assert_held(&rbd_dev->lock_rwsem);
spin_lock(&rbd_dev->lock_lists_lock);
if (!list_empty(&img_req->lock_item)) {
+ rbd_assert(!list_empty(&rbd_dev->running_list));
list_del_init(&img_req->lock_item);
- need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_RELEASING &&
+ need_wakeup = (rbd_dev->lock_state == RBD_LOCK_STATE_QUIESCING &&
list_empty(&rbd_dev->running_list));
}
spin_unlock(&rbd_dev->lock_lists_lock);
if (need_wakeup)
- complete(&rbd_dev->releasing_wait);
+ complete(&rbd_dev->quiescing_wait);
}
static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
@@ -3477,11 +3478,6 @@ static int rbd_img_exclusive_lock(struct rbd_img_request *img_req)
if (rbd_lock_add_request(img_req))
return 1;
- if (rbd_dev->opts->exclusive) {
- WARN_ON(1); /* lock got released? */
- return -EROFS;
- }
-
/*
* Note the use of mod_delayed_work() in rbd_acquire_lock()
* and cancel_delayed_work() in wake_lock_waiters().
@@ -4182,16 +4178,16 @@ static bool rbd_quiesce_lock(struct rbd_device *rbd_dev)
/*
* Ensure that all in-flight IO is flushed.
*/
- rbd_dev->lock_state = RBD_LOCK_STATE_RELEASING;
- rbd_assert(!completion_done(&rbd_dev->releasing_wait));
+ rbd_dev->lock_state = RBD_LOCK_STATE_QUIESCING;
+ rbd_assert(!completion_done(&rbd_dev->quiescing_wait));
if (list_empty(&rbd_dev->running_list))
return true;
up_write(&rbd_dev->lock_rwsem);
- wait_for_completion(&rbd_dev->releasing_wait);
+ wait_for_completion(&rbd_dev->quiescing_wait);
down_write(&rbd_dev->lock_rwsem);
- if (rbd_dev->lock_state != RBD_LOCK_STATE_RELEASING)
+ if (rbd_dev->lock_state != RBD_LOCK_STATE_QUIESCING)
return false;
rbd_assert(list_empty(&rbd_dev->running_list));
@@ -4602,6 +4598,10 @@ static void rbd_reacquire_lock(struct rbd_device *rbd_dev)
rbd_warn(rbd_dev, "failed to update lock cookie: %d",
ret);
+ if (rbd_dev->opts->exclusive)
+ rbd_warn(rbd_dev,
+ "temporarily releasing lock on exclusive mapping");
+
/*
* Lock cookie cannot be updated on older OSDs, so do
* a manual release and queue an acquire.
@@ -5383,7 +5383,7 @@ static struct rbd_device *__rbd_dev_create(struct rbd_spec *spec)
INIT_LIST_HEAD(&rbd_dev->acquiring_list);
INIT_LIST_HEAD(&rbd_dev->running_list);
init_completion(&rbd_dev->acquire_wait);
- init_completion(&rbd_dev->releasing_wait);
+ init_completion(&rbd_dev->quiescing_wait);
spin_lock_init(&rbd_dev->object_map_lock);
@@ -6589,11 +6589,6 @@ static int rbd_add_acquire_lock(struct rbd_device *rbd_dev)
if (ret)
return ret;
- /*
- * The lock may have been released by now, unless automatic lock
- * transitions are disabled.
- */
- rbd_assert(!rbd_dev->opts->exclusive || rbd_is_lock_owner(rbd_dev));
return 0;
}
diff --git a/drivers/bluetooth/btusb.c b/drivers/bluetooth/btusb.c
index 6a772b955d69..2d8c405a27a6 100644
--- a/drivers/bluetooth/btusb.c
+++ b/drivers/bluetooth/btusb.c
@@ -545,6 +545,10 @@ static const struct usb_device_id blacklist_table[] = {
BTUSB_WIDEBAND_SPEECH },
{ USB_DEVICE(0x13d3, 0x3571), .driver_info = BTUSB_REALTEK |
BTUSB_WIDEBAND_SPEECH },
+ { USB_DEVICE(0x13d3, 0x3591), .driver_info = BTUSB_REALTEK |
+ BTUSB_WIDEBAND_SPEECH },
+ { USB_DEVICE(0x0489, 0xe125), .driver_info = BTUSB_REALTEK |
+ BTUSB_WIDEBAND_SPEECH },
/* Realtek Bluetooth devices */
{ USB_VENDOR_AND_INTERFACE_INFO(0x0bda, 0xe0, 0x01, 0x01),
diff --git a/drivers/char/hw_random/amd-rng.c b/drivers/char/hw_random/amd-rng.c
index 0555e3838bce..5229da114377 100644
--- a/drivers/char/hw_random/amd-rng.c
+++ b/drivers/char/hw_random/amd-rng.c
@@ -142,8 +142,10 @@ static int __init amd_rng_mod_init(void)
found:
err = pci_read_config_dword(pdev, 0x58, &pmbase);
- if (err)
+ if (err) {
+ err = pcibios_err_to_errno(err);
goto put_dev;
+ }
pmbase &= 0x0000FF00;
if (pmbase == 0) {
diff --git a/drivers/char/tpm/eventlog/common.c b/drivers/char/tpm/eventlog/common.c
index 8512ec76d526..4a6186f9f889 100644
--- a/drivers/char/tpm/eventlog/common.c
+++ b/drivers/char/tpm/eventlog/common.c
@@ -47,6 +47,8 @@ static int tpm_bios_measurements_open(struct inode *inode,
if (!err) {
seq = file->private_data;
seq->private = chip;
+ } else {
+ put_device(&chip->dev);
}
return err;
diff --git a/drivers/clk/clk-en7523.c b/drivers/clk/clk-en7523.c
index 29f0126cbd05..d22fae24a3da 100644
--- a/drivers/clk/clk-en7523.c
+++ b/drivers/clk/clk-en7523.c
@@ -41,6 +41,7 @@ struct en_clk_desc {
u8 div_shift;
u16 div_val0;
u8 div_step;
+ u8 div_offset;
};
struct en_clk_gate {
@@ -68,6 +69,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_EMI,
.name = "emi",
@@ -81,6 +83,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_BUS,
.name = "bus",
@@ -94,6 +97,7 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_SLIC,
.name = "slic",
@@ -134,13 +138,14 @@ static const struct en_clk_desc en7523_base_clks[] = {
.div_bits = 3,
.div_shift = 0,
.div_step = 1,
+ .div_offset = 1,
}, {
.id = EN7523_CLK_CRYPTO,
.name = "crypto",
.base_reg = REG_CRYPTO_CLKSRC,
.base_bits = 1,
- .base_shift = 8,
+ .base_shift = 0,
.base_values = emi_base,
.n_base_values = ARRAY_SIZE(emi_base),
}
@@ -185,7 +190,7 @@ static u32 en7523_get_div(void __iomem *base, int i)
if (!val && desc->div_val0)
return desc->div_val0;
- return (val + 1) * desc->div_step;
+ return (val + desc->div_offset) * desc->div_step;
}
static int en7523_pci_is_enabled(struct clk_hw *hw)
diff --git a/drivers/clk/davinci/da8xx-cfgchip.c b/drivers/clk/davinci/da8xx-cfgchip.c
index 4103d605e804..6faa4372ed65 100644
--- a/drivers/clk/davinci/da8xx-cfgchip.c
+++ b/drivers/clk/davinci/da8xx-cfgchip.c
@@ -505,7 +505,7 @@ da8xx_cfgchip_register_usb0_clk48(struct device *dev,
const char * const parent_names[] = { "usb_refclkin", "pll0_auxclk" };
struct clk *fck_clk;
struct da8xx_usb0_clk48 *usb0;
- struct clk_init_data init;
+ struct clk_init_data init = {};
int ret;
fck_clk = devm_clk_get(dev, "fck");
@@ -579,7 +579,7 @@ da8xx_cfgchip_register_usb1_clk48(struct device *dev,
{
const char * const parent_names[] = { "usb0_clk48", "usb_refclkin" };
struct da8xx_usb1_clk48 *usb1;
- struct clk_init_data init;
+ struct clk_init_data init = {};
int ret;
usb1 = devm_kzalloc(dev, sizeof(*usb1), GFP_KERNEL);
diff --git a/drivers/clk/qcom/camcc-sc7280.c b/drivers/clk/qcom/camcc-sc7280.c
index ec163ea769f5..932096a972bc 100644
--- a/drivers/clk/qcom/camcc-sc7280.c
+++ b/drivers/clk/qcom/camcc-sc7280.c
@@ -2260,6 +2260,7 @@ static struct gdsc cam_cc_bps_gdsc = {
.name = "cam_cc_bps_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = HW_CTRL | RETAIN_FF_ENABLE,
};
@@ -2269,6 +2270,7 @@ static struct gdsc cam_cc_ife_0_gdsc = {
.name = "cam_cc_ife_0_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = RETAIN_FF_ENABLE,
};
@@ -2278,6 +2280,7 @@ static struct gdsc cam_cc_ife_1_gdsc = {
.name = "cam_cc_ife_1_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = RETAIN_FF_ENABLE,
};
@@ -2287,6 +2290,7 @@ static struct gdsc cam_cc_ife_2_gdsc = {
.name = "cam_cc_ife_2_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = RETAIN_FF_ENABLE,
};
@@ -2296,6 +2300,7 @@ static struct gdsc cam_cc_ipe_0_gdsc = {
.name = "cam_cc_ipe_0_gdsc",
},
.pwrsts = PWRSTS_OFF_ON,
+ .parent = &cam_cc_titan_top_gdsc.pd,
.flags = HW_CTRL | RETAIN_FF_ENABLE,
};
diff --git a/drivers/clk/qcom/clk-branch.h b/drivers/clk/qcom/clk-branch.h
index 17a58119165e..55b3a2c3afed 100644
--- a/drivers/clk/qcom/clk-branch.h
+++ b/drivers/clk/qcom/clk-branch.h
@@ -37,6 +37,32 @@ struct clk_branch {
struct clk_regmap clkr;
};
+/* Branch clock common bits for HLOS-owned clocks */
+#define CBCR_FORCE_MEM_CORE_ON BIT(14)
+#define CBCR_FORCE_MEM_PERIPH_ON BIT(13)
+#define CBCR_FORCE_MEM_PERIPH_OFF BIT(12)
+
+static inline void qcom_branch_set_force_mem_core(struct regmap *regmap,
+ struct clk_branch clk, bool on)
+{
+ regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_CORE_ON,
+ on ? CBCR_FORCE_MEM_CORE_ON : 0);
+}
+
+static inline void qcom_branch_set_force_periph_on(struct regmap *regmap,
+ struct clk_branch clk, bool on)
+{
+ regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_ON,
+ on ? CBCR_FORCE_MEM_PERIPH_ON : 0);
+}
+
+static inline void qcom_branch_set_force_periph_off(struct regmap *regmap,
+ struct clk_branch clk, bool on)
+{
+ regmap_update_bits(regmap, clk.halt_reg, CBCR_FORCE_MEM_PERIPH_OFF,
+ on ? CBCR_FORCE_MEM_PERIPH_OFF : 0);
+}
+
extern const struct clk_ops clk_branch_ops;
extern const struct clk_ops clk_branch2_ops;
extern const struct clk_ops clk_branch_simple_ops;
diff --git a/drivers/clk/qcom/clk-rcg2.c b/drivers/clk/qcom/clk-rcg2.c
index dc797bd137ca..e46bb60dcda4 100644
--- a/drivers/clk/qcom/clk-rcg2.c
+++ b/drivers/clk/qcom/clk-rcg2.c
@@ -1136,7 +1136,39 @@ clk_rcg2_shared_recalc_rate(struct clk_hw *hw, unsigned long parent_rate)
return clk_rcg2_recalc_rate(hw, parent_rate);
}
+static int clk_rcg2_shared_init(struct clk_hw *hw)
+{
+ /*
+ * This does a few things:
+ *
+ * 1. Sets rcg->parked_cfg to reflect the value at probe so that the
+ * proper parent is reported from clk_rcg2_shared_get_parent().
+ *
+ * 2. Clears the force enable bit of the RCG because we rely on child
+ * clks (branches) to turn the RCG on/off with a hardware feedback
+ * mechanism and only set the force enable bit in the RCG when we
+ * want to make sure the clk stays on for parent switches or
+ * parking.
+ *
+ * 3. Parks shared RCGs on the safe source at registration because we
+ * can't be certain that the parent clk will stay on during boot,
+ * especially if the parent is shared. If this RCG is enabled at
+ * boot, and the parent is turned off, the RCG will get stuck on. A
+ * GDSC can wedge if is turned on and the RCG is stuck on because
+ * the GDSC's controller will hang waiting for the clk status to
+ * toggle on when it never does.
+ *
+ * The safest option here is to "park" the RCG at init so that the clk
+ * can never get stuck on or off. This ensures the GDSC can't get
+ * wedged.
+ */
+ clk_rcg2_shared_disable(hw);
+
+ return 0;
+}
+
const struct clk_ops clk_rcg2_shared_ops = {
+ .init = clk_rcg2_shared_init,
.enable = clk_rcg2_shared_enable,
.disable = clk_rcg2_shared_disable,
.get_parent = clk_rcg2_shared_get_parent,
diff --git a/drivers/clk/qcom/gcc-sc7280.c b/drivers/clk/qcom/gcc-sc7280.c
index 46d41ebce2b0..2067e39840cb 100644
--- a/drivers/clk/qcom/gcc-sc7280.c
+++ b/drivers/clk/qcom/gcc-sc7280.c
@@ -3469,6 +3469,9 @@ static int gcc_sc7280_probe(struct platform_device *pdev)
regmap_update_bits(regmap, 0x71004, BIT(0), BIT(0));
regmap_update_bits(regmap, 0x7100C, BIT(13), BIT(13));
+ /* FORCE_MEM_CORE_ON for ufs phy ice core clocks */
+ qcom_branch_set_force_mem_core(regmap, gcc_ufs_phy_ice_core_clk, true);
+
ret = qcom_cc_register_rcg_dfs(regmap, gcc_dfs_clocks,
ARRAY_SIZE(gcc_dfs_clocks));
if (ret)
diff --git a/drivers/clk/qcom/gpucc-sm8350.c b/drivers/clk/qcom/gpucc-sm8350.c
index 5367ce654ac9..cc9fcbc88465 100644
--- a/drivers/clk/qcom/gpucc-sm8350.c
+++ b/drivers/clk/qcom/gpucc-sm8350.c
@@ -2,6 +2,7 @@
/*
* Copyright (c) 2019-2020, The Linux Foundation. All rights reserved.
* Copyright (c) 2022, Linaro Limited
+ * Copyright (c) 2024, Qualcomm Innovation Center, Inc. All rights reserved.
*/
#include <linux/clk.h>
@@ -147,7 +148,7 @@ static struct clk_rcg2 gpu_cc_gmu_clk_src = {
.parent_data = gpu_cc_parent_data_0,
.num_parents = ARRAY_SIZE(gpu_cc_parent_data_0),
.flags = CLK_SET_RATE_PARENT,
- .ops = &clk_rcg2_ops,
+ .ops = &clk_rcg2_shared_ops,
},
};
@@ -169,7 +170,7 @@ static struct clk_rcg2 gpu_cc_hub_clk_src = {
.parent_data = gpu_cc_parent_data_1,
.num_parents = ARRAY_SIZE(gpu_cc_parent_data_1),
.flags = CLK_SET_RATE_PARENT,
- .ops = &clk_rcg2_ops,
+ .ops = &clk_rcg2_shared_ops,
},
};
diff --git a/drivers/cpufreq/ti-cpufreq.c b/drivers/cpufreq/ti-cpufreq.c
index 61ef653bcf56..15e2ef830350 100644
--- a/drivers/cpufreq/ti-cpufreq.c
+++ b/drivers/cpufreq/ti-cpufreq.c
@@ -381,7 +381,7 @@ static int ti_cpufreq_probe(struct platform_device *pdev)
ret = dev_pm_opp_set_config(opp_data->cpu_dev, &config);
if (ret < 0) {
- dev_err(opp_data->cpu_dev, "Failed to set OPP config\n");
+ dev_err_probe(opp_data->cpu_dev, ret, "Failed to set OPP config\n");
goto fail_put_node;
}
diff --git a/drivers/crypto/qat/qat_common/adf_cfg.c b/drivers/crypto/qat/qat_common/adf_cfg.c
index 1931e5b37f2b..368d14d81503 100644
--- a/drivers/crypto/qat/qat_common/adf_cfg.c
+++ b/drivers/crypto/qat/qat_common/adf_cfg.c
@@ -276,17 +276,19 @@ int adf_cfg_add_key_value_param(struct adf_accel_dev *accel_dev,
* 3. if the key exists with the same value, then return without doing
* anything (the newly created key_val is freed).
*/
+ down_write(&cfg->lock);
if (!adf_cfg_key_val_get(accel_dev, section_name, key, temp_val)) {
if (strncmp(temp_val, key_val->val, sizeof(temp_val))) {
adf_cfg_keyval_remove(key, section);
} else {
kfree(key_val);
- return 0;
+ goto out;
}
}
- down_write(&cfg->lock);
adf_cfg_keyval_add(key_val, section);
+
+out:
up_write(&cfg->lock);
return 0;
}
diff --git a/drivers/dma/ti/k3-udma.c b/drivers/dma/ti/k3-udma.c
index 82e7acfda6ed..e323e1a5f20f 100644
--- a/drivers/dma/ti/k3-udma.c
+++ b/drivers/dma/ti/k3-udma.c
@@ -4423,7 +4423,9 @@ static int udma_get_mmrs(struct platform_device *pdev, struct udma_dev *ud)
ud->rchan_cnt = UDMA_CAP2_RCHAN_CNT(cap2);
break;
case DMA_TYPE_BCDMA:
- ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2);
+ ud->bchan_cnt = BCDMA_CAP2_BCHAN_CNT(cap2) +
+ BCDMA_CAP3_HBCHAN_CNT(cap3) +
+ BCDMA_CAP3_UBCHAN_CNT(cap3);
ud->tchan_cnt = BCDMA_CAP2_TCHAN_CNT(cap2);
ud->rchan_cnt = BCDMA_CAP2_RCHAN_CNT(cap2);
ud->rflow_cnt = ud->rchan_cnt;
diff --git a/drivers/edac/Makefile b/drivers/edac/Makefile
index 2d1641a27a28..a98e1981df15 100644
--- a/drivers/edac/Makefile
+++ b/drivers/edac/Makefile
@@ -54,11 +54,13 @@ obj-$(CONFIG_EDAC_MPC85XX) += mpc85xx_edac_mod.o
layerscape_edac_mod-y := fsl_ddr_edac.o layerscape_edac.o
obj-$(CONFIG_EDAC_LAYERSCAPE) += layerscape_edac_mod.o
-skx_edac-y := skx_common.o skx_base.o
-obj-$(CONFIG_EDAC_SKX) += skx_edac.o
+skx_edac_common-y := skx_common.o
-i10nm_edac-y := skx_common.o i10nm_base.o
-obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o
+skx_edac-y := skx_base.o
+obj-$(CONFIG_EDAC_SKX) += skx_edac.o skx_edac_common.o
+
+i10nm_edac-y := i10nm_base.o
+obj-$(CONFIG_EDAC_I10NM) += i10nm_edac.o skx_edac_common.o
obj-$(CONFIG_EDAC_CELL) += cell_edac.o
obj-$(CONFIG_EDAC_PPC4XX) += ppc4xx_edac.o
diff --git a/drivers/edac/skx_common.c b/drivers/edac/skx_common.c
index f0f8e98f6efb..e218909f9f9e 100644
--- a/drivers/edac/skx_common.c
+++ b/drivers/edac/skx_common.c
@@ -48,7 +48,7 @@ static u64 skx_tolm, skx_tohm;
static LIST_HEAD(dev_edac_list);
static bool skx_mem_cfg_2lm;
-int __init skx_adxl_get(void)
+int skx_adxl_get(void)
{
const char * const *names;
int i, j;
@@ -110,12 +110,14 @@ int __init skx_adxl_get(void)
return -ENODEV;
}
+EXPORT_SYMBOL_GPL(skx_adxl_get);
-void __exit skx_adxl_put(void)
+void skx_adxl_put(void)
{
kfree(adxl_values);
kfree(adxl_msg);
}
+EXPORT_SYMBOL_GPL(skx_adxl_put);
static bool skx_adxl_decode(struct decoded_addr *res, bool error_in_1st_level_mem)
{
@@ -187,12 +189,14 @@ void skx_set_mem_cfg(bool mem_cfg_2lm)
{
skx_mem_cfg_2lm = mem_cfg_2lm;
}
+EXPORT_SYMBOL_GPL(skx_set_mem_cfg);
void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log)
{
driver_decode = decode;
skx_show_retry_rd_err_log = show_retry_log;
}
+EXPORT_SYMBOL_GPL(skx_set_decode);
int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
{
@@ -206,6 +210,7 @@ int skx_get_src_id(struct skx_dev *d, int off, u8 *id)
*id = GET_BITFIELD(reg, 12, 14);
return 0;
}
+EXPORT_SYMBOL_GPL(skx_get_src_id);
int skx_get_node_id(struct skx_dev *d, u8 *id)
{
@@ -219,6 +224,7 @@ int skx_get_node_id(struct skx_dev *d, u8 *id)
*id = GET_BITFIELD(reg, 0, 2);
return 0;
}
+EXPORT_SYMBOL_GPL(skx_get_node_id);
static int get_width(u32 mtr)
{
@@ -284,6 +290,7 @@ int skx_get_all_bus_mappings(struct res_config *cfg, struct list_head **list)
*list = &dev_edac_list;
return ndev;
}
+EXPORT_SYMBOL_GPL(skx_get_all_bus_mappings);
int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
{
@@ -323,6 +330,7 @@ int skx_get_hi_lo(unsigned int did, int off[], u64 *tolm, u64 *tohm)
pci_dev_put(pdev);
return -ENODEV;
}
+EXPORT_SYMBOL_GPL(skx_get_hi_lo);
static int skx_get_dimm_attr(u32 reg, int lobit, int hibit, int add,
int minval, int maxval, const char *name)
@@ -394,6 +402,7 @@ int skx_get_dimm_info(u32 mtr, u32 mcmtr, u32 amap, struct dimm_info *dimm,
return 1;
}
+EXPORT_SYMBOL_GPL(skx_get_dimm_info);
int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
int chan, int dimmno, const char *mod_str)
@@ -442,6 +451,7 @@ int skx_get_nvdimm_info(struct dimm_info *dimm, struct skx_imc *imc,
return (size == 0 || size == ~0ull) ? 0 : 1;
}
+EXPORT_SYMBOL_GPL(skx_get_nvdimm_info);
int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
const char *ctl_name, const char *mod_str,
@@ -512,6 +522,7 @@ int skx_register_mci(struct skx_imc *imc, struct pci_dev *pdev,
imc->mci = NULL;
return rc;
}
+EXPORT_SYMBOL_GPL(skx_register_mci);
static void skx_unregister_mci(struct skx_imc *imc)
{
@@ -694,6 +705,7 @@ int skx_mce_check_error(struct notifier_block *nb, unsigned long val,
mce->kflags |= MCE_HANDLED_EDAC;
return NOTIFY_DONE;
}
+EXPORT_SYMBOL_GPL(skx_mce_check_error);
void skx_remove(void)
{
@@ -731,3 +743,8 @@ void skx_remove(void)
kfree(d);
}
}
+EXPORT_SYMBOL_GPL(skx_remove);
+
+MODULE_LICENSE("GPL v2");
+MODULE_AUTHOR("Tony Luck");
+MODULE_DESCRIPTION("MC Driver for Intel server processors");
diff --git a/drivers/edac/skx_common.h b/drivers/edac/skx_common.h
index 0cbadd3d2cd3..c0c174c101d2 100644
--- a/drivers/edac/skx_common.h
+++ b/drivers/edac/skx_common.h
@@ -178,8 +178,8 @@ typedef int (*get_dimm_config_f)(struct mem_ctl_info *mci,
typedef bool (*skx_decode_f)(struct decoded_addr *res);
typedef void (*skx_show_retry_log_f)(struct decoded_addr *res, char *msg, int len, bool scrub_err);
-int __init skx_adxl_get(void);
-void __exit skx_adxl_put(void);
+int skx_adxl_get(void);
+void skx_adxl_put(void);
void skx_set_decode(skx_decode_f decode, skx_show_retry_log_f show_retry_log);
void skx_set_mem_cfg(bool mem_cfg_2lm);
diff --git a/drivers/firmware/efi/libstub/x86-stub.c b/drivers/firmware/efi/libstub/x86-stub.c
index f7eb389aeec0..b8246fc7f412 100644
--- a/drivers/firmware/efi/libstub/x86-stub.c
+++ b/drivers/firmware/efi/libstub/x86-stub.c
@@ -435,11 +435,12 @@ void __noreturn efi_stub_entry(efi_handle_t handle,
efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
efi_system_table_t *sys_table_arg)
{
- static struct boot_params boot_params __page_aligned_bss;
- struct setup_header *hdr = &boot_params.hdr;
efi_guid_t proto = LOADED_IMAGE_PROTOCOL_GUID;
+ struct boot_params *boot_params;
+ struct setup_header *hdr;
int options_size = 0;
efi_status_t status;
+ unsigned long alloc;
char *cmdline_ptr;
if (efi_is_native())
@@ -457,6 +458,13 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
efi_exit(handle, status);
}
+ status = efi_allocate_pages(PARAM_SIZE, &alloc, ULONG_MAX);
+ if (status != EFI_SUCCESS)
+ efi_exit(handle, status);
+
+ boot_params = memset((void *)alloc, 0x0, PARAM_SIZE);
+ hdr = &boot_params->hdr;
+
/* Assign the setup_header fields that the kernel actually cares about */
hdr->root_flags = 1;
hdr->vid_mode = 0xffff;
@@ -466,17 +474,16 @@ efi_status_t __efiapi efi_pe_entry(efi_handle_t handle,
/* Convert unicode cmdline to ascii */
cmdline_ptr = efi_convert_cmdline(image, &options_size);
- if (!cmdline_ptr)
- goto fail;
+ if (!cmdline_ptr) {
+ efi_free(PARAM_SIZE, alloc);
+ efi_exit(handle, EFI_OUT_OF_RESOURCES);
+ }
efi_set_u64_split((unsigned long)cmdline_ptr, &hdr->cmd_line_ptr,
- &boot_params.ext_cmd_line_ptr);
+ &boot_params->ext_cmd_line_ptr);
- efi_stub_entry(handle, sys_table_arg, &boot_params);
+ efi_stub_entry(handle, sys_table_arg, boot_params);
/* not reached */
-
-fail:
- efi_exit(handle, status);
}
static void add_e820ext(struct boot_params *params,
diff --git a/drivers/firmware/turris-mox-rwtm.c b/drivers/firmware/turris-mox-rwtm.c
index c2d34dc8ba46..c3d49fcc5330 100644
--- a/drivers/firmware/turris-mox-rwtm.c
+++ b/drivers/firmware/turris-mox-rwtm.c
@@ -2,7 +2,7 @@
/*
* Turris Mox rWTM firmware driver
*
- * Copyright (C) 2019 Marek Behún <kabel@kernel.org>
+ * Copyright (C) 2019, 2024 Marek Behún <kabel@kernel.org>
*/
#include <linux/armada-37xx-rwtm-mailbox.h>
@@ -174,6 +174,9 @@ static void mox_rwtm_rx_callback(struct mbox_client *cl, void *data)
struct mox_rwtm *rwtm = dev_get_drvdata(cl->dev);
struct armada_37xx_rwtm_rx_msg *msg = data;
+ if (completion_done(&rwtm->cmd_done))
+ return;
+
rwtm->reply = *msg;
complete(&rwtm->cmd_done);
}
@@ -199,9 +202,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
if (ret < 0)
return ret;
- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
- if (ret < 0)
- return ret;
+ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+ return -ETIMEDOUT;
ret = mox_get_status(MBOX_CMD_BOARD_INFO, reply->retval);
if (ret == -ENODATA) {
@@ -235,9 +237,8 @@ static int mox_get_board_info(struct mox_rwtm *rwtm)
if (ret < 0)
return ret;
- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
- if (ret < 0)
- return ret;
+ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+ return -ETIMEDOUT;
ret = mox_get_status(MBOX_CMD_ECDSA_PUB_KEY, reply->retval);
if (ret == -ENODATA) {
@@ -274,9 +275,8 @@ static int check_get_random_support(struct mox_rwtm *rwtm)
if (ret < 0)
return ret;
- ret = wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2);
- if (ret < 0)
- return ret;
+ if (!wait_for_completion_timeout(&rwtm->cmd_done, HZ / 2))
+ return -ETIMEDOUT;
return mox_get_status(MBOX_CMD_GET_RANDOM, rwtm->reply.retval);
}
@@ -499,6 +499,7 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
platform_set_drvdata(pdev, rwtm);
mutex_init(&rwtm->busy);
+ init_completion(&rwtm->cmd_done);
rwtm->mbox_client.dev = dev;
rwtm->mbox_client.rx_callback = mox_rwtm_rx_callback;
@@ -512,8 +513,6 @@ static int turris_mox_rwtm_probe(struct platform_device *pdev)
goto remove_files;
}
- init_completion(&rwtm->cmd_done);
-
ret = mox_get_board_info(rwtm);
if (ret < 0)
dev_warn(dev, "Cannot read board information: %i\n", ret);
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
index 157441dd0704..d4faa489bd5f 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_device.c
@@ -5815,7 +5815,7 @@ int amdgpu_device_baco_exit(struct drm_device *dev)
adev->nbio.funcs->enable_doorbell_interrupt)
adev->nbio.funcs->enable_doorbell_interrupt(adev, true);
- if (amdgpu_passthrough(adev) &&
+ if (amdgpu_passthrough(adev) && adev->nbio.funcs &&
adev->nbio.funcs->clear_doorbell_interrupt)
adev->nbio.funcs->clear_doorbell_interrupt(adev);
diff --git a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
index ea0fb079f942..fd98d2508a22 100644
--- a/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
+++ b/drivers/gpu/drm/amd/amdgpu/amdgpu_gmc.c
@@ -583,7 +583,6 @@ void amdgpu_gmc_noretry_set(struct amdgpu_device *adev)
struct amdgpu_gmc *gmc = &adev->gmc;
uint32_t gc_ver = adev->ip_versions[GC_HWIP][0];
bool noretry_default = (gc_ver == IP_VERSION(9, 0, 1) ||
- gc_ver == IP_VERSION(9, 3, 0) ||
gc_ver == IP_VERSION(9, 4, 0) ||
gc_ver == IP_VERSION(9, 4, 1) ||
gc_ver == IP_VERSION(9, 4, 2) ||
diff --git a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
index c7af36370b0d..38f57455bc74 100644
--- a/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
+++ b/drivers/gpu/drm/amd/amdgpu/sdma_v5_2.c
@@ -241,6 +241,14 @@ static void sdma_v5_2_ring_set_wptr(struct amdgpu_ring *ring)
DRM_DEBUG("calling WDOORBELL64(0x%08x, 0x%016llx)\n",
ring->doorbell_index, ring->wptr << 2);
WDOORBELL64(ring->doorbell_index, ring->wptr << 2);
+ /* SDMA seems to miss doorbells sometimes when powergating kicks in.
+ * Updating the wptr directly will wake it. This is only safe because
+ * we disallow gfxoff in begin_use() and then allow it again in end_use().
+ */
+ WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR),
+ lower_32_bits(ring->wptr << 2));
+ WREG32(sdma_v5_2_get_reg_offset(adev, ring->me, mmSDMA0_GFX_RB_WPTR_HI),
+ upper_32_bits(ring->wptr << 2));
} else {
DRM_DEBUG("Not using doorbell -- "
"mmSDMA%i_GFX_RB_WPTR == 0x%08x "
@@ -1705,6 +1713,10 @@ static void sdma_v5_2_ring_begin_use(struct amdgpu_ring *ring)
* but it shouldn't hurt for other parts since
* this GFXOFF will be disallowed anyway when SDMA is
* active, this just makes it explicit.
+ * sdma_v5_2_ring_set_wptr() takes advantage of this
+ * to update the wptr because sometimes SDMA seems to miss
+ * doorbells when entering PG. If you remove this, update
+ * sdma_v5_2_ring_set_wptr() as well!
*/
amdgpu_gfx_off_ctrl(adev, false);
}
diff --git a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
index a80e45300783..f4f3ca7aad60 100644
--- a/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
+++ b/drivers/gpu/drm/amd/display/dc/core/dc_surface.c
@@ -154,7 +154,8 @@ const struct dc_plane_status *dc_plane_get_status(
if (pipe_ctx->plane_state != plane_state)
continue;
- pipe_ctx->plane_state->status.is_flip_pending = false;
+ if (pipe_ctx->plane_state)
+ pipe_ctx->plane_state->status.is_flip_pending = false;
break;
}
diff --git a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
index f3257cf4b06f..3aab1caed2ac 100644
--- a/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
+++ b/drivers/gpu/drm/amd/pm/swsmu/smu13/smu_v13_0.c
@@ -79,8 +79,8 @@ MODULE_FIRMWARE("amdgpu/smu_13_0_10.bin");
#define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD_MASK 0x00000070L
#define PCIE_LC_LINK_WIDTH_CNTL__LC_LINK_WIDTH_RD__SHIFT 0x4
#define smnPCIE_LC_SPEED_CNTL 0x11140290
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xC000
-#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0xE
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE_MASK 0xE0
+#define PCIE_LC_SPEED_CNTL__LC_CURRENT_DATA_RATE__SHIFT 0x5
static const int link_width[] = {0, 1, 2, 4, 8, 12, 16};
static const int link_speed[] = {25, 50, 80, 160};
diff --git a/drivers/gpu/drm/display/drm_dp_mst_topology.c b/drivers/gpu/drm/display/drm_dp_mst_topology.c
index 72b2b171e533..805f8455b8d6 100644
--- a/drivers/gpu/drm/display/drm_dp_mst_topology.c
+++ b/drivers/gpu/drm/display/drm_dp_mst_topology.c
@@ -2923,7 +2923,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
/* FIXME: Actually do some real error handling here */
ret = drm_dp_mst_wait_tx_reply(mstb, txmsg);
- if (ret <= 0) {
+ if (ret < 0) {
drm_err(mgr->dev, "Sending link address failed with %d\n", ret);
goto out;
}
@@ -2975,7 +2975,7 @@ static int drm_dp_send_link_address(struct drm_dp_mst_topology_mgr *mgr,
mutex_unlock(&mgr->lock);
out:
- if (ret <= 0)
+ if (ret < 0)
mstb->link_address_sent = false;
kfree(txmsg);
return ret < 0 ? ret : changed;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_gem.c b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
index 5cf13e52f7c9..23d5058eca8d 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_gem.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_gem.c
@@ -355,9 +355,11 @@ static void *etnaviv_gem_vmap_impl(struct etnaviv_gem_object *obj)
static inline enum dma_data_direction etnaviv_op_to_dma_dir(u32 op)
{
- if (op & ETNA_PREP_READ)
+ op &= ETNA_PREP_READ | ETNA_PREP_WRITE;
+
+ if (op == ETNA_PREP_READ)
return DMA_FROM_DEVICE;
- else if (op & ETNA_PREP_WRITE)
+ else if (op == ETNA_PREP_WRITE)
return DMA_TO_DEVICE;
else
return DMA_BIDIRECTIONAL;
diff --git a/drivers/gpu/drm/etnaviv/etnaviv_sched.c b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
index 72e2553fbc98..5d506767b8f2 100644
--- a/drivers/gpu/drm/etnaviv/etnaviv_sched.c
+++ b/drivers/gpu/drm/etnaviv/etnaviv_sched.c
@@ -38,9 +38,6 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
u32 dma_addr;
int change;
- /* block scheduler */
- drm_sched_stop(&gpu->sched, sched_job);
-
/*
* If the GPU managed to complete this jobs fence, the timout is
* spurious. Bail out.
@@ -62,6 +59,9 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
goto out_no_timeout;
}
+ /* block scheduler */
+ drm_sched_stop(&gpu->sched, sched_job);
+
if(sched_job)
drm_sched_increase_karma(sched_job);
@@ -75,8 +75,7 @@ static enum drm_gpu_sched_stat etnaviv_sched_timedout_job(struct drm_sched_job
return DRM_GPU_SCHED_STAT_NOMINAL;
out_no_timeout:
- /* restart scheduler after GPU is usable again */
- drm_sched_start(&gpu->sched, true);
+ list_add(&sched_job->list, &sched_job->sched->pending_list);
return DRM_GPU_SCHED_STAT_NOMINAL;
}
diff --git a/drivers/gpu/drm/gma500/cdv_intel_lvds.c b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
index be6efcaaa3b3..c9ad16960e82 100644
--- a/drivers/gpu/drm/gma500/cdv_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/cdv_intel_lvds.c
@@ -309,6 +309,9 @@ static int cdv_intel_lvds_get_modes(struct drm_connector *connector)
if (mode_dev->panel_fixed_mode != NULL) {
struct drm_display_mode *mode =
drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+ if (!mode)
+ return 0;
+
drm_mode_probed_add(connector, mode);
return 1;
}
diff --git a/drivers/gpu/drm/gma500/psb_intel_lvds.c b/drivers/gpu/drm/gma500/psb_intel_lvds.c
index 7ee6c8ce103b..9842de0dad3a 100644
--- a/drivers/gpu/drm/gma500/psb_intel_lvds.c
+++ b/drivers/gpu/drm/gma500/psb_intel_lvds.c
@@ -502,6 +502,9 @@ static int psb_intel_lvds_get_modes(struct drm_connector *connector)
if (mode_dev->panel_fixed_mode != NULL) {
struct drm_display_mode *mode =
drm_mode_duplicate(dev, mode_dev->panel_fixed_mode);
+ if (!mode)
+ return 0;
+
drm_mode_probed_add(connector, mode);
return 1;
}
diff --git a/drivers/gpu/drm/i915/display/intel_dp.c b/drivers/gpu/drm/i915/display/intel_dp.c
index a27563bfd909..3f65d890b8a9 100644
--- a/drivers/gpu/drm/i915/display/intel_dp.c
+++ b/drivers/gpu/drm/i915/display/intel_dp.c
@@ -4089,6 +4089,8 @@ int intel_dp_retrain_link(struct intel_encoder *encoder,
!intel_dp_mst_is_master_trans(crtc_state))
continue;
+ intel_dp->link_trained = false;
+
intel_dp_check_frl_training(intel_dp);
intel_dp_pcon_dsc_configure(intel_dp, crtc_state);
intel_dp_start_link_train(intel_dp, crtc_state);
diff --git a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
index eae138b9f2df..321dbecba0f3 100644
--- a/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
+++ b/drivers/gpu/drm/i915/gt/intel_execlists_submission.c
@@ -3313,11 +3313,7 @@ static void remove_from_engine(struct i915_request *rq)
static bool can_preempt(struct intel_engine_cs *engine)
{
- if (GRAPHICS_VER(engine->i915) > 8)
- return true;
-
- /* GPGPU on bdw requires extra w/a; not implemented */
- return engine->class != RENDER_CLASS;
+ return GRAPHICS_VER(engine->i915) > 8;
}
static void kick_execlists(const struct i915_request *rq, int prio)
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_drv.c b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
index 25639fbfd374..905275df0980 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_drv.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_drv.c
@@ -598,6 +598,8 @@ static const struct of_device_id mtk_ddp_comp_dt_ids[] = {
.data = (void *)MTK_DISP_OVL },
{ .compatible = "mediatek,mt8192-disp-ovl",
.data = (void *)MTK_DISP_OVL },
+ { .compatible = "mediatek,mt8195-disp-ovl",
+ .data = (void *)MTK_DISP_OVL },
{ .compatible = "mediatek,mt8183-disp-ovl-2l",
.data = (void *)MTK_DISP_OVL_2L },
{ .compatible = "mediatek,mt8192-disp-ovl-2l",
diff --git a/drivers/gpu/drm/mediatek/mtk_drm_plane.c b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
index c4a0203d17e3..30d361671aa9 100644
--- a/drivers/gpu/drm/mediatek/mtk_drm_plane.c
+++ b/drivers/gpu/drm/mediatek/mtk_drm_plane.c
@@ -157,6 +157,8 @@ static void mtk_plane_atomic_async_update(struct drm_plane *plane,
plane->state->src_y = new_state->src_y;
plane->state->src_h = new_state->src_h;
plane->state->src_w = new_state->src_w;
+ plane->state->dst.x1 = new_state->dst.x1;
+ plane->state->dst.y1 = new_state->dst.y1;
mtk_plane_update_new_state(new_state, new_plane_state);
swap(plane->state->fb, new_state->fb);
diff --git a/drivers/gpu/drm/meson/meson_drv.c b/drivers/gpu/drm/meson/meson_drv.c
index fbac39aa38cc..f0df41cf39a3 100644
--- a/drivers/gpu/drm/meson/meson_drv.c
+++ b/drivers/gpu/drm/meson/meson_drv.c
@@ -249,29 +249,20 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
if (ret)
goto free_drm;
ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_0);
- if (ret) {
- meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
- goto free_drm;
- }
+ if (ret)
+ goto free_canvas_osd1;
ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_1);
- if (ret) {
- meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
- goto free_drm;
- }
+ if (ret)
+ goto free_canvas_vd1_0;
ret = meson_canvas_alloc(priv->canvas, &priv->canvas_id_vd1_2);
- if (ret) {
- meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
- meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
- goto free_drm;
- }
+ if (ret)
+ goto free_canvas_vd1_1;
priv->vsync_irq = platform_get_irq(pdev, 0);
ret = drm_vblank_init(drm, 1);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
/* Assign limits per soc revision/package */
for (i = 0 ; i < ARRAY_SIZE(meson_drm_soc_attrs) ; ++i) {
@@ -287,11 +278,11 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
*/
ret = drm_aperture_remove_framebuffers(&meson_driver);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
ret = drmm_mode_config_init(drm);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
drm->mode_config.max_width = 3840;
drm->mode_config.max_height = 2160;
drm->mode_config.funcs = &meson_mode_config_funcs;
@@ -306,7 +297,7 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
if (priv->afbcd.ops) {
ret = priv->afbcd.ops->init(priv);
if (ret)
- goto free_drm;
+ goto free_canvas_vd1_2;
}
/* Encoder Initialization */
@@ -364,6 +355,14 @@ static int meson_drv_bind_master(struct device *dev, bool has_components)
exit_afbcd:
if (priv->afbcd.ops)
priv->afbcd.ops->exit(priv);
+free_canvas_vd1_2:
+ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_2);
+free_canvas_vd1_1:
+ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_1);
+free_canvas_vd1_0:
+ meson_canvas_free(priv->canvas, priv->canvas_id_vd1_0);
+free_canvas_osd1:
+ meson_canvas_free(priv->canvas, priv->canvas_id_osd1);
free_drm:
drm_dev_put(drm);
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
index 3632f0768aa9..1bf41a82cd0f 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder.c
@@ -1653,8 +1653,7 @@ void dpu_encoder_trigger_kickoff_pending(struct drm_encoder *drm_enc)
phys = dpu_enc->phys_encs[i];
ctl = phys->hw_ctl;
- if (ctl->ops.clear_pending_flush)
- ctl->ops.clear_pending_flush(ctl);
+ ctl->ops.clear_pending_flush(ctl);
/* update only for command mode primary ctl */
if ((phys == dpu_enc->cur_master) &&
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
index 42c7e378d504..05a09d86e183 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_encoder_phys_wb.c
@@ -548,8 +548,7 @@ static void dpu_encoder_phys_wb_disable(struct dpu_encoder_phys *phys_enc)
}
/* reset h/w before final flush */
- if (phys_enc->hw_ctl->ops.clear_pending_flush)
- phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
+ phys_enc->hw_ctl->ops.clear_pending_flush(phys_enc->hw_ctl);
/*
* New CTL reset sequence from 5.0 MDP onwards.
diff --git a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
index 96c012ec8467..ec5265771cdf 100644
--- a/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
+++ b/drivers/gpu/drm/msm/disp/dpu1/dpu_hw_ctl.h
@@ -81,7 +81,8 @@ struct dpu_hw_ctl_ops {
/**
* Clear the value of the cached pending_flush_mask
- * No effect on hardware
+ * No effect on hardware.
+ * Required to be implemented.
* @ctx : ctl path ctx pointer
*/
void (*clear_pending_flush)(struct dpu_hw_ctl *ctx);
diff --git a/drivers/gpu/drm/msm/dsi/dsi_host.c b/drivers/gpu/drm/msm/dsi/dsi_host.c
index cd9ca3690161..034ad810fd65 100644
--- a/drivers/gpu/drm/msm/dsi/dsi_host.c
+++ b/drivers/gpu/drm/msm/dsi/dsi_host.c
@@ -848,6 +848,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
u32 slice_per_intf, total_bytes_per_intf;
u32 pkt_per_line;
u32 eol_byte_num;
+ u32 bytes_per_pkt;
/* first calculate dsc parameters and then program
* compress mode registers
@@ -855,6 +856,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
slice_per_intf = DIV_ROUND_UP(hdisplay, dsc->slice_width);
total_bytes_per_intf = dsc->slice_chunk_size * slice_per_intf;
+ bytes_per_pkt = dsc->slice_chunk_size; /* * slice_per_pkt; */
eol_byte_num = total_bytes_per_intf % 3;
@@ -892,6 +894,7 @@ static void dsi_update_dsc_timing(struct msm_dsi_host *msm_host, bool is_cmd_mod
dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL, reg_ctrl);
dsi_write(msm_host, REG_DSI_COMMAND_COMPRESSION_MODE_CTRL2, reg_ctrl2);
} else {
+ reg |= DSI_VIDEO_COMPRESSION_MODE_CTRL_WC(bytes_per_pkt);
dsi_write(msm_host, REG_DSI_VIDEO_COMPRESSION_MODE_CTRL, reg);
}
}
diff --git a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
index 1c008bd9102f..820d8d29b62b 100644
--- a/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
+++ b/drivers/gpu/drm/panel/panel-boe-tv101wum-nl6.c
@@ -1271,7 +1271,11 @@ static int boe_panel_prepare(struct drm_panel *panel)
usleep_range(10000, 11000);
if (boe->desc->lp11_before_reset) {
- mipi_dsi_dcs_nop(boe->dsi);
+ ret = mipi_dsi_dcs_nop(boe->dsi);
+ if (ret < 0) {
+ dev_err(&boe->dsi->dev, "Failed to send NOP: %d\n", ret);
+ goto poweroff;
+ }
usleep_range(1000, 2000);
}
gpiod_set_value(boe->enable_gpio, 1);
@@ -1292,13 +1296,13 @@ static int boe_panel_prepare(struct drm_panel *panel)
return 0;
poweroff:
+ gpiod_set_value(boe->enable_gpio, 0);
regulator_disable(boe->avee);
poweroffavdd:
regulator_disable(boe->avdd);
poweroff1v8:
usleep_range(5000, 7000);
regulator_disable(boe->pp1800);
- gpiod_set_value(boe->enable_gpio, 0);
return ret;
}
diff --git a/drivers/gpu/drm/panfrost/panfrost_drv.c b/drivers/gpu/drm/panfrost/panfrost_drv.c
index 919e6cc04982..3c0aa8b5e1ae 100644
--- a/drivers/gpu/drm/panfrost/panfrost_drv.c
+++ b/drivers/gpu/drm/panfrost/panfrost_drv.c
@@ -704,3 +704,4 @@ module_platform_driver(panfrost_driver);
MODULE_AUTHOR("Panfrost Project Developers");
MODULE_DESCRIPTION("Panfrost DRM Driver");
MODULE_LICENSE("GPL v2");
+MODULE_SOFTDEP("pre: governor_simpleondemand");
diff --git a/drivers/gpu/drm/qxl/qxl_display.c b/drivers/gpu/drm/qxl/qxl_display.c
index f91a86225d5e..462a4d2ac0b9 100644
--- a/drivers/gpu/drm/qxl/qxl_display.c
+++ b/drivers/gpu/drm/qxl/qxl_display.c
@@ -236,6 +236,9 @@ static int qxl_add_mode(struct drm_connector *connector,
return 0;
mode = drm_cvt_mode(dev, width, height, 60, false, false, false);
+ if (!mode)
+ return 0;
+
if (preferred)
mode->type |= DRM_MODE_TYPE_PREFERRED;
mode->hdisplay = width;
diff --git a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
index a72642bb9cc6..80b8c8334284 100644
--- a/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
+++ b/drivers/gpu/drm/rockchip/rockchip_drm_vop2.c
@@ -1923,7 +1923,7 @@ static void vop2_setup_layer_mixer(struct vop2_video_port *vp)
port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX,
(vp2->nlayers + vp1->nlayers + vp0->nlayers - 1));
else
- port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT1_MUX, 8);
+ port_sel |= FIELD_PREP(RK3568_OVL_PORT_SET__PORT2_MUX, 8);
layer_sel = vop2_readl(vop2, RK3568_OVL_LAYER_SEL);
diff --git a/drivers/hwmon/adt7475.c b/drivers/hwmon/adt7475.c
index 6a6ebcc896b1..3ac674427675 100644
--- a/drivers/hwmon/adt7475.c
+++ b/drivers/hwmon/adt7475.c
@@ -1863,7 +1863,7 @@ static void adt7475_read_pwm(struct i2c_client *client, int index)
data->pwm[CONTROL][index] &= ~0xE0;
data->pwm[CONTROL][index] |= (7 << 5);
- i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
+ i2c_smbus_write_byte_data(client, PWM_REG(index),
data->pwm[INPUT][index]);
i2c_smbus_write_byte_data(client, PWM_CONFIG_REG(index),
diff --git a/drivers/hwmon/max6697.c b/drivers/hwmon/max6697.c
index 2895cea54193..266baae94e3e 100644
--- a/drivers/hwmon/max6697.c
+++ b/drivers/hwmon/max6697.c
@@ -312,6 +312,7 @@ static ssize_t temp_store(struct device *dev,
return ret;
mutex_lock(&data->update_lock);
+ temp = clamp_val(temp, -1000000, 1000000); /* prevent underflow */
temp = DIV_ROUND_CLOSEST(temp, 1000) + data->temp_offset;
temp = clamp_val(temp, 0, data->type == max6581 ? 255 : 127);
data->temp[nr][index] = temp;
@@ -429,14 +430,14 @@ static SENSOR_DEVICE_ATTR_RO(temp6_max_alarm, alarm, 20);
static SENSOR_DEVICE_ATTR_RO(temp7_max_alarm, alarm, 21);
static SENSOR_DEVICE_ATTR_RO(temp8_max_alarm, alarm, 23);
-static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 14);
+static SENSOR_DEVICE_ATTR_RO(temp1_crit_alarm, alarm, 15);
static SENSOR_DEVICE_ATTR_RO(temp2_crit_alarm, alarm, 8);
static SENSOR_DEVICE_ATTR_RO(temp3_crit_alarm, alarm, 9);
static SENSOR_DEVICE_ATTR_RO(temp4_crit_alarm, alarm, 10);
static SENSOR_DEVICE_ATTR_RO(temp5_crit_alarm, alarm, 11);
static SENSOR_DEVICE_ATTR_RO(temp6_crit_alarm, alarm, 12);
static SENSOR_DEVICE_ATTR_RO(temp7_crit_alarm, alarm, 13);
-static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 15);
+static SENSOR_DEVICE_ATTR_RO(temp8_crit_alarm, alarm, 14);
static SENSOR_DEVICE_ATTR_RO(temp2_fault, alarm, 1);
static SENSOR_DEVICE_ATTR_RO(temp3_fault, alarm, 2);
diff --git a/drivers/hwtracing/coresight/coresight-platform.c b/drivers/hwtracing/coresight/coresight-platform.c
index 475899714104..3f82ae07a18e 100644
--- a/drivers/hwtracing/coresight/coresight-platform.c
+++ b/drivers/hwtracing/coresight/coresight-platform.c
@@ -323,8 +323,10 @@ static int of_get_coresight_platform_data(struct device *dev,
continue;
ret = of_coresight_parse_endpoint(dev, ep, pdata);
- if (ret)
+ if (ret) {
+ of_node_put(ep);
return ret;
+ }
}
return 0;
diff --git a/drivers/iio/frequency/adrf6780.c b/drivers/iio/frequency/adrf6780.c
index b4defb82f37e..3f46032c9275 100644
--- a/drivers/iio/frequency/adrf6780.c
+++ b/drivers/iio/frequency/adrf6780.c
@@ -9,7 +9,6 @@
#include <linux/bits.h>
#include <linux/clk.h>
#include <linux/clkdev.h>
-#include <linux/clk-provider.h>
#include <linux/delay.h>
#include <linux/device.h>
#include <linux/iio/iio.h>
diff --git a/drivers/infiniband/core/cache.c b/drivers/infiniband/core/cache.c
index 4084d05a4510..c319664ca74b 100644
--- a/drivers/infiniband/core/cache.c
+++ b/drivers/infiniband/core/cache.c
@@ -794,7 +794,6 @@ static struct ib_gid_table *alloc_gid_table(int sz)
static void release_gid_table(struct ib_device *device,
struct ib_gid_table *table)
{
- bool leak = false;
int i;
if (!table)
@@ -803,15 +802,12 @@ static void release_gid_table(struct ib_device *device,
for (i = 0; i < table->sz; i++) {
if (is_gid_entry_free(table->data_vec[i]))
continue;
- if (kref_read(&table->data_vec[i]->kref) > 1) {
- dev_err(&device->dev,
- "GID entry ref leak for index %d ref=%u\n", i,
- kref_read(&table->data_vec[i]->kref));
- leak = true;
- }
+
+ WARN_ONCE(true,
+ "GID entry ref leak for dev %s index %d ref=%u\n",
+ dev_name(&device->dev), i,
+ kref_read(&table->data_vec[i]->kref));
}
- if (leak)
- return;
mutex_destroy(&table->lock);
kfree(table->data_vec);
diff --git a/drivers/infiniband/core/device.c b/drivers/infiniband/core/device.c
index 453188db39d8..291ded20934c 100644
--- a/drivers/infiniband/core/device.c
+++ b/drivers/infiniband/core/device.c
@@ -2146,6 +2146,9 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
unsigned long flags;
int ret;
+ if (!rdma_is_port_valid(ib_dev, port))
+ return -EINVAL;
+
/*
* Drivers wish to call this before ib_register_driver, so we have to
* setup the port data early.
@@ -2154,9 +2157,6 @@ int ib_device_set_netdev(struct ib_device *ib_dev, struct net_device *ndev,
if (ret)
return ret;
- if (!rdma_is_port_valid(ib_dev, port))
- return -EINVAL;
-
pdata = &ib_dev->port_data[port];
spin_lock_irqsave(&pdata->netdev_lock, flags);
old_ndev = rcu_dereference_protected(
diff --git a/drivers/infiniband/core/iwcm.c b/drivers/infiniband/core/iwcm.c
index 2b47073c61a6..2d09d1be38f1 100644
--- a/drivers/infiniband/core/iwcm.c
+++ b/drivers/infiniband/core/iwcm.c
@@ -369,8 +369,10 @@ EXPORT_SYMBOL(iw_cm_disconnect);
*
* Clean up all resources associated with the connection and release
* the initial reference taken by iw_create_cm_id.
+ *
+ * Returns true if and only if the last cm_id_priv reference has been dropped.
*/
-static void destroy_cm_id(struct iw_cm_id *cm_id)
+static bool destroy_cm_id(struct iw_cm_id *cm_id)
{
struct iwcm_id_private *cm_id_priv;
struct ib_qp *qp;
@@ -440,7 +442,7 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
iwpm_remove_mapping(&cm_id->local_addr, RDMA_NL_IWCM);
}
- (void)iwcm_deref_id(cm_id_priv);
+ return iwcm_deref_id(cm_id_priv);
}
/*
@@ -451,7 +453,8 @@ static void destroy_cm_id(struct iw_cm_id *cm_id)
*/
void iw_destroy_cm_id(struct iw_cm_id *cm_id)
{
- destroy_cm_id(cm_id);
+ if (!destroy_cm_id(cm_id))
+ flush_workqueue(iwcm_wq);
}
EXPORT_SYMBOL(iw_destroy_cm_id);
@@ -1035,7 +1038,7 @@ static void cm_work_handler(struct work_struct *_work)
if (!test_bit(IWCM_F_DROP_EVENTS, &cm_id_priv->flags)) {
ret = process_event(cm_id_priv, &levent);
if (ret)
- destroy_cm_id(&cm_id_priv->id);
+ WARN_ON_ONCE(destroy_cm_id(&cm_id_priv->id));
} else
pr_debug("dropping event %d\n", levent.event);
if (iwcm_deref_id(cm_id_priv))
diff --git a/drivers/infiniband/hw/bnxt_re/ib_verbs.c b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
index 6ed0568747ea..4c34cb1cb786 100644
--- a/drivers/infiniband/hw/bnxt_re/ib_verbs.c
+++ b/drivers/infiniband/hw/bnxt_re/ib_verbs.c
@@ -2359,7 +2359,7 @@ static int bnxt_re_build_send_wqe(struct bnxt_re_qp *qp,
break;
case IB_WR_SEND_WITH_IMM:
wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_IMM;
- wqe->send.imm_data = wr->ex.imm_data;
+ wqe->send.imm_data = be32_to_cpu(wr->ex.imm_data);
break;
case IB_WR_SEND_WITH_INV:
wqe->type = BNXT_QPLIB_SWQE_TYPE_SEND_WITH_INV;
@@ -2389,7 +2389,7 @@ static int bnxt_re_build_rdma_wqe(const struct ib_send_wr *wr,
break;
case IB_WR_RDMA_WRITE_WITH_IMM:
wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_WRITE_WITH_IMM;
- wqe->rdma.imm_data = wr->ex.imm_data;
+ wqe->rdma.imm_data = be32_to_cpu(wr->ex.imm_data);
break;
case IB_WR_RDMA_READ:
wqe->type = BNXT_QPLIB_SWQE_TYPE_RDMA_READ;
@@ -3340,7 +3340,7 @@ static void bnxt_re_process_res_shadow_qp_wc(struct bnxt_re_qp *gsi_sqp,
wc->byte_len = orig_cqe->length;
wc->qp = &gsi_qp->ib_qp;
- wc->ex.imm_data = orig_cqe->immdata;
+ wc->ex.imm_data = cpu_to_be32(le32_to_cpu(orig_cqe->immdata));
wc->src_qp = orig_cqe->src_qp;
memcpy(wc->smac, orig_cqe->smac, ETH_ALEN);
if (bnxt_re_is_vlan_pkt(orig_cqe, &vlan_id, &sl)) {
@@ -3476,7 +3476,7 @@ int bnxt_re_poll_cq(struct ib_cq *ib_cq, int num_entries, struct ib_wc *wc)
(unsigned long)(cqe->qp_handle),
struct bnxt_re_qp, qplib_qp);
wc->qp = &qp->ib_qp;
- wc->ex.imm_data = cqe->immdata;
+ wc->ex.imm_data = cpu_to_be32(le32_to_cpu(cqe->immdata));
wc->src_qp = cqe->src_qp;
memcpy(wc->smac, cqe->smac, ETH_ALEN);
wc->port_num = 1;
diff --git a/drivers/infiniband/hw/bnxt_re/qplib_fp.h b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
index 49d89c080827..4f1a845f9be6 100644
--- a/drivers/infiniband/hw/bnxt_re/qplib_fp.h
+++ b/drivers/infiniband/hw/bnxt_re/qplib_fp.h
@@ -164,7 +164,7 @@ struct bnxt_qplib_swqe {
/* Send, with imm, inval key */
struct {
union {
- __be32 imm_data;
+ u32 imm_data;
u32 inv_key;
};
u32 q_key;
@@ -182,7 +182,7 @@ struct bnxt_qplib_swqe {
/* RDMA write, with imm, read */
struct {
union {
- __be32 imm_data;
+ u32 imm_data;
u32 inv_key;
};
u64 remote_va;
@@ -374,7 +374,7 @@ struct bnxt_qplib_cqe {
u16 cfa_meta;
u64 wr_id;
union {
- __be32 immdata;
+ __le32 immdata;
u32 invrkey;
};
u64 qp_handle;
diff --git a/drivers/infiniband/hw/hns/hns_roce_device.h b/drivers/infiniband/hw/hns/hns_roce_device.h
index 8748b65c87ea..a2bdfa026c56 100644
--- a/drivers/infiniband/hw/hns/hns_roce_device.h
+++ b/drivers/infiniband/hw/hns/hns_roce_device.h
@@ -82,6 +82,7 @@
#define MR_TYPE_DMA 0x03
#define HNS_ROCE_FRMR_MAX_PA 512
+#define HNS_ROCE_FRMR_ALIGN_SIZE 128
#define PKEY_ID 0xffff
#define NODE_DESC_SIZE 64
@@ -90,6 +91,8 @@
/* Configure to HW for PAGE_SIZE larger than 4KB */
#define PG_SHIFT_OFFSET (PAGE_SHIFT - 12)
+#define ATOMIC_WR_LEN 8
+
#define HNS_ROCE_IDX_QUE_ENTRY_SZ 4
#define SRQ_DB_REG 0x230
@@ -180,6 +183,9 @@ enum {
#define HNS_HW_PAGE_SHIFT 12
#define HNS_HW_PAGE_SIZE (1 << HNS_HW_PAGE_SHIFT)
+#define HNS_HW_MAX_PAGE_SHIFT 27
+#define HNS_HW_MAX_PAGE_SIZE (1 << HNS_HW_MAX_PAGE_SHIFT)
+
struct hns_roce_uar {
u64 pfn;
unsigned long index;
diff --git a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
index c931cce50d50..c4521ab66ee4 100644
--- a/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
+++ b/drivers/infiniband/hw/hns/hns_roce_hw_v2.c
@@ -602,11 +602,16 @@ static inline int set_rc_wqe(struct hns_roce_qp *qp,
(wr->send_flags & IB_SEND_SIGNALED) ? 1 : 0);
if (wr->opcode == IB_WR_ATOMIC_CMP_AND_SWP ||
- wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD)
+ wr->opcode == IB_WR_ATOMIC_FETCH_AND_ADD) {
+ if (msg_len != ATOMIC_WR_LEN)
+ return -EINVAL;
set_atomic_seg(wr, rc_sq_wqe, valid_num_sge);
- else if (wr->opcode != IB_WR_REG_MR)
+ } else if (wr->opcode != IB_WR_REG_MR) {
ret = set_rwqe_data_seg(&qp->ibqp, wr, rc_sq_wqe,
&curr_idx, valid_num_sge);
+ if (ret)
+ return ret;
+ }
/*
* The pipeline can sequentially post all valid WQEs into WQ buffer,
@@ -2569,14 +2574,16 @@ static int set_llm_cfg_to_hw(struct hns_roce_dev *hr_dev,
static struct hns_roce_link_table *
alloc_link_table_buf(struct hns_roce_dev *hr_dev)
{
+ u16 total_sl = hr_dev->caps.sl_num * hr_dev->func_num;
struct hns_roce_v2_priv *priv = hr_dev->priv;
struct hns_roce_link_table *link_tbl;
u32 pg_shift, size, min_size;
link_tbl = &priv->ext_llm;
pg_shift = hr_dev->caps.llm_buf_pg_sz + PAGE_SHIFT;
- size = hr_dev->caps.num_qps * HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
- min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(hr_dev->caps.sl_num) << pg_shift;
+ size = hr_dev->caps.num_qps * hr_dev->func_num *
+ HNS_ROCE_V2_EXT_LLM_ENTRY_SZ;
+ min_size = HNS_ROCE_EXT_LLM_MIN_PAGES(total_sl) << pg_shift;
/* Alloc data table */
size = max(size, min_size);
@@ -6413,9 +6420,16 @@ static void hns_roce_v2_int_mask_enable(struct hns_roce_dev *hr_dev,
roce_write(hr_dev, ROCEE_VF_ABN_INT_CFG_REG, enable_flag);
}
-static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
+static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
+{
+ hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+}
+
+static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev,
+ struct hns_roce_eq *eq)
{
struct device *dev = hr_dev->dev;
+ int eqn = eq->eqn;
int ret;
u8 cmd;
@@ -6426,12 +6440,9 @@ static void hns_roce_v2_destroy_eqc(struct hns_roce_dev *hr_dev, u32 eqn)
ret = hns_roce_destroy_hw_ctx(hr_dev, cmd, eqn & HNS_ROCE_V2_EQN_M);
if (ret)
- dev_err(dev, "[mailbox cmd] destroy eqc(%u) failed.\n", eqn);
-}
+ dev_err(dev, "[mailbox cmd] destroy eqc(%d) failed.\n", eqn);
-static void free_eq_buf(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
-{
- hns_roce_mtr_destroy(hr_dev, &eq->mtr);
+ free_eq_buf(hr_dev, eq);
}
static void init_eq_config(struct hns_roce_dev *hr_dev, struct hns_roce_eq *eq)
@@ -6737,7 +6748,7 @@ static int hns_roce_v2_init_eq_table(struct hns_roce_dev *hr_dev)
err_create_eq_fail:
for (i -= 1; i >= 0; i--)
- free_eq_buf(hr_dev, &eq_table->eq[i]);
+ hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
kfree(eq_table->eq);
return ret;
@@ -6757,11 +6768,8 @@ static void hns_roce_v2_cleanup_eq_table(struct hns_roce_dev *hr_dev)
__hns_roce_free_irq(hr_dev);
destroy_workqueue(hr_dev->irq_workq);
- for (i = 0; i < eq_num; i++) {
- hns_roce_v2_destroy_eqc(hr_dev, i);
-
- free_eq_buf(hr_dev, &eq_table->eq[i]);
- }
+ for (i = 0; i < eq_num; i++)
+ hns_roce_v2_destroy_eqc(hr_dev, &eq_table->eq[i]);
kfree(eq_table->eq);
}
diff --git a/drivers/infiniband/hw/hns/hns_roce_mr.c b/drivers/infiniband/hw/hns/hns_roce_mr.c
index 190e62da98e4..980261969b0c 100644
--- a/drivers/infiniband/hw/hns/hns_roce_mr.c
+++ b/drivers/infiniband/hw/hns/hns_roce_mr.c
@@ -423,6 +423,11 @@ int hns_roce_map_mr_sg(struct ib_mr *ibmr, struct scatterlist *sg, int sg_nents,
struct hns_roce_mtr *mtr = &mr->pbl_mtr;
int ret, sg_num = 0;
+ if (!IS_ALIGNED(*sg_offset, HNS_ROCE_FRMR_ALIGN_SIZE) ||
+ ibmr->page_size < HNS_HW_PAGE_SIZE ||
+ ibmr->page_size > HNS_HW_MAX_PAGE_SIZE)
+ return sg_num;
+
mr->npages = 0;
mr->page_list = kvcalloc(mr->pbl_mtr.hem_cfg.buf_pg_count,
sizeof(dma_addr_t), GFP_KERNEL);
diff --git a/drivers/infiniband/hw/hns/hns_roce_qp.c b/drivers/infiniband/hw/hns/hns_roce_qp.c
index 7b79e6b3f3ba..c97b5dba1772 100644
--- a/drivers/infiniband/hw/hns/hns_roce_qp.c
+++ b/drivers/infiniband/hw/hns/hns_roce_qp.c
@@ -538,13 +538,15 @@ static unsigned int get_sge_num_from_max_inl_data(bool is_ud_or_gsi,
{
unsigned int inline_sge;
- inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
+ if (!max_inline_data)
+ return 0;
/*
* if max_inline_data less than
* HNS_ROCE_SGE_IN_WQE * HNS_ROCE_SGE_SIZE,
* In addition to ud's mode, no need to extend sge.
*/
+ inline_sge = roundup_pow_of_two(max_inline_data) / HNS_ROCE_SGE_SIZE;
if (!is_ud_or_gsi && inline_sge <= HNS_ROCE_SGE_IN_WQE)
inline_sge = 0;
diff --git a/drivers/infiniband/hw/hns/hns_roce_srq.c b/drivers/infiniband/hw/hns/hns_roce_srq.c
index 6a4923c21cbc..727f92650071 100644
--- a/drivers/infiniband/hw/hns/hns_roce_srq.c
+++ b/drivers/infiniband/hw/hns/hns_roce_srq.c
@@ -296,7 +296,7 @@ static int set_srq_basic_param(struct hns_roce_srq *srq,
max_sge = proc_srq_sge(hr_dev, srq, !!udata);
if (attr->max_wr > hr_dev->caps.max_srq_wrs ||
- attr->max_sge > max_sge) {
+ attr->max_sge > max_sge || !attr->max_sge) {
ibdev_err(&hr_dev->ib_dev,
"invalid SRQ attr, depth = %u, sge = %u.\n",
attr->max_wr, attr->max_sge);
diff --git a/drivers/infiniband/hw/mlx4/alias_GUID.c b/drivers/infiniband/hw/mlx4/alias_GUID.c
index 111fa88a3be4..9a439569ffcf 100644
--- a/drivers/infiniband/hw/mlx4/alias_GUID.c
+++ b/drivers/infiniband/hw/mlx4/alias_GUID.c
@@ -829,7 +829,7 @@ void mlx4_ib_destroy_alias_guid_service(struct mlx4_ib_dev *dev)
int mlx4_ib_init_alias_guid_service(struct mlx4_ib_dev *dev)
{
- char alias_wq_name[15];
+ char alias_wq_name[22];
int ret = 0;
int i, j;
union ib_gid gid;
diff --git a/drivers/infiniband/hw/mlx4/mad.c b/drivers/infiniband/hw/mlx4/mad.c
index a37cfac5e23f..dc9cf45d2d32 100644
--- a/drivers/infiniband/hw/mlx4/mad.c
+++ b/drivers/infiniband/hw/mlx4/mad.c
@@ -2158,7 +2158,7 @@ static int mlx4_ib_alloc_demux_ctx(struct mlx4_ib_dev *dev,
struct mlx4_ib_demux_ctx *ctx,
int port)
{
- char name[12];
+ char name[21];
int ret = 0;
int i;
diff --git a/drivers/infiniband/hw/mlx5/mlx5_ib.h b/drivers/infiniband/hw/mlx5/mlx5_ib.h
index 8d94e6834e01..0ef347e91ffe 100644
--- a/drivers/infiniband/hw/mlx5/mlx5_ib.h
+++ b/drivers/infiniband/hw/mlx5/mlx5_ib.h
@@ -109,6 +109,19 @@ unsigned long __mlx5_umem_find_best_quantized_pgoff(
__mlx5_bit_sz(typ, page_offset_fld), 0, scale, \
page_offset_quantized)
+static inline unsigned long
+mlx5_umem_dmabuf_find_best_pgsz(struct ib_umem_dmabuf *umem_dmabuf)
+{
+ /*
+ * mkeys used for dmabuf are fixed at PAGE_SIZE because we must be able
+ * to hold any sgl after a move operation. Ideally the mkc page size
+ * could be changed at runtime to be optimal, but right now the driver
+ * cannot do that.
+ */
+ return ib_umem_find_best_pgsz(&umem_dmabuf->umem, PAGE_SIZE,
+ umem_dmabuf->umem.iova);
+}
+
enum {
MLX5_IB_MMAP_OFFSET_START = 9,
MLX5_IB_MMAP_OFFSET_END = 255,
diff --git a/drivers/infiniband/hw/mlx5/odp.c b/drivers/infiniband/hw/mlx5/odp.c
index bc97958818bb..af73c5ebe6ac 100644
--- a/drivers/infiniband/hw/mlx5/odp.c
+++ b/drivers/infiniband/hw/mlx5/odp.c
@@ -706,10 +706,8 @@ static int pagefault_dmabuf_mr(struct mlx5_ib_mr *mr, size_t bcnt,
return err;
}
- page_size = mlx5_umem_find_best_pgsz(&umem_dmabuf->umem, mkc,
- log_page_size, 0,
- umem_dmabuf->umem.iova);
- if (unlikely(page_size < PAGE_SIZE)) {
+ page_size = mlx5_umem_dmabuf_find_best_pgsz(umem_dmabuf);
+ if (!page_size) {
ib_umem_dmabuf_unmap_pages(umem_dmabuf);
err = -EINVAL;
} else {
diff --git a/drivers/infiniband/sw/rxe/rxe_req.c b/drivers/infiniband/sw/rxe/rxe_req.c
index 2ace1007a419..35768fdbd5b7 100644
--- a/drivers/infiniband/sw/rxe/rxe_req.c
+++ b/drivers/infiniband/sw/rxe/rxe_req.c
@@ -390,7 +390,7 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
int paylen;
int solicited;
u32 qp_num;
- int ack_req;
+ int ack_req = 0;
/* length from start of bth to end of icrc */
paylen = rxe_opcode[opcode].length + payload + pad + RXE_ICRC_SIZE;
@@ -411,8 +411,9 @@ static struct sk_buff *init_req_packet(struct rxe_qp *qp,
qp_num = (pkt->mask & RXE_DETH_MASK) ? ibwr->wr.ud.remote_qpn :
qp->attr.dest_qp_num;
- ack_req = ((pkt->mask & RXE_END_MASK) ||
- (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
+ if (qp_type(qp) != IB_QPT_UD && qp_type(qp) != IB_QPT_UC)
+ ack_req = ((pkt->mask & RXE_END_MASK) ||
+ (qp->req.noack_pkts++ > RXE_MAX_PKT_PER_ACK));
if (ack_req)
qp->req.noack_pkts = 0;
diff --git a/drivers/input/keyboard/qt1050.c b/drivers/input/keyboard/qt1050.c
index 403060d05c3b..7193a4198e21 100644
--- a/drivers/input/keyboard/qt1050.c
+++ b/drivers/input/keyboard/qt1050.c
@@ -226,7 +226,12 @@ static bool qt1050_identify(struct qt1050_priv *ts)
int err;
/* Read Chip ID */
- regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+ err = regmap_read(ts->regmap, QT1050_CHIP_ID, &val);
+ if (err) {
+ dev_err(&ts->client->dev, "Failed to read chip ID: %d\n", err);
+ return false;
+ }
+
if (val != QT1050_CHIP_ID_VER) {
dev_err(&ts->client->dev, "ID %d not supported\n", val);
return false;
diff --git a/drivers/input/mouse/elan_i2c_core.c b/drivers/input/mouse/elan_i2c_core.c
index d4eb59b55bf1..5fa0d6ef627b 100644
--- a/drivers/input/mouse/elan_i2c_core.c
+++ b/drivers/input/mouse/elan_i2c_core.c
@@ -1372,6 +1372,8 @@ static int __maybe_unused elan_suspend(struct device *dev)
}
err:
+ if (ret)
+ enable_irq(client->irq);
mutex_unlock(&data->sysfs_mutex);
return ret;
}
diff --git a/drivers/interconnect/qcom/qcm2290.c b/drivers/interconnect/qcom/qcm2290.c
index ca7ad37ea677..d75bb918e1bb 100644
--- a/drivers/interconnect/qcom/qcm2290.c
+++ b/drivers/interconnect/qcom/qcm2290.c
@@ -166,7 +166,7 @@ static struct qcom_icc_node mas_snoc_bimc = {
.qos.ap_owned = true,
.qos.qos_port = 6,
.qos.qos_mode = NOC_QOS_MODE_BYPASS,
- .mas_rpm_id = 164,
+ .mas_rpm_id = 3,
.slv_rpm_id = -1,
.num_links = ARRAY_SIZE(mas_snoc_bimc_links),
.links = mas_snoc_bimc_links,
diff --git a/drivers/iommu/intel/iommu.c b/drivers/iommu/intel/iommu.c
index e111b35a7aff..7b9502c30fe9 100644
--- a/drivers/iommu/intel/iommu.c
+++ b/drivers/iommu/intel/iommu.c
@@ -113,13 +113,17 @@ static inline unsigned long lvl_to_nr_pages(unsigned int lvl)
/* VT-d pages must always be _smaller_ than MM pages. Otherwise things
are never going to work. */
-static inline unsigned long mm_to_dma_pfn(unsigned long mm_pfn)
+static inline unsigned long mm_to_dma_pfn_start(unsigned long mm_pfn)
{
return mm_pfn << (PAGE_SHIFT - VTD_PAGE_SHIFT);
}
+static inline unsigned long mm_to_dma_pfn_end(unsigned long mm_pfn)
+{
+ return ((mm_pfn + 1) << (PAGE_SHIFT - VTD_PAGE_SHIFT)) - 1;
+}
static inline unsigned long page_to_dma_pfn(struct page *pg)
{
- return mm_to_dma_pfn(page_to_pfn(pg));
+ return mm_to_dma_pfn_start(page_to_pfn(pg));
}
static inline unsigned long virt_to_dma_pfn(void *p)
{
@@ -2439,8 +2443,8 @@ static int __init si_domain_init(int hw)
for_each_mem_pfn_range(i, nid, &start_pfn, &end_pfn, NULL) {
ret = iommu_domain_identity_map(si_domain,
- mm_to_dma_pfn(start_pfn),
- mm_to_dma_pfn(end_pfn));
+ mm_to_dma_pfn_start(start_pfn),
+ mm_to_dma_pfn_end(end_pfn-1));
if (ret)
return ret;
}
@@ -2461,8 +2465,8 @@ static int __init si_domain_init(int hw)
continue;
ret = iommu_domain_identity_map(si_domain,
- mm_to_dma_pfn(start >> PAGE_SHIFT),
- mm_to_dma_pfn(end >> PAGE_SHIFT));
+ mm_to_dma_pfn_start(start >> PAGE_SHIFT),
+ mm_to_dma_pfn_end(end >> PAGE_SHIFT));
if (ret)
return ret;
}
@@ -3698,8 +3702,8 @@ static int intel_iommu_memory_notifier(struct notifier_block *nb,
unsigned long val, void *v)
{
struct memory_notify *mhp = v;
- unsigned long start_vpfn = mm_to_dma_pfn(mhp->start_pfn);
- unsigned long last_vpfn = mm_to_dma_pfn(mhp->start_pfn +
+ unsigned long start_vpfn = mm_to_dma_pfn_start(mhp->start_pfn);
+ unsigned long last_vpfn = mm_to_dma_pfn_end(mhp->start_pfn +
mhp->nr_pages - 1);
switch (val) {
@@ -4401,7 +4405,7 @@ static void intel_iommu_tlb_sync(struct iommu_domain *domain,
unsigned long i;
nrpages = aligned_nrpages(gather->start, size);
- start_pfn = mm_to_dma_pfn(iova_pfn);
+ start_pfn = mm_to_dma_pfn_start(iova_pfn);
xa_for_each(&dmar_domain->iommu_array, i, info)
iommu_flush_iotlb_psi(info->iommu, dmar_domain,
diff --git a/drivers/iommu/sprd-iommu.c b/drivers/iommu/sprd-iommu.c
index e4358393fe37..71d22daaec2e 100644
--- a/drivers/iommu/sprd-iommu.c
+++ b/drivers/iommu/sprd-iommu.c
@@ -234,8 +234,8 @@ static void sprd_iommu_cleanup(struct sprd_iommu_domain *dom)
pgt_size = sprd_iommu_pgt_size(&dom->domain);
dma_free_coherent(dom->sdev->dev, pgt_size, dom->pgt_va, dom->pgt_pa);
- dom->sdev = NULL;
sprd_iommu_hw_en(dom->sdev, false);
+ dom->sdev = NULL;
}
static void sprd_iommu_domain_free(struct iommu_domain *domain)
diff --git a/drivers/irqchip/irq-imx-irqsteer.c b/drivers/irqchip/irq-imx-irqsteer.c
index 96230a04ec23..44ce85c27f57 100644
--- a/drivers/irqchip/irq-imx-irqsteer.c
+++ b/drivers/irqchip/irq-imx-irqsteer.c
@@ -35,6 +35,7 @@ struct irqsteer_data {
int channel;
struct irq_domain *domain;
u32 *saved_reg;
+ struct device *dev;
};
static int imx_irqsteer_get_reg_index(struct irqsteer_data *data,
@@ -71,10 +72,26 @@ static void imx_irqsteer_irq_mask(struct irq_data *d)
raw_spin_unlock_irqrestore(&data->lock, flags);
}
+static void imx_irqsteer_irq_bus_lock(struct irq_data *d)
+{
+ struct irqsteer_data *data = d->chip_data;
+
+ pm_runtime_get_sync(data->dev);
+}
+
+static void imx_irqsteer_irq_bus_sync_unlock(struct irq_data *d)
+{
+ struct irqsteer_data *data = d->chip_data;
+
+ pm_runtime_put_autosuspend(data->dev);
+}
+
static const struct irq_chip imx_irqsteer_irq_chip = {
- .name = "irqsteer",
- .irq_mask = imx_irqsteer_irq_mask,
- .irq_unmask = imx_irqsteer_irq_unmask,
+ .name = "irqsteer",
+ .irq_mask = imx_irqsteer_irq_mask,
+ .irq_unmask = imx_irqsteer_irq_unmask,
+ .irq_bus_lock = imx_irqsteer_irq_bus_lock,
+ .irq_bus_sync_unlock = imx_irqsteer_irq_bus_sync_unlock,
};
static int imx_irqsteer_irq_map(struct irq_domain *h, unsigned int irq,
@@ -149,6 +166,7 @@ static int imx_irqsteer_probe(struct platform_device *pdev)
if (!data)
return -ENOMEM;
+ data->dev = &pdev->dev;
data->regs = devm_platform_ioremap_resource(pdev, 0);
if (IS_ERR(data->regs)) {
dev_err(&pdev->dev, "failed to initialize reg\n");
diff --git a/drivers/isdn/hardware/mISDN/hfcmulti.c b/drivers/isdn/hardware/mISDN/hfcmulti.c
index e840609c50eb..2063afffd085 100644
--- a/drivers/isdn/hardware/mISDN/hfcmulti.c
+++ b/drivers/isdn/hardware/mISDN/hfcmulti.c
@@ -1931,7 +1931,7 @@ hfcmulti_dtmf(struct hfc_multi *hc)
static void
hfcmulti_tx(struct hfc_multi *hc, int ch)
{
- int i, ii, temp, len = 0;
+ int i, ii, temp, tmp_len, len = 0;
int Zspace, z1, z2; /* must be int for calculation */
int Fspace, f1, f2;
u_char *d;
@@ -2152,14 +2152,15 @@ hfcmulti_tx(struct hfc_multi *hc, int ch)
HFC_wait_nodebug(hc);
}
+ tmp_len = (*sp)->len;
dev_kfree_skb(*sp);
/* check for next frame */
if (bch && get_next_bframe(bch)) {
- len = (*sp)->len;
+ len = tmp_len;
goto next_frame;
}
if (dch && get_next_dframe(dch)) {
- len = (*sp)->len;
+ len = tmp_len;
goto next_frame;
}
diff --git a/drivers/leds/flash/leds-mt6360.c b/drivers/leds/flash/leds-mt6360.c
index e1066a52d2d2..2fab335a6425 100644
--- a/drivers/leds/flash/leds-mt6360.c
+++ b/drivers/leds/flash/leds-mt6360.c
@@ -637,14 +637,17 @@ static int mt6360_init_isnk_properties(struct mt6360_led *led,
ret = fwnode_property_read_u32(child, "reg", ®);
if (ret || reg > MT6360_LED_ISNK3 ||
- priv->leds_active & BIT(reg))
+ priv->leds_active & BIT(reg)) {
+ fwnode_handle_put(child);
return -EINVAL;
+ }
ret = fwnode_property_read_u32(child, "color", &color);
if (ret) {
dev_err(priv->dev,
"led %d, no color specified\n",
led->led_no);
+ fwnode_handle_put(child);
return ret;
}
diff --git a/drivers/leds/led-class.c b/drivers/leds/led-class.c
index aa39b2a48fdf..7391d2cf1370 100644
--- a/drivers/leds/led-class.c
+++ b/drivers/leds/led-class.c
@@ -235,7 +235,6 @@ struct led_classdev *of_led_get(struct device_node *np, int index)
led_dev = class_find_device_by_of_node(leds_class, led_node);
of_node_put(led_node);
- put_device(led_dev);
if (!led_dev)
return ERR_PTR(-EPROBE_DEFER);
diff --git a/drivers/leds/led-triggers.c b/drivers/leds/led-triggers.c
index 072491d3e17b..024b73f84ce0 100644
--- a/drivers/leds/led-triggers.c
+++ b/drivers/leds/led-triggers.c
@@ -179,9 +179,9 @@ int led_trigger_set(struct led_classdev *led_cdev, struct led_trigger *trig)
cancel_work_sync(&led_cdev->set_brightness_work);
led_stop_software_blink(led_cdev);
+ device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
if (led_cdev->trigger->deactivate)
led_cdev->trigger->deactivate(led_cdev);
- device_remove_groups(led_cdev->dev, led_cdev->trigger->groups);
led_cdev->trigger = NULL;
led_cdev->trigger_data = NULL;
led_cdev->activated = false;
diff --git a/drivers/leds/leds-ss4200.c b/drivers/leds/leds-ss4200.c
index fcaa34706b6c..2ef9fc7371bd 100644
--- a/drivers/leds/leds-ss4200.c
+++ b/drivers/leds/leds-ss4200.c
@@ -356,8 +356,10 @@ static int ich7_lpc_probe(struct pci_dev *dev,
nas_gpio_pci_dev = dev;
status = pci_read_config_dword(dev, PMBASE, &g_pm_io_base);
- if (status)
+ if (status) {
+ status = pcibios_err_to_errno(status);
goto out;
+ }
g_pm_io_base &= 0x00000ff80;
status = pci_read_config_dword(dev, GPIO_CTRL, &gc);
@@ -369,8 +371,9 @@ static int ich7_lpc_probe(struct pci_dev *dev,
}
status = pci_read_config_dword(dev, GPIO_BASE, &nas_gpio_io_base);
- if (0 > status) {
+ if (status) {
dev_info(&dev->dev, "Unable to read GPIOBASE.\n");
+ status = pcibios_err_to_errno(status);
goto out;
}
dev_dbg(&dev->dev, ": GPIOBASE = 0x%08x\n", nas_gpio_io_base);
diff --git a/drivers/macintosh/therm_windtunnel.c b/drivers/macintosh/therm_windtunnel.c
index b8228ca40454..ab9b381c8ff1 100644
--- a/drivers/macintosh/therm_windtunnel.c
+++ b/drivers/macintosh/therm_windtunnel.c
@@ -548,7 +548,7 @@ g4fan_exit( void )
platform_driver_unregister( &therm_of_driver );
if( x.of_dev )
- of_device_unregister( x.of_dev );
+ of_platform_device_destroy(&x.of_dev->dev, NULL);
}
module_init(g4fan_init);
diff --git a/drivers/md/dm-verity-target.c b/drivers/md/dm-verity-target.c
index 6a707b41dc86..52585e2c61aa 100644
--- a/drivers/md/dm-verity-target.c
+++ b/drivers/md/dm-verity-target.c
@@ -1496,14 +1496,6 @@ static int verity_ctr(struct dm_target *ti, unsigned int argc, char **argv)
return r;
}
-/*
- * Check whether a DM target is a verity target.
- */
-bool dm_is_verity_target(struct dm_target *ti)
-{
- return ti->type->module == THIS_MODULE;
-}
-
/*
* Get the verity mode (error behavior) of a verity target.
*
@@ -1575,6 +1567,14 @@ static void __exit dm_verity_exit(void)
module_init(dm_verity_init);
module_exit(dm_verity_exit);
+/*
+ * Check whether a DM target is a verity target.
+ */
+bool dm_is_verity_target(struct dm_target *ti)
+{
+ return ti->type == &verity_target;
+}
+
MODULE_AUTHOR("Mikulas Patocka <mpatocka@redhat.com>");
MODULE_AUTHOR("Mandeep Baines <msb@chromium.org>");
MODULE_AUTHOR("Will Drewry <wad@chromium.org>");
diff --git a/drivers/md/md.c b/drivers/md/md.c
index 506c998c0ca5..7dc1c42acccc 100644
--- a/drivers/md/md.c
+++ b/drivers/md/md.c
@@ -527,13 +527,9 @@ static void md_end_flush(struct bio *bio)
rdev_dec_pending(rdev, mddev);
- if (atomic_dec_and_test(&mddev->flush_pending)) {
- /* The pair is percpu_ref_get() from md_flush_request() */
- percpu_ref_put(&mddev->active_io);
-
+ if (atomic_dec_and_test(&mddev->flush_pending))
/* The pre-request flush has finished */
queue_work(md_wq, &mddev->flush_work);
- }
}
static void md_submit_flush_data(struct work_struct *ws);
@@ -564,12 +560,8 @@ static void submit_flushes(struct work_struct *ws)
rcu_read_lock();
}
rcu_read_unlock();
- if (atomic_dec_and_test(&mddev->flush_pending)) {
- /* The pair is percpu_ref_get() from md_flush_request() */
- percpu_ref_put(&mddev->active_io);
-
+ if (atomic_dec_and_test(&mddev->flush_pending))
queue_work(md_wq, &mddev->flush_work);
- }
}
static void md_submit_flush_data(struct work_struct *ws)
@@ -594,8 +586,20 @@ static void md_submit_flush_data(struct work_struct *ws)
bio_endio(bio);
} else {
bio->bi_opf &= ~REQ_PREFLUSH;
- md_handle_request(mddev, bio);
+
+ /*
+ * make_requst() will never return error here, it only
+ * returns error in raid5_make_request() by dm-raid.
+ * Since dm always splits data and flush operation into
+ * two separate io, io size of flush submitted by dm
+ * always is 0, make_request() will not be called here.
+ */
+ if (WARN_ON_ONCE(!mddev->pers->make_request(mddev, bio)))
+ bio_io_error(bio);;
}
+
+ /* The pair is percpu_ref_get() from md_flush_request() */
+ percpu_ref_put(&mddev->active_io);
}
/*
diff --git a/drivers/media/i2c/imx412.c b/drivers/media/i2c/imx412.c
index 7f6d29e0e7c4..77fa6253ba3e 100644
--- a/drivers/media/i2c/imx412.c
+++ b/drivers/media/i2c/imx412.c
@@ -544,14 +544,13 @@ static int imx412_update_controls(struct imx412 *imx412,
*/
static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
{
- u32 lpfr, shutter;
+ u32 lpfr;
int ret;
lpfr = imx412->vblank + imx412->cur_mode->height;
- shutter = lpfr - exposure;
- dev_dbg(imx412->dev, "Set exp %u, analog gain %u, shutter %u, lpfr %u",
- exposure, gain, shutter, lpfr);
+ dev_dbg(imx412->dev, "Set exp %u, analog gain %u, lpfr %u",
+ exposure, gain, lpfr);
ret = imx412_write_reg(imx412, IMX412_REG_HOLD, 1, 1);
if (ret)
@@ -561,7 +560,7 @@ static int imx412_update_exp_gain(struct imx412 *imx412, u32 exposure, u32 gain)
if (ret)
goto error_release_group_hold;
- ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, shutter);
+ ret = imx412_write_reg(imx412, IMX412_REG_EXPOSURE_CIT, 2, exposure);
if (ret)
goto error_release_group_hold;
diff --git a/drivers/media/pci/ivtv/ivtv-udma.c b/drivers/media/pci/ivtv/ivtv-udma.c
index 210be8290f24..fd76f88975ae 100644
--- a/drivers/media/pci/ivtv/ivtv-udma.c
+++ b/drivers/media/pci/ivtv/ivtv-udma.c
@@ -131,6 +131,8 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
/* Fill SG List with new values */
if (ivtv_udma_fill_sg_list(dma, &user_dma, 0) < 0) {
+ IVTV_DEBUG_WARN("%s: could not allocate bounce buffers for highmem userspace buffers\n",
+ __func__);
unpin_user_pages(dma->map, dma->page_count);
dma->page_count = 0;
return -ENOMEM;
@@ -139,6 +141,12 @@ int ivtv_udma_setup(struct ivtv *itv, unsigned long ivtv_dest_addr,
/* Map SG List */
dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
dma->page_count, DMA_TO_DEVICE);
+ if (!dma->SG_length) {
+ IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+ unpin_user_pages(dma->map, dma->page_count);
+ dma->page_count = 0;
+ return -EINVAL;
+ }
/* Fill SG Array with new values */
ivtv_udma_fill_sg_array (dma, ivtv_dest_addr, 0, -1);
diff --git a/drivers/media/pci/ivtv/ivtv-yuv.c b/drivers/media/pci/ivtv/ivtv-yuv.c
index 4ba10c34a16a..bd0b80331602 100644
--- a/drivers/media/pci/ivtv/ivtv-yuv.c
+++ b/drivers/media/pci/ivtv/ivtv-yuv.c
@@ -115,6 +115,12 @@ static int ivtv_yuv_prep_user_dma(struct ivtv *itv, struct ivtv_user_dma *dma,
}
dma->SG_length = dma_map_sg(&itv->pdev->dev, dma->SGlist,
dma->page_count, DMA_TO_DEVICE);
+ if (!dma->SG_length) {
+ IVTV_DEBUG_WARN("%s: DMA map error, SG_length is 0\n", __func__);
+ unpin_user_pages(dma->map, dma->page_count);
+ dma->page_count = 0;
+ return -EINVAL;
+ }
/* Fill SG Array with new values */
ivtv_udma_fill_sg_array(dma, y_buffer_offset, uv_buffer_offset, y_size);
diff --git a/drivers/media/pci/ivtv/ivtvfb.c b/drivers/media/pci/ivtv/ivtvfb.c
index 00ac94d4ab19..a642becdc0d7 100644
--- a/drivers/media/pci/ivtv/ivtvfb.c
+++ b/drivers/media/pci/ivtv/ivtvfb.c
@@ -281,10 +281,10 @@ static int ivtvfb_prep_dec_dma_to_device(struct ivtv *itv,
/* Map User DMA */
if (ivtv_udma_setup(itv, ivtv_dest_addr, userbuf, size_in_bytes) <= 0) {
mutex_unlock(&itv->udma.lock);
- IVTVFB_WARN("ivtvfb_prep_dec_dma_to_device, Error with pin_user_pages: %d bytes, %d pages returned\n",
- size_in_bytes, itv->udma.page_count);
+ IVTVFB_WARN("%s, Error in ivtv_udma_setup: %d bytes, %d pages returned\n",
+ __func__, size_in_bytes, itv->udma.page_count);
- /* pin_user_pages must have failed completely */
+ /* pin_user_pages or DMA must have failed completely */
return -EIO;
}
diff --git a/drivers/media/pci/saa7134/saa7134-dvb.c b/drivers/media/pci/saa7134/saa7134-dvb.c
index 9c6cfef03331..a66df6adfaad 100644
--- a/drivers/media/pci/saa7134/saa7134-dvb.c
+++ b/drivers/media/pci/saa7134/saa7134-dvb.c
@@ -466,7 +466,9 @@ static int philips_europa_tuner_sleep(struct dvb_frontend *fe)
/* switch the board to analog mode */
if (fe->ops.i2c_gate_ctrl)
fe->ops.i2c_gate_ctrl(fe, 1);
- i2c_transfer(&dev->i2c_adap, &analog_msg, 1);
+ if (i2c_transfer(&dev->i2c_adap, &analog_msg, 1) != 1)
+ return -EIO;
+
return 0;
}
@@ -1018,7 +1020,9 @@ static int md8800_set_voltage2(struct dvb_frontend *fe,
else
wbuf[1] = rbuf & 0xef;
msg[0].len = 2;
- i2c_transfer(&dev->i2c_adap, msg, 1);
+ if (i2c_transfer(&dev->i2c_adap, msg, 1) != 1)
+ return -EIO;
+
return 0;
}
diff --git a/drivers/media/platform/qcom/venus/vdec.c b/drivers/media/platform/qcom/venus/vdec.c
index 1a52c2ea2da5..7ea976efc024 100644
--- a/drivers/media/platform/qcom/venus/vdec.c
+++ b/drivers/media/platform/qcom/venus/vdec.c
@@ -1221,7 +1221,7 @@ static int vdec_stop_output(struct venus_inst *inst)
break;
case VENUS_DEC_STATE_INIT:
case VENUS_DEC_STATE_CAPTURE_SETUP:
- ret = hfi_session_flush(inst, HFI_FLUSH_INPUT, true);
+ ret = hfi_session_flush(inst, HFI_FLUSH_ALL, true);
break;
default:
break;
@@ -1705,6 +1705,7 @@ static int vdec_close(struct file *file)
vdec_pm_get(inst);
+ cancel_work_sync(&inst->delayed_process_work);
v4l2_m2m_ctx_release(inst->m2m_ctx);
v4l2_m2m_release(inst->m2m_dev);
vdec_ctrl_deinit(inst);
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
index 174aa6176f54..3b6657d4877a 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-csi2.c
@@ -1559,12 +1559,14 @@ static int rcsi2_probe(struct platform_device *pdev)
ret = v4l2_async_register_subdev(&priv->subdev);
if (ret < 0)
- goto error_async;
+ goto error_pm_runtime;
dev_info(priv->dev, "%d lanes found\n", priv->lanes);
return 0;
+error_pm_runtime:
+ pm_runtime_disable(&pdev->dev);
error_async:
v4l2_async_nf_unregister(&priv->notifier);
v4l2_async_nf_cleanup(&priv->notifier);
@@ -1581,6 +1583,7 @@ static int rcsi2_remove(struct platform_device *pdev)
v4l2_async_nf_unregister(&priv->notifier);
v4l2_async_nf_cleanup(&priv->notifier);
v4l2_async_unregister_subdev(&priv->subdev);
+ v4l2_subdev_cleanup(&priv->subdev);
pm_runtime_disable(&pdev->dev);
diff --git a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
index ef5adffae197..8bfb020b2f26 100644
--- a/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
+++ b/drivers/media/platform/renesas/rcar-vin/rcar-dma.c
@@ -665,12 +665,22 @@ static int rvin_setup(struct rvin_dev *vin)
*/
switch (vin->mbus_code) {
case MEDIA_BUS_FMT_YUYV8_1X16:
- /* BT.601/BT.1358 16bit YCbCr422 */
- vnmc |= VNMC_INF_YUV16;
+ if (vin->is_csi)
+ /* YCbCr422 8-bit */
+ vnmc |= VNMC_INF_YUV8_BT601;
+ else
+ /* BT.601/BT.1358 16bit YCbCr422 */
+ vnmc |= VNMC_INF_YUV16;
input_is_yuv = true;
break;
case MEDIA_BUS_FMT_UYVY8_1X16:
- vnmc |= VNMC_INF_YUV16 | VNMC_YCAL;
+ if (vin->is_csi)
+ /* YCbCr422 8-bit */
+ vnmc |= VNMC_INF_YUV8_BT601;
+ else
+ /* BT.601/BT.1358 16bit YCbCr422 */
+ vnmc |= VNMC_INF_YUV16;
+ vnmc |= VNMC_YCAL;
input_is_yuv = true;
break;
case MEDIA_BUS_FMT_UYVY8_2X8:
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_histo.c b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
index f22449dd654c..c0f1002f4ecf 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_histo.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_histo.c
@@ -36,9 +36,8 @@ struct vsp1_histogram_buffer *
vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
{
struct vsp1_histogram_buffer *buf = NULL;
- unsigned long flags;
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock(&histo->irqlock);
if (list_empty(&histo->irqqueue))
goto done;
@@ -49,7 +48,7 @@ vsp1_histogram_buffer_get(struct vsp1_histogram *histo)
histo->readout = true;
done:
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock(&histo->irqlock);
return buf;
}
@@ -58,7 +57,6 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
size_t size)
{
struct vsp1_pipeline *pipe = histo->entity.pipe;
- unsigned long flags;
/*
* The pipeline pointer is guaranteed to be valid as this function is
@@ -70,10 +68,10 @@ void vsp1_histogram_buffer_complete(struct vsp1_histogram *histo,
vb2_set_plane_payload(&buf->buf.vb2_buf, 0, size);
vb2_buffer_done(&buf->buf.vb2_buf, VB2_BUF_STATE_DONE);
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock(&histo->irqlock);
histo->readout = false;
wake_up(&histo->wait_queue);
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock(&histo->irqlock);
}
/* -----------------------------------------------------------------------------
@@ -124,11 +122,10 @@ static void histo_buffer_queue(struct vb2_buffer *vb)
struct vb2_v4l2_buffer *vbuf = to_vb2_v4l2_buffer(vb);
struct vsp1_histogram *histo = vb2_get_drv_priv(vb->vb2_queue);
struct vsp1_histogram_buffer *buf = to_vsp1_histogram_buffer(vbuf);
- unsigned long flags;
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock_irq(&histo->irqlock);
list_add_tail(&buf->queue, &histo->irqqueue);
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock_irq(&histo->irqlock);
}
static int histo_start_streaming(struct vb2_queue *vq, unsigned int count)
@@ -140,9 +137,8 @@ static void histo_stop_streaming(struct vb2_queue *vq)
{
struct vsp1_histogram *histo = vb2_get_drv_priv(vq);
struct vsp1_histogram_buffer *buffer;
- unsigned long flags;
- spin_lock_irqsave(&histo->irqlock, flags);
+ spin_lock_irq(&histo->irqlock);
/* Remove all buffers from the IRQ queue. */
list_for_each_entry(buffer, &histo->irqqueue, queue)
@@ -152,7 +148,7 @@ static void histo_stop_streaming(struct vb2_queue *vq)
/* Wait for the buffer being read out (if any) to complete. */
wait_event_lock_irq(histo->wait_queue, !histo->readout, histo->irqlock);
- spin_unlock_irqrestore(&histo->irqlock, flags);
+ spin_unlock_irq(&histo->irqlock);
}
static const struct vb2_ops histo_video_queue_qops = {
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
index ae646c9ef337..15daf35bda21 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
+++ b/drivers/media/platform/renesas/vsp1/vsp1_pipe.h
@@ -73,7 +73,7 @@ struct vsp1_partition_window {
* @wpf: The WPF partition window configuration
*/
struct vsp1_partition {
- struct vsp1_partition_window rpf;
+ struct vsp1_partition_window rpf[VSP1_MAX_RPF];
struct vsp1_partition_window uds_sink;
struct vsp1_partition_window uds_source;
struct vsp1_partition_window sru;
diff --git a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
index 75083cb234fe..996a3058d5b7 100644
--- a/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
+++ b/drivers/media/platform/renesas/vsp1/vsp1_rpf.c
@@ -271,8 +271,8 @@ static void rpf_configure_partition(struct vsp1_entity *entity,
* 'width' need to be adjusted.
*/
if (pipe->partitions > 1) {
- crop.width = pipe->partition->rpf.width;
- crop.left += pipe->partition->rpf.left;
+ crop.width = pipe->partition->rpf[rpf->entity.index].width;
+ crop.left += pipe->partition->rpf[rpf->entity.index].left;
}
if (pipe->interlaced) {
@@ -327,7 +327,9 @@ static void rpf_partition(struct vsp1_entity *entity,
unsigned int partition_idx,
struct vsp1_partition_window *window)
{
- partition->rpf = *window;
+ struct vsp1_rwpf *rpf = to_rwpf(&entity->subdev);
+
+ partition->rpf[rpf->entity.index] = *window;
}
static const struct vsp1_entity_operations rpf_entity_ops = {
diff --git a/drivers/media/rc/imon.c b/drivers/media/rc/imon.c
index 5719dda6e0f0..e5590a708f1c 100644
--- a/drivers/media/rc/imon.c
+++ b/drivers/media/rc/imon.c
@@ -1148,10 +1148,7 @@ static int imon_ir_change_protocol(struct rc_dev *rc, u64 *rc_proto)
memcpy(ictx->usb_tx_buf, &ir_proto_packet, sizeof(ir_proto_packet));
- if (!mutex_is_locked(&ictx->lock)) {
- unlock = true;
- mutex_lock(&ictx->lock);
- }
+ unlock = mutex_trylock(&ictx->lock);
retval = send_packet(ictx);
if (retval)
diff --git a/drivers/media/rc/lirc_dev.c b/drivers/media/rc/lirc_dev.c
index adb8c794a2d7..d9a9017b96ea 100644
--- a/drivers/media/rc/lirc_dev.c
+++ b/drivers/media/rc/lirc_dev.c
@@ -828,8 +828,10 @@ struct rc_dev *rc_dev_get_from_fd(int fd, bool write)
return ERR_PTR(-EINVAL);
}
- if (write && !(f.file->f_mode & FMODE_WRITE))
+ if (write && !(f.file->f_mode & FMODE_WRITE)) {
+ fdput(f);
return ERR_PTR(-EPERM);
+ }
fh = f.file->private_data;
dev = fh->rc;
diff --git a/drivers/media/usb/dvb-usb/dvb-usb-init.c b/drivers/media/usb/dvb-usb/dvb-usb-init.c
index 58eea8ab5477..6cf6d08cc4ec 100644
--- a/drivers/media/usb/dvb-usb/dvb-usb-init.c
+++ b/drivers/media/usb/dvb-usb/dvb-usb-init.c
@@ -23,11 +23,40 @@ static int dvb_usb_force_pid_filter_usage;
module_param_named(force_pid_filter_usage, dvb_usb_force_pid_filter_usage, int, 0444);
MODULE_PARM_DESC(force_pid_filter_usage, "force all dvb-usb-devices to use a PID filter, if any (default: 0).");
+static int dvb_usb_check_bulk_endpoint(struct dvb_usb_device *d, u8 endpoint)
+{
+ if (endpoint) {
+ int ret;
+
+ ret = usb_pipe_type_check(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+ if (ret)
+ return ret;
+ ret = usb_pipe_type_check(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+ if (ret)
+ return ret;
+ }
+ return 0;
+}
+
+static void dvb_usb_clear_halt(struct dvb_usb_device *d, u8 endpoint)
+{
+ if (endpoint) {
+ usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, endpoint));
+ usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, endpoint));
+ }
+}
+
static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
{
struct dvb_usb_adapter *adap;
int ret, n, o;
+ ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint);
+ if (ret)
+ return ret;
+ ret = dvb_usb_check_bulk_endpoint(d, d->props.generic_bulk_ctrl_endpoint_response);
+ if (ret)
+ return ret;
for (n = 0; n < d->props.num_adapters; n++) {
adap = &d->adapter[n];
adap->dev = d;
@@ -103,10 +132,8 @@ static int dvb_usb_adapter_init(struct dvb_usb_device *d, short *adapter_nrs)
* when reloading the driver w/o replugging the device
* sometimes a timeout occurs, this helps
*/
- if (d->props.generic_bulk_ctrl_endpoint != 0) {
- usb_clear_halt(d->udev, usb_sndbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
- usb_clear_halt(d->udev, usb_rcvbulkpipe(d->udev, d->props.generic_bulk_ctrl_endpoint));
- }
+ dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint);
+ dvb_usb_clear_halt(d, d->props.generic_bulk_ctrl_endpoint_response);
return 0;
diff --git a/drivers/media/usb/uvc/uvc_ctrl.c b/drivers/media/usb/uvc/uvc_ctrl.c
index 6d7535efc09d..dffc9d03235c 100644
--- a/drivers/media/usb/uvc/uvc_ctrl.c
+++ b/drivers/media/usb/uvc/uvc_ctrl.c
@@ -1959,7 +1959,13 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
else
ret = uvc_query_ctrl(dev, UVC_GET_INFO, ctrl->entity->id,
dev->intfnum, info->selector, data, 1);
- if (!ret)
+
+ if (!ret) {
+ info->flags &= ~(UVC_CTRL_FLAG_GET_CUR |
+ UVC_CTRL_FLAG_SET_CUR |
+ UVC_CTRL_FLAG_AUTO_UPDATE |
+ UVC_CTRL_FLAG_ASYNCHRONOUS);
+
info->flags |= (data[0] & UVC_CONTROL_CAP_GET ?
UVC_CTRL_FLAG_GET_CUR : 0)
| (data[0] & UVC_CONTROL_CAP_SET ?
@@ -1968,6 +1974,7 @@ static int uvc_ctrl_get_flags(struct uvc_device *dev,
UVC_CTRL_FLAG_AUTO_UPDATE : 0)
| (data[0] & UVC_CONTROL_CAP_ASYNCHRONOUS ?
UVC_CTRL_FLAG_ASYNCHRONOUS : 0);
+ }
kfree(data);
return ret;
diff --git a/drivers/media/usb/uvc/uvc_video.c b/drivers/media/usb/uvc/uvc_video.c
index 0d3a3b697b2d..a5ad3ff8bdbb 100644
--- a/drivers/media/usb/uvc/uvc_video.c
+++ b/drivers/media/usb/uvc/uvc_video.c
@@ -705,11 +705,11 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
unsigned long flags;
u64 timestamp;
u32 delta_stc;
- u32 y1, y2;
+ u32 y1;
u32 x1, x2;
u32 mean;
u32 sof;
- u64 y;
+ u64 y, y2;
if (!uvc_hw_timestamps_param)
return;
@@ -749,7 +749,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
sof = y;
uvc_dbg(stream->dev, CLOCK,
- "%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %u SOF offset %u)\n",
+ "%s: PTS %u y %llu.%06llu SOF %u.%06llu (x1 %u x2 %u y1 %u y2 %llu SOF offset %u)\n",
stream->dev->name, buf->pts,
y >> 16, div_u64((y & 0xffff) * 1000000, 65536),
sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
@@ -764,7 +764,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
goto done;
y1 = NSEC_PER_SEC;
- y2 = (u32)ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
+ y2 = ktime_to_ns(ktime_sub(last->host_time, first->host_time)) + y1;
/*
* Interpolated and host SOF timestamps can wrap around at slightly
@@ -785,7 +785,7 @@ void uvc_video_clock_update(struct uvc_streaming *stream,
timestamp = ktime_to_ns(first->host_time) + y - y1;
uvc_dbg(stream->dev, CLOCK,
- "%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %u)\n",
+ "%s: SOF %u.%06llu y %llu ts %llu buf ts %llu (x1 %u/%u/%u x2 %u/%u/%u y1 %u y2 %llu)\n",
stream->dev->name,
sof >> 16, div_u64(((u64)sof & 0xffff) * 1000000LLU, 65536),
y, timestamp, vbuf->vb2_buf.timestamp,
diff --git a/drivers/media/v4l2-core/v4l2-async.c b/drivers/media/v4l2-core/v4l2-async.c
index 008a2a3e312e..7471dbd14040 100644
--- a/drivers/media/v4l2-core/v4l2-async.c
+++ b/drivers/media/v4l2-core/v4l2-async.c
@@ -302,6 +302,9 @@ static int v4l2_async_create_ancillary_links(struct v4l2_async_notifier *n,
sd->entity.function != MEDIA_ENT_F_FLASH)
return 0;
+ if (!n->sd)
+ return 0;
+
link = media_create_ancillary_link(&n->sd->entity, &sd->entity);
#endif
diff --git a/drivers/memory/Kconfig b/drivers/memory/Kconfig
index fac290e48e0b..15a9e66f031d 100644
--- a/drivers/memory/Kconfig
+++ b/drivers/memory/Kconfig
@@ -178,7 +178,7 @@ config FSL_CORENET_CF
represents a coherency violation.
config FSL_IFC
- bool "Freescale IFC driver" if COMPILE_TEST
+ bool "Freescale IFC driver"
depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
depends on HAS_IOMEM
diff --git a/drivers/mfd/Makefile b/drivers/mfd/Makefile
index 7ed3ef4a698c..e26c64bf7cb7 100644
--- a/drivers/mfd/Makefile
+++ b/drivers/mfd/Makefile
@@ -276,7 +276,5 @@ obj-$(CONFIG_MFD_INTEL_M10_BMC) += intel-m10-bmc.o
obj-$(CONFIG_MFD_ATC260X) += atc260x-core.o
obj-$(CONFIG_MFD_ATC260X_I2C) += atc260x-i2c.o
-rsmu-i2c-objs := rsmu_core.o rsmu_i2c.o
-rsmu-spi-objs := rsmu_core.o rsmu_spi.o
-obj-$(CONFIG_MFD_RSMU_I2C) += rsmu-i2c.o
-obj-$(CONFIG_MFD_RSMU_SPI) += rsmu-spi.o
+obj-$(CONFIG_MFD_RSMU_I2C) += rsmu_i2c.o rsmu_core.o
+obj-$(CONFIG_MFD_RSMU_SPI) += rsmu_spi.o rsmu_core.o
diff --git a/drivers/mfd/omap-usb-tll.c b/drivers/mfd/omap-usb-tll.c
index 080d7970a377..5971b5cb290a 100644
--- a/drivers/mfd/omap-usb-tll.c
+++ b/drivers/mfd/omap-usb-tll.c
@@ -237,8 +237,7 @@ static int usbtll_omap_probe(struct platform_device *pdev)
break;
}
- tll = devm_kzalloc(dev, sizeof(*tll) + sizeof(tll->ch_clk[nch]),
- GFP_KERNEL);
+ tll = devm_kzalloc(dev, struct_size(tll, ch_clk, nch), GFP_KERNEL);
if (!tll) {
pm_runtime_put_sync(dev);
pm_runtime_disable(dev);
diff --git a/drivers/mfd/rsmu_core.c b/drivers/mfd/rsmu_core.c
index 29437fd0bd5b..fd04a6e5dfa3 100644
--- a/drivers/mfd/rsmu_core.c
+++ b/drivers/mfd/rsmu_core.c
@@ -78,11 +78,13 @@ int rsmu_core_init(struct rsmu_ddata *rsmu)
return ret;
}
+EXPORT_SYMBOL_GPL(rsmu_core_init);
void rsmu_core_exit(struct rsmu_ddata *rsmu)
{
mutex_destroy(&rsmu->lock);
}
+EXPORT_SYMBOL_GPL(rsmu_core_exit);
MODULE_DESCRIPTION("Renesas SMU core driver");
MODULE_LICENSE("GPL");
diff --git a/drivers/mtd/nand/raw/Kconfig b/drivers/mtd/nand/raw/Kconfig
index 4cd40af362de..900b12121939 100644
--- a/drivers/mtd/nand/raw/Kconfig
+++ b/drivers/mtd/nand/raw/Kconfig
@@ -248,8 +248,7 @@ config MTD_NAND_FSL_IFC
tristate "Freescale IFC NAND controller"
depends on FSL_SOC || ARCH_LAYERSCAPE || SOC_LS1021A || COMPILE_TEST
depends on HAS_IOMEM
- select FSL_IFC
- select MEMORY
+ depends on FSL_IFC
help
Various Freescale chips e.g P1010, include a NAND Flash machine
with built-in hardware ECC capabilities.
diff --git a/drivers/mtd/tests/Makefile b/drivers/mtd/tests/Makefile
index 5de0378f90db..7dae831ee8b6 100644
--- a/drivers/mtd/tests/Makefile
+++ b/drivers/mtd/tests/Makefile
@@ -1,19 +1,19 @@
# SPDX-License-Identifier: GPL-2.0
-obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o
-obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o
+obj-$(CONFIG_MTD_TESTS) += mtd_oobtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_pagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_readtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_speedtest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_stresstest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_subpagetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_torturetest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandecctest.o mtd_test.o
+obj-$(CONFIG_MTD_TESTS) += mtd_nandbiterrs.o mtd_test.o
-mtd_oobtest-objs := oobtest.o mtd_test.o
-mtd_pagetest-objs := pagetest.o mtd_test.o
-mtd_readtest-objs := readtest.o mtd_test.o
-mtd_speedtest-objs := speedtest.o mtd_test.o
-mtd_stresstest-objs := stresstest.o mtd_test.o
-mtd_subpagetest-objs := subpagetest.o mtd_test.o
-mtd_torturetest-objs := torturetest.o mtd_test.o
-mtd_nandbiterrs-objs := nandbiterrs.o mtd_test.o
+mtd_oobtest-objs := oobtest.o
+mtd_pagetest-objs := pagetest.o
+mtd_readtest-objs := readtest.o
+mtd_speedtest-objs := speedtest.o
+mtd_stresstest-objs := stresstest.o
+mtd_subpagetest-objs := subpagetest.o
+mtd_torturetest-objs := torturetest.o
+mtd_nandbiterrs-objs := nandbiterrs.o
diff --git a/drivers/mtd/tests/mtd_test.c b/drivers/mtd/tests/mtd_test.c
index c84250beffdc..f391e0300cdc 100644
--- a/drivers/mtd/tests/mtd_test.c
+++ b/drivers/mtd/tests/mtd_test.c
@@ -25,6 +25,7 @@ int mtdtest_erase_eraseblock(struct mtd_info *mtd, unsigned int ebnum)
return 0;
}
+EXPORT_SYMBOL_GPL(mtdtest_erase_eraseblock);
static int is_block_bad(struct mtd_info *mtd, unsigned int ebnum)
{
@@ -57,6 +58,7 @@ int mtdtest_scan_for_bad_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
return 0;
}
+EXPORT_SYMBOL_GPL(mtdtest_scan_for_bad_eraseblocks);
int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
unsigned int eb, int ebcnt)
@@ -75,6 +77,7 @@ int mtdtest_erase_good_eraseblocks(struct mtd_info *mtd, unsigned char *bbt,
return 0;
}
+EXPORT_SYMBOL_GPL(mtdtest_erase_good_eraseblocks);
int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
{
@@ -92,6 +95,7 @@ int mtdtest_read(struct mtd_info *mtd, loff_t addr, size_t size, void *buf)
return err;
}
+EXPORT_SYMBOL_GPL(mtdtest_read);
int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
const void *buf)
@@ -107,3 +111,8 @@ int mtdtest_write(struct mtd_info *mtd, loff_t addr, size_t size,
return err;
}
+EXPORT_SYMBOL_GPL(mtdtest_write);
+
+MODULE_LICENSE("GPL");
+MODULE_DESCRIPTION("MTD function test helpers");
+MODULE_AUTHOR("Akinobu Mita");
diff --git a/drivers/mtd/ubi/eba.c b/drivers/mtd/ubi/eba.c
index 4e1d80746b04..38f41ce72b6a 100644
--- a/drivers/mtd/ubi/eba.c
+++ b/drivers/mtd/ubi/eba.c
@@ -1560,6 +1560,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
GFP_KERNEL);
if (!fm_eba[i]) {
ret = -ENOMEM;
+ kfree(scan_eba[i]);
goto out_free;
}
@@ -1595,7 +1596,7 @@ int self_check_eba(struct ubi_device *ubi, struct ubi_attach_info *ai_fastmap,
}
out_free:
- for (i = 0; i < num_volumes; i++) {
+ while (--i >= 0) {
if (!ubi->volumes[i])
continue;
diff --git a/drivers/net/bonding/bond_main.c b/drivers/net/bonding/bond_main.c
index 710734a5af9b..be5348d0b22e 100644
--- a/drivers/net/bonding/bond_main.c
+++ b/drivers/net/bonding/bond_main.c
@@ -1117,13 +1117,10 @@ static struct slave *bond_find_best_slave(struct bonding *bond)
return bestslave;
}
+/* must be called in RCU critical section or with RTNL held */
static bool bond_should_notify_peers(struct bonding *bond)
{
- struct slave *slave;
-
- rcu_read_lock();
- slave = rcu_dereference(bond->curr_active_slave);
- rcu_read_unlock();
+ struct slave *slave = rcu_dereference_rtnl(bond->curr_active_slave);
if (!slave || !bond->send_peer_notif ||
bond->send_peer_notif %
diff --git a/drivers/net/dsa/b53/b53_common.c b/drivers/net/dsa/b53/b53_common.c
index 59cdfc51ce06..922e5934de73 100644
--- a/drivers/net/dsa/b53/b53_common.c
+++ b/drivers/net/dsa/b53/b53_common.c
@@ -2221,6 +2221,9 @@ static int b53_change_mtu(struct dsa_switch *ds, int port, int mtu)
if (is5325(dev) || is5365(dev))
return -EOPNOTSUPP;
+ if (!dsa_is_cpu_port(ds, port))
+ return 0;
+
enable_jumbo = (mtu >= JMS_MIN_SIZE);
allow_10_100 = (dev->chip_id == BCM583XX_DEVICE_ID);
diff --git a/drivers/net/dsa/mv88e6xxx/chip.c b/drivers/net/dsa/mv88e6xxx/chip.c
index 4938550a67c0..d94b46316a11 100644
--- a/drivers/net/dsa/mv88e6xxx/chip.c
+++ b/drivers/net/dsa/mv88e6xxx/chip.c
@@ -3606,7 +3606,8 @@ static int mv88e6xxx_change_mtu(struct dsa_switch *ds, int port, int new_mtu)
mv88e6xxx_reg_lock(chip);
if (chip->info->ops->port_set_jumbo_size)
ret = chip->info->ops->port_set_jumbo_size(chip, port, new_mtu);
- else if (chip->info->ops->set_max_frame_size)
+ else if (chip->info->ops->set_max_frame_size &&
+ dsa_is_cpu_port(ds, port))
ret = chip->info->ops->set_max_frame_size(chip, new_mtu);
mv88e6xxx_reg_unlock(chip);
diff --git a/drivers/net/ethernet/brocade/bna/bna_types.h b/drivers/net/ethernet/brocade/bna/bna_types.h
index 666b6922e24d..ebf54d74c2bb 100644
--- a/drivers/net/ethernet/brocade/bna/bna_types.h
+++ b/drivers/net/ethernet/brocade/bna/bna_types.h
@@ -410,7 +410,7 @@ struct bna_ib {
/* Tx object */
/* Tx datapath control structure */
-#define BNA_Q_NAME_SIZE 16
+#define BNA_Q_NAME_SIZE (IFNAMSIZ + 6)
struct bna_tcb {
/* Fast path */
void **sw_qpt;
diff --git a/drivers/net/ethernet/brocade/bna/bnad.c b/drivers/net/ethernet/brocade/bna/bnad.c
index d6d90f9722a7..aecdb98f8a9c 100644
--- a/drivers/net/ethernet/brocade/bna/bnad.c
+++ b/drivers/net/ethernet/brocade/bna/bnad.c
@@ -1535,8 +1535,9 @@ bnad_tx_msix_register(struct bnad *bnad, struct bnad_tx_info *tx_info,
for (i = 0; i < num_txqs; i++) {
vector_num = tx_info->tcb[i]->intr_vector;
- sprintf(tx_info->tcb[i]->name, "%s TXQ %d", bnad->netdev->name,
- tx_id + tx_info->tcb[i]->id);
+ snprintf(tx_info->tcb[i]->name, BNA_Q_NAME_SIZE, "%s TXQ %d",
+ bnad->netdev->name,
+ tx_id + tx_info->tcb[i]->id);
err = request_irq(bnad->msix_table[vector_num].vector,
(irq_handler_t)bnad_msix_tx, 0,
tx_info->tcb[i]->name,
@@ -1586,9 +1587,9 @@ bnad_rx_msix_register(struct bnad *bnad, struct bnad_rx_info *rx_info,
for (i = 0; i < num_rxps; i++) {
vector_num = rx_info->rx_ctrl[i].ccb->intr_vector;
- sprintf(rx_info->rx_ctrl[i].ccb->name, "%s CQ %d",
- bnad->netdev->name,
- rx_id + rx_info->rx_ctrl[i].ccb->id);
+ snprintf(rx_info->rx_ctrl[i].ccb->name, BNA_Q_NAME_SIZE,
+ "%s CQ %d", bnad->netdev->name,
+ rx_id + rx_info->rx_ctrl[i].ccb->id);
err = request_irq(bnad->msix_table[vector_num].vector,
(irq_handler_t)bnad_msix_rx, 0,
rx_info->rx_ctrl[i].ccb->name,
diff --git a/drivers/net/ethernet/freescale/fec_main.c b/drivers/net/ethernet/freescale/fec_main.c
index 0a3df468316e..0a5c3d27ed3b 100644
--- a/drivers/net/ethernet/freescale/fec_main.c
+++ b/drivers/net/ethernet/freescale/fec_main.c
@@ -267,8 +267,8 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
#define PKT_MINBUF_SIZE 64
/* FEC receive acceleration */
-#define FEC_RACC_IPDIS (1 << 1)
-#define FEC_RACC_PRODIS (1 << 2)
+#define FEC_RACC_IPDIS BIT(1)
+#define FEC_RACC_PRODIS BIT(2)
#define FEC_RACC_SHIFT16 BIT(7)
#define FEC_RACC_OPTIONS (FEC_RACC_IPDIS | FEC_RACC_PRODIS)
@@ -300,8 +300,23 @@ MODULE_PARM_DESC(macaddr, "FEC Ethernet MAC address");
#define FEC_MMFR_TA (2 << 16)
#define FEC_MMFR_DATA(v) (v & 0xffff)
/* FEC ECR bits definition */
-#define FEC_ECR_MAGICEN (1 << 2)
-#define FEC_ECR_SLEEP (1 << 3)
+#define FEC_ECR_RESET BIT(0)
+#define FEC_ECR_ETHEREN BIT(1)
+#define FEC_ECR_MAGICEN BIT(2)
+#define FEC_ECR_SLEEP BIT(3)
+#define FEC_ECR_EN1588 BIT(4)
+#define FEC_ECR_BYTESWP BIT(8)
+/* FEC RCR bits definition */
+#define FEC_RCR_LOOP BIT(0)
+#define FEC_RCR_HALFDPX BIT(1)
+#define FEC_RCR_MII BIT(2)
+#define FEC_RCR_PROMISC BIT(3)
+#define FEC_RCR_BC_REJ BIT(4)
+#define FEC_RCR_FLOWCTL BIT(5)
+#define FEC_RCR_RMII BIT(8)
+#define FEC_RCR_10BASET BIT(9)
+/* TX WMARK bits */
+#define FEC_TXWMRK_STRFWD BIT(8)
#define FEC_MII_TIMEOUT 30000 /* us */
@@ -1038,7 +1053,7 @@ fec_restart(struct net_device *ndev)
struct fec_enet_private *fep = netdev_priv(ndev);
u32 temp_mac[2];
u32 rcntl = OPT_FRAME_SIZE | 0x04;
- u32 ecntl = 0x2; /* ETHEREN */
+ u32 ecntl = FEC_ECR_ETHEREN;
/* Whack a reset. We should wait for this.
* For i.MX6SX SOC, enet use AXI bus, we use disable MAC
@@ -1116,18 +1131,18 @@ fec_restart(struct net_device *ndev)
fep->phy_interface == PHY_INTERFACE_MODE_RGMII_TXID)
rcntl |= (1 << 6);
else if (fep->phy_interface == PHY_INTERFACE_MODE_RMII)
- rcntl |= (1 << 8);
+ rcntl |= FEC_RCR_RMII;
else
- rcntl &= ~(1 << 8);
+ rcntl &= ~FEC_RCR_RMII;
/* 1G, 100M or 10M */
if (ndev->phydev) {
if (ndev->phydev->speed == SPEED_1000)
ecntl |= (1 << 5);
else if (ndev->phydev->speed == SPEED_100)
- rcntl &= ~(1 << 9);
+ rcntl &= ~FEC_RCR_10BASET;
else
- rcntl |= (1 << 9);
+ rcntl |= FEC_RCR_10BASET;
}
} else {
#ifdef FEC_MIIGSK_ENR
@@ -1186,13 +1201,13 @@ fec_restart(struct net_device *ndev)
if (fep->quirks & FEC_QUIRK_ENET_MAC) {
/* enable ENET endian swap */
- ecntl |= (1 << 8);
+ ecntl |= FEC_ECR_BYTESWP;
/* enable ENET store and forward mode */
- writel(1 << 8, fep->hwp + FEC_X_WMRK);
+ writel(FEC_TXWMRK_STRFWD, fep->hwp + FEC_X_WMRK);
}
if (fep->bufdesc_ex)
- ecntl |= (1 << 4);
+ ecntl |= FEC_ECR_EN1588;
if (fep->quirks & FEC_QUIRK_DELAYED_CLKS_SUPPORT &&
fep->rgmii_txc_dly)
@@ -1291,7 +1306,7 @@ static void
fec_stop(struct net_device *ndev)
{
struct fec_enet_private *fep = netdev_priv(ndev);
- u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & (1 << 8);
+ u32 rmii_mode = readl(fep->hwp + FEC_R_CNTRL) & FEC_RCR_RMII;
u32 val;
/* We cannot expect a graceful transmit stop without link !!! */
@@ -1310,7 +1325,7 @@ fec_stop(struct net_device *ndev)
if (fep->quirks & FEC_QUIRK_HAS_MULTI_QUEUES) {
writel(0, fep->hwp + FEC_ECNTRL);
} else {
- writel(1, fep->hwp + FEC_ECNTRL);
+ writel(FEC_ECR_RESET, fep->hwp + FEC_ECNTRL);
udelay(10);
}
} else {
@@ -1324,11 +1339,16 @@ fec_stop(struct net_device *ndev)
/* We have to keep ENET enabled to have MII interrupt stay working */
if (fep->quirks & FEC_QUIRK_ENET_MAC &&
!(fep->wol_flag & FEC_WOL_FLAG_SLEEP_ON)) {
- writel(2, fep->hwp + FEC_ECNTRL);
+ writel(FEC_ECR_ETHEREN, fep->hwp + FEC_ECNTRL);
writel(rmii_mode, fep->hwp + FEC_R_CNTRL);
}
-}
+ if (fep->bufdesc_ex) {
+ val = readl(fep->hwp + FEC_ECNTRL);
+ val |= FEC_ECR_EN1588;
+ writel(val, fep->hwp + FEC_ECNTRL);
+ }
+}
static void
fec_timeout(struct net_device *ndev, unsigned int txqueue)
diff --git a/drivers/net/ethernet/google/gve/gve_tx_dqo.c b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
index 5147fb37929e..eabed3deca76 100644
--- a/drivers/net/ethernet/google/gve/gve_tx_dqo.c
+++ b/drivers/net/ethernet/google/gve/gve_tx_dqo.c
@@ -596,22 +596,42 @@ static bool gve_can_send_tso(const struct sk_buff *skb)
const int header_len = skb_tcp_all_headers(skb);
const int gso_size = shinfo->gso_size;
int cur_seg_num_bufs;
+ int prev_frag_size;
int cur_seg_size;
int i;
cur_seg_size = skb_headlen(skb) - header_len;
+ prev_frag_size = skb_headlen(skb);
cur_seg_num_bufs = cur_seg_size > 0;
for (i = 0; i < shinfo->nr_frags; i++) {
if (cur_seg_size >= gso_size) {
cur_seg_size %= gso_size;
cur_seg_num_bufs = cur_seg_size > 0;
+
+ if (prev_frag_size > GVE_TX_MAX_BUF_SIZE_DQO) {
+ int prev_frag_remain = prev_frag_size %
+ GVE_TX_MAX_BUF_SIZE_DQO;
+
+ /* If the last descriptor of the previous frag
+ * is less than cur_seg_size, the segment will
+ * span two descriptors in the previous frag.
+ * Since max gso size (9728) is less than
+ * GVE_TX_MAX_BUF_SIZE_DQO, it is impossible
+ * for the segment to span more than two
+ * descriptors.
+ */
+ if (prev_frag_remain &&
+ cur_seg_size > prev_frag_remain)
+ cur_seg_num_bufs++;
+ }
}
if (unlikely(++cur_seg_num_bufs > max_bufs_per_seg))
return false;
- cur_seg_size += skb_frag_size(&shinfo->frags[i]);
+ prev_frag_size = skb_frag_size(&shinfo->frags[i]);
+ cur_seg_size += prev_frag_size;
}
return true;
diff --git a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
index 8c6e13f87b7d..1839a37139dc 100644
--- a/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_ethtool_fdir.c
@@ -531,7 +531,7 @@ ice_parse_rx_flow_user_data(struct ethtool_rx_flow_spec *fsp,
*
* Returns the number of available flow director filters to this VSI
*/
-static int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi)
{
u16 vsi_num = ice_get_hw_vsi_num(hw, vsi->idx);
u16 num_guar;
diff --git a/drivers/net/ethernet/intel/ice/ice_fdir.h b/drivers/net/ethernet/intel/ice/ice_fdir.h
index 1b9b84490689..b384d2a4ab19 100644
--- a/drivers/net/ethernet/intel/ice/ice_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_fdir.h
@@ -202,6 +202,8 @@ struct ice_fdir_base_pkt {
const u8 *tun_pkt;
};
+struct ice_vsi;
+
int ice_alloc_fd_res_cntr(struct ice_hw *hw, u16 *cntr_id);
int ice_free_fd_res_cntr(struct ice_hw *hw, u16 cntr_id);
int ice_alloc_fd_guar_item(struct ice_hw *hw, u16 *cntr_id, u16 num_fltr);
@@ -213,6 +215,7 @@ int
ice_fdir_get_gen_prgm_pkt(struct ice_hw *hw, struct ice_fdir_fltr *input,
u8 *pkt, bool frag, bool tun);
int ice_get_fdir_cnt_all(struct ice_hw *hw);
+int ice_fdir_num_avail_fltr(struct ice_hw *hw, struct ice_vsi *vsi);
bool ice_fdir_is_dup_fltr(struct ice_hw *hw, struct ice_fdir_fltr *input);
bool ice_fdir_has_frag(enum ice_fltr_ptype flow);
struct ice_fdir_fltr *
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
index fb8e85693309..bff3e9662a8f 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.c
@@ -551,6 +551,8 @@ static void ice_vc_fdir_reset_cnt_all(struct ice_vf_fdir *fdir)
fdir->fdir_fltr_cnt[flow][0] = 0;
fdir->fdir_fltr_cnt[flow][1] = 0;
}
+
+ fdir->fdir_fltr_cnt_total = 0;
}
/**
@@ -1567,6 +1569,7 @@ ice_vc_add_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
resp->status = status;
resp->flow_id = conf->flow_id;
vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]++;
+ vf->fdir.fdir_fltr_cnt_total++;
ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
(u8 *)resp, len);
@@ -1631,6 +1634,7 @@ ice_vc_del_fdir_fltr_post(struct ice_vf *vf, struct ice_vf_fdir_ctx *ctx,
resp->status = status;
ice_vc_fdir_remove_entry(vf, conf, conf->flow_id);
vf->fdir.fdir_fltr_cnt[conf->input.flow_type][is_tun]--;
+ vf->fdir.fdir_fltr_cnt_total--;
ret = ice_vc_send_msg_to_vf(vf, ctx->v_opcode, v_ret,
(u8 *)resp, len);
@@ -1797,6 +1801,7 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
struct virtchnl_fdir_add *stat = NULL;
struct virtchnl_fdir_fltr_conf *conf;
enum virtchnl_status_code v_ret;
+ struct ice_vsi *vf_vsi;
struct device *dev;
struct ice_pf *pf;
int is_tun = 0;
@@ -1805,6 +1810,17 @@ int ice_vc_add_fdir_fltr(struct ice_vf *vf, u8 *msg)
pf = vf->pf;
dev = ice_pf_to_dev(pf);
+ vf_vsi = ice_get_vf_vsi(vf);
+
+#define ICE_VF_MAX_FDIR_FILTERS 128
+ if (!ice_fdir_num_avail_fltr(&pf->hw, vf_vsi) ||
+ vf->fdir.fdir_fltr_cnt_total >= ICE_VF_MAX_FDIR_FILTERS) {
+ v_ret = VIRTCHNL_STATUS_ERR_PARAM;
+ dev_err(dev, "Max number of FDIR filters for VF %d is reached\n",
+ vf->vf_id);
+ goto err_exit;
+ }
+
ret = ice_vc_fdir_param_check(vf, fltr->vsi_id);
if (ret) {
v_ret = VIRTCHNL_STATUS_ERR_PARAM;
diff --git a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
index c5bcc8d7481c..ac6dcab454b4 100644
--- a/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
+++ b/drivers/net/ethernet/intel/ice/ice_virtchnl_fdir.h
@@ -29,6 +29,7 @@ struct ice_vf_fdir_ctx {
struct ice_vf_fdir {
u16 fdir_fltr_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
int prof_entry_cnt[ICE_FLTR_PTYPE_MAX][ICE_FD_HW_SEG_MAX];
+ u16 fdir_fltr_cnt_total;
struct ice_fd_hw_prof **fdir_prof;
struct idr fdir_rule_idr;
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
index 4b713832fdd5..f5c0a4214c4e 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_atcam.c
@@ -391,7 +391,8 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
if (err)
return err;
- lkey_id = aregion->ops->lkey_id_get(aregion, aentry->enc_key, erp_id);
+ lkey_id = aregion->ops->lkey_id_get(aregion, aentry->ht_key.enc_key,
+ erp_id);
if (IS_ERR(lkey_id))
return PTR_ERR(lkey_id);
aentry->lkey_id = lkey_id;
@@ -399,7 +400,7 @@ mlxsw_sp_acl_atcam_region_entry_insert(struct mlxsw_sp *mlxsw_sp,
kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_WRITE,
priority, region->tcam_region_info,
- aentry->enc_key, erp_id,
+ aentry->ht_key.enc_key, erp_id,
aentry->delta_info.start,
aentry->delta_info.mask,
aentry->delta_info.value,
@@ -428,7 +429,7 @@ mlxsw_sp_acl_atcam_region_entry_remove(struct mlxsw_sp *mlxsw_sp,
mlxsw_reg_ptce3_pack(ptce3_pl, false, MLXSW_REG_PTCE3_OP_WRITE_WRITE, 0,
region->tcam_region_info,
- aentry->enc_key, erp_id,
+ aentry->ht_key.enc_key, erp_id,
aentry->delta_info.start,
aentry->delta_info.mask,
aentry->delta_info.value,
@@ -457,7 +458,7 @@ mlxsw_sp_acl_atcam_region_entry_action_replace(struct mlxsw_sp *mlxsw_sp,
kvdl_index = mlxsw_afa_block_first_kvdl_index(rulei->act_block);
mlxsw_reg_ptce3_pack(ptce3_pl, true, MLXSW_REG_PTCE3_OP_WRITE_UPDATE,
priority, region->tcam_region_info,
- aentry->enc_key, erp_id,
+ aentry->ht_key.enc_key, erp_id,
aentry->delta_info.start,
aentry->delta_info.mask,
aentry->delta_info.value,
@@ -480,15 +481,13 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
int err;
mlxsw_afk_encode(afk, region->key_info, &rulei->values,
- aentry->ht_key.full_enc_key, mask);
+ aentry->ht_key.enc_key, mask);
erp_mask = mlxsw_sp_acl_erp_mask_get(aregion, mask, false);
if (IS_ERR(erp_mask))
return PTR_ERR(erp_mask);
aentry->erp_mask = erp_mask;
aentry->ht_key.erp_id = mlxsw_sp_acl_erp_mask_erp_id(erp_mask);
- memcpy(aentry->enc_key, aentry->ht_key.full_enc_key,
- sizeof(aentry->enc_key));
/* Compute all needed delta information and clear the delta bits
* from the encrypted key.
@@ -497,9 +496,8 @@ __mlxsw_sp_acl_atcam_entry_add(struct mlxsw_sp *mlxsw_sp,
aentry->delta_info.start = mlxsw_sp_acl_erp_delta_start(delta);
aentry->delta_info.mask = mlxsw_sp_acl_erp_delta_mask(delta);
aentry->delta_info.value =
- mlxsw_sp_acl_erp_delta_value(delta,
- aentry->ht_key.full_enc_key);
- mlxsw_sp_acl_erp_delta_clear(delta, aentry->enc_key);
+ mlxsw_sp_acl_erp_delta_value(delta, aentry->ht_key.enc_key);
+ mlxsw_sp_acl_erp_delta_clear(delta, aentry->ht_key.enc_key);
/* Add rule to the list of A-TCAM rules, assuming this
* rule is intended to A-TCAM. In case this rule does
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
index 95f63fcf4ba1..a54eedb69a3f 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_bloom_filter.c
@@ -249,7 +249,7 @@ __mlxsw_sp_acl_bf_key_encode(struct mlxsw_sp_acl_atcam_region *aregion,
memcpy(chunk + pad_bytes, &erp_region_id,
sizeof(erp_region_id));
memcpy(chunk + key_offset,
- &aentry->enc_key[chunk_key_offsets[chunk_index]],
+ &aentry->ht_key.enc_key[chunk_key_offsets[chunk_index]],
chunk_key_len);
chunk += chunk_len;
}
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
index d231f4d2888b..9eee229303cc 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_erp.c
@@ -1217,18 +1217,6 @@ static bool mlxsw_sp_acl_erp_delta_check(void *priv, const void *parent_obj,
return err ? false : true;
}
-static int mlxsw_sp_acl_erp_hints_obj_cmp(const void *obj1, const void *obj2)
-{
- const struct mlxsw_sp_acl_erp_key *key1 = obj1;
- const struct mlxsw_sp_acl_erp_key *key2 = obj2;
-
- /* For hints purposes, two objects are considered equal
- * in case the masks are the same. Does not matter what
- * the "ctcam" value is.
- */
- return memcmp(key1->mask, key2->mask, sizeof(key1->mask));
-}
-
static void *mlxsw_sp_acl_erp_delta_create(void *priv, void *parent_obj,
void *obj)
{
@@ -1308,7 +1296,6 @@ static void mlxsw_sp_acl_erp_root_destroy(void *priv, void *root_priv)
static const struct objagg_ops mlxsw_sp_acl_erp_objagg_ops = {
.obj_size = sizeof(struct mlxsw_sp_acl_erp_key),
.delta_check = mlxsw_sp_acl_erp_delta_check,
- .hints_obj_cmp = mlxsw_sp_acl_erp_hints_obj_cmp,
.delta_create = mlxsw_sp_acl_erp_delta_create,
.delta_destroy = mlxsw_sp_acl_erp_delta_destroy,
.root_create = mlxsw_sp_acl_erp_root_create,
diff --git a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
index edbbc89e7a71..24ba15d8b416 100644
--- a/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
+++ b/drivers/net/ethernet/mellanox/mlxsw/spectrum_acl_tcam.h
@@ -171,9 +171,9 @@ struct mlxsw_sp_acl_atcam_region {
};
struct mlxsw_sp_acl_atcam_entry_ht_key {
- char full_enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded
- * key.
- */
+ char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key, minus
+ * delta bits.
+ */
u8 erp_id;
};
@@ -185,9 +185,6 @@ struct mlxsw_sp_acl_atcam_entry {
struct rhash_head ht_node;
struct list_head list; /* Member in entries_list */
struct mlxsw_sp_acl_atcam_entry_ht_key ht_key;
- char enc_key[MLXSW_REG_PTCEX_FLEX_KEY_BLOCKS_LEN]; /* Encoded key,
- * minus delta bits.
- */
struct {
u16 start;
u8 mask;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
index 39112d5cb5b8..687eb17e41c6 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwmac4_core.c
@@ -971,7 +971,7 @@ static void dwmac4_set_mac_loopback(void __iomem *ioaddr, bool enable)
}
static void dwmac4_update_vlan_hash(struct mac_device_info *hw, u32 hash,
- __le16 perfect_match, bool is_double)
+ u16 perfect_match, bool is_double)
{
void __iomem *ioaddr = hw->pcsr;
u32 value;
diff --git a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
index dd73f38ec08d..813327d04c56 100644
--- a/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
+++ b/drivers/net/ethernet/stmicro/stmmac/dwxgmac2_core.c
@@ -582,7 +582,7 @@ static int dwxgmac2_rss_configure(struct mac_device_info *hw,
}
static void dwxgmac2_update_vlan_hash(struct mac_device_info *hw, u32 hash,
- __le16 perfect_match, bool is_double)
+ u16 perfect_match, bool is_double)
{
void __iomem *ioaddr = hw->pcsr;
diff --git a/drivers/net/ethernet/stmicro/stmmac/hwif.h b/drivers/net/ethernet/stmicro/stmmac/hwif.h
index b2b9cf04bc72..820e2251b7c8 100644
--- a/drivers/net/ethernet/stmicro/stmmac/hwif.h
+++ b/drivers/net/ethernet/stmicro/stmmac/hwif.h
@@ -366,7 +366,7 @@ struct stmmac_ops {
struct stmmac_rss *cfg, u32 num_rxq);
/* VLAN */
void (*update_vlan_hash)(struct mac_device_info *hw, u32 hash,
- __le16 perfect_match, bool is_double);
+ u16 perfect_match, bool is_double);
void (*enable_vlan)(struct mac_device_info *hw, u32 type);
int (*add_hw_vlan_rx_fltr)(struct net_device *dev,
struct mac_device_info *hw,
diff --git a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
index e2d51014ab4b..93630840309e 100644
--- a/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
+++ b/drivers/net/ethernet/stmicro/stmmac/stmmac_main.c
@@ -6311,7 +6311,7 @@ static u32 stmmac_vid_crc32_le(__le16 vid_le)
static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
{
u32 crc, hash = 0;
- __le16 pmatch = 0;
+ u16 pmatch = 0;
int count = 0;
u16 vid = 0;
@@ -6326,7 +6326,7 @@ static int stmmac_vlan_update(struct stmmac_priv *priv, bool is_double)
if (count > 2) /* VID = 0 always passes filter */
return -EOPNOTSUPP;
- pmatch = cpu_to_le16(vid);
+ pmatch = vid;
hash = 0;
}
diff --git a/drivers/net/netconsole.c b/drivers/net/netconsole.c
index bdff9ac5056d..1e797f1ddc31 100644
--- a/drivers/net/netconsole.c
+++ b/drivers/net/netconsole.c
@@ -716,6 +716,7 @@ static int netconsole_netdev_event(struct notifier_block *this,
/* rtnl_lock already held
* we might sleep in __netpoll_cleanup()
*/
+ nt->enabled = false;
spin_unlock_irqrestore(&target_list_lock, flags);
__netpoll_cleanup(&nt->np);
@@ -723,7 +724,6 @@ static int netconsole_netdev_event(struct notifier_block *this,
spin_lock_irqsave(&target_list_lock, flags);
netdev_put(nt->np.dev, &nt->np.dev_tracker);
nt->np.dev = NULL;
- nt->enabled = false;
stopped = true;
netconsole_target_put(nt);
goto restart;
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.c b/drivers/net/wireless/ath/ath11k/dp_rx.c
index b1067bcdf88a..3746f9c95696 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.c
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.c
@@ -1879,8 +1879,7 @@ static void ath11k_dp_rx_h_csum_offload(struct ath11k *ar, struct sk_buff *msdu)
CHECKSUM_NONE : CHECKSUM_UNNECESSARY;
}
-static int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar,
- enum hal_encrypt_type enctype)
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype)
{
switch (enctype) {
case HAL_ENCRYPT_TYPE_OPEN:
diff --git a/drivers/net/wireless/ath/ath11k/dp_rx.h b/drivers/net/wireless/ath/ath11k/dp_rx.h
index 623da3bf9dc8..c322e30caa96 100644
--- a/drivers/net/wireless/ath/ath11k/dp_rx.h
+++ b/drivers/net/wireless/ath/ath11k/dp_rx.h
@@ -1,6 +1,7 @@
/* SPDX-License-Identifier: BSD-3-Clause-Clear */
/*
* Copyright (c) 2018-2019 The Linux Foundation. All rights reserved.
+ * Copyright (c) 2024 Qualcomm Innovation Center, Inc. All rights reserved.
*/
#ifndef ATH11K_DP_RX_H
#define ATH11K_DP_RX_H
@@ -95,4 +96,6 @@ int ath11k_peer_rx_frag_setup(struct ath11k *ar, const u8 *peer_mac, int vdev_id
int ath11k_dp_rx_pktlog_start(struct ath11k_base *ab);
int ath11k_dp_rx_pktlog_stop(struct ath11k_base *ab, bool stop_timer);
+int ath11k_dp_rx_crypto_mic_len(struct ath11k *ar, enum hal_encrypt_type enctype);
+
#endif /* ATH11K_DP_RX_H */
diff --git a/drivers/net/wireless/ath/ath11k/mac.c b/drivers/net/wireless/ath/ath11k/mac.c
index b863ead198bd..8234e34269ed 100644
--- a/drivers/net/wireless/ath/ath11k/mac.c
+++ b/drivers/net/wireless/ath/ath11k/mac.c
@@ -3748,6 +3748,7 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
switch (key->cipher) {
case WLAN_CIPHER_SUITE_CCMP:
+ case WLAN_CIPHER_SUITE_CCMP_256:
arg.key_cipher = WMI_CIPHER_AES_CCM;
/* TODO: Re-check if flag is valid */
key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
@@ -3757,12 +3758,10 @@ static int ath11k_install_key(struct ath11k_vif *arvif,
arg.key_txmic_len = 8;
arg.key_rxmic_len = 8;
break;
- case WLAN_CIPHER_SUITE_CCMP_256:
- arg.key_cipher = WMI_CIPHER_AES_CCM;
- break;
case WLAN_CIPHER_SUITE_GCMP:
case WLAN_CIPHER_SUITE_GCMP_256:
arg.key_cipher = WMI_CIPHER_AES_GCM;
+ key->flags |= IEEE80211_KEY_FLAG_GENERATE_IV_MGMT;
break;
default:
ath11k_warn(ar->ab, "cipher %d is not supported\n", key->cipher);
@@ -5542,7 +5541,10 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
{
struct ath11k_base *ab = ar->ab;
struct ieee80211_hdr *hdr = (struct ieee80211_hdr *)skb->data;
+ struct ath11k_skb_cb *skb_cb = ATH11K_SKB_CB(skb);
struct ieee80211_tx_info *info;
+ enum hal_encrypt_type enctype;
+ unsigned int mic_len;
dma_addr_t paddr;
int buf_id;
int ret;
@@ -5566,7 +5568,12 @@ static int ath11k_mac_mgmt_tx_wmi(struct ath11k *ar, struct ath11k_vif *arvif,
ieee80211_is_deauth(hdr->frame_control) ||
ieee80211_is_disassoc(hdr->frame_control)) &&
ieee80211_has_protected(hdr->frame_control)) {
- skb_put(skb, IEEE80211_CCMP_MIC_LEN);
+ if (!(skb_cb->flags & ATH11K_SKB_CIPHER_SET))
+ ath11k_warn(ab, "WMI management tx frame without ATH11K_SKB_CIPHER_SET");
+
+ enctype = ath11k_dp_tx_get_encrypt_type(skb_cb->cipher);
+ mic_len = ath11k_dp_rx_crypto_mic_len(ar, enctype);
+ skb_put(skb, mic_len);
}
}
diff --git a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
index 7717eb85a1db..47c0e8e429e5 100644
--- a/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
+++ b/drivers/net/wireless/broadcom/brcm80211/brcmsmac/phy/phy_lcn.c
@@ -2567,7 +2567,6 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
struct lcnphy_txgains cal_gains, temp_gains;
u16 hash;
- u8 band_idx;
int j;
u16 ncorr_override[5];
u16 syst_coeffs[] = { 0x0000, 0x0000, 0x0000, 0x0000, 0x0000, 0x0000,
@@ -2599,6 +2598,9 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
u16 *values_to_save;
struct brcms_phy_lcnphy *pi_lcn = pi->u.pi_lcnphy;
+ if (WARN_ON(CHSPEC_IS5G(pi->radio_chanspec)))
+ return;
+
values_to_save = kmalloc_array(20, sizeof(u16), GFP_ATOMIC);
if (NULL == values_to_save)
return;
@@ -2662,20 +2664,18 @@ wlc_lcnphy_tx_iqlo_cal(struct brcms_phy *pi,
hash = (target_gains->gm_gain << 8) |
(target_gains->pga_gain << 4) | (target_gains->pad_gain);
- band_idx = (CHSPEC_IS5G(pi->radio_chanspec) ? 1 : 0);
-
cal_gains = *target_gains;
memset(ncorr_override, 0, sizeof(ncorr_override));
- for (j = 0; j < iqcal_gainparams_numgains_lcnphy[band_idx]; j++) {
- if (hash == tbl_iqcal_gainparams_lcnphy[band_idx][j][0]) {
+ for (j = 0; j < iqcal_gainparams_numgains_lcnphy[0]; j++) {
+ if (hash == tbl_iqcal_gainparams_lcnphy[0][j][0]) {
cal_gains.gm_gain =
- tbl_iqcal_gainparams_lcnphy[band_idx][j][1];
+ tbl_iqcal_gainparams_lcnphy[0][j][1];
cal_gains.pga_gain =
- tbl_iqcal_gainparams_lcnphy[band_idx][j][2];
+ tbl_iqcal_gainparams_lcnphy[0][j][2];
cal_gains.pad_gain =
- tbl_iqcal_gainparams_lcnphy[band_idx][j][3];
+ tbl_iqcal_gainparams_lcnphy[0][j][3];
memcpy(ncorr_override,
- &tbl_iqcal_gainparams_lcnphy[band_idx][j][3],
+ &tbl_iqcal_gainparams_lcnphy[0][j][3],
sizeof(ncorr_override));
break;
}
diff --git a/drivers/net/wireless/marvell/mwifiex/cfg80211.c b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
index c907da2a4789..d1b23dba5ad5 100644
--- a/drivers/net/wireless/marvell/mwifiex/cfg80211.c
+++ b/drivers/net/wireless/marvell/mwifiex/cfg80211.c
@@ -926,6 +926,8 @@ mwifiex_init_new_priv_params(struct mwifiex_private *priv,
return -EOPNOTSUPP;
}
+ priv->bss_num = mwifiex_get_unused_bss_num(adapter, priv->bss_type);
+
spin_lock_irqsave(&adapter->main_proc_lock, flags);
adapter->main_locked = false;
spin_unlock_irqrestore(&adapter->main_proc_lock, flags);
diff --git a/drivers/net/wireless/realtek/rtw89/debug.c b/drivers/net/wireless/realtek/rtw89/debug.c
index 3a8fe60d0bb7..0e014d6afb84 100644
--- a/drivers/net/wireless/realtek/rtw89/debug.c
+++ b/drivers/net/wireless/realtek/rtw89/debug.c
@@ -2386,7 +2386,7 @@ static void rtw89_sta_info_get_iter(void *data, struct ieee80211_sta *sta)
case RX_ENC_HE:
seq_printf(m, "HE %dSS MCS-%d GI:%s", status->nss, status->rate_idx,
status->he_gi <= NL80211_RATE_INFO_HE_GI_3_2 ?
- he_gi_str[rate->he_gi] : "N/A");
+ he_gi_str[status->he_gi] : "N/A");
break;
}
seq_printf(m, "\t(hw_rate=0x%x)\n", rtwsta->rx_hw_rate);
diff --git a/drivers/net/wireless/virt_wifi.c b/drivers/net/wireless/virt_wifi.c
index ba14d83353a4..fb4d95a027fe 100644
--- a/drivers/net/wireless/virt_wifi.c
+++ b/drivers/net/wireless/virt_wifi.c
@@ -136,6 +136,9 @@ static struct ieee80211_supported_band band_5ghz = {
/* Assigned at module init. Guaranteed locally-administered and unicast. */
static u8 fake_router_bssid[ETH_ALEN] __ro_after_init = {};
+#define VIRT_WIFI_SSID "VirtWifi"
+#define VIRT_WIFI_SSID_LEN 8
+
static void virt_wifi_inform_bss(struct wiphy *wiphy)
{
u64 tsf = div_u64(ktime_get_boottime_ns(), 1000);
@@ -146,8 +149,8 @@ static void virt_wifi_inform_bss(struct wiphy *wiphy)
u8 ssid[8];
} __packed ssid = {
.tag = WLAN_EID_SSID,
- .len = 8,
- .ssid = "VirtWifi",
+ .len = VIRT_WIFI_SSID_LEN,
+ .ssid = VIRT_WIFI_SSID,
};
informed_bss = cfg80211_inform_bss(wiphy, &channel_5ghz,
@@ -213,6 +216,8 @@ struct virt_wifi_netdev_priv {
struct net_device *upperdev;
u32 tx_packets;
u32 tx_failed;
+ u32 connect_requested_ssid_len;
+ u8 connect_requested_ssid[IEEE80211_MAX_SSID_LEN];
u8 connect_requested_bss[ETH_ALEN];
bool is_up;
bool is_connected;
@@ -229,6 +234,12 @@ static int virt_wifi_connect(struct wiphy *wiphy, struct net_device *netdev,
if (priv->being_deleted || !priv->is_up)
return -EBUSY;
+ if (!sme->ssid)
+ return -EINVAL;
+
+ priv->connect_requested_ssid_len = sme->ssid_len;
+ memcpy(priv->connect_requested_ssid, sme->ssid, sme->ssid_len);
+
could_schedule = schedule_delayed_work(&priv->connect, HZ * 2);
if (!could_schedule)
return -EBUSY;
@@ -252,12 +263,15 @@ static void virt_wifi_connect_complete(struct work_struct *work)
container_of(work, struct virt_wifi_netdev_priv, connect.work);
u8 *requested_bss = priv->connect_requested_bss;
bool right_addr = ether_addr_equal(requested_bss, fake_router_bssid);
+ bool right_ssid = priv->connect_requested_ssid_len == VIRT_WIFI_SSID_LEN &&
+ !memcmp(priv->connect_requested_ssid, VIRT_WIFI_SSID,
+ priv->connect_requested_ssid_len);
u16 status = WLAN_STATUS_SUCCESS;
if (is_zero_ether_addr(requested_bss))
requested_bss = NULL;
- if (!priv->is_up || (requested_bss && !right_addr))
+ if (!priv->is_up || (requested_bss && !right_addr) || !right_ssid)
status = WLAN_STATUS_UNSPECIFIED_FAILURE;
else
priv->is_connected = true;
diff --git a/drivers/nvme/host/pci.c b/drivers/nvme/host/pci.c
index 32e89ea853a4..27446fa84752 100644
--- a/drivers/nvme/host/pci.c
+++ b/drivers/nvme/host/pci.c
@@ -910,7 +910,8 @@ static blk_status_t nvme_prep_rq(struct nvme_dev *dev, struct request *req)
blk_mq_start_request(req);
return BLK_STS_OK;
out_unmap_data:
- nvme_unmap_data(dev, req);
+ if (blk_rq_nr_phys_segments(req))
+ nvme_unmap_data(dev, req);
out_free_cmd:
nvme_cleanup_cmd(req);
return ret;
@@ -1322,7 +1323,7 @@ static void nvme_warn_reset(struct nvme_dev *dev, u32 csts)
dev_warn(dev->ctrl.device,
"Does your device have a faulty power saving mode enabled?\n");
dev_warn(dev->ctrl.device,
- "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off\" and report a bug\n");
+ "Try \"nvme_core.default_ps_max_latency_us=0 pcie_aspm=off pcie_port_pm=off\" and report a bug\n");
}
static enum blk_eh_timer_return nvme_timeout(struct request *req)
diff --git a/drivers/nvme/target/auth.c b/drivers/nvme/target/auth.c
index e900525b7866..aacc05ec00c2 100644
--- a/drivers/nvme/target/auth.c
+++ b/drivers/nvme/target/auth.c
@@ -314,7 +314,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
req->sq->dhchap_c1,
challenge, shash_len);
if (ret)
- goto out_free_response;
+ goto out_free_challenge;
}
pr_debug("ctrl %d qid %d host response seq %u transaction %d\n",
@@ -325,7 +325,7 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
GFP_KERNEL);
if (!shash) {
ret = -ENOMEM;
- goto out_free_response;
+ goto out_free_challenge;
}
shash->tfm = shash_tfm;
ret = crypto_shash_init(shash);
@@ -361,9 +361,10 @@ int nvmet_auth_host_hash(struct nvmet_req *req, u8 *response,
goto out;
ret = crypto_shash_final(shash, response);
out:
+ kfree(shash);
+out_free_challenge:
if (challenge != req->sq->dhchap_c1)
kfree(challenge);
- kfree(shash);
out_free_response:
kfree_sensitive(host_response);
out_free_tfm:
@@ -426,14 +427,14 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
req->sq->dhchap_c2,
challenge, shash_len);
if (ret)
- goto out_free_response;
+ goto out_free_challenge;
}
shash = kzalloc(sizeof(*shash) + crypto_shash_descsize(shash_tfm),
GFP_KERNEL);
if (!shash) {
ret = -ENOMEM;
- goto out_free_response;
+ goto out_free_challenge;
}
shash->tfm = shash_tfm;
@@ -470,9 +471,10 @@ int nvmet_auth_ctrl_hash(struct nvmet_req *req, u8 *response,
goto out;
ret = crypto_shash_final(shash, response);
out:
+ kfree(shash);
+out_free_challenge:
if (challenge != req->sq->dhchap_c2)
kfree(challenge);
- kfree(shash);
out_free_response:
kfree_sensitive(ctrl_response);
out_free_tfm:
diff --git a/drivers/opp/ti-opp-supply.c b/drivers/opp/ti-opp-supply.c
index 8f3f13fbbb25..a8a696d2e03a 100644
--- a/drivers/opp/ti-opp-supply.c
+++ b/drivers/opp/ti-opp-supply.c
@@ -400,10 +400,12 @@ static int ti_opp_supply_probe(struct platform_device *pdev)
}
ret = dev_pm_opp_set_config_regulators(cpu_dev, ti_opp_config_regulators);
- if (ret < 0)
+ if (ret < 0) {
_free_optimized_voltages(dev, &opp_data);
+ return ret;
+ }
- return ret;
+ return 0;
}
static struct platform_driver ti_opp_supply_driver = {
diff --git a/drivers/parport/procfs.c b/drivers/parport/procfs.c
index d740eba3c099..8400a379186e 100644
--- a/drivers/parport/procfs.c
+++ b/drivers/parport/procfs.c
@@ -51,12 +51,12 @@ static int do_active_device(struct ctl_table *table, int write,
for (dev = port->devices; dev ; dev = dev->next) {
if(dev == port->cad) {
- len += sprintf(buffer, "%s\n", dev->name);
+ len += snprintf(buffer, sizeof(buffer), "%s\n", dev->name);
}
}
if(!len) {
- len += sprintf(buffer, "%s\n", "none");
+ len += snprintf(buffer, sizeof(buffer), "%s\n", "none");
}
if (len > *lenp)
@@ -87,19 +87,19 @@ static int do_autoprobe(struct ctl_table *table, int write,
}
if ((str = info->class_name) != NULL)
- len += sprintf (buffer + len, "CLASS:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "CLASS:%s;\n", str);
if ((str = info->model) != NULL)
- len += sprintf (buffer + len, "MODEL:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "MODEL:%s;\n", str);
if ((str = info->mfr) != NULL)
- len += sprintf (buffer + len, "MANUFACTURER:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "MANUFACTURER:%s;\n", str);
if ((str = info->description) != NULL)
- len += sprintf (buffer + len, "DESCRIPTION:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "DESCRIPTION:%s;\n", str);
if ((str = info->cmdset) != NULL)
- len += sprintf (buffer + len, "COMMAND SET:%s;\n", str);
+ len += snprintf (buffer + len, sizeof(buffer) - len, "COMMAND SET:%s;\n", str);
if (len > *lenp)
len = *lenp;
@@ -117,7 +117,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
void *result, size_t *lenp, loff_t *ppos)
{
struct parport *port = (struct parport *)table->extra1;
- char buffer[20];
+ char buffer[64];
int len = 0;
if (*ppos) {
@@ -128,7 +128,7 @@ static int do_hardware_base_addr(struct ctl_table *table, int write,
if (write) /* permissions prevent this anyway */
return -EACCES;
- len += sprintf (buffer, "%lu\t%lu\n", port->base, port->base_hi);
+ len += snprintf (buffer, sizeof(buffer), "%lu\t%lu\n", port->base, port->base_hi);
if (len > *lenp)
len = *lenp;
@@ -155,7 +155,7 @@ static int do_hardware_irq(struct ctl_table *table, int write,
if (write) /* permissions prevent this anyway */
return -EACCES;
- len += sprintf (buffer, "%d\n", port->irq);
+ len += snprintf (buffer, sizeof(buffer), "%d\n", port->irq);
if (len > *lenp)
len = *lenp;
@@ -182,7 +182,7 @@ static int do_hardware_dma(struct ctl_table *table, int write,
if (write) /* permissions prevent this anyway */
return -EACCES;
- len += sprintf (buffer, "%d\n", port->dma);
+ len += snprintf (buffer, sizeof(buffer), "%d\n", port->dma);
if (len > *lenp)
len = *lenp;
@@ -213,7 +213,7 @@ static int do_hardware_modes(struct ctl_table *table, int write,
#define printmode(x) \
do { \
if (port->modes & PARPORT_MODE_##x) \
- len += sprintf(buffer + len, "%s%s", f++ ? "," : "", #x); \
+ len += snprintf(buffer + len, sizeof(buffer) - len, "%s%s", f++ ? "," : "", #x); \
} while (0)
int f = 0;
printmode(PCSPP);
diff --git a/drivers/pci/controller/dwc/pci-keystone.c b/drivers/pci/controller/dwc/pci-keystone.c
index 7ecad72cff7e..6007ffcb4752 100644
--- a/drivers/pci/controller/dwc/pci-keystone.c
+++ b/drivers/pci/controller/dwc/pci-keystone.c
@@ -247,8 +247,68 @@ static struct irq_chip ks_pcie_msi_irq_chip = {
.irq_unmask = ks_pcie_msi_unmask,
};
+/**
+ * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ * PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+ u32 val;
+
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ val |= DBI_CS2;
+ ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+ do {
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ } while (!(val & DBI_CS2));
+}
+
+/**
+ * ks_pcie_clear_dbi_mode() - Disable DBI mode
+ * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
+ * PCIe host controller driver information.
+ *
+ * Since modification of dbi_cs2 involves different clock domain, read the
+ * status back to ensure the transition is complete.
+ */
+static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
+{
+ u32 val;
+
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ val &= ~DBI_CS2;
+ ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+ do {
+ val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
+ } while (val & DBI_CS2);
+}
+
static int ks_pcie_msi_host_init(struct dw_pcie_rp *pp)
{
+ struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
+ struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
+
+ /* Configure and set up BAR0 */
+ ks_pcie_set_dbi_mode(ks_pcie);
+
+ /* Enable BAR0 */
+ dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
+ dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
+
+ ks_pcie_clear_dbi_mode(ks_pcie);
+
+ /*
+ * For BAR0, just setting bus address for inbound writes (MSI) should
+ * be sufficient. Use physical address to avoid any conflicts.
+ */
+ dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
+
pp->msi_irq_chip = &ks_pcie_msi_irq_chip;
return dw_pcie_allocate_domains(pp);
}
@@ -343,59 +403,22 @@ static const struct irq_domain_ops ks_pcie_legacy_irq_domain_ops = {
.xlate = irq_domain_xlate_onetwocell,
};
-/**
- * ks_pcie_set_dbi_mode() - Set DBI mode to access overlaid BAR mask registers
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- * PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_set_dbi_mode(struct keystone_pcie *ks_pcie)
-{
- u32 val;
-
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- val |= DBI_CS2;
- ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
- do {
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- } while (!(val & DBI_CS2));
-}
-
-/**
- * ks_pcie_clear_dbi_mode() - Disable DBI mode
- * @ks_pcie: A pointer to the keystone_pcie structure which holds the KeyStone
- * PCIe host controller driver information.
- *
- * Since modification of dbi_cs2 involves different clock domain, read the
- * status back to ensure the transition is complete.
- */
-static void ks_pcie_clear_dbi_mode(struct keystone_pcie *ks_pcie)
-{
- u32 val;
-
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- val &= ~DBI_CS2;
- ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
-
- do {
- val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
- } while (val & DBI_CS2);
-}
-
-static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
+static int ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
{
u32 val;
u32 num_viewport = ks_pcie->num_viewport;
struct dw_pcie *pci = ks_pcie->pci;
struct dw_pcie_rp *pp = &pci->pp;
- u64 start, end;
+ struct resource_entry *entry;
struct resource *mem;
+ u64 start, end;
int i;
- mem = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM)->res;
+ entry = resource_list_first_type(&pp->bridge->windows, IORESOURCE_MEM);
+ if (!entry)
+ return -ENODEV;
+
+ mem = entry->res;
start = mem->start;
end = mem->end;
@@ -406,7 +429,7 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
ks_pcie_clear_dbi_mode(ks_pcie);
if (ks_pcie->is_am6)
- return;
+ return 0;
val = ilog2(OB_WIN_SIZE);
ks_pcie_app_writel(ks_pcie, OB_SIZE, val);
@@ -423,6 +446,8 @@ static void ks_pcie_setup_rc_app_regs(struct keystone_pcie *ks_pcie)
val = ks_pcie_app_readl(ks_pcie, CMD_STATUS);
val |= OB_XLAT_EN_VAL;
ks_pcie_app_writel(ks_pcie, CMD_STATUS, val);
+
+ return 0;
}
static void __iomem *ks_pcie_other_map_bus(struct pci_bus *bus,
@@ -448,44 +473,10 @@ static struct pci_ops ks_child_pcie_ops = {
.write = pci_generic_config_write,
};
-/**
- * ks_pcie_v3_65_add_bus() - keystone add_bus post initialization
- * @bus: A pointer to the PCI bus structure.
- *
- * This sets BAR0 to enable inbound access for MSI_IRQ register
- */
-static int ks_pcie_v3_65_add_bus(struct pci_bus *bus)
-{
- struct dw_pcie_rp *pp = bus->sysdata;
- struct dw_pcie *pci = to_dw_pcie_from_pp(pp);
- struct keystone_pcie *ks_pcie = to_keystone_pcie(pci);
-
- if (!pci_is_root_bus(bus))
- return 0;
-
- /* Configure and set up BAR0 */
- ks_pcie_set_dbi_mode(ks_pcie);
-
- /* Enable BAR0 */
- dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, 1);
- dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, SZ_4K - 1);
-
- ks_pcie_clear_dbi_mode(ks_pcie);
-
- /*
- * For BAR0, just setting bus address for inbound writes (MSI) should
- * be sufficient. Use physical address to avoid any conflicts.
- */
- dw_pcie_writel_dbi(pci, PCI_BASE_ADDRESS_0, ks_pcie->app.start);
-
- return 0;
-}
-
static struct pci_ops ks_pcie_ops = {
.map_bus = dw_pcie_own_conf_map_bus,
.read = pci_generic_config_read,
.write = pci_generic_config_write,
- .add_bus = ks_pcie_v3_65_add_bus,
};
/**
@@ -818,7 +809,10 @@ static int __init ks_pcie_host_init(struct dw_pcie_rp *pp)
return ret;
ks_pcie_stop_link(pci);
- ks_pcie_setup_rc_app_regs(ks_pcie);
+ ret = ks_pcie_setup_rc_app_regs(ks_pcie);
+ if (ret)
+ return ret;
+
writew(PCI_IO_RANGE_TYPE_32 | (PCI_IO_RANGE_TYPE_32 << 8),
pci->dbi_base + PCI_IO_BASE);
diff --git a/drivers/pci/controller/dwc/pcie-designware-ep.c b/drivers/pci/controller/dwc/pcie-designware-ep.c
index 506d6d061d4c..449ad709495d 100644
--- a/drivers/pci/controller/dwc/pcie-designware-ep.c
+++ b/drivers/pci/controller/dwc/pcie-designware-ep.c
@@ -165,7 +165,7 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
if (!ep->bar_to_atu[bar])
free_win = find_first_zero_bit(ep->ib_window_map, pci->num_ib_windows);
else
- free_win = ep->bar_to_atu[bar];
+ free_win = ep->bar_to_atu[bar] - 1;
if (free_win >= pci->num_ib_windows) {
dev_err(pci->dev, "No free inbound window\n");
@@ -179,7 +179,11 @@ static int dw_pcie_ep_inbound_atu(struct dw_pcie_ep *ep, u8 func_no, int type,
return ret;
}
- ep->bar_to_atu[bar] = free_win;
+ /*
+ * Always increment free_win before assignment, since value 0 is used to identify
+ * unallocated mapping.
+ */
+ ep->bar_to_atu[bar] = free_win + 1;
set_bit(free_win, ep->ib_window_map);
return 0;
@@ -216,7 +220,10 @@ static void dw_pcie_ep_clear_bar(struct pci_epc *epc, u8 func_no, u8 vfunc_no,
struct dw_pcie_ep *ep = epc_get_drvdata(epc);
struct dw_pcie *pci = to_dw_pcie_from_ep(ep);
enum pci_barno bar = epf_bar->barno;
- u32 atu_index = ep->bar_to_atu[bar];
+ u32 atu_index = ep->bar_to_atu[bar] - 1;
+
+ if (!ep->bar_to_atu[bar])
+ return;
__dw_pcie_ep_reset_bar(pci, func_no, bar, epf_bar->flags);
diff --git a/drivers/pci/controller/dwc/pcie-dw-rockchip.c b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
index c1e7653e508e..4332370fefa0 100644
--- a/drivers/pci/controller/dwc/pcie-dw-rockchip.c
+++ b/drivers/pci/controller/dwc/pcie-dw-rockchip.c
@@ -240,7 +240,7 @@ static int rockchip_pcie_resource_get(struct platform_device *pdev,
return PTR_ERR(rockchip->apb_base);
rockchip->rst_gpio = devm_gpiod_get_optional(&pdev->dev, "reset",
- GPIOD_OUT_HIGH);
+ GPIOD_OUT_LOW);
if (IS_ERR(rockchip->rst_gpio))
return PTR_ERR(rockchip->rst_gpio);
diff --git a/drivers/pci/controller/dwc/pcie-qcom-ep.c b/drivers/pci/controller/dwc/pcie-qcom-ep.c
index 1c7fd05ce028..f2bf3eba2254 100644
--- a/drivers/pci/controller/dwc/pcie-qcom-ep.c
+++ b/drivers/pci/controller/dwc/pcie-qcom-ep.c
@@ -446,12 +446,6 @@ static int qcom_pcie_perst_deassert(struct dw_pcie *pci)
static void qcom_pcie_perst_assert(struct dw_pcie *pci)
{
struct qcom_pcie_ep *pcie_ep = to_pcie_ep(pci);
- struct device *dev = pci->dev;
-
- if (pcie_ep->link_status == QCOM_PCIE_EP_LINK_DISABLED) {
- dev_dbg(dev, "Link is already disabled\n");
- return;
- }
qcom_pcie_disable_resources(pcie_ep);
pcie_ep->link_status = QCOM_PCIE_EP_LINK_DISABLED;
diff --git a/drivers/pci/controller/pci-hyperv.c b/drivers/pci/controller/pci-hyperv.c
index b36cbc9136ae..09491d06589e 100644
--- a/drivers/pci/controller/pci-hyperv.c
+++ b/drivers/pci/controller/pci-hyperv.c
@@ -1092,8 +1092,8 @@ static void _hv_pcifront_read_config(struct hv_pci_dev *hpdev, int where,
PCI_CAPABILITY_LIST) {
/* ROM BARs are unimplemented */
*val = 0;
- } else if (where >= PCI_INTERRUPT_LINE && where + size <=
- PCI_INTERRUPT_PIN) {
+ } else if ((where >= PCI_INTERRUPT_LINE && where + size <= PCI_INTERRUPT_PIN) ||
+ (where >= PCI_INTERRUPT_PIN && where + size <= PCI_MIN_GNT)) {
/*
* Interrupt Line and Interrupt PIN are hard-wired to zero
* because this front-end only supports message-signaled
diff --git a/drivers/pci/controller/pci-loongson.c b/drivers/pci/controller/pci-loongson.c
index a860f25473df..76f125d556eb 100644
--- a/drivers/pci/controller/pci-loongson.c
+++ b/drivers/pci/controller/pci-loongson.c
@@ -163,6 +163,19 @@ DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON,
DEV_LS7A_HDMI, loongson_pci_pin_quirk);
+static void loongson_pci_msi_quirk(struct pci_dev *dev)
+{
+ u16 val, class = dev->class >> 8;
+
+ if (class != PCI_CLASS_BRIDGE_HOST)
+ return;
+
+ pci_read_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, &val);
+ val |= PCI_MSI_FLAGS_ENABLE;
+ pci_write_config_word(dev, dev->msi_cap + PCI_MSI_FLAGS, val);
+}
+DECLARE_PCI_FIXUP_FINAL(PCI_VENDOR_ID_LOONGSON, DEV_LS7A_PCIE_PORT5, loongson_pci_msi_quirk);
+
static struct loongson_pci *pci_bus_to_loongson_pci(struct pci_bus *bus)
{
struct pci_config_window *cfg;
diff --git a/drivers/pci/controller/pcie-rcar-host.c b/drivers/pci/controller/pcie-rcar-host.c
index e4faf90feaf5..d0fe5076d977 100644
--- a/drivers/pci/controller/pcie-rcar-host.c
+++ b/drivers/pci/controller/pcie-rcar-host.c
@@ -92,7 +92,11 @@ static int rcar_pcie_wakeup(struct device *pcie_dev, void __iomem *pcie_base)
writel(L1IATN, pcie_base + PMCTLR);
ret = readl_poll_timeout_atomic(pcie_base + PMSR, val,
val & L1FAEG, 10, 1000);
- WARN(ret, "Timeout waiting for L1 link state, ret=%d\n", ret);
+ if (ret) {
+ dev_warn_ratelimited(pcie_dev,
+ "Timeout waiting for L1 link state, ret=%d\n",
+ ret);
+ }
writel(L1FAEG | PMEL1RX, pcie_base + PMSR);
}
diff --git a/drivers/pci/controller/pcie-rockchip.c b/drivers/pci/controller/pcie-rockchip.c
index 1aa84035a8bc..bdce1ba7c1bc 100644
--- a/drivers/pci/controller/pcie-rockchip.c
+++ b/drivers/pci/controller/pcie-rockchip.c
@@ -120,7 +120,7 @@ int rockchip_pcie_parse_dt(struct rockchip_pcie *rockchip)
if (rockchip->is_rc) {
rockchip->ep_gpio = devm_gpiod_get_optional(dev, "ep",
- GPIOD_OUT_HIGH);
+ GPIOD_OUT_LOW);
if (IS_ERR(rockchip->ep_gpio))
return dev_err_probe(dev, PTR_ERR(rockchip->ep_gpio),
"failed to get ep GPIO\n");
diff --git a/drivers/pci/endpoint/functions/pci-epf-vntb.c b/drivers/pci/endpoint/functions/pci-epf-vntb.c
index b4c1a4f6029d..6708d2e789cb 100644
--- a/drivers/pci/endpoint/functions/pci-epf-vntb.c
+++ b/drivers/pci/endpoint/functions/pci-epf-vntb.c
@@ -813,8 +813,9 @@ static int epf_ntb_epc_init(struct epf_ntb *ntb)
*/
static void epf_ntb_epc_cleanup(struct epf_ntb *ntb)
{
- epf_ntb_db_bar_clear(ntb);
epf_ntb_mw_bar_clear(ntb, ntb->num_mws);
+ epf_ntb_db_bar_clear(ntb);
+ epf_ntb_config_sspad_bar_clear(ntb);
}
#define EPF_NTB_R(_name) \
@@ -1032,8 +1033,10 @@ static int vpci_scan_bus(void *sysdata)
struct epf_ntb *ndev = sysdata;
vpci_bus = pci_scan_bus(ndev->vbus_number, &vpci_ops, sysdata);
- if (vpci_bus)
- pr_err("create pci bus\n");
+ if (!vpci_bus) {
+ pr_err("create pci bus failed\n");
+ return -EINVAL;
+ }
pci_bus_add_devices(vpci_bus);
@@ -1352,13 +1355,19 @@ static int epf_ntb_bind(struct pci_epf *epf)
ret = pci_register_driver(&vntb_pci_driver);
if (ret) {
dev_err(dev, "failure register vntb pci driver\n");
- goto err_bar_alloc;
+ goto err_epc_cleanup;
}
- vpci_scan_bus(ntb);
+ ret = vpci_scan_bus(ntb);
+ if (ret)
+ goto err_unregister;
return 0;
+err_unregister:
+ pci_unregister_driver(&vntb_pci_driver);
+err_epc_cleanup:
+ epf_ntb_epc_cleanup(ntb);
err_bar_alloc:
epf_ntb_config_spad_bar_free(ntb);
diff --git a/drivers/pci/pci.c b/drivers/pci/pci.c
index 0399204941db..2d373ab3ccb3 100644
--- a/drivers/pci/pci.c
+++ b/drivers/pci/pci.c
@@ -5007,7 +5007,7 @@ static int pci_bus_max_d3cold_delay(const struct pci_bus *bus)
int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type,
int timeout)
{
- struct pci_dev *child;
+ struct pci_dev *child __free(pci_dev_put) = NULL;
int delay;
if (pci_dev_is_disconnected(dev))
@@ -5036,8 +5036,8 @@ int pci_bridge_wait_for_secondary_bus(struct pci_dev *dev, char *reset_type,
return 0;
}
- child = list_first_entry(&dev->subordinate->devices, struct pci_dev,
- bus_list);
+ child = pci_dev_get(list_first_entry(&dev->subordinate->devices,
+ struct pci_dev, bus_list));
up_read(&pci_bus_sem);
/*
diff --git a/drivers/pci/setup-bus.c b/drivers/pci/setup-bus.c
index c690572b10ce..b8cb990044fb 100644
--- a/drivers/pci/setup-bus.c
+++ b/drivers/pci/setup-bus.c
@@ -824,11 +824,9 @@ static resource_size_t calculate_memsize(resource_size_t size,
size = min_size;
if (old_size == 1)
old_size = 0;
- if (size < old_size)
- size = old_size;
- size = ALIGN(max(size, add_size) + children_add_size, align);
- return size;
+ size = max(size, add_size) + children_add_size;
+ return ALIGN(max(size, old_size), align);
}
resource_size_t __weak pcibios_window_alignment(struct pci_bus *bus,
diff --git a/drivers/phy/cadence/phy-cadence-torrent.c b/drivers/phy/cadence/phy-cadence-torrent.c
index f099053c583c..34a380ce533a 100644
--- a/drivers/phy/cadence/phy-cadence-torrent.c
+++ b/drivers/phy/cadence/phy-cadence-torrent.c
@@ -1087,6 +1087,9 @@ static int cdns_torrent_dp_set_power_state(struct cdns_torrent_phy *cdns_phy,
ret = regmap_read_poll_timeout(regmap, PHY_PMA_XCVR_POWER_STATE_ACK,
read_val, (read_val & mask) == value, 0,
POLL_TIMEOUT_US);
+ if (ret)
+ return ret;
+
cdns_torrent_dp_write(regmap, PHY_PMA_XCVR_POWER_STATE_REQ, 0x00000000);
ndelay(100);
diff --git a/drivers/pinctrl/core.c b/drivers/pinctrl/core.c
index db5fc55a5c96..3b6051d63218 100644
--- a/drivers/pinctrl/core.c
+++ b/drivers/pinctrl/core.c
@@ -2062,6 +2062,14 @@ pinctrl_init_controller(struct pinctrl_desc *pctldesc, struct device *dev,
return ERR_PTR(ret);
}
+static void pinctrl_uninit_controller(struct pinctrl_dev *pctldev, struct pinctrl_desc *pctldesc)
+{
+ pinctrl_free_pindescs(pctldev, pctldesc->pins,
+ pctldesc->npins);
+ mutex_destroy(&pctldev->mutex);
+ kfree(pctldev);
+}
+
static int pinctrl_claim_hogs(struct pinctrl_dev *pctldev)
{
pctldev->p = create_pinctrl(pctldev->dev, pctldev);
@@ -2142,8 +2150,10 @@ struct pinctrl_dev *pinctrl_register(struct pinctrl_desc *pctldesc,
return pctldev;
error = pinctrl_enable(pctldev);
- if (error)
+ if (error) {
+ pinctrl_uninit_controller(pctldev, pctldesc);
return ERR_PTR(error);
+ }
return pctldev;
}
diff --git a/drivers/pinctrl/freescale/pinctrl-mxs.c b/drivers/pinctrl/freescale/pinctrl-mxs.c
index 735cedd0958a..5b0fcf15f280 100644
--- a/drivers/pinctrl/freescale/pinctrl-mxs.c
+++ b/drivers/pinctrl/freescale/pinctrl-mxs.c
@@ -405,8 +405,8 @@ static int mxs_pinctrl_probe_dt(struct platform_device *pdev,
int ret;
u32 val;
- child = of_get_next_child(np, NULL);
- if (!child) {
+ val = of_get_child_count(np);
+ if (val == 0) {
dev_err(&pdev->dev, "no group is defined\n");
return -ENOENT;
}
diff --git a/drivers/pinctrl/pinctrl-rockchip.c b/drivers/pinctrl/pinctrl-rockchip.c
index d26682f21ad1..6d140a60888c 100644
--- a/drivers/pinctrl/pinctrl-rockchip.c
+++ b/drivers/pinctrl/pinctrl-rockchip.c
@@ -916,9 +916,8 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
RK_MUXROUTE_SAME(0, RK_PC3, 1, 0x314, BIT(16 + 0) | BIT(0)), /* rtc_clk */
RK_MUXROUTE_SAME(1, RK_PC6, 2, 0x314, BIT(16 + 2) | BIT(16 + 3)), /* uart2_rxm0 */
RK_MUXROUTE_SAME(4, RK_PD2, 2, 0x314, BIT(16 + 2) | BIT(16 + 3) | BIT(2)), /* uart2_rxm1 */
- RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x608, BIT(16 + 8) | BIT(16 + 9)), /* i2c3_sdam0 */
- RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(8)), /* i2c3_sdam1 */
- RK_MUXROUTE_SAME(2, RK_PA0, 3, 0x608, BIT(16 + 8) | BIT(16 + 9) | BIT(9)), /* i2c3_sdam2 */
+ RK_MUXROUTE_SAME(0, RK_PB7, 2, 0x314, BIT(16 + 4)), /* i2c3_sdam0 */
+ RK_MUXROUTE_SAME(3, RK_PB4, 2, 0x314, BIT(16 + 4) | BIT(4)), /* i2c3_sdam1 */
RK_MUXROUTE_SAME(1, RK_PA3, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclktxm0 */
RK_MUXROUTE_SAME(1, RK_PA4, 2, 0x308, BIT(16 + 3)), /* i2s-8ch-1-sclkrxm0 */
RK_MUXROUTE_SAME(1, RK_PB5, 2, 0x308, BIT(16 + 3) | BIT(3)), /* i2s-8ch-1-sclktxm1 */
@@ -927,18 +926,6 @@ static struct rockchip_mux_route_data rk3308_mux_route_data[] = {
RK_MUXROUTE_SAME(1, RK_PB6, 4, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* pdm-clkm1 */
RK_MUXROUTE_SAME(2, RK_PA6, 2, 0x308, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* pdm-clkm2 */
RK_MUXROUTE_SAME(2, RK_PA4, 3, 0x600, BIT(16 + 2) | BIT(2)), /* pdm-clkm-m2 */
- RK_MUXROUTE_SAME(3, RK_PB2, 3, 0x314, BIT(16 + 9)), /* spi1_miso */
- RK_MUXROUTE_SAME(2, RK_PA4, 2, 0x314, BIT(16 + 9) | BIT(9)), /* spi1_miso_m1 */
- RK_MUXROUTE_SAME(0, RK_PB3, 3, 0x314, BIT(16 + 10) | BIT(16 + 11)), /* owire_m0 */
- RK_MUXROUTE_SAME(1, RK_PC6, 7, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(10)), /* owire_m1 */
- RK_MUXROUTE_SAME(2, RK_PA2, 5, 0x314, BIT(16 + 10) | BIT(16 + 11) | BIT(11)), /* owire_m2 */
- RK_MUXROUTE_SAME(0, RK_PB3, 2, 0x314, BIT(16 + 12) | BIT(16 + 13)), /* can_rxd_m0 */
- RK_MUXROUTE_SAME(1, RK_PC6, 5, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(12)), /* can_rxd_m1 */
- RK_MUXROUTE_SAME(2, RK_PA2, 4, 0x314, BIT(16 + 12) | BIT(16 + 13) | BIT(13)), /* can_rxd_m2 */
- RK_MUXROUTE_SAME(1, RK_PC4, 3, 0x314, BIT(16 + 14)), /* mac_rxd0_m0 */
- RK_MUXROUTE_SAME(4, RK_PA2, 2, 0x314, BIT(16 + 14) | BIT(14)), /* mac_rxd0_m1 */
- RK_MUXROUTE_SAME(3, RK_PB4, 4, 0x314, BIT(16 + 15)), /* uart3_rx */
- RK_MUXROUTE_SAME(0, RK_PC1, 3, 0x314, BIT(16 + 15) | BIT(15)), /* uart3_rx_m1 */
};
static struct rockchip_mux_route_data rk3328_mux_route_data[] = {
diff --git a/drivers/pinctrl/pinctrl-single.c b/drivers/pinctrl/pinctrl-single.c
index 9ad8f7020614..cd23479f352a 100644
--- a/drivers/pinctrl/pinctrl-single.c
+++ b/drivers/pinctrl/pinctrl-single.c
@@ -1328,7 +1328,6 @@ static void pcs_irq_free(struct pcs_device *pcs)
static void pcs_free_resources(struct pcs_device *pcs)
{
pcs_irq_free(pcs);
- pinctrl_unregister(pcs->pctl);
#if IS_BUILTIN(CONFIG_PINCTRL_SINGLE)
if (pcs->missing_nr_pinctrl_cells)
@@ -1885,7 +1884,7 @@ static int pcs_probe(struct platform_device *pdev)
if (ret < 0)
goto free;
- ret = pinctrl_register_and_init(&pcs->desc, pcs->dev, pcs, &pcs->pctl);
+ ret = devm_pinctrl_register_and_init(pcs->dev, &pcs->desc, pcs, &pcs->pctl);
if (ret) {
dev_err(pcs->dev, "could not register single pinctrl driver\n");
goto free;
@@ -1918,8 +1917,10 @@ static int pcs_probe(struct platform_device *pdev)
dev_info(pcs->dev, "%i pins, size %u\n", pcs->desc.npins, pcs->size);
- return pinctrl_enable(pcs->pctl);
+ if (pinctrl_enable(pcs->pctl))
+ goto free;
+ return 0;
free:
pcs_free_resources(pcs);
diff --git a/drivers/pinctrl/renesas/pfc-r8a779g0.c b/drivers/pinctrl/renesas/pfc-r8a779g0.c
index acf7664ea835..595a5a4b02ec 100644
--- a/drivers/pinctrl/renesas/pfc-r8a779g0.c
+++ b/drivers/pinctrl/renesas/pfc-r8a779g0.c
@@ -62,20 +62,20 @@
#define GPSR0_9 F_(MSIOF5_SYNC, IP1SR0_7_4)
#define GPSR0_8 F_(MSIOF5_SS1, IP1SR0_3_0)
#define GPSR0_7 F_(MSIOF5_SS2, IP0SR0_31_28)
-#define GPSR0_6 F_(IRQ0, IP0SR0_27_24)
-#define GPSR0_5 F_(IRQ1, IP0SR0_23_20)
-#define GPSR0_4 F_(IRQ2, IP0SR0_19_16)
-#define GPSR0_3 F_(IRQ3, IP0SR0_15_12)
+#define GPSR0_6 F_(IRQ0_A, IP0SR0_27_24)
+#define GPSR0_5 F_(IRQ1_A, IP0SR0_23_20)
+#define GPSR0_4 F_(IRQ2_A, IP0SR0_19_16)
+#define GPSR0_3 F_(IRQ3_A, IP0SR0_15_12)
#define GPSR0_2 F_(GP0_02, IP0SR0_11_8)
#define GPSR0_1 F_(GP0_01, IP0SR0_7_4)
#define GPSR0_0 F_(GP0_00, IP0SR0_3_0)
/* GPSR1 */
-#define GPSR1_28 F_(HTX3, IP3SR1_19_16)
-#define GPSR1_27 F_(HCTS3_N, IP3SR1_15_12)
-#define GPSR1_26 F_(HRTS3_N, IP3SR1_11_8)
-#define GPSR1_25 F_(HSCK3, IP3SR1_7_4)
-#define GPSR1_24 F_(HRX3, IP3SR1_3_0)
+#define GPSR1_28 F_(HTX3_A, IP3SR1_19_16)
+#define GPSR1_27 F_(HCTS3_N_A, IP3SR1_15_12)
+#define GPSR1_26 F_(HRTS3_N_A, IP3SR1_11_8)
+#define GPSR1_25 F_(HSCK3_A, IP3SR1_7_4)
+#define GPSR1_24 F_(HRX3_A, IP3SR1_3_0)
#define GPSR1_23 F_(GP1_23, IP2SR1_31_28)
#define GPSR1_22 F_(AUDIO_CLKIN, IP2SR1_27_24)
#define GPSR1_21 F_(AUDIO_CLKOUT, IP2SR1_23_20)
@@ -113,14 +113,14 @@
#define GPSR2_11 F_(CANFD0_RX, IP1SR2_15_12)
#define GPSR2_10 F_(CANFD0_TX, IP1SR2_11_8)
#define GPSR2_9 F_(CAN_CLK, IP1SR2_7_4)
-#define GPSR2_8 F_(TPU0TO0, IP1SR2_3_0)
-#define GPSR2_7 F_(TPU0TO1, IP0SR2_31_28)
+#define GPSR2_8 F_(TPU0TO0_A, IP1SR2_3_0)
+#define GPSR2_7 F_(TPU0TO1_A, IP0SR2_31_28)
#define GPSR2_6 F_(FXR_TXDB, IP0SR2_27_24)
-#define GPSR2_5 F_(FXR_TXENB_N, IP0SR2_23_20)
+#define GPSR2_5 F_(FXR_TXENB_N_A, IP0SR2_23_20)
#define GPSR2_4 F_(RXDB_EXTFXR, IP0SR2_19_16)
#define GPSR2_3 F_(CLK_EXTFXR, IP0SR2_15_12)
#define GPSR2_2 F_(RXDA_EXTFXR, IP0SR2_11_8)
-#define GPSR2_1 F_(FXR_TXENA_N, IP0SR2_7_4)
+#define GPSR2_1 F_(FXR_TXENA_N_A, IP0SR2_7_4)
#define GPSR2_0 F_(FXR_TXDA, IP0SR2_3_0)
/* GPSR3 */
@@ -269,13 +269,13 @@
/* SR0 */
/* IP0SR0 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP0SR0_3_0 F_(0, 0) FM(ERROROUTC_N_B) FM(TCLK2_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_3_0 F_(0, 0) FM(ERROROUTC_N_B) FM(TCLK2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR0_7_4 F_(0, 0) FM(MSIOF3_SS1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR0_11_8 F_(0, 0) FM(MSIOF3_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_15_12 FM(IRQ3) FM(MSIOF3_SCK) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_19_16 FM(IRQ2) FM(MSIOF3_TXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_23_20 FM(IRQ1) FM(MSIOF3_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR0_27_24 FM(IRQ0) FM(MSIOF3_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_15_12 FM(IRQ3_A) FM(MSIOF3_SCK) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_19_16 FM(IRQ2_A) FM(MSIOF3_TXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_23_20 FM(IRQ1_A) FM(MSIOF3_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR0_27_24 FM(IRQ0_A) FM(MSIOF3_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR0_31_28 FM(MSIOF5_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP1SR0 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
@@ -284,72 +284,72 @@
#define IP1SR0_11_8 FM(MSIOF5_TXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR0_15_12 FM(MSIOF5_SCK) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR0_19_16 FM(MSIOF5_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_23_20 FM(MSIOF2_SS2) FM(TCLK1) FM(IRQ2_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_27_24 FM(MSIOF2_SS1) FM(HTX1) FM(TX1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR0_31_28 FM(MSIOF2_SYNC) FM(HRX1) FM(RX1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_23_20 FM(MSIOF2_SS2) FM(TCLK1_A) FM(IRQ2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_27_24 FM(MSIOF2_SS1) FM(HTX1_A) FM(TX1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR0_31_28 FM(MSIOF2_SYNC) FM(HRX1_A) FM(RX1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR0 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP2SR0_3_0 FM(MSIOF2_TXD) FM(HCTS1_N) FM(CTS1_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_7_4 FM(MSIOF2_SCK) FM(HRTS1_N) FM(RTS1_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR0_11_8 FM(MSIOF2_RXD) FM(HSCK1) FM(SCK1) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_3_0 FM(MSIOF2_TXD) FM(HCTS1_N_A) FM(CTS1_N_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_7_4 FM(MSIOF2_SCK) FM(HRTS1_N_A) FM(RTS1_N_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR0_11_8 FM(MSIOF2_RXD) FM(HSCK1_A) FM(SCK1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* SR1 */
/* IP0SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP0SR1_3_0 FM(MSIOF1_SS2) FM(HTX3_A) FM(TX3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_7_4 FM(MSIOF1_SS1) FM(HCTS3_N_A) FM(RX3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_11_8 FM(MSIOF1_SYNC) FM(HRTS3_N_A) FM(RTS3_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_15_12 FM(MSIOF1_SCK) FM(HSCK3_A) FM(CTS3_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_19_16 FM(MSIOF1_TXD) FM(HRX3_A) FM(SCK3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_3_0 FM(MSIOF1_SS2) FM(HTX3_B) FM(TX3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_7_4 FM(MSIOF1_SS1) FM(HCTS3_N_B) FM(RX3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_11_8 FM(MSIOF1_SYNC) FM(HRTS3_N_B) FM(RTS3_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_15_12 FM(MSIOF1_SCK) FM(HSCK3_B) FM(CTS3_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_19_16 FM(MSIOF1_TXD) FM(HRX3_B) FM(SCK3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR1_23_20 FM(MSIOF1_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_27_24 FM(MSIOF0_SS2) FM(HTX1_X) FM(TX1_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR1_31_28 FM(MSIOF0_SS1) FM(HRX1_X) FM(RX1_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_27_24 FM(MSIOF0_SS2) FM(HTX1_B) FM(TX1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR1_31_28 FM(MSIOF0_SS1) FM(HRX1_B) FM(RX1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP1SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP1SR1_3_0 FM(MSIOF0_SYNC) FM(HCTS1_N_X) FM(CTS1_N_X) FM(CANFD5_TX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_7_4 FM(MSIOF0_TXD) FM(HRTS1_N_X) FM(RTS1_N_X) FM(CANFD5_RX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_11_8 FM(MSIOF0_SCK) FM(HSCK1_X) FM(SCK1_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_3_0 FM(MSIOF0_SYNC) FM(HCTS1_N_B) FM(CTS1_N_B) FM(CANFD5_TX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_7_4 FM(MSIOF0_TXD) FM(HRTS1_N_B) FM(RTS1_N_B) FM(CANFD5_RX_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_11_8 FM(MSIOF0_SCK) FM(HSCK1_B) FM(SCK1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR1_15_12 FM(MSIOF0_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR1_19_16 FM(HTX0) FM(TX0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_23_20 FM(HCTS0_N) FM(CTS0_N) FM(PWM8_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_27_24 FM(HRTS0_N) FM(RTS0_N) FM(PWM9_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR1_31_28 FM(HSCK0) FM(SCK0) FM(PWM0_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_23_20 FM(HCTS0_N) FM(CTS0_N) FM(PWM8) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_27_24 FM(HRTS0_N) FM(RTS0_N) FM(PWM9) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR1_31_28 FM(HSCK0) FM(SCK0) FM(PWM0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
#define IP2SR1_3_0 FM(HRX0) FM(RX0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP2SR1_7_4 FM(SCIF_CLK) FM(IRQ4_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_11_8 FM(SSI_SCK) FM(TCLK3) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_15_12 FM(SSI_WS) FM(TCLK4) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_19_16 FM(SSI_SD) FM(IRQ0_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_23_20 FM(AUDIO_CLKOUT) FM(IRQ1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_11_8 FM(SSI_SCK) FM(TCLK3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_15_12 FM(SSI_WS) FM(TCLK4_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_19_16 FM(SSI_SD) FM(IRQ0_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_23_20 FM(AUDIO_CLKOUT) FM(IRQ1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP2SR1_27_24 FM(AUDIO_CLKIN) FM(PWM3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP2SR1_31_28 F_(0, 0) FM(TCLK2) FM(MSIOF4_SS1) FM(IRQ3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP2SR1_31_28 F_(0, 0) FM(TCLK2_A) FM(MSIOF4_SS1) FM(IRQ3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP3SR1 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP3SR1_3_0 FM(HRX3) FM(SCK3_A) FM(MSIOF4_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_7_4 FM(HSCK3) FM(CTS3_N_A) FM(MSIOF4_SCK) FM(TPU0TO0_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_11_8 FM(HRTS3_N) FM(RTS3_N_A) FM(MSIOF4_TXD) FM(TPU0TO1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_15_12 FM(HCTS3_N) FM(RX3_A) FM(MSIOF4_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP3SR1_19_16 FM(HTX3) FM(TX3_A) FM(MSIOF4_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_3_0 FM(HRX3_A) FM(SCK3_A) FM(MSIOF4_SS2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_7_4 FM(HSCK3_A) FM(CTS3_N_A) FM(MSIOF4_SCK) FM(TPU0TO0_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_11_8 FM(HRTS3_N_A) FM(RTS3_N_A) FM(MSIOF4_TXD) FM(TPU0TO1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_15_12 FM(HCTS3_N_A) FM(RX3_A) FM(MSIOF4_RXD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP3SR1_19_16 FM(HTX3_A) FM(TX3_A) FM(MSIOF4_SYNC) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* SR2 */
/* IP0SR2 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP0SR2_3_0 FM(FXR_TXDA) FM(CANFD1_TX) FM(TPU0TO2_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_7_4 FM(FXR_TXENA_N) FM(CANFD1_RX) FM(TPU0TO3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_11_8 FM(RXDA_EXTFXR) FM(CANFD5_TX) FM(IRQ5) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_15_12 FM(CLK_EXTFXR) FM(CANFD5_RX) FM(IRQ4_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_3_0 FM(FXR_TXDA) FM(CANFD1_TX) FM(TPU0TO2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_7_4 FM(FXR_TXENA_N_A) FM(CANFD1_RX) FM(TPU0TO3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_11_8 FM(RXDA_EXTFXR) FM(CANFD5_TX_A) FM(IRQ5) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_15_12 FM(CLK_EXTFXR) FM(CANFD5_RX_A) FM(IRQ4_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR2_19_16 FM(RXDB_EXTFXR) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_23_20 FM(FXR_TXENB_N) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_23_20 FM(FXR_TXENB_N_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP0SR2_27_24 FM(FXR_TXDB) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP0SR2_31_28 FM(TPU0TO1) FM(CANFD6_TX) F_(0, 0) FM(TCLK2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP0SR2_31_28 FM(TPU0TO1_A) FM(CANFD6_TX) F_(0, 0) FM(TCLK2_C) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP1SR2 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
-#define IP1SR2_3_0 FM(TPU0TO0) FM(CANFD6_RX) F_(0, 0) FM(TCLK1_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_7_4 FM(CAN_CLK) FM(FXR_TXENA_N_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_11_8 FM(CANFD0_TX) FM(FXR_TXENB_N_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_3_0 FM(TPU0TO0_A) FM(CANFD6_RX) F_(0, 0) FM(TCLK1_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_7_4 FM(CAN_CLK) FM(FXR_TXENA_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_11_8 FM(CANFD0_TX) FM(FXR_TXENB_N_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR2_15_12 FM(CANFD0_RX) FM(STPWT_EXTFXR) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_19_16 FM(CANFD2_TX) FM(TPU0TO2) F_(0, 0) FM(TCLK3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_23_20 FM(CANFD2_RX) FM(TPU0TO3) FM(PWM1_B) FM(TCLK4_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR2_27_24 FM(CANFD3_TX) F_(0, 0) FM(PWM2_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_19_16 FM(CANFD2_TX) FM(TPU0TO2_A) F_(0, 0) FM(TCLK3_C) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_23_20 FM(CANFD2_RX) FM(TPU0TO3_A) FM(PWM1_B) FM(TCLK4_C) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR2_27_24 FM(CANFD3_TX) F_(0, 0) FM(PWM2) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR2_31_28 FM(CANFD3_RX) F_(0, 0) FM(PWM3_B) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR2 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
@@ -375,8 +375,8 @@
#define IP1SR3_11_8 FM(MMC_SD_CMD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR3_15_12 FM(SD_CD) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR3_19_16 FM(SD_WP) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_23_20 FM(IPC_CLKIN) FM(IPC_CLKEN_IN) FM(PWM1_A) FM(TCLK3_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
-#define IP1SR3_27_24 FM(IPC_CLKOUT) FM(IPC_CLKEN_OUT) FM(ERROROUTC_N_A) FM(TCLK4_X) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_23_20 FM(IPC_CLKIN) FM(IPC_CLKEN_IN) FM(PWM1_A) FM(TCLK3_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
+#define IP1SR3_27_24 FM(IPC_CLKOUT) FM(IPC_CLKEN_OUT) FM(ERROROUTC_N_A) FM(TCLK4_A) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
#define IP1SR3_31_28 FM(QSPI0_SSL) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0) F_(0, 0)
/* IP2SR3 */ /* 0 */ /* 1 */ /* 2 */ /* 3 4 5 6 7 8 9 A B C D E F */
@@ -712,22 +712,22 @@ static const u16 pinmux_data[] = {
/* IP0SR0 */
PINMUX_IPSR_GPSR(IP0SR0_3_0, ERROROUTC_N_B),
- PINMUX_IPSR_GPSR(IP0SR0_3_0, TCLK2_A),
+ PINMUX_IPSR_GPSR(IP0SR0_3_0, TCLK2_B),
PINMUX_IPSR_GPSR(IP0SR0_7_4, MSIOF3_SS1),
PINMUX_IPSR_GPSR(IP0SR0_11_8, MSIOF3_SS2),
- PINMUX_IPSR_GPSR(IP0SR0_15_12, IRQ3),
+ PINMUX_IPSR_GPSR(IP0SR0_15_12, IRQ3_A),
PINMUX_IPSR_GPSR(IP0SR0_15_12, MSIOF3_SCK),
- PINMUX_IPSR_GPSR(IP0SR0_19_16, IRQ2),
+ PINMUX_IPSR_GPSR(IP0SR0_19_16, IRQ2_A),
PINMUX_IPSR_GPSR(IP0SR0_19_16, MSIOF3_TXD),
- PINMUX_IPSR_GPSR(IP0SR0_23_20, IRQ1),
+ PINMUX_IPSR_GPSR(IP0SR0_23_20, IRQ1_A),
PINMUX_IPSR_GPSR(IP0SR0_23_20, MSIOF3_RXD),
- PINMUX_IPSR_GPSR(IP0SR0_27_24, IRQ0),
+ PINMUX_IPSR_GPSR(IP0SR0_27_24, IRQ0_A),
PINMUX_IPSR_GPSR(IP0SR0_27_24, MSIOF3_SYNC),
PINMUX_IPSR_GPSR(IP0SR0_31_28, MSIOF5_SS2),
@@ -744,75 +744,75 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP1SR0_19_16, MSIOF5_RXD),
PINMUX_IPSR_GPSR(IP1SR0_23_20, MSIOF2_SS2),
- PINMUX_IPSR_GPSR(IP1SR0_23_20, TCLK1),
- PINMUX_IPSR_GPSR(IP1SR0_23_20, IRQ2_A),
+ PINMUX_IPSR_GPSR(IP1SR0_23_20, TCLK1_A),
+ PINMUX_IPSR_GPSR(IP1SR0_23_20, IRQ2_B),
PINMUX_IPSR_GPSR(IP1SR0_27_24, MSIOF2_SS1),
- PINMUX_IPSR_GPSR(IP1SR0_27_24, HTX1),
- PINMUX_IPSR_GPSR(IP1SR0_27_24, TX1),
+ PINMUX_IPSR_GPSR(IP1SR0_27_24, HTX1_A),
+ PINMUX_IPSR_GPSR(IP1SR0_27_24, TX1_A),
PINMUX_IPSR_GPSR(IP1SR0_31_28, MSIOF2_SYNC),
- PINMUX_IPSR_GPSR(IP1SR0_31_28, HRX1),
- PINMUX_IPSR_GPSR(IP1SR0_31_28, RX1),
+ PINMUX_IPSR_GPSR(IP1SR0_31_28, HRX1_A),
+ PINMUX_IPSR_GPSR(IP1SR0_31_28, RX1_A),
/* IP2SR0 */
PINMUX_IPSR_GPSR(IP2SR0_3_0, MSIOF2_TXD),
- PINMUX_IPSR_GPSR(IP2SR0_3_0, HCTS1_N),
- PINMUX_IPSR_GPSR(IP2SR0_3_0, CTS1_N),
+ PINMUX_IPSR_GPSR(IP2SR0_3_0, HCTS1_N_A),
+ PINMUX_IPSR_GPSR(IP2SR0_3_0, CTS1_N_A),
PINMUX_IPSR_GPSR(IP2SR0_7_4, MSIOF2_SCK),
- PINMUX_IPSR_GPSR(IP2SR0_7_4, HRTS1_N),
- PINMUX_IPSR_GPSR(IP2SR0_7_4, RTS1_N),
+ PINMUX_IPSR_GPSR(IP2SR0_7_4, HRTS1_N_A),
+ PINMUX_IPSR_GPSR(IP2SR0_7_4, RTS1_N_A),
PINMUX_IPSR_GPSR(IP2SR0_11_8, MSIOF2_RXD),
- PINMUX_IPSR_GPSR(IP2SR0_11_8, HSCK1),
- PINMUX_IPSR_GPSR(IP2SR0_11_8, SCK1),
+ PINMUX_IPSR_GPSR(IP2SR0_11_8, HSCK1_A),
+ PINMUX_IPSR_GPSR(IP2SR0_11_8, SCK1_A),
/* IP0SR1 */
PINMUX_IPSR_GPSR(IP0SR1_3_0, MSIOF1_SS2),
- PINMUX_IPSR_GPSR(IP0SR1_3_0, HTX3_A),
- PINMUX_IPSR_GPSR(IP0SR1_3_0, TX3),
+ PINMUX_IPSR_GPSR(IP0SR1_3_0, HTX3_B),
+ PINMUX_IPSR_GPSR(IP0SR1_3_0, TX3_B),
PINMUX_IPSR_GPSR(IP0SR1_7_4, MSIOF1_SS1),
- PINMUX_IPSR_GPSR(IP0SR1_7_4, HCTS3_N_A),
- PINMUX_IPSR_GPSR(IP0SR1_7_4, RX3),
+ PINMUX_IPSR_GPSR(IP0SR1_7_4, HCTS3_N_B),
+ PINMUX_IPSR_GPSR(IP0SR1_7_4, RX3_B),
PINMUX_IPSR_GPSR(IP0SR1_11_8, MSIOF1_SYNC),
- PINMUX_IPSR_GPSR(IP0SR1_11_8, HRTS3_N_A),
- PINMUX_IPSR_GPSR(IP0SR1_11_8, RTS3_N),
+ PINMUX_IPSR_GPSR(IP0SR1_11_8, HRTS3_N_B),
+ PINMUX_IPSR_GPSR(IP0SR1_11_8, RTS3_N_B),
PINMUX_IPSR_GPSR(IP0SR1_15_12, MSIOF1_SCK),
- PINMUX_IPSR_GPSR(IP0SR1_15_12, HSCK3_A),
- PINMUX_IPSR_GPSR(IP0SR1_15_12, CTS3_N),
+ PINMUX_IPSR_GPSR(IP0SR1_15_12, HSCK3_B),
+ PINMUX_IPSR_GPSR(IP0SR1_15_12, CTS3_N_B),
PINMUX_IPSR_GPSR(IP0SR1_19_16, MSIOF1_TXD),
- PINMUX_IPSR_GPSR(IP0SR1_19_16, HRX3_A),
- PINMUX_IPSR_GPSR(IP0SR1_19_16, SCK3),
+ PINMUX_IPSR_GPSR(IP0SR1_19_16, HRX3_B),
+ PINMUX_IPSR_GPSR(IP0SR1_19_16, SCK3_B),
PINMUX_IPSR_GPSR(IP0SR1_23_20, MSIOF1_RXD),
PINMUX_IPSR_GPSR(IP0SR1_27_24, MSIOF0_SS2),
- PINMUX_IPSR_GPSR(IP0SR1_27_24, HTX1_X),
- PINMUX_IPSR_GPSR(IP0SR1_27_24, TX1_X),
+ PINMUX_IPSR_GPSR(IP0SR1_27_24, HTX1_B),
+ PINMUX_IPSR_GPSR(IP0SR1_27_24, TX1_B),
PINMUX_IPSR_GPSR(IP0SR1_31_28, MSIOF0_SS1),
- PINMUX_IPSR_GPSR(IP0SR1_31_28, HRX1_X),
- PINMUX_IPSR_GPSR(IP0SR1_31_28, RX1_X),
+ PINMUX_IPSR_GPSR(IP0SR1_31_28, HRX1_B),
+ PINMUX_IPSR_GPSR(IP0SR1_31_28, RX1_B),
/* IP1SR1 */
PINMUX_IPSR_GPSR(IP1SR1_3_0, MSIOF0_SYNC),
- PINMUX_IPSR_GPSR(IP1SR1_3_0, HCTS1_N_X),
- PINMUX_IPSR_GPSR(IP1SR1_3_0, CTS1_N_X),
+ PINMUX_IPSR_GPSR(IP1SR1_3_0, HCTS1_N_B),
+ PINMUX_IPSR_GPSR(IP1SR1_3_0, CTS1_N_B),
PINMUX_IPSR_GPSR(IP1SR1_3_0, CANFD5_TX_B),
PINMUX_IPSR_GPSR(IP1SR1_7_4, MSIOF0_TXD),
- PINMUX_IPSR_GPSR(IP1SR1_7_4, HRTS1_N_X),
- PINMUX_IPSR_GPSR(IP1SR1_7_4, RTS1_N_X),
+ PINMUX_IPSR_GPSR(IP1SR1_7_4, HRTS1_N_B),
+ PINMUX_IPSR_GPSR(IP1SR1_7_4, RTS1_N_B),
PINMUX_IPSR_GPSR(IP1SR1_7_4, CANFD5_RX_B),
PINMUX_IPSR_GPSR(IP1SR1_11_8, MSIOF0_SCK),
- PINMUX_IPSR_GPSR(IP1SR1_11_8, HSCK1_X),
- PINMUX_IPSR_GPSR(IP1SR1_11_8, SCK1_X),
+ PINMUX_IPSR_GPSR(IP1SR1_11_8, HSCK1_B),
+ PINMUX_IPSR_GPSR(IP1SR1_11_8, SCK1_B),
PINMUX_IPSR_GPSR(IP1SR1_15_12, MSIOF0_RXD),
@@ -821,15 +821,15 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP1SR1_23_20, HCTS0_N),
PINMUX_IPSR_GPSR(IP1SR1_23_20, CTS0_N),
- PINMUX_IPSR_GPSR(IP1SR1_23_20, PWM8_A),
+ PINMUX_IPSR_GPSR(IP1SR1_23_20, PWM8),
PINMUX_IPSR_GPSR(IP1SR1_27_24, HRTS0_N),
PINMUX_IPSR_GPSR(IP1SR1_27_24, RTS0_N),
- PINMUX_IPSR_GPSR(IP1SR1_27_24, PWM9_A),
+ PINMUX_IPSR_GPSR(IP1SR1_27_24, PWM9),
PINMUX_IPSR_GPSR(IP1SR1_31_28, HSCK0),
PINMUX_IPSR_GPSR(IP1SR1_31_28, SCK0),
- PINMUX_IPSR_GPSR(IP1SR1_31_28, PWM0_A),
+ PINMUX_IPSR_GPSR(IP1SR1_31_28, PWM0),
/* IP2SR1 */
PINMUX_IPSR_GPSR(IP2SR1_3_0, HRX0),
@@ -839,99 +839,99 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP2SR1_7_4, IRQ4_A),
PINMUX_IPSR_GPSR(IP2SR1_11_8, SSI_SCK),
- PINMUX_IPSR_GPSR(IP2SR1_11_8, TCLK3),
+ PINMUX_IPSR_GPSR(IP2SR1_11_8, TCLK3_B),
PINMUX_IPSR_GPSR(IP2SR1_15_12, SSI_WS),
- PINMUX_IPSR_GPSR(IP2SR1_15_12, TCLK4),
+ PINMUX_IPSR_GPSR(IP2SR1_15_12, TCLK4_B),
PINMUX_IPSR_GPSR(IP2SR1_19_16, SSI_SD),
- PINMUX_IPSR_GPSR(IP2SR1_19_16, IRQ0_A),
+ PINMUX_IPSR_GPSR(IP2SR1_19_16, IRQ0_B),
PINMUX_IPSR_GPSR(IP2SR1_23_20, AUDIO_CLKOUT),
- PINMUX_IPSR_GPSR(IP2SR1_23_20, IRQ1_A),
+ PINMUX_IPSR_GPSR(IP2SR1_23_20, IRQ1_B),
PINMUX_IPSR_GPSR(IP2SR1_27_24, AUDIO_CLKIN),
PINMUX_IPSR_GPSR(IP2SR1_27_24, PWM3_A),
- PINMUX_IPSR_GPSR(IP2SR1_31_28, TCLK2),
+ PINMUX_IPSR_GPSR(IP2SR1_31_28, TCLK2_A),
PINMUX_IPSR_GPSR(IP2SR1_31_28, MSIOF4_SS1),
PINMUX_IPSR_GPSR(IP2SR1_31_28, IRQ3_B),
/* IP3SR1 */
- PINMUX_IPSR_GPSR(IP3SR1_3_0, HRX3),
+ PINMUX_IPSR_GPSR(IP3SR1_3_0, HRX3_A),
PINMUX_IPSR_GPSR(IP3SR1_3_0, SCK3_A),
PINMUX_IPSR_GPSR(IP3SR1_3_0, MSIOF4_SS2),
- PINMUX_IPSR_GPSR(IP3SR1_7_4, HSCK3),
+ PINMUX_IPSR_GPSR(IP3SR1_7_4, HSCK3_A),
PINMUX_IPSR_GPSR(IP3SR1_7_4, CTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_7_4, MSIOF4_SCK),
- PINMUX_IPSR_GPSR(IP3SR1_7_4, TPU0TO0_A),
+ PINMUX_IPSR_GPSR(IP3SR1_7_4, TPU0TO0_B),
- PINMUX_IPSR_GPSR(IP3SR1_11_8, HRTS3_N),
+ PINMUX_IPSR_GPSR(IP3SR1_11_8, HRTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_11_8, RTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_11_8, MSIOF4_TXD),
- PINMUX_IPSR_GPSR(IP3SR1_11_8, TPU0TO1_A),
+ PINMUX_IPSR_GPSR(IP3SR1_11_8, TPU0TO1_B),
- PINMUX_IPSR_GPSR(IP3SR1_15_12, HCTS3_N),
+ PINMUX_IPSR_GPSR(IP3SR1_15_12, HCTS3_N_A),
PINMUX_IPSR_GPSR(IP3SR1_15_12, RX3_A),
PINMUX_IPSR_GPSR(IP3SR1_15_12, MSIOF4_RXD),
- PINMUX_IPSR_GPSR(IP3SR1_19_16, HTX3),
+ PINMUX_IPSR_GPSR(IP3SR1_19_16, HTX3_A),
PINMUX_IPSR_GPSR(IP3SR1_19_16, TX3_A),
PINMUX_IPSR_GPSR(IP3SR1_19_16, MSIOF4_SYNC),
/* IP0SR2 */
PINMUX_IPSR_GPSR(IP0SR2_3_0, FXR_TXDA),
PINMUX_IPSR_GPSR(IP0SR2_3_0, CANFD1_TX),
- PINMUX_IPSR_GPSR(IP0SR2_3_0, TPU0TO2_A),
+ PINMUX_IPSR_GPSR(IP0SR2_3_0, TPU0TO2_B),
- PINMUX_IPSR_GPSR(IP0SR2_7_4, FXR_TXENA_N),
+ PINMUX_IPSR_GPSR(IP0SR2_7_4, FXR_TXENA_N_A),
PINMUX_IPSR_GPSR(IP0SR2_7_4, CANFD1_RX),
- PINMUX_IPSR_GPSR(IP0SR2_7_4, TPU0TO3_A),
+ PINMUX_IPSR_GPSR(IP0SR2_7_4, TPU0TO3_B),
PINMUX_IPSR_GPSR(IP0SR2_11_8, RXDA_EXTFXR),
- PINMUX_IPSR_GPSR(IP0SR2_11_8, CANFD5_TX),
+ PINMUX_IPSR_GPSR(IP0SR2_11_8, CANFD5_TX_A),
PINMUX_IPSR_GPSR(IP0SR2_11_8, IRQ5),
PINMUX_IPSR_GPSR(IP0SR2_15_12, CLK_EXTFXR),
- PINMUX_IPSR_GPSR(IP0SR2_15_12, CANFD5_RX),
+ PINMUX_IPSR_GPSR(IP0SR2_15_12, CANFD5_RX_A),
PINMUX_IPSR_GPSR(IP0SR2_15_12, IRQ4_B),
PINMUX_IPSR_GPSR(IP0SR2_19_16, RXDB_EXTFXR),
- PINMUX_IPSR_GPSR(IP0SR2_23_20, FXR_TXENB_N),
+ PINMUX_IPSR_GPSR(IP0SR2_23_20, FXR_TXENB_N_A),
PINMUX_IPSR_GPSR(IP0SR2_27_24, FXR_TXDB),
- PINMUX_IPSR_GPSR(IP0SR2_31_28, TPU0TO1),
+ PINMUX_IPSR_GPSR(IP0SR2_31_28, TPU0TO1_A),
PINMUX_IPSR_GPSR(IP0SR2_31_28, CANFD6_TX),
- PINMUX_IPSR_GPSR(IP0SR2_31_28, TCLK2_B),
+ PINMUX_IPSR_GPSR(IP0SR2_31_28, TCLK2_C),
/* IP1SR2 */
- PINMUX_IPSR_GPSR(IP1SR2_3_0, TPU0TO0),
+ PINMUX_IPSR_GPSR(IP1SR2_3_0, TPU0TO0_A),
PINMUX_IPSR_GPSR(IP1SR2_3_0, CANFD6_RX),
- PINMUX_IPSR_GPSR(IP1SR2_3_0, TCLK1_A),
+ PINMUX_IPSR_GPSR(IP1SR2_3_0, TCLK1_B),
PINMUX_IPSR_GPSR(IP1SR2_7_4, CAN_CLK),
- PINMUX_IPSR_GPSR(IP1SR2_7_4, FXR_TXENA_N_X),
+ PINMUX_IPSR_GPSR(IP1SR2_7_4, FXR_TXENA_N_B),
PINMUX_IPSR_GPSR(IP1SR2_11_8, CANFD0_TX),
- PINMUX_IPSR_GPSR(IP1SR2_11_8, FXR_TXENB_N_X),
+ PINMUX_IPSR_GPSR(IP1SR2_11_8, FXR_TXENB_N_B),
PINMUX_IPSR_GPSR(IP1SR2_15_12, CANFD0_RX),
PINMUX_IPSR_GPSR(IP1SR2_15_12, STPWT_EXTFXR),
PINMUX_IPSR_GPSR(IP1SR2_19_16, CANFD2_TX),
- PINMUX_IPSR_GPSR(IP1SR2_19_16, TPU0TO2),
- PINMUX_IPSR_GPSR(IP1SR2_19_16, TCLK3_A),
+ PINMUX_IPSR_GPSR(IP1SR2_19_16, TPU0TO2_A),
+ PINMUX_IPSR_GPSR(IP1SR2_19_16, TCLK3_C),
PINMUX_IPSR_GPSR(IP1SR2_23_20, CANFD2_RX),
- PINMUX_IPSR_GPSR(IP1SR2_23_20, TPU0TO3),
+ PINMUX_IPSR_GPSR(IP1SR2_23_20, TPU0TO3_A),
PINMUX_IPSR_GPSR(IP1SR2_23_20, PWM1_B),
- PINMUX_IPSR_GPSR(IP1SR2_23_20, TCLK4_A),
+ PINMUX_IPSR_GPSR(IP1SR2_23_20, TCLK4_C),
PINMUX_IPSR_GPSR(IP1SR2_27_24, CANFD3_TX),
- PINMUX_IPSR_GPSR(IP1SR2_27_24, PWM2_B),
+ PINMUX_IPSR_GPSR(IP1SR2_27_24, PWM2),
PINMUX_IPSR_GPSR(IP1SR2_31_28, CANFD3_RX),
PINMUX_IPSR_GPSR(IP1SR2_31_28, PWM3_B),
@@ -973,12 +973,12 @@ static const u16 pinmux_data[] = {
PINMUX_IPSR_GPSR(IP1SR3_23_20, IPC_CLKIN),
PINMUX_IPSR_GPSR(IP1SR3_23_20, IPC_CLKEN_IN),
PINMUX_IPSR_GPSR(IP1SR3_23_20, PWM1_A),
- PINMUX_IPSR_GPSR(IP1SR3_23_20, TCLK3_X),
+ PINMUX_IPSR_GPSR(IP1SR3_23_20, TCLK3_A),
PINMUX_IPSR_GPSR(IP1SR3_27_24, IPC_CLKOUT),
PINMUX_IPSR_GPSR(IP1SR3_27_24, IPC_CLKEN_OUT),
PINMUX_IPSR_GPSR(IP1SR3_27_24, ERROROUTC_N_A),
- PINMUX_IPSR_GPSR(IP1SR3_27_24, TCLK4_X),
+ PINMUX_IPSR_GPSR(IP1SR3_27_24, TCLK4_A),
PINMUX_IPSR_GPSR(IP1SR3_31_28, QSPI0_SSL),
@@ -1507,15 +1507,14 @@ static const unsigned int canfd4_data_mux[] = {
};
/* - CANFD5 ----------------------------------------------------------------- */
-static const unsigned int canfd5_data_pins[] = {
- /* CANFD5_TX, CANFD5_RX */
+static const unsigned int canfd5_data_a_pins[] = {
+ /* CANFD5_TX_A, CANFD5_RX_A */
RCAR_GP_PIN(2, 2), RCAR_GP_PIN(2, 3),
};
-static const unsigned int canfd5_data_mux[] = {
- CANFD5_TX_MARK, CANFD5_RX_MARK,
+static const unsigned int canfd5_data_a_mux[] = {
+ CANFD5_TX_A_MARK, CANFD5_RX_A_MARK,
};
-/* - CANFD5_B ----------------------------------------------------------------- */
static const unsigned int canfd5_data_b_pins[] = {
/* CANFD5_TX_B, CANFD5_RX_B */
RCAR_GP_PIN(1, 8), RCAR_GP_PIN(1, 9),
@@ -1575,49 +1574,48 @@ static const unsigned int hscif0_ctrl_mux[] = {
};
/* - HSCIF1 ----------------------------------------------------------------- */
-static const unsigned int hscif1_data_pins[] = {
- /* HRX1, HTX1 */
+static const unsigned int hscif1_data_a_pins[] = {
+ /* HRX1_A, HTX1_A */
RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
};
-static const unsigned int hscif1_data_mux[] = {
- HRX1_MARK, HTX1_MARK,
+static const unsigned int hscif1_data_a_mux[] = {
+ HRX1_A_MARK, HTX1_A_MARK,
};
-static const unsigned int hscif1_clk_pins[] = {
- /* HSCK1 */
+static const unsigned int hscif1_clk_a_pins[] = {
+ /* HSCK1_A */
RCAR_GP_PIN(0, 18),
};
-static const unsigned int hscif1_clk_mux[] = {
- HSCK1_MARK,
+static const unsigned int hscif1_clk_a_mux[] = {
+ HSCK1_A_MARK,
};
-static const unsigned int hscif1_ctrl_pins[] = {
- /* HRTS1_N, HCTS1_N */
+static const unsigned int hscif1_ctrl_a_pins[] = {
+ /* HRTS1_N_A, HCTS1_N_A */
RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
};
-static const unsigned int hscif1_ctrl_mux[] = {
- HRTS1_N_MARK, HCTS1_N_MARK,
+static const unsigned int hscif1_ctrl_a_mux[] = {
+ HRTS1_N_A_MARK, HCTS1_N_A_MARK,
};
-/* - HSCIF1_X---------------------------------------------------------------- */
-static const unsigned int hscif1_data_x_pins[] = {
- /* HRX1_X, HTX1_X */
+static const unsigned int hscif1_data_b_pins[] = {
+ /* HRX1_B, HTX1_B */
RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
};
-static const unsigned int hscif1_data_x_mux[] = {
- HRX1_X_MARK, HTX1_X_MARK,
+static const unsigned int hscif1_data_b_mux[] = {
+ HRX1_B_MARK, HTX1_B_MARK,
};
-static const unsigned int hscif1_clk_x_pins[] = {
- /* HSCK1_X */
+static const unsigned int hscif1_clk_b_pins[] = {
+ /* HSCK1_B */
RCAR_GP_PIN(1, 10),
};
-static const unsigned int hscif1_clk_x_mux[] = {
- HSCK1_X_MARK,
+static const unsigned int hscif1_clk_b_mux[] = {
+ HSCK1_B_MARK,
};
-static const unsigned int hscif1_ctrl_x_pins[] = {
- /* HRTS1_N_X, HCTS1_N_X */
+static const unsigned int hscif1_ctrl_b_pins[] = {
+ /* HRTS1_N_B, HCTS1_N_B */
RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
};
-static const unsigned int hscif1_ctrl_x_mux[] = {
- HRTS1_N_X_MARK, HCTS1_N_X_MARK,
+static const unsigned int hscif1_ctrl_b_mux[] = {
+ HRTS1_N_B_MARK, HCTS1_N_B_MARK,
};
/* - HSCIF2 ----------------------------------------------------------------- */
@@ -1644,49 +1642,48 @@ static const unsigned int hscif2_ctrl_mux[] = {
};
/* - HSCIF3 ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_pins[] = {
- /* HRX3, HTX3 */
+static const unsigned int hscif3_data_a_pins[] = {
+ /* HRX3_A, HTX3_A */
RCAR_GP_PIN(1, 24), RCAR_GP_PIN(1, 28),
};
-static const unsigned int hscif3_data_mux[] = {
- HRX3_MARK, HTX3_MARK,
+static const unsigned int hscif3_data_a_mux[] = {
+ HRX3_A_MARK, HTX3_A_MARK,
};
-static const unsigned int hscif3_clk_pins[] = {
- /* HSCK3 */
+static const unsigned int hscif3_clk_a_pins[] = {
+ /* HSCK3_A */
RCAR_GP_PIN(1, 25),
};
-static const unsigned int hscif3_clk_mux[] = {
- HSCK3_MARK,
+static const unsigned int hscif3_clk_a_mux[] = {
+ HSCK3_A_MARK,
};
-static const unsigned int hscif3_ctrl_pins[] = {
- /* HRTS3_N, HCTS3_N */
+static const unsigned int hscif3_ctrl_a_pins[] = {
+ /* HRTS3_N_A, HCTS3_N_A */
RCAR_GP_PIN(1, 26), RCAR_GP_PIN(1, 27),
};
-static const unsigned int hscif3_ctrl_mux[] = {
- HRTS3_N_MARK, HCTS3_N_MARK,
+static const unsigned int hscif3_ctrl_a_mux[] = {
+ HRTS3_N_A_MARK, HCTS3_N_A_MARK,
};
-/* - HSCIF3_A ----------------------------------------------------------------- */
-static const unsigned int hscif3_data_a_pins[] = {
- /* HRX3_A, HTX3_A */
+static const unsigned int hscif3_data_b_pins[] = {
+ /* HRX3_B, HTX3_B */
RCAR_GP_PIN(1, 4), RCAR_GP_PIN(1, 0),
};
-static const unsigned int hscif3_data_a_mux[] = {
- HRX3_A_MARK, HTX3_A_MARK,
+static const unsigned int hscif3_data_b_mux[] = {
+ HRX3_B_MARK, HTX3_B_MARK,
};
-static const unsigned int hscif3_clk_a_pins[] = {
- /* HSCK3_A */
+static const unsigned int hscif3_clk_b_pins[] = {
+ /* HSCK3_B */
RCAR_GP_PIN(1, 3),
};
-static const unsigned int hscif3_clk_a_mux[] = {
- HSCK3_A_MARK,
+static const unsigned int hscif3_clk_b_mux[] = {
+ HSCK3_B_MARK,
};
-static const unsigned int hscif3_ctrl_a_pins[] = {
- /* HRTS3_N_A, HCTS3_N_A */
+static const unsigned int hscif3_ctrl_b_pins[] = {
+ /* HRTS3_N_B, HCTS3_N_B */
RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 1),
};
-static const unsigned int hscif3_ctrl_a_mux[] = {
- HRTS3_N_A_MARK, HCTS3_N_A_MARK,
+static const unsigned int hscif3_ctrl_b_mux[] = {
+ HRTS3_N_B_MARK, HCTS3_N_B_MARK,
};
/* - I2C0 ------------------------------------------------------------------- */
@@ -2069,13 +2066,13 @@ static const unsigned int pcie1_clkreq_n_mux[] = {
PCIE1_CLKREQ_N_MARK,
};
-/* - PWM0_A ------------------------------------------------------------------- */
-static const unsigned int pwm0_a_pins[] = {
- /* PWM0_A */
+/* - PWM0 ------------------------------------------------------------------- */
+static const unsigned int pwm0_pins[] = {
+ /* PWM0 */
RCAR_GP_PIN(1, 15),
};
-static const unsigned int pwm0_a_mux[] = {
- PWM0_A_MARK,
+static const unsigned int pwm0_mux[] = {
+ PWM0_MARK,
};
/* - PWM1_A ------------------------------------------------------------------- */
@@ -2096,13 +2093,13 @@ static const unsigned int pwm1_b_mux[] = {
PWM1_B_MARK,
};
-/* - PWM2_B ------------------------------------------------------------------- */
-static const unsigned int pwm2_b_pins[] = {
- /* PWM2_B */
+/* - PWM2 ------------------------------------------------------------------- */
+static const unsigned int pwm2_pins[] = {
+ /* PWM2 */
RCAR_GP_PIN(2, 14),
};
-static const unsigned int pwm2_b_mux[] = {
- PWM2_B_MARK,
+static const unsigned int pwm2_mux[] = {
+ PWM2_MARK,
};
/* - PWM3_A ------------------------------------------------------------------- */
@@ -2159,22 +2156,22 @@ static const unsigned int pwm7_mux[] = {
PWM7_MARK,
};
-/* - PWM8_A ------------------------------------------------------------------- */
-static const unsigned int pwm8_a_pins[] = {
- /* PWM8_A */
+/* - PWM8 ------------------------------------------------------------------- */
+static const unsigned int pwm8_pins[] = {
+ /* PWM8 */
RCAR_GP_PIN(1, 13),
};
-static const unsigned int pwm8_a_mux[] = {
- PWM8_A_MARK,
+static const unsigned int pwm8_mux[] = {
+ PWM8_MARK,
};
-/* - PWM9_A ------------------------------------------------------------------- */
-static const unsigned int pwm9_a_pins[] = {
- /* PWM9_A */
+/* - PWM9 ------------------------------------------------------------------- */
+static const unsigned int pwm9_pins[] = {
+ /* PWM9 */
RCAR_GP_PIN(1, 14),
};
-static const unsigned int pwm9_a_mux[] = {
- PWM9_A_MARK,
+static const unsigned int pwm9_mux[] = {
+ PWM9_MARK,
};
/* - QSPI0 ------------------------------------------------------------------ */
@@ -2237,75 +2234,51 @@ static const unsigned int scif0_ctrl_mux[] = {
};
/* - SCIF1 ------------------------------------------------------------------ */
-static const unsigned int scif1_data_pins[] = {
- /* RX1, TX1 */
+static const unsigned int scif1_data_a_pins[] = {
+ /* RX1_A, TX1_A */
RCAR_GP_PIN(0, 15), RCAR_GP_PIN(0, 14),
};
-static const unsigned int scif1_data_mux[] = {
- RX1_MARK, TX1_MARK,
+static const unsigned int scif1_data_a_mux[] = {
+ RX1_A_MARK, TX1_A_MARK,
};
-static const unsigned int scif1_clk_pins[] = {
- /* SCK1 */
+static const unsigned int scif1_clk_a_pins[] = {
+ /* SCK1_A */
RCAR_GP_PIN(0, 18),
};
-static const unsigned int scif1_clk_mux[] = {
- SCK1_MARK,
+static const unsigned int scif1_clk_a_mux[] = {
+ SCK1_A_MARK,
};
-static const unsigned int scif1_ctrl_pins[] = {
- /* RTS1_N, CTS1_N */
+static const unsigned int scif1_ctrl_a_pins[] = {
+ /* RTS1_N_A, CTS1_N_A */
RCAR_GP_PIN(0, 17), RCAR_GP_PIN(0, 16),
};
-static const unsigned int scif1_ctrl_mux[] = {
- RTS1_N_MARK, CTS1_N_MARK,
+static const unsigned int scif1_ctrl_a_mux[] = {
+ RTS1_N_A_MARK, CTS1_N_A_MARK,
};
-/* - SCIF1_X ------------------------------------------------------------------ */
-static const unsigned int scif1_data_x_pins[] = {
- /* RX1_X, TX1_X */
+static const unsigned int scif1_data_b_pins[] = {
+ /* RX1_B, TX1_B */
RCAR_GP_PIN(1, 7), RCAR_GP_PIN(1, 6),
};
-static const unsigned int scif1_data_x_mux[] = {
- RX1_X_MARK, TX1_X_MARK,
+static const unsigned int scif1_data_b_mux[] = {
+ RX1_B_MARK, TX1_B_MARK,
};
-static const unsigned int scif1_clk_x_pins[] = {
- /* SCK1_X */
+static const unsigned int scif1_clk_b_pins[] = {
+ /* SCK1_B */
RCAR_GP_PIN(1, 10),
};
-static const unsigned int scif1_clk_x_mux[] = {
- SCK1_X_MARK,
+static const unsigned int scif1_clk_b_mux[] = {
+ SCK1_B_MARK,
};
-static const unsigned int scif1_ctrl_x_pins[] = {
- /* RTS1_N_X, CTS1_N_X */
+static const unsigned int scif1_ctrl_b_pins[] = {
+ /* RTS1_N_B, CTS1_N_B */
RCAR_GP_PIN(1, 9), RCAR_GP_PIN(1, 8),
};
-static const unsigned int scif1_ctrl_x_mux[] = {
- RTS1_N_X_MARK, CTS1_N_X_MARK,
+static const unsigned int scif1_ctrl_b_mux[] = {
+ RTS1_N_B_MARK, CTS1_N_B_MARK,
};
/* - SCIF3 ------------------------------------------------------------------ */
-static const unsigned int scif3_data_pins[] = {
- /* RX3, TX3 */
- RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
-};
-static const unsigned int scif3_data_mux[] = {
- RX3_MARK, TX3_MARK,
-};
-static const unsigned int scif3_clk_pins[] = {
- /* SCK3 */
- RCAR_GP_PIN(1, 4),
-};
-static const unsigned int scif3_clk_mux[] = {
- SCK3_MARK,
-};
-static const unsigned int scif3_ctrl_pins[] = {
- /* RTS3_N, CTS3_N */
- RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
-};
-static const unsigned int scif3_ctrl_mux[] = {
- RTS3_N_MARK, CTS3_N_MARK,
-};
-
-/* - SCIF3_A ------------------------------------------------------------------ */
static const unsigned int scif3_data_a_pins[] = {
/* RX3_A, TX3_A */
RCAR_GP_PIN(1, 27), RCAR_GP_PIN(1, 28),
@@ -2328,6 +2301,28 @@ static const unsigned int scif3_ctrl_a_mux[] = {
RTS3_N_A_MARK, CTS3_N_A_MARK,
};
+static const unsigned int scif3_data_b_pins[] = {
+ /* RX3_B, TX3_B */
+ RCAR_GP_PIN(1, 1), RCAR_GP_PIN(1, 0),
+};
+static const unsigned int scif3_data_b_mux[] = {
+ RX3_B_MARK, TX3_B_MARK,
+};
+static const unsigned int scif3_clk_b_pins[] = {
+ /* SCK3_B */
+ RCAR_GP_PIN(1, 4),
+};
+static const unsigned int scif3_clk_b_mux[] = {
+ SCK3_B_MARK,
+};
+static const unsigned int scif3_ctrl_b_pins[] = {
+ /* RTS3_N_B, CTS3_N_B */
+ RCAR_GP_PIN(1, 2), RCAR_GP_PIN(1, 3),
+};
+static const unsigned int scif3_ctrl_b_mux[] = {
+ RTS3_N_B_MARK, CTS3_N_B_MARK,
+};
+
/* - SCIF4 ------------------------------------------------------------------ */
static const unsigned int scif4_data_pins[] = {
/* RX4, TX4 */
@@ -2384,64 +2379,63 @@ static const unsigned int ssi_ctrl_mux[] = {
SSI_SCK_MARK, SSI_WS_MARK,
};
-/* - TPU ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_pins[] = {
- /* TPU0TO0 */
+/* - TPU -------------------------------------------------------------------- */
+static const unsigned int tpu_to0_a_pins[] = {
+ /* TPU0TO0_A */
RCAR_GP_PIN(2, 8),
};
-static const unsigned int tpu_to0_mux[] = {
- TPU0TO0_MARK,
+static const unsigned int tpu_to0_a_mux[] = {
+ TPU0TO0_A_MARK,
};
-static const unsigned int tpu_to1_pins[] = {
- /* TPU0TO1 */
+static const unsigned int tpu_to1_a_pins[] = {
+ /* TPU0TO1_A */
RCAR_GP_PIN(2, 7),
};
-static const unsigned int tpu_to1_mux[] = {
- TPU0TO1_MARK,
+static const unsigned int tpu_to1_a_mux[] = {
+ TPU0TO1_A_MARK,
};
-static const unsigned int tpu_to2_pins[] = {
- /* TPU0TO2 */
+static const unsigned int tpu_to2_a_pins[] = {
+ /* TPU0TO2_A */
RCAR_GP_PIN(2, 12),
};
-static const unsigned int tpu_to2_mux[] = {
- TPU0TO2_MARK,
+static const unsigned int tpu_to2_a_mux[] = {
+ TPU0TO2_A_MARK,
};
-static const unsigned int tpu_to3_pins[] = {
- /* TPU0TO3 */
+static const unsigned int tpu_to3_a_pins[] = {
+ /* TPU0TO3_A */
RCAR_GP_PIN(2, 13),
};
-static const unsigned int tpu_to3_mux[] = {
- TPU0TO3_MARK,
+static const unsigned int tpu_to3_a_mux[] = {
+ TPU0TO3_A_MARK,
};
-/* - TPU_A ------------------------------------------------------------------- */
-static const unsigned int tpu_to0_a_pins[] = {
- /* TPU0TO0_A */
+static const unsigned int tpu_to0_b_pins[] = {
+ /* TPU0TO0_B */
RCAR_GP_PIN(1, 25),
};
-static const unsigned int tpu_to0_a_mux[] = {
- TPU0TO0_A_MARK,
+static const unsigned int tpu_to0_b_mux[] = {
+ TPU0TO0_B_MARK,
};
-static const unsigned int tpu_to1_a_pins[] = {
- /* TPU0TO1_A */
+static const unsigned int tpu_to1_b_pins[] = {
+ /* TPU0TO1_B */
RCAR_GP_PIN(1, 26),
};
-static const unsigned int tpu_to1_a_mux[] = {
- TPU0TO1_A_MARK,
+static const unsigned int tpu_to1_b_mux[] = {
+ TPU0TO1_B_MARK,
};
-static const unsigned int tpu_to2_a_pins[] = {
- /* TPU0TO2_A */
+static const unsigned int tpu_to2_b_pins[] = {
+ /* TPU0TO2_B */
RCAR_GP_PIN(2, 0),
};
-static const unsigned int tpu_to2_a_mux[] = {
- TPU0TO2_A_MARK,
+static const unsigned int tpu_to2_b_mux[] = {
+ TPU0TO2_B_MARK,
};
-static const unsigned int tpu_to3_a_pins[] = {
- /* TPU0TO3_A */
+static const unsigned int tpu_to3_b_pins[] = {
+ /* TPU0TO3_B */
RCAR_GP_PIN(2, 1),
};
-static const unsigned int tpu_to3_a_mux[] = {
- TPU0TO3_A_MARK,
+static const unsigned int tpu_to3_b_mux[] = {
+ TPU0TO3_B_MARK,
};
/* - TSN0 ------------------------------------------------ */
@@ -2551,8 +2545,8 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(canfd2_data),
SH_PFC_PIN_GROUP(canfd3_data),
SH_PFC_PIN_GROUP(canfd4_data),
- SH_PFC_PIN_GROUP(canfd5_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(canfd5_data_b), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(canfd5_data_a),
+ SH_PFC_PIN_GROUP(canfd5_data_b),
SH_PFC_PIN_GROUP(canfd6_data),
SH_PFC_PIN_GROUP(canfd7_data),
SH_PFC_PIN_GROUP(can_clk),
@@ -2560,21 +2554,21 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(hscif0_data),
SH_PFC_PIN_GROUP(hscif0_clk),
SH_PFC_PIN_GROUP(hscif0_ctrl),
- SH_PFC_PIN_GROUP(hscif1_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_data_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_clk_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif1_ctrl_x), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(hscif1_data_a),
+ SH_PFC_PIN_GROUP(hscif1_clk_a),
+ SH_PFC_PIN_GROUP(hscif1_ctrl_a),
+ SH_PFC_PIN_GROUP(hscif1_data_b),
+ SH_PFC_PIN_GROUP(hscif1_clk_b),
+ SH_PFC_PIN_GROUP(hscif1_ctrl_b),
SH_PFC_PIN_GROUP(hscif2_data),
SH_PFC_PIN_GROUP(hscif2_clk),
SH_PFC_PIN_GROUP(hscif2_ctrl),
- SH_PFC_PIN_GROUP(hscif3_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_data_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_clk_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(hscif3_ctrl_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(hscif3_data_a),
+ SH_PFC_PIN_GROUP(hscif3_clk_a),
+ SH_PFC_PIN_GROUP(hscif3_ctrl_a),
+ SH_PFC_PIN_GROUP(hscif3_data_b),
+ SH_PFC_PIN_GROUP(hscif3_clk_b),
+ SH_PFC_PIN_GROUP(hscif3_ctrl_b),
SH_PFC_PIN_GROUP(i2c0),
SH_PFC_PIN_GROUP(i2c1),
@@ -2636,18 +2630,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(pcie0_clkreq_n),
SH_PFC_PIN_GROUP(pcie1_clkreq_n),
- SH_PFC_PIN_GROUP(pwm0_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(pwm0),
SH_PFC_PIN_GROUP(pwm1_a),
SH_PFC_PIN_GROUP(pwm1_b),
- SH_PFC_PIN_GROUP(pwm2_b), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(pwm2),
SH_PFC_PIN_GROUP(pwm3_a),
SH_PFC_PIN_GROUP(pwm3_b),
SH_PFC_PIN_GROUP(pwm4),
SH_PFC_PIN_GROUP(pwm5),
SH_PFC_PIN_GROUP(pwm6),
SH_PFC_PIN_GROUP(pwm7),
- SH_PFC_PIN_GROUP(pwm8_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(pwm9_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(pwm8),
+ SH_PFC_PIN_GROUP(pwm9),
SH_PFC_PIN_GROUP(qspi0_ctrl),
BUS_DATA_PIN_GROUP(qspi0_data, 2),
@@ -2659,18 +2653,18 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(scif0_data),
SH_PFC_PIN_GROUP(scif0_clk),
SH_PFC_PIN_GROUP(scif0_ctrl),
- SH_PFC_PIN_GROUP(scif1_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_data_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_clk_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif1_ctrl_x), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_data), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_clk), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_ctrl), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_data_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_clk_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(scif3_ctrl_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(scif1_data_a),
+ SH_PFC_PIN_GROUP(scif1_clk_a),
+ SH_PFC_PIN_GROUP(scif1_ctrl_a),
+ SH_PFC_PIN_GROUP(scif1_data_b),
+ SH_PFC_PIN_GROUP(scif1_clk_b),
+ SH_PFC_PIN_GROUP(scif1_ctrl_b),
+ SH_PFC_PIN_GROUP(scif3_data_a),
+ SH_PFC_PIN_GROUP(scif3_clk_a),
+ SH_PFC_PIN_GROUP(scif3_ctrl_a),
+ SH_PFC_PIN_GROUP(scif3_data_b),
+ SH_PFC_PIN_GROUP(scif3_clk_b),
+ SH_PFC_PIN_GROUP(scif3_ctrl_b),
SH_PFC_PIN_GROUP(scif4_data),
SH_PFC_PIN_GROUP(scif4_clk),
SH_PFC_PIN_GROUP(scif4_ctrl),
@@ -2680,14 +2674,14 @@ static const struct sh_pfc_pin_group pinmux_groups[] = {
SH_PFC_PIN_GROUP(ssi_data),
SH_PFC_PIN_GROUP(ssi_ctrl),
- SH_PFC_PIN_GROUP(tpu_to0), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to0_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to1), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to1_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to2), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to2_a), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to3), /* suffix might be updated */
- SH_PFC_PIN_GROUP(tpu_to3_a), /* suffix might be updated */
+ SH_PFC_PIN_GROUP(tpu_to0_a),
+ SH_PFC_PIN_GROUP(tpu_to0_b),
+ SH_PFC_PIN_GROUP(tpu_to1_a),
+ SH_PFC_PIN_GROUP(tpu_to1_b),
+ SH_PFC_PIN_GROUP(tpu_to2_a),
+ SH_PFC_PIN_GROUP(tpu_to2_b),
+ SH_PFC_PIN_GROUP(tpu_to3_a),
+ SH_PFC_PIN_GROUP(tpu_to3_b),
SH_PFC_PIN_GROUP(tsn0_link),
SH_PFC_PIN_GROUP(tsn0_phy_int),
@@ -2756,8 +2750,7 @@ static const char * const canfd4_groups[] = {
};
static const char * const canfd5_groups[] = {
- /* suffix might be updated */
- "canfd5_data",
+ "canfd5_data_a",
"canfd5_data_b",
};
@@ -2780,13 +2773,12 @@ static const char * const hscif0_groups[] = {
};
static const char * const hscif1_groups[] = {
- /* suffix might be updated */
- "hscif1_data",
- "hscif1_clk",
- "hscif1_ctrl",
- "hscif1_data_x",
- "hscif1_clk_x",
- "hscif1_ctrl_x",
+ "hscif1_data_a",
+ "hscif1_clk_a",
+ "hscif1_ctrl_a",
+ "hscif1_data_b",
+ "hscif1_clk_b",
+ "hscif1_ctrl_b",
};
static const char * const hscif2_groups[] = {
@@ -2796,13 +2788,12 @@ static const char * const hscif2_groups[] = {
};
static const char * const hscif3_groups[] = {
- /* suffix might be updated */
- "hscif3_data",
- "hscif3_clk",
- "hscif3_ctrl",
"hscif3_data_a",
"hscif3_clk_a",
"hscif3_ctrl_a",
+ "hscif3_data_b",
+ "hscif3_clk_b",
+ "hscif3_ctrl_b",
};
static const char * const i2c0_groups[] = {
@@ -2899,8 +2890,7 @@ static const char * const pcie_groups[] = {
};
static const char * const pwm0_groups[] = {
- /* suffix might be updated */
- "pwm0_a",
+ "pwm0",
};
static const char * const pwm1_groups[] = {
@@ -2909,8 +2899,7 @@ static const char * const pwm1_groups[] = {
};
static const char * const pwm2_groups[] = {
- /* suffix might be updated */
- "pwm2_b",
+ "pwm2",
};
static const char * const pwm3_groups[] = {
@@ -2935,13 +2924,11 @@ static const char * const pwm7_groups[] = {
};
static const char * const pwm8_groups[] = {
- /* suffix might be updated */
- "pwm8_a",
+ "pwm8",
};
static const char * const pwm9_groups[] = {
- /* suffix might be updated */
- "pwm9_a",
+ "pwm9",
};
static const char * const qspi0_groups[] = {
@@ -2963,23 +2950,21 @@ static const char * const scif0_groups[] = {
};
static const char * const scif1_groups[] = {
- /* suffix might be updated */
- "scif1_data",
- "scif1_clk",
- "scif1_ctrl",
- "scif1_data_x",
- "scif1_clk_x",
- "scif1_ctrl_x",
+ "scif1_data_a",
+ "scif1_clk_a",
+ "scif1_ctrl_a",
+ "scif1_data_b",
+ "scif1_clk_b",
+ "scif1_ctrl_b",
};
static const char * const scif3_groups[] = {
- /* suffix might be updated */
- "scif3_data",
- "scif3_clk",
- "scif3_ctrl",
"scif3_data_a",
"scif3_clk_a",
"scif3_ctrl_a",
+ "scif3_data_b",
+ "scif3_clk_b",
+ "scif3_ctrl_b",
};
static const char * const scif4_groups[] = {
@@ -3002,15 +2987,14 @@ static const char * const ssi_groups[] = {
};
static const char * const tpu_groups[] = {
- /* suffix might be updated */
- "tpu_to0",
"tpu_to0_a",
- "tpu_to1",
+ "tpu_to0_b",
"tpu_to1_a",
- "tpu_to2",
+ "tpu_to1_b",
"tpu_to2_a",
- "tpu_to3",
+ "tpu_to2_b",
"tpu_to3_a",
+ "tpu_to3_b",
};
static const char * const tsn0_groups[] = {
diff --git a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
index 4e2382778d38..f3411e3eaf2e 100644
--- a/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
+++ b/drivers/pinctrl/ti/pinctrl-ti-iodelay.c
@@ -883,7 +883,7 @@ static int ti_iodelay_probe(struct platform_device *pdev)
iod->desc.name = dev_name(dev);
iod->desc.owner = THIS_MODULE;
- ret = pinctrl_register_and_init(&iod->desc, dev, iod, &iod->pctl);
+ ret = devm_pinctrl_register_and_init(dev, &iod->desc, iod, &iod->pctl);
if (ret) {
dev_err(dev, "Failed to register pinctrl\n");
goto exit_out;
@@ -891,7 +891,11 @@ static int ti_iodelay_probe(struct platform_device *pdev)
platform_set_drvdata(pdev, iod);
- return pinctrl_enable(iod->pctl);
+ ret = pinctrl_enable(iod->pctl);
+ if (ret)
+ goto exit_out;
+
+ return 0;
exit_out:
of_node_put(np);
@@ -908,12 +912,6 @@ static int ti_iodelay_remove(struct platform_device *pdev)
{
struct ti_iodelay_device *iod = platform_get_drvdata(pdev);
- if (!iod)
- return 0;
-
- if (iod->pctl)
- pinctrl_unregister(iod->pctl);
-
ti_iodelay_pinconf_deinit_dev(iod);
/* Expect other allocations to be freed by devm */
diff --git a/drivers/platform/chrome/cros_ec_debugfs.c b/drivers/platform/chrome/cros_ec_debugfs.c
index 4e63adf083ea..b19207f3aecf 100644
--- a/drivers/platform/chrome/cros_ec_debugfs.c
+++ b/drivers/platform/chrome/cros_ec_debugfs.c
@@ -326,6 +326,7 @@ static int ec_read_version_supported(struct cros_ec_dev *ec)
if (!msg)
return 0;
+ msg->version = 1;
msg->command = EC_CMD_GET_CMD_VERSIONS + ec->cmd_offset;
msg->outsize = sizeof(*params);
msg->insize = sizeof(*response);
diff --git a/drivers/platform/mips/cpu_hwmon.c b/drivers/platform/mips/cpu_hwmon.c
index d8c5f9195f85..2ac2f31090f9 100644
--- a/drivers/platform/mips/cpu_hwmon.c
+++ b/drivers/platform/mips/cpu_hwmon.c
@@ -139,6 +139,9 @@ static int __init loongson_hwmon_init(void)
csr_temp_enable = csr_readl(LOONGSON_CSR_FEATURES) &
LOONGSON_CSRF_TEMP;
+ if (!csr_temp_enable && !loongson_chiptemp[0])
+ return -ENODEV;
+
nr_packages = loongson_sysconf.nr_cpus /
loongson_sysconf.cores_per_package;
diff --git a/drivers/pwm/pwm-atmel-tcb.c b/drivers/pwm/pwm-atmel-tcb.c
index 2826fc216d29..e74b45f00a9a 100644
--- a/drivers/pwm/pwm-atmel-tcb.c
+++ b/drivers/pwm/pwm-atmel-tcb.c
@@ -34,7 +34,6 @@
ATMEL_TC_BEEVT | ATMEL_TC_BSWTRG)
struct atmel_tcb_pwm_device {
- enum pwm_polarity polarity; /* PWM polarity */
unsigned div; /* PWM clock divider */
unsigned duty; /* PWM duty expressed in clk cycles */
unsigned period; /* PWM period expressed in clk cycles */
@@ -57,7 +56,7 @@ struct atmel_tcb_pwm_chip {
struct clk *clk;
struct clk *gclk;
struct clk *slow_clk;
- struct atmel_tcb_pwm_device *pwms[NPWM];
+ struct atmel_tcb_pwm_device pwms[NPWM];
struct atmel_tcb_channel bkup;
};
@@ -68,42 +67,24 @@ static inline struct atmel_tcb_pwm_chip *to_tcb_chip(struct pwm_chip *chip)
return container_of(chip, struct atmel_tcb_pwm_chip, chip);
}
-static int atmel_tcb_pwm_set_polarity(struct pwm_chip *chip,
- struct pwm_device *pwm,
- enum pwm_polarity polarity)
-{
- struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
- struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
-
- tcbpwm->polarity = polarity;
-
- return 0;
-}
-
static int atmel_tcb_pwm_request(struct pwm_chip *chip,
struct pwm_device *pwm)
{
struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
- struct atmel_tcb_pwm_device *tcbpwm;
+ struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
unsigned cmr;
int ret;
- tcbpwm = devm_kzalloc(chip->dev, sizeof(*tcbpwm), GFP_KERNEL);
- if (!tcbpwm)
- return -ENOMEM;
-
ret = clk_prepare_enable(tcbpwmc->clk);
- if (ret) {
- devm_kfree(chip->dev, tcbpwm);
+ if (ret)
return ret;
- }
- tcbpwm->polarity = PWM_POLARITY_NORMAL;
tcbpwm->duty = 0;
tcbpwm->period = 0;
tcbpwm->div = 0;
- spin_lock(&tcbpwmc->lock);
+ guard(spinlock)(&tcbpwmc->lock);
+
regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
/*
* Get init config from Timer Counter registers if
@@ -129,9 +110,6 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
cmr |= ATMEL_TC_WAVE | ATMEL_TC_WAVESEL_UP_AUTO | ATMEL_TC_EEVT_XC0;
regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), cmr);
- spin_unlock(&tcbpwmc->lock);
-
- tcbpwmc->pwms[pwm->hwpwm] = tcbpwm;
return 0;
}
@@ -139,19 +117,16 @@ static int atmel_tcb_pwm_request(struct pwm_chip *chip,
static void atmel_tcb_pwm_free(struct pwm_chip *chip, struct pwm_device *pwm)
{
struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
- struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
clk_disable_unprepare(tcbpwmc->clk);
- tcbpwmc->pwms[pwm->hwpwm] = NULL;
- devm_kfree(chip->dev, tcbpwm);
}
-static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
+static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm,
+ enum pwm_polarity polarity)
{
struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
- struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+ struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
unsigned cmr;
- enum pwm_polarity polarity = tcbpwm->polarity;
/*
* If duty is 0 the timer will be stopped and we have to
@@ -164,7 +139,6 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
if (tcbpwm->duty == 0)
polarity = !polarity;
- spin_lock(&tcbpwmc->lock);
regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
/* flush old setting and set the new one */
@@ -199,16 +173,14 @@ static void atmel_tcb_pwm_disable(struct pwm_chip *chip, struct pwm_device *pwm)
ATMEL_TC_SWTRG);
tcbpwmc->bkup.enabled = 0;
}
-
- spin_unlock(&tcbpwmc->lock);
}
-static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
+static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm,
+ enum pwm_polarity polarity)
{
struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
- struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+ struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
u32 cmr;
- enum pwm_polarity polarity = tcbpwm->polarity;
/*
* If duty is 0 the timer will be stopped and we have to
@@ -221,7 +193,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
if (tcbpwm->duty == 0)
polarity = !polarity;
- spin_lock(&tcbpwmc->lock);
regmap_read(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CMR), &cmr);
/* flush old setting and set the new one */
@@ -283,7 +254,6 @@ static int atmel_tcb_pwm_enable(struct pwm_chip *chip, struct pwm_device *pwm)
regmap_write(tcbpwmc->regmap, ATMEL_TC_REG(tcbpwmc->channel, CCR),
ATMEL_TC_SWTRG | ATMEL_TC_CLKEN);
tcbpwmc->bkup.enabled = 1;
- spin_unlock(&tcbpwmc->lock);
return 0;
}
@@ -291,7 +261,7 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
int duty_ns, int period_ns)
{
struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
- struct atmel_tcb_pwm_device *tcbpwm = tcbpwmc->pwms[pwm->hwpwm];
+ struct atmel_tcb_pwm_device *tcbpwm = &tcbpwmc->pwms[pwm->hwpwm];
struct atmel_tcb_pwm_device *atcbpwm = NULL;
int i = 0;
int slowclk = 0;
@@ -338,9 +308,9 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
period = div_u64(period_ns, min);
if (pwm->hwpwm == 0)
- atcbpwm = tcbpwmc->pwms[1];
+ atcbpwm = &tcbpwmc->pwms[1];
else
- atcbpwm = tcbpwmc->pwms[0];
+ atcbpwm = &tcbpwmc->pwms[0];
/*
* PWM devices provided by the TCB driver are grouped by 2.
@@ -368,14 +338,14 @@ static int atmel_tcb_pwm_config(struct pwm_chip *chip, struct pwm_device *pwm,
static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
const struct pwm_state *state)
{
+ struct atmel_tcb_pwm_chip *tcbpwmc = to_tcb_chip(chip);
int duty_cycle, period;
int ret;
- /* This function only sets a flag in driver data */
- atmel_tcb_pwm_set_polarity(chip, pwm, state->polarity);
+ guard(spinlock)(&tcbpwmc->lock);
if (!state->enabled) {
- atmel_tcb_pwm_disable(chip, pwm);
+ atmel_tcb_pwm_disable(chip, pwm, state->polarity);
return 0;
}
@@ -386,7 +356,7 @@ static int atmel_tcb_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
if (ret)
return ret;
- return atmel_tcb_pwm_enable(chip, pwm);
+ return atmel_tcb_pwm_enable(chip, pwm, state->polarity);
}
static const struct pwm_ops atmel_tcb_pwm_ops = {
diff --git a/drivers/pwm/pwm-stm32.c b/drivers/pwm/pwm-stm32.c
index c40a6548ce7d..2070d107c632 100644
--- a/drivers/pwm/pwm-stm32.c
+++ b/drivers/pwm/pwm-stm32.c
@@ -452,8 +452,9 @@ static int stm32_pwm_apply(struct pwm_chip *chip, struct pwm_device *pwm,
enabled = pwm->state.enabled;
- if (enabled && !state->enabled) {
- stm32_pwm_disable(priv, pwm->hwpwm);
+ if (!state->enabled) {
+ if (enabled)
+ stm32_pwm_disable(priv, pwm->hwpwm);
return 0;
}
diff --git a/drivers/remoteproc/imx_rproc.c b/drivers/remoteproc/imx_rproc.c
index 8a2a7112678c..bc26fe541662 100644
--- a/drivers/remoteproc/imx_rproc.c
+++ b/drivers/remoteproc/imx_rproc.c
@@ -596,31 +596,37 @@ static int imx_rproc_addr_init(struct imx_rproc *priv,
struct resource res;
node = of_parse_phandle(np, "memory-region", a);
+ if (!node)
+ continue;
/* Not map vdevbuffer, vdevring region */
if (!strncmp(node->name, "vdev", strlen("vdev"))) {
of_node_put(node);
continue;
}
err = of_address_to_resource(node, 0, &res);
- of_node_put(node);
if (err) {
dev_err(dev, "unable to resolve memory region\n");
+ of_node_put(node);
return err;
}
- if (b >= IMX_RPROC_MEM_MAX)
+ if (b >= IMX_RPROC_MEM_MAX) {
+ of_node_put(node);
break;
+ }
/* Not use resource version, because we might share region */
priv->mem[b].cpu_addr = devm_ioremap_wc(&pdev->dev, res.start, resource_size(&res));
if (!priv->mem[b].cpu_addr) {
dev_err(dev, "failed to remap %pr\n", &res);
+ of_node_put(node);
return -ENOMEM;
}
priv->mem[b].sys_addr = res.start;
priv->mem[b].size = resource_size(&res);
if (!strcmp(node->name, "rsc-table"))
priv->rsc_table = priv->mem[b].cpu_addr;
+ of_node_put(node);
b++;
}
diff --git a/drivers/remoteproc/stm32_rproc.c b/drivers/remoteproc/stm32_rproc.c
index 74da0393172c..d88220a8fb0c 100644
--- a/drivers/remoteproc/stm32_rproc.c
+++ b/drivers/remoteproc/stm32_rproc.c
@@ -293,7 +293,7 @@ static void stm32_rproc_mb_vq_work(struct work_struct *work)
mutex_lock(&rproc->lock);
- if (rproc->state != RPROC_RUNNING)
+ if (rproc->state != RPROC_RUNNING && rproc->state != RPROC_ATTACHED)
goto unlock_mutex;
if (rproc_vq_interrupt(rproc, mb->vq_id) == IRQ_NONE)
diff --git a/drivers/rtc/interface.c b/drivers/rtc/interface.c
index 3d0fbc644f57..c928037bf6f3 100644
--- a/drivers/rtc/interface.c
+++ b/drivers/rtc/interface.c
@@ -274,10 +274,9 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
return err;
/* full-function RTCs won't have such missing fields */
- if (rtc_valid_tm(&alarm->time) == 0) {
- rtc_add_offset(rtc, &alarm->time);
- return 0;
- }
+ err = rtc_valid_tm(&alarm->time);
+ if (!err)
+ goto done;
/* get the "after" timestamp, to detect wrapped fields */
err = rtc_read_time(rtc, &now);
@@ -379,6 +378,8 @@ int __rtc_read_alarm(struct rtc_device *rtc, struct rtc_wkalrm *alarm)
if (err)
dev_warn(&rtc->dev, "invalid alarm value: %ptR\n",
&alarm->time);
+ else
+ rtc_add_offset(rtc, &alarm->time);
return err;
}
diff --git a/drivers/rtc/rtc-cmos.c b/drivers/rtc/rtc-cmos.c
index e0a798923ce0..542568cd72b3 100644
--- a/drivers/rtc/rtc-cmos.c
+++ b/drivers/rtc/rtc-cmos.c
@@ -643,11 +643,10 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
size_t count)
{
unsigned char *buf = val;
- int retval;
off += NVRAM_OFFSET;
spin_lock_irq(&rtc_lock);
- for (retval = 0; count; count--, off++, retval++) {
+ for (; count; count--, off++) {
if (off < 128)
*buf++ = CMOS_READ(off);
else if (can_bank2)
@@ -657,7 +656,7 @@ static int cmos_nvram_read(void *priv, unsigned int off, void *val,
}
spin_unlock_irq(&rtc_lock);
- return retval;
+ return count ? -EIO : 0;
}
static int cmos_nvram_write(void *priv, unsigned int off, void *val,
@@ -665,7 +664,6 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
{
struct cmos_rtc *cmos = priv;
unsigned char *buf = val;
- int retval;
/* NOTE: on at least PCs and Ataris, the boot firmware uses a
* checksum on part of the NVRAM data. That's currently ignored
@@ -674,7 +672,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
*/
off += NVRAM_OFFSET;
spin_lock_irq(&rtc_lock);
- for (retval = 0; count; count--, off++, retval++) {
+ for (; count; count--, off++) {
/* don't trash RTC registers */
if (off == cmos->day_alrm
|| off == cmos->mon_alrm
@@ -689,7 +687,7 @@ static int cmos_nvram_write(void *priv, unsigned int off, void *val,
}
spin_unlock_irq(&rtc_lock);
- return retval;
+ return count ? -EIO : 0;
}
/*----------------------------------------------------------------*/
diff --git a/drivers/rtc/rtc-isl1208.c b/drivers/rtc/rtc-isl1208.c
index f448a525333e..2615b2cf8334 100644
--- a/drivers/rtc/rtc-isl1208.c
+++ b/drivers/rtc/rtc-isl1208.c
@@ -743,14 +743,13 @@ static int isl1208_nvmem_read(void *priv, unsigned int off, void *buf,
{
struct isl1208_state *isl1208 = priv;
struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
- int ret;
/* nvmem sanitizes offset/count for us, but count==0 is possible */
if (!count)
return count;
- ret = isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
+
+ return isl1208_i2c_read_regs(client, ISL1208_REG_USR1 + off, buf,
count);
- return ret == 0 ? count : ret;
}
static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
@@ -758,15 +757,13 @@ static int isl1208_nvmem_write(void *priv, unsigned int off, void *buf,
{
struct isl1208_state *isl1208 = priv;
struct i2c_client *client = to_i2c_client(isl1208->rtc->dev.parent);
- int ret;
/* nvmem sanitizes off/count for us, but count==0 is possible */
if (!count)
return count;
- ret = isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
- count);
- return ret == 0 ? count : ret;
+ return isl1208_i2c_set_regs(client, ISL1208_REG_USR1 + off, buf,
+ count);
}
static const struct nvmem_config isl1208_nvmem_config = {
diff --git a/drivers/s390/block/dasd_devmap.c b/drivers/s390/block/dasd_devmap.c
index b2a4c3433057..1129f6ae98b5 100644
--- a/drivers/s390/block/dasd_devmap.c
+++ b/drivers/s390/block/dasd_devmap.c
@@ -2135,13 +2135,19 @@ static ssize_t dasd_copy_pair_store(struct device *dev,
/* allocate primary devmap if needed */
prim_devmap = dasd_find_busid(prim_busid);
- if (IS_ERR(prim_devmap))
+ if (IS_ERR(prim_devmap)) {
prim_devmap = dasd_add_busid(prim_busid, DASD_FEATURE_DEFAULT);
+ if (IS_ERR(prim_devmap))
+ return PTR_ERR(prim_devmap);
+ }
/* allocate secondary devmap if needed */
sec_devmap = dasd_find_busid(sec_busid);
- if (IS_ERR(sec_devmap))
+ if (IS_ERR(sec_devmap)) {
sec_devmap = dasd_add_busid(sec_busid, DASD_FEATURE_DEFAULT);
+ if (IS_ERR(sec_devmap))
+ return PTR_ERR(sec_devmap);
+ }
/* setting copy relation is only allowed for offline secondary */
if (sec_devmap->device)
diff --git a/drivers/scsi/qla2xxx/qla_bsg.c b/drivers/scsi/qla2xxx/qla_bsg.c
index 19bb64bdd88b..52dc9604f567 100644
--- a/drivers/scsi/qla2xxx/qla_bsg.c
+++ b/drivers/scsi/qla2xxx/qla_bsg.c
@@ -324,7 +324,7 @@ qla2x00_process_els(struct bsg_job *bsg_job)
"request_sg_cnt=%x reply_sg_cnt=%x.\n",
bsg_job->request_payload.sg_cnt,
bsg_job->reply_payload.sg_cnt);
- rval = -EPERM;
+ rval = -ENOBUFS;
goto done;
}
@@ -3059,17 +3059,61 @@ qla24xx_bsg_request(struct bsg_job *bsg_job)
return ret;
}
-int
-qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+static bool qla_bsg_found(struct qla_qpair *qpair, struct bsg_job *bsg_job)
{
+ bool found = false;
struct fc_bsg_reply *bsg_reply = bsg_job->reply;
scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
struct qla_hw_data *ha = vha->hw;
- srb_t *sp;
- int cnt, que;
+ srb_t *sp = NULL;
+ int cnt;
unsigned long flags;
struct req_que *req;
+ spin_lock_irqsave(qpair->qp_lock_ptr, flags);
+ req = qpair->req;
+
+ for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
+ sp = req->outstanding_cmds[cnt];
+ if (sp &&
+ (sp->type == SRB_CT_CMD ||
+ sp->type == SRB_ELS_CMD_HST ||
+ sp->type == SRB_ELS_CMD_HST_NOLOGIN) &&
+ sp->u.bsg_job == bsg_job) {
+ req->outstanding_cmds[cnt] = NULL;
+ spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+ if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
+ ql_log(ql_log_warn, vha, 0x7089,
+ "mbx abort_command failed.\n");
+ bsg_reply->result = -EIO;
+ } else {
+ ql_dbg(ql_dbg_user, vha, 0x708a,
+ "mbx abort_command success.\n");
+ bsg_reply->result = 0;
+ }
+ /* ref: INIT */
+ kref_put(&sp->cmd_kref, qla2x00_sp_release);
+
+ found = true;
+ goto done;
+ }
+ }
+ spin_unlock_irqrestore(qpair->qp_lock_ptr, flags);
+
+done:
+ return found;
+}
+
+int
+qla24xx_bsg_timeout(struct bsg_job *bsg_job)
+{
+ struct fc_bsg_reply *bsg_reply = bsg_job->reply;
+ scsi_qla_host_t *vha = shost_priv(fc_bsg_to_shost(bsg_job));
+ struct qla_hw_data *ha = vha->hw;
+ int i;
+ struct qla_qpair *qpair;
+
ql_log(ql_log_info, vha, 0x708b, "%s CMD timeout. bsg ptr %p.\n",
__func__, bsg_job);
@@ -3079,48 +3123,22 @@ qla24xx_bsg_timeout(struct bsg_job *bsg_job)
qla_pci_set_eeh_busy(vha);
}
+ if (qla_bsg_found(ha->base_qpair, bsg_job))
+ goto done;
+
/* find the bsg job from the active list of commands */
- spin_lock_irqsave(&ha->hardware_lock, flags);
- for (que = 0; que < ha->max_req_queues; que++) {
- req = ha->req_q_map[que];
- if (!req)
+ for (i = 0; i < ha->max_qpairs; i++) {
+ qpair = vha->hw->queue_pair_map[i];
+ if (!qpair)
continue;
-
- for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
- sp = req->outstanding_cmds[cnt];
- if (sp &&
- (sp->type == SRB_CT_CMD ||
- sp->type == SRB_ELS_CMD_HST ||
- sp->type == SRB_ELS_CMD_HST_NOLOGIN ||
- sp->type == SRB_FXIOCB_BCMD) &&
- sp->u.bsg_job == bsg_job) {
- req->outstanding_cmds[cnt] = NULL;
- spin_unlock_irqrestore(&ha->hardware_lock, flags);
-
- if (!ha->flags.eeh_busy && ha->isp_ops->abort_command(sp)) {
- ql_log(ql_log_warn, vha, 0x7089,
- "mbx abort_command failed.\n");
- bsg_reply->result = -EIO;
- } else {
- ql_dbg(ql_dbg_user, vha, 0x708a,
- "mbx abort_command success.\n");
- bsg_reply->result = 0;
- }
- spin_lock_irqsave(&ha->hardware_lock, flags);
- goto done;
-
- }
- }
+ if (qla_bsg_found(qpair, bsg_job))
+ goto done;
}
- spin_unlock_irqrestore(&ha->hardware_lock, flags);
+
ql_log(ql_log_info, vha, 0x708b, "SRB not found to abort.\n");
bsg_reply->result = -ENXIO;
- return 0;
done:
- spin_unlock_irqrestore(&ha->hardware_lock, flags);
- /* ref: INIT */
- kref_put(&sp->cmd_kref, qla2x00_sp_release);
return 0;
}
diff --git a/drivers/scsi/qla2xxx/qla_def.h b/drivers/scsi/qla2xxx/qla_def.h
index 31c451daeeb8..8490181424c7 100644
--- a/drivers/scsi/qla2xxx/qla_def.h
+++ b/drivers/scsi/qla2xxx/qla_def.h
@@ -3278,6 +3278,8 @@ struct fab_scan_rp {
struct fab_scan {
struct fab_scan_rp *l;
u32 size;
+ u32 rscn_gen_start;
+ u32 rscn_gen_end;
u16 scan_retry;
#define MAX_SCAN_RETRIES 5
enum scan_flags_t scan_flags;
@@ -4985,6 +4987,7 @@ typedef struct scsi_qla_host {
/* Counter to detect races between ELS and RSCN events */
atomic_t generation_tick;
+ atomic_t rscn_gen;
/* Time when global fcport update has been scheduled */
int total_fcport_update_gen;
/* List of pending LOGOs, protected by tgt_mutex */
diff --git a/drivers/scsi/qla2xxx/qla_gs.c b/drivers/scsi/qla2xxx/qla_gs.c
index 64ab070b8716..9c707d677f64 100644
--- a/drivers/scsi/qla2xxx/qla_gs.c
+++ b/drivers/scsi/qla2xxx/qla_gs.c
@@ -1710,7 +1710,7 @@ qla2x00_hba_attributes(scsi_qla_host_t *vha, void *entries,
eiter->type = cpu_to_be16(FDMI_HBA_OPTION_ROM_VERSION);
alen = scnprintf(
eiter->a.orom_version, sizeof(eiter->a.orom_version),
- "%d.%02d", ha->bios_revision[1], ha->bios_revision[0]);
+ "%d.%02d", ha->efi_revision[1], ha->efi_revision[0]);
alen += FDMI_ATTR_ALIGNMENT(alen);
alen += FDMI_ATTR_TYPELEN(eiter);
eiter->len = cpu_to_be16(alen);
@@ -3465,6 +3465,29 @@ static int qla2x00_is_a_vp(scsi_qla_host_t *vha, u64 wwn)
return rc;
}
+static bool qla_ok_to_clear_rscn(scsi_qla_host_t *vha, fc_port_t *fcport)
+{
+ u32 rscn_gen;
+
+ rscn_gen = atomic_read(&vha->rscn_gen);
+ ql_dbg(ql_dbg_disc + ql_dbg_verbose, vha, 0x2017,
+ "%s %d %8phC rscn_gen %x start %x end %x current %x\n",
+ __func__, __LINE__, fcport->port_name, fcport->rscn_gen,
+ vha->scan.rscn_gen_start, vha->scan.rscn_gen_end, rscn_gen);
+
+ if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_start,
+ vha->scan.rscn_gen_end))
+ /* rscn came in before fabric scan */
+ return true;
+
+ if (val_is_in_range(fcport->rscn_gen, vha->scan.rscn_gen_end, rscn_gen))
+ /* rscn came in after fabric scan */
+ return false;
+
+ /* rare: fcport's scan_needed + rscn_gen must be stale */
+ return true;
+}
+
void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
{
fc_port_t *fcport;
@@ -3578,10 +3601,10 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
(fcport->scan_needed &&
fcport->port_type != FCT_INITIATOR &&
fcport->port_type != FCT_NVME_INITIATOR)) {
+ fcport->scan_needed = 0;
qlt_schedule_sess_for_deletion(fcport);
}
fcport->d_id.b24 = rp->id.b24;
- fcport->scan_needed = 0;
break;
}
@@ -3622,7 +3645,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
do_delete = true;
}
- fcport->scan_needed = 0;
+ if (qla_ok_to_clear_rscn(vha, fcport))
+ fcport->scan_needed = 0;
+
if (((qla_dual_mode_enabled(vha) ||
qla_ini_mode_enabled(vha)) &&
atomic_read(&fcport->state) == FCS_ONLINE) ||
@@ -3652,7 +3677,9 @@ void qla24xx_async_gnnft_done(scsi_qla_host_t *vha, srb_t *sp)
fcport->port_name, fcport->loop_id,
fcport->login_retry);
}
- fcport->scan_needed = 0;
+
+ if (qla_ok_to_clear_rscn(vha, fcport))
+ fcport->scan_needed = 0;
qla24xx_fcport_handle_login(vha, fcport);
}
}
diff --git a/drivers/scsi/qla2xxx/qla_init.c b/drivers/scsi/qla2xxx/qla_init.c
index 6dce3f166564..a65c60160820 100644
--- a/drivers/scsi/qla2xxx/qla_init.c
+++ b/drivers/scsi/qla2xxx/qla_init.c
@@ -1843,10 +1843,18 @@ int qla24xx_post_newsess_work(struct scsi_qla_host *vha, port_id_t *id,
return qla2x00_post_work(vha, e);
}
+static void qla_rscn_gen_tick(scsi_qla_host_t *vha, u32 *ret_rscn_gen)
+{
+ *ret_rscn_gen = atomic_inc_return(&vha->rscn_gen);
+ /* memory barrier */
+ wmb();
+}
+
void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
{
fc_port_t *fcport;
unsigned long flags;
+ u32 rscn_gen;
switch (ea->id.b.rsvd_1) {
case RSCN_PORT_ADDR:
@@ -1876,15 +1884,16 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
* Otherwise we're already in the middle of a relogin
*/
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ qla_rscn_gen_tick(vha, &fcport->rscn_gen);
}
} else {
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ qla_rscn_gen_tick(vha, &fcport->rscn_gen);
}
}
break;
case RSCN_AREA_ADDR:
+ qla_rscn_gen_tick(vha, &rscn_gen);
list_for_each_entry(fcport, &vha->vp_fcports, list) {
if (fcport->flags & FCF_FCP2_DEVICE &&
atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1892,11 +1901,12 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
if ((ea->id.b24 & 0xffff00) == (fcport->d_id.b24 & 0xffff00)) {
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ fcport->rscn_gen = rscn_gen;
}
}
break;
case RSCN_DOM_ADDR:
+ qla_rscn_gen_tick(vha, &rscn_gen);
list_for_each_entry(fcport, &vha->vp_fcports, list) {
if (fcport->flags & FCF_FCP2_DEVICE &&
atomic_read(&fcport->state) == FCS_ONLINE)
@@ -1904,19 +1914,20 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
if ((ea->id.b24 & 0xff0000) == (fcport->d_id.b24 & 0xff0000)) {
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ fcport->rscn_gen = rscn_gen;
}
}
break;
case RSCN_FAB_ADDR:
default:
+ qla_rscn_gen_tick(vha, &rscn_gen);
list_for_each_entry(fcport, &vha->vp_fcports, list) {
if (fcport->flags & FCF_FCP2_DEVICE &&
atomic_read(&fcport->state) == FCS_ONLINE)
continue;
fcport->scan_needed = 1;
- fcport->rscn_gen++;
+ fcport->rscn_gen = rscn_gen;
}
break;
}
@@ -1925,6 +1936,7 @@ void qla2x00_handle_rscn(scsi_qla_host_t *vha, struct event_arg *ea)
if (vha->scan.scan_flags == 0) {
ql_dbg(ql_dbg_disc, vha, 0xffff, "%s: schedule\n", __func__);
vha->scan.scan_flags |= SF_QUEUED;
+ vha->scan.rscn_gen_start = atomic_read(&vha->rscn_gen);
schedule_delayed_work(&vha->scan.scan_work, 5);
}
spin_unlock_irqrestore(&vha->work_lock, flags);
@@ -6419,6 +6431,8 @@ qla2x00_configure_fabric(scsi_qla_host_t *vha)
qlt_do_generation_tick(vha, &discovery_gen);
if (USE_ASYNC_SCAN(ha)) {
+ /* start of scan begins here */
+ vha->scan.rscn_gen_end = atomic_read(&vha->rscn_gen);
rval = qla24xx_async_gpnft(vha, FC4_TYPE_FCP_SCSI,
NULL);
if (rval)
@@ -8260,15 +8274,21 @@ qla28xx_get_aux_images(
struct qla27xx_image_status pri_aux_image_status, sec_aux_image_status;
bool valid_pri_image = false, valid_sec_image = false;
bool active_pri_image = false, active_sec_image = false;
+ int rc;
if (!ha->flt_region_aux_img_status_pri) {
ql_dbg(ql_dbg_init, vha, 0x018a, "Primary aux image not addressed\n");
goto check_sec_image;
}
- qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
+ rc = qla24xx_read_flash_data(vha, (uint32_t *)&pri_aux_image_status,
ha->flt_region_aux_img_status_pri,
sizeof(pri_aux_image_status) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a1,
+ "Unable to read Primary aux image(%x).\n", rc);
+ goto check_sec_image;
+ }
qla27xx_print_image(vha, "Primary aux image", &pri_aux_image_status);
if (qla28xx_check_aux_image_status_signature(&pri_aux_image_status)) {
@@ -8299,9 +8319,15 @@ qla28xx_get_aux_images(
goto check_valid_image;
}
- qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
+ rc = qla24xx_read_flash_data(vha, (uint32_t *)&sec_aux_image_status,
ha->flt_region_aux_img_status_sec,
sizeof(sec_aux_image_status) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a2,
+ "Unable to read Secondary aux image(%x).\n", rc);
+ goto check_valid_image;
+ }
+
qla27xx_print_image(vha, "Secondary aux image", &sec_aux_image_status);
if (qla28xx_check_aux_image_status_signature(&sec_aux_image_status)) {
@@ -8359,6 +8385,7 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
struct qla27xx_image_status pri_image_status, sec_image_status;
bool valid_pri_image = false, valid_sec_image = false;
bool active_pri_image = false, active_sec_image = false;
+ int rc;
if (!ha->flt_region_img_status_pri) {
ql_dbg(ql_dbg_init, vha, 0x018a, "Primary image not addressed\n");
@@ -8400,8 +8427,14 @@ qla27xx_get_active_image(struct scsi_qla_host *vha,
goto check_valid_image;
}
- qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
+ rc = qla24xx_read_flash_data(vha, (uint32_t *)(&sec_image_status),
ha->flt_region_img_status_sec, sizeof(sec_image_status) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a3,
+ "Unable to read Secondary image status(%x).\n", rc);
+ goto check_valid_image;
+ }
+
qla27xx_print_image(vha, "Secondary image", &sec_image_status);
if (qla27xx_check_image_status_signature(&sec_image_status)) {
@@ -8473,11 +8506,10 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
"FW: Loading firmware from flash (%x).\n", faddr);
dcode = (uint32_t *)req->ring;
- qla24xx_read_flash_data(vha, dcode, faddr, 8);
- if (qla24xx_risc_firmware_invalid(dcode)) {
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+ if (rval || qla24xx_risc_firmware_invalid(dcode)) {
ql_log(ql_log_fatal, vha, 0x008c,
- "Unable to verify the integrity of flash firmware "
- "image.\n");
+ "Unable to verify the integrity of flash firmware image (rval %x).\n", rval);
ql_log(ql_log_fatal, vha, 0x008d,
"Firmware data: %08x %08x %08x %08x.\n",
dcode[0], dcode[1], dcode[2], dcode[3]);
@@ -8491,7 +8523,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
for (j = 0; j < segments; j++) {
ql_dbg(ql_dbg_init, vha, 0x008d,
"-> Loading segment %u...\n", j);
- qla24xx_read_flash_data(vha, dcode, faddr, 10);
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, 10);
+ if (rval) {
+ ql_log(ql_log_fatal, vha, 0x016a,
+ "-> Unable to read segment addr + size .\n");
+ return QLA_FUNCTION_FAILED;
+ }
risc_addr = be32_to_cpu((__force __be32)dcode[2]);
risc_size = be32_to_cpu((__force __be32)dcode[3]);
if (!*srisc_addr) {
@@ -8507,7 +8544,13 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
ql_dbg(ql_dbg_init, vha, 0x008e,
"-> Loading fragment %u: %#x <- %#x (%#lx dwords)...\n",
fragment, risc_addr, faddr, dlen);
- qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, dlen);
+ if (rval) {
+ ql_log(ql_log_fatal, vha, 0x016b,
+ "-> Unable to read fragment(faddr %#x dlen %#lx).\n",
+ faddr, dlen);
+ return QLA_FUNCTION_FAILED;
+ }
for (i = 0; i < dlen; i++)
dcode[i] = swab32(dcode[i]);
@@ -8536,7 +8579,14 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
fwdt->length = 0;
dcode = (uint32_t *)req->ring;
- qla24xx_read_flash_data(vha, dcode, faddr, 7);
+
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, 7);
+ if (rval) {
+ ql_log(ql_log_fatal, vha, 0x016c,
+ "-> Unable to read template size.\n");
+ goto failed;
+ }
+
risc_size = be32_to_cpu((__force __be32)dcode[2]);
ql_dbg(ql_dbg_init, vha, 0x0161,
"-> fwdt%u template array at %#x (%#x dwords)\n",
@@ -8562,11 +8612,12 @@ qla24xx_load_risc_flash(scsi_qla_host_t *vha, uint32_t *srisc_addr,
}
dcode = fwdt->template;
- qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
+ rval = qla24xx_read_flash_data(vha, dcode, faddr, risc_size);
- if (!qla27xx_fwdt_template_valid(dcode)) {
+ if (rval || !qla27xx_fwdt_template_valid(dcode)) {
ql_log(ql_log_warn, vha, 0x0165,
- "-> fwdt%u failed template validate\n", j);
+ "-> fwdt%u failed template validate (rval %x)\n",
+ j, rval);
goto failed;
}
diff --git a/drivers/scsi/qla2xxx/qla_inline.h b/drivers/scsi/qla2xxx/qla_inline.h
index a4a56ab0ba74..ef4b3cc1cd77 100644
--- a/drivers/scsi/qla2xxx/qla_inline.h
+++ b/drivers/scsi/qla2xxx/qla_inline.h
@@ -631,3 +631,11 @@ static inline int qla_mapq_alloc_qp_cpu_map(struct qla_hw_data *ha)
}
return 0;
}
+
+static inline bool val_is_in_range(u32 val, u32 start, u32 end)
+{
+ if (val >= start && val <= end)
+ return true;
+ else
+ return false;
+}
diff --git a/drivers/scsi/qla2xxx/qla_mid.c b/drivers/scsi/qla2xxx/qla_mid.c
index 16a9f22bb860..9e8df452ee14 100644
--- a/drivers/scsi/qla2xxx/qla_mid.c
+++ b/drivers/scsi/qla2xxx/qla_mid.c
@@ -180,7 +180,7 @@ qla24xx_disable_vp(scsi_qla_host_t *vha)
atomic_set(&vha->loop_state, LOOP_DOWN);
atomic_set(&vha->loop_down_timer, LOOP_DOWN_TIME);
list_for_each_entry(fcport, &vha->vp_fcports, list)
- fcport->logout_on_delete = 0;
+ fcport->logout_on_delete = 1;
if (!vha->hw->flags.edif_enabled)
qla2x00_wait_for_sess_deletion(vha);
diff --git a/drivers/scsi/qla2xxx/qla_nvme.c b/drivers/scsi/qla2xxx/qla_nvme.c
index 9941b38eac93..622b11660b67 100644
--- a/drivers/scsi/qla2xxx/qla_nvme.c
+++ b/drivers/scsi/qla2xxx/qla_nvme.c
@@ -29,7 +29,10 @@ int qla_nvme_register_remote(struct scsi_qla_host *vha, struct fc_port *fcport)
return 0;
}
- if (!vha->nvme_local_port && qla_nvme_register_hba(vha))
+ if (qla_nvme_register_hba(vha))
+ return 0;
+
+ if (!vha->nvme_local_port)
return 0;
if (!(fcport->nvme_prli_service_param &
diff --git a/drivers/scsi/qla2xxx/qla_os.c b/drivers/scsi/qla2xxx/qla_os.c
index 25d0c2bfdd74..41a7ffaabfd1 100644
--- a/drivers/scsi/qla2xxx/qla_os.c
+++ b/drivers/scsi/qla2xxx/qla_os.c
@@ -1869,14 +1869,9 @@ __qla2x00_abort_all_cmds(struct qla_qpair *qp, int res)
for (cnt = 1; cnt < req->num_outstanding_cmds; cnt++) {
sp = req->outstanding_cmds[cnt];
if (sp) {
- /*
- * perform lockless completion during driver unload
- */
if (qla2x00_chip_is_down(vha)) {
req->outstanding_cmds[cnt] = NULL;
- spin_unlock_irqrestore(qp->qp_lock_ptr, flags);
sp->done(sp, res);
- spin_lock_irqsave(qp->qp_lock_ptr, flags);
continue;
}
@@ -4667,7 +4662,7 @@ static void
qla2x00_number_of_exch(scsi_qla_host_t *vha, u32 *ret_cnt, u16 max_cnt)
{
u32 temp;
- struct init_cb_81xx *icb = (struct init_cb_81xx *)&vha->hw->init_cb;
+ struct init_cb_81xx *icb = (struct init_cb_81xx *)vha->hw->init_cb;
*ret_cnt = FW_DEF_EXCHANGES_CNT;
if (max_cnt > vha->hw->max_exchg)
diff --git a/drivers/scsi/qla2xxx/qla_sup.c b/drivers/scsi/qla2xxx/qla_sup.c
index c092a6b1ced4..6d16546e1729 100644
--- a/drivers/scsi/qla2xxx/qla_sup.c
+++ b/drivers/scsi/qla2xxx/qla_sup.c
@@ -555,6 +555,7 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
struct qla_flt_location *fltl = (void *)req->ring;
uint32_t *dcode = (uint32_t *)req->ring;
uint8_t *buf = (void *)req->ring, *bcode, last_image;
+ int rc;
/*
* FLT-location structure resides after the last PCI region.
@@ -584,14 +585,24 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
pcihdr = 0;
do {
/* Verify PCI expansion ROM header. */
- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x016d,
+ "Unable to read PCI Expansion Rom Header (%x).\n", rc);
+ return QLA_FUNCTION_FAILED;
+ }
bcode = buf + (pcihdr % 4);
if (bcode[0x0] != 0x55 || bcode[0x1] != 0xaa)
goto end;
/* Locate PCI data structure. */
pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
- qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ rc = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x0179,
+ "Unable to read PCI Data Structure (%x).\n", rc);
+ return QLA_FUNCTION_FAILED;
+ }
bcode = buf + (pcihdr % 4);
/* Validate signature of PCI data structure. */
@@ -606,7 +617,12 @@ qla2xxx_find_flt_start(scsi_qla_host_t *vha, uint32_t *start)
} while (!last_image);
/* Now verify FLT-location structure. */
- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+ rc = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, sizeof(*fltl) >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x017a,
+ "Unable to read FLT (%x).\n", rc);
+ return QLA_FUNCTION_FAILED;
+ }
if (memcmp(fltl->sig, "QFLT", 4))
goto end;
@@ -2605,13 +2621,18 @@ qla24xx_read_optrom_data(struct scsi_qla_host *vha, void *buf,
uint32_t offset, uint32_t length)
{
struct qla_hw_data *ha = vha->hw;
+ int rc;
/* Suspend HBA. */
scsi_block_requests(vha->host);
set_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
/* Go with read. */
- qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+ rc = qla24xx_read_flash_data(vha, buf, offset >> 2, length >> 2);
+ if (rc) {
+ ql_log(ql_log_info, vha, 0x01a0,
+ "Unable to perform optrom read(%x).\n", rc);
+ }
/* Resume HBA. */
clear_bit(MBX_UPDATE_FLASH_ACTIVE, &ha->mbx_cmd_flags);
@@ -3412,7 +3433,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
struct active_regions active_regions = { };
if (IS_P3P_TYPE(ha))
- return ret;
+ return QLA_SUCCESS;
if (!mbuf)
return QLA_FUNCTION_FAILED;
@@ -3432,20 +3453,31 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
do {
/* Verify PCI expansion ROM header. */
- qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ ret = qla24xx_read_flash_data(vha, dcode, pcihdr >> 2, 0x20);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x017d,
+ "Unable to read PCI EXP Rom Header(%x).\n", ret);
+ return QLA_FUNCTION_FAILED;
+ }
+
bcode = mbuf + (pcihdr % 4);
if (memcmp(bcode, "\x55\xaa", 2)) {
/* No signature */
ql_log(ql_log_fatal, vha, 0x0059,
"No matching ROM signature.\n");
- ret = QLA_FUNCTION_FAILED;
- break;
+ return QLA_FUNCTION_FAILED;
}
/* Locate PCI data structure. */
pcids = pcihdr + ((bcode[0x19] << 8) | bcode[0x18]);
- qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ ret = qla24xx_read_flash_data(vha, dcode, pcids >> 2, 0x20);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x018e,
+ "Unable to read PCI Data Structure (%x).\n", ret);
+ return QLA_FUNCTION_FAILED;
+ }
+
bcode = mbuf + (pcihdr % 4);
/* Validate signature of PCI data structure. */
@@ -3454,8 +3486,7 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
ql_log(ql_log_fatal, vha, 0x005a,
"PCI data struct not found pcir_adr=%x.\n", pcids);
ql_dump_buffer(ql_dbg_init, vha, 0x0059, dcode, 32);
- ret = QLA_FUNCTION_FAILED;
- break;
+ return QLA_FUNCTION_FAILED;
}
/* Read version */
@@ -3507,20 +3538,26 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
faddr = ha->flt_region_fw_sec;
}
- qla24xx_read_flash_data(vha, dcode, faddr, 8);
- if (qla24xx_risc_firmware_invalid(dcode)) {
- ql_log(ql_log_warn, vha, 0x005f,
- "Unrecognized fw revision at %x.\n",
- ha->flt_region_fw * 4);
- ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+ ret = qla24xx_read_flash_data(vha, dcode, faddr, 8);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x019e,
+ "Unable to read FW version (%x).\n", ret);
+ return ret;
} else {
- for (i = 0; i < 4; i++)
- ha->fw_revision[i] =
+ if (qla24xx_risc_firmware_invalid(dcode)) {
+ ql_log(ql_log_warn, vha, 0x005f,
+ "Unrecognized fw revision at %x.\n",
+ ha->flt_region_fw * 4);
+ ql_dump_buffer(ql_dbg_init, vha, 0x005f, dcode, 32);
+ } else {
+ for (i = 0; i < 4; i++)
+ ha->fw_revision[i] =
be32_to_cpu((__force __be32)dcode[4+i]);
- ql_dbg(ql_dbg_init, vha, 0x0060,
- "Firmware revision (flash) %u.%u.%u (%x).\n",
- ha->fw_revision[0], ha->fw_revision[1],
- ha->fw_revision[2], ha->fw_revision[3]);
+ ql_dbg(ql_dbg_init, vha, 0x0060,
+ "Firmware revision (flash) %u.%u.%u (%x).\n",
+ ha->fw_revision[0], ha->fw_revision[1],
+ ha->fw_revision[2], ha->fw_revision[3]);
+ }
}
/* Check for golden firmware and get version if available */
@@ -3531,18 +3568,23 @@ qla24xx_get_flash_version(scsi_qla_host_t *vha, void *mbuf)
memset(ha->gold_fw_version, 0, sizeof(ha->gold_fw_version));
faddr = ha->flt_region_gold_fw;
- qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
- if (qla24xx_risc_firmware_invalid(dcode)) {
- ql_log(ql_log_warn, vha, 0x0056,
- "Unrecognized golden fw at %#x.\n", faddr);
- ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+ ret = qla24xx_read_flash_data(vha, dcode, ha->flt_region_gold_fw, 8);
+ if (ret) {
+ ql_log(ql_log_info, vha, 0x019f,
+ "Unable to read Gold FW version (%x).\n", ret);
return ret;
- }
-
- for (i = 0; i < 4; i++)
- ha->gold_fw_version[i] =
- be32_to_cpu((__force __be32)dcode[4+i]);
+ } else {
+ if (qla24xx_risc_firmware_invalid(dcode)) {
+ ql_log(ql_log_warn, vha, 0x0056,
+ "Unrecognized golden fw at %#x.\n", faddr);
+ ql_dump_buffer(ql_dbg_init, vha, 0x0056, dcode, 32);
+ return QLA_FUNCTION_FAILED;
+ }
+ for (i = 0; i < 4; i++)
+ ha->gold_fw_version[i] =
+ be32_to_cpu((__force __be32)dcode[4+i]);
+ }
return ret;
}
diff --git a/drivers/soc/qcom/pdr_interface.c b/drivers/soc/qcom/pdr_interface.c
index 0034af927b48..c7cd4daa10b0 100644
--- a/drivers/soc/qcom/pdr_interface.c
+++ b/drivers/soc/qcom/pdr_interface.c
@@ -76,12 +76,12 @@ static int pdr_locator_new_server(struct qmi_handle *qmi,
locator_hdl);
struct pdr_service *pds;
+ mutex_lock(&pdr->lock);
/* Create a local client port for QMI communication */
pdr->locator_addr.sq_family = AF_QIPCRTR;
pdr->locator_addr.sq_node = svc->node;
pdr->locator_addr.sq_port = svc->port;
- mutex_lock(&pdr->lock);
pdr->locator_init_complete = true;
mutex_unlock(&pdr->lock);
@@ -104,10 +104,10 @@ static void pdr_locator_del_server(struct qmi_handle *qmi,
mutex_lock(&pdr->lock);
pdr->locator_init_complete = false;
- mutex_unlock(&pdr->lock);
pdr->locator_addr.sq_node = 0;
pdr->locator_addr.sq_port = 0;
+ mutex_unlock(&pdr->lock);
}
static const struct qmi_ops pdr_locator_ops = {
@@ -365,12 +365,14 @@ static int pdr_get_domain_list(struct servreg_get_domain_list_req *req,
if (ret < 0)
return ret;
+ mutex_lock(&pdr->lock);
ret = qmi_send_request(&pdr->locator_hdl,
&pdr->locator_addr,
&txn, SERVREG_GET_DOMAIN_LIST_REQ,
SERVREG_GET_DOMAIN_LIST_REQ_MAX_LEN,
servreg_get_domain_list_req_ei,
req);
+ mutex_unlock(&pdr->lock);
if (ret < 0) {
qmi_txn_cancel(&txn);
return ret;
@@ -415,7 +417,7 @@ static int pdr_locate_service(struct pdr_handle *pdr, struct pdr_service *pds)
if (ret < 0)
goto out;
- for (i = domains_read; i < resp->domain_list_len; i++) {
+ for (i = 0; i < resp->domain_list_len; i++) {
entry = &resp->domain_list[i];
if (strnlen(entry->name, sizeof(entry->name)) == sizeof(entry->name))
diff --git a/drivers/soc/qcom/rpmh-rsc.c b/drivers/soc/qcom/rpmh-rsc.c
index 5e7bb6338707..ff2b9eb9f669 100644
--- a/drivers/soc/qcom/rpmh-rsc.c
+++ b/drivers/soc/qcom/rpmh-rsc.c
@@ -608,13 +608,14 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
{
struct tcs_group *tcs;
int tcs_id;
- unsigned long flags;
+
+ might_sleep();
tcs = get_tcs_for_msg(drv, msg);
if (IS_ERR(tcs))
return PTR_ERR(tcs);
- spin_lock_irqsave(&drv->lock, flags);
+ spin_lock_irq(&drv->lock);
/* Wait forever for a free tcs. It better be there eventually! */
wait_event_lock_irq(drv->tcs_wait,
@@ -632,7 +633,7 @@ int rpmh_rsc_send_data(struct rsc_drv *drv, const struct tcs_request *msg)
write_tcs_reg_sync(drv, RSC_DRV_CMD_ENABLE, tcs_id, 0);
enable_tcs_irq(drv, tcs_id, true);
}
- spin_unlock_irqrestore(&drv->lock, flags);
+ spin_unlock_irq(&drv->lock);
/*
* These two can be done after the lock is released because:
diff --git a/drivers/soc/qcom/rpmh.c b/drivers/soc/qcom/rpmh.c
index 01765ee9cdfb..c6df7ac0afeb 100644
--- a/drivers/soc/qcom/rpmh.c
+++ b/drivers/soc/qcom/rpmh.c
@@ -189,7 +189,6 @@ static int __rpmh_write(const struct device *dev, enum rpmh_state state,
}
if (state == RPMH_ACTIVE_ONLY_STATE) {
- WARN_ON(irqs_disabled());
ret = rpmh_rsc_send_data(ctrlr_to_drv(ctrlr), &rpm_msg->msg);
} else {
/* Clean up our call by spoofing tx_done */
diff --git a/drivers/soc/xilinx/xlnx_event_manager.c b/drivers/soc/xilinx/xlnx_event_manager.c
index 8293cc40047f..82e317474023 100644
--- a/drivers/soc/xilinx/xlnx_event_manager.c
+++ b/drivers/soc/xilinx/xlnx_event_manager.c
@@ -3,6 +3,7 @@
* Xilinx Event Management Driver
*
* Copyright (C) 2021 Xilinx, Inc.
+ * Copyright (C) 2024 Advanced Micro Devices, Inc.
*
* Abhyuday Godhasara <abhyuday.godhasara@xilinx.com>
*/
@@ -19,7 +20,7 @@
#include <linux/platform_device.h>
#include <linux/slab.h>
-static DEFINE_PER_CPU_READ_MOSTLY(int, cpu_number1);
+static DEFINE_PER_CPU_READ_MOSTLY(int, dummy_cpu_number);
static int virq_sgi;
static int event_manager_availability = -EACCES;
@@ -555,7 +556,6 @@ static void xlnx_disable_percpu_irq(void *data)
static int xlnx_event_init_sgi(struct platform_device *pdev)
{
int ret = 0;
- int cpu;
/*
* IRQ related structures are used for the following:
* for each SGI interrupt ensure its mapped by GIC IRQ domain
@@ -592,11 +592,8 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
sgi_fwspec.param[0] = sgi_num;
virq_sgi = irq_create_fwspec_mapping(&sgi_fwspec);
- cpu = get_cpu();
- per_cpu(cpu_number1, cpu) = cpu;
ret = request_percpu_irq(virq_sgi, xlnx_event_handler, "xlnx_event_mgmt",
- &cpu_number1);
- put_cpu();
+ &dummy_cpu_number);
WARN_ON(ret);
if (ret) {
@@ -612,16 +609,12 @@ static int xlnx_event_init_sgi(struct platform_device *pdev)
static void xlnx_event_cleanup_sgi(struct platform_device *pdev)
{
- int cpu = smp_processor_id();
-
- per_cpu(cpu_number1, cpu) = cpu;
-
cpuhp_remove_state(CPUHP_AP_ONLINE_DYN);
on_each_cpu(xlnx_disable_percpu_irq, NULL, 1);
irq_clear_status_flags(virq_sgi, IRQ_PER_CPU);
- free_percpu_irq(virq_sgi, &cpu_number1);
+ free_percpu_irq(virq_sgi, &dummy_cpu_number);
irq_dispose_mapping(virq_sgi);
}
diff --git a/drivers/soc/xilinx/zynqmp_power.c b/drivers/soc/xilinx/zynqmp_power.c
index 78a8a7545d1e..5d41763414ad 100644
--- a/drivers/soc/xilinx/zynqmp_power.c
+++ b/drivers/soc/xilinx/zynqmp_power.c
@@ -187,7 +187,9 @@ static int zynqmp_pm_probe(struct platform_device *pdev)
u32 pm_api_version;
struct mbox_client *client;
- zynqmp_pm_get_api_version(&pm_api_version);
+ ret = zynqmp_pm_get_api_version(&pm_api_version);
+ if (ret)
+ return ret;
/* Check PM API version number */
if (pm_api_version < ZYNQMP_PM_VERSION)
diff --git a/drivers/spi/atmel-quadspi.c b/drivers/spi/atmel-quadspi.c
index 7e05b48dbd71..1f1aee28b1f7 100644
--- a/drivers/spi/atmel-quadspi.c
+++ b/drivers/spi/atmel-quadspi.c
@@ -724,8 +724,15 @@ static int __maybe_unused atmel_qspi_resume(struct device *dev)
struct atmel_qspi *aq = spi_controller_get_devdata(ctrl);
int ret;
- clk_prepare(aq->pclk);
- clk_prepare(aq->qspick);
+ ret = clk_prepare(aq->pclk);
+ if (ret)
+ return ret;
+
+ ret = clk_prepare(aq->qspick);
+ if (ret) {
+ clk_unprepare(aq->pclk);
+ return ret;
+ }
ret = pm_runtime_force_resume(dev);
if (ret < 0)
diff --git a/drivers/spi/spi-microchip-core.c b/drivers/spi/spi-microchip-core.c
index d352844c798c..bfad0fe743ad 100644
--- a/drivers/spi/spi-microchip-core.c
+++ b/drivers/spi/spi-microchip-core.c
@@ -21,7 +21,7 @@
#include <linux/spi/spi.h>
#define MAX_LEN (0xffff)
-#define MAX_CS (8)
+#define MAX_CS (1)
#define DEFAULT_FRAMESIZE (8)
#define FIFO_DEPTH (32)
#define CLK_GEN_MODE1_MAX (255)
@@ -75,6 +75,7 @@
#define REG_CONTROL (0x00)
#define REG_FRAME_SIZE (0x04)
+#define FRAME_SIZE_MASK GENMASK(5, 0)
#define REG_STATUS (0x08)
#define REG_INT_CLEAR (0x0c)
#define REG_RX_DATA (0x10)
@@ -89,6 +90,7 @@
#define REG_RIS (0x24)
#define REG_CONTROL2 (0x28)
#define REG_COMMAND (0x2c)
+#define COMMAND_CLRFRAMECNT BIT(4)
#define REG_PKTSIZE (0x30)
#define REG_CMD_SIZE (0x34)
#define REG_HWSTATUS (0x38)
@@ -157,62 +159,59 @@ static inline void mchp_corespi_read_fifo(struct mchp_corespi *spi)
static void mchp_corespi_enable_ints(struct mchp_corespi *spi)
{
- u32 control, mask = INT_ENABLE_MASK;
-
- mchp_corespi_disable(spi);
-
- control = mchp_corespi_read(spi, REG_CONTROL);
-
- control |= mask;
- mchp_corespi_write(spi, REG_CONTROL, control);
+ u32 control = mchp_corespi_read(spi, REG_CONTROL);
- control |= CONTROL_ENABLE;
+ control |= INT_ENABLE_MASK;
mchp_corespi_write(spi, REG_CONTROL, control);
}
static void mchp_corespi_disable_ints(struct mchp_corespi *spi)
{
- u32 control, mask = INT_ENABLE_MASK;
-
- mchp_corespi_disable(spi);
-
- control = mchp_corespi_read(spi, REG_CONTROL);
- control &= ~mask;
- mchp_corespi_write(spi, REG_CONTROL, control);
+ u32 control = mchp_corespi_read(spi, REG_CONTROL);
- control |= CONTROL_ENABLE;
+ control &= ~INT_ENABLE_MASK;
mchp_corespi_write(spi, REG_CONTROL, control);
}
static inline void mchp_corespi_set_xfer_size(struct mchp_corespi *spi, int len)
{
u32 control;
- u16 lenpart;
+ u32 lenpart;
+ u32 frames = mchp_corespi_read(spi, REG_FRAMESUP);
/*
- * Disable the SPI controller. Writes to transfer length have
- * no effect when the controller is enabled.
+ * Writing to FRAMECNT in REG_CONTROL will reset the frame count, taking
+ * a shortcut requires an explicit clear.
*/
- mchp_corespi_disable(spi);
+ if (frames == len) {
+ mchp_corespi_write(spi, REG_COMMAND, COMMAND_CLRFRAMECNT);
+ return;
+ }
/*
* The lower 16 bits of the frame count are stored in the control reg
* for legacy reasons, but the upper 16 written to a different register:
* FRAMESUP. While both the upper and lower bits can be *READ* from the
- * FRAMESUP register, writing to the lower 16 bits is a NOP
+ * FRAMESUP register, writing to the lower 16 bits is (supposedly) a NOP.
+ *
+ * The driver used to disable the controller while modifying the frame
+ * count, and mask off the lower 16 bits of len while writing to
+ * FRAMES_UP. When the driver was changed to disable the controller as
+ * infrequently as possible, it was discovered that the logic of
+ * lenpart = len & 0xffff_0000
+ * write(REG_FRAMESUP, lenpart)
+ * would actually write zeros into the lower 16 bits on an mpfs250t-es,
+ * despite documentation stating these bits were read-only.
+ * Writing len unmasked into FRAMES_UP ensures those bits aren't zeroed
+ * on an mpfs250t-es and will be a NOP for the lower 16 bits on hardware
+ * that matches the documentation.
*/
lenpart = len & 0xffff;
-
control = mchp_corespi_read(spi, REG_CONTROL);
control &= ~CONTROL_FRAMECNT_MASK;
control |= lenpart << CONTROL_FRAMECNT_SHIFT;
mchp_corespi_write(spi, REG_CONTROL, control);
-
- lenpart = len & 0xffff0000;
- mchp_corespi_write(spi, REG_FRAMESUP, lenpart);
-
- control |= CONTROL_ENABLE;
- mchp_corespi_write(spi, REG_CONTROL, control);
+ mchp_corespi_write(spi, REG_FRAMESUP, len);
}
static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
@@ -235,17 +234,22 @@ static inline void mchp_corespi_write_fifo(struct mchp_corespi *spi)
static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
{
+ u32 frame_size = mchp_corespi_read(spi, REG_FRAME_SIZE);
u32 control;
+ if ((frame_size & FRAME_SIZE_MASK) == bt)
+ return;
+
/*
* Disable the SPI controller. Writes to the frame size have
* no effect when the controller is enabled.
*/
- mchp_corespi_disable(spi);
+ control = mchp_corespi_read(spi, REG_CONTROL);
+ control &= ~CONTROL_ENABLE;
+ mchp_corespi_write(spi, REG_CONTROL, control);
mchp_corespi_write(spi, REG_FRAME_SIZE, bt);
- control = mchp_corespi_read(spi, REG_CONTROL);
control |= CONTROL_ENABLE;
mchp_corespi_write(spi, REG_CONTROL, control);
}
@@ -253,7 +257,7 @@ static inline void mchp_corespi_set_framesize(struct mchp_corespi *spi, int bt)
static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
{
u32 reg;
- struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+ struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
reg = mchp_corespi_read(corespi, REG_SLAVE_SELECT);
reg &= ~BIT(spi->chip_select);
@@ -264,11 +268,11 @@ static void mchp_corespi_set_cs(struct spi_device *spi, bool disable)
static int mchp_corespi_setup(struct spi_device *spi)
{
- struct mchp_corespi *corespi = spi_master_get_devdata(spi->master);
+ struct mchp_corespi *corespi = spi_controller_get_devdata(spi->controller);
u32 reg;
/*
- * Active high slaves need to be specifically set to their inactive
+ * Active high targets need to be specifically set to their inactive
* states during probe by adding them to the "control group" & thus
* driving their select line low.
*/
@@ -280,22 +284,18 @@ static int mchp_corespi_setup(struct spi_device *spi)
return 0;
}
-static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *spi)
+static void mchp_corespi_init(struct spi_controller *host, struct mchp_corespi *spi)
{
unsigned long clk_hz;
u32 control = mchp_corespi_read(spi, REG_CONTROL);
- control |= CONTROL_MASTER;
+ control &= ~CONTROL_ENABLE;
+ mchp_corespi_write(spi, REG_CONTROL, control);
+ control |= CONTROL_MASTER;
control &= ~CONTROL_MODE_MASK;
control |= MOTOROLA_MODE;
- mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
-
- /* max. possible spi clock rate is the apb clock rate */
- clk_hz = clk_get_rate(spi->clk);
- master->max_speed_hz = clk_hz;
-
/*
* The controller must be configured so that it doesn't remove Chip
* Select until the entire message has been transferred, even if at
@@ -304,17 +304,22 @@ static void mchp_corespi_init(struct spi_master *master, struct mchp_corespi *sp
* BIGFIFO mode is also enabled, which sets the fifo depth to 32 frames
* for the 8 bit transfers that this driver uses.
*/
- control = mchp_corespi_read(spi, REG_CONTROL);
control |= CONTROL_SPS | CONTROL_BIGFIFO;
mchp_corespi_write(spi, REG_CONTROL, control);
+ mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
+
+ /* max. possible spi clock rate is the apb clock rate */
+ clk_hz = clk_get_rate(spi->clk);
+ host->max_speed_hz = clk_hz;
+
mchp_corespi_enable_ints(spi);
/*
* It is required to enable direct mode, otherwise control over the chip
* select is relinquished to the hardware. SSELOUT is enabled too so we
- * can deal with active high slaves.
+ * can deal with active high targets.
*/
mchp_corespi_write(spi, REG_SLAVE_SELECT, SSELOUT | SSEL_DIRECT);
@@ -330,8 +335,6 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
{
u32 control;
- mchp_corespi_disable(spi);
-
control = mchp_corespi_read(spi, REG_CONTROL);
if (spi->clk_mode)
control |= CONTROL_CLKMODE;
@@ -340,12 +343,12 @@ static inline void mchp_corespi_set_clk_gen(struct mchp_corespi *spi)
mchp_corespi_write(spi, REG_CLK_GEN, spi->clk_gen);
mchp_corespi_write(spi, REG_CONTROL, control);
- mchp_corespi_write(spi, REG_CONTROL, control | CONTROL_ENABLE);
}
static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int mode)
{
- u32 control, mode_val;
+ u32 mode_val;
+ u32 control = mchp_corespi_read(spi, REG_CONTROL);
switch (mode & SPI_MODE_X_MASK) {
case SPI_MODE_0:
@@ -363,12 +366,13 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
}
/*
- * Disable the SPI controller. Writes to the frame size have
+ * Disable the SPI controller. Writes to the frame protocol have
* no effect when the controller is enabled.
*/
- mchp_corespi_disable(spi);
- control = mchp_corespi_read(spi, REG_CONTROL);
+ control &= ~CONTROL_ENABLE;
+ mchp_corespi_write(spi, REG_CONTROL, control);
+
control &= ~(SPI_MODE_X_MASK << MODE_X_MASK_SHIFT);
control |= mode_val;
@@ -380,8 +384,8 @@ static inline void mchp_corespi_set_mode(struct mchp_corespi *spi, unsigned int
static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
{
- struct spi_master *master = dev_id;
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct spi_controller *host = dev_id;
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
u32 intfield = mchp_corespi_read(spi, REG_MIS) & 0xf;
bool finalise = false;
@@ -389,26 +393,23 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
if (intfield == 0)
return IRQ_NONE;
- if (intfield & INT_TXDONE) {
+ if (intfield & INT_TXDONE)
mchp_corespi_write(spi, REG_INT_CLEAR, INT_TXDONE);
+ if (intfield & INT_RXRDY) {
+ mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+
if (spi->rx_len)
mchp_corespi_read_fifo(spi);
-
- if (spi->tx_len)
- mchp_corespi_write_fifo(spi);
-
- if (!spi->rx_len)
- finalise = true;
}
- if (intfield & INT_RXRDY)
- mchp_corespi_write(spi, REG_INT_CLEAR, INT_RXRDY);
+ if (!spi->rx_len && !spi->tx_len)
+ finalise = true;
if (intfield & INT_RX_CHANNEL_OVERFLOW) {
mchp_corespi_write(spi, REG_INT_CLEAR, INT_RX_CHANNEL_OVERFLOW);
finalise = true;
- dev_err(&master->dev,
+ dev_err(&host->dev,
"%s: RX OVERFLOW: rxlen: %d, txlen: %d\n", __func__,
spi->rx_len, spi->tx_len);
}
@@ -416,13 +417,13 @@ static irqreturn_t mchp_corespi_interrupt(int irq, void *dev_id)
if (intfield & INT_TX_CHANNEL_UNDERRUN) {
mchp_corespi_write(spi, REG_INT_CLEAR, INT_TX_CHANNEL_UNDERRUN);
finalise = true;
- dev_err(&master->dev,
+ dev_err(&host->dev,
"%s: TX UNDERFLOW: rxlen: %d, txlen: %d\n", __func__,
spi->rx_len, spi->tx_len);
}
if (finalise)
- spi_finalize_current_transfer(master);
+ spi_finalize_current_transfer(host);
return IRQ_HANDLED;
}
@@ -464,16 +465,16 @@ static int mchp_corespi_calculate_clkgen(struct mchp_corespi *spi,
return 0;
}
-static int mchp_corespi_transfer_one(struct spi_master *master,
+static int mchp_corespi_transfer_one(struct spi_controller *host,
struct spi_device *spi_dev,
struct spi_transfer *xfer)
{
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
int ret;
ret = mchp_corespi_calculate_clkgen(spi, (unsigned long)xfer->speed_hz);
if (ret) {
- dev_err(&master->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
+ dev_err(&host->dev, "failed to set clk_gen for target %u Hz\n", xfer->speed_hz);
return ret;
}
@@ -488,16 +489,17 @@ static int mchp_corespi_transfer_one(struct spi_master *master,
mchp_corespi_set_xfer_size(spi, (spi->tx_len > FIFO_DEPTH)
? FIFO_DEPTH : spi->tx_len);
- if (spi->tx_len)
+ while (spi->tx_len)
mchp_corespi_write_fifo(spi);
+
return 1;
}
-static int mchp_corespi_prepare_message(struct spi_master *master,
+static int mchp_corespi_prepare_message(struct spi_controller *host,
struct spi_message *msg)
{
struct spi_device *spi_dev = msg->spi;
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
mchp_corespi_set_framesize(spi, DEFAULT_FRAMESIZE);
mchp_corespi_set_mode(spi, spi_dev->mode);
@@ -507,32 +509,32 @@ static int mchp_corespi_prepare_message(struct spi_master *master,
static int mchp_corespi_probe(struct platform_device *pdev)
{
- struct spi_master *master;
+ struct spi_controller *host;
struct mchp_corespi *spi;
struct resource *res;
u32 num_cs;
int ret = 0;
- master = devm_spi_alloc_master(&pdev->dev, sizeof(*spi));
- if (!master)
+ host = devm_spi_alloc_host(&pdev->dev, sizeof(*spi));
+ if (!host)
return dev_err_probe(&pdev->dev, -ENOMEM,
- "unable to allocate master for SPI controller\n");
+ "unable to allocate host for SPI controller\n");
- platform_set_drvdata(pdev, master);
+ platform_set_drvdata(pdev, host);
if (of_property_read_u32(pdev->dev.of_node, "num-cs", &num_cs))
num_cs = MAX_CS;
- master->num_chipselect = num_cs;
- master->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
- master->setup = mchp_corespi_setup;
- master->bits_per_word_mask = SPI_BPW_MASK(8);
- master->transfer_one = mchp_corespi_transfer_one;
- master->prepare_message = mchp_corespi_prepare_message;
- master->set_cs = mchp_corespi_set_cs;
- master->dev.of_node = pdev->dev.of_node;
+ host->num_chipselect = num_cs;
+ host->mode_bits = SPI_CPOL | SPI_CPHA | SPI_CS_HIGH;
+ host->setup = mchp_corespi_setup;
+ host->bits_per_word_mask = SPI_BPW_MASK(8);
+ host->transfer_one = mchp_corespi_transfer_one;
+ host->prepare_message = mchp_corespi_prepare_message;
+ host->set_cs = mchp_corespi_set_cs;
+ host->dev.of_node = pdev->dev.of_node;
- spi = spi_master_get_devdata(master);
+ spi = spi_controller_get_devdata(host);
spi->regs = devm_platform_get_and_ioremap_resource(pdev, 0, &res);
if (IS_ERR(spi->regs))
@@ -545,7 +547,7 @@ static int mchp_corespi_probe(struct platform_device *pdev)
spi->irq);
ret = devm_request_irq(&pdev->dev, spi->irq, mchp_corespi_interrupt,
- IRQF_SHARED, dev_name(&pdev->dev), master);
+ IRQF_SHARED, dev_name(&pdev->dev), host);
if (ret)
return dev_err_probe(&pdev->dev, ret,
"could not request irq\n");
@@ -560,25 +562,25 @@ static int mchp_corespi_probe(struct platform_device *pdev)
return dev_err_probe(&pdev->dev, ret,
"failed to enable clock\n");
- mchp_corespi_init(master, spi);
+ mchp_corespi_init(host, spi);
- ret = devm_spi_register_master(&pdev->dev, master);
+ ret = devm_spi_register_controller(&pdev->dev, host);
if (ret) {
mchp_corespi_disable(spi);
clk_disable_unprepare(spi->clk);
return dev_err_probe(&pdev->dev, ret,
- "unable to register master for SPI controller\n");
+ "unable to register host for SPI controller\n");
}
- dev_info(&pdev->dev, "Registered SPI controller %d\n", master->bus_num);
+ dev_info(&pdev->dev, "Registered SPI controller %d\n", host->bus_num);
return 0;
}
static int mchp_corespi_remove(struct platform_device *pdev)
{
- struct spi_master *master = platform_get_drvdata(pdev);
- struct mchp_corespi *spi = spi_master_get_devdata(master);
+ struct spi_controller *host = platform_get_drvdata(pdev);
+ struct mchp_corespi *spi = spi_controller_get_devdata(host);
mchp_corespi_disable_ints(spi);
clk_disable_unprepare(spi->clk);
diff --git a/drivers/spi/spidev.c b/drivers/spi/spidev.c
index 71c3db60e968..00612efc2277 100644
--- a/drivers/spi/spidev.c
+++ b/drivers/spi/spidev.c
@@ -700,6 +700,7 @@ static const struct spi_device_id spidev_spi_ids[] = {
{ .name = "m53cpld" },
{ .name = "spi-petra" },
{ .name = "spi-authenta" },
+ { .name = "em3581" },
{},
};
MODULE_DEVICE_TABLE(spi, spidev_spi_ids);
@@ -718,14 +719,16 @@ static int spidev_of_check(struct device *dev)
}
static const struct of_device_id spidev_dt_ids[] = {
- { .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
+ { .compatible = "cisco,spi-petra", .data = &spidev_of_check },
+ { .compatible = "dh,dhcom-board", .data = &spidev_of_check },
{ .compatible = "lineartechnology,ltc2488", .data = &spidev_of_check },
- { .compatible = "semtech,sx1301", .data = &spidev_of_check },
{ .compatible = "lwn,bk4", .data = &spidev_of_check },
- { .compatible = "dh,dhcom-board", .data = &spidev_of_check },
{ .compatible = "menlo,m53cpld", .data = &spidev_of_check },
- { .compatible = "cisco,spi-petra", .data = &spidev_of_check },
{ .compatible = "micron,spi-authenta", .data = &spidev_of_check },
+ { .compatible = "rohm,bh2228fv", .data = &spidev_of_check },
+ { .compatible = "rohm,dh2228fv", .data = &spidev_of_check },
+ { .compatible = "semtech,sx1301", .data = &spidev_of_check },
+ { .compatible = "silabs,em3581", .data = &spidev_of_check },
{},
};
MODULE_DEVICE_TABLE(of, spidev_dt_ids);
diff --git a/drivers/vhost/vsock.c b/drivers/vhost/vsock.c
index 1f3b89c885cc..c00f5821d6ec 100644
--- a/drivers/vhost/vsock.c
+++ b/drivers/vhost/vsock.c
@@ -654,6 +654,7 @@ static int vhost_vsock_dev_open(struct inode *inode, struct file *file)
}
vsock->guest_cid = 0; /* no CID assigned yet */
+ vsock->seqpacket_allow = false;
atomic_set(&vsock->queued_replies, 0);
@@ -797,8 +798,7 @@ static int vhost_vsock_set_features(struct vhost_vsock *vsock, u64 features)
goto err;
}
- if (features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET))
- vsock->seqpacket_allow = true;
+ vsock->seqpacket_allow = features & (1ULL << VIRTIO_VSOCK_F_SEQPACKET);
for (i = 0; i < ARRAY_SIZE(vsock->vqs); i++) {
vq = &vsock->vqs[i];
diff --git a/drivers/watchdog/rzg2l_wdt.c b/drivers/watchdog/rzg2l_wdt.c
index d404953d0e0f..9b2698a4fc1a 100644
--- a/drivers/watchdog/rzg2l_wdt.c
+++ b/drivers/watchdog/rzg2l_wdt.c
@@ -123,8 +123,11 @@ static void rzg2l_wdt_init_timeout(struct watchdog_device *wdev)
static int rzg2l_wdt_start(struct watchdog_device *wdev)
{
struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+ int ret;
- pm_runtime_get_sync(wdev->parent);
+ ret = pm_runtime_resume_and_get(wdev->parent);
+ if (ret)
+ return ret;
/* Initialize time out */
rzg2l_wdt_init_timeout(wdev);
@@ -141,15 +144,21 @@ static int rzg2l_wdt_start(struct watchdog_device *wdev)
static int rzg2l_wdt_stop(struct watchdog_device *wdev)
{
struct rzg2l_wdt_priv *priv = watchdog_get_drvdata(wdev);
+ int ret;
rzg2l_wdt_reset(priv);
- pm_runtime_put(wdev->parent);
+
+ ret = pm_runtime_put(wdev->parent);
+ if (ret < 0)
+ return ret;
return 0;
}
static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int timeout)
{
+ int ret = 0;
+
wdev->timeout = timeout;
/*
@@ -158,11 +167,14 @@ static int rzg2l_wdt_set_timeout(struct watchdog_device *wdev, unsigned int time
* to reset the module) so that it is updated with new timeout values.
*/
if (watchdog_active(wdev)) {
- rzg2l_wdt_stop(wdev);
- rzg2l_wdt_start(wdev);
+ ret = rzg2l_wdt_stop(wdev);
+ if (ret)
+ return ret;
+
+ ret = rzg2l_wdt_start(wdev);
}
- return 0;
+ return ret;
}
static int rzg2l_wdt_restart(struct watchdog_device *wdev,
diff --git a/fs/ceph/super.c b/fs/ceph/super.c
index 281b493fdac8..aa75aa796e43 100644
--- a/fs/ceph/super.c
+++ b/fs/ceph/super.c
@@ -924,7 +924,8 @@ static int __init init_caches(void)
if (!ceph_mds_request_cachep)
goto bad_mds_req;
- ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10, CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT);
+ ceph_wb_pagevec_pool = mempool_create_kmalloc_pool(10,
+ (CEPH_MAX_WRITE_SIZE >> PAGE_SHIFT) * sizeof(struct page *));
if (!ceph_wb_pagevec_pool)
goto bad_pagevec_pool;
diff --git a/fs/ext2/balloc.c b/fs/ext2/balloc.c
index 5dc0a31f4a08..d2eb4d291985 100644
--- a/fs/ext2/balloc.c
+++ b/fs/ext2/balloc.c
@@ -79,26 +79,33 @@ static int ext2_valid_block_bitmap(struct super_block *sb,
ext2_grpblk_t next_zero_bit;
ext2_fsblk_t bitmap_blk;
ext2_fsblk_t group_first_block;
+ ext2_grpblk_t max_bit;
group_first_block = ext2_group_first_block_no(sb, block_group);
+ max_bit = ext2_group_last_block_no(sb, block_group) - group_first_block;
/* check whether block bitmap block number is set */
bitmap_blk = le32_to_cpu(desc->bg_block_bitmap);
offset = bitmap_blk - group_first_block;
- if (!ext2_test_bit(offset, bh->b_data))
+ if (offset < 0 || offset > max_bit ||
+ !ext2_test_bit(offset, bh->b_data))
/* bad block bitmap */
goto err_out;
/* check whether the inode bitmap block number is set */
bitmap_blk = le32_to_cpu(desc->bg_inode_bitmap);
offset = bitmap_blk - group_first_block;
- if (!ext2_test_bit(offset, bh->b_data))
+ if (offset < 0 || offset > max_bit ||
+ !ext2_test_bit(offset, bh->b_data))
/* bad block bitmap */
goto err_out;
/* check whether the inode table block number is set */
bitmap_blk = le32_to_cpu(desc->bg_inode_table);
offset = bitmap_blk - group_first_block;
+ if (offset < 0 || offset > max_bit ||
+ offset + EXT2_SB(sb)->s_itb_per_group - 1 > max_bit)
+ goto err_out;
next_zero_bit = ext2_find_next_zero_bit(bh->b_data,
offset + EXT2_SB(sb)->s_itb_per_group,
offset);
diff --git a/fs/ext4/extents_status.c b/fs/ext4/extents_status.c
index 470d29fb407a..9766d3b21ca2 100644
--- a/fs/ext4/extents_status.c
+++ b/fs/ext4/extents_status.c
@@ -312,6 +312,8 @@ void ext4_es_find_extent_range(struct inode *inode,
ext4_lblk_t lblk, ext4_lblk_t end,
struct extent_status *es)
{
+ es->es_lblk = es->es_len = es->es_pblk = 0;
+
if (EXT4_SB(inode->i_sb)->s_mount_state & EXT4_FC_REPLAY)
return;
diff --git a/fs/ext4/fast_commit.c b/fs/ext4/fast_commit.c
index 1110bfa0a5b7..19353a2f44bb 100644
--- a/fs/ext4/fast_commit.c
+++ b/fs/ext4/fast_commit.c
@@ -649,6 +649,12 @@ void ext4_fc_track_range(handle_t *handle, struct inode *inode, ext4_lblk_t star
if (ext4_test_mount_flag(inode->i_sb, EXT4_MF_FC_INELIGIBLE))
return;
+ if (ext4_has_inline_data(inode)) {
+ ext4_fc_mark_ineligible(inode->i_sb, EXT4_FC_REASON_XATTR,
+ handle);
+ return;
+ }
+
args.start = start;
args.end = end;
diff --git a/fs/ext4/namei.c b/fs/ext4/namei.c
index 8b1383223848..173f46fa1068 100644
--- a/fs/ext4/namei.c
+++ b/fs/ext4/namei.c
@@ -151,10 +151,11 @@ static struct buffer_head *__ext4_read_dirblock(struct inode *inode,
return bh;
}
- if (!bh && (type == INDEX || type == DIRENT_HTREE)) {
+ /* The first directory block must not be a hole. */
+ if (!bh && (type == INDEX || type == DIRENT_HTREE || block == 0)) {
ext4_error_inode(inode, func, line, block,
- "Directory hole found for htree %s block",
- (type == INDEX) ? "index" : "leaf");
+ "Directory hole found for htree %s block %u",
+ (type == INDEX) ? "index" : "leaf", block);
return ERR_PTR(-EFSCORRUPTED);
}
if (!bh)
@@ -2218,6 +2219,52 @@ static int add_dirent_to_buf(handle_t *handle, struct ext4_filename *fname,
return err ? err : err2;
}
+static bool ext4_check_dx_root(struct inode *dir, struct dx_root *root)
+{
+ struct fake_dirent *fde;
+ const char *error_msg;
+ unsigned int rlen;
+ unsigned int blocksize = dir->i_sb->s_blocksize;
+ char *blockend = (char *)root + dir->i_sb->s_blocksize;
+
+ fde = &root->dot;
+ if (unlikely(fde->name_len != 1)) {
+ error_msg = "invalid name_len for '.'";
+ goto corrupted;
+ }
+ if (unlikely(strncmp(root->dot_name, ".", fde->name_len))) {
+ error_msg = "invalid name for '.'";
+ goto corrupted;
+ }
+ rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+ if (unlikely((char *)fde + rlen >= blockend)) {
+ error_msg = "invalid rec_len for '.'";
+ goto corrupted;
+ }
+
+ fde = &root->dotdot;
+ if (unlikely(fde->name_len != 2)) {
+ error_msg = "invalid name_len for '..'";
+ goto corrupted;
+ }
+ if (unlikely(strncmp(root->dotdot_name, "..", fde->name_len))) {
+ error_msg = "invalid name for '..'";
+ goto corrupted;
+ }
+ rlen = ext4_rec_len_from_disk(fde->rec_len, blocksize);
+ if (unlikely((char *)fde + rlen >= blockend)) {
+ error_msg = "invalid rec_len for '..'";
+ goto corrupted;
+ }
+
+ return true;
+
+corrupted:
+ EXT4_ERROR_INODE(dir, "Corrupt dir, %s, running e2fsck is recommended",
+ error_msg);
+ return false;
+}
+
/*
* This converts a one block unindexed directory to a 3 block indexed
* directory, and adds the dentry to the indexed directory.
@@ -2252,17 +2299,17 @@ static int make_indexed_dir(handle_t *handle, struct ext4_filename *fname,
brelse(bh);
return retval;
}
+
root = (struct dx_root *) bh->b_data;
+ if (!ext4_check_dx_root(dir, root)) {
+ brelse(bh);
+ return -EFSCORRUPTED;
+ }
/* The 0th block becomes the root, move the dirents out */
fde = &root->dotdot;
de = (struct ext4_dir_entry_2 *)((char *)fde +
ext4_rec_len_from_disk(fde->rec_len, blocksize));
- if ((char *) de >= (((char *) root) + blocksize)) {
- EXT4_ERROR_INODE(dir, "invalid rec_len for '..'");
- brelse(bh);
- return -EFSCORRUPTED;
- }
len = ((char *) root) + (blocksize - csum_size) - (char *) de;
/* Allocate new block for the 0th block's dirents */
@@ -3087,10 +3134,7 @@ bool ext4_empty_dir(struct inode *inode)
EXT4_ERROR_INODE(inode, "invalid size");
return false;
}
- /* The first directory block must not be a hole,
- * so treat it as DIRENT_HTREE
- */
- bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+ bh = ext4_read_dirblock(inode, 0, EITHER);
if (IS_ERR(bh))
return false;
@@ -3534,10 +3578,7 @@ static struct buffer_head *ext4_get_first_dir_block(handle_t *handle,
struct ext4_dir_entry_2 *de;
unsigned int offset;
- /* The first directory block must not be a hole, so
- * treat it as DIRENT_HTREE
- */
- bh = ext4_read_dirblock(inode, 0, DIRENT_HTREE);
+ bh = ext4_read_dirblock(inode, 0, EITHER);
if (IS_ERR(bh)) {
*retval = PTR_ERR(bh);
return NULL;
diff --git a/fs/ext4/xattr.c b/fs/ext4/xattr.c
index 28d00ed833db..f0a45d3ec4eb 100644
--- a/fs/ext4/xattr.c
+++ b/fs/ext4/xattr.c
@@ -1384,6 +1384,12 @@ static int ext4_xattr_inode_write(handle_t *handle, struct inode *ea_inode,
goto out;
memcpy(bh->b_data, buf, csize);
+ /*
+ * Zero out block tail to avoid writing uninitialized memory
+ * to disk.
+ */
+ if (csize < blocksize)
+ memset(bh->b_data + csize, 0, blocksize - csize);
set_buffer_uptodate(bh);
ext4_handle_dirty_metadata(handle, ea_inode, bh);
diff --git a/fs/f2fs/checkpoint.c b/fs/f2fs/checkpoint.c
index 13d877470675..ad4073cde397 100644
--- a/fs/f2fs/checkpoint.c
+++ b/fs/f2fs/checkpoint.c
@@ -1178,6 +1178,11 @@ static void __prepare_cp_block(struct f2fs_sb_info *sbi)
ckpt->valid_node_count = cpu_to_le32(valid_node_count(sbi));
ckpt->valid_inode_count = cpu_to_le32(valid_inode_count(sbi));
ckpt->next_free_nid = cpu_to_le32(last_nid);
+
+ /* update user_block_counts */
+ sbi->last_valid_block_count = sbi->total_valid_block_count;
+ percpu_counter_set(&sbi->alloc_valid_block_count, 0);
+ percpu_counter_set(&sbi->rf_node_block_count, 0);
}
static bool __need_flush_quota(struct f2fs_sb_info *sbi)
@@ -1569,11 +1574,6 @@ static int do_checkpoint(struct f2fs_sb_info *sbi, struct cp_control *cpc)
start_blk += NR_CURSEG_NODE_TYPE;
}
- /* update user_block_counts */
- sbi->last_valid_block_count = sbi->total_valid_block_count;
- percpu_counter_set(&sbi->alloc_valid_block_count, 0);
- percpu_counter_set(&sbi->rf_node_block_count, 0);
-
/* Here, we have one bio having CP pack except cp pack 2 page */
f2fs_sync_meta_pages(sbi, META, LONG_MAX, FS_CP_META_IO);
/* Wait for all dirty meta pages to be submitted for IO */
diff --git a/fs/f2fs/file.c b/fs/f2fs/file.c
index 1d73582d1f63..c6fb179f9d4a 100644
--- a/fs/f2fs/file.c
+++ b/fs/f2fs/file.c
@@ -812,6 +812,8 @@ static bool f2fs_force_buffered_io(struct inode *inode, int rw)
return true;
if (f2fs_compressed_file(inode))
return true;
+ if (f2fs_has_inline_data(inode))
+ return true;
/* disallow direct IO if any of devices has unaligned blksize */
if (f2fs_is_multi_device(sbi) && !sbi->aligned_blksize)
diff --git a/fs/f2fs/inline.c b/fs/f2fs/inline.c
index 8747eec3d0a3..7a2fb9789e5e 100644
--- a/fs/f2fs/inline.c
+++ b/fs/f2fs/inline.c
@@ -204,8 +204,10 @@ int f2fs_convert_inline_inode(struct inode *inode)
struct page *ipage, *page;
int err = 0;
- if (!f2fs_has_inline_data(inode) ||
- f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+ if (f2fs_hw_is_readonly(sbi) || f2fs_readonly(sbi->sb))
+ return -EROFS;
+
+ if (!f2fs_has_inline_data(inode))
return 0;
err = f2fs_dquot_initialize(inode);
diff --git a/fs/f2fs/inode.c b/fs/f2fs/inode.c
index 35b1c672644e..ff4a4e92a40c 100644
--- a/fs/f2fs/inode.c
+++ b/fs/f2fs/inode.c
@@ -27,6 +27,9 @@ void f2fs_mark_inode_dirty_sync(struct inode *inode, bool sync)
if (is_inode_flag_set(inode, FI_NEW_INODE))
return;
+ if (f2fs_readonly(F2FS_I_SB(inode)->sb))
+ return;
+
if (f2fs_inode_dirtied(inode, sync))
return;
diff --git a/fs/f2fs/segment.h b/fs/f2fs/segment.h
index aa9ad85e0901..17d1723d98a0 100644
--- a/fs/f2fs/segment.h
+++ b/fs/f2fs/segment.h
@@ -373,7 +373,8 @@ static inline unsigned int get_ckpt_valid_blocks(struct f2fs_sb_info *sbi,
unsigned int segno, bool use_section)
{
if (use_section && __is_large_section(sbi)) {
- unsigned int start_segno = START_SEGNO(segno);
+ unsigned int secno = GET_SEC_FROM_SEG(sbi, segno);
+ unsigned int start_segno = GET_SEG_FROM_SEC(sbi, secno);
unsigned int blocks = 0;
int i;
diff --git a/fs/fuse/inode.c b/fs/fuse/inode.c
index 367e3b276092..f19bdd7cbd77 100644
--- a/fs/fuse/inode.c
+++ b/fs/fuse/inode.c
@@ -724,6 +724,8 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
struct fs_parse_result result;
struct fuse_fs_context *ctx = fsc->fs_private;
int opt;
+ kuid_t kuid;
+ kgid_t kgid;
if (fsc->purpose == FS_CONTEXT_FOR_RECONFIGURE) {
/*
@@ -768,16 +770,30 @@ static int fuse_parse_param(struct fs_context *fsc, struct fs_parameter *param)
break;
case OPT_USER_ID:
- ctx->user_id = make_kuid(fsc->user_ns, result.uint_32);
- if (!uid_valid(ctx->user_id))
+ kuid = make_kuid(fsc->user_ns, result.uint_32);
+ if (!uid_valid(kuid))
return invalfc(fsc, "Invalid user_id");
+ /*
+ * The requested uid must be representable in the
+ * filesystem's idmapping.
+ */
+ if (!kuid_has_mapping(fsc->user_ns, kuid))
+ return invalfc(fsc, "Invalid user_id");
+ ctx->user_id = kuid;
ctx->user_id_present = true;
break;
case OPT_GROUP_ID:
- ctx->group_id = make_kgid(fsc->user_ns, result.uint_32);
- if (!gid_valid(ctx->group_id))
+ kgid = make_kgid(fsc->user_ns, result.uint_32);;
+ if (!gid_valid(kgid))
+ return invalfc(fsc, "Invalid group_id");
+ /*
+ * The requested gid must be representable in the
+ * filesystem's idmapping.
+ */
+ if (!kgid_has_mapping(fsc->user_ns, kgid))
return invalfc(fsc, "Invalid group_id");
+ ctx->group_id = kgid;
ctx->group_id_present = true;
break;
diff --git a/fs/hfs/inode.c b/fs/hfs/inode.c
index 80d17c520d0b..aedb4b262189 100644
--- a/fs/hfs/inode.c
+++ b/fs/hfs/inode.c
@@ -204,6 +204,7 @@ struct inode *hfs_new_inode(struct inode *dir, const struct qstr *name, umode_t
HFS_I(inode)->flags = 0;
HFS_I(inode)->rsrc_inode = NULL;
HFS_I(inode)->fs_blocks = 0;
+ HFS_I(inode)->tz_secondswest = sys_tz.tz_minuteswest * 60;
if (S_ISDIR(mode)) {
inode->i_size = 2;
HFS_SB(sb)->folder_count++;
@@ -279,6 +280,8 @@ void hfs_inode_read_fork(struct inode *inode, struct hfs_extent *ext,
for (count = 0, i = 0; i < 3; i++)
count += be16_to_cpu(ext[i].count);
HFS_I(inode)->first_blocks = count;
+ HFS_I(inode)->cached_start = 0;
+ HFS_I(inode)->cached_blocks = 0;
inode->i_size = HFS_I(inode)->phys_size = log_size;
HFS_I(inode)->fs_blocks = (log_size + sb->s_blocksize - 1) >> sb->s_blocksize_bits;
diff --git a/fs/hfsplus/bfind.c b/fs/hfsplus/bfind.c
index ca2ba8c9f82e..901e83d65d20 100644
--- a/fs/hfsplus/bfind.c
+++ b/fs/hfsplus/bfind.c
@@ -25,19 +25,8 @@ int hfs_find_init(struct hfs_btree *tree, struct hfs_find_data *fd)
fd->key = ptr + tree->max_key_len + 2;
hfs_dbg(BNODE_REFS, "find_init: %d (%p)\n",
tree->cnid, __builtin_return_address(0));
- switch (tree->cnid) {
- case HFSPLUS_CAT_CNID:
- mutex_lock_nested(&tree->tree_lock, CATALOG_BTREE_MUTEX);
- break;
- case HFSPLUS_EXT_CNID:
- mutex_lock_nested(&tree->tree_lock, EXTENTS_BTREE_MUTEX);
- break;
- case HFSPLUS_ATTR_CNID:
- mutex_lock_nested(&tree->tree_lock, ATTR_BTREE_MUTEX);
- break;
- default:
- BUG();
- }
+ mutex_lock_nested(&tree->tree_lock,
+ hfsplus_btree_lock_class(tree));
return 0;
}
diff --git a/fs/hfsplus/extents.c b/fs/hfsplus/extents.c
index 721f779b4ec3..91354e769642 100644
--- a/fs/hfsplus/extents.c
+++ b/fs/hfsplus/extents.c
@@ -430,7 +430,8 @@ int hfsplus_free_fork(struct super_block *sb, u32 cnid,
hfsplus_free_extents(sb, ext_entry, total_blocks - start,
total_blocks);
total_blocks = start;
- mutex_lock(&fd.tree->tree_lock);
+ mutex_lock_nested(&fd.tree->tree_lock,
+ hfsplus_btree_lock_class(fd.tree));
} while (total_blocks > blocks);
hfs_find_exit(&fd);
@@ -592,7 +593,8 @@ void hfsplus_file_truncate(struct inode *inode)
alloc_cnt, alloc_cnt - blk_cnt);
hfsplus_dump_extent(hip->first_extents);
hip->first_blocks = blk_cnt;
- mutex_lock(&fd.tree->tree_lock);
+ mutex_lock_nested(&fd.tree->tree_lock,
+ hfsplus_btree_lock_class(fd.tree));
break;
}
res = __hfsplus_ext_cache_extent(&fd, inode, alloc_cnt);
@@ -606,7 +608,8 @@ void hfsplus_file_truncate(struct inode *inode)
hfsplus_free_extents(sb, hip->cached_extents,
alloc_cnt - start, alloc_cnt - blk_cnt);
hfsplus_dump_extent(hip->cached_extents);
- mutex_lock(&fd.tree->tree_lock);
+ mutex_lock_nested(&fd.tree->tree_lock,
+ hfsplus_btree_lock_class(fd.tree));
if (blk_cnt > start) {
hip->extent_state |= HFSPLUS_EXT_DIRTY;
break;
diff --git a/fs/hfsplus/hfsplus_fs.h b/fs/hfsplus/hfsplus_fs.h
index 6aa919e59483..7db213cd1eea 100644
--- a/fs/hfsplus/hfsplus_fs.h
+++ b/fs/hfsplus/hfsplus_fs.h
@@ -552,6 +552,27 @@ static inline __be32 __hfsp_ut2mt(time64_t ut)
return cpu_to_be32(lower_32_bits(ut) + HFSPLUS_UTC_OFFSET);
}
+static inline enum hfsplus_btree_mutex_classes
+hfsplus_btree_lock_class(struct hfs_btree *tree)
+{
+ enum hfsplus_btree_mutex_classes class;
+
+ switch (tree->cnid) {
+ case HFSPLUS_CAT_CNID:
+ class = CATALOG_BTREE_MUTEX;
+ break;
+ case HFSPLUS_EXT_CNID:
+ class = EXTENTS_BTREE_MUTEX;
+ break;
+ case HFSPLUS_ATTR_CNID:
+ class = ATTR_BTREE_MUTEX;
+ break;
+ default:
+ BUG();
+ }
+ return class;
+}
+
/* compatibility */
#define hfsp_mt2ut(t) (struct timespec64){ .tv_sec = __hfsp_mt2ut(t) }
#define hfsp_ut2mt(t) __hfsp_ut2mt((t).tv_sec)
diff --git a/fs/jbd2/commit.c b/fs/jbd2/commit.c
index 556b259a00ba..7b34deec8b87 100644
--- a/fs/jbd2/commit.c
+++ b/fs/jbd2/commit.c
@@ -801,7 +801,7 @@ void jbd2_journal_commit_transaction(journal_t *journal)
if (first_block < journal->j_tail)
freed += journal->j_last - journal->j_first;
/* Update tail only if we free significant amount of space */
- if (freed < jbd2_journal_get_max_txn_bufs(journal))
+ if (freed < journal->j_max_transaction_buffers)
update_tail = 0;
}
J_ASSERT(commit_transaction->t_state == T_COMMIT);
diff --git a/fs/jbd2/journal.c b/fs/jbd2/journal.c
index 3df45e4699f1..b136b46b63bc 100644
--- a/fs/jbd2/journal.c
+++ b/fs/jbd2/journal.c
@@ -1532,6 +1532,11 @@ static void journal_fail_superblock(journal_t *journal)
journal->j_sb_buffer = NULL;
}
+static int jbd2_journal_get_max_txn_bufs(journal_t *journal)
+{
+ return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
+}
+
/*
* Given a journal_t structure, initialise the various fields for
* startup of a new journaling session. We use this both when creating
diff --git a/fs/jfs/jfs_imap.c b/fs/jfs/jfs_imap.c
index ac42f8ee553f..ba6f28521360 100644
--- a/fs/jfs/jfs_imap.c
+++ b/fs/jfs/jfs_imap.c
@@ -290,7 +290,7 @@ int diSync(struct inode *ipimap)
int diRead(struct inode *ip)
{
struct jfs_sb_info *sbi = JFS_SBI(ip->i_sb);
- int iagno, ino, extno, rc;
+ int iagno, ino, extno, rc, agno;
struct inode *ipimap;
struct dinode *dp;
struct iag *iagp;
@@ -339,8 +339,11 @@ int diRead(struct inode *ip)
/* get the ag for the iag */
agstart = le64_to_cpu(iagp->agstart);
+ agno = BLKTOAG(agstart, JFS_SBI(ip->i_sb));
release_metapage(mp);
+ if (agno >= MAXAG || agno < 0)
+ return -EIO;
rel_inode = (ino & (INOSPERPAGE - 1));
pageno = blkno >> sbi->l2nbperpage;
diff --git a/fs/kernfs/dir.c b/fs/kernfs/dir.c
index a00e11ebfa77..2c74b24fc22a 100644
--- a/fs/kernfs/dir.c
+++ b/fs/kernfs/dir.c
@@ -125,9 +125,9 @@ static struct kernfs_node *kernfs_common_ancestor(struct kernfs_node *a,
* kn_to: /n1/n2/n3 [depth=3]
* result: /../..
*
- * [3] when @kn_to is NULL result will be "(null)"
+ * [3] when @kn_to is %NULL result will be "(null)"
*
- * Returns the length of the full path. If the full length is equal to or
+ * Return: the length of the constructed path. If the path would have been
* greater than @buflen, @buf contains the truncated path with the trailing
* '\0'. On error, -errno is returned.
*/
@@ -138,16 +138,17 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
struct kernfs_node *kn, *common;
const char parent_str[] = "/..";
size_t depth_from, depth_to, len = 0;
+ ssize_t copied;
int i, j;
if (!kn_to)
- return strlcpy(buf, "(null)", buflen);
+ return strscpy(buf, "(null)", buflen);
if (!kn_from)
kn_from = kernfs_root(kn_to)->kn;
if (kn_from == kn_to)
- return strlcpy(buf, "/", buflen);
+ return strscpy(buf, "/", buflen);
if (!buf)
return -EINVAL;
@@ -161,18 +162,19 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
buf[0] = '\0';
- for (i = 0; i < depth_from; i++)
- len += strlcpy(buf + len, parent_str,
- len < buflen ? buflen - len : 0);
+ for (i = 0; i < depth_from; i++) {
+ copied = strscpy(buf + len, parent_str, buflen - len);
+ if (copied < 0)
+ return copied;
+ len += copied;
+ }
/* Calculate how many bytes we need for the rest */
for (i = depth_to - 1; i >= 0; i--) {
for (kn = kn_to, j = 0; j < i; j++)
kn = kn->parent;
- len += strlcpy(buf + len, "/",
- len < buflen ? buflen - len : 0);
- len += strlcpy(buf + len, kn->name,
- len < buflen ? buflen - len : 0);
+
+ len += scnprintf(buf + len, buflen - len, "/%s", kn->name);
}
return len;
@@ -185,10 +187,12 @@ static int kernfs_path_from_node_locked(struct kernfs_node *kn_to,
* @buflen: size of @buf
*
* Copies the name of @kn into @buf of @buflen bytes. The behavior is
- * similar to strlcpy(). It returns the length of @kn's name and if @buf
- * isn't long enough, it's filled upto @buflen-1 and nul terminated.
+ * similar to strlcpy().
*
- * Fills buffer with "(null)" if @kn is NULL.
+ * Fills buffer with "(null)" if @kn is %NULL.
+ *
+ * Return: the length of @kn's name and if @buf isn't long enough,
+ * it's filled up to @buflen-1 and nul terminated.
*
* This function can be called from any context.
*/
@@ -215,7 +219,7 @@ int kernfs_name(struct kernfs_node *kn, char *buf, size_t buflen)
* path (which includes '..'s) as needed to reach from @from to @to is
* returned.
*
- * Returns the length of the full path. If the full length is equal to or
+ * Return: the length of the constructed path. If the path would have been
* greater than @buflen, @buf contains the truncated path with the trailing
* '\0'. On error, -errno is returned.
*/
@@ -266,12 +270,10 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
sz = kernfs_path_from_node(kn, NULL, kernfs_pr_cont_buf,
sizeof(kernfs_pr_cont_buf));
if (sz < 0) {
- pr_cont("(error)");
- goto out;
- }
-
- if (sz >= sizeof(kernfs_pr_cont_buf)) {
- pr_cont("(name too long)");
+ if (sz == -E2BIG)
+ pr_cont("(name too long)");
+ else
+ pr_cont("(error)");
goto out;
}
@@ -287,6 +289,8 @@ void pr_cont_kernfs_path(struct kernfs_node *kn)
*
* Determines @kn's parent, pins and returns it. This function can be
* called from any context.
+ *
+ * Return: parent node of @kn
*/
struct kernfs_node *kernfs_get_parent(struct kernfs_node *kn)
{
@@ -302,11 +306,11 @@ struct kernfs_node *kernfs_get_parent(struct kernfs_node *kn)
}
/**
- * kernfs_name_hash
+ * kernfs_name_hash - calculate hash of @ns + @name
* @name: Null terminated string to hash
* @ns: Namespace tag to hash
*
- * Returns 31 bit hash of ns + name (so it fits in an off_t )
+ * Return: 31-bit hash of ns + name (so it fits in an off_t)
*/
static unsigned int kernfs_name_hash(const char *name, const void *ns)
{
@@ -354,8 +358,8 @@ static int kernfs_sd_compare(const struct kernfs_node *left,
* Locking:
* kernfs_rwsem held exclusive
*
- * RETURNS:
- * 0 on susccess -EEXIST on failure.
+ * Return:
+ * %0 on success, -EEXIST on failure.
*/
static int kernfs_link_sibling(struct kernfs_node *kn)
{
@@ -394,8 +398,10 @@ static int kernfs_link_sibling(struct kernfs_node *kn)
* @kn: kernfs_node of interest
*
* Try to unlink @kn from its sibling rbtree which starts from
- * kn->parent->dir.children. Returns %true if @kn was actually
- * removed, %false if @kn wasn't on the rbtree.
+ * kn->parent->dir.children.
+ *
+ * Return: %true if @kn was actually removed,
+ * %false if @kn wasn't on the rbtree.
*
* Locking:
* kernfs_rwsem held exclusive
@@ -419,10 +425,10 @@ static bool kernfs_unlink_sibling(struct kernfs_node *kn)
* @kn: kernfs_node to get an active reference to
*
* Get an active reference of @kn. This function is noop if @kn
- * is NULL.
+ * is %NULL.
*
- * RETURNS:
- * Pointer to @kn on success, NULL on failure.
+ * Return:
+ * Pointer to @kn on success, %NULL on failure.
*/
struct kernfs_node *kernfs_get_active(struct kernfs_node *kn)
{
@@ -442,7 +448,7 @@ struct kernfs_node *kernfs_get_active(struct kernfs_node *kn)
* @kn: kernfs_node to put an active reference to
*
* Put an active reference to @kn. This function is noop if @kn
- * is NULL.
+ * is %NULL.
*/
void kernfs_put_active(struct kernfs_node *kn)
{
@@ -464,7 +470,7 @@ void kernfs_put_active(struct kernfs_node *kn)
* kernfs_drain - drain kernfs_node
* @kn: kernfs_node to drain
*
- * Drain existing usages and nuke all existing mmaps of @kn. Mutiple
+ * Drain existing usages and nuke all existing mmaps of @kn. Multiple
* removers may invoke this function concurrently on @kn and all will
* return after draining is complete.
*/
@@ -577,7 +583,7 @@ EXPORT_SYMBOL_GPL(kernfs_put);
* kernfs_node_from_dentry - determine kernfs_node associated with a dentry
* @dentry: the dentry in question
*
- * Return the kernfs_node associated with @dentry. If @dentry is not a
+ * Return: the kernfs_node associated with @dentry. If @dentry is not a
* kernfs one, %NULL is returned.
*
* While the returned kernfs_node will stay accessible as long as @dentry
@@ -698,8 +704,8 @@ struct kernfs_node *kernfs_new_node(struct kernfs_node *parent,
* @id's lower 32bits encode ino and upper gen. If the gen portion is
* zero, all generations are matched.
*
- * RETURNS:
- * NULL on failure. Return a kernfs node with reference counter incremented
+ * Return: %NULL on failure,
+ * otherwise a kernfs node with reference counter incremented.
*/
struct kernfs_node *kernfs_find_and_get_node_by_id(struct kernfs_root *root,
u64 id)
@@ -747,8 +753,8 @@ struct kernfs_node *kernfs_find_and_get_node_by_id(struct kernfs_root *root,
* function increments nlink of the parent's inode if @kn is a
* directory and link into the children list of the parent.
*
- * RETURNS:
- * 0 on success, -EEXIST if entry with the given name already
+ * Return:
+ * %0 on success, -EEXIST if entry with the given name already
* exists.
*/
int kernfs_add_one(struct kernfs_node *kn)
@@ -811,8 +817,9 @@ int kernfs_add_one(struct kernfs_node *kn)
* @name: name to look for
* @ns: the namespace tag to use
*
- * Look for kernfs_node with name @name under @parent. Returns pointer to
- * the found kernfs_node on success, %NULL on failure.
+ * Look for kernfs_node with name @name under @parent.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
*/
static struct kernfs_node *kernfs_find_ns(struct kernfs_node *parent,
const unsigned char *name,
@@ -885,8 +892,9 @@ static struct kernfs_node *kernfs_walk_ns(struct kernfs_node *parent,
* @ns: the namespace tag to use
*
* Look for kernfs_node with name @name under @parent and get a reference
- * if found. This function may sleep and returns pointer to the found
- * kernfs_node on success, %NULL on failure.
+ * if found. This function may sleep.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
*/
struct kernfs_node *kernfs_find_and_get_ns(struct kernfs_node *parent,
const char *name, const void *ns)
@@ -910,8 +918,9 @@ EXPORT_SYMBOL_GPL(kernfs_find_and_get_ns);
* @ns: the namespace tag to use
*
* Look for kernfs_node with path @path under @parent and get a reference
- * if found. This function may sleep and returns pointer to the found
- * kernfs_node on success, %NULL on failure.
+ * if found. This function may sleep.
+ *
+ * Return: pointer to the found kernfs_node on success, %NULL on failure.
*/
struct kernfs_node *kernfs_walk_and_get_ns(struct kernfs_node *parent,
const char *path, const void *ns)
@@ -933,7 +942,7 @@ struct kernfs_node *kernfs_walk_and_get_ns(struct kernfs_node *parent,
* @flags: KERNFS_ROOT_* flags
* @priv: opaque data associated with the new directory
*
- * Returns the root of the new hierarchy on success, ERR_PTR() value on
+ * Return: the root of the new hierarchy on success, ERR_PTR() value on
* failure.
*/
struct kernfs_root *kernfs_create_root(struct kernfs_syscall_ops *scops,
@@ -1005,6 +1014,8 @@ void kernfs_destroy_root(struct kernfs_root *root)
/**
* kernfs_root_to_node - return the kernfs_node associated with a kernfs_root
* @root: root to use to lookup
+ *
+ * Return: @root's kernfs_node
*/
struct kernfs_node *kernfs_root_to_node(struct kernfs_root *root)
{
@@ -1021,7 +1032,7 @@ struct kernfs_node *kernfs_root_to_node(struct kernfs_root *root)
* @priv: opaque data associated with the new directory
* @ns: optional namespace tag of the directory
*
- * Returns the created node on success, ERR_PTR() value on failure.
+ * Return: the created node on success, ERR_PTR() value on failure.
*/
struct kernfs_node *kernfs_create_dir_ns(struct kernfs_node *parent,
const char *name, umode_t mode,
@@ -1055,7 +1066,7 @@ struct kernfs_node *kernfs_create_dir_ns(struct kernfs_node *parent,
* @parent: parent in which to create a new directory
* @name: name of the new directory
*
- * Returns the created node on success, ERR_PTR() value on failure.
+ * Return: the created node on success, ERR_PTR() value on failure.
*/
struct kernfs_node *kernfs_create_empty_dir(struct kernfs_node *parent,
const char *name)
@@ -1304,6 +1315,8 @@ static struct kernfs_node *kernfs_leftmost_descendant(struct kernfs_node *pos)
* Find the next descendant to visit for post-order traversal of @root's
* descendants. @root is included in the iteration and the last node to be
* visited.
+ *
+ * Return: the next descendant to visit or %NULL when done.
*/
static struct kernfs_node *kernfs_next_descendant_post(struct kernfs_node *pos,
struct kernfs_node *root)
@@ -1567,6 +1580,8 @@ void kernfs_unbreak_active_protection(struct kernfs_node *kn)
* the whole kernfs_ops which won the arbitration. This can be used to
* guarantee, for example, all concurrent writes to a "delete" file to
* finish only after the whole operation is complete.
+ *
+ * Return: %true if @kn is removed by this call, otherwise %false.
*/
bool kernfs_remove_self(struct kernfs_node *kn)
{
@@ -1627,7 +1642,8 @@ bool kernfs_remove_self(struct kernfs_node *kn)
* @ns: namespace tag of the kernfs_node to remove
*
* Look for the kernfs_node with @name and @ns under @parent and remove it.
- * Returns 0 on success, -ENOENT if such entry doesn't exist.
+ *
+ * Return: %0 on success, -ENOENT if such entry doesn't exist.
*/
int kernfs_remove_by_name_ns(struct kernfs_node *parent, const char *name,
const void *ns)
@@ -1665,6 +1681,8 @@ int kernfs_remove_by_name_ns(struct kernfs_node *parent, const char *name,
* @new_parent: new parent to put @sd under
* @new_name: new name
* @new_ns: new namespace tag
+ *
+ * Return: %0 on success, -errno on failure.
*/
int kernfs_rename_ns(struct kernfs_node *kn, struct kernfs_node *new_parent,
const char *new_name, const void *new_ns)
diff --git a/fs/kernfs/file.c b/fs/kernfs/file.c
index 9ab6c92e02da..e4a50e4ff0d2 100644
--- a/fs/kernfs/file.c
+++ b/fs/kernfs/file.c
@@ -33,7 +33,7 @@ struct kernfs_open_node {
* pending queue is implemented as a singly linked list of kernfs_nodes.
* The list is terminated with the self pointer so that whether a
* kernfs_node is on the list or not can be determined by testing the next
- * pointer for NULL.
+ * pointer for %NULL.
*/
#define KERNFS_NOTIFY_EOL ((void *)&kernfs_notify_list)
@@ -59,8 +59,10 @@ static inline struct mutex *kernfs_open_file_mutex_lock(struct kernfs_node *kn)
}
/**
- * of_on - Return the kernfs_open_node of the specified kernfs_open_file
- * @of: taret kernfs_open_file
+ * of_on - Get the kernfs_open_node of the specified kernfs_open_file
+ * @of: target kernfs_open_file
+ *
+ * Return: the kernfs_open_node of the kernfs_open_file
*/
static struct kernfs_open_node *of_on(struct kernfs_open_file *of)
{
@@ -82,6 +84,8 @@ static struct kernfs_open_node *of_on(struct kernfs_open_file *of)
* outside RCU read-side critical section.
*
* The caller needs to make sure that kernfs_open_file_mutex is held.
+ *
+ * Return: @kn->attr.open when kernfs_open_file_mutex is held.
*/
static struct kernfs_open_node *
kernfs_deref_open_node_locked(struct kernfs_node *kn)
@@ -548,11 +552,11 @@ static int kernfs_fop_mmap(struct file *file, struct vm_area_struct *vma)
* If @kn->attr.open exists, increment its reference count; otherwise,
* create one. @of is chained to the files list.
*
- * LOCKING:
+ * Locking:
* Kernel thread context (may sleep).
*
- * RETURNS:
- * 0 on success, -errno on failure.
+ * Return:
+ * %0 on success, -errno on failure.
*/
static int kernfs_get_open_node(struct kernfs_node *kn,
struct kernfs_open_file *of)
@@ -1024,7 +1028,7 @@ const struct file_operations kernfs_file_fops = {
* @ns: optional namespace tag of the file
* @key: lockdep key for the file's active_ref, %NULL to disable lockdep
*
- * Returns the created node on success, ERR_PTR() value on error.
+ * Return: the created node on success, ERR_PTR() value on error.
*/
struct kernfs_node *__kernfs_create_file(struct kernfs_node *parent,
const char *name,
diff --git a/fs/kernfs/inode.c b/fs/kernfs/inode.c
index 3d783d80f5da..076ba9884916 100644
--- a/fs/kernfs/inode.c
+++ b/fs/kernfs/inode.c
@@ -94,7 +94,7 @@ int __kernfs_setattr(struct kernfs_node *kn, const struct iattr *iattr)
* @kn: target node
* @iattr: iattr to set
*
- * Returns 0 on success, -errno on failure.
+ * Return: %0 on success, -errno on failure.
*/
int kernfs_setattr(struct kernfs_node *kn, const struct iattr *iattr)
{
@@ -241,11 +241,11 @@ static void kernfs_init_inode(struct kernfs_node *kn, struct inode *inode)
* allocated and basics are initialized. New inode is returned
* locked.
*
- * LOCKING:
+ * Locking:
* Kernel thread context (may sleep).
*
- * RETURNS:
- * Pointer to allocated inode on success, NULL on failure.
+ * Return:
+ * Pointer to allocated inode on success, %NULL on failure.
*/
struct inode *kernfs_get_inode(struct super_block *sb, struct kernfs_node *kn)
{
diff --git a/fs/kernfs/kernfs-internal.h b/fs/kernfs/kernfs-internal.h
index fc5821effd97..9046d9f39e63 100644
--- a/fs/kernfs/kernfs-internal.h
+++ b/fs/kernfs/kernfs-internal.h
@@ -58,7 +58,7 @@ struct kernfs_root {
* kernfs_root - find out the kernfs_root a kernfs_node belongs to
* @kn: kernfs_node of interest
*
- * Return the kernfs_root @kn belongs to.
+ * Return: the kernfs_root @kn belongs to.
*/
static inline struct kernfs_root *kernfs_root(struct kernfs_node *kn)
{
diff --git a/fs/kernfs/mount.c b/fs/kernfs/mount.c
index d0859f72d2d6..e08e8d999807 100644
--- a/fs/kernfs/mount.c
+++ b/fs/kernfs/mount.c
@@ -153,7 +153,7 @@ static const struct export_operations kernfs_export_ops = {
* kernfs_root_from_sb - determine kernfs_root associated with a super_block
* @sb: the super_block in question
*
- * Return the kernfs_root associated with @sb. If @sb is not a kernfs one,
+ * Return: the kernfs_root associated with @sb. If @sb is not a kernfs one,
* %NULL is returned.
*/
struct kernfs_root *kernfs_root_from_sb(struct super_block *sb)
@@ -167,7 +167,7 @@ struct kernfs_root *kernfs_root_from_sb(struct super_block *sb)
* find the next ancestor in the path down to @child, where @parent was the
* ancestor whose descendant we want to find.
*
- * Say the path is /a/b/c/d. @child is d, @parent is NULL. We return the root
+ * Say the path is /a/b/c/d. @child is d, @parent is %NULL. We return the root
* node. If @parent is b, then we return the node for c.
* Passing in d as @parent is not ok.
*/
@@ -192,6 +192,8 @@ static struct kernfs_node *find_next_ancestor(struct kernfs_node *child,
* kernfs_node_dentry - get a dentry for the given kernfs_node
* @kn: kernfs_node for which a dentry is needed
* @sb: the kernfs super_block
+ *
+ * Return: the dentry pointer
*/
struct dentry *kernfs_node_dentry(struct kernfs_node *kn,
struct super_block *sb)
@@ -296,7 +298,7 @@ static int kernfs_set_super(struct super_block *sb, struct fs_context *fc)
* kernfs_super_ns - determine the namespace tag of a kernfs super_block
* @sb: super_block of interest
*
- * Return the namespace tag associated with kernfs super_block @sb.
+ * Return: the namespace tag associated with kernfs super_block @sb.
*/
const void *kernfs_super_ns(struct super_block *sb)
{
@@ -313,6 +315,8 @@ const void *kernfs_super_ns(struct super_block *sb)
* implementation, which should set the specified ->@fs_type and ->@flags, and
* specify the hierarchy and namespace tag to mount via ->@root and ->@ns,
* respectively.
+ *
+ * Return: %0 on success, -errno on failure.
*/
int kernfs_get_tree(struct fs_context *fc)
{
diff --git a/fs/kernfs/symlink.c b/fs/kernfs/symlink.c
index 0ab13824822f..45371a70caa7 100644
--- a/fs/kernfs/symlink.c
+++ b/fs/kernfs/symlink.c
@@ -19,7 +19,7 @@
* @name: name of the symlink
* @target: target node for the symlink to point to
*
- * Returns the created node on success, ERR_PTR() value on error.
+ * Return: the created node on success, ERR_PTR() value on error.
* Ownership of the link matches ownership of the target.
*/
struct kernfs_node *kernfs_create_link(struct kernfs_node *parent,
diff --git a/fs/nfs/nfs4client.c b/fs/nfs/nfs4client.c
index 84b345efcec0..02caeec2c173 100644
--- a/fs/nfs/nfs4client.c
+++ b/fs/nfs/nfs4client.c
@@ -230,9 +230,8 @@ struct nfs_client *nfs4_alloc_client(const struct nfs_client_initdata *cl_init)
__set_bit(NFS_CS_INFINITE_SLOTS, &clp->cl_flags);
__set_bit(NFS_CS_DISCRTRY, &clp->cl_flags);
__set_bit(NFS_CS_NO_RETRANS_TIMEOUT, &clp->cl_flags);
-
- if (test_bit(NFS_CS_DS, &cl_init->init_flags))
- __set_bit(NFS_CS_DS, &clp->cl_flags);
+ if (test_bit(NFS_CS_PNFS, &cl_init->init_flags))
+ __set_bit(NFS_CS_PNFS, &clp->cl_flags);
/*
* Set up the connection to the server before we add add to the
* global list.
@@ -997,7 +996,6 @@ struct nfs_client *nfs4_set_ds_client(struct nfs_server *mds_srv,
if (mds_srv->flags & NFS_MOUNT_NORESVPORT)
__set_bit(NFS_CS_NORESVPORT, &cl_init.init_flags);
- __set_bit(NFS_CS_DS, &cl_init.init_flags);
__set_bit(NFS_CS_PNFS, &cl_init.init_flags);
cl_init.max_connect = NFS_MAX_TRANSPORTS;
/*
diff --git a/fs/nfs/nfs4proc.c b/fs/nfs/nfs4proc.c
index cc620fc7aaf7..467e9439eded 100644
--- a/fs/nfs/nfs4proc.c
+++ b/fs/nfs/nfs4proc.c
@@ -8821,7 +8821,7 @@ nfs4_run_exchange_id(struct nfs_client *clp, const struct cred *cred,
#ifdef CONFIG_NFS_V4_1_MIGRATION
calldata->args.flags |= EXCHGID4_FLAG_SUPP_MOVED_MIGR;
#endif
- if (test_bit(NFS_CS_DS, &clp->cl_flags))
+ if (test_bit(NFS_CS_PNFS, &clp->cl_flags))
calldata->args.flags |= EXCHGID4_FLAG_USE_PNFS_DS;
msg.rpc_argp = &calldata->args;
msg.rpc_resp = &calldata->res;
diff --git a/fs/nilfs2/btnode.c b/fs/nilfs2/btnode.c
index ee2cde07264b..19ed9015bd66 100644
--- a/fs/nilfs2/btnode.c
+++ b/fs/nilfs2/btnode.c
@@ -51,12 +51,21 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
bh = nilfs_grab_buffer(inode, btnc, blocknr, BIT(BH_NILFS_Node));
if (unlikely(!bh))
- return NULL;
+ return ERR_PTR(-ENOMEM);
if (unlikely(buffer_mapped(bh) || buffer_uptodate(bh) ||
buffer_dirty(bh))) {
- brelse(bh);
- BUG();
+ /*
+ * The block buffer at the specified new address was already
+ * in use. This can happen if it is a virtual block number
+ * and has been reallocated due to corruption of the bitmap
+ * used to manage its allocation state (if not, the buffer
+ * clearing of an abandoned b-tree node is missing somewhere).
+ */
+ nilfs_error(inode->i_sb,
+ "state inconsistency probably due to duplicate use of b-tree node block address %llu (ino=%lu)",
+ (unsigned long long)blocknr, inode->i_ino);
+ goto failed;
}
memset(bh->b_data, 0, i_blocksize(inode));
bh->b_bdev = inode->i_sb->s_bdev;
@@ -67,6 +76,12 @@ nilfs_btnode_create_block(struct address_space *btnc, __u64 blocknr)
unlock_page(bh->b_page);
put_page(bh->b_page);
return bh;
+
+failed:
+ unlock_page(bh->b_page);
+ put_page(bh->b_page);
+ brelse(bh);
+ return ERR_PTR(-EIO);
}
int nilfs_btnode_submit_block(struct address_space *btnc, __u64 blocknr,
@@ -217,8 +232,8 @@ int nilfs_btnode_prepare_change_key(struct address_space *btnc,
}
nbh = nilfs_btnode_create_block(btnc, newkey);
- if (!nbh)
- return -ENOMEM;
+ if (IS_ERR(nbh))
+ return PTR_ERR(nbh);
BUG_ON(nbh == obh);
ctxt->newbh = nbh;
diff --git a/fs/nilfs2/btree.c b/fs/nilfs2/btree.c
index 146640f0607a..bd24a33fc72e 100644
--- a/fs/nilfs2/btree.c
+++ b/fs/nilfs2/btree.c
@@ -63,8 +63,8 @@ static int nilfs_btree_get_new_block(const struct nilfs_bmap *btree,
struct buffer_head *bh;
bh = nilfs_btnode_create_block(btnc, ptr);
- if (!bh)
- return -ENOMEM;
+ if (IS_ERR(bh))
+ return PTR_ERR(bh);
set_buffer_nilfs_volatile(bh);
*bhp = bh;
diff --git a/fs/nilfs2/segment.c b/fs/nilfs2/segment.c
index 04943ab40a01..5110c50be291 100644
--- a/fs/nilfs2/segment.c
+++ b/fs/nilfs2/segment.c
@@ -136,7 +136,7 @@ static void nilfs_dispose_list(struct the_nilfs *, struct list_head *, int);
#define nilfs_cnt32_ge(a, b) \
(typecheck(__u32, a) && typecheck(__u32, b) && \
- ((__s32)(a) - (__s32)(b) >= 0))
+ ((__s32)((a) - (b)) >= 0))
static int nilfs_prepare_segment_lock(struct super_block *sb,
struct nilfs_transaction_info *ti)
diff --git a/fs/ntfs3/attrib.c b/fs/ntfs3/attrib.c
index 2618bf5a3789..0388e6b42100 100644
--- a/fs/ntfs3/attrib.c
+++ b/fs/ntfs3/attrib.c
@@ -242,7 +242,7 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
struct ntfs_sb_info *sbi;
struct ATTRIB *attr_s;
struct MFT_REC *rec;
- u32 used, asize, rsize, aoff, align;
+ u32 used, asize, rsize, aoff;
bool is_data;
CLST len, alen;
char *next;
@@ -263,10 +263,13 @@ int attr_make_nonresident(struct ntfs_inode *ni, struct ATTRIB *attr,
rsize = le32_to_cpu(attr->res.data_size);
is_data = attr->type == ATTR_DATA && !attr->name_len;
- align = sbi->cluster_size;
- if (is_attr_compressed(attr))
- align <<= COMPRESSION_UNIT;
- len = (rsize + align - 1) >> sbi->cluster_bits;
+ /* len - how many clusters required to store 'rsize' bytes */
+ if (is_attr_compressed(attr)) {
+ u8 shift = sbi->cluster_bits + NTFS_LZNT_CUNIT;
+ len = ((rsize + (1u << shift) - 1) >> shift) << NTFS_LZNT_CUNIT;
+ } else {
+ len = bytes_to_cluster(sbi, rsize);
+ }
run_init(run);
@@ -678,7 +681,8 @@ int attr_set_size(struct ntfs_inode *ni, enum ATTR_TYPE type,
goto undo_2;
}
- if (!is_mft)
+ /* keep runs for $MFT::$ATTR_DATA and $MFT::$ATTR_BITMAP. */
+ if (ni->mi.rno != MFT_REC_MFT)
run_truncate_head(run, evcn + 1);
svcn = le64_to_cpu(attr->nres.svcn);
@@ -1637,6 +1641,7 @@ int attr_allocate_frame(struct ntfs_inode *ni, CLST frame, size_t compr_size,
attr_b->nres.total_size = cpu_to_le64(total_size);
inode_set_bytes(&ni->vfs_inode, total_size);
+ ni->ni_flags |= NI_FLAG_UPDATE_PARENT;
mi_b->dirty = true;
mark_inode_dirty(&ni->vfs_inode);
diff --git a/fs/ntfs3/bitmap.c b/fs/ntfs3/bitmap.c
index c055bbdfe0f7..dfe4930ccec6 100644
--- a/fs/ntfs3/bitmap.c
+++ b/fs/ntfs3/bitmap.c
@@ -1356,7 +1356,7 @@ int wnd_extend(struct wnd_bitmap *wnd, size_t new_bits)
err = ntfs_vbo_to_lbo(sbi, &wnd->run, vbo, &lbo, &bytes);
if (err)
- break;
+ return err;
bh = ntfs_bread(sb, lbo >> sb->s_blocksize_bits);
if (!bh)
diff --git a/fs/ntfs3/dir.c b/fs/ntfs3/dir.c
index 98f57d0c702e..dcd689ed4baa 100644
--- a/fs/ntfs3/dir.c
+++ b/fs/ntfs3/dir.c
@@ -326,7 +326,8 @@ static inline int ntfs_filldir(struct ntfs_sb_info *sbi, struct ntfs_inode *ni,
* It does additional locks/reads just to get the type of name.
* Should we use additional mount option to enable branch below?
*/
- if ((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) &&
+ if (((fname->dup.fa & FILE_ATTRIBUTE_REPARSE_POINT) ||
+ fname->dup.ea_size) &&
ino != ni->mi.rno) {
struct inode *inode = ntfs_iget5(sbi->sb, &e->ref, NULL);
if (!IS_ERR_OR_NULL(inode)) {
diff --git a/fs/ntfs3/file.c b/fs/ntfs3/file.c
index 14efe46df91e..6f03de747e37 100644
--- a/fs/ntfs3/file.c
+++ b/fs/ntfs3/file.c
@@ -396,10 +396,7 @@ static int ntfs_file_mmap(struct file *file, struct vm_area_struct *vma)
}
if (ni->i_valid < to) {
- if (!inode_trylock(inode)) {
- err = -EAGAIN;
- goto out;
- }
+ inode_lock(inode);
err = ntfs_extend_initialized_size(file, ni,
ni->i_valid, to);
inode_unlock(inode);
diff --git a/fs/ntfs3/frecord.c b/fs/ntfs3/frecord.c
index d26026090024..02465ab3f398 100644
--- a/fs/ntfs3/frecord.c
+++ b/fs/ntfs3/frecord.c
@@ -1501,7 +1501,7 @@ int ni_insert_nonresident(struct ntfs_inode *ni, enum ATTR_TYPE type,
if (is_ext) {
if (flags & ATTR_FLAG_COMPRESSED)
- attr->nres.c_unit = COMPRESSION_UNIT;
+ attr->nres.c_unit = NTFS_LZNT_CUNIT;
attr->nres.total_size = attr->nres.alloc_size;
}
diff --git a/fs/ntfs3/fslog.c b/fs/ntfs3/fslog.c
index 6d0d9b1c3b2e..8e23bd6cd0f2 100644
--- a/fs/ntfs3/fslog.c
+++ b/fs/ntfs3/fslog.c
@@ -2999,7 +2999,7 @@ static struct ATTRIB *attr_create_nonres_log(struct ntfs_sb_info *sbi,
if (is_ext) {
attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
if (is_attr_compressed(attr))
- attr->nres.c_unit = COMPRESSION_UNIT;
+ attr->nres.c_unit = NTFS_LZNT_CUNIT;
attr->nres.run_off =
cpu_to_le16(SIZEOF_NONRESIDENT_EX + name_size);
@@ -3937,6 +3937,9 @@ int log_replay(struct ntfs_inode *ni, bool *initialized)
goto out;
}
+ log->page_mask = log->page_size - 1;
+ log->page_bits = blksize_bits(log->page_size);
+
/* If the file size has shrunk then we won't mount it. */
if (l_size < le64_to_cpu(ra2->l_size)) {
err = -EINVAL;
diff --git a/fs/ntfs3/fsntfs.c b/fs/ntfs3/fsntfs.c
index 4c2d079b3d49..97723a839c81 100644
--- a/fs/ntfs3/fsntfs.c
+++ b/fs/ntfs3/fsntfs.c
@@ -475,7 +475,7 @@ static int ntfs_extend_mft(struct ntfs_sb_info *sbi)
struct ATTRIB *attr;
struct wnd_bitmap *wnd = &sbi->mft.bitmap;
- new_mft_total = (wnd->nbits + MFT_INCREASE_CHUNK + 127) & (CLST)~127;
+ new_mft_total = ALIGN(wnd->nbits + NTFS_MFT_INCREASE_STEP, 128);
new_mft_bytes = (u64)new_mft_total << sbi->record_bits;
/* Step 1: Resize $MFT::DATA. */
diff --git a/fs/ntfs3/index.c b/fs/ntfs3/index.c
index 730629235ffa..9c36e0f3468d 100644
--- a/fs/ntfs3/index.c
+++ b/fs/ntfs3/index.c
@@ -979,7 +979,7 @@ static struct indx_node *indx_new(struct ntfs_index *indx,
hdr->used =
cpu_to_le32(eo + sizeof(struct NTFS_DE) + sizeof(u64));
de_set_vbn_le(e, *sub_vbn);
- hdr->flags = 1;
+ hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
} else {
e->size = cpu_to_le16(sizeof(struct NTFS_DE));
hdr->used = cpu_to_le32(eo + sizeof(struct NTFS_DE));
@@ -1677,7 +1677,7 @@ static int indx_insert_into_root(struct ntfs_index *indx, struct ntfs_inode *ni,
e->size = cpu_to_le16(sizeof(struct NTFS_DE) + sizeof(u64));
e->flags = NTFS_IE_HAS_SUBNODES | NTFS_IE_LAST;
- hdr->flags = 1;
+ hdr->flags = NTFS_INDEX_HDR_HAS_SUBNODES;
hdr->used = hdr->total =
cpu_to_le32(new_root_size - offsetof(struct INDEX_ROOT, ihdr));
diff --git a/fs/ntfs3/inode.c b/fs/ntfs3/inode.c
index 2c8c32d9fcaa..28cbae395431 100644
--- a/fs/ntfs3/inode.c
+++ b/fs/ntfs3/inode.c
@@ -1459,7 +1459,7 @@ struct inode *ntfs_create_inode(struct user_namespace *mnt_userns,
attr->size = cpu_to_le32(SIZEOF_NONRESIDENT_EX + 8);
attr->name_off = SIZEOF_NONRESIDENT_EX_LE;
attr->flags = ATTR_FLAG_COMPRESSED;
- attr->nres.c_unit = COMPRESSION_UNIT;
+ attr->nres.c_unit = NTFS_LZNT_CUNIT;
asize = SIZEOF_NONRESIDENT_EX + 8;
} else {
attr->size = cpu_to_le32(SIZEOF_NONRESIDENT + 8);
@@ -1967,5 +1967,6 @@ const struct address_space_operations ntfs_aops = {
const struct address_space_operations ntfs_aops_cmpr = {
.read_folio = ntfs_read_folio,
.readahead = ntfs_readahead,
+ .dirty_folio = block_dirty_folio,
};
// clang-format on
diff --git a/fs/ntfs3/ntfs.h b/fs/ntfs3/ntfs.h
index 324c0b036fdc..625f2b52bd58 100644
--- a/fs/ntfs3/ntfs.h
+++ b/fs/ntfs3/ntfs.h
@@ -82,10 +82,6 @@ typedef u32 CLST;
#define RESIDENT_LCN ((CLST)-2)
#define COMPRESSED_LCN ((CLST)-3)
-#define COMPRESSION_UNIT 4
-#define COMPRESS_MAX_CLUSTER 0x1000
-#define MFT_INCREASE_CHUNK 1024
-
enum RECORD_NUM {
MFT_REC_MFT = 0,
MFT_REC_MIRR = 1,
@@ -690,14 +686,15 @@ static inline bool de_has_vcn_ex(const struct NTFS_DE *e)
offsetof(struct ATTR_FILE_NAME, name) + \
NTFS_NAME_LEN * sizeof(short), 8)
+#define NTFS_INDEX_HDR_HAS_SUBNODES cpu_to_le32(1)
+
struct INDEX_HDR {
__le32 de_off; // 0x00: The offset from the start of this structure
// to the first NTFS_DE.
__le32 used; // 0x04: The size of this structure plus all
// entries (quad-word aligned).
__le32 total; // 0x08: The allocated size of for this structure plus all entries.
- u8 flags; // 0x0C: 0x00 = Small directory, 0x01 = Large directory.
- u8 res[3];
+ __le32 flags; // 0x0C: 0x00 = Small directory, 0x01 = Large directory.
//
// de_off + used <= total
@@ -744,7 +741,7 @@ static inline struct NTFS_DE *hdr_next_de(const struct INDEX_HDR *hdr,
static inline bool hdr_has_subnode(const struct INDEX_HDR *hdr)
{
- return hdr->flags & 1;
+ return hdr->flags & NTFS_INDEX_HDR_HAS_SUBNODES;
}
struct INDEX_BUFFER {
@@ -764,7 +761,7 @@ static inline bool ib_is_empty(const struct INDEX_BUFFER *ib)
static inline bool ib_is_leaf(const struct INDEX_BUFFER *ib)
{
- return !(ib->ihdr.flags & 1);
+ return !(ib->ihdr.flags & NTFS_INDEX_HDR_HAS_SUBNODES);
}
/* Index root structure ( 0x90 ). */
diff --git a/fs/ntfs3/ntfs_fs.h b/fs/ntfs3/ntfs_fs.h
index 0f9bec29f2b7..3e65ccccdb89 100644
--- a/fs/ntfs3/ntfs_fs.h
+++ b/fs/ntfs3/ntfs_fs.h
@@ -197,6 +197,8 @@ struct ntfs_index {
/* Minimum MFT zone. */
#define NTFS_MIN_MFT_ZONE 100
+/* Step to increase the MFT. */
+#define NTFS_MFT_INCREASE_STEP 1024
/* Ntfs file system in-core superblock data. */
struct ntfs_sb_info {
diff --git a/fs/proc/task_mmu.c b/fs/proc/task_mmu.c
index a954305fbc31..484886cdd272 100644
--- a/fs/proc/task_mmu.c
+++ b/fs/proc/task_mmu.c
@@ -1513,6 +1513,8 @@ static int pagemap_pmd_range(pmd_t *pmdp, unsigned long addr, unsigned long end,
}
#endif
+ if (page && !PageAnon(page))
+ flags |= PM_FILE;
if (page && !migration && page_mapcount(page) == 1)
flags |= PM_MMAP_EXCLUSIVE;
diff --git a/fs/smb/client/cifsfs.c b/fs/smb/client/cifsfs.c
index 78340d904c7b..6384e1b2b2ef 100644
--- a/fs/smb/client/cifsfs.c
+++ b/fs/smb/client/cifsfs.c
@@ -1872,12 +1872,12 @@ init_cifs(void)
WQ_FREEZABLE|WQ_MEM_RECLAIM, 0);
if (!serverclose_wq) {
rc = -ENOMEM;
- goto out_destroy_serverclose_wq;
+ goto out_destroy_deferredclose_wq;
}
rc = cifs_init_inodecache();
if (rc)
- goto out_destroy_deferredclose_wq;
+ goto out_destroy_serverclose_wq;
rc = init_mids();
if (rc)
@@ -1939,6 +1939,8 @@ init_cifs(void)
destroy_mids();
out_destroy_inodecache:
cifs_destroy_inodecache();
+out_destroy_serverclose_wq:
+ destroy_workqueue(serverclose_wq);
out_destroy_deferredclose_wq:
destroy_workqueue(deferredclose_wq);
out_destroy_cifsoplockd_wq:
@@ -1949,8 +1951,6 @@ init_cifs(void)
destroy_workqueue(decrypt_wq);
out_destroy_cifsiod_wq:
destroy_workqueue(cifsiod_wq);
-out_destroy_serverclose_wq:
- destroy_workqueue(serverclose_wq);
out_clean_proc:
cifs_proc_clean();
return rc;
diff --git a/fs/smb/client/connect.c b/fs/smb/client/connect.c
index 8c2a784200ec..21b344762d0f 100644
--- a/fs/smb/client/connect.c
+++ b/fs/smb/client/connect.c
@@ -2592,6 +2592,13 @@ cifs_get_tcon(struct cifs_ses *ses, struct smb3_fs_context *ctx)
cifs_dbg(VFS, "Server does not support mounting with posix SMB3.11 extensions\n");
rc = -EOPNOTSUPP;
goto out_fail;
+ } else if (ses->server->vals->protocol_id == SMB10_PROT_ID)
+ if (cap_unix(ses))
+ cifs_dbg(FYI, "Unix Extensions requested on SMB1 mount\n");
+ else {
+ cifs_dbg(VFS, "SMB1 Unix Extensions not supported by server\n");
+ rc = -EOPNOTSUPP;
+ goto out_fail;
} else {
cifs_dbg(VFS, "Check vers= mount option. SMB3.11 "
"disabled but required for POSIX extensions\n");
@@ -3975,6 +3982,7 @@ int cifs_mount(struct cifs_sb_info *cifs_sb, struct smb3_fs_context *ctx)
}
#endif
+#ifdef CONFIG_CIFS_ALLOW_INSECURE_LEGACY
/*
* Issue a TREE_CONNECT request.
*/
@@ -4096,11 +4104,25 @@ CIFSTCon(const unsigned int xid, struct cifs_ses *ses,
else
tcon->Flags = 0;
cifs_dbg(FYI, "Tcon flags: 0x%x\n", tcon->Flags);
- }
+ /*
+ * reset_cifs_unix_caps calls QFSInfo which requires
+ * need_reconnect to be false, but we would not need to call
+ * reset_caps if this were not a reconnect case so must check
+ * need_reconnect flag here. The caller will also clear
+ * need_reconnect when tcon was successful but needed to be
+ * cleared earlier in the case of unix extensions reconnect
+ */
+ if (tcon->need_reconnect && tcon->unix_ext) {
+ cifs_dbg(FYI, "resetting caps for %s\n", tcon->tree_name);
+ tcon->need_reconnect = false;
+ reset_cifs_unix_caps(xid, tcon, NULL, NULL);
+ }
+ }
cifs_buf_release(smb_buffer);
return rc;
}
+#endif /* CONFIG_CIFS_ALLOW_INSECURE_LEGACY */
static void delayed_free(struct rcu_head *p)
{
diff --git a/fs/super.c b/fs/super.c
index d138332e57a9..b116f72cd122 100644
--- a/fs/super.c
+++ b/fs/super.c
@@ -569,6 +569,17 @@ struct super_block *sget_fc(struct fs_context *fc,
struct user_namespace *user_ns = fc->global ? &init_user_ns : fc->user_ns;
int err;
+ /*
+ * Never allow s_user_ns != &init_user_ns when FS_USERNS_MOUNT is
+ * not set, as the filesystem is likely unprepared to handle it.
+ * This can happen when fsconfig() is called from init_user_ns with
+ * an fs_fd opened in another user namespace.
+ */
+ if (user_ns != &init_user_ns && !(fc->fs_type->fs_flags & FS_USERNS_MOUNT)) {
+ errorfc(fc, "VFS: Mounting from non-initial user namespace is not allowed");
+ return ERR_PTR(-EPERM);
+ }
+
retry:
spin_lock(&sb_lock);
if (test) {
diff --git a/fs/udf/balloc.c b/fs/udf/balloc.c
index f416b7fe092f..c4c18eeacb60 100644
--- a/fs/udf/balloc.c
+++ b/fs/udf/balloc.c
@@ -68,8 +68,12 @@ static int read_block_bitmap(struct super_block *sb,
}
for (i = 0; i < count; i++)
- if (udf_test_bit(i + off, bh->b_data))
+ if (udf_test_bit(i + off, bh->b_data)) {
+ bitmap->s_block_bitmap[bitmap_nr] =
+ ERR_PTR(-EFSCORRUPTED);
+ brelse(bh);
return -EFSCORRUPTED;
+ }
return 0;
}
@@ -85,8 +89,15 @@ static int __load_block_bitmap(struct super_block *sb,
block_group, nr_groups);
}
- if (bitmap->s_block_bitmap[block_group])
+ if (bitmap->s_block_bitmap[block_group]) {
+ /*
+ * The bitmap failed verification in the past. No point in
+ * trying again.
+ */
+ if (IS_ERR(bitmap->s_block_bitmap[block_group]))
+ return PTR_ERR(bitmap->s_block_bitmap[block_group]);
return block_group;
+ }
retval = read_block_bitmap(sb, bitmap, block_group, block_group);
if (retval < 0)
diff --git a/fs/udf/super.c b/fs/udf/super.c
index 6dc9d8dad88e..65fbc60a88e4 100644
--- a/fs/udf/super.c
+++ b/fs/udf/super.c
@@ -266,7 +266,8 @@ static void udf_sb_free_bitmap(struct udf_bitmap *bitmap)
int nr_groups = bitmap->s_nr_groups;
for (i = 0; i < nr_groups; i++)
- brelse(bitmap->s_block_bitmap[i]);
+ if (!IS_ERR_OR_NULL(bitmap->s_block_bitmap[i]))
+ brelse(bitmap->s_block_bitmap[i]);
kvfree(bitmap);
}
diff --git a/include/asm-generic/vmlinux.lds.h b/include/asm-generic/vmlinux.lds.h
index 1d1f480a5e9e..e7539dc02498 100644
--- a/include/asm-generic/vmlinux.lds.h
+++ b/include/asm-generic/vmlinux.lds.h
@@ -101,7 +101,7 @@
#define DATA_MAIN .data .data.[0-9a-zA-Z_]* .data..L* .data..compoundliteral* .data.$__unnamed_* .data.$L*
#define SDATA_MAIN .sdata .sdata.[0-9a-zA-Z_]*
#define RODATA_MAIN .rodata .rodata.[0-9a-zA-Z_]* .rodata..L*
-#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..compoundliteral*
+#define BSS_MAIN .bss .bss.[0-9a-zA-Z_]* .bss..L* .bss..compoundliteral*
#define SBSS_MAIN .sbss .sbss.[0-9a-zA-Z_]*
#else
#define TEXT_MAIN .text
diff --git a/include/drm/drm_mipi_dsi.h b/include/drm/drm_mipi_dsi.h
index 66a7e01c6260..1a921e8943a0 100644
--- a/include/drm/drm_mipi_dsi.h
+++ b/include/drm/drm_mipi_dsi.h
@@ -309,15 +309,18 @@ int mipi_dsi_dcs_get_display_brightness_large(struct mipi_dsi_device *dsi,
* @cmd: Command
* @seq: buffer containing data to be transmitted
*/
-#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...) do { \
- static const u8 d[] = { cmd, seq }; \
- struct device *dev = &dsi->dev; \
- int ret; \
- ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d)); \
- if (ret < 0) { \
- dev_err_ratelimited(dev, "sending command %#02x failed: %d\n", cmd, ret); \
- return ret; \
- } \
+#define mipi_dsi_dcs_write_seq(dsi, cmd, seq...) \
+ do { \
+ static const u8 d[] = { cmd, seq }; \
+ struct device *dev = &dsi->dev; \
+ ssize_t ret; \
+ ret = mipi_dsi_dcs_write_buffer(dsi, d, ARRAY_SIZE(d)); \
+ if (ret < 0) { \
+ dev_err_ratelimited( \
+ dev, "sending command %#02x failed: %zd\n", \
+ cmd, ret); \
+ return ret; \
+ } \
} while (0)
/**
diff --git a/include/linux/bpf_verifier.h b/include/linux/bpf_verifier.h
index f080ccf27d25..6a524c5462a6 100644
--- a/include/linux/bpf_verifier.h
+++ b/include/linux/bpf_verifier.h
@@ -645,7 +645,7 @@ static inline u32 type_flag(u32 type)
/* only use after check_attach_btf_id() */
static inline enum bpf_prog_type resolve_prog_type(const struct bpf_prog *prog)
{
- return prog->type == BPF_PROG_TYPE_EXT ?
+ return (prog->type == BPF_PROG_TYPE_EXT && prog->aux->dst_prog) ?
prog->aux->dst_prog->type : prog->type;
}
diff --git a/include/linux/hugetlb.h b/include/linux/hugetlb.h
index 37eeef9841c4..cc555072940f 100644
--- a/include/linux/hugetlb.h
+++ b/include/linux/hugetlb.h
@@ -694,6 +694,7 @@ HPAGEFLAG(RawHwpUnreliable, raw_hwp_unreliable)
/* Defines one hugetlb page size */
struct hstate {
struct mutex resize_lock;
+ struct lock_class_key resize_key;
int next_nid_to_alloc;
int next_nid_to_free;
unsigned int order;
diff --git a/include/linux/jbd2.h b/include/linux/jbd2.h
index 6611af5f1d0c..e301d323108d 100644
--- a/include/linux/jbd2.h
+++ b/include/linux/jbd2.h
@@ -1665,11 +1665,6 @@ int jbd2_wait_inode_data(journal_t *journal, struct jbd2_inode *jinode);
int jbd2_fc_wait_bufs(journal_t *journal, int num_blks);
int jbd2_fc_release_bufs(journal_t *journal);
-static inline int jbd2_journal_get_max_txn_bufs(journal_t *journal)
-{
- return (journal->j_total_len - journal->j_fc_wbufsize) / 4;
-}
-
/*
* is_journal_abort
*
diff --git a/include/linux/jump_label.h b/include/linux/jump_label.h
index 570831ca9951..4e968ebadce6 100644
--- a/include/linux/jump_label.h
+++ b/include/linux/jump_label.h
@@ -224,9 +224,10 @@ extern bool arch_jump_label_transform_queue(struct jump_entry *entry,
enum jump_label_type type);
extern void arch_jump_label_transform_apply(void);
extern int jump_label_text_reserved(void *start, void *end);
-extern void static_key_slow_inc(struct static_key *key);
+extern bool static_key_slow_inc(struct static_key *key);
+extern bool static_key_fast_inc_not_disabled(struct static_key *key);
extern void static_key_slow_dec(struct static_key *key);
-extern void static_key_slow_inc_cpuslocked(struct static_key *key);
+extern bool static_key_slow_inc_cpuslocked(struct static_key *key);
extern void static_key_slow_dec_cpuslocked(struct static_key *key);
extern int static_key_count(struct static_key *key);
extern void static_key_enable(struct static_key *key);
@@ -278,11 +279,23 @@ static __always_inline bool static_key_true(struct static_key *key)
return false;
}
-static inline void static_key_slow_inc(struct static_key *key)
+static inline bool static_key_fast_inc_not_disabled(struct static_key *key)
{
+ int v;
+
STATIC_KEY_CHECK_USE(key);
- atomic_inc(&key->enabled);
+ /*
+ * Prevent key->enabled getting negative to follow the same semantics
+ * as for CONFIG_JUMP_LABEL=y, see kernel/jump_label.c comment.
+ */
+ v = atomic_read(&key->enabled);
+ do {
+ if (v < 0 || (v + 1) < 0)
+ return false;
+ } while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v + 1)));
+ return true;
}
+#define static_key_slow_inc(key) static_key_fast_inc_not_disabled(key)
static inline void static_key_slow_dec(struct static_key *key)
{
diff --git a/include/linux/mlx5/qp.h b/include/linux/mlx5/qp.h
index ca0eee571ad7..15e8d7fd3879 100644
--- a/include/linux/mlx5/qp.h
+++ b/include/linux/mlx5/qp.h
@@ -566,9 +566,12 @@ static inline const char *mlx5_qp_state_str(int state)
static inline int mlx5_get_qp_default_ts(struct mlx5_core_dev *dev)
{
- return !MLX5_CAP_ROCE(dev, qp_ts_format) ?
- MLX5_TIMESTAMP_FORMAT_FREE_RUNNING :
- MLX5_TIMESTAMP_FORMAT_DEFAULT;
+ u8 supported_ts_cap = mlx5_get_roce_state(dev) ?
+ MLX5_CAP_ROCE(dev, qp_ts_format) :
+ MLX5_CAP_GEN(dev, sq_ts_format);
+
+ return supported_ts_cap ? MLX5_TIMESTAMP_FORMAT_DEFAULT :
+ MLX5_TIMESTAMP_FORMAT_FREE_RUNNING;
}
#endif /* MLX5_QP_H */
diff --git a/include/linux/objagg.h b/include/linux/objagg.h
index 78021777df46..6df5b887dc54 100644
--- a/include/linux/objagg.h
+++ b/include/linux/objagg.h
@@ -8,7 +8,6 @@ struct objagg_ops {
size_t obj_size;
bool (*delta_check)(void *priv, const void *parent_obj,
const void *obj);
- int (*hints_obj_cmp)(const void *obj1, const void *obj2);
void * (*delta_create)(void *priv, void *parent_obj, void *obj);
void (*delta_destroy)(void *priv, void *delta_priv);
void * (*root_create)(void *priv, void *obj, unsigned int root_id);
diff --git a/include/linux/pci.h b/include/linux/pci.h
index 4da7411da9ba..df73fb26b825 100644
--- a/include/linux/pci.h
+++ b/include/linux/pci.h
@@ -1138,6 +1138,7 @@ int pci_get_interrupt_pin(struct pci_dev *dev, struct pci_dev **bridge);
u8 pci_common_swizzle(struct pci_dev *dev, u8 *pinp);
struct pci_dev *pci_dev_get(struct pci_dev *dev);
void pci_dev_put(struct pci_dev *dev);
+DEFINE_FREE(pci_dev_put, struct pci_dev *, if (_T) pci_dev_put(_T))
void pci_remove_bus(struct pci_bus *b);
void pci_stop_and_remove_bus_device(struct pci_dev *dev);
void pci_stop_and_remove_bus_device_locked(struct pci_dev *dev);
@@ -1746,6 +1747,7 @@ void pci_cfg_access_unlock(struct pci_dev *dev);
void pci_dev_lock(struct pci_dev *dev);
int pci_dev_trylock(struct pci_dev *dev);
void pci_dev_unlock(struct pci_dev *dev);
+DEFINE_GUARD(pci_dev, struct pci_dev *, pci_dev_lock(_T), pci_dev_unlock(_T))
/*
* PCI domain support. Sometimes called PCI segment (eg by ACPI),
diff --git a/include/linux/perf_event.h b/include/linux/perf_event.h
index 1578a4de1f3c..27b694552d58 100644
--- a/include/linux/perf_event.h
+++ b/include/linux/perf_event.h
@@ -765,6 +765,7 @@ struct perf_event {
struct irq_work pending_irq;
struct callback_head pending_task;
unsigned int pending_work;
+ struct rcuwait pending_work_wait;
atomic_t event_limit;
diff --git a/include/linux/sbitmap.h b/include/linux/sbitmap.h
index d662cf136021..c09cdcc99471 100644
--- a/include/linux/sbitmap.h
+++ b/include/linux/sbitmap.h
@@ -36,6 +36,11 @@ struct sbitmap_word {
* @cleared: word holding cleared bits
*/
unsigned long cleared ____cacheline_aligned_in_smp;
+
+ /**
+ * @swap_lock: serializes simultaneous updates of ->word and ->cleared
+ */
+ spinlock_t swap_lock;
} ____cacheline_aligned_in_smp;
/**
diff --git a/include/linux/task_work.h b/include/linux/task_work.h
index 795ef5a68429..26b8a47f41fc 100644
--- a/include/linux/task_work.h
+++ b/include/linux/task_work.h
@@ -30,7 +30,8 @@ int task_work_add(struct task_struct *task, struct callback_head *twork,
struct callback_head *task_work_cancel_match(struct task_struct *task,
bool (*match)(struct callback_head *, void *data), void *data);
-struct callback_head *task_work_cancel(struct task_struct *, task_work_func_t);
+struct callback_head *task_work_cancel_func(struct task_struct *, task_work_func_t);
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb);
void task_work_run(void);
static inline void exit_task_work(struct task_struct *task)
diff --git a/include/linux/virtio_net.h b/include/linux/virtio_net.h
index 6047058d6703..29b19d0a324c 100644
--- a/include/linux/virtio_net.h
+++ b/include/linux/virtio_net.h
@@ -51,6 +51,7 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
unsigned int thlen = 0;
unsigned int p_off = 0;
unsigned int ip_proto;
+ u64 ret, remainder, gso_size;
if (hdr->gso_type != VIRTIO_NET_HDR_GSO_NONE) {
switch (hdr->gso_type & ~VIRTIO_NET_HDR_GSO_ECN) {
@@ -87,6 +88,16 @@ static inline int virtio_net_hdr_to_skb(struct sk_buff *skb,
u32 off = __virtio16_to_cpu(little_endian, hdr->csum_offset);
u32 needed = start + max_t(u32, thlen, off + sizeof(__sum16));
+ if (hdr->gso_size) {
+ gso_size = __virtio16_to_cpu(little_endian, hdr->gso_size);
+ ret = div64_u64_rem(skb->len, gso_size, &remainder);
+ if (!(ret && (hdr->gso_size > needed) &&
+ ((remainder > needed) || (remainder == 0)))) {
+ return -EINVAL;
+ }
+ skb_shinfo(skb)->tx_flags |= SKBFL_SHARED_FRAG;
+ }
+
if (!pskb_may_pull(skb, needed))
return -EINVAL;
diff --git a/include/net/ip_fib.h b/include/net/ip_fib.h
index 15de07d36540..ca1700c2a573 100644
--- a/include/net/ip_fib.h
+++ b/include/net/ip_fib.h
@@ -173,6 +173,7 @@ struct fib_result {
unsigned char type;
unsigned char scope;
u32 tclassid;
+ dscp_t dscp;
struct fib_nh_common *nhc;
struct fib_info *fi;
struct fib_table *table;
diff --git a/include/net/tcp.h b/include/net/tcp.h
index 8ea1fba84eff..cc314c383c53 100644
--- a/include/net/tcp.h
+++ b/include/net/tcp.h
@@ -633,6 +633,7 @@ void tcp_skb_collapse_tstamp(struct sk_buff *skb,
/* tcp_input.c */
void tcp_rearm_rto(struct sock *sk);
void tcp_synack_rtt_meas(struct sock *sk, struct request_sock *req);
+void tcp_done_with_error(struct sock *sk, int err);
void tcp_reset(struct sock *sk, struct sk_buff *skb);
void tcp_skb_mark_lost_uncond_verify(struct tcp_sock *tp, struct sk_buff *skb);
void tcp_fin(struct sock *sk);
diff --git a/include/trace/events/rpcgss.h b/include/trace/events/rpcgss.h
index 894d9fc8bd94..e228a44af291 100644
--- a/include/trace/events/rpcgss.h
+++ b/include/trace/events/rpcgss.h
@@ -54,7 +54,7 @@ TRACE_DEFINE_ENUM(GSS_S_UNSEQ_TOKEN);
TRACE_DEFINE_ENUM(GSS_S_GAP_TOKEN);
#define show_gss_status(x) \
- __print_flags(x, "|", \
+ __print_symbolic(x, \
{ GSS_S_BAD_MECH, "GSS_S_BAD_MECH" }, \
{ GSS_S_BAD_NAME, "GSS_S_BAD_NAME" }, \
{ GSS_S_BAD_NAMETYPE, "GSS_S_BAD_NAMETYPE" }, \
diff --git a/include/uapi/linux/netfilter/nf_tables.h b/include/uapi/linux/netfilter/nf_tables.h
index 707af820f1a9..672b2e1b47f2 100644
--- a/include/uapi/linux/netfilter/nf_tables.h
+++ b/include/uapi/linux/netfilter/nf_tables.h
@@ -1324,7 +1324,7 @@ enum nft_secmark_attributes {
#define NFTA_SECMARK_MAX (__NFTA_SECMARK_MAX - 1)
/* Max security context length */
-#define NFT_SECMARK_CTX_MAXLEN 256
+#define NFT_SECMARK_CTX_MAXLEN 4096
/**
* enum nft_reject_types - nf_tables reject expression reject types
diff --git a/include/uapi/linux/zorro_ids.h b/include/uapi/linux/zorro_ids.h
index 6e574d7b7d79..393f2ee9c042 100644
--- a/include/uapi/linux/zorro_ids.h
+++ b/include/uapi/linux/zorro_ids.h
@@ -449,6 +449,9 @@
#define ZORRO_PROD_VMC_ISDN_BLASTER_Z2 ZORRO_ID(VMC, 0x01, 0)
#define ZORRO_PROD_VMC_HYPERCOM_4 ZORRO_ID(VMC, 0x02, 0)
+#define ZORRO_MANUF_CSLAB 0x1400
+#define ZORRO_PROD_CSLAB_WARP_1260 ZORRO_ID(CSLAB, 0x65, 0)
+
#define ZORRO_MANUF_INFORMATION 0x157C
#define ZORRO_PROD_INFORMATION_ISDN_ENGINE_I ZORRO_ID(INFORMATION, 0x64, 0)
diff --git a/io_uring/io-wq.c b/io_uring/io-wq.c
index 98ac9dbcec2f..04503118cdc1 100644
--- a/io_uring/io-wq.c
+++ b/io_uring/io-wq.c
@@ -22,6 +22,7 @@
#include "io_uring.h"
#define WORKER_IDLE_TIMEOUT (5 * HZ)
+#define WORKER_INIT_LIMIT 3
enum {
IO_WORKER_F_UP = 1, /* up and active */
@@ -58,6 +59,7 @@ struct io_worker {
unsigned long create_state;
struct callback_head create_work;
int create_index;
+ int init_retries;
union {
struct rcu_head rcu;
@@ -729,7 +731,7 @@ static bool io_wq_work_match_all(struct io_wq_work *work, void *data)
return true;
}
-static inline bool io_should_retry_thread(long err)
+static inline bool io_should_retry_thread(struct io_worker *worker, long err)
{
/*
* Prevent perpetual task_work retry, if the task (or its group) is
@@ -737,6 +739,8 @@ static inline bool io_should_retry_thread(long err)
*/
if (fatal_signal_pending(current))
return false;
+ if (worker->init_retries++ >= WORKER_INIT_LIMIT)
+ return false;
switch (err) {
case -EAGAIN:
@@ -763,7 +767,7 @@ static void create_worker_cont(struct callback_head *cb)
io_init_new_worker(wqe, worker, tsk);
io_worker_release(worker);
return;
- } else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+ } else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
struct io_wqe_acct *acct = io_wqe_get_acct(worker);
atomic_dec(&acct->nr_running);
@@ -830,7 +834,7 @@ static bool create_io_worker(struct io_wq *wq, struct io_wqe *wqe, int index)
tsk = create_io_thread(io_wqe_worker, worker, wqe->node);
if (!IS_ERR(tsk)) {
io_init_new_worker(wqe, worker, tsk);
- } else if (!io_should_retry_thread(PTR_ERR(tsk))) {
+ } else if (!io_should_retry_thread(worker, PTR_ERR(tsk))) {
kfree(worker);
goto fail;
} else {
diff --git a/io_uring/io_uring.c b/io_uring/io_uring.c
index 958c3b619020..b21f2bafaeb0 100644
--- a/io_uring/io_uring.c
+++ b/io_uring/io_uring.c
@@ -3000,8 +3000,11 @@ __cold void io_uring_cancel_generic(bool cancel_all, struct io_sq_data *sqd)
bool loop = false;
io_uring_drop_tctx_refs(current);
+ if (!tctx_inflight(tctx, !cancel_all))
+ break;
+
/* read completions before cancelations */
- inflight = tctx_inflight(tctx, !cancel_all);
+ inflight = tctx_inflight(tctx, false);
if (!inflight)
break;
diff --git a/io_uring/timeout.c b/io_uring/timeout.c
index b0cf05ebcbcc..7cdc234c5f53 100644
--- a/io_uring/timeout.c
+++ b/io_uring/timeout.c
@@ -601,7 +601,7 @@ void io_queue_linked_timeout(struct io_kiocb *req)
static bool io_match_task(struct io_kiocb *head, struct task_struct *task,
bool cancel_all)
- __must_hold(&req->ctx->timeout_lock)
+ __must_hold(&head->ctx->timeout_lock)
{
struct io_kiocb *req;
diff --git a/kernel/bpf/btf.c b/kernel/bpf/btf.c
index 7582ec4fd413..bb88fd2266a8 100644
--- a/kernel/bpf/btf.c
+++ b/kernel/bpf/btf.c
@@ -378,7 +378,7 @@ const char *btf_type_str(const struct btf_type *t)
struct btf_show {
u64 flags;
void *target; /* target of show operation (seq file, buffer) */
- void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
+ __printf(2, 0) void (*showfn)(struct btf_show *show, const char *fmt, va_list args);
const struct btf *btf;
/* below are used during iteration */
struct {
@@ -6792,8 +6792,8 @@ static void btf_type_show(const struct btf *btf, u32 type_id, void *obj,
btf_type_ops(t)->show(btf, t, type_id, obj, 0, show);
}
-static void btf_seq_show(struct btf_show *show, const char *fmt,
- va_list args)
+__printf(2, 0) static void btf_seq_show(struct btf_show *show, const char *fmt,
+ va_list args)
{
seq_vprintf((struct seq_file *)show->target, fmt, args);
}
@@ -6826,8 +6826,8 @@ struct btf_show_snprintf {
int len; /* length we would have written */
};
-static void btf_snprintf_show(struct btf_show *show, const char *fmt,
- va_list args)
+__printf(2, 0) static void btf_snprintf_show(struct btf_show *show, const char *fmt,
+ va_list args)
{
struct btf_show_snprintf *ssnprintf = (struct btf_show_snprintf *)show;
int len;
diff --git a/kernel/bpf/dispatcher.c b/kernel/bpf/dispatcher.c
index c19719f48ce0..fa3e9225aedc 100644
--- a/kernel/bpf/dispatcher.c
+++ b/kernel/bpf/dispatcher.c
@@ -125,6 +125,11 @@ static void bpf_dispatcher_update(struct bpf_dispatcher *d, int prev_num_progs)
__BPF_DISPATCHER_UPDATE(d, new ?: (void *)&bpf_dispatcher_nop_func);
+ /* Make sure all the callers executing the previous/old half of the
+ * image leave it, so following update call can modify it safely.
+ */
+ synchronize_rcu();
+
if (new)
d->image_off = noff;
}
diff --git a/kernel/cgroup/cgroup-v1.c b/kernel/cgroup/cgroup-v1.c
index 289cc873cb71..c2d28ffee3b7 100644
--- a/kernel/cgroup/cgroup-v1.c
+++ b/kernel/cgroup/cgroup-v1.c
@@ -802,7 +802,7 @@ void cgroup1_release_agent(struct work_struct *work)
goto out_free;
ret = cgroup_path_ns(cgrp, pathbuf, PATH_MAX, &init_cgroup_ns);
- if (ret < 0 || ret >= PATH_MAX)
+ if (ret < 0)
goto out_free;
argv[0] = agentbuf;
diff --git a/kernel/cgroup/cgroup.c b/kernel/cgroup/cgroup.c
index 97ecca43386d..1e008ea467c0 100644
--- a/kernel/cgroup/cgroup.c
+++ b/kernel/cgroup/cgroup.c
@@ -1910,7 +1910,7 @@ int cgroup_show_path(struct seq_file *sf, struct kernfs_node *kf_node,
len = kernfs_path_from_node(kf_node, ns_cgroup->kn, buf, PATH_MAX);
spin_unlock_irq(&css_set_lock);
- if (len >= PATH_MAX)
+ if (len == -E2BIG)
len = -ERANGE;
else if (len > 0) {
seq_escape(sf, buf, " \t\n\\");
@@ -6287,7 +6287,7 @@ int proc_cgroup_show(struct seq_file *m, struct pid_namespace *ns,
if (cgroup_on_dfl(cgrp) || !(tsk->flags & PF_EXITING)) {
retval = cgroup_path_ns_locked(cgrp, buf, PATH_MAX,
current->nsproxy->cgroup_ns);
- if (retval >= PATH_MAX)
+ if (retval == -E2BIG)
retval = -ENAMETOOLONG;
if (retval < 0)
goto out_unlock;
diff --git a/kernel/cgroup/cpuset.c b/kernel/cgroup/cpuset.c
index 01f5a019e0f5..370a6bce20a8 100644
--- a/kernel/cgroup/cpuset.c
+++ b/kernel/cgroup/cpuset.c
@@ -21,6 +21,7 @@
* License. See the file COPYING in the main directory of the Linux
* distribution for more details.
*/
+#include "cgroup-internal.h"
#include <linux/cpu.h>
#include <linux/cpumask.h>
@@ -4213,11 +4214,15 @@ int proc_cpuset_show(struct seq_file *m, struct pid_namespace *ns,
if (!buf)
goto out;
- css = task_get_css(tsk, cpuset_cgrp_id);
- retval = cgroup_path_ns(css->cgroup, buf, PATH_MAX,
- current->nsproxy->cgroup_ns);
- css_put(css);
- if (retval >= PATH_MAX)
+ rcu_read_lock();
+ spin_lock_irq(&css_set_lock);
+ css = task_css(tsk, cpuset_cgrp_id);
+ retval = cgroup_path_ns_locked(css->cgroup, buf, PATH_MAX,
+ current->nsproxy->cgroup_ns);
+ spin_unlock_irq(&css_set_lock);
+ rcu_read_unlock();
+
+ if (retval == -E2BIG)
retval = -ENAMETOOLONG;
if (retval < 0)
goto out_free;
diff --git a/kernel/debug/kdb/kdb_io.c b/kernel/debug/kdb/kdb_io.c
index b1f79d5a5a60..d545abe08087 100644
--- a/kernel/debug/kdb/kdb_io.c
+++ b/kernel/debug/kdb/kdb_io.c
@@ -193,7 +193,7 @@ char kdb_getchar(void)
*/
static void kdb_position_cursor(char *prompt, char *buffer, char *cp)
{
- kdb_printf("\r%s", kdb_prompt_str);
+ kdb_printf("\r%s", prompt);
if (cp > buffer)
kdb_printf("%.*s", (int)(cp - buffer), buffer);
}
@@ -357,7 +357,7 @@ static char *kdb_read(char *buffer, size_t bufsize)
if (i >= dtab_count)
kdb_printf("...");
kdb_printf("\n");
- kdb_printf(kdb_prompt_str);
+ kdb_printf("%s", kdb_prompt_str);
kdb_printf("%s", buffer);
if (cp != lastchar)
kdb_position_cursor(kdb_prompt_str, buffer, cp);
@@ -449,7 +449,7 @@ char *kdb_getstr(char *buffer, size_t bufsize, const char *prompt)
{
if (prompt && kdb_prompt_str != prompt)
strscpy(kdb_prompt_str, prompt, CMD_BUFLEN);
- kdb_printf(kdb_prompt_str);
+ kdb_printf("%s", kdb_prompt_str);
kdb_nextline = 1; /* Prompt and input resets line number */
return kdb_read(buffer, bufsize);
}
diff --git a/kernel/dma/mapping.c b/kernel/dma/mapping.c
index 33437d620644..f1051ad0da7c 100644
--- a/kernel/dma/mapping.c
+++ b/kernel/dma/mapping.c
@@ -63,8 +63,8 @@ void dmam_free_coherent(struct device *dev, size_t size, void *vaddr,
{
struct dma_devres match_data = { size, vaddr, dma_handle };
- dma_free_coherent(dev, size, vaddr, dma_handle);
WARN_ON(devres_destroy(dev, dmam_release, dmam_match, &match_data));
+ dma_free_coherent(dev, size, vaddr, dma_handle);
}
EXPORT_SYMBOL(dmam_free_coherent);
diff --git a/kernel/events/core.c b/kernel/events/core.c
index 413a69aecf5c..ba099d5b41cd 100644
--- a/kernel/events/core.c
+++ b/kernel/events/core.c
@@ -2316,18 +2316,14 @@ event_sched_out(struct perf_event *event,
}
if (event->pending_sigtrap) {
- bool dec = true;
-
event->pending_sigtrap = 0;
if (state != PERF_EVENT_STATE_OFF &&
- !event->pending_work) {
+ !event->pending_work &&
+ !task_work_add(current, &event->pending_task, TWA_RESUME)) {
event->pending_work = 1;
- dec = false;
- WARN_ON_ONCE(!atomic_long_inc_not_zero(&event->refcount));
- task_work_add(current, &event->pending_task, TWA_RESUME);
- }
- if (dec)
+ } else {
local_dec(&event->ctx->nr_pending);
+ }
}
perf_event_set_state(event, state);
@@ -5007,9 +5003,35 @@ static bool exclusive_event_installable(struct perf_event *event,
static void perf_addr_filters_splice(struct perf_event *event,
struct list_head *head);
+static void perf_pending_task_sync(struct perf_event *event)
+{
+ struct callback_head *head = &event->pending_task;
+
+ if (!event->pending_work)
+ return;
+ /*
+ * If the task is queued to the current task's queue, we
+ * obviously can't wait for it to complete. Simply cancel it.
+ */
+ if (task_work_cancel(current, head)) {
+ event->pending_work = 0;
+ local_dec(&event->ctx->nr_pending);
+ return;
+ }
+
+ /*
+ * All accesses related to the event are within the same
+ * non-preemptible section in perf_pending_task(). The RCU
+ * grace period before the event is freed will make sure all
+ * those accesses are complete by then.
+ */
+ rcuwait_wait_event(&event->pending_work_wait, !event->pending_work, TASK_UNINTERRUPTIBLE);
+}
+
static void _free_event(struct perf_event *event)
{
irq_work_sync(&event->pending_irq);
+ perf_pending_task_sync(event);
unaccount_event(event);
@@ -6307,6 +6329,8 @@ static int perf_mmap(struct file *file, struct vm_area_struct *vma)
return -EINVAL;
nr_pages = vma_size / PAGE_SIZE;
+ if (nr_pages > INT_MAX)
+ return -ENOMEM;
mutex_lock(&event->mmap_mutex);
ret = -EINVAL;
@@ -6637,24 +6661,28 @@ static void perf_pending_task(struct callback_head *head)
struct perf_event *event = container_of(head, struct perf_event, pending_task);
int rctx;
+ /*
+ * All accesses to the event must belong to the same implicit RCU read-side
+ * critical section as the ->pending_work reset. See comment in
+ * perf_pending_task_sync().
+ */
+ preempt_disable_notrace();
/*
* If we 'fail' here, that's OK, it means recursion is already disabled
* and we won't recurse 'further'.
*/
- preempt_disable_notrace();
rctx = perf_swevent_get_recursion_context();
if (event->pending_work) {
event->pending_work = 0;
perf_sigtrap(event);
local_dec(&event->ctx->nr_pending);
+ rcuwait_wake_up(&event->pending_work_wait);
}
if (rctx >= 0)
perf_swevent_put_recursion_context(rctx);
preempt_enable_notrace();
-
- put_event(event);
}
#ifdef CONFIG_GUEST_PERF_EVENTS
@@ -9095,21 +9123,19 @@ static void perf_event_bpf_emit_ksymbols(struct bpf_prog *prog,
bool unregister = type == PERF_BPF_EVENT_PROG_UNLOAD;
int i;
- if (prog->aux->func_cnt == 0) {
- perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
- (u64)(unsigned long)prog->bpf_func,
- prog->jited_len, unregister,
- prog->aux->ksym.name);
- } else {
- for (i = 0; i < prog->aux->func_cnt; i++) {
- struct bpf_prog *subprog = prog->aux->func[i];
-
- perf_event_ksymbol(
- PERF_RECORD_KSYMBOL_TYPE_BPF,
- (u64)(unsigned long)subprog->bpf_func,
- subprog->jited_len, unregister,
- subprog->aux->ksym.name);
- }
+ perf_event_ksymbol(PERF_RECORD_KSYMBOL_TYPE_BPF,
+ (u64)(unsigned long)prog->bpf_func,
+ prog->jited_len, unregister,
+ prog->aux->ksym.name);
+
+ for (i = 1; i < prog->aux->func_cnt; i++) {
+ struct bpf_prog *subprog = prog->aux->func[i];
+
+ perf_event_ksymbol(
+ PERF_RECORD_KSYMBOL_TYPE_BPF,
+ (u64)(unsigned long)subprog->bpf_func,
+ subprog->jited_len, unregister,
+ subprog->aux->ksym.name);
}
}
@@ -11780,6 +11806,7 @@ perf_event_alloc(struct perf_event_attr *attr, int cpu,
init_waitqueue_head(&event->waitq);
init_irq_work(&event->pending_irq, perf_pending_irq);
init_task_work(&event->pending_task, perf_pending_task);
+ rcuwait_init(&event->pending_work_wait);
mutex_init(&event->mmap_mutex);
raw_spin_lock_init(&event->addr_filters.lock);
diff --git a/kernel/events/internal.h b/kernel/events/internal.h
index 5150d5f84c03..386d21c7edfa 100644
--- a/kernel/events/internal.h
+++ b/kernel/events/internal.h
@@ -128,7 +128,7 @@ static inline unsigned long perf_data_size(struct perf_buffer *rb)
static inline unsigned long perf_aux_size(struct perf_buffer *rb)
{
- return rb->aux_nr_pages << PAGE_SHIFT;
+ return (unsigned long)rb->aux_nr_pages << PAGE_SHIFT;
}
#define __DEFINE_OUTPUT_COPY_BODY(advance_buf, memcpy_func, ...) \
diff --git a/kernel/events/ring_buffer.c b/kernel/events/ring_buffer.c
index 45965f13757e..f3a3c294ff2b 100644
--- a/kernel/events/ring_buffer.c
+++ b/kernel/events/ring_buffer.c
@@ -683,7 +683,9 @@ int rb_alloc_aux(struct perf_buffer *rb, struct perf_event *event,
* max_order, to aid PMU drivers in double buffering.
*/
if (!watermark)
- watermark = nr_pages << (PAGE_SHIFT - 1);
+ watermark = min_t(unsigned long,
+ U32_MAX,
+ (unsigned long)nr_pages << (PAGE_SHIFT - 1));
/*
* Use aux_watermark as the basis for chunking to
diff --git a/kernel/irq/manage.c b/kernel/irq/manage.c
index 40fe7806cc8c..a5843563d015 100644
--- a/kernel/irq/manage.c
+++ b/kernel/irq/manage.c
@@ -1324,7 +1324,7 @@ static int irq_thread(void *data)
* synchronize_hardirq(). So neither IRQTF_RUNTHREAD nor the
* oneshot mask bit can be set.
*/
- task_work_cancel(current, irq_thread_dtor);
+ task_work_cancel_func(current, irq_thread_dtor);
return 0;
}
diff --git a/kernel/jump_label.c b/kernel/jump_label.c
index 714ac4c3b556..eec802175ccc 100644
--- a/kernel/jump_label.c
+++ b/kernel/jump_label.c
@@ -113,30 +113,51 @@ int static_key_count(struct static_key *key)
}
EXPORT_SYMBOL_GPL(static_key_count);
-void static_key_slow_inc_cpuslocked(struct static_key *key)
+/*
+ * static_key_fast_inc_not_disabled - adds a user for a static key
+ * @key: static key that must be already enabled
+ *
+ * The caller must make sure that the static key can't get disabled while
+ * in this function. It doesn't patch jump labels, only adds a user to
+ * an already enabled static key.
+ *
+ * Returns true if the increment was done. Unlike refcount_t the ref counter
+ * is not saturated, but will fail to increment on overflow.
+ */
+bool static_key_fast_inc_not_disabled(struct static_key *key)
{
- int v, v1;
+ int v;
STATIC_KEY_CHECK_USE(key);
+ /*
+ * Negative key->enabled has a special meaning: it sends
+ * static_key_slow_inc/dec() down the slow path, and it is non-zero
+ * so it counts as "enabled" in jump_label_update(). Note that
+ * atomic_inc_unless_negative() checks >= 0, so roll our own.
+ */
+ v = atomic_read(&key->enabled);
+ do {
+ if (v <= 0 || (v + 1) < 0)
+ return false;
+ } while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v + 1)));
+
+ return true;
+}
+EXPORT_SYMBOL_GPL(static_key_fast_inc_not_disabled);
+
+bool static_key_slow_inc_cpuslocked(struct static_key *key)
+{
lockdep_assert_cpus_held();
/*
- * Careful if we get concurrent static_key_slow_inc() calls;
+ * Careful if we get concurrent static_key_slow_inc/dec() calls;
* later calls must wait for the first one to _finish_ the
* jump_label_update() process. At the same time, however,
* the jump_label_update() call below wants to see
* static_key_enabled(&key) for jumps to be updated properly.
- *
- * So give a special meaning to negative key->enabled: it sends
- * static_key_slow_inc() down the slow path, and it is non-zero
- * so it counts as "enabled" in jump_label_update(). Note that
- * atomic_inc_unless_negative() checks >= 0, so roll our own.
*/
- for (v = atomic_read(&key->enabled); v > 0; v = v1) {
- v1 = atomic_cmpxchg(&key->enabled, v, v + 1);
- if (likely(v1 == v))
- return;
- }
+ if (static_key_fast_inc_not_disabled(key))
+ return true;
jump_label_lock();
if (atomic_read(&key->enabled) == 0) {
@@ -148,16 +169,23 @@ void static_key_slow_inc_cpuslocked(struct static_key *key)
*/
atomic_set_release(&key->enabled, 1);
} else {
- atomic_inc(&key->enabled);
+ if (WARN_ON_ONCE(!static_key_fast_inc_not_disabled(key))) {
+ jump_label_unlock();
+ return false;
+ }
}
jump_label_unlock();
+ return true;
}
-void static_key_slow_inc(struct static_key *key)
+bool static_key_slow_inc(struct static_key *key)
{
+ bool ret;
+
cpus_read_lock();
- static_key_slow_inc_cpuslocked(key);
+ ret = static_key_slow_inc_cpuslocked(key);
cpus_read_unlock();
+ return ret;
}
EXPORT_SYMBOL_GPL(static_key_slow_inc);
@@ -219,20 +247,32 @@ EXPORT_SYMBOL_GPL(static_key_disable);
static bool static_key_slow_try_dec(struct static_key *key)
{
- int val;
-
- val = atomic_fetch_add_unless(&key->enabled, -1, 1);
- if (val == 1)
- return false;
+ int v;
/*
- * The negative count check is valid even when a negative
- * key->enabled is in use by static_key_slow_inc(); a
- * __static_key_slow_dec() before the first static_key_slow_inc()
- * returns is unbalanced, because all other static_key_slow_inc()
- * instances block while the update is in progress.
+ * Go into the slow path if key::enabled is less than or equal than
+ * one. One is valid to shut down the key, anything less than one
+ * is an imbalance, which is handled at the call site.
+ *
+ * That includes the special case of '-1' which is set in
+ * static_key_slow_inc_cpuslocked(), but that's harmless as it is
+ * fully serialized in the slow path below. By the time this task
+ * acquires the jump label lock the value is back to one and the
+ * retry under the lock must succeed.
*/
- WARN(val < 0, "jump label: negative count!\n");
+ v = atomic_read(&key->enabled);
+ do {
+ /*
+ * Warn about the '-1' case though; since that means a
+ * decrement is concurrent with a first (0->1) increment. IOW
+ * people are trying to disable something that wasn't yet fully
+ * enabled. This suggests an ordering problem on the user side.
+ */
+ WARN_ON_ONCE(v < 0);
+ if (v <= 1)
+ return false;
+ } while (!likely(atomic_try_cmpxchg(&key->enabled, &v, v - 1)));
+
return true;
}
@@ -243,10 +283,11 @@ static void __static_key_slow_dec_cpuslocked(struct static_key *key)
if (static_key_slow_try_dec(key))
return;
- jump_label_lock();
- if (atomic_dec_and_test(&key->enabled))
+ guard(mutex)(&jump_label_mutex);
+ if (atomic_cmpxchg(&key->enabled, 1, 0))
jump_label_update(key);
- jump_label_unlock();
+ else
+ WARN_ON_ONCE(!static_key_slow_try_dec(key));
}
static void __static_key_slow_dec(struct static_key *key)
diff --git a/kernel/locking/rwsem.c b/kernel/locking/rwsem.c
index 92d8e2c4edda..ffc2bbe39187 100644
--- a/kernel/locking/rwsem.c
+++ b/kernel/locking/rwsem.c
@@ -1308,7 +1308,7 @@ static inline int __down_read_trylock(struct rw_semaphore *sem)
/*
* lock for writing
*/
-static inline int __down_write_common(struct rw_semaphore *sem, int state)
+static __always_inline int __down_write_common(struct rw_semaphore *sem, int state)
{
if (unlikely(!rwsem_write_trylock(sem))) {
if (IS_ERR(rwsem_down_write_slowpath(sem, state)))
@@ -1318,12 +1318,12 @@ static inline int __down_write_common(struct rw_semaphore *sem, int state)
return 0;
}
-static inline void __down_write(struct rw_semaphore *sem)
+static __always_inline void __down_write(struct rw_semaphore *sem)
{
__down_write_common(sem, TASK_UNINTERRUPTIBLE);
}
-static inline int __down_write_killable(struct rw_semaphore *sem)
+static __always_inline int __down_write_killable(struct rw_semaphore *sem)
{
return __down_write_common(sem, TASK_KILLABLE);
}
diff --git a/kernel/rcu/tasks.h b/kernel/rcu/tasks.h
index 6f48f565e3ac..456c956f481e 100644
--- a/kernel/rcu/tasks.h
+++ b/kernel/rcu/tasks.h
@@ -1531,6 +1531,16 @@ static void rcu_tasks_trace_pregp_step(struct list_head *hop)
// allow safe access to the hop list.
for_each_online_cpu(cpu) {
rcu_read_lock();
+ // Note that cpu_curr_snapshot() picks up the target
+ // CPU's current task while its runqueue is locked with
+ // an smp_mb__after_spinlock(). This ensures that either
+ // the grace-period kthread will see that task's read-side
+ // critical section or the task will see the updater's pre-GP
+ // accesses. The trailing smp_mb() in cpu_curr_snapshot()
+ // does not currently play a role other than simplify
+ // that function's ordering semantics. If these simplified
+ // ordering semantics continue to be redundant, that smp_mb()
+ // might be removed.
t = cpu_curr_snapshot(cpu);
if (rcu_tasks_trace_pertask_prep(t, true))
trc_add_holdout(t, hop);
diff --git a/kernel/sched/core.c b/kernel/sched/core.c
index cac41c49bd2f..4a96bf1d2f37 100644
--- a/kernel/sched/core.c
+++ b/kernel/sched/core.c
@@ -1259,27 +1259,24 @@ int tg_nop(struct task_group *tg, void *data)
static void set_load_weight(struct task_struct *p, bool update_load)
{
int prio = p->static_prio - MAX_RT_PRIO;
- struct load_weight *load = &p->se.load;
+ struct load_weight lw;
- /*
- * SCHED_IDLE tasks get minimal weight:
- */
if (task_has_idle_policy(p)) {
- load->weight = scale_load(WEIGHT_IDLEPRIO);
- load->inv_weight = WMULT_IDLEPRIO;
- return;
+ lw.weight = scale_load(WEIGHT_IDLEPRIO);
+ lw.inv_weight = WMULT_IDLEPRIO;
+ } else {
+ lw.weight = scale_load(sched_prio_to_weight[prio]);
+ lw.inv_weight = sched_prio_to_wmult[prio];
}
/*
* SCHED_OTHER tasks have to update their load when changing their
* weight
*/
- if (update_load && p->sched_class == &fair_sched_class) {
- reweight_task(p, prio);
- } else {
- load->weight = scale_load(sched_prio_to_weight[prio]);
- load->inv_weight = sched_prio_to_wmult[prio];
- }
+ if (update_load && p->sched_class == &fair_sched_class)
+ reweight_task(p, &lw);
+ else
+ p->se.load = lw;
}
#ifdef CONFIG_UCLAMP_TASK
@@ -4318,12 +4315,7 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
* @cpu: The CPU on which to snapshot the task.
*
* Returns the task_struct pointer of the task "currently" running on
- * the specified CPU. If the same task is running on that CPU throughout,
- * the return value will be a pointer to that task's task_struct structure.
- * If the CPU did any context switches even vaguely concurrently with the
- * execution of this function, the return value will be a pointer to the
- * task_struct structure of a randomly chosen task that was running on
- * that CPU somewhere around the time that this function was executing.
+ * the specified CPU.
*
* If the specified CPU was offline, the return value is whatever it
* is, perhaps a pointer to the task_struct structure of that CPU's idle
@@ -4337,11 +4329,16 @@ int task_call_func(struct task_struct *p, task_call_f func, void *arg)
*/
struct task_struct *cpu_curr_snapshot(int cpu)
{
+ struct rq *rq = cpu_rq(cpu);
struct task_struct *t;
+ struct rq_flags rf;
- smp_mb(); /* Pairing determined by caller's synchronization design. */
+ rq_lock_irqsave(rq, &rf);
+ smp_mb__after_spinlock(); /* Pairing determined by caller's synchronization design. */
t = rcu_dereference(cpu_curr(cpu));
+ rq_unlock_irqrestore(rq, &rf);
smp_mb(); /* Pairing determined by caller's synchronization design. */
+
return t;
}
diff --git a/kernel/sched/fair.c b/kernel/sched/fair.c
index d0851610cf46..1e12f731a033 100644
--- a/kernel/sched/fair.c
+++ b/kernel/sched/fair.c
@@ -3330,15 +3330,14 @@ static void reweight_entity(struct cfs_rq *cfs_rq, struct sched_entity *se,
}
-void reweight_task(struct task_struct *p, int prio)
+void reweight_task(struct task_struct *p, const struct load_weight *lw)
{
struct sched_entity *se = &p->se;
struct cfs_rq *cfs_rq = cfs_rq_of(se);
struct load_weight *load = &se->load;
- unsigned long weight = scale_load(sched_prio_to_weight[prio]);
- reweight_entity(cfs_rq, se, weight);
- load->inv_weight = sched_prio_to_wmult[prio];
+ reweight_entity(cfs_rq, se, lw->weight);
+ load->inv_weight = lw->inv_weight;
}
static inline int throttled_hierarchy(struct cfs_rq *cfs_rq);
@@ -8525,7 +8524,7 @@ static int detach_tasks(struct lb_env *env)
case migrate_util:
util = task_util_est(p);
- if (util > env->imbalance)
+ if (shr_bound(util, env->sd->nr_balance_failed) > env->imbalance)
goto next;
env->imbalance -= util;
diff --git a/kernel/sched/sched.h b/kernel/sched/sched.h
index 81d9698f0a1e..f0c3d0d4a0dd 100644
--- a/kernel/sched/sched.h
+++ b/kernel/sched/sched.h
@@ -2346,7 +2346,7 @@ extern void init_sched_dl_class(void);
extern void init_sched_rt_class(void);
extern void init_sched_fair_class(void);
-extern void reweight_task(struct task_struct *p, int prio);
+extern void reweight_task(struct task_struct *p, const struct load_weight *lw);
extern void resched_curr(struct rq *rq);
extern void resched_cpu(int cpu);
diff --git a/kernel/signal.c b/kernel/signal.c
index 5d45f5da2b36..4bebd2443cc3 100644
--- a/kernel/signal.c
+++ b/kernel/signal.c
@@ -2558,6 +2558,14 @@ static void do_freezer_trap(void)
spin_unlock_irq(¤t->sighand->siglock);
cgroup_enter_frozen();
schedule();
+
+ /*
+ * We could've been woken by task_work, run it to clear
+ * TIF_NOTIFY_SIGNAL. The caller will retry if necessary.
+ */
+ clear_notify_signal();
+ if (unlikely(task_work_pending(current)))
+ task_work_run();
}
static int ptrace_signal(int signr, kernel_siginfo_t *info, enum pid_type type)
diff --git a/kernel/task_work.c b/kernel/task_work.c
index 065e1ef8fc8d..ffba54734cdb 100644
--- a/kernel/task_work.c
+++ b/kernel/task_work.c
@@ -119,9 +119,9 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
}
/**
- * task_work_cancel - cancel a pending work added by task_work_add()
- * @task: the task which should execute the work
- * @func: identifies the work to remove
+ * task_work_cancel_func - cancel a pending work matching a function added by task_work_add()
+ * @task: the task which should execute the func's work
+ * @func: identifies the func to match with a work to remove
*
* Find the last queued pending work with ->func == @func and remove
* it from queue.
@@ -130,11 +130,35 @@ static bool task_work_func_match(struct callback_head *cb, void *data)
* The found work or NULL if not found.
*/
struct callback_head *
-task_work_cancel(struct task_struct *task, task_work_func_t func)
+task_work_cancel_func(struct task_struct *task, task_work_func_t func)
{
return task_work_cancel_match(task, task_work_func_match, func);
}
+static bool task_work_match(struct callback_head *cb, void *data)
+{
+ return cb == data;
+}
+
+/**
+ * task_work_cancel - cancel a pending work added by task_work_add()
+ * @task: the task which should execute the work
+ * @cb: the callback to remove if queued
+ *
+ * Remove a callback from a task's queue if queued.
+ *
+ * RETURNS:
+ * True if the callback was queued and got cancelled, false otherwise.
+ */
+bool task_work_cancel(struct task_struct *task, struct callback_head *cb)
+{
+ struct callback_head *ret;
+
+ ret = task_work_cancel_match(task, task_work_match, cb);
+
+ return ret == cb;
+}
+
/**
* task_work_run - execute the works added by task_work_add()
*
@@ -167,7 +191,7 @@ void task_work_run(void)
if (!work)
break;
/*
- * Synchronize with task_work_cancel(). It can not remove
+ * Synchronize with task_work_cancel_match(). It can not remove
* the first entry == work, cmpxchg(task_works) must fail.
* But it can remove another entry from the ->next list.
*/
diff --git a/kernel/time/tick-broadcast.c b/kernel/time/tick-broadcast.c
index 0916cc9adb82..ba551ec546f5 100644
--- a/kernel/time/tick-broadcast.c
+++ b/kernel/time/tick-broadcast.c
@@ -1137,6 +1137,7 @@ void tick_broadcast_switch_to_oneshot(void)
#ifdef CONFIG_HOTPLUG_CPU
void hotplug_cpu__broadcast_tick_pull(int deadcpu)
{
+ struct tick_device *td = this_cpu_ptr(&tick_cpu_device);
struct clock_event_device *bc;
unsigned long flags;
@@ -1144,6 +1145,28 @@ void hotplug_cpu__broadcast_tick_pull(int deadcpu)
bc = tick_broadcast_device.evtdev;
if (bc && broadcast_needs_cpu(bc, deadcpu)) {
+ /*
+ * If the broadcast force bit of the current CPU is set,
+ * then the current CPU has not yet reprogrammed the local
+ * timer device to avoid a ping-pong race. See
+ * ___tick_broadcast_oneshot_control().
+ *
+ * If the broadcast device is hrtimer based then
+ * programming the broadcast event below does not have any
+ * effect because the local clockevent device is not
+ * running and not programmed because the broadcast event
+ * is not earlier than the pending event of the local clock
+ * event device. As a consequence all CPUs waiting for a
+ * broadcast event are stuck forever.
+ *
+ * Detect this condition and reprogram the cpu local timer
+ * device to avoid the starvation.
+ */
+ if (tick_check_broadcast_expired()) {
+ cpumask_clear_cpu(smp_processor_id(), tick_broadcast_force_mask);
+ tick_program_event(td->evtdev->next_event, 1);
+ }
+
/* This moves the broadcast assignment to this CPU: */
clockevents_program_event(bc, bc->next_event, 1);
}
diff --git a/kernel/trace/pid_list.c b/kernel/trace/pid_list.c
index 95106d02b32d..85de221c0b6f 100644
--- a/kernel/trace/pid_list.c
+++ b/kernel/trace/pid_list.c
@@ -354,7 +354,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
while (upper_count-- > 0) {
union upper_chunk *chunk;
- chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+ chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
if (!chunk)
break;
*upper_next = chunk;
@@ -365,7 +365,7 @@ static void pid_list_refill_irq(struct irq_work *iwork)
while (lower_count-- > 0) {
union lower_chunk *chunk;
- chunk = kzalloc(sizeof(*chunk), GFP_KERNEL);
+ chunk = kzalloc(sizeof(*chunk), GFP_NOWAIT);
if (!chunk)
break;
*lower_next = chunk;
diff --git a/kernel/watchdog_hld.c b/kernel/watchdog_hld.c
index 1e8a49dc956e..8ba4b269ab89 100644
--- a/kernel/watchdog_hld.c
+++ b/kernel/watchdog_hld.c
@@ -91,11 +91,15 @@ static bool watchdog_check_timestamp(void)
__this_cpu_write(last_timestamp, now);
return true;
}
-#else
-static inline bool watchdog_check_timestamp(void)
+
+static void watchdog_init_timestamp(void)
{
- return true;
+ __this_cpu_write(nmi_rearmed, 0);
+ __this_cpu_write(last_timestamp, ktime_get_mono_fast_ns());
}
+#else
+static inline bool watchdog_check_timestamp(void) { return true; }
+static inline void watchdog_init_timestamp(void) { }
#endif
static struct perf_event_attr wd_hw_attr = {
@@ -196,6 +200,7 @@ void hardlockup_detector_perf_enable(void)
if (!atomic_fetch_inc(&watchdog_cpus))
pr_info("Enabled. Permanently consumes one hw-PMU counter.\n");
+ watchdog_init_timestamp();
perf_event_enable(this_cpu_read(watchdog_ev));
}
diff --git a/lib/decompress_bunzip2.c b/lib/decompress_bunzip2.c
index 3518e7394eca..ca736166f100 100644
--- a/lib/decompress_bunzip2.c
+++ b/lib/decompress_bunzip2.c
@@ -232,7 +232,8 @@ static int INIT get_next_block(struct bunzip_data *bd)
RUNB) */
symCount = symTotal+2;
for (j = 0; j < groupCount; j++) {
- unsigned char length[MAX_SYMBOLS], temp[MAX_HUFCODE_BITS+1];
+ unsigned char length[MAX_SYMBOLS];
+ unsigned short temp[MAX_HUFCODE_BITS+1];
int minLen, maxLen, pp;
/* Read Huffman code lengths for each symbol. They're
stored in a way similar to mtf; record a starting
diff --git a/lib/kobject_uevent.c b/lib/kobject_uevent.c
index 7c44b7ae4c5c..d397b1ad5ccf 100644
--- a/lib/kobject_uevent.c
+++ b/lib/kobject_uevent.c
@@ -432,8 +432,23 @@ static void zap_modalias_env(struct kobj_uevent_env *env)
len = strlen(env->envp[i]) + 1;
if (i != env->envp_idx - 1) {
+ /* @env->envp[] contains pointers to @env->buf[]
+ * with @env->buflen chars, and we are removing
+ * variable MODALIAS here pointed by @env->envp[i]
+ * with length @len as shown below:
+ *
+ * 0 @env->buf[] @env->buflen
+ * ---------------------------------------------
+ * ^ ^ ^ ^
+ * | |-> @len <-| target block |
+ * @env->envp[0] @env->envp[i] @env->envp[i + 1]
+ *
+ * so the "target block" indicated above is moved
+ * backward by @len, and its right size is
+ * @env->buflen - (@env->envp[i + 1] - @env->envp[0]).
+ */
memmove(env->envp[i], env->envp[i + 1],
- env->buflen - len);
+ env->buflen - (env->envp[i + 1] - env->envp[0]));
for (j = i; j < env->envp_idx - 1; j++)
env->envp[j] = env->envp[j + 1] - len;
diff --git a/lib/objagg.c b/lib/objagg.c
index 1e248629ed64..1608895b009c 100644
--- a/lib/objagg.c
+++ b/lib/objagg.c
@@ -167,6 +167,9 @@ static int objagg_obj_parent_assign(struct objagg *objagg,
{
void *delta_priv;
+ if (WARN_ON(!objagg_obj_is_root(parent)))
+ return -EINVAL;
+
delta_priv = objagg->ops->delta_create(objagg->priv, parent->obj,
objagg_obj->obj);
if (IS_ERR(delta_priv))
@@ -903,20 +906,6 @@ static const struct objagg_opt_algo *objagg_opt_algos[] = {
[OBJAGG_OPT_ALGO_SIMPLE_GREEDY] = &objagg_opt_simple_greedy,
};
-static int objagg_hints_obj_cmp(struct rhashtable_compare_arg *arg,
- const void *obj)
-{
- struct rhashtable *ht = arg->ht;
- struct objagg_hints *objagg_hints =
- container_of(ht, struct objagg_hints, node_ht);
- const struct objagg_ops *ops = objagg_hints->ops;
- const char *ptr = obj;
-
- ptr += ht->p.key_offset;
- return ops->hints_obj_cmp ? ops->hints_obj_cmp(ptr, arg->key) :
- memcmp(ptr, arg->key, ht->p.key_len);
-}
-
/**
* objagg_hints_get - obtains hints instance
* @objagg: objagg instance
@@ -955,7 +944,6 @@ struct objagg_hints *objagg_hints_get(struct objagg *objagg,
offsetof(struct objagg_hints_node, obj);
objagg_hints->ht_params.head_offset =
offsetof(struct objagg_hints_node, ht_node);
- objagg_hints->ht_params.obj_cmpfn = objagg_hints_obj_cmp;
err = rhashtable_init(&objagg_hints->node_ht, &objagg_hints->ht_params);
if (err)
diff --git a/lib/sbitmap.c b/lib/sbitmap.c
index c515072eca29..61075535a807 100644
--- a/lib/sbitmap.c
+++ b/lib/sbitmap.c
@@ -60,12 +60,30 @@ static inline void update_alloc_hint_after_get(struct sbitmap *sb,
/*
* See if we have deferred clears that we can batch move
*/
-static inline bool sbitmap_deferred_clear(struct sbitmap_word *map)
+static inline bool sbitmap_deferred_clear(struct sbitmap_word *map,
+ unsigned int depth, unsigned int alloc_hint, bool wrap)
{
- unsigned long mask;
+ unsigned long mask, word_mask;
- if (!READ_ONCE(map->cleared))
- return false;
+ guard(spinlock_irqsave)(&map->swap_lock);
+
+ if (!map->cleared) {
+ if (depth == 0)
+ return false;
+
+ word_mask = (~0UL) >> (BITS_PER_LONG - depth);
+ /*
+ * The current behavior is to always retry after moving
+ * ->cleared to word, and we change it to retry in case
+ * of any free bits. To avoid an infinite loop, we need
+ * to take wrap & alloc_hint into account, otherwise a
+ * soft lockup may occur.
+ */
+ if (!wrap && alloc_hint)
+ word_mask &= ~((1UL << alloc_hint) - 1);
+
+ return (READ_ONCE(map->word) & word_mask) != word_mask;
+ }
/*
* First get a stable cleared mask, setting the old mask to 0.
@@ -85,6 +103,7 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
bool alloc_hint)
{
unsigned int bits_per_word;
+ int i;
if (shift < 0)
shift = sbitmap_calculate_shift(depth);
@@ -116,6 +135,9 @@ int sbitmap_init_node(struct sbitmap *sb, unsigned int depth, int shift,
return -ENOMEM;
}
+ for (i = 0; i < sb->map_nr; i++)
+ spin_lock_init(&sb->map[i].swap_lock);
+
return 0;
}
EXPORT_SYMBOL_GPL(sbitmap_init_node);
@@ -126,7 +148,7 @@ void sbitmap_resize(struct sbitmap *sb, unsigned int depth)
unsigned int i;
for (i = 0; i < sb->map_nr; i++)
- sbitmap_deferred_clear(&sb->map[i]);
+ sbitmap_deferred_clear(&sb->map[i], 0, 0, 0);
sb->depth = depth;
sb->map_nr = DIV_ROUND_UP(sb->depth, bits_per_word);
@@ -167,18 +189,19 @@ static int __sbitmap_get_word(unsigned long *word, unsigned long depth,
return nr;
}
-static int sbitmap_find_bit_in_index(struct sbitmap *sb, int index,
- unsigned int alloc_hint)
+static int sbitmap_find_bit_in_word(struct sbitmap_word *map,
+ unsigned int depth,
+ unsigned int alloc_hint,
+ bool wrap)
{
- struct sbitmap_word *map = &sb->map[index];
int nr;
do {
- nr = __sbitmap_get_word(&map->word, __map_depth(sb, index),
- alloc_hint, !sb->round_robin);
+ nr = __sbitmap_get_word(&map->word, depth,
+ alloc_hint, wrap);
if (nr != -1)
break;
- if (!sbitmap_deferred_clear(map))
+ if (!sbitmap_deferred_clear(map, depth, alloc_hint, wrap))
break;
} while (1);
@@ -203,7 +226,9 @@ static int __sbitmap_get(struct sbitmap *sb, unsigned int alloc_hint)
alloc_hint = 0;
for (i = 0; i < sb->map_nr; i++) {
- nr = sbitmap_find_bit_in_index(sb, index, alloc_hint);
+ nr = sbitmap_find_bit_in_word(&sb->map[index],
+ __map_depth(sb, index),
+ alloc_hint, !sb->round_robin);
if (nr != -1) {
nr += index << sb->shift;
break;
@@ -243,30 +268,24 @@ static int __sbitmap_get_shallow(struct sbitmap *sb,
int nr = -1;
index = SB_NR_TO_INDEX(sb, alloc_hint);
+ alloc_hint = SB_NR_TO_BIT(sb, alloc_hint);
for (i = 0; i < sb->map_nr; i++) {
-again:
- nr = __sbitmap_get_word(&sb->map[index].word,
- min_t(unsigned int,
- __map_depth(sb, index),
- shallow_depth),
- SB_NR_TO_BIT(sb, alloc_hint), true);
+ nr = sbitmap_find_bit_in_word(&sb->map[index],
+ min_t(unsigned int,
+ __map_depth(sb, index),
+ shallow_depth),
+ alloc_hint, true);
+
if (nr != -1) {
nr += index << sb->shift;
break;
}
- if (sbitmap_deferred_clear(&sb->map[index]))
- goto again;
-
/* Jump to next index. */
- index++;
- alloc_hint = index << sb->shift;
-
- if (index >= sb->map_nr) {
+ alloc_hint = 0;
+ if (++index >= sb->map_nr)
index = 0;
- alloc_hint = 0;
- }
}
return nr;
@@ -506,18 +525,18 @@ unsigned long __sbitmap_queue_get_batch(struct sbitmap_queue *sbq, int nr_tags,
struct sbitmap_word *map = &sb->map[index];
unsigned long get_mask;
unsigned int map_depth = __map_depth(sb, index);
+ unsigned long val;
- sbitmap_deferred_clear(map);
- if (map->word == (1UL << (map_depth - 1)) - 1)
+ sbitmap_deferred_clear(map, 0, 0, 0);
+ val = READ_ONCE(map->word);
+ if (val == (1UL << (map_depth - 1)) - 1)
goto next;
- nr = find_first_zero_bit(&map->word, map_depth);
+ nr = find_first_zero_bit(&val, map_depth);
if (nr + nr_tags <= map_depth) {
atomic_long_t *ptr = (atomic_long_t *) &map->word;
- unsigned long val;
get_mask = ((1UL << nr_tags) - 1) << nr;
- val = READ_ONCE(map->word);
while (!atomic_long_try_cmpxchg(ptr, &val,
get_mask | val))
;
diff --git a/mm/hugetlb.c b/mm/hugetlb.c
index 87a14638fad0..05b8797163b2 100644
--- a/mm/hugetlb.c
+++ b/mm/hugetlb.c
@@ -4353,7 +4353,7 @@ void __init hugetlb_add_hstate(unsigned int order)
BUG_ON(hugetlb_max_hstate >= HUGE_MAX_HSTATE);
BUG_ON(order == 0);
h = &hstates[hugetlb_max_hstate++];
- mutex_init(&h->resize_lock);
+ __mutex_init(&h->resize_lock, "resize mutex", &h->resize_key);
h->order = order;
h->mask = ~(huge_page_size(h) - 1);
for (i = 0; i < MAX_NUMNODES; ++i)
diff --git a/mm/mempolicy.c b/mm/mempolicy.c
index 84e11c2caae4..399d8cb48813 100644
--- a/mm/mempolicy.c
+++ b/mm/mempolicy.c
@@ -3112,8 +3112,9 @@ int mpol_parse_str(char *str, struct mempolicy **mpol)
* @pol: pointer to mempolicy to be formatted
*
* Convert @pol into a string. If @buffer is too short, truncate the string.
- * Recommend a @maxlen of at least 32 for the longest mode, "interleave", the
- * longest flag, "relative", and to display at least a few node ids.
+ * Recommend a @maxlen of at least 51 for the longest mode, "weighted
+ * interleave", plus the longest flag flags, "relative|balancing", and to
+ * display at least a few node ids.
*/
void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
{
@@ -3122,7 +3123,10 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
unsigned short mode = MPOL_DEFAULT;
unsigned short flags = 0;
- if (pol && pol != &default_policy && !(pol->flags & MPOL_F_MORON)) {
+ if (pol &&
+ pol != &default_policy &&
+ !(pol >= &preferred_node_policy[0] &&
+ pol <= &preferred_node_policy[ARRAY_SIZE(preferred_node_policy) - 1])) {
mode = pol->mode;
flags = pol->flags;
}
@@ -3149,12 +3153,18 @@ void mpol_to_str(char *buffer, int maxlen, struct mempolicy *pol)
p += snprintf(p, buffer + maxlen - p, "=");
/*
- * Currently, the only defined flags are mutually exclusive
+ * Static and relative are mutually exclusive.
*/
if (flags & MPOL_F_STATIC_NODES)
p += snprintf(p, buffer + maxlen - p, "static");
else if (flags & MPOL_F_RELATIVE_NODES)
p += snprintf(p, buffer + maxlen - p, "relative");
+
+ if (flags & MPOL_F_NUMA_BALANCING) {
+ if (!is_power_of_2(flags & MPOL_MODE_FLAGS))
+ p += snprintf(p, buffer + maxlen - p, "|");
+ p += snprintf(p, buffer + maxlen - p, "balancing");
+ }
}
if (!nodes_empty(nodes))
diff --git a/mm/mmap_lock.c b/mm/mmap_lock.c
index 1854850b4b89..368b840e7508 100644
--- a/mm/mmap_lock.c
+++ b/mm/mmap_lock.c
@@ -19,14 +19,7 @@ EXPORT_TRACEPOINT_SYMBOL(mmap_lock_released);
#ifdef CONFIG_MEMCG
-/*
- * Our various events all share the same buffer (because we don't want or need
- * to allocate a set of buffers *per event type*), so we need to protect against
- * concurrent _reg() and _unreg() calls, and count how many _reg() calls have
- * been made.
- */
-static DEFINE_MUTEX(reg_lock);
-static int reg_refcount; /* Protected by reg_lock. */
+static atomic_t reg_refcount;
/*
* Size of the buffer for memcg path names. Ignoring stack trace support,
@@ -34,136 +27,22 @@ static int reg_refcount; /* Protected by reg_lock. */
*/
#define MEMCG_PATH_BUF_SIZE MAX_FILTER_STR_VAL
-/*
- * How many contexts our trace events might be called in: normal, softirq, irq,
- * and NMI.
- */
-#define CONTEXT_COUNT 4
-
-struct memcg_path {
- local_lock_t lock;
- char __rcu *buf;
- local_t buf_idx;
-};
-static DEFINE_PER_CPU(struct memcg_path, memcg_paths) = {
- .lock = INIT_LOCAL_LOCK(lock),
- .buf_idx = LOCAL_INIT(0),
-};
-
-static char **tmp_bufs;
-
-/* Called with reg_lock held. */
-static void free_memcg_path_bufs(void)
-{
- struct memcg_path *memcg_path;
- int cpu;
- char **old = tmp_bufs;
-
- for_each_possible_cpu(cpu) {
- memcg_path = per_cpu_ptr(&memcg_paths, cpu);
- *(old++) = rcu_dereference_protected(memcg_path->buf,
- lockdep_is_held(®_lock));
- rcu_assign_pointer(memcg_path->buf, NULL);
- }
-
- /* Wait for inflight memcg_path_buf users to finish. */
- synchronize_rcu();
-
- old = tmp_bufs;
- for_each_possible_cpu(cpu) {
- kfree(*(old++));
- }
-
- kfree(tmp_bufs);
- tmp_bufs = NULL;
-}
-
int trace_mmap_lock_reg(void)
{
- int cpu;
- char *new;
-
- mutex_lock(®_lock);
-
- /* If the refcount is going 0->1, proceed with allocating buffers. */
- if (reg_refcount++)
- goto out;
-
- tmp_bufs = kmalloc_array(num_possible_cpus(), sizeof(*tmp_bufs),
- GFP_KERNEL);
- if (tmp_bufs == NULL)
- goto out_fail;
-
- for_each_possible_cpu(cpu) {
- new = kmalloc(MEMCG_PATH_BUF_SIZE * CONTEXT_COUNT, GFP_KERNEL);
- if (new == NULL)
- goto out_fail_free;
- rcu_assign_pointer(per_cpu_ptr(&memcg_paths, cpu)->buf, new);
- /* Don't need to wait for inflights, they'd have gotten NULL. */
- }
-
-out:
- mutex_unlock(®_lock);
+ atomic_inc(®_refcount);
return 0;
-
-out_fail_free:
- free_memcg_path_bufs();
-out_fail:
- /* Since we failed, undo the earlier ref increment. */
- --reg_refcount;
-
- mutex_unlock(®_lock);
- return -ENOMEM;
}
void trace_mmap_lock_unreg(void)
{
- mutex_lock(®_lock);
-
- /* If the refcount is going 1->0, proceed with freeing buffers. */
- if (--reg_refcount)
- goto out;
-
- free_memcg_path_bufs();
-
-out:
- mutex_unlock(®_lock);
-}
-
-static inline char *get_memcg_path_buf(void)
-{
- struct memcg_path *memcg_path = this_cpu_ptr(&memcg_paths);
- char *buf;
- int idx;
-
- rcu_read_lock();
- buf = rcu_dereference(memcg_path->buf);
- if (buf == NULL) {
- rcu_read_unlock();
- return NULL;
- }
- idx = local_add_return(MEMCG_PATH_BUF_SIZE, &memcg_path->buf_idx) -
- MEMCG_PATH_BUF_SIZE;
- return &buf[idx];
+ atomic_dec(®_refcount);
}
-static inline void put_memcg_path_buf(void)
-{
- local_sub(MEMCG_PATH_BUF_SIZE, &this_cpu_ptr(&memcg_paths)->buf_idx);
- rcu_read_unlock();
-}
-
-#define TRACE_MMAP_LOCK_EVENT(type, mm, ...) \
- do { \
- const char *memcg_path; \
- local_lock(&memcg_paths.lock); \
- memcg_path = get_mm_memcg_path(mm); \
- trace_mmap_lock_##type(mm, \
- memcg_path != NULL ? memcg_path : "", \
- ##__VA_ARGS__); \
- if (likely(memcg_path != NULL)) \
- put_memcg_path_buf(); \
- local_unlock(&memcg_paths.lock); \
+#define TRACE_MMAP_LOCK_EVENT(type, mm, ...) \
+ do { \
+ char buf[MEMCG_PATH_BUF_SIZE]; \
+ get_mm_memcg_path(mm, buf, sizeof(buf)); \
+ trace_mmap_lock_##type(mm, buf, ##__VA_ARGS__); \
} while (0)
#else /* !CONFIG_MEMCG */
@@ -185,37 +64,23 @@ void trace_mmap_lock_unreg(void)
#ifdef CONFIG_TRACING
#ifdef CONFIG_MEMCG
/*
- * Write the given mm_struct's memcg path to a percpu buffer, and return a
- * pointer to it. If the path cannot be determined, or no buffer was available
- * (because the trace event is being unregistered), NULL is returned.
- *
- * Note: buffers are allocated per-cpu to avoid locking, so preemption must be
- * disabled by the caller before calling us, and re-enabled only after the
- * caller is done with the pointer.
- *
- * The caller must call put_memcg_path_buf() once the buffer is no longer
- * needed. This must be done while preemption is still disabled.
+ * Write the given mm_struct's memcg path to a buffer. If the path cannot be
+ * determined or the trace event is being unregistered, empty string is written.
*/
-static const char *get_mm_memcg_path(struct mm_struct *mm)
+static void get_mm_memcg_path(struct mm_struct *mm, char *buf, size_t buflen)
{
- char *buf = NULL;
- struct mem_cgroup *memcg = get_mem_cgroup_from_mm(mm);
+ struct mem_cgroup *memcg;
+ buf[0] = '\0';
+ /* No need to get path if no trace event is registered. */
+ if (!atomic_read(®_refcount))
+ return;
+ memcg = get_mem_cgroup_from_mm(mm);
if (memcg == NULL)
- goto out;
- if (unlikely(memcg->css.cgroup == NULL))
- goto out_put;
-
- buf = get_memcg_path_buf();
- if (buf == NULL)
- goto out_put;
-
- cgroup_path(memcg->css.cgroup, buf, MEMCG_PATH_BUF_SIZE);
-
-out_put:
+ return;
+ if (memcg->css.cgroup)
+ cgroup_path(memcg->css.cgroup, buf, buflen);
css_put(&memcg->css);
-out:
- return buf;
}
#endif /* CONFIG_MEMCG */
diff --git a/mm/vmscan.c b/mm/vmscan.c
index a3b1d8e5dbb3..4cd0cbf9c121 100644
--- a/mm/vmscan.c
+++ b/mm/vmscan.c
@@ -5065,7 +5065,6 @@ static int evict_folios(struct lruvec *lruvec, struct scan_control *sc, int swap
/* retry folios that may have missed folio_rotate_reclaimable() */
list_move(&folio->lru, &clean);
- sc->nr_scanned -= folio_nr_pages(folio);
}
spin_lock_irq(&lruvec->lru_lock);
diff --git a/net/bridge/br_forward.c b/net/bridge/br_forward.c
index 9661698e86e4..a32d73f38155 100644
--- a/net/bridge/br_forward.c
+++ b/net/bridge/br_forward.c
@@ -25,8 +25,8 @@ static inline int should_deliver(const struct net_bridge_port *p,
vg = nbp_vlan_group_rcu(p);
return ((p->flags & BR_HAIRPIN_MODE) || skb->dev != p->dev) &&
- p->state == BR_STATE_FORWARDING && br_allowed_egress(vg, skb) &&
- nbp_switchdev_allowed_egress(p, skb) &&
+ (br_mst_is_enabled(p->br) || p->state == BR_STATE_FORWARDING) &&
+ br_allowed_egress(vg, skb) && nbp_switchdev_allowed_egress(p, skb) &&
!br_skb_isolated(p, skb);
}
diff --git a/net/core/filter.c b/net/core/filter.c
index dc89c3424718..210b881cb50b 100644
--- a/net/core/filter.c
+++ b/net/core/filter.c
@@ -3518,13 +3518,20 @@ static int bpf_skb_net_grow(struct sk_buff *skb, u32 off, u32 len_diff,
if (skb_is_gso(skb)) {
struct skb_shared_info *shinfo = skb_shinfo(skb);
- /* Due to header grow, MSS needs to be downgraded. */
- if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO))
- skb_decrease_gso_size(shinfo, len_diff);
-
/* Header must be checked, and gso_segs recomputed. */
shinfo->gso_type |= gso_type;
shinfo->gso_segs = 0;
+
+ /* Due to header growth, MSS needs to be downgraded.
+ * There is a BUG_ON() when segmenting the frag_list with
+ * head_frag true, so linearize the skb after downgrading
+ * the MSS.
+ */
+ if (!(flags & BPF_F_ADJ_ROOM_FIXED_GSO)) {
+ skb_decrease_gso_size(shinfo, len_diff);
+ if (shinfo->frag_list)
+ return skb_linearize(skb);
+ }
}
return 0;
diff --git a/net/core/flow_dissector.c b/net/core/flow_dissector.c
index 0c85c8a9e752..fba8eb1bb281 100644
--- a/net/core/flow_dissector.c
+++ b/net/core/flow_dissector.c
@@ -1013,7 +1013,7 @@ bool __skb_flow_dissect(const struct net *net,
}
}
- WARN_ON_ONCE(!net);
+ DEBUG_NET_WARN_ON_ONCE(!net);
if (net) {
enum netns_bpf_attach_type type = NETNS_BPF_FLOW_DISSECTOR;
struct bpf_prog_array *run_array;
diff --git a/net/core/xdp.c b/net/core/xdp.c
index c3f6653b4274..90de33b7c9ce 100644
--- a/net/core/xdp.c
+++ b/net/core/xdp.c
@@ -124,10 +124,8 @@ void xdp_unreg_mem_model(struct xdp_mem_info *mem)
return;
if (type == MEM_TYPE_PAGE_POOL) {
- rcu_read_lock();
- xa = rhashtable_lookup(mem_id_ht, &id, mem_id_rht_params);
+ xa = rhashtable_lookup_fast(mem_id_ht, &id, mem_id_rht_params);
page_pool_destroy(xa->page_pool);
- rcu_read_unlock();
}
}
EXPORT_SYMBOL_GPL(xdp_unreg_mem_model);
diff --git a/net/ipv4/esp4.c b/net/ipv4/esp4.c
index e2546961add3..419969b26822 100644
--- a/net/ipv4/esp4.c
+++ b/net/ipv4/esp4.c
@@ -238,8 +238,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
#else
static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
{
- kfree_skb(skb);
-
+ WARN_ON(1);
return -EOPNOTSUPP;
}
#endif
diff --git a/net/ipv4/fib_semantics.c b/net/ipv4/fib_semantics.c
index 5eb1b8d302bb..e3268615a65a 100644
--- a/net/ipv4/fib_semantics.c
+++ b/net/ipv4/fib_semantics.c
@@ -2270,6 +2270,15 @@ void fib_select_path(struct net *net, struct fib_result *res,
fib_select_default(fl4, res);
check_saddr:
- if (!fl4->saddr)
- fl4->saddr = fib_result_prefsrc(net, res);
+ if (!fl4->saddr) {
+ struct net_device *l3mdev;
+
+ l3mdev = dev_get_by_index_rcu(net, fl4->flowi4_l3mdev);
+
+ if (!l3mdev ||
+ l3mdev_master_dev_rcu(FIB_RES_DEV(*res)) == l3mdev)
+ fl4->saddr = fib_result_prefsrc(net, res);
+ else
+ fl4->saddr = inet_select_addr(l3mdev, 0, RT_SCOPE_LINK);
+ }
}
diff --git a/net/ipv4/fib_trie.c b/net/ipv4/fib_trie.c
index 9bdfdab906fe..77b97c48da5e 100644
--- a/net/ipv4/fib_trie.c
+++ b/net/ipv4/fib_trie.c
@@ -1628,6 +1628,7 @@ int fib_table_lookup(struct fib_table *tb, const struct flowi4 *flp,
res->nhc = nhc;
res->type = fa->fa_type;
res->scope = fi->fib_scope;
+ res->dscp = fa->fa_dscp;
res->fi = fi;
res->table = tb;
res->fa_head = &n->leaf;
diff --git a/net/ipv4/nexthop.c b/net/ipv4/nexthop.c
index be5498f5dd31..bba955d82f72 100644
--- a/net/ipv4/nexthop.c
+++ b/net/ipv4/nexthop.c
@@ -676,9 +676,10 @@ static int nla_put_nh_group(struct sk_buff *skb, struct nh_group *nhg)
p = nla_data(nla);
for (i = 0; i < nhg->num_nh; ++i) {
- p->id = nhg->nh_entries[i].nh->id;
- p->weight = nhg->nh_entries[i].weight - 1;
- p += 1;
+ *p++ = (struct nexthop_grp) {
+ .id = nhg->nh_entries[i].nh->id,
+ .weight = nhg->nh_entries[i].weight - 1,
+ };
}
if (nhg->resilient && nla_put_nh_group_res(skb, nhg))
diff --git a/net/ipv4/route.c b/net/ipv4/route.c
index fcbacd39febe..fda88894d020 100644
--- a/net/ipv4/route.c
+++ b/net/ipv4/route.c
@@ -1275,7 +1275,7 @@ void ip_rt_get_source(u8 *addr, struct sk_buff *skb, struct rtable *rt)
struct flowi4 fl4 = {
.daddr = iph->daddr,
.saddr = iph->saddr,
- .flowi4_tos = RT_TOS(iph->tos),
+ .flowi4_tos = iph->tos & IPTOS_RT_MASK,
.flowi4_oif = rt->dst.dev->ifindex,
.flowi4_iif = skb->dev->ifindex,
.flowi4_mark = skb->mark,
@@ -2934,9 +2934,9 @@ EXPORT_SYMBOL_GPL(ip_route_output_tunnel);
/* called with rcu_read_lock held */
static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
- struct rtable *rt, u32 table_id, struct flowi4 *fl4,
- struct sk_buff *skb, u32 portid, u32 seq,
- unsigned int flags)
+ struct rtable *rt, u32 table_id, dscp_t dscp,
+ struct flowi4 *fl4, struct sk_buff *skb, u32 portid,
+ u32 seq, unsigned int flags)
{
struct rtmsg *r;
struct nlmsghdr *nlh;
@@ -2952,7 +2952,7 @@ static int rt_fill_info(struct net *net, __be32 dst, __be32 src,
r->rtm_family = AF_INET;
r->rtm_dst_len = 32;
r->rtm_src_len = 0;
- r->rtm_tos = fl4 ? fl4->flowi4_tos : 0;
+ r->rtm_tos = inet_dscp_to_dsfield(dscp);
r->rtm_table = table_id < 256 ? table_id : RT_TABLE_COMPAT;
if (nla_put_u32(skb, RTA_TABLE, table_id))
goto nla_put_failure;
@@ -3102,7 +3102,7 @@ static int fnhe_dump_bucket(struct net *net, struct sk_buff *skb,
goto next;
err = rt_fill_info(net, fnhe->fnhe_daddr, 0, rt,
- table_id, NULL, skb,
+ table_id, 0, NULL, skb,
NETLINK_CB(cb->skb).portid,
cb->nlh->nlmsg_seq, flags);
if (err)
@@ -3398,7 +3398,7 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
fri.tb_id = table_id;
fri.dst = res.prefix;
fri.dst_len = res.prefixlen;
- fri.dscp = inet_dsfield_to_dscp(fl4.flowi4_tos);
+ fri.dscp = res.dscp;
fri.type = rt->rt_type;
fri.offload = 0;
fri.trap = 0;
@@ -3425,8 +3425,8 @@ static int inet_rtm_getroute(struct sk_buff *in_skb, struct nlmsghdr *nlh,
err = fib_dump_info(skb, NETLINK_CB(in_skb).portid,
nlh->nlmsg_seq, RTM_NEWROUTE, &fri, 0);
} else {
- err = rt_fill_info(net, dst, src, rt, table_id, &fl4, skb,
- NETLINK_CB(in_skb).portid,
+ err = rt_fill_info(net, dst, src, rt, table_id, res.dscp, &fl4,
+ skb, NETLINK_CB(in_skb).portid,
nlh->nlmsg_seq, 0);
}
if (err < 0)
diff --git a/net/ipv4/tcp.c b/net/ipv4/tcp.c
index 2d4f697d338f..cb79919323a6 100644
--- a/net/ipv4/tcp.c
+++ b/net/ipv4/tcp.c
@@ -589,9 +589,10 @@ __poll_t tcp_poll(struct file *file, struct socket *sock, poll_table *wait)
*/
mask |= EPOLLOUT | EPOLLWRNORM;
}
- /* This barrier is coupled with smp_wmb() in tcp_reset() */
+ /* This barrier is coupled with smp_wmb() in tcp_done_with_error() */
smp_rmb();
- if (sk->sk_err || !skb_queue_empty_lockless(&sk->sk_error_queue))
+ if (READ_ONCE(sk->sk_err) ||
+ !skb_queue_empty_lockless(&sk->sk_error_queue))
mask |= EPOLLERR;
return mask;
@@ -3119,7 +3120,7 @@ int tcp_disconnect(struct sock *sk, int flags)
if (old_state == TCP_LISTEN) {
inet_csk_listen_stop(sk);
} else if (unlikely(tp->repair)) {
- sk->sk_err = ECONNABORTED;
+ WRITE_ONCE(sk->sk_err, ECONNABORTED);
} else if (tcp_need_reset(old_state) ||
(tp->snd_nxt != tp->write_seq &&
(1 << old_state) & (TCPF_CLOSING | TCPF_LAST_ACK))) {
@@ -3127,9 +3128,9 @@ int tcp_disconnect(struct sock *sk, int flags)
* states
*/
tcp_send_active_reset(sk, gfp_any());
- sk->sk_err = ECONNRESET;
+ WRITE_ONCE(sk->sk_err, ECONNRESET);
} else if (old_state == TCP_SYN_SENT)
- sk->sk_err = ECONNRESET;
+ WRITE_ONCE(sk->sk_err, ECONNRESET);
tcp_clear_xmit_timers(sk);
__skb_queue_purge(&sk->sk_receive_queue);
@@ -4735,7 +4736,7 @@ int tcp_abort(struct sock *sk, int err)
bh_lock_sock(sk);
if (!sock_flag(sk, SOCK_DEAD)) {
- sk->sk_err = err;
+ WRITE_ONCE(sk->sk_err, err);
/* This barrier is coupled with smp_rmb() in tcp_poll() */
smp_wmb();
sk_error_report(sk);
diff --git a/net/ipv4/tcp_input.c b/net/ipv4/tcp_input.c
index 359ffda9b736..b1b4f44d2137 100644
--- a/net/ipv4/tcp_input.c
+++ b/net/ipv4/tcp_input.c
@@ -3922,7 +3922,7 @@ static int tcp_ack(struct sock *sk, const struct sk_buff *skb, int flag)
/* We passed data and got it acked, remove any soft error
* log. Something worked...
*/
- sk->sk_err_soft = 0;
+ WRITE_ONCE(sk->sk_err_soft, 0);
icsk->icsk_probes_out = 0;
tp->rcv_tstamp = tcp_jiffies32;
if (!prior_packets)
@@ -4356,9 +4356,26 @@ static inline bool tcp_sequence(const struct tcp_sock *tp, u32 seq, u32 end_seq)
!after(seq, tp->rcv_nxt + tcp_receive_window(tp));
}
+
+void tcp_done_with_error(struct sock *sk, int err)
+{
+ /* This barrier is coupled with smp_rmb() in tcp_poll() */
+ WRITE_ONCE(sk->sk_err, err);
+ smp_wmb();
+
+ tcp_write_queue_purge(sk);
+ tcp_done(sk);
+
+ if (!sock_flag(sk, SOCK_DEAD))
+ sk_error_report(sk);
+}
+EXPORT_SYMBOL(tcp_done_with_error);
+
/* When we get a reset we do this. */
void tcp_reset(struct sock *sk, struct sk_buff *skb)
{
+ int err;
+
trace_tcp_receive_reset(sk);
/* mptcp can't tell us to ignore reset pkts,
@@ -4370,24 +4387,17 @@ void tcp_reset(struct sock *sk, struct sk_buff *skb)
/* We want the right error as BSD sees it (and indeed as we do). */
switch (sk->sk_state) {
case TCP_SYN_SENT:
- sk->sk_err = ECONNREFUSED;
+ err = ECONNREFUSED;
break;
case TCP_CLOSE_WAIT:
- sk->sk_err = EPIPE;
+ err = EPIPE;
break;
case TCP_CLOSE:
return;
default:
- sk->sk_err = ECONNRESET;
+ err = ECONNRESET;
}
- /* This barrier is coupled with smp_rmb() in tcp_poll() */
- smp_wmb();
-
- tcp_write_queue_purge(sk);
- tcp_done(sk);
-
- if (!sock_flag(sk, SOCK_DEAD))
- sk_error_report(sk);
+ tcp_done_with_error(sk, err);
}
/*
diff --git a/net/ipv4/tcp_ipv4.c b/net/ipv4/tcp_ipv4.c
index befa848fb820..c64ba4f8ddaa 100644
--- a/net/ipv4/tcp_ipv4.c
+++ b/net/ipv4/tcp_ipv4.c
@@ -368,7 +368,7 @@ void tcp_v4_mtu_reduced(struct sock *sk)
* for the case, if this connection will not able to recover.
*/
if (mtu < dst_mtu(dst) && ip_dont_fragment(sk, dst))
- sk->sk_err_soft = EMSGSIZE;
+ WRITE_ONCE(sk->sk_err_soft, EMSGSIZE);
mtu = dst_mtu(dst);
@@ -602,15 +602,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
ip_icmp_error(sk, skb, err, th->dest, info, (u8 *)th);
- if (!sock_owned_by_user(sk)) {
- sk->sk_err = err;
-
- sk_error_report(sk);
-
- tcp_done(sk);
- } else {
- sk->sk_err_soft = err;
- }
+ if (!sock_owned_by_user(sk))
+ tcp_done_with_error(sk, err);
+ else
+ WRITE_ONCE(sk->sk_err_soft, err);
goto out;
}
@@ -632,10 +627,10 @@ int tcp_v4_err(struct sk_buff *skb, u32 info)
inet = inet_sk(sk);
if (!sock_owned_by_user(sk) && inet->recverr) {
- sk->sk_err = err;
+ WRITE_ONCE(sk->sk_err, err);
sk_error_report(sk);
} else { /* Only an error on timeout */
- sk->sk_err_soft = err;
+ WRITE_ONCE(sk->sk_err_soft, err);
}
out:
diff --git a/net/ipv4/tcp_output.c b/net/ipv4/tcp_output.c
index 15f814c1e169..19b5a6179c06 100644
--- a/net/ipv4/tcp_output.c
+++ b/net/ipv4/tcp_output.c
@@ -3764,7 +3764,7 @@ static void tcp_connect_init(struct sock *sk)
tp->rx_opt.rcv_wscale = rcv_wscale;
tp->rcv_ssthresh = tp->rcv_wnd;
- sk->sk_err = 0;
+ WRITE_ONCE(sk->sk_err, 0);
sock_reset_flag(sk, SOCK_DONE);
tp->snd_wnd = 0;
tcp_init_wl(tp, 0);
diff --git a/net/ipv4/tcp_timer.c b/net/ipv4/tcp_timer.c
index 016f9eff49b4..3662b49ce71a 100644
--- a/net/ipv4/tcp_timer.c
+++ b/net/ipv4/tcp_timer.c
@@ -67,11 +67,7 @@ u32 tcp_clamp_probe0_to_user_timeout(const struct sock *sk, u32 when)
static void tcp_write_err(struct sock *sk)
{
- sk->sk_err = sk->sk_err_soft ? : ETIMEDOUT;
- sk_error_report(sk);
-
- tcp_write_queue_purge(sk);
- tcp_done(sk);
+ tcp_done_with_error(sk, READ_ONCE(sk->sk_err_soft) ? : ETIMEDOUT);
__NET_INC_STATS(sock_net(sk), LINUX_MIB_TCPABORTONTIMEOUT);
}
@@ -110,7 +106,7 @@ static int tcp_out_of_resources(struct sock *sk, bool do_reset)
shift++;
/* If some dubious ICMP arrived, penalize even more. */
- if (sk->sk_err_soft)
+ if (READ_ONCE(sk->sk_err_soft))
shift++;
if (tcp_check_oom(sk, shift)) {
@@ -146,7 +142,7 @@ static int tcp_orphan_retries(struct sock *sk, bool alive)
int retries = READ_ONCE(sock_net(sk)->ipv4.sysctl_tcp_orphan_retries); /* May be zero. */
/* We know from an ICMP that something is wrong. */
- if (sk->sk_err_soft && !alive)
+ if (READ_ONCE(sk->sk_err_soft) && !alive)
retries = 0;
/* However, if socket sent something recently, select some safe
diff --git a/net/ipv6/addrconf.c b/net/ipv6/addrconf.c
index 22e246ff910e..4e1e6ef72464 100644
--- a/net/ipv6/addrconf.c
+++ b/net/ipv6/addrconf.c
@@ -1831,7 +1831,8 @@ int ipv6_dev_get_saddr(struct net *net, const struct net_device *dst_dev,
master, &dst,
scores, hiscore_idx);
- if (scores[hiscore_idx].ifa)
+ if (scores[hiscore_idx].ifa &&
+ scores[hiscore_idx].scopedist >= 0)
goto out;
}
diff --git a/net/ipv6/esp6.c b/net/ipv6/esp6.c
index c2dcb5c613b6..a021c88d3d9b 100644
--- a/net/ipv6/esp6.c
+++ b/net/ipv6/esp6.c
@@ -255,8 +255,7 @@ static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
#else
static int esp_output_tail_tcp(struct xfrm_state *x, struct sk_buff *skb)
{
- kfree_skb(skb);
-
+ WARN_ON(1);
return -EOPNOTSUPP;
}
#endif
diff --git a/net/ipv6/tcp_ipv6.c b/net/ipv6/tcp_ipv6.c
index 4b0e05349862..eb6fc0e2a453 100644
--- a/net/ipv6/tcp_ipv6.c
+++ b/net/ipv6/tcp_ipv6.c
@@ -492,13 +492,10 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
ipv6_icmp_error(sk, skb, err, th->dest, ntohl(info), (u8 *)th);
- if (!sock_owned_by_user(sk)) {
- sk->sk_err = err;
- sk_error_report(sk); /* Wake people up to see the error (see connect in sock.c) */
-
- tcp_done(sk);
- } else
- sk->sk_err_soft = err;
+ if (!sock_owned_by_user(sk))
+ tcp_done_with_error(sk, err);
+ else
+ WRITE_ONCE(sk->sk_err_soft, err);
goto out;
case TCP_LISTEN:
break;
@@ -512,11 +509,11 @@ static int tcp_v6_err(struct sk_buff *skb, struct inet6_skb_parm *opt,
}
if (!sock_owned_by_user(sk) && np->recverr) {
- sk->sk_err = err;
+ WRITE_ONCE(sk->sk_err, err);
sk_error_report(sk);
- } else
- sk->sk_err_soft = err;
-
+ } else {
+ WRITE_ONCE(sk->sk_err_soft, err);
+ }
out:
bh_unlock_sock(sk);
sock_put(sk);
diff --git a/net/mac80211/cfg.c b/net/mac80211/cfg.c
index 2c60fc165801..1ce8fefd7f0d 100644
--- a/net/mac80211/cfg.c
+++ b/net/mac80211/cfg.c
@@ -1775,7 +1775,7 @@ static int sta_link_apply_parameters(struct ieee80211_local *local,
sband->band);
}
- ieee80211_sta_set_rx_nss(link_sta);
+ ieee80211_sta_init_nss(link_sta);
return ret;
}
@@ -2577,6 +2577,17 @@ static int ieee80211_change_bss(struct wiphy *wiphy,
if (!sband)
return -EINVAL;
+ if (params->basic_rates) {
+ if (!ieee80211_parse_bitrates(sdata->vif.bss_conf.chandef.width,
+ wiphy->bands[sband->band],
+ params->basic_rates,
+ params->basic_rates_len,
+ &sdata->vif.bss_conf.basic_rates))
+ return -EINVAL;
+ changed |= BSS_CHANGED_BASIC_RATES;
+ ieee80211_check_rate_mask(&sdata->deflink);
+ }
+
if (params->use_cts_prot >= 0) {
sdata->vif.bss_conf.use_cts_prot = params->use_cts_prot;
changed |= BSS_CHANGED_ERP_CTS_PROT;
@@ -2600,16 +2611,6 @@ static int ieee80211_change_bss(struct wiphy *wiphy,
changed |= BSS_CHANGED_ERP_SLOT;
}
- if (params->basic_rates) {
- ieee80211_parse_bitrates(sdata->vif.bss_conf.chandef.width,
- wiphy->bands[sband->band],
- params->basic_rates,
- params->basic_rates_len,
- &sdata->vif.bss_conf.basic_rates);
- changed |= BSS_CHANGED_BASIC_RATES;
- ieee80211_check_rate_mask(&sdata->deflink);
- }
-
if (params->ap_isolate >= 0) {
if (params->ap_isolate)
sdata->flags |= IEEE80211_SDATA_DONT_BRIDGE_PACKETS;
diff --git a/net/mac80211/ieee80211_i.h b/net/mac80211/ieee80211_i.h
index 0d8a9bb92538..709eb7bfcf19 100644
--- a/net/mac80211/ieee80211_i.h
+++ b/net/mac80211/ieee80211_i.h
@@ -2071,7 +2071,7 @@ enum ieee80211_sta_rx_bandwidth
ieee80211_sta_cap_rx_bw(struct link_sta_info *link_sta);
enum ieee80211_sta_rx_bandwidth
ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta);
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta);
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta);
enum ieee80211_sta_rx_bandwidth
ieee80211_chan_width_to_rx_bw(enum nl80211_chan_width width);
enum nl80211_chan_width
diff --git a/net/mac80211/rate.c b/net/mac80211/rate.c
index a2bc9c5d92b8..3cf252418bd3 100644
--- a/net/mac80211/rate.c
+++ b/net/mac80211/rate.c
@@ -37,7 +37,7 @@ void rate_control_rate_init(struct sta_info *sta)
struct ieee80211_supported_band *sband;
struct ieee80211_chanctx_conf *chanctx_conf;
- ieee80211_sta_set_rx_nss(&sta->deflink);
+ ieee80211_sta_init_nss(&sta->deflink);
if (!ref)
return;
diff --git a/net/mac80211/sta_info.h b/net/mac80211/sta_info.h
index 2517ea714dc4..4809756a43dd 100644
--- a/net/mac80211/sta_info.h
+++ b/net/mac80211/sta_info.h
@@ -3,7 +3,7 @@
* Copyright 2002-2005, Devicescape Software, Inc.
* Copyright 2013-2014 Intel Mobile Communications GmbH
* Copyright(c) 2015-2017 Intel Deutschland GmbH
- * Copyright(c) 2020-2022 Intel Corporation
+ * Copyright(c) 2020-2024 Intel Corporation
*/
#ifndef STA_INFO_H
@@ -485,6 +485,8 @@ struct ieee80211_fragment_cache {
* same for non-MLD STA. This is used as key for searching link STA
* @link_id: Link ID uniquely identifying the link STA. This is 0 for non-MLD
* and set to the corresponding vif LinkId for MLD STA
+ * @op_mode_nss: NSS limit as set by operating mode notification, or 0
+ * @capa_nss: NSS limit as determined by local and peer capabilities
* @link_hash_node: hash node for rhashtable
* @sta: Points to the STA info
* @gtk: group keys negotiated with this station, if any
@@ -520,6 +522,8 @@ struct link_sta_info {
u8 addr[ETH_ALEN];
u8 link_id;
+ u8 op_mode_nss, capa_nss;
+
struct rhlist_head link_hash_node;
struct sta_info *sta;
diff --git a/net/mac80211/vht.c b/net/mac80211/vht.c
index f7526be8a1c7..bc13b1419981 100644
--- a/net/mac80211/vht.c
+++ b/net/mac80211/vht.c
@@ -4,7 +4,7 @@
*
* Portions of this file
* Copyright(c) 2015 - 2016 Intel Deutschland GmbH
- * Copyright (C) 2018 - 2023 Intel Corporation
+ * Copyright (C) 2018 - 2024 Intel Corporation
*/
#include <linux/ieee80211.h>
@@ -541,15 +541,11 @@ ieee80211_sta_cur_vht_bw(struct link_sta_info *link_sta)
return bw;
}
-void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
+void ieee80211_sta_init_nss(struct link_sta_info *link_sta)
{
u8 ht_rx_nss = 0, vht_rx_nss = 0, he_rx_nss = 0, eht_rx_nss = 0, rx_nss;
bool support_160;
- /* if we received a notification already don't overwrite it */
- if (link_sta->pub->rx_nss)
- return;
-
if (link_sta->pub->eht_cap.has_eht) {
int i;
const u8 *rx_nss_mcs = (void *)&link_sta->pub->eht_cap.eht_mcs_nss_supp;
@@ -627,7 +623,15 @@ void ieee80211_sta_set_rx_nss(struct link_sta_info *link_sta)
rx_nss = max(vht_rx_nss, ht_rx_nss);
rx_nss = max(he_rx_nss, rx_nss);
rx_nss = max(eht_rx_nss, rx_nss);
- link_sta->pub->rx_nss = max_t(u8, 1, rx_nss);
+ rx_nss = max_t(u8, 1, rx_nss);
+ link_sta->capa_nss = rx_nss;
+
+ /* that shouldn't be set yet, but we can handle it anyway */
+ if (link_sta->op_mode_nss)
+ link_sta->pub->rx_nss =
+ min_t(u8, rx_nss, link_sta->op_mode_nss);
+ else
+ link_sta->pub->rx_nss = rx_nss;
}
u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
@@ -647,11 +651,20 @@ u32 __ieee80211_vht_handle_opmode(struct ieee80211_sub_if_data *sdata,
nss >>= IEEE80211_OPMODE_NOTIF_RX_NSS_SHIFT;
nss += 1;
- if (link_sta->pub->rx_nss != nss) {
- link_sta->pub->rx_nss = nss;
- sta_opmode.rx_nss = nss;
- changed |= IEEE80211_RC_NSS_CHANGED;
- sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+ if (link_sta->op_mode_nss != nss) {
+ if (nss <= link_sta->capa_nss) {
+ link_sta->op_mode_nss = nss;
+
+ if (nss != link_sta->pub->rx_nss) {
+ link_sta->pub->rx_nss = nss;
+ changed |= IEEE80211_RC_NSS_CHANGED;
+ sta_opmode.rx_nss = link_sta->pub->rx_nss;
+ sta_opmode.changed |= STA_OPMODE_N_SS_CHANGED;
+ }
+ } else {
+ pr_warn_ratelimited("Ignoring NSS change in VHT Operating Mode Notification from %pM with invalid nss %d",
+ link_sta->pub->addr, nss);
+ }
}
switch (opmode & IEEE80211_OPMODE_NOTIF_CHANWIDTH_MASK) {
diff --git a/net/netfilter/ipvs/ip_vs_proto_sctp.c b/net/netfilter/ipvs/ip_vs_proto_sctp.c
index 1e689c714127..83e452916403 100644
--- a/net/netfilter/ipvs/ip_vs_proto_sctp.c
+++ b/net/netfilter/ipvs/ip_vs_proto_sctp.c
@@ -126,7 +126,7 @@ sctp_snat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
if (sctph->source != cp->vport || payload_csum ||
skb->ip_summed == CHECKSUM_PARTIAL) {
sctph->source = cp->vport;
- if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+ if (!skb_is_gso(skb))
sctp_nat_csum(skb, sctph, sctphoff);
} else {
skb->ip_summed = CHECKSUM_UNNECESSARY;
@@ -175,7 +175,7 @@ sctp_dnat_handler(struct sk_buff *skb, struct ip_vs_protocol *pp,
(skb->ip_summed == CHECKSUM_PARTIAL &&
!(skb_dst(skb)->dev->features & NETIF_F_SCTP_CRC))) {
sctph->dest = cp->dport;
- if (!skb_is_gso(skb) || !skb_is_gso_sctp(skb))
+ if (!skb_is_gso(skb))
sctp_nat_csum(skb, sctph, sctphoff);
} else if (skb->ip_summed != CHECKSUM_PARTIAL) {
skb->ip_summed = CHECKSUM_UNNECESSARY;
diff --git a/net/netfilter/nf_conntrack_netlink.c b/net/netfilter/nf_conntrack_netlink.c
index 9ee8abd3e4b1..9672b0e00d6b 100644
--- a/net/netfilter/nf_conntrack_netlink.c
+++ b/net/netfilter/nf_conntrack_netlink.c
@@ -3415,7 +3415,8 @@ static int ctnetlink_del_expect(struct sk_buff *skb,
if (cda[CTA_EXPECT_ID]) {
__be32 id = nla_get_be32(cda[CTA_EXPECT_ID]);
- if (ntohl(id) != (u32)(unsigned long)exp) {
+
+ if (id != nf_expect_get_id(exp)) {
nf_ct_expect_put(exp);
return -ENOENT;
}
diff --git a/net/netfilter/nft_set_pipapo.c b/net/netfilter/nft_set_pipapo.c
index a56ed216c223..d9c1c467ea68 100644
--- a/net/netfilter/nft_set_pipapo.c
+++ b/net/netfilter/nft_set_pipapo.c
@@ -360,7 +360,7 @@
* Return: -1 on no match, bit position on 'match_only', 0 otherwise.
*/
int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
- union nft_pipapo_map_bucket *mt, bool match_only)
+ const union nft_pipapo_map_bucket *mt, bool match_only)
{
unsigned long bitset;
int k, ret = -1;
@@ -412,9 +412,9 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
struct nft_pipapo_scratch *scratch;
unsigned long *res_map, *fill_map;
u8 genmask = nft_genmask_cur(net);
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
const u8 *rp = (const u8 *)key;
- struct nft_pipapo_match *m;
- struct nft_pipapo_field *f;
bool map_index;
int i;
@@ -432,7 +432,7 @@ bool nft_pipapo_lookup(const struct net *net, const struct nft_set *set,
res_map = scratch->map + (map_index ? m->bsize_max : 0);
fill_map = scratch->map + (map_index ? 0 : m->bsize_max);
- memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+ pipapo_resmap_init(m, res_map);
nft_pipapo_for_each_field(f, i, m) {
bool last = i == m->field_count - 1;
@@ -519,11 +519,13 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
{
struct nft_pipapo_elem *ret = ERR_PTR(-ENOENT);
struct nft_pipapo *priv = nft_set_priv(set);
- struct nft_pipapo_match *m = priv->clone;
unsigned long *res_map, *fill_map = NULL;
- struct nft_pipapo_field *f;
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
int i;
+ m = priv->clone;
+
res_map = kmalloc_array(m->bsize_max, sizeof(*res_map), GFP_ATOMIC);
if (!res_map) {
ret = ERR_PTR(-ENOMEM);
@@ -536,7 +538,7 @@ static struct nft_pipapo_elem *pipapo_get(const struct net *net,
goto out;
}
- memset(res_map, 0xff, m->bsize_max * sizeof(*res_map));
+ pipapo_resmap_init(m, res_map);
nft_pipapo_for_each_field(f, i, m) {
bool last = i == m->field_count - 1;
@@ -1595,7 +1597,7 @@ static void pipapo_gc(const struct nft_set *_set, struct nft_pipapo_match *m)
while ((rules_f0 = pipapo_rules_same_key(m->f, first_rule))) {
union nft_pipapo_map_bucket rulemap[NFT_PIPAPO_MAX_FIELDS];
- struct nft_pipapo_field *f;
+ const struct nft_pipapo_field *f;
int i, start, rules_fx;
start = first_rule;
@@ -2041,8 +2043,8 @@ static void nft_pipapo_walk(const struct nft_ctx *ctx, struct nft_set *set,
{
struct nft_pipapo *priv = nft_set_priv(set);
struct net *net = read_pnet(&set->net);
- struct nft_pipapo_match *m;
- struct nft_pipapo_field *f;
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
int i, r;
rcu_read_lock();
diff --git a/net/netfilter/nft_set_pipapo.h b/net/netfilter/nft_set_pipapo.h
index 30a3d092cd84..519a2e6dc206 100644
--- a/net/netfilter/nft_set_pipapo.h
+++ b/net/netfilter/nft_set_pipapo.h
@@ -185,7 +185,7 @@ struct nft_pipapo_elem {
};
int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
- union nft_pipapo_map_bucket *mt, bool match_only);
+ const union nft_pipapo_map_bucket *mt, bool match_only);
/**
* pipapo_and_field_buckets_4bit() - Intersect 4-bit buckets
@@ -193,7 +193,7 @@ int pipapo_refill(unsigned long *map, int len, int rules, unsigned long *dst,
* @dst: Area to store result
* @data: Input data selecting table buckets
*/
-static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_4bit(const struct nft_pipapo_field *f,
unsigned long *dst,
const u8 *data)
{
@@ -221,7 +221,7 @@ static inline void pipapo_and_field_buckets_4bit(struct nft_pipapo_field *f,
* @dst: Area to store result
* @data: Input data selecting table buckets
*/
-static inline void pipapo_and_field_buckets_8bit(struct nft_pipapo_field *f,
+static inline void pipapo_and_field_buckets_8bit(const struct nft_pipapo_field *f,
unsigned long *dst,
const u8 *data)
{
@@ -285,4 +285,25 @@ static u64 pipapo_estimate_size(const struct nft_set_desc *desc)
return size;
}
+/**
+ * pipapo_resmap_init() - Initialise result map before first use
+ * @m: Matching data, including mapping table
+ * @res_map: Result map
+ *
+ * Initialize all bits covered by the first field to one, so that after
+ * the first step, only the matching bits of the first bit group remain.
+ *
+ * If other fields have a large bitmap, set remainder of res_map to 0.
+ */
+static inline void pipapo_resmap_init(const struct nft_pipapo_match *m, unsigned long *res_map)
+{
+ const struct nft_pipapo_field *f = m->f;
+ int i;
+
+ for (i = 0; i < f->bsize; i++)
+ res_map[i] = ULONG_MAX;
+
+ for (i = f->bsize; i < m->bsize_max; i++)
+ res_map[i] = 0ul;
+}
#endif /* _NFT_SET_PIPAPO_H */
diff --git a/net/netfilter/nft_set_pipapo_avx2.c b/net/netfilter/nft_set_pipapo_avx2.c
index a3a8ddca9918..b8d3c3213efe 100644
--- a/net/netfilter/nft_set_pipapo_avx2.c
+++ b/net/netfilter/nft_set_pipapo_avx2.c
@@ -212,8 +212,9 @@ static int nft_pipapo_avx2_refill(int offset, unsigned long *map,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
u8 pg[2] = { pkt[0] >> 4, pkt[0] & 0xf };
@@ -274,8 +275,9 @@ static int nft_pipapo_avx2_lookup_4b_2(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
u8 pg[4] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf };
@@ -350,8 +352,9 @@ static int nft_pipapo_avx2_lookup_4b_4(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
u8 pg[8] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf,
pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf,
@@ -445,8 +448,9 @@ static int nft_pipapo_avx2_lookup_4b_8(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
u8 pg[12] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf,
pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf,
@@ -534,8 +538,9 @@ static int nft_pipapo_avx2_lookup_4b_12(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
u8 pg[32] = { pkt[0] >> 4, pkt[0] & 0xf, pkt[1] >> 4, pkt[1] & 0xf,
pkt[2] >> 4, pkt[2] & 0xf, pkt[3] >> 4, pkt[3] & 0xf,
@@ -669,8 +674,9 @@ static int nft_pipapo_avx2_lookup_4b_32(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -726,8 +732,9 @@ static int nft_pipapo_avx2_lookup_8b_1(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -790,8 +797,9 @@ static int nft_pipapo_avx2_lookup_8b_2(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -865,8 +873,9 @@ static int nft_pipapo_avx2_lookup_8b_4(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -950,8 +959,9 @@ static int nft_pipapo_avx2_lookup_8b_6(unsigned long *map, unsigned long *fill,
* word index to be checked next (i.e. first filled word).
*/
static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
int i, ret = -1, m256_size = f->bsize / NFT_PIPAPO_LONGS_PER_M256, b;
unsigned long *lt = f->lt, bsize = f->bsize;
@@ -1026,6 +1036,7 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
/**
* nft_pipapo_avx2_lookup_slow() - Fallback function for uncommon field sizes
+ * @mdata: Matching data, including mapping table
* @map: Previous match result, used as initial bitmap
* @fill: Destination bitmap to be filled with current match result
* @f: Field, containing lookup and mapping tables
@@ -1041,15 +1052,17 @@ static int nft_pipapo_avx2_lookup_8b_16(unsigned long *map, unsigned long *fill,
* Return: -1 on no match, rule index of match if @last, otherwise first long
* word index to be checked next (i.e. first filled word).
*/
-static int nft_pipapo_avx2_lookup_slow(unsigned long *map, unsigned long *fill,
- struct nft_pipapo_field *f, int offset,
- const u8 *pkt, bool first, bool last)
+static int nft_pipapo_avx2_lookup_slow(const struct nft_pipapo_match *mdata,
+ unsigned long *map, unsigned long *fill,
+ const struct nft_pipapo_field *f,
+ int offset, const u8 *pkt,
+ bool first, bool last)
{
unsigned long bsize = f->bsize;
int i, ret = -1, b;
if (first)
- memset(map, 0xff, bsize * sizeof(*map));
+ pipapo_resmap_init(mdata, map);
for (i = offset; i < bsize; i++) {
if (f->bb == 8)
@@ -1119,15 +1132,21 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
struct nft_pipapo *priv = nft_set_priv(set);
struct nft_pipapo_scratch *scratch;
u8 genmask = nft_genmask_cur(net);
+ const struct nft_pipapo_match *m;
+ const struct nft_pipapo_field *f;
const u8 *rp = (const u8 *)key;
- struct nft_pipapo_match *m;
- struct nft_pipapo_field *f;
unsigned long *res, *fill;
bool map_index;
int i, ret = 0;
- if (unlikely(!irq_fpu_usable()))
- return nft_pipapo_lookup(net, set, key, ext);
+ local_bh_disable();
+
+ if (unlikely(!irq_fpu_usable())) {
+ bool fallback_res = nft_pipapo_lookup(net, set, key, ext);
+
+ local_bh_enable();
+ return fallback_res;
+ }
m = rcu_dereference(priv->match);
@@ -1142,6 +1161,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
scratch = *raw_cpu_ptr(m->scratch);
if (unlikely(!scratch)) {
kernel_fpu_end();
+ local_bh_enable();
return false;
}
@@ -1175,7 +1195,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
} else if (f->groups == 16) {
NFT_SET_PIPAPO_AVX2_LOOKUP(8, 16);
} else {
- ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+ ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
ret, rp,
first, last);
}
@@ -1191,7 +1211,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
} else if (f->groups == 32) {
NFT_SET_PIPAPO_AVX2_LOOKUP(4, 32);
} else {
- ret = nft_pipapo_avx2_lookup_slow(res, fill, f,
+ ret = nft_pipapo_avx2_lookup_slow(m, res, fill, f,
ret, rp,
first, last);
}
@@ -1222,6 +1242,7 @@ bool nft_pipapo_avx2_lookup(const struct net *net, const struct nft_set *set,
if (i % 2)
scratch->map_index = !map_index;
kernel_fpu_end();
+ local_bh_enable();
return ret >= 0;
}
diff --git a/net/packet/af_packet.c b/net/packet/af_packet.c
index c48cb7664c55..c9c813f731c6 100644
--- a/net/packet/af_packet.c
+++ b/net/packet/af_packet.c
@@ -541,6 +541,61 @@ static void *packet_current_frame(struct packet_sock *po,
return packet_lookup_frame(po, rb, rb->head, status);
}
+static u16 vlan_get_tci(struct sk_buff *skb, struct net_device *dev)
+{
+ u8 *skb_orig_data = skb->data;
+ int skb_orig_len = skb->len;
+ struct vlan_hdr vhdr, *vh;
+ unsigned int header_len;
+
+ if (!dev)
+ return 0;
+
+ /* In the SOCK_DGRAM scenario, skb data starts at the network
+ * protocol, which is after the VLAN headers. The outer VLAN
+ * header is at the hard_header_len offset in non-variable
+ * length link layer headers. If it's a VLAN device, the
+ * min_header_len should be used to exclude the VLAN header
+ * size.
+ */
+ if (dev->min_header_len == dev->hard_header_len)
+ header_len = dev->hard_header_len;
+ else if (is_vlan_dev(dev))
+ header_len = dev->min_header_len;
+ else
+ return 0;
+
+ skb_push(skb, skb->data - skb_mac_header(skb));
+ vh = skb_header_pointer(skb, header_len, sizeof(vhdr), &vhdr);
+ if (skb_orig_data != skb->data) {
+ skb->data = skb_orig_data;
+ skb->len = skb_orig_len;
+ }
+ if (unlikely(!vh))
+ return 0;
+
+ return ntohs(vh->h_vlan_TCI);
+}
+
+static __be16 vlan_get_protocol_dgram(struct sk_buff *skb)
+{
+ __be16 proto = skb->protocol;
+
+ if (unlikely(eth_type_vlan(proto))) {
+ u8 *skb_orig_data = skb->data;
+ int skb_orig_len = skb->len;
+
+ skb_push(skb, skb->data - skb_mac_header(skb));
+ proto = __vlan_get_protocol(skb, proto, NULL);
+ if (skb_orig_data != skb->data) {
+ skb->data = skb_orig_data;
+ skb->len = skb_orig_len;
+ }
+ }
+
+ return proto;
+}
+
static void prb_del_retire_blk_timer(struct tpacket_kbdq_core *pkc)
{
del_timer_sync(&pkc->retire_blk_timer);
@@ -1010,10 +1065,16 @@ static void prb_clear_rxhash(struct tpacket_kbdq_core *pkc,
static void prb_fill_vlan_info(struct tpacket_kbdq_core *pkc,
struct tpacket3_hdr *ppd)
{
+ struct packet_sock *po = container_of(pkc, struct packet_sock, rx_ring.prb_bdqc);
+
if (skb_vlan_tag_present(pkc->skb)) {
ppd->hv1.tp_vlan_tci = skb_vlan_tag_get(pkc->skb);
ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->vlan_proto);
ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else if (unlikely(po->sk.sk_type == SOCK_DGRAM && eth_type_vlan(pkc->skb->protocol))) {
+ ppd->hv1.tp_vlan_tci = vlan_get_tci(pkc->skb, pkc->skb->dev);
+ ppd->hv1.tp_vlan_tpid = ntohs(pkc->skb->protocol);
+ ppd->tp_status = TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
} else {
ppd->hv1.tp_vlan_tci = 0;
ppd->hv1.tp_vlan_tpid = 0;
@@ -2431,6 +2492,10 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
h.h2->tp_vlan_tci = skb_vlan_tag_get(skb);
h.h2->tp_vlan_tpid = ntohs(skb->vlan_proto);
status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else if (unlikely(sk->sk_type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+ h.h2->tp_vlan_tci = vlan_get_tci(skb, skb->dev);
+ h.h2->tp_vlan_tpid = ntohs(skb->protocol);
+ status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
} else {
h.h2->tp_vlan_tci = 0;
h.h2->tp_vlan_tpid = 0;
@@ -2460,7 +2525,8 @@ static int tpacket_rcv(struct sk_buff *skb, struct net_device *dev,
sll->sll_halen = dev_parse_header(skb, sll->sll_addr);
sll->sll_family = AF_PACKET;
sll->sll_hatype = dev->type;
- sll->sll_protocol = skb->protocol;
+ sll->sll_protocol = (sk->sk_type == SOCK_DGRAM) ?
+ vlan_get_protocol_dgram(skb) : skb->protocol;
sll->sll_pkttype = skb->pkt_type;
if (unlikely(packet_sock_flag(po, PACKET_SOCK_ORIGDEV)))
sll->sll_ifindex = orig_dev->ifindex;
@@ -3481,7 +3547,8 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
/* Original length was stored in sockaddr_ll fields */
origlen = PACKET_SKB_CB(skb)->sa.origlen;
sll->sll_family = AF_PACKET;
- sll->sll_protocol = skb->protocol;
+ sll->sll_protocol = (sock->type == SOCK_DGRAM) ?
+ vlan_get_protocol_dgram(skb) : skb->protocol;
}
sock_recv_cmsgs(msg, sk, skb);
@@ -3536,6 +3603,21 @@ static int packet_recvmsg(struct socket *sock, struct msghdr *msg, size_t len,
aux.tp_vlan_tci = skb_vlan_tag_get(skb);
aux.tp_vlan_tpid = ntohs(skb->vlan_proto);
aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else if (unlikely(sock->type == SOCK_DGRAM && eth_type_vlan(skb->protocol))) {
+ struct sockaddr_ll *sll = &PACKET_SKB_CB(skb)->sa.ll;
+ struct net_device *dev;
+
+ rcu_read_lock();
+ dev = dev_get_by_index_rcu(sock_net(sk), sll->sll_ifindex);
+ if (dev) {
+ aux.tp_vlan_tci = vlan_get_tci(skb, dev);
+ aux.tp_vlan_tpid = ntohs(skb->protocol);
+ aux.tp_status |= TP_STATUS_VLAN_VALID | TP_STATUS_VLAN_TPID_VALID;
+ } else {
+ aux.tp_vlan_tci = 0;
+ aux.tp_vlan_tpid = 0;
+ }
+ rcu_read_unlock();
} else {
aux.tp_vlan_tci = 0;
aux.tp_vlan_tpid = 0;
diff --git a/net/smc/smc_core.c b/net/smc/smc_core.c
index 64b6dd439938..10d79cb55528 100644
--- a/net/smc/smc_core.c
+++ b/net/smc/smc_core.c
@@ -1959,7 +1959,6 @@ int smc_conn_create(struct smc_sock *smc, struct smc_init_info *ini)
*/
static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
{
- const unsigned int max_scat = SG_MAX_SINGLE_ALLOC * PAGE_SIZE;
u8 compressed;
if (size <= SMC_BUF_MIN_SIZE)
@@ -1969,9 +1968,11 @@ static u8 smc_compress_bufsize(int size, bool is_smcd, bool is_rmb)
compressed = min_t(u8, ilog2(size) + 1,
is_smcd ? SMCD_DMBE_SIZES : SMCR_RMBE_SIZES);
+#ifdef CONFIG_ARCH_NO_SG_CHAIN
if (!is_smcd && is_rmb)
/* RMBs are backed by & limited to max size of scatterlists */
- compressed = min_t(u8, compressed, ilog2(max_scat >> 14));
+ compressed = min_t(u8, compressed, ilog2((SG_MAX_SINGLE_ALLOC * PAGE_SIZE) >> 14));
+#endif
return compressed;
}
diff --git a/net/sunrpc/auth_gss/gss_krb5_keys.c b/net/sunrpc/auth_gss/gss_krb5_keys.c
index 726c076950c0..fc4639687c0f 100644
--- a/net/sunrpc/auth_gss/gss_krb5_keys.c
+++ b/net/sunrpc/auth_gss/gss_krb5_keys.c
@@ -161,7 +161,7 @@ u32 krb5_derive_key(const struct gss_krb5_enctype *gk5e,
if (IS_ERR(cipher))
goto err_return;
if (crypto_sync_skcipher_setkey(cipher, inkey->data, inkey->len))
- goto err_return;
+ goto err_free_cipher;
/* allocate and set up buffers */
diff --git a/net/sunrpc/clnt.c b/net/sunrpc/clnt.c
index 1dbad41c4614..b6529a9d37d3 100644
--- a/net/sunrpc/clnt.c
+++ b/net/sunrpc/clnt.c
@@ -2296,12 +2296,13 @@ call_transmit_status(struct rpc_task *task)
task->tk_action = call_transmit;
task->tk_status = 0;
break;
- case -ECONNREFUSED:
case -EHOSTDOWN:
case -ENETDOWN:
case -EHOSTUNREACH:
case -ENETUNREACH:
case -EPERM:
+ break;
+ case -ECONNREFUSED:
if (RPC_IS_SOFTCONN(task)) {
if (!task->tk_msg.rpc_proc->p_proc)
trace_xprt_ping(task->tk_xprt,
diff --git a/net/sunrpc/xprtrdma/frwr_ops.c b/net/sunrpc/xprtrdma/frwr_ops.c
index ffbf99894970..47f33bb7bff8 100644
--- a/net/sunrpc/xprtrdma/frwr_ops.c
+++ b/net/sunrpc/xprtrdma/frwr_ops.c
@@ -92,7 +92,8 @@ static void frwr_mr_put(struct rpcrdma_mr *mr)
rpcrdma_mr_push(mr, &mr->mr_req->rl_free_mrs);
}
-/* frwr_reset - Place MRs back on the free list
+/**
+ * frwr_reset - Place MRs back on @req's free list
* @req: request to reset
*
* Used after a failed marshal. For FRWR, this means the MRs
diff --git a/net/sunrpc/xprtrdma/verbs.c b/net/sunrpc/xprtrdma/verbs.c
index 4f71627ba39c..cb909329a503 100644
--- a/net/sunrpc/xprtrdma/verbs.c
+++ b/net/sunrpc/xprtrdma/verbs.c
@@ -897,6 +897,8 @@ static int rpcrdma_reqs_setup(struct rpcrdma_xprt *r_xprt)
static void rpcrdma_req_reset(struct rpcrdma_req *req)
{
+ struct rpcrdma_mr *mr;
+
/* Credits are valid for only one connection */
req->rl_slot.rq_cong = 0;
@@ -906,7 +908,19 @@ static void rpcrdma_req_reset(struct rpcrdma_req *req)
rpcrdma_regbuf_dma_unmap(req->rl_sendbuf);
rpcrdma_regbuf_dma_unmap(req->rl_recvbuf);
- frwr_reset(req);
+ /* The verbs consumer can't know the state of an MR on the
+ * req->rl_registered list unless a successful completion
+ * has occurred, so they cannot be re-used.
+ */
+ while ((mr = rpcrdma_mr_pop(&req->rl_registered))) {
+ struct rpcrdma_buffer *buf = &mr->mr_xprt->rx_buf;
+
+ spin_lock(&buf->rb_lock);
+ list_del(&mr->mr_all);
+ spin_unlock(&buf->rb_lock);
+
+ frwr_mr_release(mr);
+ }
}
/* ASSUMPTION: the rb_allreqs list is stable for the duration,
diff --git a/net/tipc/udp_media.c b/net/tipc/udp_media.c
index 0a85244fd618..73e461dc12d7 100644
--- a/net/tipc/udp_media.c
+++ b/net/tipc/udp_media.c
@@ -135,8 +135,11 @@ static int tipc_udp_addr2str(struct tipc_media_addr *a, char *buf, int size)
snprintf(buf, size, "%pI4:%u", &ua->ipv4, ntohs(ua->port));
else if (ntohs(ua->proto) == ETH_P_IPV6)
snprintf(buf, size, "%pI6:%u", &ua->ipv6, ntohs(ua->port));
- else
+ else {
pr_err("Invalid UDP media address\n");
+ return 1;
+ }
+
return 0;
}
diff --git a/net/unix/af_unix.c b/net/unix/af_unix.c
index 3905cdcaa518..db71f35b67b8 100644
--- a/net/unix/af_unix.c
+++ b/net/unix/af_unix.c
@@ -2710,10 +2710,49 @@ static struct sk_buff *manage_oob(struct sk_buff *skb, struct sock *sk,
static int unix_stream_read_skb(struct sock *sk, skb_read_actor_t recv_actor)
{
+ struct unix_sock *u = unix_sk(sk);
+ struct sk_buff *skb;
+ int err;
+
if (unlikely(READ_ONCE(sk->sk_state) != TCP_ESTABLISHED))
return -ENOTCONN;
- return unix_read_skb(sk, recv_actor);
+ mutex_lock(&u->iolock);
+ skb = skb_recv_datagram(sk, MSG_DONTWAIT, &err);
+ mutex_unlock(&u->iolock);
+ if (!skb)
+ return err;
+
+#if IS_ENABLED(CONFIG_AF_UNIX_OOB)
+ if (unlikely(skb == READ_ONCE(u->oob_skb))) {
+ bool drop = false;
+
+ unix_state_lock(sk);
+
+ if (sock_flag(sk, SOCK_DEAD)) {
+ unix_state_unlock(sk);
+ kfree_skb(skb);
+ return -ECONNRESET;
+ }
+
+ spin_lock(&sk->sk_receive_queue.lock);
+ if (likely(skb == u->oob_skb)) {
+ WRITE_ONCE(u->oob_skb, NULL);
+ drop = true;
+ }
+ spin_unlock(&sk->sk_receive_queue.lock);
+
+ unix_state_unlock(sk);
+
+ if (drop) {
+ WARN_ON_ONCE(skb_unref(skb));
+ kfree_skb(skb);
+ return -EAGAIN;
+ }
+ }
+#endif
+
+ return recv_actor(sk, skb);
}
static int unix_stream_read_generic(struct unix_stream_read_state *state,
diff --git a/net/unix/unix_bpf.c b/net/unix/unix_bpf.c
index bd84785bf8d6..bca2d86ba97d 100644
--- a/net/unix/unix_bpf.c
+++ b/net/unix/unix_bpf.c
@@ -54,6 +54,9 @@ static int unix_bpf_recvmsg(struct sock *sk, struct msghdr *msg,
struct sk_psock *psock;
int copied;
+ if (flags & MSG_OOB)
+ return -EOPNOTSUPP;
+
if (!len)
return 0;
diff --git a/net/wireless/util.c b/net/wireless/util.c
index 73b3648e1b4c..1665320d2214 100644
--- a/net/wireless/util.c
+++ b/net/wireless/util.c
@@ -1373,7 +1373,7 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
5120, /* 0.833333... */
};
u32 rates_160M[3] = { 960777777, 907400000, 816666666 };
- u32 rates_969[3] = { 480388888, 453700000, 408333333 };
+ u32 rates_996[3] = { 480388888, 453700000, 408333333 };
u32 rates_484[3] = { 229411111, 216666666, 195000000 };
u32 rates_242[3] = { 114711111, 108333333, 97500000 };
u32 rates_106[3] = { 40000000, 37777777, 34000000 };
@@ -1393,12 +1393,14 @@ static u32 cfg80211_calculate_bitrate_he(struct rate_info *rate)
if (WARN_ON_ONCE(rate->nss < 1 || rate->nss > 8))
return 0;
- if (rate->bw == RATE_INFO_BW_160)
+ if (rate->bw == RATE_INFO_BW_160 ||
+ (rate->bw == RATE_INFO_BW_HE_RU &&
+ rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_2x996))
result = rates_160M[rate->he_gi];
else if (rate->bw == RATE_INFO_BW_80 ||
(rate->bw == RATE_INFO_BW_HE_RU &&
rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_996))
- result = rates_969[rate->he_gi];
+ result = rates_996[rate->he_gi];
else if (rate->bw == RATE_INFO_BW_40 ||
(rate->bw == RATE_INFO_BW_HE_RU &&
rate->he_ru_alloc == NL80211_RATE_INFO_HE_RU_ALLOC_484))
diff --git a/scripts/Makefile.lib b/scripts/Makefile.lib
index 3aa384cec76b..d236e5658f9b 100644
--- a/scripts/Makefile.lib
+++ b/scripts/Makefile.lib
@@ -382,8 +382,12 @@ cmd_dtc = $(HOSTCC) -E $(dtc_cpp_flags) -x assembler-with-cpp -o $(dtc-tmp) $< ;
-d $(depfile).dtc.tmp $(dtc-tmp) ; \
cat $(depfile).pre.tmp $(depfile).dtc.tmp > $(depfile)
+# NOTE:
+# Do not replace $(filter %.dtb %.dtbo, $^) with $(real-prereqs). When a single
+# DTB is turned into a multi-blob DTB, $^ will contain header file dependencies
+# recorded in the .*.cmd file.
quiet_cmd_fdtoverlay = DTOVL $@
- cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(real-prereqs)
+ cmd_fdtoverlay = $(objtree)/scripts/dtc/fdtoverlay -o $@ -i $(filter %.dtb %.dtbo, $^)
$(multi-dtb-y): FORCE
$(call if_changed,fdtoverlay)
diff --git a/scripts/gcc-x86_32-has-stack-protector.sh b/scripts/gcc-x86_32-has-stack-protector.sh
index 825c75c5b715..9459ca4f0f11 100755
--- a/scripts/gcc-x86_32-has-stack-protector.sh
+++ b/scripts/gcc-x86_32-has-stack-protector.sh
@@ -5,4 +5,4 @@
# -mstack-protector-guard-reg, added by
# https://gcc.gnu.org/bugzilla/show_bug.cgi?id=81708
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m32 -O0 -fstack-protector -mstack-protector-guard-reg=fs -mstack-protector-guard-symbol=__stack_chk_guard - -o - 2> /dev/null | grep -q "%fs"
diff --git a/scripts/gcc-x86_64-has-stack-protector.sh b/scripts/gcc-x86_64-has-stack-protector.sh
index 75e4e22b986a..f680bb01aeeb 100755
--- a/scripts/gcc-x86_64-has-stack-protector.sh
+++ b/scripts/gcc-x86_64-has-stack-protector.sh
@@ -1,4 +1,4 @@
#!/bin/sh
# SPDX-License-Identifier: GPL-2.0
-echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
+echo "int foo(void) { char X[200]; return 3; }" | $* -S -x c -m64 -O0 -mcmodel=kernel -fno-PIE -fstack-protector - -o - 2> /dev/null | grep -q "%gs"
diff --git a/security/apparmor/lsm.c b/security/apparmor/lsm.c
index 1e2f40db15c5..97389b9c4129 100644
--- a/security/apparmor/lsm.c
+++ b/security/apparmor/lsm.c
@@ -1081,6 +1081,13 @@ static int apparmor_socket_sock_rcv_skb(struct sock *sk, struct sk_buff *skb)
if (!skb->secmark)
return 0;
+ /*
+ * If reach here before socket_post_create hook is called, in which
+ * case label is null, drop the packet.
+ */
+ if (!ctx->label)
+ return -EACCES;
+
return apparmor_secmark_check(ctx->label, OP_RECVMSG, AA_MAY_RECEIVE,
skb->secmark, sk);
}
diff --git a/security/apparmor/policy.c b/security/apparmor/policy.c
index c7b84fb56841..4ee5a450d118 100644
--- a/security/apparmor/policy.c
+++ b/security/apparmor/policy.c
@@ -187,7 +187,7 @@ static void aa_free_data(void *ptr, void *arg)
{
struct aa_data *data = ptr;
- kfree_sensitive(data->data);
+ kvfree_sensitive(data->data, data->size);
kfree_sensitive(data->key);
kfree_sensitive(data);
}
diff --git a/security/apparmor/policy_unpack.c b/security/apparmor/policy_unpack.c
index 633e778ec369..17601235ff98 100644
--- a/security/apparmor/policy_unpack.c
+++ b/security/apparmor/policy_unpack.c
@@ -898,6 +898,7 @@ static struct aa_profile *unpack_profile(struct aa_ext *e, char **ns_name)
if (rhashtable_insert_fast(profile->data, &data->head,
profile->data->p)) {
+ kvfree_sensitive(data->data, data->size);
kfree_sensitive(data->key);
kfree_sensitive(data);
info = "failed to insert data to table";
diff --git a/security/keys/keyctl.c b/security/keys/keyctl.c
index 19be69fa4d05..aa1dc43b16dd 100644
--- a/security/keys/keyctl.c
+++ b/security/keys/keyctl.c
@@ -1694,7 +1694,7 @@ long keyctl_session_to_parent(void)
goto unlock;
/* cancel an already pending keyring replacement */
- oldwork = task_work_cancel(parent, key_change_session_keyring);
+ oldwork = task_work_cancel_func(parent, key_change_session_keyring);
/* the replacement session keyring is applied just prior to userspace
* restarting */
diff --git a/security/landlock/cred.c b/security/landlock/cred.c
index ec6c37f04a19..e215607fd46c 100644
--- a/security/landlock/cred.c
+++ b/security/landlock/cred.c
@@ -14,8 +14,8 @@
#include "ruleset.h"
#include "setup.h"
-static int hook_cred_prepare(struct cred *const new,
- const struct cred *const old, const gfp_t gfp)
+static void hook_cred_transfer(struct cred *const new,
+ const struct cred *const old)
{
struct landlock_ruleset *const old_dom = landlock_cred(old)->domain;
@@ -23,6 +23,12 @@ static int hook_cred_prepare(struct cred *const new,
landlock_get_ruleset(old_dom);
landlock_cred(new)->domain = old_dom;
}
+}
+
+static int hook_cred_prepare(struct cred *const new,
+ const struct cred *const old, const gfp_t gfp)
+{
+ hook_cred_transfer(new, old);
return 0;
}
@@ -36,6 +42,7 @@ static void hook_cred_free(struct cred *const cred)
static struct security_hook_list landlock_hooks[] __lsm_ro_after_init = {
LSM_HOOK_INIT(cred_prepare, hook_cred_prepare),
+ LSM_HOOK_INIT(cred_transfer, hook_cred_transfer),
LSM_HOOK_INIT(cred_free, hook_cred_free),
};
diff --git a/sound/soc/amd/acp-es8336.c b/sound/soc/amd/acp-es8336.c
index 89499542c803..f91a3c13ac23 100644
--- a/sound/soc/amd/acp-es8336.c
+++ b/sound/soc/amd/acp-es8336.c
@@ -203,8 +203,10 @@ static int st_es8336_late_probe(struct snd_soc_card *card)
codec_dev = acpi_get_first_physical_node(adev);
acpi_dev_put(adev);
- if (!codec_dev)
+ if (!codec_dev) {
dev_err(card->dev, "can not find codec dev\n");
+ return -ENODEV;
+ }
ret = devm_acpi_dev_add_driver_gpios(codec_dev, acpi_es8336_gpios);
if (ret)
diff --git a/sound/soc/amd/yc/acp6x-mach.c b/sound/soc/amd/yc/acp6x-mach.c
index 8e3eccb4faa7..c438fccac8e9 100644
--- a/sound/soc/amd/yc/acp6x-mach.c
+++ b/sound/soc/amd/yc/acp6x-mach.c
@@ -220,6 +220,13 @@ static const struct dmi_system_id yc_acp_quirk_table[] = {
DMI_MATCH(DMI_PRODUCT_NAME, "21J6"),
}
},
+ {
+ .driver_data = &acp6x_card,
+ .matches = {
+ DMI_MATCH(DMI_BOARD_VENDOR, "LENOVO"),
+ DMI_MATCH(DMI_PRODUCT_NAME, "21M5"),
+ }
+ },
{
.driver_data = &acp6x_card,
.matches = {
diff --git a/sound/soc/codecs/max98088.c b/sound/soc/codecs/max98088.c
index 405ec16be2b6..eaabfe2cfd70 100644
--- a/sound/soc/codecs/max98088.c
+++ b/sound/soc/codecs/max98088.c
@@ -1318,6 +1318,7 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
enum snd_soc_bias_level level)
{
struct max98088_priv *max98088 = snd_soc_component_get_drvdata(component);
+ int ret;
switch (level) {
case SND_SOC_BIAS_ON:
@@ -1333,10 +1334,13 @@ static int max98088_set_bias_level(struct snd_soc_component *component,
*/
if (!IS_ERR(max98088->mclk)) {
if (snd_soc_component_get_bias_level(component) ==
- SND_SOC_BIAS_ON)
+ SND_SOC_BIAS_ON) {
clk_disable_unprepare(max98088->mclk);
- else
- clk_prepare_enable(max98088->mclk);
+ } else {
+ ret = clk_prepare_enable(max98088->mclk);
+ if (ret)
+ return ret;
+ }
}
break;
diff --git a/sound/soc/intel/common/soc-intel-quirks.h b/sound/soc/intel/common/soc-intel-quirks.h
index de4e550c5b34..42bd51456b94 100644
--- a/sound/soc/intel/common/soc-intel-quirks.h
+++ b/sound/soc/intel/common/soc-intel-quirks.h
@@ -11,7 +11,7 @@
#include <linux/platform_data/x86/soc.h>
-#if IS_ENABLED(CONFIG_X86)
+#if IS_REACHABLE(CONFIG_IOSF_MBI)
#include <linux/dmi.h>
#include <asm/iosf_mbi.h>
diff --git a/sound/soc/qcom/lpass-cpu.c b/sound/soc/qcom/lpass-cpu.c
index dbdaaa85ce48..4387cca893c5 100644
--- a/sound/soc/qcom/lpass-cpu.c
+++ b/sound/soc/qcom/lpass-cpu.c
@@ -1160,9 +1160,13 @@ int asoc_qcom_lpass_cpu_platform_probe(struct platform_device *pdev)
}
res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-rxtx-cdc-dma-lpm");
+ if (!res)
+ return -EINVAL;
drvdata->rxtx_cdc_dma_lpm_buf = res->start;
res = platform_get_resource_byname(pdev, IORESOURCE_MEM, "lpass-va-cdc-dma-lpm");
+ if (!res)
+ return -EINVAL;
drvdata->va_cdc_dma_lpm_buf = res->start;
}
diff --git a/sound/soc/sof/imx/imx8m.c b/sound/soc/sof/imx/imx8m.c
index 1243f8a6141e..186ba4bbb5b2 100644
--- a/sound/soc/sof/imx/imx8m.c
+++ b/sound/soc/sof/imx/imx8m.c
@@ -243,7 +243,7 @@ static int imx8m_probe(struct snd_sof_dev *sdev)
/* set default mailbox offset for FW ready message */
sdev->dsp_box.offset = MBOX_OFFSET;
- priv->regmap = syscon_regmap_lookup_by_compatible("fsl,dsp-ctrl");
+ priv->regmap = syscon_regmap_lookup_by_phandle(np, "fsl,dsp-ctrl");
if (IS_ERR(priv->regmap)) {
dev_err(sdev->dev, "cannot find dsp-ctrl registers");
ret = PTR_ERR(priv->regmap);
diff --git a/sound/usb/mixer.c b/sound/usb/mixer.c
index 783a2493707e..5699a62d1767 100644
--- a/sound/usb/mixer.c
+++ b/sound/usb/mixer.c
@@ -1211,6 +1211,13 @@ static void volume_control_quirks(struct usb_mixer_elem_info *cval,
cval->res = 16;
}
break;
+ case USB_ID(0x1bcf, 0x2281): /* HD Webcam */
+ if (!strcmp(kctl->id.name, "Mic Capture Volume")) {
+ usb_audio_info(chip,
+ "set resolution quirk: cval->res = 16\n");
+ cval->res = 16;
+ }
+ break;
}
}
diff --git a/sound/usb/quirks.c b/sound/usb/quirks.c
index b8a474a2e4d5..733a25275fe9 100644
--- a/sound/usb/quirks.c
+++ b/sound/usb/quirks.c
@@ -2083,6 +2083,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
QUIRK_FLAG_CTL_MSG_DELAY_1M),
DEVICE_FLG(0x0b0e, 0x0349, /* Jabra 550a */
QUIRK_FLAG_CTL_MSG_DELAY_1M),
+ DEVICE_FLG(0x0c45, 0x6340, /* Sonix HD USB Camera */
+ QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x0ecb, 0x205c, /* JBL Quantum610 Wireless */
QUIRK_FLAG_FIXED_RATE),
DEVICE_FLG(0x0ecb, 0x2069, /* JBL Quantum810 Wireless */
@@ -2125,6 +2127,8 @@ static const struct usb_audio_quirk_flags_table quirk_flags_table[] = {
QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x19f7, 0x0035, /* RODE NT-USB+ */
QUIRK_FLAG_GET_SAMPLE_RATE),
+ DEVICE_FLG(0x1bcf, 0x2281, /* HD Webcam */
+ QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x1bcf, 0x2283, /* NexiGo N930AF FHD Webcam */
QUIRK_FLAG_GET_SAMPLE_RATE),
DEVICE_FLG(0x2040, 0x7200, /* Hauppauge HVR-950Q */
diff --git a/tools/bpf/bpftool/common.c b/tools/bpf/bpftool/common.c
index e7a11cff7245..db02b000fbeb 100644
--- a/tools/bpf/bpftool/common.c
+++ b/tools/bpf/bpftool/common.c
@@ -333,7 +333,7 @@ void get_prog_full_name(const struct bpf_prog_info *prog_info, int prog_fd,
{
const char *prog_name = prog_info->name;
const struct btf_type *func_type;
- const struct bpf_func_info finfo = {};
+ struct bpf_func_info finfo = {};
struct bpf_prog_info info = {};
__u32 info_len = sizeof(info);
struct btf *prog_btf = NULL;
diff --git a/tools/bpf/bpftool/prog.c b/tools/bpf/bpftool/prog.c
index 7e0b846e17ee..21817eb51039 100644
--- a/tools/bpf/bpftool/prog.c
+++ b/tools/bpf/bpftool/prog.c
@@ -1707,6 +1707,10 @@ static int load_with_options(int argc, char **argv, bool first_prog_only)
}
if (pinmaps) {
+ err = create_and_mount_bpffs_dir(pinmaps);
+ if (err)
+ goto err_unpin;
+
err = bpf_object__pin_maps(obj, pinmaps);
if (err) {
p_err("failed to pin all maps");
diff --git a/tools/bpf/resolve_btfids/main.c b/tools/bpf/resolve_btfids/main.c
index 82bffa7cf865..7775040182e3 100644
--- a/tools/bpf/resolve_btfids/main.c
+++ b/tools/bpf/resolve_btfids/main.c
@@ -696,7 +696,7 @@ static int sets_patch(struct object *obj)
* Make sure id is at the beginning of the pairs
* struct, otherwise the below qsort would not work.
*/
- BUILD_BUG_ON(set8->pairs != &set8->pairs[0].id);
+ BUILD_BUG_ON((u32 *)set8->pairs != &set8->pairs[0].id);
qsort(set8->pairs, set8->cnt, sizeof(set8->pairs[0]), cmp_id);
/*
diff --git a/tools/lib/bpf/btf_dump.c b/tools/lib/bpf/btf_dump.c
index 713264899250..cfdee656789b 100644
--- a/tools/lib/bpf/btf_dump.c
+++ b/tools/lib/bpf/btf_dump.c
@@ -1521,10 +1521,12 @@ static void btf_dump_emit_type_chain(struct btf_dump *d,
* Clang for BPF target generates func_proto with no
* args as a func_proto with a single void arg (e.g.,
* `int (*f)(void)` vs just `int (*f)()`). We are
- * going to pretend there are no args for such case.
+ * going to emit valid empty args (void) syntax for
+ * such case. Similarly and conveniently, valid
+ * no args case can be special-cased here as well.
*/
- if (vlen == 1 && p->type == 0) {
- btf_dump_printf(d, ")");
+ if (vlen == 0 || (vlen == 1 && p->type == 0)) {
+ btf_dump_printf(d, "void)");
return;
}
diff --git a/tools/lib/bpf/linker.c b/tools/lib/bpf/linker.c
index 4ac02c28e152..8a7cb830bff1 100644
--- a/tools/lib/bpf/linker.c
+++ b/tools/lib/bpf/linker.c
@@ -2189,10 +2189,17 @@ static int linker_fixup_btf(struct src_obj *obj)
vi = btf_var_secinfos(t);
for (j = 0, m = btf_vlen(t); j < m; j++, vi++) {
const struct btf_type *vt = btf__type_by_id(obj->btf, vi->type);
- const char *var_name = btf__str_by_offset(obj->btf, vt->name_off);
- int var_linkage = btf_var(vt)->linkage;
+ const char *var_name;
+ int var_linkage;
Elf64_Sym *sym;
+ /* could be a variable or function */
+ if (!btf_is_var(vt))
+ continue;
+
+ var_name = btf__str_by_offset(obj->btf, vt->name_off);
+ var_linkage = btf_var(vt)->linkage;
+
/* no need to patch up static or extern vars */
if (var_linkage != BTF_VAR_GLOBAL_ALLOCATED)
continue;
diff --git a/tools/memory-model/lock.cat b/tools/memory-model/lock.cat
index 6b52f365d73a..9f3b5b38221b 100644
--- a/tools/memory-model/lock.cat
+++ b/tools/memory-model/lock.cat
@@ -102,19 +102,19 @@ let rf-lf = rfe-lf | rfi-lf
* within one of the lock's critical sections returns False.
*)
-(* rfi for RU events: an RU may read from the last po-previous UL *)
-let rfi-ru = ([UL] ; po-loc ; [RU]) \ ([UL] ; po-loc ; [LKW] ; po-loc)
-
-(* rfe for RU events: an RU may read from an external UL or the initial write *)
-let all-possible-rfe-ru =
- let possible-rfe-ru r =
+(*
+ * rf for RU events: an RU may read from an external UL or the initial write,
+ * or from the last po-previous UL
+ *)
+let all-possible-rf-ru =
+ let possible-rf-ru r =
let pair-to-relation p = p ++ 0
- in map pair-to-relation (((UL | IW) * {r}) & loc & ext)
- in map possible-rfe-ru RU
+ in map pair-to-relation ((((UL | IW) * {r}) & loc & ext) |
+ (((UL * {r}) & po-loc) \ ([UL] ; po-loc ; [LKW] ; po-loc)))
+ in map possible-rf-ru RU
(* Generate all rf relations for RU events *)
-with rfe-ru from cross(all-possible-rfe-ru)
-let rf-ru = rfe-ru | rfi-ru
+with rf-ru from cross(all-possible-rf-ru)
(* Final rf relation *)
let rf = rf | rf-lf | rf-ru
diff --git a/tools/perf/arch/x86/util/intel-pt.c b/tools/perf/arch/x86/util/intel-pt.c
index af102f471e9f..9daec588103b 100644
--- a/tools/perf/arch/x86/util/intel-pt.c
+++ b/tools/perf/arch/x86/util/intel-pt.c
@@ -32,6 +32,7 @@
#include "../../../util/tsc.h"
#include <internal/lib.h> // page_size
#include "../../../util/intel-pt.h"
+#include <api/fs/fs.h>
#define KiB(x) ((x) * 1024)
#define MiB(x) ((x) * 1024 * 1024)
@@ -440,6 +441,16 @@ static int intel_pt_track_switches(struct evlist *evlist)
return 0;
}
+static bool intel_pt_exclude_guest(void)
+{
+ int pt_mode;
+
+ if (sysfs__read_int("module/kvm_intel/parameters/pt_mode", &pt_mode))
+ pt_mode = 0;
+
+ return pt_mode == 1;
+}
+
static void intel_pt_valid_str(char *str, size_t len, u64 valid)
{
unsigned int val, last = 0, state = 1;
@@ -643,6 +654,7 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
}
evsel->core.attr.freq = 0;
evsel->core.attr.sample_period = 1;
+ evsel->core.attr.exclude_guest = intel_pt_exclude_guest();
evsel->no_aux_samples = true;
evsel->needs_auxtrace_mmap = true;
intel_pt_evsel = evsel;
@@ -780,7 +792,8 @@ static int intel_pt_recording_options(struct auxtrace_record *itr,
}
if (!opts->auxtrace_snapshot_mode && !opts->auxtrace_sample_mode) {
- u32 aux_watermark = opts->auxtrace_mmap_pages * page_size / 4;
+ size_t aw = opts->auxtrace_mmap_pages * (size_t)page_size / 4;
+ u32 aux_watermark = aw > UINT_MAX ? UINT_MAX : aw;
intel_pt_evsel->core.attr.aux_watermark = aux_watermark;
}
diff --git a/tools/perf/tests/shell/test_arm_callgraph_fp.sh b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
index ec108d45d3c6..60cd35c73e47 100755
--- a/tools/perf/tests/shell/test_arm_callgraph_fp.sh
+++ b/tools/perf/tests/shell/test_arm_callgraph_fp.sh
@@ -4,65 +4,31 @@
lscpu | grep -q "aarch64" || exit 2
-if ! [ -x "$(command -v cc)" ]; then
- echo "failed: no compiler, install gcc"
- exit 2
-fi
-
PERF_DATA=$(mktemp /tmp/__perf_test.perf.data.XXXXX)
-TEST_PROGRAM_SOURCE=$(mktemp /tmp/test_program.XXXXX.c)
-TEST_PROGRAM=$(mktemp /tmp/test_program.XXXXX)
+TEST_PROGRAM="perf test -w leafloop"
cleanup_files()
{
- rm -f $PERF_DATA
- rm -f $TEST_PROGRAM_SOURCE
- rm -f $TEST_PROGRAM
-}
-
-trap cleanup_files exit term int
-
-cat << EOF > $TEST_PROGRAM_SOURCE
-int a = 0;
-void leaf(void) {
- for (;;)
- a += a;
+ rm -f "$PERF_DATA"
}
-void parent(void) {
- leaf();
-}
-int main(void) {
- parent();
- return 0;
-}
-EOF
-
-echo " + Compiling test program ($TEST_PROGRAM)..."
-
-CFLAGS="-g -O0 -fno-inline -fno-omit-frame-pointer"
-cc $CFLAGS $TEST_PROGRAM_SOURCE -o $TEST_PROGRAM || exit 1
-# Add a 1 second delay to skip samples that are not in the leaf() function
-perf record -o $PERF_DATA --call-graph fp -e cycles//u -D 1000 --user-callchains -- $TEST_PROGRAM 2> /dev/null &
-PID=$!
+trap cleanup_files EXIT TERM INT
-echo " + Recording (PID=$PID)..."
-sleep 2
-echo " + Stopping perf-record..."
+# shellcheck disable=SC2086
+perf record -o "$PERF_DATA" --call-graph fp -e cycles//u --user-callchains -- $TEST_PROGRAM
-kill $PID
-wait $PID
+# Try opening the file so any immediate errors are visible in the log
+perf script -i "$PERF_DATA" -F comm,ip,sym | head -n4
-# expected perf-script output:
+# expected perf-script output if 'leaf' has been inserted correctly:
#
-# program
+# perf
# 728 leaf
# 753 parent
-# 76c main
-# ...
+# 76c leafloop
+# ... remaining stack to main() ...
-perf script -i $PERF_DATA -F comm,ip,sym | head -n4
-perf script -i $PERF_DATA -F comm,ip,sym | head -n4 | \
- awk '{ if ($2 != "") sym[i++] = $2 } END { if (sym[0] != "leaf" ||
- sym[1] != "parent" ||
- sym[2] != "main") exit 1 }'
+# Each frame is separated by a tab, some spaces and an address
+SEP="[[:space:]]+ [[:xdigit:]]+"
+perf script -i "$PERF_DATA" -F comm,ip,sym | tr '\n' ' ' | \
+ grep -E -q "perf $SEP leaf $SEP parent $SEP leafloop"
diff --git a/tools/perf/tests/workloads/leafloop.c b/tools/perf/tests/workloads/leafloop.c
index 1bf5cc97649b..f7561767e32c 100644
--- a/tools/perf/tests/workloads/leafloop.c
+++ b/tools/perf/tests/workloads/leafloop.c
@@ -1,6 +1,8 @@
/* SPDX-License-Identifier: GPL-2.0 */
+#include <signal.h>
#include <stdlib.h>
#include <linux/compiler.h>
+#include <unistd.h>
#include "../tests.h"
/* We want to check these symbols in perf script */
@@ -8,10 +10,16 @@ noinline void leaf(volatile int b);
noinline void parent(volatile int b);
static volatile int a;
+static volatile sig_atomic_t done;
+
+static void sighandler(int sig __maybe_unused)
+{
+ done = 1;
+}
noinline void leaf(volatile int b)
{
- for (;;)
+ while (!done)
a += b;
}
@@ -22,12 +30,16 @@ noinline void parent(volatile int b)
static int leafloop(int argc, const char **argv)
{
- int c = 1;
+ int sec = 1;
if (argc > 0)
- c = atoi(argv[0]);
+ sec = atoi(argv[0]);
+
+ signal(SIGINT, sighandler);
+ signal(SIGALRM, sighandler);
+ alarm(sec);
- parent(c);
+ parent(sec);
return 0;
}
diff --git a/tools/perf/util/sort.c b/tools/perf/util/sort.c
index 6882b1714499..1821c81892df 100644
--- a/tools/perf/util/sort.c
+++ b/tools/perf/util/sort.c
@@ -275,7 +275,7 @@ sort__sym_cmp(struct hist_entry *left, struct hist_entry *right)
* comparing symbol address alone is not enough since it's a
* relative address within a dso.
*/
- if (!hists__has(left->hists, dso) || hists__has(right->hists, dso)) {
+ if (!hists__has(left->hists, dso)) {
ret = sort__dso_cmp(left, right);
if (ret != 0)
return ret;
diff --git a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
index 597d0467a926..de2466547efe 100644
--- a/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
+++ b/tools/testing/selftests/bpf/prog_tests/sk_lookup.c
@@ -994,7 +994,7 @@ static void drop_on_reuseport(const struct test *t)
err = update_lookup_map(t->sock_map, SERVER_A, server1);
if (err)
- goto detach;
+ goto close_srv1;
/* second server on destination address we should never reach */
server2 = make_server(t->sotype, t->connect_to.ip, t->connect_to.port,
diff --git a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
index 39973ea1ce43..89366913a251 100644
--- a/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
+++ b/tools/testing/selftests/bpf/prog_tests/xdp_adjust_tail.c
@@ -217,7 +217,7 @@ static void test_xdp_adjust_frags_tail_grow(void)
prog = bpf_object__next_program(obj, NULL);
if (bpf_object__load(obj))
- return;
+ goto out;
prog_fd = bpf_program__fd(prog);
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
index ba97165bdb28..a657651eba52 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_multidim.c
@@ -14,9 +14,9 @@ typedef int *ptr_arr_t[6];
typedef int *ptr_multiarr_t[7][8][9][10];
-typedef int * (*fn_ptr_arr_t[11])();
+typedef int * (*fn_ptr_arr_t[11])(void);
-typedef int * (*fn_ptr_multiarr_t[12][13])();
+typedef int * (*fn_ptr_multiarr_t[12][13])(void);
struct root_struct {
arr_t _1;
diff --git a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
index 4ee4748133fe..9355e323d40c 100644
--- a/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
+++ b/tools/testing/selftests/bpf/progs/btf_dump_test_case_syntax.c
@@ -67,7 +67,7 @@ typedef void (*printf_fn_t)(const char *, ...);
* `int -> char *` function and returns pointer to a char. Equivalent:
* typedef char * (*fn_input_t)(int);
* typedef char * (*fn_output_outer_t)(fn_input_t);
- * typedef const fn_output_outer_t (* fn_output_inner_t)();
+ * typedef const fn_output_outer_t (* fn_output_inner_t)(void);
* typedef const fn_output_inner_t fn_ptr_arr2_t[5];
*/
/* ----- START-EXPECTED-OUTPUT ----- */
@@ -94,7 +94,7 @@ typedef void (* (*signal_t)(int, void (*)(int)))(int);
typedef char * (*fn_ptr_arr1_t[10])(int **);
-typedef char * (* (* const fn_ptr_arr2_t[5])())(char * (*)(int));
+typedef char * (* (* const fn_ptr_arr2_t[5])(void))(char * (*)(int));
struct struct_w_typedefs {
int_t a;
diff --git a/tools/testing/selftests/bpf/test_sockmap.c b/tools/testing/selftests/bpf/test_sockmap.c
index d56f521b8aaa..25da05cad8f6 100644
--- a/tools/testing/selftests/bpf/test_sockmap.c
+++ b/tools/testing/selftests/bpf/test_sockmap.c
@@ -63,7 +63,7 @@ int passed;
int failed;
int map_fd[9];
struct bpf_map *maps[9];
-int prog_fd[11];
+int prog_fd[9];
int txmsg_pass;
int txmsg_redir;
@@ -680,7 +680,8 @@ static int msg_loop(int fd, int iov_count, int iov_length, int cnt,
}
}
- s->bytes_recvd += recv;
+ if (recv > 0)
+ s->bytes_recvd += recv;
if (opt->check_recved_len && s->bytes_recvd > total_bytes) {
errno = EMSGSIZE;
@@ -1775,8 +1776,6 @@ int prog_attach_type[] = {
BPF_SK_MSG_VERDICT,
BPF_SK_MSG_VERDICT,
BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
- BPF_SK_MSG_VERDICT,
};
int prog_type[] = {
@@ -1789,8 +1788,6 @@ int prog_type[] = {
BPF_PROG_TYPE_SK_MSG,
BPF_PROG_TYPE_SK_MSG,
BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
- BPF_PROG_TYPE_SK_MSG,
};
static int populate_progs(char *bpf_file)
diff --git a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
index 616d3581419c..21d0f419cc6d 100755
--- a/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
+++ b/tools/testing/selftests/drivers/net/mlxsw/spectrum-2/tc_flower.sh
@@ -11,7 +11,7 @@ ALL_TESTS="single_mask_test identical_filters_test two_masks_test \
multiple_masks_test ctcam_edge_cases_test delta_simple_test \
delta_two_masks_one_key_test delta_simple_rehash_test \
bloom_simple_test bloom_complex_test bloom_delta_test \
- max_erp_entries_test max_group_size_test"
+ max_erp_entries_test max_group_size_test collision_test"
NUM_NETIFS=2
source $lib_dir/lib.sh
source $lib_dir/tc_common.sh
@@ -457,7 +457,7 @@ delta_two_masks_one_key_test()
{
# If 2 keys are the same and only differ in mask in a way that
# they belong under the same ERP (second is delta of the first),
- # there should be no C-TCAM spill.
+ # there should be C-TCAM spill.
RET=0
@@ -474,8 +474,8 @@ delta_two_masks_one_key_test()
tp_record "mlxsw:*" "tc filter add dev $h2 ingress protocol ip \
pref 2 handle 102 flower $tcflags dst_ip 192.0.2.2 \
action drop"
- tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 0
- check_err $? "incorrect C-TCAM spill while inserting the second rule"
+ tp_check_hits "mlxsw:mlxsw_sp_acl_atcam_entry_add_ctcam_spill" 1
+ check_err $? "C-TCAM spill did not happen while inserting the second rule"
$MZ $h1 -c 1 -p 64 -a $h1mac -b $h2mac -A 192.0.2.1 -B 192.0.2.2 \
-t ip -q
@@ -1087,6 +1087,53 @@ max_group_size_test()
log_test "max ACL group size test ($tcflags). max size $max_size"
}
+collision_test()
+{
+ # Filters cannot share an eRP if in the common unmasked part (i.e.,
+ # without the delta bits) they have the same values. If the driver does
+ # not prevent such configuration (by spilling into the C-TCAM), then
+ # multiple entries will be present in the device with the same key,
+ # leading to collisions and a reduced scale.
+ #
+ # Create such a scenario and make sure all the filters are successfully
+ # added.
+
+ RET=0
+
+ local ret
+
+ if [[ "$tcflags" != "skip_sw" ]]; then
+ return 0;
+ fi
+
+ # Add a single dst_ip/24 filter and multiple dst_ip/32 filters that all
+ # have the same values in the common unmasked part (dst_ip/24).
+
+ tc filter add dev $h2 ingress pref 1 proto ipv4 handle 101 \
+ flower $tcflags dst_ip 198.51.100.0/24 \
+ action drop
+
+ for i in {0..255}; do
+ tc filter add dev $h2 ingress pref 2 proto ipv4 \
+ handle $((102 + i)) \
+ flower $tcflags dst_ip 198.51.100.${i}/32 \
+ action drop
+ ret=$?
+ [[ $ret -ne 0 ]] && break
+ done
+
+ check_err $ret "failed to add all the filters"
+
+ for i in {255..0}; do
+ tc filter del dev $h2 ingress pref 2 proto ipv4 \
+ handle $((102 + i)) flower
+ done
+
+ tc filter del dev $h2 ingress pref 1 proto ipv4 handle 101 flower
+
+ log_test "collision test ($tcflags)"
+}
+
setup_prepare()
{
h1=${NETIFS[p1]}
diff --git a/tools/testing/selftests/landlock/base_test.c b/tools/testing/selftests/landlock/base_test.c
index da9290817866..e43831746146 100644
--- a/tools/testing/selftests/landlock/base_test.c
+++ b/tools/testing/selftests/landlock/base_test.c
@@ -9,6 +9,7 @@
#define _GNU_SOURCE
#include <errno.h>
#include <fcntl.h>
+#include <linux/keyctl.h>
#include <linux/landlock.h>
#include <string.h>
#include <sys/prctl.h>
@@ -356,4 +357,77 @@ TEST(ruleset_fd_transfer)
ASSERT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
}
+TEST(cred_transfer)
+{
+ struct landlock_ruleset_attr ruleset_attr = {
+ .handled_access_fs = LANDLOCK_ACCESS_FS_READ_DIR,
+ };
+ int ruleset_fd, dir_fd;
+ pid_t child;
+ int status;
+
+ drop_caps(_metadata);
+
+ dir_fd = open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC);
+ EXPECT_LE(0, dir_fd);
+ EXPECT_EQ(0, close(dir_fd));
+
+ /* Denies opening directories. */
+ ruleset_fd =
+ landlock_create_ruleset(&ruleset_attr, sizeof(ruleset_attr), 0);
+ ASSERT_LE(0, ruleset_fd);
+ EXPECT_EQ(0, prctl(PR_SET_NO_NEW_PRIVS, 1, 0, 0, 0));
+ ASSERT_EQ(0, landlock_restrict_self(ruleset_fd, 0));
+ EXPECT_EQ(0, close(ruleset_fd));
+
+ /* Checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+
+ /* Needed for KEYCTL_SESSION_TO_PARENT permission checks */
+ EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING, NULL, 0,
+ 0, 0))
+ {
+ TH_LOG("Failed to join session keyring: %s", strerror(errno));
+ }
+
+ child = fork();
+ ASSERT_LE(0, child);
+ if (child == 0) {
+ /* Checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+
+ /*
+ * KEYCTL_SESSION_TO_PARENT is a no-op unless we have a
+ * different session keyring in the child, so make that happen.
+ */
+ EXPECT_NE(-1, syscall(__NR_keyctl, KEYCTL_JOIN_SESSION_KEYRING,
+ NULL, 0, 0, 0));
+
+ /*
+ * KEYCTL_SESSION_TO_PARENT installs credentials on the parent
+ * that never go through the cred_prepare hook, this path uses
+ * cred_transfer instead.
+ */
+ EXPECT_EQ(0, syscall(__NR_keyctl, KEYCTL_SESSION_TO_PARENT, 0,
+ 0, 0, 0));
+
+ /* Re-checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+
+ _exit(_metadata->passed ? EXIT_SUCCESS : EXIT_FAILURE);
+ return;
+ }
+
+ EXPECT_EQ(child, waitpid(child, &status, 0));
+ EXPECT_EQ(1, WIFEXITED(status));
+ EXPECT_EQ(EXIT_SUCCESS, WEXITSTATUS(status));
+
+ /* Re-checks ruleset enforcement. */
+ EXPECT_EQ(-1, open("/", O_RDONLY | O_DIRECTORY | O_CLOEXEC));
+ EXPECT_EQ(EACCES, errno);
+}
+
TEST_HARNESS_MAIN
diff --git a/tools/testing/selftests/landlock/config b/tools/testing/selftests/landlock/config
index 0f0a65287bac..177f4878bdf3 100644
--- a/tools/testing/selftests/landlock/config
+++ b/tools/testing/selftests/landlock/config
@@ -1,7 +1,8 @@
+CONFIG_KEYS=y
CONFIG_OVERLAY_FS=y
+CONFIG_SECURITY=y
CONFIG_SECURITY_LANDLOCK=y
CONFIG_SECURITY_PATH=y
-CONFIG_SECURITY=y
CONFIG_SHMEM=y
-CONFIG_TMPFS_XATTR=y
CONFIG_TMPFS=y
+CONFIG_TMPFS_XATTR=y
diff --git a/tools/testing/selftests/net/fib_tests.sh b/tools/testing/selftests/net/fib_tests.sh
index e5db2a2a67df..26f30c6fa0f2 100755
--- a/tools/testing/selftests/net/fib_tests.sh
+++ b/tools/testing/selftests/net/fib_tests.sh
@@ -1485,53 +1485,53 @@ ipv4_rt_dsfield()
# DSCP 0x10 should match the specific route, no matter the ECN bits
$IP route get fibmatch 172.16.102.1 dsfield 0x10 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:Not-ECT"
$IP route get fibmatch 172.16.102.1 dsfield 0x11 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:ECT(1)"
$IP route get fibmatch 172.16.102.1 dsfield 0x12 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:ECT(0)"
$IP route get fibmatch 172.16.102.1 dsfield 0x13 | \
- grep -q "via 172.16.103.2"
+ grep -q "172.16.102.0/24 tos 0x10 via 172.16.103.2"
log_test $? 0 "IPv4 route with DSCP and ECN:CE"
# Unknown DSCP should match the generic route, no matter the ECN bits
$IP route get fibmatch 172.16.102.1 dsfield 0x14 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:Not-ECT"
$IP route get fibmatch 172.16.102.1 dsfield 0x15 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(1)"
$IP route get fibmatch 172.16.102.1 dsfield 0x16 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:ECT(0)"
$IP route get fibmatch 172.16.102.1 dsfield 0x17 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with unknown DSCP and ECN:CE"
# Null DSCP should match the generic route, no matter the ECN bits
$IP route get fibmatch 172.16.102.1 dsfield 0x00 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:Not-ECT"
$IP route get fibmatch 172.16.102.1 dsfield 0x01 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(1)"
$IP route get fibmatch 172.16.102.1 dsfield 0x02 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:ECT(0)"
$IP route get fibmatch 172.16.102.1 dsfield 0x03 | \
- grep -q "via 172.16.101.2"
+ grep -q "172.16.102.0/24 via 172.16.101.2"
log_test $? 0 "IPv4 route with no DSCP and ECN:CE"
}
diff --git a/tools/testing/selftests/net/forwarding/devlink_lib.sh b/tools/testing/selftests/net/forwarding/devlink_lib.sh
index 601990c6881b..4c555fab9e75 100644
--- a/tools/testing/selftests/net/forwarding/devlink_lib.sh
+++ b/tools/testing/selftests/net/forwarding/devlink_lib.sh
@@ -122,6 +122,8 @@ devlink_reload()
still_pending=$(devlink resource show "$DEVLINK_DEV" | \
grep -c "size_new")
check_err $still_pending "Failed reload - There are still unset sizes"
+
+ udevadm settle
}
declare -A DEVLINK_ORIG
diff --git a/tools/testing/selftests/sigaltstack/current_stack_pointer.h b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
index ea9bdf3a90b1..09da8f1011ce 100644
--- a/tools/testing/selftests/sigaltstack/current_stack_pointer.h
+++ b/tools/testing/selftests/sigaltstack/current_stack_pointer.h
@@ -8,7 +8,7 @@ register unsigned long sp asm("sp");
register unsigned long sp asm("esp");
#elif __loongarch64
register unsigned long sp asm("$sp");
-#elif __ppc__
+#elif __powerpc__
register unsigned long sp asm("r1");
#elif __s390x__
register unsigned long sp asm("%15");
^ permalink raw reply related [flat|nested] 2+ messages in thread
end of thread, other threads:[~2024-08-03 7:06 UTC | newest]
Thread overview: 2+ messages (download: mbox.gz follow: Atom feed
-- links below jump to the message on this page --
2024-08-03 7:05 Linux 6.1.103 Greg Kroah-Hartman
2024-08-03 7:05 ` Greg Kroah-Hartman
This is a public inbox, see mirroring instructions
for how to clone and mirror all data and code used for this inbox